GSE49485: Hypoxia transcriptome sequencing of rat brain.
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Wrnip1
|
ENSRNOG00000017040 | Werner helicase interacting protein 1 |
|
Mta3
|
ENSRNOG00000004685 | metastasis associated 1 family, member 3 |
|
Rcor1
|
ENSRNOG00000008067 | REST corepressor 1 |
|
Rcor1
|
ENSRNOG00000049783 | REST corepressor 1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Rcor1 | rn6_v1_chr6_+_135513650_135513650 | -0.56 | 3.3e-01 | Click! |
| Mta3 | rn6_v1_chr6_+_6946695_6946695 | -0.28 | 6.5e-01 | Click! |
| Wrnip1 | rn6_v1_chr17_-_32953641_32953641 | 0.07 | 9.1e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr12_-_17186679 | 7.31 |
ENSRNOT00000001730
|
Uncx
|
UNC homeobox |
| chr3_-_152382529 | 7.11 |
ENSRNOT00000027076
|
Scand1
|
SCAN domain-containing 1 |
| chr7_-_123445613 | 6.78 |
ENSRNOT00000070937
|
Shisa8
|
shisa family member 8 |
| chr1_+_33910912 | 6.46 |
ENSRNOT00000044690
|
Irx1
|
iroquois homeobox 1 |
| chr2_-_164126783 | 6.00 |
ENSRNOT00000016843
|
Shox2
|
short stature homeobox 2 |
| chr16_-_8685529 | 5.70 |
ENSRNOT00000092751
|
Slc18a3
|
solute carrier family 18 member A3 |
| chr5_-_151709877 | 4.76 |
ENSRNOT00000080602
|
Trnp1
|
TMF1-regulated nuclear protein 1 |
| chr15_-_34550850 | 4.71 |
ENSRNOT00000027794
ENSRNOT00000090228 |
Cbln3
|
cerebellin 3 precursor |
| chr12_-_38782010 | 4.60 |
ENSRNOT00000001813
|
Wdr66
|
WD repeat domain 66 |
| chr3_-_123119460 | 4.57 |
ENSRNOT00000028833
|
Avp
|
arginine vasopressin |
| chr10_-_15603649 | 4.21 |
ENSRNOT00000051483
|
Hba-a2
|
hemoglobin alpha, adult chain 2 |
| chr3_+_123106694 | 4.14 |
ENSRNOT00000028829
|
Oxt
|
oxytocin/neurophysin 1 prepropeptide |
| chr16_-_20890949 | 4.08 |
ENSRNOT00000081977
|
Homer3
|
homer scaffolding protein 3 |
| chr2_+_190003223 | 4.07 |
ENSRNOT00000015712
|
S100a5
|
S100 calcium binding protein A5 |
| chr2_-_187160373 | 3.92 |
ENSRNOT00000018961
|
Ntrk1
|
neurotrophic receptor tyrosine kinase 1 |
| chr1_+_198690794 | 3.91 |
ENSRNOT00000023999
|
Zfp771
|
zinc finger protein 771 |
| chr19_-_37250919 | 3.90 |
ENSRNOT00000021015
|
Exoc3l1
|
exocyst complex component 3-like 1 |
| chrX_-_14890606 | 3.90 |
ENSRNOT00000049864
|
RGD1560784
|
similar to RIKEN cDNA B630019K06 |
| chr10_-_108196217 | 3.82 |
ENSRNOT00000075440
|
Cbx4
|
chromobox 4 |
| chr10_-_71849293 | 3.74 |
ENSRNOT00000003799
|
Lhx1
|
LIM homeobox 1 |
| chr10_-_56962161 | 3.60 |
ENSRNOT00000026038
|
Alox15
|
arachidonate 15-lipoxygenase |
| chr10_-_88670430 | 3.58 |
ENSRNOT00000025547
|
Hcrt
|
hypocretin neuropeptide precursor |
| chr20_+_5094468 | 3.55 |
ENSRNOT00000078576
|
Abhd16a
|
abhydrolase domain containing 16A |
| chr4_+_438668 | 3.55 |
ENSRNOT00000008951
|
En2
|
engrailed homeobox 2 |
| chr17_+_78793336 | 3.53 |
ENSRNOT00000057898
|
Mt1
|
metallothionein 1 |
| chr19_-_11302938 | 3.46 |
ENSRNOT00000038212
|
AC128848.1
|
|
| chr14_-_6679878 | 3.45 |
ENSRNOT00000075989
ENSRNOT00000067875 |
Spp1
|
secreted phosphoprotein 1 |
| chr10_-_90307658 | 3.40 |
ENSRNOT00000092102
|
Slc4a1
|
solute carrier family 4 member 1 |
| chr1_+_90948976 | 3.38 |
ENSRNOT00000056877
|
LOC108348111
|
succinate dehydrogenase assembly factor 1, mitochondrial |
| chr1_-_85510114 | 3.37 |
ENSRNOT00000074665
|
Eid2b
|
EP300 interacting inhibitor of differentiation 2B |
| chr1_-_89474252 | 3.37 |
ENSRNOT00000028597
|
Fxyd5
|
FXYD domain-containing ion transport regulator 5 |
| chr5_-_169467153 | 3.33 |
ENSRNOT00000014536
|
Hes3
|
hes family bHLH transcription factor 3 |
| chr12_-_2174131 | 3.32 |
ENSRNOT00000001313
|
Pcp2
|
Purkinje cell protein 2 |
| chr1_-_78212350 | 3.31 |
ENSRNOT00000071098
|
Inafm1
|
InaF-motif containing 1 |
| chr5_-_148392689 | 3.14 |
ENSRNOT00000018464
ENSRNOT00000080166 |
Tinagl1
|
tubulointerstitial nephritis antigen-like 1 |
| chr2_-_77632628 | 3.12 |
ENSRNOT00000073915
|
Basp1
|
brain abundant, membrane attached signal protein 1 |
| chr15_+_37790141 | 3.10 |
ENSRNOT00000076392
ENSRNOT00000091953 |
Il17d
|
interleukin 17D |
| chr20_-_9855443 | 3.08 |
ENSRNOT00000090275
ENSRNOT00000066266 |
Tff3
|
trefoil factor 3 |
| chr3_-_9738752 | 3.07 |
ENSRNOT00000045993
|
Ptges
|
prostaglandin E synthase |
| chr18_+_63130542 | 2.96 |
ENSRNOT00000024947
|
Tubb6
|
tubulin, beta 6 class V |
| chr1_-_190965115 | 2.90 |
ENSRNOT00000023483
|
AC103221.1
|
|
| chr1_+_242572533 | 2.90 |
ENSRNOT00000035123
|
Tmem252
|
transmembrane protein 252 |
| chr19_+_41482728 | 2.88 |
ENSRNOT00000022943
|
Calb2
|
calbindin 2 |
| chr10_+_103396155 | 2.88 |
ENSRNOT00000086924
|
Gprc5c
|
G protein-coupled receptor, class C, group 5, member C |
| chr5_-_156734541 | 2.86 |
ENSRNOT00000021036
|
LOC100909857
|
cytidine deaminase-like |
| chr10_-_90312386 | 2.82 |
ENSRNOT00000028445
|
Slc4a1
|
solute carrier family 4 member 1 |
| chr19_+_20607507 | 2.78 |
ENSRNOT00000000011
|
Cbln1
|
cerebellin 1 precursor |
| chr5_+_139597731 | 2.78 |
ENSRNOT00000072427
|
Cited4
|
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
| chr8_-_23000455 | 2.77 |
ENSRNOT00000091027
ENSRNOT00000017493 |
Rgl3
|
ral guanine nucleotide dissociation stimulator-like 3 |
| chr1_-_216663720 | 2.73 |
ENSRNOT00000078944
ENSRNOT00000077409 |
Cdkn1c
|
cyclin-dependent kinase inhibitor 1C |
| chr6_+_43001948 | 2.72 |
ENSRNOT00000007374
|
Hpcal1
|
hippocalcin-like 1 |
| chr2_-_30127269 | 2.72 |
ENSRNOT00000023869
|
Cartpt
|
CART prepropeptide |
| chr10_+_15088935 | 2.72 |
ENSRNOT00000030273
|
Gng13
|
G protein subunit gamma 13 |
| chr11_+_32655616 | 2.71 |
ENSRNOT00000084412
ENSRNOT00000034383 |
Clic6
|
chloride intracellular channel 6 |
| chr6_-_11494459 | 2.70 |
ENSRNOT00000021570
|
Kcnk12
|
potassium two pore domain channel subfamily K member 12 |
| chr4_-_10269748 | 2.69 |
ENSRNOT00000074662
|
Fam185a
|
family with sequence similarity 185, member A |
| chr13_+_52588917 | 2.68 |
ENSRNOT00000011999
|
Phlda3
|
pleckstrin homology-like domain, family A, member 3 |
| chr1_-_88193346 | 2.67 |
ENSRNOT00000078600
|
LOC103690068
|
immortalization up-regulated protein-like |
| chr3_-_8315910 | 2.66 |
ENSRNOT00000074482
|
LOC102546892
|
proline-rich protein HaeIII subfamily 1-like |
| chr1_-_89473904 | 2.64 |
ENSRNOT00000089474
|
Fxyd5
|
FXYD domain-containing ion transport regulator 5 |
| chr19_-_37427989 | 2.60 |
ENSRNOT00000022863
|
Tppp3
|
tubulin polymerization-promoting protein family member 3 |
| chr10_-_15166457 | 2.57 |
ENSRNOT00000026676
|
Metrn
|
meteorin, glial cell differentiation regulator |
| chr14_+_77380262 | 2.56 |
ENSRNOT00000008030
|
Nsg1
|
neuron specific gene family member 1 |
| chr16_-_19225037 | 2.53 |
ENSRNOT00000019052
|
Klf2
|
Kruppel-like factor 2 |
| chr18_+_52550739 | 2.51 |
ENSRNOT00000037529
|
Ctxn3
|
cortexin 3 |
| chr10_-_15590220 | 2.51 |
ENSRNOT00000048977
|
Hba-a2
|
hemoglobin alpha, adult chain 2 |
| chr1_-_33275540 | 2.47 |
ENSRNOT00000017019
|
Irx2
|
iroquois homeobox 2 |
| chr6_+_33885495 | 2.45 |
ENSRNOT00000086633
|
Sdc1
|
syndecan 1 |
| chr16_+_36116258 | 2.43 |
ENSRNOT00000017652
|
Sap30
|
Sin3A associated protein 30 |
| chr1_+_211423022 | 2.42 |
ENSRNOT00000029587
|
Dpysl4
|
dihydropyrimidinase-like 4 |
| chr10_-_64202380 | 2.41 |
ENSRNOT00000008982
|
Rflnb
|
refilin B |
| chr16_-_20807070 | 2.40 |
ENSRNOT00000072536
|
Comp
|
cartilage oligomeric matrix protein |
| chr1_-_52992213 | 2.40 |
ENSRNOT00000033528
|
Prr18
|
proline rich 18 |
| chr2_-_202816562 | 2.40 |
ENSRNOT00000020401
|
Fam46c
|
family with sequence similarity 46, member C |
| chr3_-_66417741 | 2.38 |
ENSRNOT00000007662
|
Neurod1
|
neuronal differentiation 1 |
| chr5_-_127273656 | 2.37 |
ENSRNOT00000057341
|
Dmrtb1
|
DMRT-like family B with proline-rich C-terminal, 1 |
| chr4_+_100407658 | 2.37 |
ENSRNOT00000018562
|
Capg
|
capping actin protein, gelsolin like |
| chr19_+_16415636 | 2.36 |
ENSRNOT00000089975
|
Irx5
|
iroquois homeobox 5 |
| chr14_+_4362717 | 2.34 |
ENSRNOT00000002887
|
Barhl2
|
BarH-like homeobox 2 |
| chr7_+_116090189 | 2.33 |
ENSRNOT00000081571
|
Psca
|
prostate stem cell antigen |
| chr4_+_84194347 | 2.32 |
ENSRNOT00000084256
|
Chn2
|
chimerin 2 |
| chr1_+_218466289 | 2.32 |
ENSRNOT00000017948
|
Mrgprf
|
MAS related GPR family member F |
| chr5_-_21345805 | 2.31 |
ENSRNOT00000081296
ENSRNOT00000007802 |
Car8
|
carbonic anhydrase 8 |
| chr10_-_55642681 | 2.31 |
ENSRNOT00000057157
|
AC129753.1
|
|
| chr3_+_150323116 | 2.30 |
ENSRNOT00000023429
ENSRNOT00000080485 |
Raly
|
RALY heterogeneous nuclear ribonucleoprotein |
| chr10_-_12997930 | 2.29 |
ENSRNOT00000004842
|
Tnfrsf12a
|
TNF receptor superfamily member 12A |
| chr6_-_109004598 | 2.28 |
ENSRNOT00000007790
|
Pgf
|
placental growth factor |
| chr6_+_8886591 | 2.27 |
ENSRNOT00000091510
ENSRNOT00000089174 |
Six3
|
SIX homeobox 3 |
| chr10_+_103703404 | 2.26 |
ENSRNOT00000086469
|
Rab37
|
RAB37, member RAS oncogene family |
| chr6_+_8346704 | 2.25 |
ENSRNOT00000092218
|
AC111831.2
|
|
| chr13_+_25778317 | 2.24 |
ENSRNOT00000021129
|
Tnfrsf11a
|
TNF receptor superfamily member 11A |
| chr7_-_12609868 | 2.23 |
ENSRNOT00000016396
|
Kiss1r
|
KISS1 receptor |
| chr10_-_27862868 | 2.22 |
ENSRNOT00000004877
|
Gabra6
|
gamma-aminobutyric acid type A receptor alpha 6 subunit |
| chr7_-_143793774 | 2.22 |
ENSRNOT00000079678
|
Csad
|
cysteine sulfinic acid decarboxylase |
| chrX_+_136460215 | 2.21 |
ENSRNOT00000093538
|
Arhgap36
|
Rho GTPase activating protein 36 |
| chr3_+_79713567 | 2.19 |
ENSRNOT00000012110
|
C1qtnf4
|
C1q and tumor necrosis factor related protein 4 |
| chr6_+_3012804 | 2.17 |
ENSRNOT00000061980
|
Arhgef33
|
Rho guanine nucleotide exchange factor 33 |
| chr1_+_175445088 | 2.16 |
ENSRNOT00000036718
|
Adm
|
adrenomedullin |
| chr7_+_11737293 | 2.15 |
ENSRNOT00000046059
|
Lingo3
|
leucine rich repeat and Ig domain containing 3 |
| chr10_-_89084885 | 2.15 |
ENSRNOT00000027452
|
Plekhh3
|
pleckstrin homology, MyTH4 and FERM domain containing H3 |
| chr7_-_120490061 | 2.14 |
ENSRNOT00000016247
|
Slc16a8
|
solute carrier family 16 member 8 |
| chr14_+_83752393 | 2.13 |
ENSRNOT00000081123
|
Selenom
|
selenoprotein M |
| chr1_+_101178104 | 2.13 |
ENSRNOT00000028072
|
Pth2
|
parathyroid hormone 2 |
| chr1_-_72339395 | 2.13 |
ENSRNOT00000021772
|
Zfp580
|
zinc finger protein 580 |
| chr13_-_44345735 | 2.13 |
ENSRNOT00000005006
|
Tmem163
|
transmembrane protein 163 |
| chr9_+_117795132 | 2.13 |
ENSRNOT00000086943
|
Akain1
|
A-kinase anchor inhibitor 1 |
| chr5_+_162031722 | 2.12 |
ENSRNOT00000020483
|
Lrrc38
|
leucine rich repeat containing 38 |
| chr1_-_218657925 | 2.11 |
ENSRNOT00000020425
|
Gal
|
galanin and GMAP prepropeptide |
| chr14_+_87448692 | 2.10 |
ENSRNOT00000077177
|
Igfbp1
|
insulin-like growth factor binding protein 1 |
| chr7_-_136997050 | 2.10 |
ENSRNOT00000009143
|
Dbx2
|
developing brain homeobox 2 |
| chr1_-_87191588 | 2.10 |
ENSRNOT00000027998
|
LOC100361913
|
rCG54286-like |
| chr1_-_43884267 | 2.09 |
ENSRNOT00000024418
|
Cnksr3
|
Cnksr family member 3 |
| chr1_-_261090437 | 2.08 |
ENSRNOT00000072055
|
Frat2
|
FRAT2, WNT signaling pathway regulator |
| chr20_-_4921348 | 2.07 |
ENSRNOT00000082497
ENSRNOT00000041151 |
RT1-CE4
|
RT1 class I, locus CE4 |
| chr17_+_76002275 | 2.06 |
ENSRNOT00000092665
ENSRNOT00000086701 |
Echdc3
|
enoyl CoA hydratase domain containing 3 |
| chr7_-_12609694 | 2.06 |
ENSRNOT00000093287
ENSRNOT00000079485 |
Kiss1r
|
KISS1 receptor |
| chr11_+_83975367 | 2.05 |
ENSRNOT00000058131
|
Camk2n2
|
calcium/calmodulin-dependent protein kinase II inhibitor 2 |
| chr11_+_77815181 | 2.04 |
ENSRNOT00000002640
|
Cldn1
|
claudin 1 |
| chr10_-_88551056 | 2.04 |
ENSRNOT00000032737
|
Zfp385c
|
zinc finger protein 385C |
| chr3_+_164424515 | 2.03 |
ENSRNOT00000083876
|
Cebpb
|
CCAAT/enhancer binding protein beta |
| chr13_+_51534025 | 2.02 |
ENSRNOT00000006637
|
Syt2
|
synaptotagmin 2 |
| chr10_+_59529785 | 2.02 |
ENSRNOT00000064840
ENSRNOT00000065181 |
Atp2a3
|
ATPase sarcoplasmic/endoplasmic reticulum Ca2+ transporting 3 |
| chr20_+_14095914 | 2.01 |
ENSRNOT00000093404
|
Gucd1
|
guanylyl cyclase domain containing 1 |
| chr3_-_114307250 | 1.98 |
ENSRNOT00000064592
|
Shf
|
Src homology 2 domain containing F |
| chr10_-_66229311 | 1.98 |
ENSRNOT00000016897
|
Lgals5
|
lectin, galactose binding, soluble 5 |
| chr20_+_5067330 | 1.98 |
ENSRNOT00000037482
|
Ly6g6e
|
lymphocyte antigen 6 complex, locus G6E |
| chr2_-_260596777 | 1.98 |
ENSRNOT00000009370
|
Lhx8
|
LIM homeobox 8 |
| chr10_+_109278712 | 1.96 |
ENSRNOT00000065565
|
LOC690871
|
hypothetical protein LOC690871 |
| chr4_-_482645 | 1.96 |
ENSRNOT00000062073
ENSRNOT00000071713 |
Cnpy1
|
canopy FGF signaling regulator 1 |
| chr10_-_89958805 | 1.96 |
ENSRNOT00000084266
|
Mpp3
|
membrane palmitoylated protein 3 |
| chr7_-_28715224 | 1.95 |
ENSRNOT00000065899
|
Parpbp
|
PARP1 binding protein |
| chr3_-_80842916 | 1.95 |
ENSRNOT00000033978
|
Mdk
|
midkine |
| chr1_-_192057612 | 1.94 |
ENSRNOT00000024471
|
Ndufab1
|
NADH:ubiquinone oxidoreductase subunit AB1 |
| chr3_-_13435979 | 1.94 |
ENSRNOT00000029600
|
Pbx3
|
PBX homeobox 3 |
| chr16_+_10250404 | 1.93 |
ENSRNOT00000087037
ENSRNOT00000081183 |
Gdf10
|
growth differentiation factor 10 |
| chr20_+_13662867 | 1.92 |
ENSRNOT00000032257
|
RGD1564162
|
similar to Homo sapiens fetal lung specific expression unknown |
| chr4_-_123494742 | 1.92 |
ENSRNOT00000073268
|
Slc41a3
|
solute carrier family 41, member 3 |
| chr4_-_158010166 | 1.91 |
ENSRNOT00000026633
|
Cd9
|
CD9 molecule |
| chr1_+_267607416 | 1.90 |
ENSRNOT00000087894
ENSRNOT00000076367 ENSRNOT00000016851 |
Gsto2
Gsto1
|
glutathione S-transferase omega 2 glutathione S-transferase omega 1 |
| chr12_+_17736287 | 1.90 |
ENSRNOT00000091476
|
Pdgfa
|
platelet derived growth factor subunit A |
| chr7_-_119441487 | 1.89 |
ENSRNOT00000067635
|
Pvalb
|
parvalbumin |
| chr12_-_16126953 | 1.89 |
ENSRNOT00000001682
|
Lfng
|
LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
| chr5_-_152473868 | 1.89 |
ENSRNOT00000022130
|
Fam110d
|
family with sequence similarity 110, member D |
| chr12_+_47698947 | 1.87 |
ENSRNOT00000001586
|
Trpv4
|
transient receptor potential cation channel, subfamily V, member 4 |
| chr10_-_85938085 | 1.85 |
ENSRNOT00000043561
|
Plxdc1
|
plexin domain containing 1 |
| chr17_+_15845931 | 1.85 |
ENSRNOT00000092083
|
Card19
|
caspase recruitment domain family, member 19 |
| chr11_-_73678984 | 1.85 |
ENSRNOT00000002355
|
Fam43a
|
family with sequence similarity 43, member A |
| chr8_+_48438259 | 1.85 |
ENSRNOT00000059813
|
Mfrp
|
membrane frizzled-related protein |
| chr10_+_91710495 | 1.84 |
ENSRNOT00000033276
|
Rprml
|
reprimo-like |
| chr3_-_82856171 | 1.83 |
ENSRNOT00000088555
|
RGD1564664
|
similar to LOC387763 protein |
| chr1_+_276659542 | 1.83 |
ENSRNOT00000019681
|
Tcf7l2
|
transcription factor 7 like 2 |
| chr6_+_51662224 | 1.82 |
ENSRNOT00000060006
|
Ccdc71l
|
coiled-coil domain containing 71-like |
| chr4_-_124858250 | 1.80 |
ENSRNOT00000057045
|
Adamts9
|
ADAM metallopeptidase with thrombospondin type 1 motif, 9 |
| chr8_-_68966108 | 1.80 |
ENSRNOT00000012155
|
Smad6
|
SMAD family member 6 |
| chr5_-_166924136 | 1.79 |
ENSRNOT00000085251
|
Spsb1
|
splA/ryanodine receptor domain and SOCS box containing 1 |
| chr1_+_83003841 | 1.79 |
ENSRNOT00000057384
|
Ceacam4
|
carcinoembryonic antigen-related cell adhesion molecule 4 |
| chr9_+_102862890 | 1.79 |
ENSRNOT00000050494
ENSRNOT00000080129 |
Fam174a
|
family with sequence similarity 174, member A |
| chr7_-_13751271 | 1.78 |
ENSRNOT00000009931
|
Slc1a6
|
solute carrier family 1 member 6 |
| chr1_-_88881460 | 1.78 |
ENSRNOT00000028287
|
Hcst
|
hematopoietic cell signal transducer |
| chr1_-_226049929 | 1.77 |
ENSRNOT00000007320
|
Best1
|
bestrophin 1 |
| chr5_-_161035368 | 1.76 |
ENSRNOT00000091640
|
AABR07050321.2
|
|
| chr19_-_52282877 | 1.75 |
ENSRNOT00000021271
|
Kcng4
|
potassium voltage-gated channel modifier subfamily G member 4 |
| chr9_+_73493027 | 1.75 |
ENSRNOT00000074427
ENSRNOT00000089478 |
Unc80
|
unc-80 homolog, NALCN activator |
| chr7_-_58149061 | 1.75 |
ENSRNOT00000005157
|
Tph2
|
tryptophan hydroxylase 2 |
| chr20_+_4966817 | 1.74 |
ENSRNOT00000081527
ENSRNOT00000081265 |
Lsm2
|
LSM2 homolog, U6 small nuclear RNA and mRNA degradation associated |
| chr11_+_88122271 | 1.74 |
ENSRNOT00000002540
|
Sdf2l1
|
stromal cell-derived factor 2-like 1 |
| chr12_+_50407843 | 1.74 |
ENSRNOT00000073763
|
Cryba4
|
crystallin, beta A4 |
| chr17_+_72429618 | 1.74 |
ENSRNOT00000026187
|
Gata3
|
GATA binding protein 3 |
| chr8_-_68038533 | 1.73 |
ENSRNOT00000018756
|
Skor1
|
SKI family transcriptional corepressor 1 |
| chr3_+_161121697 | 1.73 |
ENSRNOT00000036020
|
Wfdc10a
|
WAP four-disulfide core domain 10A |
| chr12_+_47193964 | 1.73 |
ENSRNOT00000001552
ENSRNOT00000039281 |
Cabp1
|
calcium binding protein 1 |
| chr7_+_13062196 | 1.73 |
ENSRNOT00000000193
|
Plpp2
|
phospholipid phosphatase 2 |
| chr13_+_85918252 | 1.73 |
ENSRNOT00000006163
|
Lmx1a
|
LIM homeobox transcription factor 1 alpha |
| chr5_-_139864393 | 1.73 |
ENSRNOT00000030016
|
Zfp69
|
zinc finger protein 69 |
| chr15_-_61873406 | 1.73 |
ENSRNOT00000045115
|
LOC100360244
|
LRRGT00053-like |
| chr15_+_33600102 | 1.72 |
ENSRNOT00000022664
|
Cmtm5
|
CKLF-like MARVEL transmembrane domain containing 5 |
| chr5_+_24434872 | 1.72 |
ENSRNOT00000010696
|
Ccne2
|
cyclin E2 |
| chr1_+_72636959 | 1.72 |
ENSRNOT00000023489
|
Il11
|
interleukin 11 |
| chr1_+_221872220 | 1.71 |
ENSRNOT00000028651
|
Nrxn2
|
neurexin 2 |
| chr2_+_187740531 | 1.70 |
ENSRNOT00000092653
|
Paqr6
|
progestin and adipoQ receptor family member 6 |
| chr8_+_98755104 | 1.70 |
ENSRNOT00000056562
|
Zic4
|
Zic family member 4 |
| chr7_-_123088819 | 1.69 |
ENSRNOT00000056077
|
AC096601.1
|
|
| chr16_-_20888907 | 1.69 |
ENSRNOT00000027428
|
Homer3
|
homer scaffolding protein 3 |
| chr1_-_221917901 | 1.68 |
ENSRNOT00000092270
|
Slc22a12
|
solute carrier family 22 member 12 |
| chr12_+_47551935 | 1.68 |
ENSRNOT00000056932
|
RGD1560398
|
RGD1560398 |
| chr20_-_5123073 | 1.68 |
ENSRNOT00000001126
|
Apom
|
apolipoprotein M |
| chr5_+_136669674 | 1.68 |
ENSRNOT00000048770
|
Slc6a9
|
solute carrier family 6 member 9 |
| chr1_+_264504591 | 1.68 |
ENSRNOT00000050076
|
Pax2
|
paired box 2 |
| chr8_-_115167486 | 1.67 |
ENSRNOT00000033018
|
Gpr62
|
G protein-coupled receptor 62 |
| chr10_+_56662561 | 1.67 |
ENSRNOT00000025254
|
Asgr1
|
asialoglycoprotein receptor 1 |
| chr13_-_50499060 | 1.67 |
ENSRNOT00000065347
ENSRNOT00000076924 |
Etnk2
|
ethanolamine kinase 2 |
| chr15_+_108908607 | 1.66 |
ENSRNOT00000089455
|
Zic2
|
Zic family member 2 |
| chr2_-_259150479 | 1.65 |
ENSRNOT00000085892
|
AABR07013843.1
|
|
| chr10_-_59892960 | 1.64 |
ENSRNOT00000084432
|
Aspa
|
aspartoacylase |
| chr11_+_89008008 | 1.64 |
ENSRNOT00000074586
|
Cebpd
|
CCAAT/enhancer binding protein delta |
| chr16_+_20352480 | 1.64 |
ENSRNOT00000025956
|
Arrdc2
|
arrestin domain containing 2 |
| chr1_+_218003018 | 1.63 |
ENSRNOT00000028343
|
Fgf3
|
fibroblast growth factor 3 |
| chr4_-_160605107 | 1.63 |
ENSRNOT00000090725
|
Tspan9
|
tetraspanin 9 |
| chr4_-_119714302 | 1.63 |
ENSRNOT00000013299
|
Rab43
|
RAB43, member RAS oncogene family |
| chr20_+_4329811 | 1.63 |
ENSRNOT00000000513
|
Notch4
|
notch 4 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.3 | 9.3 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
| 2.2 | 8.8 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
| 1.7 | 1.7 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 1.5 | 4.4 | GO:0021558 | trochlear nerve development(GO:0021558) |
| 1.4 | 4.1 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 1.3 | 6.7 | GO:0010037 | response to carbon dioxide(GO:0010037) |
| 1.3 | 5.1 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 1.2 | 3.7 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 1.2 | 4.8 | GO:0046087 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 1.2 | 5.8 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 1.2 | 4.6 | GO:0035502 | metanephric part of ureteric bud development(GO:0035502) |
| 1.1 | 3.4 | GO:1903544 | response to butyrate(GO:1903544) |
| 1.1 | 12.1 | GO:0015671 | oxygen transport(GO:0015671) |
| 1.1 | 5.5 | GO:0035799 | ureter maturation(GO:0035799) |
| 1.1 | 3.3 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 1.0 | 3.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 1.0 | 3.0 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 1.0 | 2.9 | GO:0060683 | regulation of branching involved in salivary gland morphogenesis by epithelial-mesenchymal signaling(GO:0060683) embryonic lung development(GO:1990401) |
| 1.0 | 2.9 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.9 | 2.8 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.9 | 5.5 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.9 | 0.9 | GO:0048105 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.9 | 3.6 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
| 0.9 | 6.9 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.8 | 0.8 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.8 | 3.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.8 | 3.2 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.8 | 4.0 | GO:0034552 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.8 | 0.8 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.8 | 1.5 | GO:0051867 | general adaptation syndrome, behavioral process(GO:0051867) |
| 0.8 | 2.3 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.8 | 0.8 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.8 | 7.5 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.8 | 2.3 | GO:0050828 | regulation of liquid surface tension(GO:0050828) |
| 0.8 | 1.5 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.7 | 3.7 | GO:0046687 | response to chromate(GO:0046687) |
| 0.7 | 9.6 | GO:1901374 | acetate ester transport(GO:1901374) |
| 0.7 | 2.9 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.7 | 2.8 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.7 | 3.6 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.7 | 2.1 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
| 0.7 | 2.1 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.7 | 2.1 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.7 | 1.4 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.7 | 2.1 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.7 | 0.7 | GO:0031583 | phospholipase D-activating G-protein coupled receptor signaling pathway(GO:0031583) |
| 0.7 | 2.1 | GO:2000338 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 0.7 | 2.1 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.7 | 0.7 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.7 | 3.3 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.7 | 2.0 | GO:0034443 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) |
| 0.7 | 2.6 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.6 | 1.9 | GO:0060460 | left lung morphogenesis(GO:0060460) |
| 0.6 | 0.6 | GO:0060459 | left lung development(GO:0060459) |
| 0.6 | 1.3 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.6 | 1.9 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.6 | 1.9 | GO:0060424 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
| 0.6 | 0.6 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.6 | 0.6 | GO:1902462 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.6 | 1.2 | GO:0071298 | cellular response to L-ascorbic acid(GO:0071298) |
| 0.6 | 4.3 | GO:0035934 | corticosterone secretion(GO:0035934) |
| 0.6 | 3.6 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 0.6 | 0.6 | GO:0006408 | snRNA export from nucleus(GO:0006408) |
| 0.6 | 0.6 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) negative regulation of mitochondrial fusion(GO:0010637) |
| 0.6 | 4.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.6 | 2.3 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.6 | 0.6 | GO:0021767 | mammillary body development(GO:0021767) mammillary axonal complex development(GO:0061373) |
| 0.6 | 1.7 | GO:0071733 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.6 | 0.6 | GO:0021557 | oculomotor nerve development(GO:0021557) |
| 0.6 | 1.7 | GO:1990792 | response to glial cell derived neurotrophic factor(GO:1990790) cellular response to glial cell derived neurotrophic factor(GO:1990792) |
| 0.6 | 1.7 | GO:1904722 | positive regulation of mRNA cleavage(GO:0031439) positive regulation of endoribonuclease activity(GO:1902380) positive regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904722) |
| 0.6 | 4.0 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.6 | 1.7 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.6 | 1.7 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.6 | 2.2 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.5 | 1.6 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.5 | 1.1 | GO:0045105 | intermediate filament polymerization or depolymerization(GO:0045105) |
| 0.5 | 1.6 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.5 | 1.6 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.5 | 0.5 | GO:1903165 | response to polycyclic arene(GO:1903165) |
| 0.5 | 1.6 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.5 | 0.5 | GO:0030581 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.5 | 2.1 | GO:0010710 | regulation of collagen catabolic process(GO:0010710) |
| 0.5 | 3.6 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.5 | 1.0 | GO:0030186 | melatonin metabolic process(GO:0030186) |
| 0.5 | 2.1 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.5 | 1.5 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.5 | 2.5 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.5 | 2.5 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.5 | 1.0 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.5 | 3.0 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.5 | 0.5 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.5 | 1.5 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
| 0.5 | 2.0 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.5 | 2.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.5 | 1.0 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.5 | 2.0 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.5 | 3.4 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.5 | 1.5 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.5 | 0.5 | GO:0009196 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.5 | 1.9 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.5 | 1.4 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) |
| 0.5 | 0.5 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.5 | 2.9 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.5 | 0.5 | GO:0035747 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.5 | 0.9 | GO:0071613 | granzyme B production(GO:0071613) regulation of granzyme B production(GO:0071661) positive regulation of granzyme B production(GO:0071663) |
| 0.5 | 1.4 | GO:1990402 | embryonic liver development(GO:1990402) |
| 0.5 | 1.4 | GO:0002397 | MHC class I protein complex assembly(GO:0002397) |
| 0.5 | 1.9 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.5 | 2.8 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
| 0.5 | 1.4 | GO:1903769 | negative regulation of cell proliferation in bone marrow(GO:1903769) |
| 0.5 | 0.5 | GO:0021539 | subthalamus development(GO:0021539) |
| 0.5 | 0.9 | GO:2000422 | regulation of eosinophil chemotaxis(GO:2000422) positive regulation of eosinophil chemotaxis(GO:2000424) |
| 0.5 | 1.8 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.5 | 4.1 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
| 0.5 | 1.4 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.4 | 2.7 | GO:0008228 | opsonization(GO:0008228) |
| 0.4 | 1.8 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.4 | 0.9 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.4 | 0.4 | GO:1904396 | regulation of synaptic growth at neuromuscular junction(GO:0008582) regulation of neuromuscular junction development(GO:1904396) |
| 0.4 | 0.4 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.4 | 0.4 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.4 | 1.3 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) negative regulation of adipose tissue development(GO:1904178) |
| 0.4 | 1.3 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.4 | 1.3 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.4 | 0.9 | GO:0072003 | kidney rudiment formation(GO:0072003) |
| 0.4 | 0.4 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.4 | 1.7 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
| 0.4 | 1.7 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.4 | 3.4 | GO:0071499 | cellular response to laminar fluid shear stress(GO:0071499) |
| 0.4 | 4.3 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.4 | 0.4 | GO:1903278 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.4 | 0.4 | GO:0097324 | melanocyte migration(GO:0097324) |
| 0.4 | 2.5 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
| 0.4 | 1.7 | GO:1990379 | lipid transport across blood brain barrier(GO:1990379) |
| 0.4 | 0.4 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.4 | 0.8 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.4 | 0.8 | GO:1902218 | regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.4 | 0.8 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) fibroblast growth factor receptor signaling pathway involved in orbitofrontal cortex development(GO:0035607) |
| 0.4 | 1.3 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.4 | 1.3 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
| 0.4 | 0.4 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.4 | 1.6 | GO:0061072 | iris morphogenesis(GO:0061072) |
| 0.4 | 2.0 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 0.4 | 0.8 | GO:0006848 | pyruvate transport(GO:0006848) |
| 0.4 | 0.4 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.4 | 1.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.4 | 1.6 | GO:1990859 | response to endothelin(GO:1990839) cellular response to endothelin(GO:1990859) |
| 0.4 | 2.0 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.4 | 0.4 | GO:2000858 | mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) regulation of aldosterone secretion(GO:2000858) |
| 0.4 | 0.8 | GO:1900211 | mesenchymal cell apoptotic process involved in metanephros development(GO:1900200) regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900211) negative regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900212) |
| 0.4 | 1.2 | GO:0016129 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.4 | 1.2 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.4 | 6.5 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.4 | 1.6 | GO:0072144 | glomerular mesangial cell development(GO:0072144) |
| 0.4 | 0.4 | GO:0046671 | negative regulation of retinal cell programmed cell death(GO:0046671) |
| 0.4 | 3.6 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) |
| 0.4 | 3.2 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.4 | 1.2 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.4 | 0.4 | GO:0090164 | asymmetric Golgi ribbon formation(GO:0090164) |
| 0.4 | 0.8 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.4 | 1.2 | GO:0002481 | antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) |
| 0.4 | 0.4 | GO:0060751 | branch elongation involved in mammary gland duct branching(GO:0060751) |
| 0.4 | 1.2 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.4 | 0.4 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) endocardial cell differentiation(GO:0060956) |
| 0.4 | 1.5 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.4 | 2.3 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.4 | 0.4 | GO:0072069 | DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
| 0.4 | 1.9 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.4 | 1.1 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.4 | 1.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.4 | 1.1 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.4 | 3.8 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.4 | 0.8 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.4 | 0.8 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.4 | 1.5 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.4 | 0.8 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.4 | 1.5 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
| 0.4 | 0.4 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
| 0.4 | 7.5 | GO:0032291 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
| 0.4 | 1.5 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.4 | 1.1 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
| 0.4 | 0.7 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
| 0.4 | 0.4 | GO:0051542 | elastin biosynthetic process(GO:0051542) |
| 0.4 | 1.5 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.4 | 0.7 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.4 | 0.4 | GO:0007493 | endodermal cell fate determination(GO:0007493) |
| 0.4 | 1.1 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.4 | 2.9 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 0.4 | 1.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.4 | 1.4 | GO:1903413 | cellular response to bile acid(GO:1903413) |
| 0.4 | 1.1 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.4 | 1.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.4 | 0.4 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.4 | 6.3 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.4 | 3.2 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.3 | 1.4 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.3 | 1.0 | GO:0045210 | FasL biosynthetic process(GO:0045210) |
| 0.3 | 1.0 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.3 | 0.7 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
| 0.3 | 1.0 | GO:0042323 | negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 0.3 | 1.0 | GO:0046086 | adenosine biosynthetic process(GO:0046086) |
| 0.3 | 1.7 | GO:0060574 | intestinal epithelial cell maturation(GO:0060574) |
| 0.3 | 5.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.3 | 0.3 | GO:0071422 | succinate transport(GO:0015744) succinate transmembrane transport(GO:0071422) |
| 0.3 | 0.3 | GO:2000157 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.3 | 1.7 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.3 | 0.3 | GO:0009216 | purine deoxyribonucleoside triphosphate biosynthetic process(GO:0009216) |
| 0.3 | 0.3 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.3 | 1.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.3 | 1.3 | GO:1904373 | response to kainic acid(GO:1904373) |
| 0.3 | 1.7 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.3 | 0.3 | GO:0043366 | beta selection(GO:0043366) |
| 0.3 | 1.0 | GO:1904009 | cellular response to monosodium glutamate(GO:1904009) |
| 0.3 | 0.7 | GO:0044837 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.3 | 0.3 | GO:0018307 | enzyme active site formation(GO:0018307) |
| 0.3 | 0.3 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.3 | 1.0 | GO:1901227 | negative regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901227) |
| 0.3 | 1.0 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.3 | 1.0 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.3 | 0.7 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.3 | 1.0 | GO:2000847 | negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.3 | 2.3 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.3 | 1.6 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.3 | 1.0 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.3 | 0.6 | GO:0035697 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) |
| 0.3 | 0.3 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.3 | 0.6 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.3 | 1.0 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.3 | 3.5 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.3 | 2.2 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.3 | 2.2 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.3 | 0.3 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.3 | 1.3 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
| 0.3 | 0.9 | GO:0046075 | dTTP metabolic process(GO:0046075) |
| 0.3 | 1.3 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.3 | 1.2 | GO:0015871 | choline transport(GO:0015871) |
| 0.3 | 0.9 | GO:1904350 | regulation of protein catabolic process in the vacuole(GO:1904350) |
| 0.3 | 0.9 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.3 | 0.6 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.3 | 0.3 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.3 | 0.6 | GO:0060974 | cell migration involved in heart formation(GO:0060974) |
| 0.3 | 0.9 | GO:0060374 | mast cell differentiation(GO:0060374) |
| 0.3 | 0.9 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.3 | 0.6 | GO:1903860 | negative regulation of dendrite extension(GO:1903860) |
| 0.3 | 1.2 | GO:0033864 | positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 0.3 | 1.2 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.3 | 0.9 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.3 | 0.3 | GO:1904994 | regulation of leukocyte adhesion to vascular endothelial cell(GO:1904994) |
| 0.3 | 1.5 | GO:0061743 | motor learning(GO:0061743) |
| 0.3 | 1.2 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.3 | 1.2 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.3 | 0.9 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.3 | 0.9 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.3 | 1.8 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.3 | 1.2 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.3 | 0.6 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.3 | 0.3 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.3 | 0.3 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.3 | 1.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.3 | 1.2 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
| 0.3 | 3.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.3 | 0.9 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.3 | 1.2 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.3 | 2.3 | GO:1904871 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.3 | 0.9 | GO:0042335 | cuticle development(GO:0042335) |
| 0.3 | 0.9 | GO:0002462 | tolerance induction to nonself antigen(GO:0002462) |
| 0.3 | 0.3 | GO:0060764 | cell-cell signaling involved in mammary gland development(GO:0060764) |
| 0.3 | 1.2 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.3 | 0.6 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.3 | 0.9 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.3 | 0.9 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.3 | 1.4 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) |
| 0.3 | 2.6 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.3 | 0.3 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
| 0.3 | 0.6 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 0.3 | 1.4 | GO:0051256 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.3 | 2.0 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
| 0.3 | 0.6 | GO:0021590 | cerebellum maturation(GO:0021590) cerebellar cortex maturation(GO:0021699) |
| 0.3 | 0.8 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
| 0.3 | 1.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.3 | 2.8 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.3 | 0.5 | GO:0060913 | cardiac cell fate determination(GO:0060913) |
| 0.3 | 1.1 | GO:0015801 | aromatic amino acid transport(GO:0015801) |
| 0.3 | 1.1 | GO:0014028 | notochord formation(GO:0014028) |
| 0.3 | 0.3 | GO:0042160 | lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
| 0.3 | 1.6 | GO:0035768 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
| 0.3 | 1.1 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.3 | 0.8 | GO:0060816 | random inactivation of X chromosome(GO:0060816) regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.3 | 1.3 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.3 | 1.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.3 | 0.3 | GO:0002731 | negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.3 | 2.4 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.3 | 1.3 | GO:1904400 | response to Thyroid stimulating hormone(GO:1904400) cellular response to Thyroid stimulating hormone(GO:1904401) |
| 0.3 | 1.3 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.3 | 1.1 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
| 0.3 | 1.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.3 | 0.3 | GO:0043396 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) |
| 0.3 | 0.8 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.3 | 1.1 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.3 | 0.3 | GO:1904586 | response to putrescine(GO:1904585) cellular response to putrescine(GO:1904586) |
| 0.3 | 2.6 | GO:0048535 | lymph node development(GO:0048535) |
| 0.3 | 1.3 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.3 | 0.8 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.3 | 1.6 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.3 | 0.3 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
| 0.3 | 0.3 | GO:1903598 | positive regulation of gap junction assembly(GO:1903598) |
| 0.3 | 0.8 | GO:0006991 | response to sterol depletion(GO:0006991) |
| 0.3 | 0.8 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.3 | 1.3 | GO:0099550 | trans-synaptic signalling, modulating synaptic transmission(GO:0099550) |
| 0.3 | 0.3 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
| 0.3 | 0.5 | GO:0030070 | insulin processing(GO:0030070) |
| 0.3 | 1.3 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.3 | 0.8 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.3 | 0.5 | GO:2000417 | negative regulation of eosinophil migration(GO:2000417) |
| 0.3 | 0.8 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.3 | 0.5 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
| 0.3 | 0.5 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.3 | 0.3 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.3 | 0.3 | GO:1905146 | lysosomal protein catabolic process(GO:1905146) |
| 0.3 | 2.3 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.3 | 0.8 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.3 | 2.0 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.3 | 0.3 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.3 | 0.5 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.3 | 1.0 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.3 | 2.5 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.2 | 0.5 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.2 | 1.5 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.2 | 0.2 | GO:0000053 | argininosuccinate metabolic process(GO:0000053) |
| 0.2 | 0.7 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.2 | 0.7 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
| 0.2 | 0.2 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.2 | 0.7 | GO:1902869 | regulation of amacrine cell differentiation(GO:1902869) |
| 0.2 | 0.2 | GO:0018201 | peptidyl-glycine modification(GO:0018201) |
| 0.2 | 0.5 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.2 | 0.7 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.2 | 1.9 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.2 | 1.7 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.2 | 1.0 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.2 | 3.4 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.2 | 0.2 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.2 | 0.2 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.2 | 0.5 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.2 | 1.9 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.2 | 1.9 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.2 | 0.7 | GO:0090172 | microtubule cytoskeleton organization involved in homologous chromosome segregation(GO:0090172) |
| 0.2 | 0.2 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
| 0.2 | 0.7 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.2 | 1.7 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.2 | 1.4 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.2 | 0.7 | GO:1904815 | negative regulation of protein localization to chromosome, telomeric region(GO:1904815) |
| 0.2 | 2.1 | GO:0061621 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.2 | 0.9 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.2 | 0.7 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.2 | 0.5 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.2 | 3.3 | GO:0036065 | fucosylation(GO:0036065) |
| 0.2 | 2.6 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.2 | 1.2 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
| 0.2 | 0.5 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.2 | 0.9 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.2 | 0.2 | GO:0071554 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.2 | 2.3 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 | 0.7 | GO:0010625 | positive regulation of Schwann cell proliferation(GO:0010625) |
| 0.2 | 0.7 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.2 | 2.5 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.2 | 1.4 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.2 | 0.7 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
| 0.2 | 3.2 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.2 | 1.4 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.2 | 0.5 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.2 | 1.1 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.2 | 1.6 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.2 | 2.0 | GO:0097033 | mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.2 | 0.9 | GO:0019062 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
| 0.2 | 0.2 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
| 0.2 | 0.5 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.2 | 1.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.2 | 2.0 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.2 | 0.9 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.2 | 4.1 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
| 0.2 | 1.8 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.2 | 0.5 | GO:0002003 | angiotensin maturation(GO:0002003) |
| 0.2 | 0.2 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.2 | 0.4 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.2 | 0.4 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.2 | 0.7 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.2 | 0.4 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.2 | 3.4 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.2 | 1.1 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.2 | 1.8 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
| 0.2 | 0.7 | GO:0003166 | bundle of His development(GO:0003166) |
| 0.2 | 0.9 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.2 | 0.2 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.2 | 0.9 | GO:0021965 | spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.2 | 0.4 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.2 | 2.0 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.2 | 3.7 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
| 0.2 | 0.9 | GO:0034434 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.2 | 1.3 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.2 | 0.6 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.2 | 0.6 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.2 | 0.8 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.2 | 1.3 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.2 | 0.2 | GO:1901020 | negative regulation of calcium ion transmembrane transporter activity(GO:1901020) |
| 0.2 | 1.1 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
| 0.2 | 0.6 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.2 | 0.2 | GO:0030221 | basophil differentiation(GO:0030221) |
| 0.2 | 0.2 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.2 | 0.6 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.2 | 0.8 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.2 | 0.6 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.2 | 0.6 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.2 | 0.8 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.2 | 0.2 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.2 | 9.2 | GO:0021762 | substantia nigra development(GO:0021762) |
| 0.2 | 0.6 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
| 0.2 | 0.8 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.2 | 2.5 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.2 | 0.2 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.2 | 1.2 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.2 | 0.4 | GO:1901724 | positive regulation of cell proliferation involved in kidney development(GO:1901724) |
| 0.2 | 1.2 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.2 | 0.8 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.2 | 0.4 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.2 | 0.6 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.2 | 0.2 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.2 | 0.2 | GO:1990144 | intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.2 | 0.2 | GO:1902339 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.2 | 0.4 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.2 | 1.2 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.2 | 1.0 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.2 | 0.8 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.2 | 0.6 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.2 | 0.6 | GO:1901377 | toxin catabolic process(GO:0009407) mycotoxin metabolic process(GO:0043385) mycotoxin catabolic process(GO:0043387) aflatoxin metabolic process(GO:0046222) aflatoxin catabolic process(GO:0046223) secondary metabolite catabolic process(GO:0090487) organic heteropentacyclic compound metabolic process(GO:1901376) organic heteropentacyclic compound catabolic process(GO:1901377) |
| 0.2 | 1.2 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.2 | 0.2 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.2 | 0.4 | GO:0039019 | pronephric nephron development(GO:0039019) |
| 0.2 | 0.6 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
| 0.2 | 0.6 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.2 | 0.6 | GO:0072695 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.2 | 0.8 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.2 | 2.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.2 | 1.0 | GO:0071464 | cellular response to hydrostatic pressure(GO:0071464) |
| 0.2 | 0.8 | GO:0021586 | pons maturation(GO:0021586) |
| 0.2 | 0.2 | GO:1903542 | negative regulation of exosomal secretion(GO:1903542) |
| 0.2 | 0.8 | GO:0010045 | response to nickel cation(GO:0010045) |
| 0.2 | 1.6 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.2 | 0.6 | GO:0034696 | response to prostaglandin F(GO:0034696) |
| 0.2 | 0.4 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.2 | 0.6 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.2 | 1.0 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.2 | 1.4 | GO:0006598 | polyamine catabolic process(GO:0006598) |
| 0.2 | 0.2 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.2 | 0.8 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.2 | 1.4 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.2 | 0.6 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.2 | 0.6 | GO:0070084 | protein initiator methionine removal(GO:0070084) |
| 0.2 | 2.1 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.2 | 0.2 | GO:1904616 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.2 | 0.6 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.2 | 0.4 | GO:0070162 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
| 0.2 | 1.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.2 | 2.3 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.2 | 0.8 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
| 0.2 | 0.4 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.2 | 0.6 | GO:0046016 | positive regulation of transcription by glucose(GO:0046016) |
| 0.2 | 0.8 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
| 0.2 | 0.2 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.2 | 0.2 | GO:0034014 | response to triglyceride(GO:0034014) |
| 0.2 | 1.1 | GO:0046655 | folic acid metabolic process(GO:0046655) |
| 0.2 | 0.6 | GO:0031989 | bombesin receptor signaling pathway(GO:0031989) |
| 0.2 | 3.6 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.2 | 0.6 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.2 | 1.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.2 | 6.0 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.2 | 0.7 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.2 | 0.2 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.2 | 1.5 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 0.2 | 0.2 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
| 0.2 | 0.7 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
| 0.2 | 0.4 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.2 | 2.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.2 | 0.2 | GO:0010269 | response to selenium ion(GO:0010269) |
| 0.2 | 4.6 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.2 | 0.4 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.2 | 0.6 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.2 | 0.2 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.2 | 2.0 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.2 | 0.7 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.2 | 0.2 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.2 | 0.9 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.2 | 0.4 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.2 | 2.4 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.2 | 0.5 | GO:0036233 | glycine import(GO:0036233) |
| 0.2 | 0.9 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.2 | 1.1 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.2 | 0.4 | GO:0036476 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.2 | 0.4 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.2 | 0.4 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.2 | 1.4 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.2 | 1.3 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.2 | 0.5 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.2 | 0.2 | GO:1903332 | regulation of protein folding(GO:1903332) |
| 0.2 | 1.4 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.2 | 0.7 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.2 | 0.5 | GO:1990375 | baculum development(GO:1990375) |
| 0.2 | 0.4 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.2 | 2.5 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.2 | 0.4 | GO:0032919 | spermine acetylation(GO:0032919) |
| 0.2 | 1.6 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.2 | 0.5 | GO:0003263 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) |
| 0.2 | 2.8 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.2 | 0.9 | GO:0006582 | melanin metabolic process(GO:0006582) |
| 0.2 | 0.4 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.2 | 1.9 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.2 | 0.7 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.2 | 0.9 | GO:0002192 | IRES-dependent translational initiation(GO:0002192) |
| 0.2 | 0.4 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.2 | 0.2 | GO:0045759 | negative regulation of action potential(GO:0045759) |
| 0.2 | 1.8 | GO:0032096 | negative regulation of response to food(GO:0032096) |
| 0.2 | 0.9 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.2 | 0.5 | GO:0009992 | cellular water homeostasis(GO:0009992) |
| 0.2 | 0.5 | GO:0060911 | cardiac cell fate commitment(GO:0060911) |
| 0.2 | 0.3 | GO:0097709 | connective tissue replacement(GO:0097709) |
| 0.2 | 0.3 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
| 0.2 | 0.7 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.2 | 5.5 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.2 | 0.2 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
| 0.2 | 2.1 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
| 0.2 | 1.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.2 | 0.5 | GO:0071387 | cellular response to cortisol stimulus(GO:0071387) |
| 0.2 | 0.9 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.2 | 0.5 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.2 | 0.2 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.2 | 0.9 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.2 | 1.2 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.2 | 0.7 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
| 0.2 | 0.5 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.2 | 0.5 | GO:0046833 | positive regulation of RNA export from nucleus(GO:0046833) |
| 0.2 | 0.3 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.2 | 4.1 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
| 0.2 | 0.7 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.2 | 2.4 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.2 | 0.5 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.2 | 0.8 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.2 | 0.3 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.2 | 0.5 | GO:0033306 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
| 0.2 | 0.5 | GO:0010266 | response to vitamin B1(GO:0010266) |
| 0.2 | 0.3 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.2 | 0.5 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.2 | 1.2 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.2 | 0.3 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.2 | 2.3 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 | 0.8 | GO:0009624 | response to nematode(GO:0009624) |
| 0.2 | 0.8 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.2 | 0.2 | GO:0002835 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) negative regulation of natural killer cell mediated immune response to tumor cell(GO:0002856) negative regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002859) |
| 0.2 | 0.5 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.2 | 0.7 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.2 | 0.3 | GO:0043060 | meiotic metaphase I plate congression(GO:0043060) |
| 0.2 | 0.3 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.2 | 2.3 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.2 | 0.7 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.2 | 0.5 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.2 | 0.2 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) |
| 0.2 | 1.6 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.2 | 0.8 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.2 | 0.3 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.2 | 0.5 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.2 | 0.5 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.2 | 0.2 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
| 0.2 | 1.1 | GO:0051583 | dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) |
| 0.2 | 0.5 | GO:0009609 | response to symbiotic bacterium(GO:0009609) |
| 0.2 | 3.7 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.2 | 0.5 | GO:1904995 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.2 | 0.2 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.2 | 1.0 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.2 | 0.2 | GO:0061517 | macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) |
| 0.2 | 0.2 | GO:0051231 | spindle elongation(GO:0051231) |
| 0.2 | 0.2 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.2 | 0.2 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
| 0.2 | 0.2 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
| 0.2 | 0.8 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.2 | 0.5 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.2 | 1.0 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.2 | 2.7 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.2 | 0.6 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.2 | 0.3 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.2 | 0.2 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.2 | 1.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.2 | 0.5 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.2 | 0.6 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.2 | 0.2 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.2 | 0.2 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.2 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.2 | 0.9 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.2 | 3.0 | GO:0030901 | midbrain development(GO:0030901) |
| 0.2 | 0.5 | GO:0098758 | response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.2 | 1.3 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.2 | 0.5 | GO:0002353 | kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
| 0.2 | 1.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.2 | 1.2 | GO:1901028 | regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901028) |
| 0.2 | 0.3 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.2 | 0.2 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.2 | 2.6 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.2 | 0.9 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.2 | 0.8 | GO:0002666 | positive regulation of T cell tolerance induction(GO:0002666) |
| 0.2 | 4.5 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.2 | 0.5 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.2 | 2.2 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.2 | 0.6 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.2 | 0.8 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.2 | 0.9 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.2 | 0.6 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.2 | 0.2 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.2 | 0.2 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 0.2 | 0.8 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.2 | 0.5 | GO:0009648 | photoperiodism(GO:0009648) |
| 0.2 | 0.5 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.2 | 0.3 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.2 | 0.3 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
| 0.2 | 0.2 | GO:0035927 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
| 0.2 | 0.5 | GO:0080144 | amino acid homeostasis(GO:0080144) |
| 0.2 | 1.2 | GO:0006692 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.2 | 0.2 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.1 | 2.8 | GO:0021696 | cerebellar cortex morphogenesis(GO:0021696) |
| 0.1 | 0.9 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 0.4 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.1 | 0.1 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.1 | 0.7 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.4 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 0.6 | GO:0097332 | response to antipsychotic drug(GO:0097332) |
| 0.1 | 2.7 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.1 | 0.6 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.1 | 0.3 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.1 | 0.1 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.1 | 1.8 | GO:0072575 | hepatocyte proliferation(GO:0072574) epithelial cell proliferation involved in liver morphogenesis(GO:0072575) |
| 0.1 | 1.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 0.3 | GO:0014908 | myotube differentiation involved in skeletal muscle regeneration(GO:0014908) |
| 0.1 | 1.3 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.1 | 0.6 | GO:0021930 | cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.1 | 0.6 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.1 | 1.3 | GO:0032831 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
| 0.1 | 0.7 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.1 | 0.3 | GO:0045606 | positive regulation of epidermal cell differentiation(GO:0045606) |
| 0.1 | 1.6 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.1 | 1.3 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.1 | 0.4 | GO:0098749 | cerebellar neuron development(GO:0098749) |
| 0.1 | 2.5 | GO:0045047 | protein targeting to ER(GO:0045047) |
| 0.1 | 0.4 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.6 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 0.6 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.4 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.1 | 0.1 | GO:1903430 | negative regulation of cell maturation(GO:1903430) |
| 0.1 | 0.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 1.0 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 | 0.3 | GO:0008215 | spermine metabolic process(GO:0008215) |
| 0.1 | 0.7 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
| 0.1 | 0.1 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.1 | 0.1 | GO:2000848 | positive regulation of corticosteroid hormone secretion(GO:2000848) |
| 0.1 | 1.0 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 | 0.9 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.1 | 2.3 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.1 | 0.6 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.1 | 0.3 | GO:0042322 | negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) |
| 0.1 | 0.4 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.1 | 0.1 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.1 | 0.3 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.1 | 0.8 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
| 0.1 | 0.3 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
| 0.1 | 0.4 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.1 | 0.3 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.1 | 0.6 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.1 | 0.7 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.8 | GO:0015816 | glycine transport(GO:0015816) |
| 0.1 | 0.4 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.1 | 0.3 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.1 | 0.4 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.1 | 0.3 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.1 | 1.6 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.1 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.1 | 3.3 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.1 | 0.4 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.1 | 1.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 2.0 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 | 0.5 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.1 | 0.3 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 0.1 | 0.9 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.1 | 0.3 | GO:0032632 | interleukin-3 production(GO:0032632) |
| 0.1 | 0.3 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.1 | 2.2 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.1 | 0.4 | GO:0006524 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.1 | 0.3 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.1 | 0.3 | GO:0071450 | cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
| 0.1 | 0.9 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.7 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.1 | 1.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.1 | 0.1 | GO:0016559 | peroxisome fission(GO:0016559) |
| 0.1 | 3.1 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
| 0.1 | 0.5 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.1 | 0.3 | GO:0072248 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.1 | 1.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.1 | 0.8 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.1 | 1.6 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 0.3 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.1 | 0.4 | GO:2001045 | negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.1 | 0.4 | GO:0015855 | pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.1 | 0.1 | GO:0035565 | regulation of pronephros size(GO:0035565) |
| 0.1 | 0.4 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.1 | 1.3 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 0.1 | GO:0071245 | cellular response to carbon monoxide(GO:0071245) |
| 0.1 | 0.5 | GO:0015746 | citrate transport(GO:0015746) |
| 0.1 | 0.6 | GO:0051926 | negative regulation of calcium ion transport(GO:0051926) |
| 0.1 | 0.5 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) |
| 0.1 | 0.9 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.1 | 0.3 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.1 | 0.8 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.1 | 0.1 | GO:0015965 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 | 0.5 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 1.0 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.1 | 2.1 | GO:0046697 | decidualization(GO:0046697) |
| 0.1 | 1.4 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 0.1 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.1 | 0.6 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
| 0.1 | 0.3 | GO:0089709 | histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) |
| 0.1 | 0.6 | GO:1901380 | negative regulation of potassium ion transmembrane transport(GO:1901380) |
| 0.1 | 1.7 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.1 | 1.0 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 | 0.1 | GO:0035696 | monocyte extravasation(GO:0035696) |
| 0.1 | 0.3 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.1 | 0.5 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.1 | 0.3 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.1 | 0.4 | GO:0007314 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
| 0.1 | 1.1 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.1 | 0.1 | GO:0071287 | cellular response to manganese ion(GO:0071287) |
| 0.1 | 0.5 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 | 0.1 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
| 0.1 | 0.5 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
| 0.1 | 0.2 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.1 | 0.6 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 | 1.1 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.1 | 0.4 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
| 0.1 | 0.4 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 0.5 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.1 | 0.5 | GO:0006901 | vesicle coating(GO:0006901) |
| 0.1 | 0.1 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.1 | 0.1 | GO:1904580 | regulation of intracellular mRNA localization(GO:1904580) |
| 0.1 | 0.2 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.1 | 0.2 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.1 | 0.7 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.1 | 1.0 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.1 | 0.2 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.1 | 0.1 | GO:1904383 | response to sodium phosphate(GO:1904383) |
| 0.1 | 0.2 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.1 | 0.7 | GO:0009445 | putrescine metabolic process(GO:0009445) putrescine biosynthetic process(GO:0009446) |
| 0.1 | 0.5 | GO:0071415 | cellular response to purine-containing compound(GO:0071415) |
| 0.1 | 0.1 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) |
| 0.1 | 0.4 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.1 | 0.2 | GO:0061311 | cell surface receptor signaling pathway involved in heart development(GO:0061311) |
| 0.1 | 0.4 | GO:0019303 | D-ribose catabolic process(GO:0019303) |
| 0.1 | 1.9 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.1 | 0.4 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.1 | 0.4 | GO:0015864 | pyrimidine nucleoside transport(GO:0015864) |
| 0.1 | 0.4 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.1 | 0.1 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.1 | 0.4 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 0.6 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 | 1.4 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.1 | 0.5 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.1 | 1.6 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 0.5 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.1 | 0.3 | GO:0009098 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.1 | 0.2 | GO:1901165 | regulation of trophoblast cell migration(GO:1901163) positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 | 0.1 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
| 0.1 | 0.3 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.1 | 0.1 | GO:2000041 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 0.1 | 1.7 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.1 | 0.2 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.1 | 2.5 | GO:0032094 | response to food(GO:0032094) |
| 0.1 | 0.7 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.1 | 0.9 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.1 | 3.1 | GO:1900027 | regulation of ruffle assembly(GO:1900027) |
| 0.1 | 1.1 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
| 0.1 | 0.6 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.1 | 0.8 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.2 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.1 | 0.7 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 | 0.2 | GO:0050942 | positive regulation of pigment cell differentiation(GO:0050942) |
| 0.1 | 0.4 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.1 | 0.1 | GO:0003099 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.1 | 0.2 | GO:0046149 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.1 | 0.3 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
| 0.1 | 0.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 1.0 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.1 | 0.7 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.1 | 1.2 | GO:0006734 | NADH metabolic process(GO:0006734) |
| 0.1 | 1.3 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 | 0.7 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.1 | 0.9 | GO:0070339 | response to bacterial lipopeptide(GO:0070339) cellular response to bacterial lipoprotein(GO:0071220) cellular response to bacterial lipopeptide(GO:0071221) response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
| 0.1 | 0.2 | GO:0060789 | hair follicle placode formation(GO:0060789) |
| 0.1 | 4.3 | GO:0042246 | tissue regeneration(GO:0042246) |
| 0.1 | 0.1 | GO:0061365 | positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.1 | 0.5 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.1 | 0.4 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.1 | 0.5 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
| 0.1 | 0.3 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.1 | 0.2 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.1 | 0.4 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
| 0.1 | 0.5 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.1 | 0.4 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.2 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.1 | 0.1 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.1 | 0.9 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 | 1.0 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 | 0.2 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.1 | 0.4 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.1 | 0.2 | GO:0007418 | ventral midline development(GO:0007418) |
| 0.1 | 0.4 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.1 | 0.1 | GO:0002866 | positive regulation of acute inflammatory response to antigenic stimulus(GO:0002866) |
| 0.1 | 0.3 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
| 0.1 | 0.3 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.1 | 0.3 | GO:1903445 | protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 | 0.2 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
| 0.1 | 0.4 | GO:0060347 | heart trabecula formation(GO:0060347) |
| 0.1 | 0.5 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) |
| 0.1 | 0.3 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.1 | 0.3 | GO:0010446 | response to alkaline pH(GO:0010446) cellular response to alkaline pH(GO:0071469) |
| 0.1 | 0.7 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 | 0.3 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 | 1.4 | GO:0007602 | phototransduction(GO:0007602) |
| 0.1 | 0.2 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.1 | GO:0009750 | response to fructose(GO:0009750) |
| 0.1 | 0.5 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.1 | 0.1 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.1 | 1.8 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.1 | 0.5 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
| 0.1 | 0.3 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.1 | 0.1 | GO:1904063 | negative regulation of cation transmembrane transport(GO:1904063) |
| 0.1 | 0.4 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 | 0.4 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 0.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.1 | 0.4 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 0.6 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.1 | 0.4 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.1 | 0.4 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.1 | 0.3 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.1 | 1.0 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 0.2 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.1 | 0.9 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.1 | 0.3 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 0.3 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.1 | 0.5 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.1 | 0.5 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.6 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.1 | 0.4 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 0.1 | 0.4 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 | 0.5 | GO:0045136 | development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 0.1 | 0.6 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 | 1.4 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.1 | 0.2 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.1 | 0.8 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.1 | 0.9 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.1 | 0.1 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.1 | 0.7 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.1 | 0.3 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 0.7 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.1 | 0.2 | GO:0060938 | cardiac fibroblast cell differentiation(GO:0060935) cardiac fibroblast cell development(GO:0060936) epicardium-derived cardiac fibroblast cell differentiation(GO:0060938) epicardium-derived cardiac fibroblast cell development(GO:0060939) |
| 0.1 | 0.3 | GO:0009822 | lipid hydroxylation(GO:0002933) alkaloid catabolic process(GO:0009822) |
| 0.1 | 0.6 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.1 | 0.4 | GO:1990774 | regulation of tumor necrosis factor secretion(GO:1904467) tumor necrosis factor secretion(GO:1990774) |
| 0.1 | 0.7 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 0.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 1.3 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.1 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.1 | 0.4 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.1 | 0.1 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.1 | 0.3 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.1 | 0.4 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.1 | 0.8 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.5 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.3 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.4 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.1 | 0.1 | GO:0070543 | response to linoleic acid(GO:0070543) |
| 0.1 | 0.2 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.1 | 0.4 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.7 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.1 | 0.6 | GO:0071377 | cellular response to glucagon stimulus(GO:0071377) |
| 0.1 | 0.6 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.1 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 0.3 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) establishment of planar polarity involved in neural tube closure(GO:0090177) |
| 0.1 | 0.8 | GO:0031498 | chromatin disassembly(GO:0031498) |
| 0.1 | 0.2 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.1 | 0.1 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
| 0.1 | 0.2 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 0.8 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.1 | 0.3 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.1 | 0.5 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.1 | 0.4 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.1 | 0.3 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.1 | 0.2 | GO:2000567 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.1 | 0.1 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
| 0.1 | 0.2 | GO:0006547 | histidine metabolic process(GO:0006547) histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.1 | 1.0 | GO:0032400 | melanosome localization(GO:0032400) |
| 0.1 | 0.2 | GO:1905168 | positive regulation of double-strand break repair via homologous recombination(GO:1905168) |
| 0.1 | 0.7 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.1 | 0.1 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
| 0.1 | 0.5 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
| 0.1 | 0.5 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 0.1 | 0.6 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.1 | 0.3 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.1 | 0.3 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.1 | 0.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.1 | 0.4 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 | 0.5 | GO:0072711 | cellular response to hydroxyurea(GO:0072711) |
| 0.1 | 0.6 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 | 0.3 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.1 | 1.6 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.1 | 0.3 | GO:0060720 | spongiotrophoblast cell proliferation(GO:0060720) cell proliferation involved in embryonic placenta development(GO:0060722) spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.1 | 0.4 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.1 | 0.4 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.1 | 2.5 | GO:0070527 | platelet aggregation(GO:0070527) |
| 0.1 | 0.8 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
| 0.1 | 0.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.1 | 0.3 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.1 | 0.4 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.1 | 0.5 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.1 | 1.0 | GO:0009584 | detection of visible light(GO:0009584) |
| 0.1 | 0.7 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 | 0.2 | GO:0021546 | rhombomere development(GO:0021546) |
| 0.1 | 0.2 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
| 0.1 | 0.2 | GO:0042670 | retinal cone cell differentiation(GO:0042670) |
| 0.1 | 0.2 | GO:0044146 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.1 | 0.6 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
| 0.1 | 0.1 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.1 | 0.2 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.1 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.1 | 1.1 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 0.2 | GO:0042168 | heme metabolic process(GO:0042168) |
| 0.1 | 0.2 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.1 | 0.2 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.1 | 0.4 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.1 | 0.9 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.2 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.1 | 0.2 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.1 | 0.1 | GO:0003192 | mitral valve formation(GO:0003192) |
| 0.1 | 5.8 | GO:0007601 | visual perception(GO:0007601) |
| 0.1 | 0.1 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 | 0.3 | GO:0042182 | ketone catabolic process(GO:0042182) |
| 0.1 | 0.2 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.1 | 0.2 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.1 | 0.1 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
| 0.1 | 0.2 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
| 0.1 | 1.0 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.1 | 2.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 1.5 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.1 | 1.9 | GO:1905144 | acetylcholine receptor signaling pathway(GO:0095500) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.1 | 0.8 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 | 0.1 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.1 | 0.5 | GO:0003360 | brainstem development(GO:0003360) |
| 0.1 | 0.1 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.1 | 0.2 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.1 | 0.2 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 | 0.3 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.6 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.1 | 0.5 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.1 | 0.3 | GO:0071107 | response to parathyroid hormone(GO:0071107) |
| 0.1 | 0.3 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.1 | 0.5 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.1 | 0.4 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
| 0.1 | 1.0 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.1 | 0.2 | GO:0009597 | detection of virus(GO:0009597) |
| 0.1 | 0.2 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.1 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.1 | 0.4 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.8 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.1 | 0.5 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.1 | 0.5 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.1 | 0.1 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
| 0.1 | 2.4 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.1 | 0.4 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.1 | 0.2 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.1 | 0.5 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.1 | 0.1 | GO:0019860 | uracil catabolic process(GO:0006212) uracil metabolic process(GO:0019860) |
| 0.1 | 0.1 | GO:1900426 | positive regulation of defense response to bacterium(GO:1900426) |
| 0.1 | 0.4 | GO:0019731 | antibacterial humoral response(GO:0019731) |
| 0.1 | 0.2 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
| 0.1 | 0.2 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.1 | 0.3 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.1 | 0.1 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.1 | 0.4 | GO:1902175 | regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902175) |
| 0.1 | 0.4 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.1 | 0.1 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.2 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.1 | 0.5 | GO:0002675 | positive regulation of acute inflammatory response(GO:0002675) |
| 0.1 | 0.2 | GO:0002420 | natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002420) natural killer cell mediated immune response to tumor cell(GO:0002423) regulation of natural killer cell mediated immune response to tumor cell(GO:0002855) regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002858) |
| 0.1 | 0.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 0.4 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 0.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 0.3 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 0.1 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.1 | 0.7 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 1.9 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 | 0.6 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.1 | 0.1 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.1 | 0.1 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
| 0.1 | 0.1 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.1 | 0.1 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
| 0.1 | 0.5 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
| 0.1 | 1.3 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
| 0.1 | 0.5 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.1 | 0.3 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.1 | 0.3 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.1 | 0.1 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.1 | 0.1 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.1 | 0.6 | GO:0034285 | response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.1 | 0.1 | GO:0035600 | tRNA methylthiolation(GO:0035600) |
| 0.1 | 1.9 | GO:0030816 | positive regulation of cAMP metabolic process(GO:0030816) |
| 0.1 | 0.2 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.1 | 0.1 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.1 | 0.2 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 0.1 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 | 0.1 | GO:1904579 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.1 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.1 | 1.0 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.1 | 0.3 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.8 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 3.3 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
| 0.1 | 0.2 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine diphosphate metabolic process(GO:0042357) thiamine-containing compound metabolic process(GO:0042723) |
| 0.1 | 0.2 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.1 | 0.1 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.1 | 0.3 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) |
| 0.1 | 0.3 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.1 | 0.2 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.1 | 0.3 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 | 0.1 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.1 | 0.8 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
| 0.1 | 0.1 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.1 | 0.1 | GO:0071350 | interleukin-15-mediated signaling pathway(GO:0035723) cellular response to interleukin-15(GO:0071350) |
| 0.1 | 0.2 | GO:1904044 | response to aldosterone(GO:1904044) |
| 0.1 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.1 | 0.1 | GO:0051189 | molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 | 0.7 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.1 | 0.2 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 0.3 | GO:0009251 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.1 | 0.1 | GO:1900164 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
| 0.1 | 0.4 | GO:0040036 | regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.1 | 0.7 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.1 | 0.3 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
| 0.1 | 0.8 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.1 | 0.3 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.1 | 0.3 | GO:0070723 | response to cholesterol(GO:0070723) |
| 0.1 | 0.3 | GO:0050925 | negative regulation of negative chemotaxis(GO:0050925) |
| 0.1 | 0.4 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.3 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.1 | GO:0070202 | regulation of establishment of protein localization to chromosome(GO:0070202) |
| 0.1 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.1 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.1 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.1 | 0.4 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.1 | 0.2 | GO:0046083 | adenine metabolic process(GO:0046083) |
| 0.1 | 0.5 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.1 | 0.1 | GO:1902884 | positive regulation of response to oxidative stress(GO:1902884) |
| 0.1 | 0.5 | GO:0071871 | response to epinephrine(GO:0071871) |
| 0.1 | 0.1 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
| 0.1 | 0.4 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.9 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.1 | 0.6 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.1 | 0.2 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) |
| 0.1 | 0.1 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
| 0.1 | 0.1 | GO:0010286 | heat acclimation(GO:0010286) |
| 0.1 | 1.3 | GO:0018149 | peptide cross-linking(GO:0018149) |
| 0.1 | 0.1 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
| 0.1 | 0.2 | GO:0006498 | N-terminal protein lipidation(GO:0006498) |
| 0.1 | 0.2 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
| 0.1 | 0.2 | GO:0007183 | SMAD protein complex assembly(GO:0007183) |
| 0.1 | 1.0 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.1 | 0.3 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.2 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.1 | 0.1 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
| 0.1 | 1.5 | GO:1904659 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.1 | 0.3 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.1 | 0.3 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.1 | 1.0 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 | 0.7 | GO:0009142 | nucleoside triphosphate biosynthetic process(GO:0009142) |
| 0.1 | 0.2 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.1 | 0.1 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.1 | 0.8 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.1 | 0.1 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.1 | 0.2 | GO:1990000 | amyloid fibril formation(GO:1990000) |
| 0.1 | 0.2 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.1 | 0.2 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.2 | GO:0032776 | DNA methylation on cytosine(GO:0032776) |
| 0.1 | 0.1 | GO:2000564 | regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 0.1 | 0.2 | GO:0042350 | GDP-L-fucose biosynthetic process(GO:0042350) |
| 0.1 | 0.1 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.1 | 0.9 | GO:0019068 | virion assembly(GO:0019068) |
| 0.1 | 0.1 | GO:0034769 | basement membrane disassembly(GO:0034769) |
| 0.1 | 0.1 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.1 | 0.1 | GO:1904975 | response to bleomycin(GO:1904975) |
| 0.1 | 0.2 | GO:0060613 | fat pad development(GO:0060613) |
| 0.1 | 0.1 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
| 0.1 | 0.2 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.1 | 0.2 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.1 | 0.2 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.1 | 0.4 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.1 | 0.2 | GO:0032472 | Golgi calcium ion transport(GO:0032472) |
| 0.1 | 0.5 | GO:1902235 | regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
| 0.1 | 0.2 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.1 | 0.1 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.1 | 0.1 | GO:0070433 | negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.1 | 1.5 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.1 | 0.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.0 | 0.3 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
| 0.0 | 0.1 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) polynucleotide 5' dephosphorylation(GO:0098507) |
| 0.0 | 0.1 | GO:0006596 | polyamine biosynthetic process(GO:0006596) |
| 0.0 | 1.1 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.0 | 0.0 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.0 | 0.4 | GO:0008210 | estrogen metabolic process(GO:0008210) |
| 0.0 | 0.1 | GO:0061081 | positive regulation of myeloid leukocyte cytokine production involved in immune response(GO:0061081) |
| 0.0 | 0.4 | GO:2000269 | regulation of fibroblast apoptotic process(GO:2000269) |
| 0.0 | 0.2 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.0 | 0.1 | GO:0036344 | platelet morphogenesis(GO:0036344) |
| 0.0 | 0.5 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 1.3 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.0 | 0.1 | GO:0071104 | response to interleukin-9(GO:0071104) |
| 0.0 | 0.0 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.0 | 0.1 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
| 0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.0 | 0.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.0 | 0.0 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.0 | 0.1 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.0 | 0.1 | GO:1904798 | regulation of core promoter binding(GO:1904796) positive regulation of core promoter binding(GO:1904798) |
| 0.0 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 | 0.2 | GO:0003159 | morphogenesis of an endothelium(GO:0003159) |
| 0.0 | 0.1 | GO:0000272 | polysaccharide catabolic process(GO:0000272) |
| 0.0 | 0.5 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.4 | GO:0002230 | positive regulation of defense response to virus by host(GO:0002230) |
| 0.0 | 0.2 | GO:1990918 | double-strand break repair involved in meiotic recombination(GO:1990918) |
| 0.0 | 0.4 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.0 | 0.6 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.0 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
| 0.0 | 1.0 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 1.0 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.4 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.0 | 0.6 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
| 0.0 | 0.3 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.0 | 0.0 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.0 | 0.2 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.0 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.0 | GO:0046865 | isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.0 | 3.7 | GO:0050907 | detection of chemical stimulus involved in sensory perception(GO:0050907) |
| 0.0 | 0.1 | GO:0031077 | post-embryonic camera-type eye development(GO:0031077) |
| 0.0 | 0.1 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.0 | 0.4 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
| 0.0 | 0.3 | GO:0018410 | C-terminal protein amino acid modification(GO:0018410) |
| 0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.0 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.0 | 0.5 | GO:2001243 | negative regulation of intrinsic apoptotic signaling pathway(GO:2001243) |
| 0.0 | 0.1 | GO:0042730 | fibrinolysis(GO:0042730) |
| 0.0 | 1.0 | GO:0006213 | pyrimidine nucleoside metabolic process(GO:0006213) |
| 0.0 | 0.0 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.0 | 0.2 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.3 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.0 | 0.3 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 0.0 | 0.2 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.0 | 0.1 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
| 0.0 | 0.1 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 1.1 | GO:0008637 | apoptotic mitochondrial changes(GO:0008637) |
| 0.0 | 0.1 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.0 | 0.0 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) |
| 0.0 | 0.2 | GO:0002021 | response to dietary excess(GO:0002021) |
| 0.0 | 0.6 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.0 | 1.9 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 | 0.2 | GO:0010447 | response to acidic pH(GO:0010447) |
| 0.0 | 0.4 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 | 2.4 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
| 0.0 | 0.6 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.0 | 2.0 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 1.2 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.1 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
| 0.0 | 0.2 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.6 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.4 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.1 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
| 0.0 | 0.0 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.0 | 0.2 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.0 | 0.1 | GO:1901070 | guanosine-containing compound biosynthetic process(GO:1901070) |
| 0.0 | 0.0 | GO:0042531 | regulation of tyrosine phosphorylation of STAT protein(GO:0042509) positive regulation of tyrosine phosphorylation of STAT protein(GO:0042531) |
| 0.0 | 1.7 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 | 0.3 | GO:0010039 | response to iron ion(GO:0010039) |
| 0.0 | 0.3 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.0 | 0.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.0 | 0.0 | GO:0043307 | eosinophil activation(GO:0043307) |
| 0.0 | 0.9 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.1 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.0 | 0.1 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 | 0.8 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.0 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
| 0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.0 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 1.1 | GO:0006414 | translational elongation(GO:0006414) |
| 0.0 | 0.2 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
| 0.0 | 0.1 | GO:0001911 | negative regulation of leukocyte mediated cytotoxicity(GO:0001911) |
| 0.0 | 0.5 | GO:0048662 | negative regulation of smooth muscle cell proliferation(GO:0048662) |
| 0.0 | 0.1 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
| 0.0 | 0.1 | GO:2000196 | positive regulation of female gonad development(GO:2000196) positive regulation of progesterone secretion(GO:2000872) |
| 0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.2 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.0 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.0 | 0.4 | GO:0018904 | glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
| 0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.1 | GO:0052428 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.0 | 0.1 | GO:0002396 | MHC protein complex assembly(GO:0002396) MHC class II protein complex assembly(GO:0002399) peptide antigen assembly with MHC protein complex(GO:0002501) peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 0.0 | 0.0 | GO:0046666 | retinal cell programmed cell death(GO:0046666) |
| 0.0 | 0.1 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.0 | 0.0 | GO:0043578 | nuclear matrix organization(GO:0043578) |
| 0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
| 0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.1 | GO:1904587 | response to glycoprotein(GO:1904587) |
| 0.0 | 0.2 | GO:0006907 | pinocytosis(GO:0006907) |
| 0.0 | 0.0 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
| 0.0 | 0.3 | GO:0052312 | modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) |
| 0.0 | 0.1 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.0 | 0.0 | GO:0046949 | fatty-acyl-CoA biosynthetic process(GO:0046949) |
| 0.0 | 0.2 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
| 0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.0 | 0.6 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.1 | GO:2000583 | regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
| 0.0 | 0.1 | GO:1901661 | quinone metabolic process(GO:1901661) |
| 0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 | 0.2 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.0 | 0.7 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.0 | 0.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.0 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.0 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.1 | GO:1990637 | response to prolactin(GO:1990637) |
| 0.0 | 0.2 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.0 | 0.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.0 | 0.1 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.0 | 2.8 | GO:0010466 | negative regulation of peptidase activity(GO:0010466) |
| 0.0 | 0.1 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
| 0.0 | 0.0 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
| 0.0 | 0.1 | GO:0002517 | T cell tolerance induction(GO:0002517) |
| 0.0 | 0.0 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
| 0.0 | 0.2 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.0 | 0.0 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.0 | 0.1 | GO:0097502 | mannosylation(GO:0097502) |
| 0.0 | 0.3 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.1 | GO:0033197 | response to vitamin E(GO:0033197) |
| 0.0 | 0.3 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.3 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 0.0 | GO:0010870 | positive regulation of receptor biosynthetic process(GO:0010870) |
| 0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 | 0.0 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.0 | 0.0 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.5 | GO:0030512 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) |
| 0.0 | 0.8 | GO:0007129 | synapsis(GO:0007129) |
| 0.0 | 0.9 | GO:0045727 | positive regulation of translation(GO:0045727) |
| 0.0 | 0.2 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.0 | 0.0 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.0 | 0.0 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.0 | 0.0 | GO:0006220 | pyrimidine nucleotide metabolic process(GO:0006220) |
| 0.0 | 0.1 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.0 | GO:0015755 | fructose transport(GO:0015755) |
| 0.0 | 0.2 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.2 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.0 | 0.0 | GO:0010737 | protein kinase A signaling(GO:0010737) |
| 0.0 | 0.1 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.0 | 0.1 | GO:0045337 | farnesyl diphosphate biosynthetic process(GO:0045337) |
| 0.0 | 0.3 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.0 | GO:0002638 | negative regulation of immunoglobulin production(GO:0002638) |
| 0.0 | 0.0 | GO:0001545 | primary ovarian follicle growth(GO:0001545) |
| 0.0 | 0.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.0 | 0.0 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.0 | 0.3 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 | 0.3 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
| 0.0 | 0.1 | GO:0045687 | positive regulation of glial cell differentiation(GO:0045687) |
| 0.0 | 0.0 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.0 | 0.1 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.0 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
| 0.0 | 0.2 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.0 | 0.1 | GO:0097531 | mast cell migration(GO:0097531) |
| 0.0 | 0.0 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.0 | 0.0 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
| 0.0 | 0.0 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.0 | 0.3 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.0 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.0 | 0.0 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.1 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 0.0 | 0.0 | GO:0034312 | diol biosynthetic process(GO:0034312) |
| 0.0 | 0.0 | GO:0002507 | tolerance induction(GO:0002507) |
| 0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.0 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) regulation of kinetochore assembly(GO:0090234) |
| 0.0 | 0.0 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.0 | 0.0 | GO:0045822 | negative regulation of heart contraction(GO:0045822) |
| 0.0 | 0.0 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 | 0.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 7.8 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 1.7 | 6.9 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.8 | 2.4 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.7 | 0.7 | GO:0032398 | MHC class Ib protein complex(GO:0032398) |
| 0.7 | 3.4 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.7 | 2.7 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.7 | 2.0 | GO:0097453 | mesaxon(GO:0097453) ensheathing process(GO:1990015) |
| 0.7 | 2.0 | GO:0032173 | septin collar(GO:0032173) |
| 0.6 | 1.8 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.6 | 3.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.6 | 1.8 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
| 0.6 | 3.0 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.6 | 0.6 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.6 | 1.7 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.5 | 1.1 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.5 | 2.7 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.5 | 1.6 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.5 | 3.5 | GO:0090543 | Flemming body(GO:0090543) |
| 0.5 | 5.2 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.5 | 1.4 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.4 | 1.3 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.4 | 2.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.4 | 2.4 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.4 | 4.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.4 | 3.3 | GO:0034709 | methylosome(GO:0034709) |
| 0.4 | 1.4 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.4 | 2.9 | GO:0005638 | lamin filament(GO:0005638) |
| 0.4 | 1.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.4 | 1.8 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.4 | 2.5 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.3 | 1.0 | GO:0005962 | mitochondrial isocitrate dehydrogenase complex (NAD+)(GO:0005962) isocitrate dehydrogenase complex (NAD+)(GO:0045242) |
| 0.3 | 1.4 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.3 | 0.7 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.3 | 4.4 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.3 | 2.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.3 | 2.6 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.3 | 3.6 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.3 | 5.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.3 | 1.3 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.3 | 0.3 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.3 | 2.2 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.3 | 0.9 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.3 | 3.4 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.3 | 0.9 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.3 | 2.4 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.3 | 1.8 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.3 | 3.0 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.3 | 1.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.3 | 0.9 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.3 | 1.2 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.3 | 2.0 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.3 | 3.4 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.3 | 14.3 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.3 | 0.6 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 0.3 | 0.8 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.3 | 3.0 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
| 0.3 | 1.6 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.3 | 2.7 | GO:0030891 | VCB complex(GO:0030891) |
| 0.3 | 2.5 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.3 | 0.3 | GO:1990257 | piccolo-bassoon transport vesicle(GO:1990257) |
| 0.3 | 0.8 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.3 | 1.6 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.3 | 1.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.3 | 3.7 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.3 | 0.3 | GO:0030430 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
| 0.3 | 8.6 | GO:0070469 | respiratory chain(GO:0070469) |
| 0.3 | 0.3 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.3 | 7.8 | GO:0005921 | gap junction(GO:0005921) |
| 0.3 | 0.5 | GO:0097413 | Lewy body(GO:0097413) |
| 0.3 | 1.0 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.3 | 1.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.3 | 1.0 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.2 | 1.0 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.2 | 1.0 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.2 | 7.2 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.2 | 1.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.2 | 2.9 | GO:0044754 | autolysosome(GO:0044754) |
| 0.2 | 2.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.2 | 2.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.2 | 1.4 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.2 | 1.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.2 | 1.6 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.2 | 0.7 | GO:0031904 | endosome lumen(GO:0031904) |
| 0.2 | 1.3 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.2 | 0.9 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.2 | 2.0 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.2 | 0.4 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.2 | 2.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.2 | 2.6 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.2 | 1.7 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.2 | 0.9 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.2 | 0.6 | GO:0014801 | longitudinal sarcoplasmic reticulum(GO:0014801) |
| 0.2 | 0.9 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.2 | 0.6 | GO:0042627 | chylomicron(GO:0042627) |
| 0.2 | 0.6 | GO:0008091 | spectrin(GO:0008091) |
| 0.2 | 0.8 | GO:0098574 | cytoplasmic side of lysosomal membrane(GO:0098574) |
| 0.2 | 0.8 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.2 | 1.7 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.2 | 2.3 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.2 | 0.6 | GO:0060187 | cell pole(GO:0060187) |
| 0.2 | 1.7 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.2 | 1.7 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.2 | 1.2 | GO:1990393 | 3M complex(GO:1990393) |
| 0.2 | 0.6 | GO:0034774 | secretory granule lumen(GO:0034774) |
| 0.2 | 0.8 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.2 | 0.8 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.2 | 1.4 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.2 | 1.0 | GO:0030478 | actin cap(GO:0030478) |
| 0.2 | 0.2 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.2 | 1.0 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.2 | 5.8 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.2 | 0.8 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.2 | 0.6 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.2 | 1.6 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.2 | 2.5 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.2 | 1.7 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.2 | 1.7 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.2 | 0.6 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.2 | 1.3 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.2 | 0.6 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.2 | 0.9 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.2 | 1.5 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.2 | 2.3 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.2 | 6.4 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.2 | 0.6 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.2 | 3.0 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.2 | 1.1 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.2 | 18.7 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.2 | 0.6 | GO:0031309 | intrinsic component of nuclear outer membrane(GO:0031308) integral component of nuclear outer membrane(GO:0031309) |
| 0.2 | 0.4 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.2 | 1.6 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.2 | 1.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.2 | 0.9 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 0.4 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.2 | 2.0 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.2 | 1.2 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
| 0.2 | 5.1 | GO:0030673 | axolemma(GO:0030673) |
| 0.2 | 1.1 | GO:0042599 | lamellar body(GO:0042599) |
| 0.2 | 0.5 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.2 | 1.0 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.2 | 1.5 | GO:0098651 | basement membrane collagen trimer(GO:0098651) |
| 0.2 | 1.0 | GO:0089701 | U2AF(GO:0089701) |
| 0.2 | 0.7 | GO:0097196 | Shu complex(GO:0097196) |
| 0.2 | 0.5 | GO:1990429 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
| 0.2 | 1.3 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.2 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.2 | 0.5 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.2 | 3.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.2 | 0.5 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.2 | 2.0 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.2 | 29.2 | GO:0043209 | myelin sheath(GO:0043209) |
| 0.2 | 1.3 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.2 | 0.5 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.2 | 0.5 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.2 | 0.5 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.2 | 1.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.2 | 0.5 | GO:0044299 | C-fiber(GO:0044299) |
| 0.2 | 5.2 | GO:0045178 | basal part of cell(GO:0045178) |
| 0.2 | 0.8 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.2 | 7.5 | GO:0030173 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
| 0.2 | 0.2 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.2 | 0.6 | GO:0031417 | NatC complex(GO:0031417) |
| 0.2 | 1.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.2 | 0.9 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.2 | 10.1 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.2 | 0.5 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.2 | 1.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.2 | 0.6 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.2 | 15.1 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.2 | 1.4 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.2 | 0.9 | GO:0097433 | dense body(GO:0097433) |
| 0.2 | 0.8 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.1 | 0.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 0.4 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.1 | 0.1 | GO:0031310 | integral component of vacuolar membrane(GO:0031166) intrinsic component of vacuolar membrane(GO:0031310) |
| 0.1 | 0.4 | GO:0098982 | glycine-gated chloride channel complex(GO:0016935) GABA-ergic synapse(GO:0098982) |
| 0.1 | 8.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.1 | 0.3 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.1 | 1.0 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.1 | 1.0 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.1 | 0.3 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.1 | 0.7 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.4 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.1 | 0.1 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 1.8 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.1 | 0.7 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 7.9 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 0.8 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 0.5 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.1 | 0.8 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 2.6 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| 0.1 | 1.3 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.5 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.1 | 0.3 | GO:0060205 | cytoplasmic membrane-bounded vesicle lumen(GO:0060205) |
| 0.1 | 0.5 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 0.8 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.1 | 0.3 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 0.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.1 | GO:0098871 | postsynaptic actin cytoskeleton(GO:0098871) postsynaptic cytoskeleton(GO:0099571) |
| 0.1 | 1.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 1.0 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.1 | 1.0 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 1.0 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 0.4 | GO:0005713 | recombination nodule(GO:0005713) |
| 0.1 | 3.6 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 0.5 | GO:0070938 | contractile ring(GO:0070938) |
| 0.1 | 1.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 0.6 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 7.7 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 0.6 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 0.4 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 3.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 0.4 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 1.9 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.1 | 0.8 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 1.2 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.5 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.1 | 1.8 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 0.3 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.1 | 1.7 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 2.4 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 0.3 | GO:0015935 | small ribosomal subunit(GO:0015935) |
| 0.1 | 0.3 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.1 | 0.7 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.1 | 2.8 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.1 | 0.6 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.1 | 6.2 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.8 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 2.4 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.4 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.1 | 1.6 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 1.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 0.6 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.1 | 0.3 | GO:0098802 | plasma membrane receptor complex(GO:0098802) |
| 0.1 | 0.8 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.1 | 4.0 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.1 | 0.2 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 1.7 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 0.1 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.1 | 5.3 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.1 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 2.5 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.1 | 0.5 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.1 | 0.6 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 0.6 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 1.8 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 1.9 | GO:0019028 | viral nucleocapsid(GO:0019013) viral capsid(GO:0019028) |
| 0.1 | 0.4 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.1 | 0.4 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.1 | 0.8 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 1.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 104.5 | GO:0005615 | extracellular space(GO:0005615) |
| 0.1 | 0.7 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.1 | 2.0 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.1 | 2.0 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.1 | 0.4 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.1 | 0.4 | GO:0071547 | piP-body(GO:0071547) |
| 0.1 | 1.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 0.3 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.1 | 1.0 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.1 | 0.7 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.1 | 0.5 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 1.7 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 1.1 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.1 | 0.3 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 1.3 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.1 | 0.2 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 0.5 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 0.2 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.1 | 0.4 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.1 | 0.8 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 0.4 | GO:0005858 | axonemal dynein complex(GO:0005858) |
| 0.1 | 0.6 | GO:0005605 | basal lamina(GO:0005605) |
| 0.1 | 0.2 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 2.8 | GO:0032420 | stereocilium(GO:0032420) |
| 0.1 | 0.1 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.1 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.1 | 1.1 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.1 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.1 | 0.4 | GO:0042581 | specific granule(GO:0042581) |
| 0.1 | 0.3 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 0.2 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.1 | 1.0 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 0.1 | GO:1990826 | nucleoplasmic periphery of the nuclear pore complex(GO:1990826) |
| 0.1 | 0.2 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 0.8 | GO:0044453 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
| 0.1 | 0.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 0.1 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 0.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.3 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.1 | 0.3 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.1 | 0.1 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.1 | 0.7 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.1 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.1 | 2.2 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 1.0 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 0.3 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.1 | 1.3 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.1 | 0.4 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.1 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 2.0 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.1 | 2.5 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.1 | 0.3 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 1.1 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.1 | 6.6 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.1 | 1.2 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 0.4 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.1 | 0.4 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 0.2 | GO:1903767 | sweet taste receptor complex(GO:1903767) taste receptor complex(GO:1903768) |
| 0.1 | 1.0 | GO:0031430 | M band(GO:0031430) |
| 0.1 | 0.2 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.1 | 0.4 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.1 | 0.5 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 3.7 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.1 | 0.1 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 10.4 | GO:0009986 | cell surface(GO:0009986) |
| 0.1 | 0.2 | GO:0098888 | extrinsic component of presynaptic membrane(GO:0098888) |
| 0.1 | 1.3 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 1.5 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.1 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.0 | 0.7 | GO:0005845 | mRNA cap binding complex(GO:0005845) |
| 0.0 | 2.4 | GO:0005840 | ribosome(GO:0005840) |
| 0.0 | 1.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.4 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.0 | 1.1 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.0 | 0.1 | GO:0031515 | tRNA (m1A) methyltransferase complex(GO:0031515) |
| 0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 0.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.0 | 0.3 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.0 | 0.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 8.9 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.5 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.7 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.3 | GO:0000791 | euchromatin(GO:0000791) |
| 0.0 | 0.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.7 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.3 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 3.2 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
| 0.0 | 2.1 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 0.2 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
| 0.0 | 2.5 | GO:0031301 | integral component of organelle membrane(GO:0031301) |
| 0.0 | 0.1 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.0 | 2.5 | GO:0032432 | actin filament bundle(GO:0032432) |
| 0.0 | 0.4 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 1.0 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.0 | 0.5 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.1 | GO:0042641 | actomyosin(GO:0042641) |
| 0.0 | 0.0 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.0 | 6.0 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
| 0.0 | 0.3 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 1.6 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 1.8 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.1 | GO:1990630 | IRE1-RACK1-PP2A complex(GO:1990630) |
| 0.0 | 0.3 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.4 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.0 | 65.5 | GO:0005576 | extracellular region(GO:0005576) |
| 0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.0 | 0.0 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.0 | 0.5 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.6 | GO:0005902 | microvillus(GO:0005902) |
| 0.0 | 0.0 | GO:0036452 | ESCRT complex(GO:0036452) |
| 0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.1 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 2.0 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.1 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 0.0 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 0.4 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.0 | 0.0 | GO:0070449 | elongin complex(GO:0070449) |
| 0.0 | 0.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.3 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 53.7 | GO:0016021 | integral component of membrane(GO:0016021) |
| 0.0 | 1.3 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.7 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.0 | 0.0 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.0 | 0.1 | GO:0019866 | organelle inner membrane(GO:0019866) |
| 0.0 | 0.2 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 0.0 | GO:0097361 | CIA complex(GO:0097361) |
| 0.0 | 0.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.7 | 8.0 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 2.1 | 6.2 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 1.6 | 4.8 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 1.2 | 3.7 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 1.1 | 3.4 | GO:0019807 | aspartoacylase activity(GO:0019807) |
| 1.0 | 3.0 | GO:0001565 | phorbol ester receptor activity(GO:0001565) |
| 1.0 | 4.8 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.9 | 3.6 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.9 | 2.6 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
| 0.9 | 3.5 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.8 | 4.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.8 | 3.2 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.8 | 3.9 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.8 | 19.6 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.7 | 2.2 | GO:0017168 | 5-oxoprolinase (ATP-hydrolyzing) activity(GO:0017168) |
| 0.7 | 2.2 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 0.7 | 2.1 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.7 | 1.4 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.7 | 2.0 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.7 | 2.6 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.6 | 1.9 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.6 | 1.9 | GO:0030977 | taurine binding(GO:0030977) |
| 0.6 | 2.5 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.6 | 3.8 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.6 | 1.9 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.6 | 1.7 | GO:0031249 | denatured protein binding(GO:0031249) |
| 0.6 | 1.7 | GO:0004807 | triose-phosphate isomerase activity(GO:0004807) |
| 0.6 | 1.7 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.5 | 1.6 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.5 | 1.6 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.5 | 2.7 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.5 | 0.5 | GO:0001605 | adrenomedullin receptor activity(GO:0001605) |
| 0.5 | 1.6 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.5 | 2.6 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.5 | 4.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.5 | 2.0 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
| 0.5 | 3.5 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.5 | 1.5 | GO:0070976 | TIR domain binding(GO:0070976) |
| 0.5 | 1.4 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.5 | 3.3 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.5 | 0.5 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.5 | 0.9 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.5 | 0.5 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.5 | 3.7 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.5 | 0.5 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) |
| 0.4 | 1.3 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.4 | 8.8 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.4 | 6.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.4 | 1.7 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.4 | 1.7 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.4 | 2.6 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.4 | 3.4 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.4 | 0.9 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.4 | 0.8 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.4 | 2.1 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.4 | 1.7 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.4 | 1.7 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.4 | 2.5 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.4 | 2.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.4 | 0.8 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.4 | 1.2 | GO:0047025 | 3-oxoacyl-[acyl-carrier-protein] reductase (NADH) activity(GO:0047025) |
| 0.4 | 2.0 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.4 | 1.2 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.4 | 1.2 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.4 | 1.9 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.4 | 0.4 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.4 | 0.4 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.4 | 2.6 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.4 | 4.8 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.4 | 1.8 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.4 | 2.2 | GO:0046790 | virion binding(GO:0046790) |
| 0.4 | 1.1 | GO:0004918 | interleukin-8 receptor activity(GO:0004918) |
| 0.4 | 1.4 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.4 | 1.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.4 | 1.1 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.4 | 2.1 | GO:0070697 | activin receptor binding(GO:0070697) |
| 0.4 | 1.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.4 | 1.1 | GO:0098603 | selenol Se-methyltransferase activity(GO:0098603) |
| 0.3 | 4.2 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.3 | 1.0 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.3 | 2.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 0.3 | 3.1 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.3 | 1.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.3 | 0.3 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.3 | 1.0 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.3 | 1.3 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.3 | 1.0 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.3 | 1.0 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.3 | 6.0 | GO:0031005 | filamin binding(GO:0031005) |
| 0.3 | 0.6 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.3 | 0.9 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.3 | 2.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.3 | 1.6 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.3 | 0.9 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.3 | 1.2 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.3 | 1.8 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.3 | 0.9 | GO:0008481 | sphinganine kinase activity(GO:0008481) |
| 0.3 | 5.5 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
| 0.3 | 3.9 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.3 | 0.9 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.3 | 0.9 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.3 | 3.0 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.3 | 0.3 | GO:0016453 | C-acetyltransferase activity(GO:0016453) |
| 0.3 | 2.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.3 | 6.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.3 | 0.3 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.3 | 0.9 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.3 | 2.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.3 | 1.8 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.3 | 2.4 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.3 | 1.2 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.3 | 3.8 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.3 | 1.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.3 | 2.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.3 | 0.9 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.3 | 0.9 | GO:0046592 | polyamine oxidase activity(GO:0046592) |
| 0.3 | 1.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.3 | 1.4 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.3 | 0.6 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.3 | 2.2 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.3 | 1.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.3 | 0.6 | GO:0004096 | catalase activity(GO:0004096) |
| 0.3 | 0.5 | GO:0005163 | nerve growth factor receptor binding(GO:0005163) |
| 0.3 | 1.4 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.3 | 0.8 | GO:0034618 | arginine binding(GO:0034618) |
| 0.3 | 0.8 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.3 | 1.1 | GO:0042806 | fucose binding(GO:0042806) |
| 0.3 | 0.8 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.3 | 1.1 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.3 | 7.3 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.3 | 0.8 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.3 | 0.3 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.3 | 1.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.3 | 5.1 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.3 | 1.3 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.3 | 1.1 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.3 | 0.8 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.3 | 0.8 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.3 | 0.8 | GO:0036478 | tyrosine 3-monooxygenase activator activity(GO:0036470) L-dopa decarboxylase activator activity(GO:0036478) |
| 0.3 | 0.8 | GO:0070404 | NADH binding(GO:0070404) |
| 0.3 | 0.5 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
| 0.3 | 0.5 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.3 | 1.3 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.3 | 1.3 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.3 | 2.0 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.3 | 1.0 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 0.3 | 1.0 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.3 | 0.8 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.3 | 0.8 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.3 | 0.3 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.3 | 1.0 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.3 | 1.8 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.2 | 0.7 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.2 | 0.7 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.2 | 0.5 | GO:0033265 | choline binding(GO:0033265) |
| 0.2 | 1.0 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.2 | 2.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.2 | 0.5 | GO:0008670 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) |
| 0.2 | 0.2 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.2 | 1.9 | GO:0008430 | selenium binding(GO:0008430) |
| 0.2 | 1.0 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.2 | 0.7 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.2 | 1.0 | GO:0035473 | lipase binding(GO:0035473) |
| 0.2 | 1.4 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.2 | 2.1 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.2 | 1.4 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.2 | 0.2 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.2 | 0.5 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.2 | 6.8 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.2 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.2 | 1.9 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.2 | 0.9 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.2 | 0.9 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.2 | 1.9 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.2 | 0.7 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.2 | 1.2 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.2 | 6.5 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.2 | 0.9 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.2 | 0.9 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
| 0.2 | 2.1 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.2 | 1.6 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.2 | 2.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.2 | 2.1 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.2 | 1.6 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.2 | 0.9 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.2 | 0.9 | GO:0050610 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.2 | 0.9 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.2 | 1.3 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.2 | 2.5 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.2 | 0.2 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.2 | 1.8 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.2 | 1.3 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.2 | 2.9 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.2 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.2 | 0.9 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.2 | 0.6 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.2 | 0.6 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
| 0.2 | 4.4 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.2 | 1.3 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
| 0.2 | 0.6 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.2 | 1.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.2 | 0.8 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.2 | 0.6 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.2 | 4.1 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.2 | 1.2 | GO:0046978 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 0.2 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.2 | 0.6 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.2 | 0.8 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.2 | 2.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.2 | 1.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.2 | 1.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.2 | 1.0 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.2 | 0.6 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.2 | 0.4 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.2 | 0.8 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.2 | 1.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.2 | 9.9 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.2 | 0.4 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.2 | 3.1 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.2 | 0.6 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.2 | 0.6 | GO:0016492 | G-protein coupled neurotensin receptor activity(GO:0016492) |
| 0.2 | 1.1 | GO:0070728 | leucine binding(GO:0070728) |
| 0.2 | 0.6 | GO:0004946 | bombesin receptor activity(GO:0004946) |
| 0.2 | 1.3 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.2 | 0.4 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.2 | 4.3 | GO:0005112 | Notch binding(GO:0005112) |
| 0.2 | 0.8 | GO:0004368 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) |
| 0.2 | 0.6 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.2 | 3.2 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.2 | 0.2 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.2 | 0.4 | GO:0034512 | box C/D snoRNA binding(GO:0034512) |
| 0.2 | 0.6 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.2 | 0.7 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.2 | 0.7 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.2 | 1.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.2 | 0.6 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.2 | 1.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.2 | 5.0 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.2 | 13.8 | GO:0005179 | hormone activity(GO:0005179) |
| 0.2 | 0.7 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.2 | 0.7 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.2 | 1.8 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.2 | 0.5 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.2 | 1.4 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.2 | 2.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.2 | 0.5 | GO:0015389 | pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
| 0.2 | 1.8 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.2 | 0.5 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.2 | 0.9 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.2 | 0.7 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.2 | 0.7 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
| 0.2 | 1.0 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.2 | 0.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.2 | 1.6 | GO:0019841 | retinol binding(GO:0019841) |
| 0.2 | 0.7 | GO:0008940 | nitrate reductase activity(GO:0008940) |
| 0.2 | 0.7 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.2 | 0.5 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.2 | 0.8 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.2 | 0.5 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.2 | 2.0 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.2 | 0.5 | GO:0004736 | pyruvate carboxylase activity(GO:0004736) |
| 0.2 | 0.2 | GO:0030547 | receptor inhibitor activity(GO:0030547) |
| 0.2 | 0.5 | GO:0004655 | porphobilinogen synthase activity(GO:0004655) |
| 0.2 | 1.3 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.2 | 2.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.2 | 0.5 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.2 | 0.8 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.2 | 0.5 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
| 0.2 | 0.5 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.2 | 0.5 | GO:0016657 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.2 | 0.8 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.2 | 0.2 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.2 | 1.1 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.2 | 0.5 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.2 | 5.3 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.2 | 1.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.2 | 0.5 | GO:0017113 | uracil binding(GO:0002058) pyrimidine nucleobase binding(GO:0002061) dihydrouracil dehydrogenase (NAD+) activity(GO:0004159) dihydropyrimidine dehydrogenase (NADP+) activity(GO:0017113) |
| 0.2 | 0.6 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.2 | 0.5 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.2 | 0.6 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.2 | 0.5 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.2 | 0.2 | GO:0015556 | C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
| 0.2 | 1.9 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.2 | 0.8 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.2 | 1.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.2 | 0.3 | GO:0019825 | oxygen binding(GO:0019825) |
| 0.2 | 4.2 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.2 | 2.0 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 0.2 | 7.2 | GO:0070888 | E-box binding(GO:0070888) |
| 0.2 | 0.9 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.2 | 0.9 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.2 | 0.3 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.2 | 0.6 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.2 | 0.3 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.2 | 6.8 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.2 | 0.8 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.2 | 0.9 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.2 | 2.1 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.2 | 5.0 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.2 | 0.3 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.2 | 0.5 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.2 | 1.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.2 | 0.3 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.1 | 0.6 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.1 | 36.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 2.2 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.1 | 0.6 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.1 | 1.7 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.1 | 0.6 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.1 | 0.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.1 | 0.6 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.1 | 1.7 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 2.7 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 1.0 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.1 | 0.6 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 2.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 1.8 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 2.1 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.1 | 2.2 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.1 | 1.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.1 | 3.8 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.1 | 3.4 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.1 | 1.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 0.4 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.1 | 1.8 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.1 | 1.4 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.1 | 1.0 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.1 | 1.1 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.1 | 0.4 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
| 0.1 | 2.1 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
| 0.1 | 0.4 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.1 | 0.5 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 1.3 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.1 | 0.5 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) |
| 0.1 | 9.0 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.1 | 1.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.1 | 0.4 | GO:0008254 | 3'-nucleotidase activity(GO:0008254) |
| 0.1 | 1.3 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.1 | 0.5 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 0.3 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.3 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 0.7 | GO:0008106 | alcohol dehydrogenase (NADP+) activity(GO:0008106) |
| 0.1 | 0.5 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.1 | 1.0 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 1.7 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.1 | 1.8 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.1 | 0.5 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.1 | 0.5 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.1 | 0.5 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) |
| 0.1 | 3.9 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.1 | 0.4 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.1 | 0.5 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 0.8 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.1 | 0.5 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.1 | 1.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 0.4 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.1 | 0.3 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
| 0.1 | 0.5 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 4.6 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.1 | 0.5 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 0.2 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.1 | 0.9 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 0.2 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
| 0.1 | 1.0 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.5 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.1 | 0.4 | GO:0031714 | C5a anaphylatoxin chemotactic receptor binding(GO:0031714) |
| 0.1 | 0.4 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.1 | 0.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 1.0 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.1 | 0.4 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 0.7 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 0.5 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.1 | 2.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.2 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.1 | 1.6 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.1 | 1.6 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
| 0.1 | 0.5 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 0.5 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.1 | 4.6 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.1 | 0.4 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
| 0.1 | 4.7 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.6 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.6 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 7.8 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
| 0.1 | 1.0 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.1 | 2.2 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.1 | 0.6 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
| 0.1 | 0.5 | GO:0004903 | growth hormone receptor activity(GO:0004903) |
| 0.1 | 0.3 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 1.5 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.1 | 1.3 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 0.6 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 0.3 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.1 | 3.6 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.1 | 2.4 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.1 | 0.5 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.1 | 0.3 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.1 | 0.9 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.1 | 0.4 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.3 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 2.0 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 0.3 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.1 | 1.0 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 0.8 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 1.0 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.3 | GO:0004335 | galactokinase activity(GO:0004335) |
| 0.1 | 0.3 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
| 0.1 | 1.7 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 2.6 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.1 | 0.7 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.5 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.3 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.1 | 0.3 | GO:0070905 | serine binding(GO:0070905) |
| 0.1 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 1.0 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
| 0.1 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 0.3 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.1 | 0.8 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
| 0.1 | 0.8 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.1 | 0.3 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.5 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.1 | 0.4 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) |
| 0.1 | 0.9 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.1 | 0.5 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.4 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.1 | 3.2 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.1 | 6.8 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.1 | 1.0 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.6 | GO:0035326 | enhancer binding(GO:0035326) |
| 0.1 | 0.4 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.1 | 0.9 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.1 | 0.7 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.1 | 1.0 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 0.5 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.1 | 0.5 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.1 | 0.3 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.1 | 0.7 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.1 | 1.0 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.1 | 0.4 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.1 | 0.7 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.1 | 0.1 | GO:0030283 | testosterone dehydrogenase [NAD(P)] activity(GO:0030283) |
| 0.1 | 0.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.1 | 1.6 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.1 | 0.9 | GO:0051766 | inositol trisphosphate kinase activity(GO:0051766) |
| 0.1 | 0.6 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.1 | 6.3 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.1 | 0.4 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.1 | 1.3 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.1 | 0.6 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.1 | 0.9 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.1 | 0.2 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.1 | 0.3 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.1 | 2.0 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.1 | 0.4 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 0.8 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.3 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.1 | 0.8 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.1 | 1.1 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 0.3 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.1 | 1.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.1 | 0.4 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.1 | 0.3 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 1.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 0.2 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.1 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 0.3 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.2 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.1 | 1.8 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.1 | 0.6 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 0.4 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.1 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 0.2 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.1 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.1 | 0.1 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.1 | 0.2 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.1 | 0.6 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.1 | 0.9 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 0.5 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.1 | 0.5 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.1 | 0.3 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.1 | 0.5 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.3 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.1 | 1.1 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 0.3 | GO:0008265 | Mo-molybdopterin cofactor sulfurase activity(GO:0008265) |
| 0.1 | 0.5 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 2.2 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 1.7 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 2.3 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.1 | 0.7 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.1 | 0.3 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.4 | GO:0004962 | endothelin receptor activity(GO:0004962) |
| 0.1 | 1.2 | GO:0016503 | pheromone receptor activity(GO:0016503) |
| 0.1 | 0.8 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.4 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
| 0.1 | 1.5 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
| 0.1 | 0.2 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.1 | 0.3 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.1 | 0.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.1 | 1.3 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.1 | 2.1 | GO:0015149 | hexose transmembrane transporter activity(GO:0015149) |
| 0.1 | 0.8 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.1 | 0.2 | GO:0003842 | 1-pyrroline-5-carboxylate dehydrogenase activity(GO:0003842) |
| 0.1 | 0.9 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.1 | 0.2 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.1 | 0.1 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.1 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.1 | 0.6 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.3 | GO:0001637 | G-protein coupled chemoattractant receptor activity(GO:0001637) |
| 0.1 | 0.6 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.6 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.1 | 0.3 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.1 | 2.1 | GO:0038024 | cargo receptor activity(GO:0038024) |
| 0.1 | 0.4 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 0.4 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 0.5 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 0.2 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 0.3 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
| 0.1 | 0.2 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 0.1 | GO:1904315 | transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.1 | 0.4 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.1 | 0.3 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 1.4 | GO:0016209 | antioxidant activity(GO:0016209) |
| 0.1 | 0.5 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 0.6 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.1 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.2 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.1 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.1 | 0.9 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 1.4 | GO:0005549 | odorant binding(GO:0005549) |
| 0.1 | 2.3 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.1 | 1.4 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.1 | 0.1 | GO:0031404 | chloride ion binding(GO:0031404) |
| 0.1 | 0.3 | GO:0001729 | ceramide kinase activity(GO:0001729) |
| 0.1 | 0.2 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.1 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.1 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.1 | 0.7 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.1 | 14.8 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.1 | 0.2 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 0.2 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 2.6 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.1 | 0.1 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 0.2 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.1 | 0.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 1.3 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.1 | 0.3 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 4.6 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.1 | 1.9 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 7.8 | GO:0008236 | serine-type peptidase activity(GO:0008236) |
| 0.1 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.1 | 0.6 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
| 0.1 | 0.2 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 0.6 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.1 | 0.2 | GO:0016885 | CoA carboxylase activity(GO:0016421) ligase activity, forming carbon-carbon bonds(GO:0016885) |
| 0.1 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.1 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.2 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 0.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 0.5 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.1 | 0.3 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) |
| 0.1 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 0.2 | GO:0019798 | procollagen-proline 3-dioxygenase activity(GO:0019797) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.1 | 5.6 | GO:0005525 | GTP binding(GO:0005525) |
| 0.1 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 0.4 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.1 | 0.3 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.1 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 0.9 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 1.1 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 2.3 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.0 | 0.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.3 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 0.5 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.0 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.2 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
| 0.0 | 0.1 | GO:0035596 | methylthiotransferase activity(GO:0035596) transferase activity, transferring alkylthio groups(GO:0050497) |
| 0.0 | 0.7 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.0 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.0 | 0.3 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.6 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.0 | 0.1 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.0 | 1.9 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.0 | 0.1 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.3 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.0 | 0.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.3 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
| 0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.0 | 0.2 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.0 | 0.2 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.6 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 0.0 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.0 | 1.8 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:0016429 | tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.0 | 0.0 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 0.4 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.5 | GO:0009975 | cyclase activity(GO:0009975) |
| 0.0 | 0.2 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.0 | 0.3 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
| 0.0 | 0.5 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 0.2 | GO:0001155 | TFIIIA-class transcription factor binding(GO:0001155) |
| 0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.7 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.3 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.1 | GO:0003921 | GMP synthase activity(GO:0003921) GMP synthase (glutamine-hydrolyzing) activity(GO:0003922) |
| 0.0 | 0.3 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.1 | GO:0036122 | BMP binding(GO:0036122) |
| 0.0 | 2.3 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.0 | 0.4 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.2 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.1 | GO:0004779 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.0 | 0.3 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.2 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 2.2 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.6 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 0.2 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.0 | 0.3 | GO:0019864 | IgG binding(GO:0019864) |
| 0.0 | 0.2 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.2 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.0 | GO:0008252 | nucleotidase activity(GO:0008252) |
| 0.0 | 0.1 | GO:0047619 | acylcarnitine hydrolase activity(GO:0047619) |
| 0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.1 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.0 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
| 0.0 | 0.0 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.0 | 0.2 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.0 | 0.1 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.4 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
| 0.0 | 0.0 | GO:1990763 | arrestin family protein binding(GO:1990763) |
| 0.0 | 1.2 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.3 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.0 | 0.0 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.0 | 0.1 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.1 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 0.3 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.5 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.0 | 0.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.9 | GO:0008083 | growth factor activity(GO:0008083) |
| 0.0 | 0.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.1 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.4 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.0 | 0.2 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.3 | GO:0015250 | water channel activity(GO:0015250) |
| 0.0 | 0.1 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.0 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.0 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.0 | 0.0 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
| 0.0 | 0.0 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 0.0 | 0.1 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.0 | 1.0 | GO:0030674 | protein binding, bridging(GO:0030674) |
| 0.0 | 0.5 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.0 | 0.1 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.0 | 0.1 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.0 | GO:0001007 | transcription factor activity, RNA polymerase III transcription factor binding(GO:0001007) |
| 0.0 | 0.6 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.0 | 1.3 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.2 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.1 | GO:0000703 | oxidized pyrimidine nucleobase lesion DNA N-glycosylase activity(GO:0000703) |
| 0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 12.3 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
| 0.0 | 0.1 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.0 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 1.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.0 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.0 | 0.0 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
| 0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.3 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 0.0 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
| 0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.0 | GO:0102390 | mycophenolic acid acyl-glucuronide esterase activity(GO:0102390) |
| 0.0 | 0.0 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) |
| 0.0 | 0.1 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.0 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.2 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 0.0 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 0.0 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 1.8 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.6 | 1.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.3 | 7.3 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.3 | 1.6 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.3 | 2.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.3 | 1.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.2 | 7.5 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.2 | 16.5 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.2 | 8.6 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.2 | 2.6 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.2 | 1.8 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.2 | 2.7 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.2 | 1.9 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.2 | 1.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.2 | 2.9 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.2 | 0.9 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.2 | 0.3 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.2 | 10.2 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.2 | 45.2 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.2 | 2.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.2 | 0.3 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.2 | 0.8 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.2 | 2.1 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.2 | 2.7 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.2 | 8.3 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.1 | 3.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.1 | 2.5 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.1 | 1.9 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.1 | 3.7 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 2.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.1 | 1.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 2.9 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.1 | 1.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 1.8 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 1.0 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.1 | 2.8 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 1.3 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.1 | 0.5 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.1 | 1.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 1.5 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 2.0 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.1 | 5.3 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.1 | 1.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.1 | 0.6 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 0.7 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.1 | 1.8 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.1 | 2.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.1 | 2.2 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 1.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.1 | 2.7 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.1 | 1.0 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 1.7 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 3.1 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 0.6 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.1 | 11.4 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.1 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 0.4 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 13.7 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
| 0.1 | 2.3 | PID BMP PATHWAY | BMP receptor signaling |
| 0.1 | 1.8 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.1 | 2.3 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.1 | 1.6 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.1 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.1 | 1.0 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 0.3 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 0.3 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 3.0 | PID P73PATHWAY | p73 transcription factor network |
| 0.1 | 1.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.1 | 1.4 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.1 | 3.6 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.1 | 2.3 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.1 | 1.4 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.1 | 0.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 10.7 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.1 | 0.6 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 0.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 0.7 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 0.8 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.1 | 2.3 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.1 | 0.4 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.1 | 0.4 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 0.3 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 1.3 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.1 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 2.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 3.2 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 1.5 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.2 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.3 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.4 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.2 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.4 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.5 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.0 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 0.4 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.5 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 0.3 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 0.6 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.5 | 9.7 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.4 | 1.5 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.4 | 6.9 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.4 | 0.7 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.4 | 9.9 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.3 | 10.0 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.3 | 0.3 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.3 | 5.5 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.3 | 4.5 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.3 | 0.6 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.3 | 0.9 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.3 | 19.9 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.3 | 2.9 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.3 | 5.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.3 | 4.8 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.3 | 5.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.3 | 4.1 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.3 | 4.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.3 | 0.3 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.3 | 2.9 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.3 | 2.6 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.3 | 0.5 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.3 | 1.8 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.3 | 2.0 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.3 | 2.3 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.2 | 7.9 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.2 | 3.6 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.2 | 7.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.2 | 1.0 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.2 | 15.1 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.2 | 0.5 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
| 0.2 | 1.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.2 | 0.2 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.2 | 0.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.2 | 0.9 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.2 | 1.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.2 | 1.5 | REACTOME OPSINS | Genes involved in Opsins |
| 0.2 | 3.2 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.2 | 7.7 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.2 | 3.5 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.2 | 32.8 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.2 | 0.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.2 | 1.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.2 | 19.8 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.2 | 2.4 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.2 | 8.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.2 | 2.9 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.2 | 0.8 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.2 | 3.6 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.2 | 0.9 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.2 | 0.9 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.2 | 3.0 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.2 | 3.0 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.2 | 1.9 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.2 | 2.4 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.2 | 1.7 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.2 | 3.8 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.2 | 2.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.2 | 2.6 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.2 | 2.7 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.2 | 3.0 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.2 | 2.6 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.2 | 1.5 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.2 | 0.8 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.2 | 1.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.2 | 4.8 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.2 | 2.7 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.2 | 0.2 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
| 0.2 | 0.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.2 | 1.7 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.2 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.2 | 2.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.2 | 1.6 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.2 | 0.5 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.2 | 2.8 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 0.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 1.0 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.1 | 13.4 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.1 | 2.3 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 3.1 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.1 | 11.6 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.1 | 3.8 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.1 | 1.7 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.1 | 2.9 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.1 | 1.8 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 0.3 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.1 | 1.7 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 0.1 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.1 | 2.5 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 3.0 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 1.8 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 2.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 1.7 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 1.6 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.1 | 0.4 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.1 | 0.8 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.1 | 1.4 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.1 | 1.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 1.4 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 0.7 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 0.8 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 0.1 | 0.3 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 0.3 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.1 | 0.5 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 1.6 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.1 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 2.1 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 1.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 0.9 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 4.0 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.1 | 1.0 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 1.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.1 | 1.7 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 1.1 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 1.2 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.1 | 0.4 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
| 0.1 | 0.7 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.1 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.1 | 0.6 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.1 | 2.6 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.1 | 1.5 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 1.3 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 1.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.1 | 0.6 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.1 | 1.8 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.1 | 0.3 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 0.7 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.1 | 1.0 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.1 | 0.3 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.1 | 1.0 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 0.9 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.1 | 1.3 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.1 | 0.7 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 0.5 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.1 | 1.0 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.1 | 0.3 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 0.2 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.1 | 1.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.1 | 2.8 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.1 | 2.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 2.1 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 0.7 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 0.3 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
| 0.1 | 1.4 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.1 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 4.2 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.1 | 0.6 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.1 | 1.5 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.1 | 0.2 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.1 | 0.8 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.6 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 4.3 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 1.4 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 1.1 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.7 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 1.9 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.1 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.0 | 0.2 | REACTOME HIV INFECTION | Genes involved in HIV Infection |
| 0.0 | 0.4 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.4 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.4 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.1 | REACTOME DEFENSINS | Genes involved in Defensins |
| 0.0 | 0.3 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.3 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.0 | 2.2 | REACTOME CLASS A1 RHODOPSIN LIKE RECEPTORS | Genes involved in Class A/1 (Rhodopsin-like receptors) |
| 0.0 | 0.4 | REACTOME FATTY ACID TRIACYLGLYCEROL AND KETONE BODY METABOLISM | Genes involved in Fatty acid, triacylglycerol, and ketone body metabolism |
| 0.0 | 2.9 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.5 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.3 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 0.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.7 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.1 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.0 | 0.8 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.3 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.6 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.5 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 2.1 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 3.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.7 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 1.4 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.7 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.3 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.0 | 0.0 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
| 0.0 | 0.0 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.0 | 0.2 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.2 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.0 | 0.3 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |