GSE49485: Hypoxia transcriptome sequencing of rat brain.
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Klf4
|
ENSRNOG00000016299 | Kruppel like factor 4 |
|
Sp3
|
ENSRNOG00000060479 | Sp3 transcription factor |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Sp3 | rn6_v1_chr3_-_59688692_59688692 | -0.84 | 7.5e-02 | Click! |
| Klf4 | rn6_v1_chr5_-_72287669_72287669 | 0.56 | 3.3e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr19_+_20607507 | 5.52 |
ENSRNOT00000000011
|
Cbln1
|
cerebellin 1 precursor |
| chr7_-_70842405 | 3.64 |
ENSRNOT00000047449
|
Nxph4
|
neurexophilin 4 |
| chr16_-_8685529 | 3.31 |
ENSRNOT00000092751
|
Slc18a3
|
solute carrier family 18 member A3 |
| chr1_-_78212350 | 2.99 |
ENSRNOT00000071098
|
Inafm1
|
InaF-motif containing 1 |
| chr1_-_216663720 | 2.70 |
ENSRNOT00000078944
ENSRNOT00000077409 |
Cdkn1c
|
cyclin-dependent kinase inhibitor 1C |
| chr7_+_120580743 | 2.64 |
ENSRNOT00000017181
|
Maff
|
MAF bZIP transcription factor F |
| chr19_+_16415636 | 2.07 |
ENSRNOT00000089975
|
Irx5
|
iroquois homeobox 5 |
| chr6_+_33885495 | 2.02 |
ENSRNOT00000086633
|
Sdc1
|
syndecan 1 |
| chr1_+_166893734 | 1.87 |
ENSRNOT00000026702
|
Phox2a
|
paired-like homeobox 2a |
| chr20_-_14282873 | 1.81 |
ENSRNOT00000001759
|
Adora2a
|
adenosine A2a receptor |
| chr13_-_50499060 | 1.76 |
ENSRNOT00000065347
ENSRNOT00000076924 |
Etnk2
|
ethanolamine kinase 2 |
| chr3_+_171037957 | 1.75 |
ENSRNOT00000008764
|
Rbm38
|
RNA binding motif protein 38 |
| chr20_+_14095914 | 1.75 |
ENSRNOT00000093404
|
Gucd1
|
guanylyl cyclase domain containing 1 |
| chr6_+_43001948 | 1.70 |
ENSRNOT00000007374
|
Hpcal1
|
hippocalcin-like 1 |
| chr12_-_18540166 | 1.70 |
ENSRNOT00000001792
|
Il3ra
|
interleukin 3 receptor subunit alpha |
| chr10_+_89376530 | 1.70 |
ENSRNOT00000028089
|
Rnd2
|
Rho family GTPase 2 |
| chr8_+_53678777 | 1.68 |
ENSRNOT00000045944
|
Drd2
|
dopamine receptor D2 |
| chr16_-_20890949 | 1.65 |
ENSRNOT00000081977
|
Homer3
|
homer scaffolding protein 3 |
| chr14_-_82055290 | 1.62 |
ENSRNOT00000058062
|
RGD1560394
|
RGD1560394 |
| chr19_-_37427989 | 1.61 |
ENSRNOT00000022863
|
Tppp3
|
tubulin polymerization-promoting protein family member 3 |
| chr4_-_123510217 | 1.57 |
ENSRNOT00000080734
|
Slc41a3
|
solute carrier family 41, member 3 |
| chr10_+_15088935 | 1.57 |
ENSRNOT00000030273
|
Gng13
|
G protein subunit gamma 13 |
| chr19_+_52647070 | 1.56 |
ENSRNOT00000068389
ENSRNOT00000087857 |
Crispld2
|
cysteine-rich secretory protein LCCL domain containing 2 |
| chr4_-_100883038 | 1.55 |
ENSRNOT00000041880
|
LOC100364435
|
thymosin, beta 10-like |
| chr2_-_164126783 | 1.55 |
ENSRNOT00000016843
|
Shox2
|
short stature homeobox 2 |
| chr10_+_4719713 | 1.54 |
ENSRNOT00000003412
|
Litaf
|
lipopolysaccharide-induced TNF factor |
| chr1_-_226501920 | 1.54 |
ENSRNOT00000050716
|
Lrrc10b
|
leucine rich repeat containing 10B |
| chr4_+_100407658 | 1.53 |
ENSRNOT00000018562
|
Capg
|
capping actin protein, gelsolin like |
| chr10_-_56962161 | 1.52 |
ENSRNOT00000026038
|
Alox15
|
arachidonate 15-lipoxygenase |
| chr12_-_38995570 | 1.50 |
ENSRNOT00000001806
|
Orai1
|
ORAI calcium release-activated calcium modulator 1 |
| chr17_+_76002275 | 1.47 |
ENSRNOT00000092665
ENSRNOT00000086701 |
Echdc3
|
enoyl CoA hydratase domain containing 3 |
| chr2_-_202816562 | 1.46 |
ENSRNOT00000020401
|
Fam46c
|
family with sequence similarity 46, member C |
| chr3_+_94035905 | 1.46 |
ENSRNOT00000014767
|
RGD1563222
|
similar to RIKEN cDNA A930018P22 |
| chr20_-_56197025 | 1.44 |
ENSRNOT00000073028
|
Cd99
|
CD99 molecule |
| chr2_-_195908037 | 1.44 |
ENSRNOT00000079776
|
Tuft1
|
tuftelin 1 |
| chr9_-_82146874 | 1.43 |
ENSRNOT00000024190
|
Fev
|
FEV, ETS transcription factor |
| chr11_+_87204175 | 1.43 |
ENSRNOT00000000306
|
Slc25a1
|
solute carrier family 25 member 1 |
| chr1_-_64099277 | 1.42 |
ENSRNOT00000084846
|
Tsen34
|
tRNA splicing endonuclease subunit 34 |
| chr1_+_211732713 | 1.42 |
ENSRNOT00000054890
|
Inpp5a
|
inositol polyphosphate-5-phosphatase A |
| chr1_+_33910912 | 1.40 |
ENSRNOT00000044690
|
Irx1
|
iroquois homeobox 1 |
| chr6_+_51662224 | 1.39 |
ENSRNOT00000060006
|
Ccdc71l
|
coiled-coil domain containing 71-like |
| chr3_+_151032952 | 1.38 |
ENSRNOT00000064013
|
Acss2
|
acyl-CoA synthetase short-chain family member 2 |
| chr1_+_220806473 | 1.37 |
ENSRNOT00000027869
|
Bles03
|
basophilic leukemia expressed protein BLES03 |
| chr6_+_129538982 | 1.36 |
ENSRNOT00000083626
ENSRNOT00000082522 |
Ak7
|
adenylate kinase 7 |
| chr13_+_52588917 | 1.36 |
ENSRNOT00000011999
|
Phlda3
|
pleckstrin homology-like domain, family A, member 3 |
| chr14_-_1461543 | 1.34 |
ENSRNOT00000075656
|
Crlf2
|
cytokine receptor-like factor 2 |
| chr17_+_78793336 | 1.34 |
ENSRNOT00000057898
|
Mt1
|
metallothionein 1 |
| chr16_+_20352480 | 1.33 |
ENSRNOT00000025956
|
Arrdc2
|
arrestin domain containing 2 |
| chr18_+_65814026 | 1.33 |
ENSRNOT00000016112
|
Mbd2
|
methyl-CpG binding domain protein 2 |
| chr5_-_156734541 | 1.31 |
ENSRNOT00000021036
|
LOC100909857
|
cytidine deaminase-like |
| chr1_+_198690794 | 1.30 |
ENSRNOT00000023999
|
Zfp771
|
zinc finger protein 771 |
| chr10_-_88670430 | 1.30 |
ENSRNOT00000025547
|
Hcrt
|
hypocretin neuropeptide precursor |
| chr4_+_148782479 | 1.30 |
ENSRNOT00000018133
|
LOC500300
|
similar to hypothetical protein MGC6835 |
| chr3_-_14538241 | 1.29 |
ENSRNOT00000025904
|
Stom
|
stomatin |
| chr20_-_29511382 | 1.29 |
ENSRNOT00000085026
|
Ddit4
|
DNA-damage-inducible transcript 4 |
| chr1_-_190965115 | 1.28 |
ENSRNOT00000023483
|
AC103221.1
|
|
| chr3_-_80842916 | 1.26 |
ENSRNOT00000033978
|
Mdk
|
midkine |
| chr19_+_55669626 | 1.24 |
ENSRNOT00000033352
|
Cdh15
|
cadherin 15 |
| chr1_+_261229347 | 1.23 |
ENSRNOT00000018485
|
Ubtd1
|
ubiquitin domain containing 1 |
| chr1_-_80666566 | 1.20 |
ENSRNOT00000082125
ENSRNOT00000025388 |
Nectin2
|
nectin cell adhesion molecule 2 |
| chr1_-_64030175 | 1.20 |
ENSRNOT00000089950
|
Tsen34l1
|
tRNA splicing endonuclease subunit 34-like 1 |
| chr7_+_122700854 | 1.19 |
ENSRNOT00000086603
|
Rbx1
|
ring-box 1 |
| chr12_+_47698947 | 1.19 |
ENSRNOT00000001586
|
Trpv4
|
transient receptor potential cation channel, subfamily V, member 4 |
| chr5_-_142845116 | 1.18 |
ENSRNOT00000065105
|
RGD1559909
|
RGD1559909 |
| chr1_+_88686731 | 1.18 |
ENSRNOT00000028222
|
Polr2i
|
RNA polymerase II subunit I |
| chr7_-_107775712 | 1.18 |
ENSRNOT00000010811
ENSRNOT00000093459 |
Ndrg1
|
N-myc downstream regulated 1 |
| chr10_+_7041510 | 1.18 |
ENSRNOT00000003514
|
Carhsp1
|
calcium regulated heat stable protein 1 |
| chr5_-_57267002 | 1.16 |
ENSRNOT00000011455
|
Bag1
|
Bcl2 associated athanogene 1 |
| chr16_-_20486707 | 1.15 |
ENSRNOT00000026470
|
Jund
|
JunD proto-oncogene, AP-1 transcription factor subunit |
| chr1_+_175445088 | 1.15 |
ENSRNOT00000036718
|
Adm
|
adrenomedullin |
| chr7_-_11754508 | 1.13 |
ENSRNOT00000026341
|
Oaz1
|
ornithine decarboxylase antizyme 1 |
| chr1_-_24190896 | 1.12 |
ENSRNOT00000016121
|
Sgk1
|
serum/glucocorticoid regulated kinase 1 |
| chr16_-_8564379 | 1.11 |
ENSRNOT00000060975
|
LOC680885
|
hypothetical protein LOC680885 |
| chr1_-_220806433 | 1.11 |
ENSRNOT00000038138
|
Drap1
|
Dr1 associated protein 1 |
| chr15_-_61873406 | 1.10 |
ENSRNOT00000045115
|
LOC100360244
|
LRRGT00053-like |
| chr12_-_50383496 | 1.10 |
ENSRNOT00000000831
|
Tpst2
|
tyrosylprotein sulfotransferase 2 |
| chrX_+_157095937 | 1.09 |
ENSRNOT00000091792
|
Bcap31
|
B-cell receptor-associated protein 31 |
| chr4_-_71763679 | 1.08 |
ENSRNOT00000024037
|
Epha1
|
Eph receptor A1 |
| chr4_-_150244372 | 1.08 |
ENSRNOT00000047685
|
Ret
|
ret proto-oncogene |
| chr10_+_14828597 | 1.07 |
ENSRNOT00000025434
|
Tekt4
|
tektin 4 |
| chr4_-_147163467 | 1.07 |
ENSRNOT00000010748
|
Timp4
|
tissue inhibitor of metalloproteinase 4 |
| chr5_+_151413382 | 1.06 |
ENSRNOT00000012626
|
Cd164l2
|
CD164 molecule like 2 |
| chr6_-_109004598 | 1.06 |
ENSRNOT00000007790
|
Pgf
|
placental growth factor |
| chr14_+_86922223 | 1.05 |
ENSRNOT00000086468
|
Ramp3
|
receptor activity modifying protein 3 |
| chr6_-_108415093 | 1.04 |
ENSRNOT00000031650
|
Syndig1l
|
synapse differentiation inducing 1-like |
| chr1_+_36320461 | 1.04 |
ENSRNOT00000023659
|
Srd5a1
|
steroid 5 alpha-reductase 1 |
| chr8_-_117353672 | 1.03 |
ENSRNOT00000027262
|
Ndufaf3
|
NADH:ubiquinone oxidoreductase complex assembly factor 3 |
| chr19_+_37476095 | 1.02 |
ENSRNOT00000092794
ENSRNOT00000023130 |
Hsd11b2
|
hydroxysteroid 11-beta dehydrogenase 2 |
| chr20_+_5050327 | 1.02 |
ENSRNOT00000083353
|
Ddah2
|
dimethylarginine dimethylaminohydrolase 2 |
| chr1_-_33275540 | 1.02 |
ENSRNOT00000017019
|
Irx2
|
iroquois homeobox 2 |
| chr9_-_17698569 | 1.01 |
ENSRNOT00000087528
|
Mrpl14
|
mitochondrial ribosomal protein L14 |
| chr7_+_13062196 | 1.01 |
ENSRNOT00000000193
|
Plpp2
|
phospholipid phosphatase 2 |
| chr13_-_102643223 | 1.01 |
ENSRNOT00000003155
|
Hlx
|
H2.0-like homeobox |
| chr5_-_151709877 | 1.01 |
ENSRNOT00000080602
|
Trnp1
|
TMF1-regulated nuclear protein 1 |
| chr5_+_147714163 | 1.01 |
ENSRNOT00000012663
|
Marcksl1
|
MARCKS-like 1 |
| chr10_-_14613878 | 1.00 |
ENSRNOT00000024072
|
Baiap3
|
BAI1-associated protein 3 |
| chr8_+_55178289 | 1.00 |
ENSRNOT00000059127
|
Cryab
|
crystallin, alpha B |
| chr10_-_91047177 | 0.98 |
ENSRNOT00000003986
|
C1ql1
|
complement C1q like 1 |
| chrX_-_32355296 | 0.98 |
ENSRNOT00000081652
ENSRNOT00000065075 |
Ap1s2
|
adaptor-related protein complex 1, sigma 2 subunit |
| chr1_+_84256159 | 0.98 |
ENSRNOT00000031026
|
Blvrb
|
biliverdin reductase B |
| chr5_-_152122542 | 0.98 |
ENSRNOT00000068634
ENSRNOT00000077248 |
Rps6ka1
|
ribosomal protein S6 kinase A1 |
| chr15_-_55277713 | 0.97 |
ENSRNOT00000023037
|
Itm2b
|
integral membrane protein 2B |
| chr3_+_151553578 | 0.97 |
ENSRNOT00000045484
|
Ergic3
|
ERGIC and golgi 3 |
| chr5_+_154522119 | 0.95 |
ENSRNOT00000072618
|
E2f2
|
E2F transcription factor 2 |
| chr1_-_83990588 | 0.95 |
ENSRNOT00000002052
|
Rab4b
|
RAB4B, member RAS oncogene family |
| chr1_-_87221826 | 0.95 |
ENSRNOT00000046611
ENSRNOT00000028006 |
Spint2
|
serine peptidase inhibitor, Kunitz type, 2 |
| chr1_-_88193346 | 0.95 |
ENSRNOT00000078600
|
LOC103690068
|
immortalization up-regulated protein-like |
| chr1_+_274245184 | 0.95 |
ENSRNOT00000018889
|
Dusp5
|
dual specificity phosphatase 5 |
| chr8_+_94243372 | 0.94 |
ENSRNOT00000012864
|
Rwdd2a
|
RWD domain containing 2A |
| chr1_+_213577122 | 0.94 |
ENSRNOT00000071925
|
RGD1309350
|
similar to transthyretin (4L369) |
| chr14_+_83752393 | 0.94 |
ENSRNOT00000081123
|
Selenom
|
selenoprotein M |
| chr1_-_107373807 | 0.92 |
ENSRNOT00000056024
|
Svip
|
small VCP interacting protein |
| chr1_+_88182585 | 0.92 |
ENSRNOT00000044145
|
Yif1b
|
Yip1 interacting factor homolog B, membrane trafficking protein |
| chr8_+_67753279 | 0.91 |
ENSRNOT00000009716
|
Calml4
|
calmodulin-like 4 |
| chr1_+_168957460 | 0.91 |
ENSRNOT00000090745
|
LOC103694857
|
hemoglobin subunit beta-2 |
| chr1_-_47213749 | 0.90 |
ENSRNOT00000024656
|
Dynlt1
|
dynein light chain Tctex-type 1 |
| chr6_-_59950586 | 0.90 |
ENSRNOT00000005800
|
Arl4a
|
ADP-ribosylation factor like GTPase 4A |
| chr8_+_99977334 | 0.89 |
ENSRNOT00000085808
ENSRNOT00000056704 ENSRNOT00000041859 |
Plod2
|
procollagen lysine, 2-oxoglutarate 5-dioxygenase 2 |
| chr15_+_24153602 | 0.89 |
ENSRNOT00000014216
|
Lgals3
|
galectin 3 |
| chr10_+_74871523 | 0.89 |
ENSRNOT00000076995
ENSRNOT00000076026 ENSRNOT00000088581 ENSRNOT00000076701 |
Sept4
|
septin 4 |
| chr19_+_52521809 | 0.89 |
ENSRNOT00000081019
|
Klhl36
|
kelch-like family member 36 |
| chr10_-_56403188 | 0.88 |
ENSRNOT00000019947
|
Chrnb1
|
cholinergic receptor nicotinic beta 1 subunit |
| chr12_+_48481750 | 0.88 |
ENSRNOT00000000886
|
Coro1c
|
coronin 1C |
| chr8_-_23000455 | 0.88 |
ENSRNOT00000091027
ENSRNOT00000017493 |
Rgl3
|
ral guanine nucleotide dissociation stimulator-like 3 |
| chr3_+_150323116 | 0.88 |
ENSRNOT00000023429
ENSRNOT00000080485 |
Raly
|
RALY heterogeneous nuclear ribonucleoprotein |
| chr13_-_95943761 | 0.88 |
ENSRNOT00000005961
|
Adss
|
adenylosuccinate synthase |
| chr5_-_152987211 | 0.88 |
ENSRNOT00000000163
|
Ldlrap1
|
low density lipoprotein receptor adaptor protein 1 |
| chr9_-_113331319 | 0.88 |
ENSRNOT00000020681
|
Vapa
|
VAMP associated protein A |
| chr10_-_109891879 | 0.88 |
ENSRNOT00000077930
|
Cenpx
|
centromere protein X |
| chr9_-_16612136 | 0.87 |
ENSRNOT00000023495
|
Mea1
|
male-enhanced antigen 1 |
| chr7_+_117304742 | 0.87 |
ENSRNOT00000059599
|
Grina
|
glutamate ionotropic receptor NMDA type subunit associated protein 1 |
| chr10_-_38782419 | 0.87 |
ENSRNOT00000073964
|
Uqcrq
|
ubiquinol-cytochrome c reductase, complex III subunit VII |
| chr13_+_111870121 | 0.87 |
ENSRNOT00000007333
|
Irf6
|
interferon regulatory factor 6 |
| chr5_+_141560192 | 0.87 |
ENSRNOT00000023354
|
Mycbp
|
Myc binding protein |
| chr7_+_12314848 | 0.86 |
ENSRNOT00000028969
|
Gamt
|
guanidinoacetate N-methyltransferase |
| chr12_-_22478752 | 0.86 |
ENSRNOT00000089392
ENSRNOT00000086915 |
Ache
|
acetylcholinesterase |
| chr18_-_28454756 | 0.86 |
ENSRNOT00000040091
|
Spata24
|
spermatogenesis associated 24 |
| chr10_-_90356242 | 0.86 |
ENSRNOT00000028496
|
Slc25a39
|
solute carrier family 25, member 39 |
| chr5_-_166726794 | 0.85 |
ENSRNOT00000022799
|
Slc25a33
|
solute carrier family 25 member 33 |
| chr16_-_10726648 | 0.85 |
ENSRNOT00000080635
ENSRNOT00000087150 |
Sncg
|
synuclein, gamma |
| chr8_-_130491998 | 0.85 |
ENSRNOT00000064114
|
Higd1a
|
HIG1 hypoxia inducible domain family, member 1A |
| chr1_+_163445527 | 0.84 |
ENSRNOT00000020520
|
Lrrc32
|
leucine rich repeat containing 32 |
| chr12_+_52637000 | 0.84 |
ENSRNOT00000063905
|
Gtpbp6
|
GTP binding protein 6 (putative) |
| chr8_+_53678994 | 0.84 |
ENSRNOT00000083419
|
Drd2
|
dopamine receptor D2 |
| chr1_+_91042635 | 0.84 |
ENSRNOT00000028211
|
LOC103690005
|
tubulin-folding cofactor B |
| chr16_+_36116258 | 0.83 |
ENSRNOT00000017652
|
Sap30
|
Sin3A associated protein 30 |
| chr20_+_30690810 | 0.83 |
ENSRNOT00000000687
|
Pcbd1
|
pterin-4 alpha-carbinolamine dehydratase 1 |
| chr10_+_13836128 | 0.83 |
ENSRNOT00000012720
|
Pgp
|
phosphoglycolate phosphatase |
| chr5_+_136112417 | 0.82 |
ENSRNOT00000025990
|
Tmem53
|
transmembrane protein 53 |
| chr10_-_89374516 | 0.82 |
ENSRNOT00000028084
|
Vat1
|
vesicle amine transport 1 |
| chr11_+_32655616 | 0.82 |
ENSRNOT00000084412
ENSRNOT00000034383 |
Clic6
|
chloride intracellular channel 6 |
| chr1_+_31967978 | 0.82 |
ENSRNOT00000081471
ENSRNOT00000021532 |
Trip13
|
thyroid hormone receptor interactor 13 |
| chr13_-_93746994 | 0.82 |
ENSRNOT00000005072
|
Opn3
|
opsin 3 |
| chr14_-_83776863 | 0.81 |
ENSRNOT00000026481
|
Smtn
|
smoothelin |
| chr20_+_5049496 | 0.81 |
ENSRNOT00000088251
ENSRNOT00000001118 |
Ddah2
|
dimethylarginine dimethylaminohydrolase 2 |
| chr3_+_113415774 | 0.81 |
ENSRNOT00000056151
|
Serf2
|
small EDRK-rich factor 2 |
| chr7_+_120153184 | 0.80 |
ENSRNOT00000013538
|
Lgals1
|
galectin 1 |
| chr20_-_7930929 | 0.80 |
ENSRNOT00000000607
|
Tead3
|
TEA domain transcription factor 3 |
| chr16_+_49462889 | 0.80 |
ENSRNOT00000039909
|
Ankrd37
|
ankyrin repeat domain 37 |
| chr14_+_83724933 | 0.80 |
ENSRNOT00000029848
|
Pla2g3
|
phospholipase A2, group III |
| chr5_+_138154673 | 0.79 |
ENSRNOT00000064452
|
Slc2a1
|
solute carrier family 2 member 1 |
| chr10_+_103396155 | 0.79 |
ENSRNOT00000086924
|
Gprc5c
|
G protein-coupled receptor, class C, group 5, member C |
| chr5_-_148392689 | 0.79 |
ENSRNOT00000018464
ENSRNOT00000080166 |
Tinagl1
|
tubulointerstitial nephritis antigen-like 1 |
| chr5_-_136762986 | 0.79 |
ENSRNOT00000026852
|
Artn
|
artemin |
| chr6_-_43493816 | 0.79 |
ENSRNOT00000077786
|
Ywhaq
|
tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, theta |
| chr1_-_221281180 | 0.78 |
ENSRNOT00000028379
|
Cdc42ep2
|
CDC42 effector protein 2 |
| chr10_+_59529785 | 0.78 |
ENSRNOT00000064840
ENSRNOT00000065181 |
Atp2a3
|
ATPase sarcoplasmic/endoplasmic reticulum Ca2+ transporting 3 |
| chr10_-_13168217 | 0.78 |
ENSRNOT00000087768
|
Elob
|
elongin B |
| chr5_+_126856705 | 0.78 |
ENSRNOT00000057362
|
Hspb11
|
heat shock protein family B (small), member 11 |
| chr3_+_164424515 | 0.78 |
ENSRNOT00000083876
|
Cebpb
|
CCAAT/enhancer binding protein beta |
| chr6_-_6842758 | 0.78 |
ENSRNOT00000006094
|
Kcng3
|
potassium voltage-gated channel modifier subfamily G member 3 |
| chr1_-_226526959 | 0.78 |
ENSRNOT00000028003
|
Ppp1r32
|
protein phosphatase 1, regulatory subunit 32 |
| chr11_+_32211115 | 0.78 |
ENSRNOT00000087452
|
Mrps6
|
mitochondrial ribosomal protein S6 |
| chr1_-_168972725 | 0.78 |
ENSRNOT00000090422
|
Hbb
|
hemoglobin subunit beta |
| chr8_-_48726963 | 0.78 |
ENSRNOT00000016145
|
Trappc4
|
trafficking protein particle complex 4 |
| chr9_+_92435896 | 0.78 |
ENSRNOT00000022901
|
Fbxo36
|
F-box protein 36 |
| chr11_+_89008008 | 0.78 |
ENSRNOT00000074586
|
Cebpd
|
CCAAT/enhancer binding protein delta |
| chr1_+_267607416 | 0.77 |
ENSRNOT00000087894
ENSRNOT00000076367 ENSRNOT00000016851 |
Gsto2
Gsto1
|
glutathione S-transferase omega 2 glutathione S-transferase omega 1 |
| chr14_+_70164650 | 0.77 |
ENSRNOT00000004385
|
Qdpr
|
quinoid dihydropteridine reductase |
| chr12_+_15890170 | 0.77 |
ENSRNOT00000001654
|
Gna12
|
G protein subunit alpha 12 |
| chr13_-_78852160 | 0.77 |
ENSRNOT00000039082
ENSRNOT00000076514 |
Zbtb37
|
zinc finger and BTB domain containing 37 |
| chr7_+_143629455 | 0.77 |
ENSRNOT00000073951
|
Krt18
|
keratin 18 |
| chr1_-_88686615 | 0.77 |
ENSRNOT00000070921
|
Tbcb
|
tubulin folding cofactor B |
| chr10_-_15200117 | 0.77 |
ENSRNOT00000026921
|
Stub1
|
STIP1 homology and U-box containing protein 1 |
| chr10_+_14105750 | 0.76 |
ENSRNOT00000090552
|
Msrb1
|
methionine sulfoxide reductase B1 |
| chr13_+_104284660 | 0.76 |
ENSRNOT00000005400
|
Dusp10
|
dual specificity phosphatase 10 |
| chr10_-_97756521 | 0.76 |
ENSRNOT00000045902
|
Slc16a6
|
solute carrier family 16, member 6 |
| chr14_-_10395047 | 0.76 |
ENSRNOT00000002936
|
Gpat3
|
glycerol-3-phosphate acyltransferase 3 |
| chr12_+_17736287 | 0.76 |
ENSRNOT00000091476
|
Pdgfa
|
platelet derived growth factor subunit A |
| chr7_-_34406318 | 0.76 |
ENSRNOT00000007331
|
Amdhd1
|
amidohydrolase domain containing 1 |
| chr14_+_86673775 | 0.75 |
ENSRNOT00000091873
ENSRNOT00000079015 |
Ppia
|
peptidylprolyl isomerase A |
| chr6_-_26497328 | 0.75 |
ENSRNOT00000074938
|
Nrbp1
|
nuclear receptor binding protein 1 |
| chr18_+_61490031 | 0.75 |
ENSRNOT00000022958
|
Sec11c
|
SEC11 homolog C, signal peptidase complex subunit |
| chr20_+_13670066 | 0.75 |
ENSRNOT00000031400
|
LOC103694874
|
stromelysin-3 |
| chr2_-_187668677 | 0.75 |
ENSRNOT00000056898
ENSRNOT00000092563 |
Tsacc
|
TSSK6 activating co-chaperone |
| chr16_+_69048730 | 0.75 |
ENSRNOT00000086082
ENSRNOT00000078128 |
Rab11fip1
|
RAB11 family interacting protein 1 |
| chr16_+_48863418 | 0.74 |
ENSRNOT00000029868
|
Primpol
|
primase and DNA directed polymerase |
| chr1_+_72732668 | 0.74 |
ENSRNOT00000024251
|
Hspbp1
|
HSPA (heat shock 70) binding protein, cytoplasmic cochaperone 1 |
| chr14_-_85191557 | 0.74 |
ENSRNOT00000011604
|
Nefh
|
neurofilament heavy |
| chr5_-_169017295 | 0.74 |
ENSRNOT00000067481
|
Camta1
|
calmodulin binding transcription activator 1 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.9 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.7 | 2.7 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.6 | 1.9 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.6 | 1.9 | GO:0021558 | trochlear nerve development(GO:0021558) |
| 0.6 | 2.4 | GO:0072268 | specification of loop of Henle identity(GO:0072086) pattern specification involved in metanephros development(GO:0072268) |
| 0.6 | 2.3 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.6 | 1.7 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.6 | 2.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.5 | 1.5 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.5 | 0.5 | GO:0031583 | phospholipase D-activating G-protein coupled receptor signaling pathway(GO:0031583) |
| 0.5 | 2.4 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.5 | 1.4 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.5 | 5.9 | GO:1901374 | acetate ester transport(GO:1901374) |
| 0.4 | 1.3 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 0.4 | 1.3 | GO:0060683 | regulation of branching involved in salivary gland morphogenesis by epithelial-mesenchymal signaling(GO:0060683) embryonic lung development(GO:1990401) |
| 0.4 | 1.3 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.4 | 0.4 | GO:0009153 | purine deoxyribonucleotide biosynthetic process(GO:0009153) |
| 0.4 | 1.2 | GO:0018201 | peptidyl-glycine modification(GO:0018201) |
| 0.4 | 1.2 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.4 | 2.0 | GO:0046687 | response to chromate(GO:0046687) |
| 0.4 | 0.4 | GO:0097214 | regulation of lysosomal membrane permeability(GO:0097213) positive regulation of lysosomal membrane permeability(GO:0097214) |
| 0.4 | 1.2 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 0.4 | 1.2 | GO:1990790 | response to glial cell derived neurotrophic factor(GO:1990790) cellular response to glial cell derived neurotrophic factor(GO:1990792) |
| 0.4 | 1.2 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.4 | 0.4 | GO:1905146 | lysosomal protein catabolic process(GO:1905146) |
| 0.4 | 1.1 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) negative regulation of adipose tissue development(GO:1904178) |
| 0.4 | 1.1 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.4 | 1.4 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.4 | 0.4 | GO:0009216 | purine deoxyribonucleoside triphosphate biosynthetic process(GO:0009216) |
| 0.4 | 3.9 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.3 | 1.7 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.3 | 1.4 | GO:0015746 | citrate transport(GO:0015746) |
| 0.3 | 0.3 | GO:0002731 | negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.3 | 1.7 | GO:0061743 | motor learning(GO:0061743) |
| 0.3 | 1.0 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.3 | 1.3 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.3 | 1.6 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.3 | 1.0 | GO:1904350 | regulation of protein catabolic process in the vacuole(GO:1904350) |
| 0.3 | 4.5 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.3 | 2.2 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.3 | 1.9 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.3 | 2.4 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.3 | 1.2 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.3 | 0.9 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.3 | 0.9 | GO:1903769 | negative regulation of cell proliferation in bone marrow(GO:1903769) |
| 0.3 | 1.5 | GO:0046149 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.3 | 0.9 | GO:0019541 | acetate metabolic process(GO:0006083) propionate metabolic process(GO:0019541) |
| 0.3 | 0.9 | GO:0021539 | subthalamus development(GO:0021539) |
| 0.3 | 0.3 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.3 | 0.9 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.3 | 0.9 | GO:0019556 | histidine catabolic process to glutamate and formamide(GO:0019556) formamide metabolic process(GO:0043606) |
| 0.3 | 1.7 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.3 | 0.8 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 0.3 | 0.8 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.3 | 0.8 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.3 | 1.0 | GO:1990402 | embryonic liver development(GO:1990402) |
| 0.3 | 0.3 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.3 | 0.8 | GO:0030091 | protein repair(GO:0030091) |
| 0.3 | 1.8 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.3 | 1.3 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.3 | 1.0 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.3 | 1.8 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.2 | 1.0 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.2 | 0.7 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.2 | 0.2 | GO:0006548 | histidine catabolic process(GO:0006548) |
| 0.2 | 1.2 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
| 0.2 | 2.7 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.2 | 0.7 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.2 | 0.7 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.2 | 0.7 | GO:0030186 | melatonin metabolic process(GO:0030186) |
| 0.2 | 0.9 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.2 | 0.9 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.2 | 0.7 | GO:1903233 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.2 | 0.9 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.2 | 1.2 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.2 | 0.7 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.2 | 0.7 | GO:0035711 | T-helper 1 cell activation(GO:0035711) |
| 0.2 | 0.9 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.2 | 0.7 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.2 | 1.1 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 0.2 | 0.9 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.2 | 1.3 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.2 | 0.7 | GO:0035502 | metanephric part of ureteric bud development(GO:0035502) |
| 0.2 | 0.7 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
| 0.2 | 1.7 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.2 | 1.1 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.2 | 0.9 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.2 | 0.4 | GO:1903243 | negative regulation of cardiac muscle hypertrophy in response to stress(GO:1903243) |
| 0.2 | 0.9 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.2 | 0.6 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.2 | 0.6 | GO:0015864 | pyrimidine nucleoside transport(GO:0015864) |
| 0.2 | 0.9 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.2 | 0.2 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.2 | 0.9 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.2 | 0.6 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.2 | 0.6 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.2 | 0.6 | GO:1904700 | granulosa cell apoptotic process(GO:1904700) regulation of granulosa cell apoptotic process(GO:1904708) |
| 0.2 | 0.6 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.2 | 0.6 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.2 | 0.2 | GO:0045210 | FasL biosynthetic process(GO:0045210) |
| 0.2 | 0.8 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.2 | 0.6 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.2 | 0.8 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.2 | 1.0 | GO:0030421 | defecation(GO:0030421) |
| 0.2 | 0.8 | GO:0030581 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.2 | 1.0 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.2 | 0.4 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
| 0.2 | 0.2 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.2 | 2.2 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 0.2 | 0.6 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.2 | 1.6 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.2 | 1.7 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.2 | 0.6 | GO:0015688 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.2 | 1.0 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.2 | 0.2 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
| 0.2 | 0.6 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.2 | 0.8 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.2 | 0.6 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.2 | 0.7 | GO:0010037 | response to carbon dioxide(GO:0010037) |
| 0.2 | 0.9 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
| 0.2 | 0.2 | GO:0021557 | oculomotor nerve development(GO:0021557) |
| 0.2 | 0.2 | GO:1903624 | regulation of apoptotic DNA fragmentation(GO:1902510) positive regulation of apoptotic DNA fragmentation(GO:1902512) regulation of DNA catabolic process(GO:1903624) positive regulation of DNA catabolic process(GO:1903626) |
| 0.2 | 0.5 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
| 0.2 | 0.9 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.2 | 0.5 | GO:1903165 | response to polycyclic arene(GO:1903165) |
| 0.2 | 2.2 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.2 | 0.5 | GO:0061741 | vacuolar transmembrane transport(GO:0034486) chaperone-mediated protein transport involved in chaperone-mediated autophagy(GO:0061741) |
| 0.2 | 0.5 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.2 | 0.7 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.2 | 0.2 | GO:1904585 | response to putrescine(GO:1904585) cellular response to putrescine(GO:1904586) |
| 0.2 | 0.7 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.2 | 0.7 | GO:0014028 | notochord formation(GO:0014028) |
| 0.2 | 0.7 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.2 | 0.5 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.2 | 0.4 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.2 | 0.9 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.2 | 0.7 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
| 0.2 | 0.7 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.2 | 1.9 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 | 0.3 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.2 | 0.5 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.2 | 0.2 | GO:0021767 | mammillary body development(GO:0021767) mammillary axonal complex development(GO:0061373) |
| 0.2 | 0.5 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.2 | 0.5 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
| 0.2 | 0.8 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.2 | 0.8 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 0.2 | 1.3 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) |
| 0.2 | 1.2 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.2 | 0.5 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.2 | 0.7 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.2 | 0.3 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.2 | 0.2 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.2 | 0.5 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.2 | 2.0 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.2 | 1.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.2 | 0.6 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.2 | 0.5 | GO:2000814 | positive regulation of barbed-end actin filament capping(GO:2000814) |
| 0.2 | 1.8 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.2 | 0.6 | GO:0030221 | basophil differentiation(GO:0030221) |
| 0.2 | 1.4 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.2 | 0.8 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
| 0.2 | 0.5 | GO:0009407 | toxin catabolic process(GO:0009407) mycotoxin metabolic process(GO:0043385) mycotoxin catabolic process(GO:0043387) aflatoxin metabolic process(GO:0046222) aflatoxin catabolic process(GO:0046223) secondary metabolite catabolic process(GO:0090487) organic heteropentacyclic compound metabolic process(GO:1901376) organic heteropentacyclic compound catabolic process(GO:1901377) |
| 0.2 | 0.8 | GO:1903278 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.2 | 0.5 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.2 | 0.8 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.2 | 0.5 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.2 | 0.2 | GO:0006113 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.2 | 0.5 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.2 | 0.5 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.2 | 0.5 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.2 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.2 | 0.6 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.2 | 1.5 | GO:0042747 | circadian sleep/wake cycle, REM sleep(GO:0042747) |
| 0.2 | 0.5 | GO:1904373 | response to kainic acid(GO:1904373) |
| 0.2 | 0.5 | GO:0016128 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.2 | 0.2 | GO:0051177 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
| 0.2 | 0.2 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.2 | 0.8 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
| 0.2 | 0.8 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
| 0.2 | 0.2 | GO:0036023 | embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.1 | 0.1 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.1 | 0.3 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.1 | 0.3 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.1 | 0.4 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 0.4 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.1 | 0.3 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.1 | 0.3 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
| 0.1 | 0.4 | GO:0000053 | argininosuccinate metabolic process(GO:0000053) |
| 0.1 | 0.3 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.1 | 0.6 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.1 | 0.4 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.1 | 0.7 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.4 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.1 | 0.4 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 | 0.6 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.1 | 1.0 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.6 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.1 | 0.1 | GO:1903093 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.1 | 0.6 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.1 | 1.4 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 | 0.7 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.1 | 1.4 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.1 | 0.6 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 0.6 | GO:0046469 | platelet activating factor metabolic process(GO:0046469) |
| 0.1 | 0.1 | GO:0003134 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
| 0.1 | 0.6 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 | 0.6 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
| 0.1 | 0.3 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.1 | 0.4 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.1 | 0.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.4 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.1 | 0.4 | GO:0007308 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
| 0.1 | 1.2 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.1 | 1.0 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.1 | 0.4 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.1 | 0.5 | GO:0033864 | positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 0.1 | 1.2 | GO:0001977 | renal system process involved in regulation of blood volume(GO:0001977) |
| 0.1 | 0.5 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.1 | 0.5 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.1 | 0.4 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 | 0.5 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.1 | 0.1 | GO:0006598 | polyamine catabolic process(GO:0006598) |
| 0.1 | 0.3 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.1 | 0.7 | GO:0036233 | glycine import(GO:0036233) |
| 0.1 | 0.1 | GO:0070602 | regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 0.1 | 0.4 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.1 | 0.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.1 | 0.1 | GO:0002397 | MHC class I protein complex assembly(GO:0002397) |
| 0.1 | 1.4 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 0.7 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.1 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.1 | 0.8 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.1 | 0.4 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) guanine salvage(GO:0006178) GMP catabolic process(GO:0046038) guanine biosynthetic process(GO:0046099) |
| 0.1 | 0.4 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.1 | 1.4 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.1 | 0.9 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.1 | 0.5 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
| 0.1 | 0.4 | GO:0060486 | Clara cell differentiation(GO:0060486) |
| 0.1 | 0.1 | GO:0060676 | ureteric bud formation(GO:0060676) mesonephric tubule formation(GO:0072172) |
| 0.1 | 0.1 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 1.9 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.4 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.1 | 0.7 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.1 | 0.2 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.1 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 | 0.9 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 | 0.5 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.1 | 0.1 | GO:0035565 | regulation of pronephros size(GO:0035565) |
| 0.1 | 0.4 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 1.0 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 0.5 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.1 | 0.2 | GO:0072363 | regulation of glycolytic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072363) |
| 0.1 | 0.2 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.1 | 0.1 | GO:0050711 | negative regulation of interleukin-1 secretion(GO:0050711) |
| 0.1 | 0.6 | GO:0051583 | dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) |
| 0.1 | 0.4 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 | 0.4 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.1 | 0.8 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.1 | 1.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 | 0.8 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.1 | 0.5 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 | 0.5 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 0.1 | 0.5 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 | 0.6 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 | 1.8 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.2 | GO:0043622 | cortical microtubule organization(GO:0043622) |
| 0.1 | 1.0 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.1 | 0.9 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.1 | 0.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.6 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
| 0.1 | 0.3 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.7 | GO:0010266 | response to vitamin B1(GO:0010266) |
| 0.1 | 0.3 | GO:0060423 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
| 0.1 | 0.3 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.1 | 0.7 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
| 0.1 | 0.1 | GO:1990418 | response to insulin-like growth factor stimulus(GO:1990418) |
| 0.1 | 0.4 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 0.1 | 0.4 | GO:0097069 | cellular response to thyroxine stimulus(GO:0097069) |
| 0.1 | 0.4 | GO:0070370 | cellular heat acclimation(GO:0070370) |
| 0.1 | 0.7 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.1 | 1.2 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 0.8 | GO:0035934 | corticosterone secretion(GO:0035934) |
| 0.1 | 0.3 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.1 | 0.1 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.1 | 0.4 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 0.1 | 0.3 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
| 0.1 | 0.9 | GO:0086103 | G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
| 0.1 | 0.2 | GO:0061072 | iris morphogenesis(GO:0061072) |
| 0.1 | 0.8 | GO:0072201 | negative regulation of mesenchymal cell proliferation(GO:0072201) |
| 0.1 | 0.5 | GO:1903367 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.1 | 0.2 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.1 | 1.1 | GO:0008215 | spermine metabolic process(GO:0008215) |
| 0.1 | 0.4 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.1 | 0.5 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.1 | 0.2 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.1 | 0.3 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.1 | 2.9 | GO:1900027 | regulation of ruffle assembly(GO:1900027) |
| 0.1 | 0.3 | GO:1903173 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
| 0.1 | 0.3 | GO:0046864 | isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.1 | 0.4 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 | 0.6 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.1 | 0.2 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.1 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.1 | 0.1 | GO:0035482 | gastric motility(GO:0035482) |
| 0.1 | 0.7 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
| 0.1 | 0.2 | GO:0098759 | response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.1 | 0.5 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.5 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.9 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.1 | 0.5 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.1 | 0.3 | GO:0032849 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
| 0.1 | 0.2 | GO:0099545 | trans-synaptic signaling by trans-synaptic complex(GO:0099545) |
| 0.1 | 2.0 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
| 0.1 | 0.3 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.1 | 0.3 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.1 | 0.4 | GO:0072181 | mesonephric duct formation(GO:0072181) |
| 0.1 | 1.6 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.1 | 0.1 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.1 | 0.8 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 3.0 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 | 0.3 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 0.1 | GO:0002434 | immune complex clearance(GO:0002434) |
| 0.1 | 2.5 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.3 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.1 | 0.3 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.1 | 0.3 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 0.1 | 0.3 | GO:0006713 | glucocorticoid catabolic process(GO:0006713) |
| 0.1 | 0.5 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.1 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.1 | 0.3 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.1 | 0.4 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.1 | 0.1 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
| 0.1 | 0.3 | GO:0070084 | protein initiator methionine removal(GO:0070084) |
| 0.1 | 0.8 | GO:0031943 | regulation of glucocorticoid metabolic process(GO:0031943) |
| 0.1 | 0.3 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.1 | 0.4 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 0.9 | GO:0003360 | brainstem development(GO:0003360) |
| 0.1 | 0.5 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 | 0.3 | GO:0060720 | spongiotrophoblast cell proliferation(GO:0060720) cell proliferation involved in embryonic placenta development(GO:0060722) spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.1 | 0.7 | GO:0071681 | cellular response to indole-3-methanol(GO:0071681) |
| 0.1 | 0.3 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
| 0.1 | 0.9 | GO:0006735 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.1 | 0.5 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 0.3 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.1 | 0.2 | GO:0002654 | positive regulation of tolerance induction dependent upon immune response(GO:0002654) |
| 0.1 | 0.4 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 | 0.1 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) positive regulation of glucocorticoid secretion(GO:2000851) |
| 0.1 | 0.6 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 0.1 | 0.8 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 | 0.6 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
| 0.1 | 0.1 | GO:0097681 | double-strand break repair via alternative nonhomologous end joining(GO:0097681) |
| 0.1 | 0.2 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.1 | 1.0 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.1 | 0.3 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.1 | 0.5 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 0.5 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.1 | 0.8 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.6 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.1 | 0.2 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.1 | 0.2 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.1 | 0.4 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 | 0.1 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.1 | 0.3 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.1 | 0.2 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 | 0.5 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.1 | 0.6 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 0.1 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.1 | 0.5 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.1 | 0.4 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.1 | 1.0 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 | 0.3 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.1 | 0.3 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
| 0.1 | 0.2 | GO:0035772 | interleukin-13-mediated signaling pathway(GO:0035772) |
| 0.1 | 0.1 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.1 | 0.3 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.1 | 0.1 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.1 | 0.3 | GO:1904685 | positive regulation of metalloendopeptidase activity(GO:1904685) |
| 0.1 | 1.9 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.1 | 0.1 | GO:0002859 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) negative regulation of natural killer cell mediated immune response to tumor cell(GO:0002856) negative regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002859) |
| 0.1 | 0.9 | GO:0032096 | negative regulation of response to food(GO:0032096) |
| 0.1 | 0.5 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
| 0.1 | 0.4 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.1 | 0.6 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.9 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.1 | 0.1 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
| 0.1 | 0.3 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.1 | 0.2 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.1 | 0.3 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine diphosphate metabolic process(GO:0042357) thiamine-containing compound metabolic process(GO:0042723) |
| 0.1 | 0.3 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.1 | 0.3 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.1 | 0.3 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 | 0.2 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.1 | 0.2 | GO:2000794 | regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
| 0.1 | 0.2 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.1 | 0.1 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.1 | 0.3 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.1 | 0.3 | GO:0009609 | response to symbiotic bacterium(GO:0009609) |
| 0.1 | 0.3 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.1 | 0.3 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.1 | 0.5 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
| 0.1 | 0.2 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 1.4 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.1 | 0.3 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) |
| 0.1 | 0.2 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.1 | 0.3 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
| 0.1 | 0.7 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) |
| 0.1 | 0.1 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.1 | 0.7 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 | 0.3 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.1 | 0.6 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.1 | 0.1 | GO:0071338 | submandibular salivary gland formation(GO:0060661) positive regulation of hair follicle cell proliferation(GO:0071338) |
| 0.1 | 0.1 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
| 0.1 | 0.4 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.1 | 0.3 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.1 | 0.2 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.1 | 0.1 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.1 | 0.5 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
| 0.1 | 0.2 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.1 | 0.4 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.1 | 0.6 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.1 | 0.6 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.1 | 0.2 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) |
| 0.1 | 0.5 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.1 | 1.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.8 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 0.1 | GO:0002353 | kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
| 0.1 | 0.3 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 | 0.2 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.1 | 0.5 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.1 | 0.2 | GO:0098507 | polynucleotide 5' dephosphorylation(GO:0098507) |
| 0.1 | 0.3 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 | 0.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 0.1 | GO:0060579 | ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.1 | 0.2 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
| 0.1 | 0.1 | GO:0071422 | succinate transport(GO:0015744) succinate transmembrane transport(GO:0071422) |
| 0.1 | 0.5 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) |
| 0.1 | 2.1 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.1 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.1 | 0.4 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.1 | 0.2 | GO:2000424 | regulation of eosinophil chemotaxis(GO:2000422) positive regulation of eosinophil chemotaxis(GO:2000424) |
| 0.1 | 0.4 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 0.3 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.1 | 0.1 | GO:0002477 | antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) |
| 0.1 | 0.3 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
| 0.1 | 0.3 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 0.5 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.2 | GO:1902024 | histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) |
| 0.1 | 0.1 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.1 | 0.2 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.1 | 0.1 | GO:1904616 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.1 | 1.0 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.1 | 0.6 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 | 0.7 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.1 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.1 | 0.4 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.1 | 2.1 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.2 | GO:0071400 | cellular response to oleic acid(GO:0071400) |
| 0.1 | 1.3 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.1 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.1 | 0.1 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.1 | 0.5 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.1 | 0.2 | GO:0021546 | rhombomere development(GO:0021546) |
| 0.1 | 0.1 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.1 | 0.1 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.1 | 1.1 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.1 | 0.2 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.1 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
| 0.1 | 0.3 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.1 | 0.7 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 0.2 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.1 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.1 | 0.5 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
| 0.1 | 2.6 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.1 | 0.1 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
| 0.1 | 0.1 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.1 | 0.1 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.1 | 0.2 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.1 | GO:0048087 | positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) |
| 0.1 | 0.4 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 0.1 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.1 | 0.2 | GO:0009189 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 2.0 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.1 | 0.3 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.1 | 0.1 | GO:1904975 | response to bleomycin(GO:1904975) |
| 0.1 | 0.2 | GO:1902869 | regulation of amacrine cell differentiation(GO:1902869) |
| 0.1 | 0.3 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
| 0.1 | 0.1 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.6 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.1 | 2.2 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.1 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
| 0.1 | 0.5 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 | 0.3 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.2 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.1 | 0.3 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.1 | 0.2 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.1 | 0.9 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.1 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 | 0.4 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
| 0.1 | 0.2 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.1 | 0.1 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
| 0.1 | 0.8 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.1 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
| 0.1 | 0.6 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.1 | 0.1 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.1 | 0.2 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.1 | 0.2 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 0.1 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
| 0.1 | 0.7 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 0.3 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
| 0.1 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.1 | 0.5 | GO:0071910 | determination of liver left/right asymmetry(GO:0071910) |
| 0.1 | 0.3 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.1 | 0.3 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
| 0.1 | 0.1 | GO:0017143 | insecticide metabolic process(GO:0017143) |
| 0.1 | 0.1 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.1 | 0.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.1 | 0.2 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.1 | 0.3 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.1 | 0.7 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.1 | 0.7 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
| 0.1 | 0.4 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 0.4 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
| 0.1 | 0.4 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.3 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.1 | 0.3 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.1 | 0.4 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.1 | 0.2 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.1 | 0.5 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
| 0.1 | 0.2 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.1 | 0.2 | GO:1905168 | positive regulation of double-strand break repair via homologous recombination(GO:1905168) |
| 0.1 | 0.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.1 | 0.2 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.2 | GO:1904400 | response to Thyroid stimulating hormone(GO:1904400) cellular response to Thyroid stimulating hormone(GO:1904401) |
| 0.1 | 0.9 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 | 0.2 | GO:0001794 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.1 | 0.6 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 | 0.6 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 0.4 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.1 | 0.1 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.1 | 0.3 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.1 | 0.6 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.1 | 0.2 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.1 | 0.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.1 | 0.5 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.4 | GO:0033198 | response to ATP(GO:0033198) |
| 0.1 | 0.4 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.1 | 0.1 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
| 0.1 | 0.2 | GO:0060037 | pharyngeal system development(GO:0060037) |
| 0.1 | 0.1 | GO:1901341 | positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 | 1.5 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 0.4 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.1 | 0.1 | GO:0060577 | pulmonary vein morphogenesis(GO:0060577) |
| 0.1 | 0.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 0.5 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.4 | GO:0006901 | vesicle coating(GO:0006901) |
| 0.1 | 0.2 | GO:1901315 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.1 | 0.2 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
| 0.1 | 2.0 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.1 | 0.4 | GO:0014889 | muscle atrophy(GO:0014889) |
| 0.1 | 0.2 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 0.1 | 0.6 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.1 | 0.2 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.1 | 0.8 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.1 | 1.0 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.1 | 0.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 0.3 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
| 0.1 | 0.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.1 | 0.8 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 | 1.0 | GO:0048665 | neuron fate specification(GO:0048665) |
| 0.1 | 2.0 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.1 | 0.3 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.1 | 0.1 | GO:0021590 | cerebellum maturation(GO:0021590) cerebellar cortex maturation(GO:0021699) |
| 0.1 | 0.6 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
| 0.1 | 0.4 | GO:0071872 | cellular response to epinephrine stimulus(GO:0071872) |
| 0.1 | 0.2 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.1 | 0.1 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 | 0.5 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 | 0.1 | GO:0034135 | regulation of toll-like receptor 2 signaling pathway(GO:0034135) |
| 0.1 | 0.2 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.1 | 0.2 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
| 0.1 | 0.6 | GO:0032986 | protein-DNA complex disassembly(GO:0032986) |
| 0.1 | 1.5 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 | 0.3 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.1 | 0.2 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 | 0.3 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.3 | GO:0046655 | folic acid metabolic process(GO:0046655) |
| 0.1 | 0.3 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.1 | 0.1 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.1 | 0.2 | GO:0006567 | threonine catabolic process(GO:0006567) |
| 0.1 | 0.2 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.1 | 0.1 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.1 | 0.1 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.1 | 0.1 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
| 0.1 | 0.1 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.1 | 0.2 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.1 | 0.1 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.1 | 0.2 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.8 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
| 0.1 | 0.3 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 1.5 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.1 | 0.2 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.1 | 0.7 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.1 | 0.2 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 0.2 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.1 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.1 | 0.2 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.1 | 0.5 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.1 | 0.2 | GO:0008228 | opsonization(GO:0008228) |
| 0.1 | 0.2 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.1 | 0.2 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.1 | 0.1 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.1 | 0.2 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.1 | 0.3 | GO:1902571 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.1 | 0.5 | GO:0072711 | cellular response to hydroxyurea(GO:0072711) |
| 0.1 | 0.2 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.1 | 0.3 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.1 | 0.3 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.1 | 0.1 | GO:2000417 | negative regulation of eosinophil migration(GO:2000417) |
| 0.1 | 1.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.1 | 0.7 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.1 | 0.3 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.2 | GO:0090164 | asymmetric Golgi ribbon formation(GO:0090164) |
| 0.1 | 0.5 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.1 | 0.1 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
| 0.1 | 0.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.6 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.1 | 0.3 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 | 0.2 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.1 | 0.2 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.1 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.1 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 | 0.5 | GO:0034312 | diol biosynthetic process(GO:0034312) |
| 0.1 | 0.3 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.1 | 0.2 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.1 | 0.1 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.0 | 0.0 | GO:0001545 | primary ovarian follicle growth(GO:0001545) |
| 0.0 | 0.0 | GO:0003192 | mitral valve formation(GO:0003192) |
| 0.0 | 0.3 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.0 | 0.5 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.0 | 0.1 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.0 | 0.7 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 0.1 | GO:0050828 | regulation of liquid surface tension(GO:0050828) |
| 0.0 | 0.2 | GO:0051542 | elastin biosynthetic process(GO:0051542) |
| 0.0 | 0.0 | GO:0001928 | regulation of exocyst assembly(GO:0001928) |
| 0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 | 0.2 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.0 | 0.1 | GO:0003164 | His-Purkinje system development(GO:0003164) |
| 0.0 | 0.2 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.0 | 1.1 | GO:0045604 | regulation of epidermal cell differentiation(GO:0045604) |
| 0.0 | 0.1 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.0 | 0.1 | GO:0021965 | spinal cord ventral commissure morphogenesis(GO:0021965) motor behavior(GO:0061744) |
| 0.0 | 0.1 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
| 0.0 | 0.3 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 | 0.4 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) regulation of leukocyte adhesion to vascular endothelial cell(GO:1904994) |
| 0.0 | 0.3 | GO:0046541 | saliva secretion(GO:0046541) |
| 0.0 | 0.7 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.0 | 0.3 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.0 | 0.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.0 | 0.1 | GO:0010625 | positive regulation of Schwann cell proliferation(GO:0010625) |
| 0.0 | 0.2 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.0 | 0.2 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.0 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.0 | 0.5 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.0 | 0.4 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.0 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.0 | 0.1 | GO:0045630 | positive regulation of T-helper 2 cell differentiation(GO:0045630) |
| 0.0 | 0.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.0 | 0.8 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
| 0.0 | 0.4 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.0 | 0.3 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.0 | 0.4 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.0 | 0.1 | GO:0015855 | pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.0 | 0.2 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.0 | 0.3 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.0 | 0.0 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.0 | 0.2 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.0 | 0.0 | GO:0039019 | pronephric nephron development(GO:0039019) |
| 0.0 | 0.1 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
| 0.0 | 0.4 | GO:0044241 | lipid digestion(GO:0044241) |
| 0.0 | 0.3 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.0 | 0.2 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.5 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.1 | GO:0009992 | cellular water homeostasis(GO:0009992) |
| 0.0 | 0.0 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.0 | 0.2 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.0 | 0.4 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.9 | GO:0021696 | cerebellar cortex morphogenesis(GO:0021696) |
| 0.0 | 0.3 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.0 | 0.3 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.0 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
| 0.0 | 0.1 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
| 0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.0 | 0.3 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.0 | 0.3 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.1 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
| 0.0 | 0.3 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.0 | 0.2 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.0 | 0.0 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.0 | 1.0 | GO:0032094 | response to food(GO:0032094) |
| 0.0 | 0.1 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.0 | 0.3 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.0 | 0.1 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.0 | 0.7 | GO:0001773 | myeloid dendritic cell activation(GO:0001773) |
| 0.0 | 0.3 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.2 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 | 0.2 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.0 | 0.1 | GO:0071874 | cellular response to norepinephrine stimulus(GO:0071874) |
| 0.0 | 2.2 | GO:1990748 | cellular detoxification(GO:1990748) |
| 0.0 | 0.1 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.0 | 0.7 | GO:0034032 | coenzyme A metabolic process(GO:0015936) nucleoside bisphosphate metabolic process(GO:0033865) ribonucleoside bisphosphate metabolic process(GO:0033875) purine nucleoside bisphosphate metabolic process(GO:0034032) |
| 0.0 | 0.1 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.0 | 0.6 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
| 0.0 | 0.2 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
| 0.0 | 0.2 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.2 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.0 | 0.2 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 0.5 | GO:0043545 | molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.2 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.0 | 0.4 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
| 0.0 | 0.5 | GO:1901661 | quinone metabolic process(GO:1901661) |
| 0.0 | 0.2 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.3 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 | 0.0 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
| 0.0 | 0.7 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.1 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.1 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.0 | 0.4 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.0 | 1.7 | GO:0035082 | axoneme assembly(GO:0035082) |
| 0.0 | 0.1 | GO:0048298 | immunoglobulin production in mucosal tissue(GO:0002426) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.0 | GO:0071107 | response to parathyroid hormone(GO:0071107) |
| 0.0 | 1.4 | GO:0045669 | positive regulation of osteoblast differentiation(GO:0045669) |
| 0.0 | 0.1 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.2 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
| 0.0 | 0.1 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.0 | 0.2 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.0 | 0.3 | GO:1902583 | intracellular transport of virus(GO:0075733) multi-organism intracellular transport(GO:1902583) |
| 0.0 | 0.1 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.0 | 0.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.2 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.0 | 0.1 | GO:0042196 | chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 0.0 | 0.5 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 | 0.1 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.0 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.0 | 0.0 | GO:0072074 | kidney mesenchyme development(GO:0072074) |
| 0.0 | 0.3 | GO:0042559 | pteridine-containing compound biosynthetic process(GO:0042559) |
| 0.0 | 0.4 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) |
| 0.0 | 0.2 | GO:0061709 | reticulophagy(GO:0061709) |
| 0.0 | 0.2 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.0 | 0.5 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
| 0.0 | 0.3 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.0 | 0.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.0 | 0.1 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
| 0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.4 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 | 0.1 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.0 | 0.1 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.0 | 0.0 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.0 | 1.1 | GO:0021762 | substantia nigra development(GO:0021762) |
| 0.0 | 0.4 | GO:0019731 | antibacterial humoral response(GO:0019731) |
| 0.0 | 0.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.0 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.0 | 0.0 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.0 | 0.1 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.0 | 0.1 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.4 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 | 0.3 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.3 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.1 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.0 | 0.3 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 1.8 | GO:0030317 | sperm motility(GO:0030317) |
| 0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.0 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.0 | 0.2 | GO:0072575 | hepatocyte proliferation(GO:0072574) epithelial cell proliferation involved in liver morphogenesis(GO:0072575) |
| 0.0 | 0.3 | GO:0051350 | negative regulation of lyase activity(GO:0051350) |
| 0.0 | 0.2 | GO:0021769 | orbitofrontal cortex development(GO:0021769) |
| 0.0 | 0.1 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
| 0.0 | 0.2 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.0 | 0.1 | GO:0046016 | positive regulation of transcription by glucose(GO:0046016) |
| 0.0 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 1.3 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.0 | 0.1 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.0 | 0.3 | GO:0015865 | purine nucleotide transport(GO:0015865) purine ribonucleotide transport(GO:0015868) |
| 0.0 | 0.1 | GO:0036378 | calcitriol biosynthetic process from calciol(GO:0036378) |
| 0.0 | 0.0 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.0 | 0.4 | GO:0010954 | positive regulation of protein processing(GO:0010954) |
| 0.0 | 0.1 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.0 | 0.1 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.0 | 0.2 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
| 0.0 | 0.1 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.3 | GO:0061756 | leukocyte tethering or rolling(GO:0050901) leukocyte adhesion to vascular endothelial cell(GO:0061756) |
| 0.0 | 0.2 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 | 0.4 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 | 0.5 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.2 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 | 0.2 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.0 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.0 | 0.1 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.0 | 0.3 | GO:0002675 | positive regulation of acute inflammatory response(GO:0002675) |
| 0.0 | 0.1 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.0 | 0.1 | GO:0009624 | response to nematode(GO:0009624) |
| 0.0 | 0.4 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.1 | GO:0042339 | keratan sulfate metabolic process(GO:0042339) |
| 0.0 | 0.3 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.0 | 0.2 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.0 | 0.3 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 0.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.1 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
| 0.0 | 0.3 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.3 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 0.0 | 0.3 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.0 | 0.1 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 | 0.1 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
| 0.0 | 0.3 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.2 | GO:0002504 | antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002504) |
| 0.0 | 0.2 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.0 | 0.1 | GO:0060613 | fat pad development(GO:0060613) |
| 0.0 | 0.1 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.0 | 0.2 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.0 | 0.1 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.0 | 0.1 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.0 | 0.1 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
| 0.0 | 0.0 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) |
| 0.0 | 0.1 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.0 | 0.2 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
| 0.0 | 0.4 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.9 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.0 | GO:0032805 | positive regulation of low-density lipoprotein particle receptor catabolic process(GO:0032805) |
| 0.0 | 0.3 | GO:0042438 | melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) |
| 0.0 | 0.1 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.0 | 0.1 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.0 | GO:2001045 | negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.0 | 0.2 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 | 0.3 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.1 | GO:0071436 | sodium ion export from cell(GO:0036376) sodium ion export(GO:0071436) |
| 0.0 | 0.5 | GO:0090023 | positive regulation of granulocyte chemotaxis(GO:0071624) positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.0 | 0.1 | GO:0032978 | protein insertion into membrane from inner side(GO:0032978) |
| 0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 | 0.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 1.0 | GO:0001706 | endoderm formation(GO:0001706) |
| 0.0 | 1.7 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.2 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.1 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
| 0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.1 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) |
| 0.0 | 0.3 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 | 0.2 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.0 | 0.2 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.2 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.0 | 1.2 | GO:0007129 | synapsis(GO:0007129) |
| 0.0 | 0.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.0 | 0.1 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.0 | 0.1 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
| 0.0 | 0.2 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.0 | 0.1 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
| 0.0 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 | 0.2 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.0 | 0.1 | GO:0045105 | intermediate filament polymerization or depolymerization(GO:0045105) |
| 0.0 | 0.0 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.0 | 0.0 | GO:1990646 | cellular response to prolactin(GO:1990646) |
| 0.0 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.0 | 0.1 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.1 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 0.0 | 0.1 | GO:0030952 | establishment or maintenance of cytoskeleton polarity(GO:0030952) |
| 0.0 | 0.2 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.5 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.0 | 0.2 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
| 0.0 | 0.1 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.0 | 0.1 | GO:0007028 | cytoplasm organization(GO:0007028) |
| 0.0 | 0.1 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.0 | 1.6 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
| 0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.0 | GO:0009446 | putrescine metabolic process(GO:0009445) putrescine biosynthetic process(GO:0009446) |
| 0.0 | 0.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.0 | 0.0 | GO:0019730 | antimicrobial humoral response(GO:0019730) |
| 0.0 | 0.2 | GO:0097435 | fibril organization(GO:0097435) |
| 0.0 | 0.2 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
| 0.0 | 0.3 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.0 | 0.1 | GO:0031424 | keratinization(GO:0031424) |
| 0.0 | 0.1 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.0 | 0.1 | GO:1901994 | negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.0 | 0.4 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.0 | 0.0 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.0 | 0.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.0 | 0.1 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.0 | 0.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.0 | 0.0 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.1 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.0 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.6 | GO:0071466 | cellular response to xenobiotic stimulus(GO:0071466) |
| 0.0 | 0.3 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.0 | 0.0 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 | 0.2 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.2 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.0 | GO:0003306 | Wnt signaling pathway involved in heart development(GO:0003306) |
| 0.0 | 0.0 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.3 | GO:0030728 | ovulation(GO:0030728) |
| 0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 0.0 | GO:2001267 | regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001267) |
| 0.0 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.0 | 0.1 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
| 0.0 | 0.4 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
| 0.0 | 0.1 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
| 0.0 | 0.1 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.0 | 0.0 | GO:0071335 | hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) |
| 0.0 | 0.2 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.1 | GO:0055023 | positive regulation of cardiac muscle tissue growth(GO:0055023) |
| 0.0 | 0.0 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 0.0 | 0.0 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.0 | 0.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.1 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
| 0.0 | 0.0 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
| 0.0 | 0.0 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
| 0.0 | 0.2 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
| 0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.0 | 0.2 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.0 | 0.1 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.0 | 0.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.0 | 0.1 | GO:1903429 | regulation of cell maturation(GO:1903429) |
| 0.0 | 0.0 | GO:0072244 | metanephric glomerular epithelium development(GO:0072244) |
| 0.0 | 0.2 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.1 | GO:0010747 | positive regulation of plasma membrane long-chain fatty acid transport(GO:0010747) |
| 0.0 | 0.1 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.0 | 0.0 | GO:0006596 | polyamine biosynthetic process(GO:0006596) |
| 0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.0 | 0.1 | GO:0043921 | modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.0 | 0.3 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.1 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.0 | 0.3 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 | 0.1 | GO:0090190 | positive regulation of mesonephros development(GO:0061213) positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
| 0.0 | 0.1 | GO:0048241 | epinephrine transport(GO:0048241) epinephrine secretion(GO:0048242) |
| 0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.0 | 0.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.1 | GO:0032274 | gonadotropin secretion(GO:0032274) |
| 0.0 | 0.3 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 | 0.1 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
| 0.0 | 0.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.0 | 0.1 | GO:1903445 | protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.0 | 0.1 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.0 | 0.2 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.0 | 0.0 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.0 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.0 | 0.0 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 | 0.2 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.0 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.0 | 0.1 | GO:0051875 | pigment granule localization(GO:0051875) |
| 0.0 | 0.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.0 | 0.1 | GO:1902074 | response to salt(GO:1902074) |
| 0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.0 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 | 0.1 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.0 | GO:0010692 | regulation of alkaline phosphatase activity(GO:0010692) |
| 0.0 | 0.0 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
| 0.0 | 0.3 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.0 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.0 | 0.1 | GO:0003299 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.0 | 0.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.1 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.0 | 0.0 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.0 | 0.1 | GO:0051154 | negative regulation of striated muscle cell differentiation(GO:0051154) |
| 0.0 | 0.4 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.0 | GO:0032148 | activation of protein kinase B activity(GO:0032148) |
| 0.0 | 0.1 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
| 0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.0 | GO:0032740 | positive regulation of interleukin-17 production(GO:0032740) |
| 0.0 | 0.1 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.0 | 0.1 | GO:0018410 | C-terminal protein amino acid modification(GO:0018410) |
| 0.0 | 0.1 | GO:0033197 | response to vitamin E(GO:0033197) |
| 0.0 | 0.1 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.0 | 0.0 | GO:0080144 | amino acid homeostasis(GO:0080144) |
| 0.0 | 0.1 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.0 | 0.0 | GO:0010714 | positive regulation of collagen metabolic process(GO:0010714) |
| 0.0 | 0.1 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.0 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.0 | 0.1 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.0 | 0.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.3 | GO:0030816 | positive regulation of cAMP metabolic process(GO:0030816) |
| 0.0 | 0.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.1 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.0 | 0.1 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.0 | 0.1 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.0 | 0.0 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.0 | 0.0 | GO:0071386 | cellular response to corticosterone stimulus(GO:0071386) |
| 0.0 | 0.0 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.0 | 0.0 | GO:1903413 | cellular response to bile acid(GO:1903413) |
| 0.0 | 0.1 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.0 | 0.0 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.0 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.1 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.0 | GO:0000303 | response to superoxide(GO:0000303) |
| 0.0 | 0.0 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.0 | 0.1 | GO:0043537 | negative regulation of blood vessel endothelial cell migration(GO:0043537) |
| 0.0 | 0.0 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
| 0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.0 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.0 | GO:1990164 | histone H2A phosphorylation(GO:1990164) |
| 0.0 | 0.0 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.0 | 0.0 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.0 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
| 0.0 | 0.0 | GO:0034311 | diol metabolic process(GO:0034311) |
| 0.0 | 0.1 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
| 0.0 | 0.2 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 4.2 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.6 | 2.8 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.4 | 4.3 | GO:0030891 | VCB complex(GO:0030891) |
| 0.4 | 3.4 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.4 | 1.9 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.4 | 1.2 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.3 | 0.6 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.3 | 1.1 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.2 | 1.0 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.2 | 0.7 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.2 | 1.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.2 | 0.7 | GO:0090534 | longitudinal sarcoplasmic reticulum(GO:0014801) calcium ion-transporting ATPase complex(GO:0090534) |
| 0.2 | 0.7 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.2 | 0.7 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
| 0.2 | 0.9 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.2 | 1.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.2 | 0.7 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.2 | 0.6 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
| 0.2 | 1.5 | GO:0090543 | Flemming body(GO:0090543) |
| 0.2 | 1.2 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.2 | 1.8 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.2 | 1.0 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.2 | 0.7 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.2 | 0.9 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.2 | 1.4 | GO:0005638 | lamin filament(GO:0005638) |
| 0.2 | 0.7 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.2 | 0.4 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.2 | 1.7 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.2 | 2.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.2 | 1.0 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.2 | 1.9 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.2 | 0.5 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.2 | 0.2 | GO:1990415 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
| 0.2 | 1.6 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.2 | 1.8 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
| 0.2 | 0.3 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.2 | 0.5 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.2 | 0.6 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.2 | 1.1 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 0.7 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 0.6 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.1 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.1 | 0.6 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.1 | 0.4 | GO:0045242 | mitochondrial isocitrate dehydrogenase complex (NAD+)(GO:0005962) isocitrate dehydrogenase complex (NAD+)(GO:0045242) |
| 0.1 | 0.9 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.4 | GO:0031310 | integral component of vacuolar membrane(GO:0031166) intrinsic component of vacuolar membrane(GO:0031310) |
| 0.1 | 0.9 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.4 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.1 | 0.9 | GO:0005861 | troponin complex(GO:0005861) |
| 0.1 | 0.9 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 0.4 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.1 | 0.4 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 0.1 | 0.5 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 0.7 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.1 | 1.4 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.1 | 1.7 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.5 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.1 | 1.5 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.1 | 0.7 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.1 | 1.0 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.1 | 0.5 | GO:0045273 | respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) |
| 0.1 | 0.4 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.1 | 0.1 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.1 | 1.4 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 1.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 1.8 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 1.5 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.1 | 1.6 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.1 | 0.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 0.5 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.1 | 3.2 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 0.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.3 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.1 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.1 | 0.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.1 | 0.6 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 1.0 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 1.2 | GO:0044754 | autolysosome(GO:0044754) |
| 0.1 | 0.9 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 0.9 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.1 | 0.8 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 0.6 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 0.7 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.1 | 2.0 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 1.6 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 6.3 | GO:0070469 | respiratory chain(GO:0070469) |
| 0.1 | 0.5 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.1 | 1.5 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 0.6 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 1.2 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 1.8 | GO:0043218 | compact myelin(GO:0043218) |
| 0.1 | 1.0 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.1 | 1.1 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.4 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.1 | 0.3 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.1 | 0.3 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 0.4 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.1 | 0.6 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 0.6 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.1 | 0.5 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 2.6 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.2 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.1 | 0.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 0.3 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 0.5 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.4 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.1 | 0.5 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 5.3 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.1 | 0.4 | GO:0060205 | cytoplasmic membrane-bounded vesicle lumen(GO:0060205) |
| 0.1 | 0.4 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.1 | 0.5 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.1 | 0.1 | GO:0032398 | MHC class Ib protein complex(GO:0032398) |
| 0.1 | 3.7 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.1 | 0.4 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.1 | 0.6 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.1 | 0.3 | GO:0099522 | region of cytosol(GO:0099522) postsynaptic cytosol(GO:0099524) |
| 0.1 | 1.1 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.1 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.1 | 0.4 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 0.4 | GO:0097361 | CIA complex(GO:0097361) |
| 0.1 | 0.3 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.1 | 0.1 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 4.2 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 1.0 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.1 | 1.4 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 0.3 | GO:0097196 | Shu complex(GO:0097196) |
| 0.1 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 0.4 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.1 | 0.2 | GO:0044299 | C-fiber(GO:0044299) |
| 0.1 | 0.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
| 0.1 | 0.6 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.1 | 0.3 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.1 | 1.8 | GO:0045178 | basal part of cell(GO:0045178) |
| 0.1 | 0.4 | GO:0018995 | host(GO:0018995) host cell(GO:0043657) |
| 0.1 | 1.2 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| 0.1 | 0.6 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.3 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 0.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.8 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.4 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 2.7 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 0.3 | GO:0072487 | MSL complex(GO:0072487) |
| 0.1 | 0.5 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.3 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.1 | 0.2 | GO:0051286 | cell tip(GO:0051286) |
| 0.1 | 0.6 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.9 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.1 | 4.6 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 0.4 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 0.3 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 0.3 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 5.6 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.1 | 0.6 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.1 | 0.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 1.1 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.1 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 1.1 | GO:0005922 | connexon complex(GO:0005922) |
| 0.1 | 0.2 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.1 | 0.5 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.1 | 2.1 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 1.9 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.1 | 0.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.1 | 0.1 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.1 | 0.8 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.3 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 1.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.8 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 0.5 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 0.5 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.0 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 3.1 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 0.3 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
| 0.0 | 0.0 | GO:0098574 | cytoplasmic side of lysosomal membrane(GO:0098574) |
| 0.0 | 0.5 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 4.0 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.9 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 0.7 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.0 | 0.1 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.0 | 6.6 | GO:0043209 | myelin sheath(GO:0043209) |
| 0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 2.0 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.6 | GO:0031091 | platelet alpha granule(GO:0031091) |
| 0.0 | 0.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 0.8 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.2 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.0 | 0.9 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 2.6 | GO:0036126 | sperm flagellum(GO:0036126) |
| 0.0 | 0.3 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.4 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 1.1 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.2 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.0 | 0.7 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.4 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.0 | 0.2 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.8 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.1 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.0 | 0.3 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.0 | 0.0 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.0 | 0.5 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.0 | 0.3 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.1 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.0 | 0.3 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.3 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.2 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.0 | 0.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.2 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 0.0 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.0 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.0 | GO:0070449 | elongin complex(GO:0070449) |
| 0.0 | 0.4 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.3 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.5 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.2 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.1 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 1.9 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.1 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.1 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 0.3 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.4 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.0 | 0.9 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.2 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
| 0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 0.1 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 0.0 | 0.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 7.4 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.1 | GO:0022624 | proteasome accessory complex(GO:0022624) |
| 0.0 | 1.1 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.0 | 0.2 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.0 | 0.3 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 1.7 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.0 | 0.8 | GO:0005902 | microvillus(GO:0005902) |
| 0.0 | 0.2 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.6 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.1 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.1 | GO:0060187 | cell pole(GO:0060187) |
| 0.0 | 49.7 | GO:0070062 | extracellular exosome(GO:0070062) |
| 0.0 | 0.1 | GO:0030677 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 0.0 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.7 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.3 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.0 | 0.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.0 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.7 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 0.2 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.0 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.0 | 0.0 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.7 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.3 | GO:0019028 | viral nucleocapsid(GO:0019013) viral capsid(GO:0019028) |
| 0.0 | 0.1 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.0 | GO:0015935 | small ribosomal subunit(GO:0015935) |
| 0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.2 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.6 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.0 | 0.1 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
| 0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.1 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.0 | 0.2 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.4 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 15.5 | GO:0005576 | extracellular region(GO:0005576) |
| 0.0 | 2.3 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.2 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.1 | GO:1903768 | sweet taste receptor complex(GO:1903767) taste receptor complex(GO:1903768) |
| 0.0 | 0.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.0 | 0.3 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.0 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.0 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.0 | 0.0 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.1 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.6 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.3 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.7 | 2.7 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.6 | 1.9 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.6 | 2.8 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.5 | 1.4 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.5 | 1.4 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.5 | 1.8 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.4 | 2.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.4 | 1.3 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.4 | 2.2 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.4 | 1.2 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.4 | 1.2 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.4 | 1.6 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.4 | 1.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.4 | 1.1 | GO:0004104 | acetylcholinesterase activity(GO:0003990) cholinesterase activity(GO:0004104) |
| 0.4 | 1.1 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.3 | 1.4 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) |
| 0.3 | 1.7 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.3 | 2.5 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.3 | 1.5 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.3 | 0.9 | GO:0033823 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
| 0.3 | 0.9 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.3 | 1.7 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.3 | 2.8 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.3 | 0.8 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.3 | 0.8 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
| 0.3 | 1.3 | GO:0070404 | NADH binding(GO:0070404) |
| 0.3 | 0.5 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.3 | 1.1 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.3 | 1.8 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.3 | 1.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.3 | 1.8 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.2 | 3.5 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.2 | 1.5 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.2 | 1.0 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.2 | 1.4 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.2 | 0.7 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.2 | 0.7 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.2 | 0.9 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.2 | 1.3 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.2 | 1.1 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.2 | 0.9 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.2 | 1.0 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.2 | 2.7 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.2 | 0.8 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.2 | 0.6 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.2 | 2.6 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.2 | 0.6 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.2 | 0.6 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.2 | 0.6 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.2 | 0.8 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.2 | 0.8 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.2 | 0.6 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.2 | 0.8 | GO:0045174 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.2 | 1.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.2 | 0.8 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.2 | 0.2 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.2 | 0.7 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.2 | 0.6 | GO:0004807 | triose-phosphate isomerase activity(GO:0004807) |
| 0.2 | 1.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.2 | 0.4 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.2 | 0.5 | GO:0047522 | 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.2 | 0.5 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.2 | 0.4 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.2 | 1.3 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.2 | 0.7 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.2 | 0.3 | GO:0004586 | ornithine decarboxylase activity(GO:0004586) |
| 0.2 | 1.4 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.2 | 0.5 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.2 | 0.7 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.2 | 0.5 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.2 | 0.5 | GO:0035539 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 0.2 | 0.7 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.2 | 0.5 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.2 | 1.0 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.2 | 1.3 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.2 | 1.4 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.2 | 0.5 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.2 | 0.5 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.2 | 0.5 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 0.2 | 1.1 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.2 | 0.5 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
| 0.2 | 0.8 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.2 | 1.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 0.4 | GO:0005503 | all-trans retinal binding(GO:0005503) benzaldehyde dehydrogenase activity(GO:0019115) S-(hydroxymethyl)glutathione dehydrogenase activity(GO:0051903) |
| 0.1 | 0.9 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 0.6 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.1 | 0.4 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.1 | 1.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 1.7 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 0.6 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.1 | 0.4 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.1 | 1.1 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 0.6 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 0.4 | GO:0004335 | galactokinase activity(GO:0004335) |
| 0.1 | 0.8 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.1 | 0.4 | GO:0046977 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 0.1 | 0.4 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.1 | 0.3 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
| 0.1 | 1.1 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.1 | 3.0 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 0.4 | GO:0030977 | taurine binding(GO:0030977) |
| 0.1 | 0.6 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.1 | 3.9 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 0.1 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.1 | 0.5 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 0.5 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.1 | 0.9 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 1.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.1 | 0.7 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.1 | 3.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.4 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 0.7 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.1 | 0.4 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.1 | 0.5 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.6 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 2.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 0.8 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 0.5 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 0.5 | GO:0004368 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) |
| 0.1 | 0.7 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.1 | 0.2 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.1 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.1 | 0.5 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.1 | 0.7 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.1 | 0.5 | GO:0033265 | choline binding(GO:0033265) |
| 0.1 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 1.6 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.7 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 1.7 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 0.2 | GO:0030283 | testosterone dehydrogenase [NAD(P)] activity(GO:0030283) |
| 0.1 | 0.8 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.9 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.1 | 0.8 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.1 | 0.2 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 1.9 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.1 | 0.3 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.1 | 0.6 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.1 | 0.8 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 0.8 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.7 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 0.1 | 0.3 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.1 | 0.7 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.3 | GO:0031780 | corticotropin hormone receptor binding(GO:0031780) type 5 melanocortin receptor binding(GO:0031783) |
| 0.1 | 0.8 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.1 | 0.4 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.9 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.1 | 0.4 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.1 | 0.3 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 1.1 | GO:0016918 | retinal binding(GO:0016918) |
| 0.1 | 0.4 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 1.8 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.1 | 0.3 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.1 | 0.3 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.1 | 0.3 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.1 | 0.8 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.1 | 0.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 0.5 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 0.2 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
| 0.1 | 0.1 | GO:0000703 | oxidized pyrimidine nucleobase lesion DNA N-glycosylase activity(GO:0000703) |
| 0.1 | 0.3 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 0.9 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.1 | 0.5 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 1.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.1 | 0.4 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.1 | 0.6 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 0.3 | GO:0004655 | porphobilinogen synthase activity(GO:0004655) |
| 0.1 | 0.3 | GO:0046592 | polyamine oxidase activity(GO:0046592) |
| 0.1 | 0.5 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.1 | 0.3 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.1 | 0.9 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.1 | 0.4 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.1 | 2.1 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.1 | 0.3 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.1 | 0.2 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 0.3 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.1 | 0.3 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.1 | 1.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 0.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 1.6 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.1 | 0.9 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 0.4 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.1 | 0.3 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.1 | 1.0 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 0.3 | GO:0016657 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.1 | 0.5 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.1 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.1 | 1.4 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.1 | 0.5 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.1 | 1.5 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.1 | 0.3 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.1 | 0.7 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
| 0.1 | 0.5 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 0.4 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.1 | 0.3 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 1.1 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.1 | 1.9 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.1 | 0.7 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 0.3 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.1 | 1.6 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.1 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
| 0.1 | 0.8 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.3 | GO:0004903 | growth hormone receptor activity(GO:0004903) |
| 0.1 | 1.5 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.6 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.1 | 1.7 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.2 | GO:0004781 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.1 | 0.3 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 0.3 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 0.2 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.1 | 0.3 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.1 | 0.6 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.3 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 1.3 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
| 0.1 | 0.3 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
| 0.1 | 0.7 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.4 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 2.3 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.1 | 0.2 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.1 | 0.4 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.5 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.1 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.1 | 0.4 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 0.1 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 0.2 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
| 0.1 | 0.4 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.1 | 0.8 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.1 | 0.6 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.3 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.1 | 0.2 | GO:0015389 | pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
| 0.1 | 2.5 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.1 | 1.3 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.1 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 1.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.2 | GO:0004918 | interleukin-8 receptor activity(GO:0004918) interleukin-8 binding(GO:0019959) |
| 0.1 | 0.1 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.1 | 0.2 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.1 | 0.3 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.1 | 0.6 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.1 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.1 | 0.5 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.1 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.1 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
| 0.1 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.8 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.1 | 0.2 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.1 | 1.1 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.4 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 0.4 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 0.3 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.1 | 0.3 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 0.1 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 0.4 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.1 | 0.3 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.9 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.1 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 0.4 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.1 | 0.3 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.9 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.2 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.1 | 5.0 | GO:0005179 | hormone activity(GO:0005179) |
| 0.1 | 0.1 | GO:0031782 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.1 | 0.2 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 0.4 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 0.4 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.1 | 0.2 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.1 | 0.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 1.2 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.1 | 0.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 0.1 | GO:0001032 | RNA polymerase III type 3 promoter DNA binding(GO:0001032) |
| 0.1 | 0.2 | GO:2001070 | starch binding(GO:2001070) |
| 0.1 | 0.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.2 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
| 0.1 | 0.3 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.1 | 0.2 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.1 | 0.4 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.1 | 0.4 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.5 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.4 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.1 | 0.2 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.1 | 0.3 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.1 | 1.0 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.8 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.2 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.1 | 0.2 | GO:0035276 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) ethanol binding(GO:0035276) |
| 0.1 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.8 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.1 | 0.8 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.1 | 0.3 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.1 | 14.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 0.3 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.1 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.1 | 0.8 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 0.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 0.2 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.1 | GO:0008106 | alcohol dehydrogenase (NADP+) activity(GO:0008106) |
| 0.1 | 0.3 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.1 | 1.6 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 1.5 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.3 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.4 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 1.5 | GO:0009055 | electron carrier activity(GO:0009055) |
| 0.1 | 0.6 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.1 | 0.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 0.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.6 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.1 | 0.2 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.1 | 1.3 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 1.7 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.1 | 0.2 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.1 | 0.1 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.1 | 0.3 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 0.2 | GO:0019809 | spermidine binding(GO:0019809) |
| 0.1 | 0.4 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.1 | 2.4 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.1 | 0.2 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.1 | 0.5 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.1 | 1.4 | GO:0016836 | hydro-lyase activity(GO:0016836) |
| 0.1 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 0.1 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.1 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.1 | 0.4 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.1 | 0.2 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.0 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.0 | 1.6 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.0 | 0.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.3 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.7 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.0 | 0.2 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.0 | 0.2 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 0.0 | 3.3 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 1.0 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.6 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.4 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.4 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 1.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.0 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.0 | 0.6 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.6 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.4 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.0 | 0.3 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 1.5 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.3 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.6 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.0 | 0.2 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 1.2 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.2 | GO:0042806 | fucose binding(GO:0042806) |
| 0.0 | 0.2 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.0 | 0.3 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.8 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.0 | 1.5 | GO:0016209 | antioxidant activity(GO:0016209) |
| 0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 1.0 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.3 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 0.3 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.0 | 0.1 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
| 0.0 | 0.5 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.4 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 1.4 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.5 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.2 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.2 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.0 | 2.3 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.2 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.1 | GO:0008254 | 3'-nucleotidase activity(GO:0008254) |
| 0.0 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.2 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.1 | GO:0019863 | IgE binding(GO:0019863) |
| 0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.1 | GO:0016492 | G-protein coupled neurotensin receptor activity(GO:0016492) |
| 0.0 | 0.3 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
| 0.0 | 0.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.0 | 0.1 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
| 0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.2 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.1 | GO:0015295 | solute:proton symporter activity(GO:0015295) |
| 0.0 | 0.1 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
| 0.0 | 0.6 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
| 0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.5 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.4 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
| 0.0 | 0.6 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.0 | 0.4 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.4 | GO:0015250 | water channel activity(GO:0015250) |
| 0.0 | 0.7 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0004058 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
| 0.0 | 0.1 | GO:1901612 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
| 0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 0.1 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.0 | 0.1 | GO:0051734 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.5 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) |
| 0.0 | 0.1 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.0 | 0.2 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.0 | 0.1 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) |
| 0.0 | 1.1 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.0 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.0 | 0.4 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.2 | GO:0070061 | fructose binding(GO:0070061) |
| 0.0 | 0.1 | GO:0052724 | inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.2 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.1 | GO:0004736 | pyruvate carboxylase activity(GO:0004736) |
| 0.0 | 0.3 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.9 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.3 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.1 | GO:0008265 | Mo-molybdopterin cofactor sulfurase activity(GO:0008265) |
| 0.0 | 0.2 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) |
| 0.0 | 0.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.2 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.1 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.0 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.8 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.1 | GO:0034512 | box C/D snoRNA binding(GO:0034512) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.1 | GO:0043121 | neurotrophin binding(GO:0043121) brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.3 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 2.1 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.0 | 0.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 2.0 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.0 | 0.1 | GO:0098603 | selenol Se-methyltransferase activity(GO:0098603) |
| 0.0 | 0.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.1 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.2 | GO:0016885 | CoA carboxylase activity(GO:0016421) ligase activity, forming carbon-carbon bonds(GO:0016885) |
| 0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.6 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.1 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.0 | 0.0 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.0 | 0.1 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.0 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.2 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.1 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.0 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.0 | 0.1 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
| 0.0 | 0.1 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.2 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.6 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.1 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.2 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.0 | 0.1 | GO:0036041 | long-chain fatty acid binding(GO:0036041) |
| 0.0 | 0.3 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.4 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.0 | 0.2 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 0.2 | GO:0050997 | quaternary ammonium group binding(GO:0050997) |
| 0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.2 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 0.2 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.1 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
| 0.0 | 0.5 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 0.1 | GO:0015556 | C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
| 0.0 | 0.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) lipopeptide binding(GO:0071723) |
| 0.0 | 0.4 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.2 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 3.6 | GO:0008236 | serine-type peptidase activity(GO:0008236) |
| 0.0 | 0.3 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.2 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.1 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.0 | 0.0 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.0 | 0.1 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.1 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.0 | 0.1 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.0 | 0.2 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 0.1 | GO:0047619 | acylcarnitine hydrolase activity(GO:0047619) |
| 0.0 | 0.3 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.1 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.0 | 0.2 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.0 | 0.1 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.2 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.1 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.0 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 0.1 | GO:0003842 | 1-pyrroline-5-carboxylate dehydrogenase activity(GO:0003842) |
| 0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.5 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.0 | 6.4 | GO:0005525 | GTP binding(GO:0005525) |
| 0.0 | 0.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.1 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.1 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.1 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.1 | GO:0036004 | GAF domain binding(GO:0036004) |
| 0.0 | 0.0 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 0.2 | GO:0015172 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
| 0.0 | 0.1 | GO:0015605 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) organophosphate ester transmembrane transporter activity(GO:0015605) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.1 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.7 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.3 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.0 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.0 | 0.2 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 0.2 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.0 | 0.1 | GO:0102391 | long-chain fatty acid-CoA ligase activity(GO:0004467) decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.3 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.0 | 0.0 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.0 | 0.1 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.0 | 0.1 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.4 | GO:0016830 | carbon-carbon lyase activity(GO:0016830) |
| 0.0 | 0.6 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.1 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.1 | GO:0019864 | IgG binding(GO:0019864) |
| 0.0 | 0.1 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.0 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 0.0 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.0 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.0 | 0.1 | GO:0009975 | cyclase activity(GO:0009975) |
| 0.0 | 0.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.9 | GO:0008201 | heparin binding(GO:0008201) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.4 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.2 | 0.6 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.2 | 0.2 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.2 | 1.4 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 0.3 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 0.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 0.9 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 3.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 1.9 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 2.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 4.3 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 2.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 1.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 1.5 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.1 | 2.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 1.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 0.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 4.3 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 3.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 5.5 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.1 | 1.8 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.1 | 0.6 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 0.4 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.1 | 2.3 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.1 | 0.4 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 0.5 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 1.6 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 0.6 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.1 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.4 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.0 | 0.5 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 0.7 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 12.8 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 1.8 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.2 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.6 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.9 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 0.5 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.0 | 1.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.4 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.7 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.3 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.5 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.5 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 0.5 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.0 | 0.2 | PID EPO PATHWAY | EPO signaling pathway |
| 0.0 | 0.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 1.7 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.6 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.1 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.7 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.5 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.2 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.3 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.7 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 4.0 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.2 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.4 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.2 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.3 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.5 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 3.0 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.1 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 0.4 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.4 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.6 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.2 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.1 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.3 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.4 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.0 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.3 | 0.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.3 | 1.5 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.2 | 0.2 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.2 | 3.5 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.2 | 3.6 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.2 | 2.7 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.2 | 2.4 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.2 | 2.4 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.2 | 1.7 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.2 | 1.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.2 | 2.9 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.2 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.2 | 3.1 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
| 0.1 | 2.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 1.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 3.1 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 2.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 1.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.1 | 0.9 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.1 | 0.8 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 1.4 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.1 | 1.9 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 2.4 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 1.0 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.1 | 3.3 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.1 | 0.3 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.1 | 1.4 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.1 | 3.1 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 1.5 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.1 | 6.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.1 | 1.6 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.1 | 2.6 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.1 | 4.9 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 1.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.1 | 1.6 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.1 | 1.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 0.5 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 3.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 0.9 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.1 | 1.6 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.1 | 1.0 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 8.4 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 0.9 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.1 | 0.8 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 2.6 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.1 | 0.9 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.1 | 1.1 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 1.8 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
| 0.1 | 0.5 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 1.1 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.1 | 0.6 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.1 | 1.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 0.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 1.0 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 1.3 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.1 | 1.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 2.5 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 0.3 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 1.4 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 2.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 1.7 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.1 | 1.2 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 0.4 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 0.7 | REACTOME AUTODEGRADATION OF CDH1 BY CDH1 APC C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |
| 0.1 | 0.3 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.1 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
| 0.1 | 1.3 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 0.6 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 0.9 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.1 | 0.6 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.1 | 1.9 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 0.5 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 0.5 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.1 | 1.0 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 1.0 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 1.0 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.1 | 4.4 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.1 | 0.3 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.1 | 1.9 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.0 | 0.8 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.6 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 5.7 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.6 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 1.2 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.3 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.0 | 0.6 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.5 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.4 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 1.3 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.5 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.1 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 2.9 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.5 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 2.0 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.7 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 0.0 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 1.0 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 0.0 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
| 0.0 | 0.6 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.0 | 0.6 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 1.1 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 1.0 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.9 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.0 | 5.3 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.0 | 0.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.0 | 0.2 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.0 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.0 | 0.7 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 0.3 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.0 | 0.7 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.0 | 0.5 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.4 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 0.9 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.2 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.3 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 2.9 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.5 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.2 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.3 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.0 | 0.0 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.1 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.0 | 0.5 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.0 | 0.1 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.2 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.0 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.7 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 0.5 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.2 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 1.0 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.3 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.2 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.2 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.0 | 0.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |