avrg: NHBE cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
ZEB1
|
ENSG00000148516.17 | ZEB1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| ZEB1 | hg19_v2_chr10_+_31610064_31610159 | -0.30 | 5.6e-01 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr2_+_220306238 | 0.90 |
ENST00000435853.1 |
SPEG |
SPEG complex locus |
| chr2_-_241835561 | 0.83 |
ENST00000388934.4 |
C2orf54 |
chromosome 2 open reading frame 54 |
| chr11_+_64004888 | 0.60 |
ENST00000541681.1 |
VEGFB |
vascular endothelial growth factor B |
| chr8_-_11660077 | 0.56 |
ENST00000533405.1 |
RP11-297N6.4 |
Uncharacterized protein |
| chr17_+_63096903 | 0.55 |
ENST00000582940.1 |
RP11-160O5.1 |
RP11-160O5.1 |
| chr16_-_74808710 | 0.50 |
ENST00000219368.3 ENST00000544337.1 |
FA2H |
fatty acid 2-hydroxylase |
| chr6_-_47445214 | 0.49 |
ENST00000604014.1 |
RP11-385F7.1 |
RP11-385F7.1 |
| chr3_+_113667354 | 0.49 |
ENST00000491556.1 |
ZDHHC23 |
zinc finger, DHHC-type containing 23 |
| chr19_+_6464243 | 0.46 |
ENST00000600229.1 ENST00000356762.3 |
CRB3 |
crumbs homolog 3 (Drosophila) |
| chr20_-_62199427 | 0.45 |
ENST00000427522.2 |
HELZ2 |
helicase with zinc finger 2, transcriptional coactivator |
| chr17_+_3539744 | 0.45 |
ENST00000046640.3 ENST00000381870.3 |
CTNS |
cystinosin, lysosomal cystine transporter |
| chr8_+_145726472 | 0.44 |
ENST00000528430.1 |
PPP1R16A |
protein phosphatase 1, regulatory subunit 16A |
| chr8_+_32406137 | 0.43 |
ENST00000521670.1 |
NRG1 |
neuregulin 1 |
| chr19_+_14017116 | 0.42 |
ENST00000589606.1 |
CC2D1A |
coiled-coil and C2 domain containing 1A |
| chr1_-_21948906 | 0.39 |
ENST00000374761.2 ENST00000599760.1 |
RAP1GAP |
RAP1 GTPase activating protein |
| chr4_-_2420335 | 0.38 |
ENST00000503000.1 |
ZFYVE28 |
zinc finger, FYVE domain containing 28 |
| chr19_+_35739631 | 0.38 |
ENST00000602003.1 ENST00000360798.3 ENST00000354900.3 |
LSR |
lipolysis stimulated lipoprotein receptor |
| chr1_-_153433120 | 0.38 |
ENST00000368723.3 |
S100A7 |
S100 calcium binding protein A7 |
| chr16_+_67280799 | 0.38 |
ENST00000566345.2 |
SLC9A5 |
solute carrier family 9, subfamily A (NHE5, cation proton antiporter 5), member 5 |
| chr19_-_40324767 | 0.37 |
ENST00000601972.1 ENST00000430012.2 ENST00000323039.5 ENST00000348817.3 |
DYRK1B |
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1B |
| chr1_-_153363452 | 0.37 |
ENST00000368732.1 ENST00000368733.3 |
S100A8 |
S100 calcium binding protein A8 |
| chr17_+_72428266 | 0.37 |
ENST00000582473.1 |
GPRC5C |
G protein-coupled receptor, family C, group 5, member C |
| chr10_+_99258625 | 0.37 |
ENST00000370664.3 |
UBTD1 |
ubiquitin domain containing 1 |
| chr1_-_47655686 | 0.37 |
ENST00000294338.2 |
PDZK1IP1 |
PDZK1 interacting protein 1 |
| chr17_-_39942322 | 0.37 |
ENST00000449889.1 ENST00000465293.1 |
JUP |
junction plakoglobin |
| chr19_+_35739597 | 0.35 |
ENST00000361790.3 |
LSR |
lipolysis stimulated lipoprotein receptor |
| chr14_-_69350920 | 0.35 |
ENST00000553290.1 |
ACTN1 |
actinin, alpha 1 |
| chr10_+_26986582 | 0.35 |
ENST00000376215.5 ENST00000376203.5 |
PDSS1 |
prenyl (decaprenyl) diphosphate synthase, subunit 1 |
| chr19_+_6464502 | 0.35 |
ENST00000308243.7 |
CRB3 |
crumbs homolog 3 (Drosophila) |
| chr19_-_37178284 | 0.35 |
ENST00000425254.2 ENST00000590952.1 ENST00000433232.1 |
AC074138.3 |
AC074138.3 |
| chr17_-_7165662 | 0.35 |
ENST00000571881.2 ENST00000360325.7 |
CLDN7 |
claudin 7 |
| chr22_+_27068766 | 0.34 |
ENST00000435162.1 ENST00000437071.1 ENST00000440816.1 ENST00000421253.1 |
CTA-211A9.5 |
CTA-211A9.5 |
| chr19_+_55897699 | 0.34 |
ENST00000558131.1 ENST00000558752.1 ENST00000458349.2 |
RPL28 |
ribosomal protein L28 |
| chr9_+_140119618 | 0.34 |
ENST00000359069.2 |
C9orf169 |
chromosome 9 open reading frame 169 |
| chr19_+_14017003 | 0.34 |
ENST00000318003.7 |
CC2D1A |
coiled-coil and C2 domain containing 1A |
| chr10_+_104404644 | 0.34 |
ENST00000462202.2 |
TRIM8 |
tripartite motif containing 8 |
| chr19_-_59010565 | 0.34 |
ENST00000594786.1 |
SLC27A5 |
solute carrier family 27 (fatty acid transporter), member 5 |
| chr8_-_25281747 | 0.33 |
ENST00000421054.2 |
GNRH1 |
gonadotropin-releasing hormone 1 (luteinizing-releasing hormone) |
| chr16_-_28936007 | 0.33 |
ENST00000568703.1 ENST00000567483.1 |
RABEP2 |
rabaptin, RAB GTPase binding effector protein 2 |
| chr1_-_1850697 | 0.33 |
ENST00000378598.4 ENST00000416272.1 ENST00000310991.3 |
TMEM52 |
transmembrane protein 52 |
| chr4_-_74904398 | 0.33 |
ENST00000296026.4 |
CXCL3 |
chemokine (C-X-C motif) ligand 3 |
| chr11_-_1619524 | 0.33 |
ENST00000412090.1 |
KRTAP5-2 |
keratin associated protein 5-2 |
| chr19_-_14316980 | 0.32 |
ENST00000361434.3 ENST00000340736.6 |
LPHN1 |
latrophilin 1 |
| chr4_-_40632605 | 0.32 |
ENST00000514014.1 |
RBM47 |
RNA binding motif protein 47 |
| chr1_-_55266865 | 0.32 |
ENST00000371274.4 |
TTC22 |
tetratricopeptide repeat domain 22 |
| chr22_-_31741757 | 0.31 |
ENST00000215919.3 |
PATZ1 |
POZ (BTB) and AT hook containing zinc finger 1 |
| chr19_+_46531127 | 0.31 |
ENST00000601033.1 |
CTC-344H19.4 |
CTC-344H19.4 |
| chr10_+_104221137 | 0.31 |
ENST00000366277.2 ENST00000238936.4 ENST00000369931.3 |
TMEM180 |
transmembrane protein 180 |
| chr1_-_223537475 | 0.30 |
ENST00000344029.6 ENST00000494793.2 ENST00000366878.4 ENST00000366877.3 |
SUSD4 |
sushi domain containing 4 |
| chr7_+_44788430 | 0.30 |
ENST00000457123.1 ENST00000309315.4 |
ZMIZ2 |
zinc finger, MIZ-type containing 2 |
| chr15_+_89182178 | 0.30 |
ENST00000559876.1 |
ISG20 |
interferon stimulated exonuclease gene 20kDa |
| chr20_+_31823792 | 0.29 |
ENST00000375413.4 ENST00000354297.4 ENST00000375422.2 |
BPIFA1 |
BPI fold containing family A, member 1 |
| chr19_-_18717627 | 0.28 |
ENST00000392386.3 |
CRLF1 |
cytokine receptor-like factor 1 |
| chr11_+_18287721 | 0.28 |
ENST00000356524.4 |
SAA1 |
serum amyloid A1 |
| chr19_+_35739782 | 0.28 |
ENST00000347609.4 |
LSR |
lipolysis stimulated lipoprotein receptor |
| chr14_-_50999373 | 0.28 |
ENST00000554273.1 |
MAP4K5 |
mitogen-activated protein kinase kinase kinase kinase 5 |
| chr6_+_2245982 | 0.28 |
ENST00000530346.1 ENST00000524770.1 ENST00000532124.1 ENST00000531092.1 ENST00000456943.2 ENST00000529893.1 |
GMDS-AS1 |
GMDS antisense RNA 1 (head to head) |
| chr12_-_25150373 | 0.28 |
ENST00000549828.1 |
C12orf77 |
chromosome 12 open reading frame 77 |
| chr11_+_18287801 | 0.28 |
ENST00000532858.1 ENST00000405158.2 |
SAA1 |
serum amyloid A1 |
| chr16_+_89753070 | 0.28 |
ENST00000353379.7 ENST00000505473.1 ENST00000564192.1 |
CDK10 |
cyclin-dependent kinase 10 |
| chr17_+_43299241 | 0.27 |
ENST00000328118.3 |
FMNL1 |
formin-like 1 |
| chr8_-_145742862 | 0.27 |
ENST00000524998.1 |
RECQL4 |
RecQ protein-like 4 |
| chr14_+_77647966 | 0.27 |
ENST00000554766.1 |
TMEM63C |
transmembrane protein 63C |
| chr1_+_209941942 | 0.27 |
ENST00000487271.1 ENST00000477431.1 |
TRAF3IP3 |
TRAF3 interacting protein 3 |
| chr12_+_6554021 | 0.27 |
ENST00000266557.3 |
CD27 |
CD27 molecule |
| chr14_+_78227105 | 0.27 |
ENST00000439131.2 ENST00000355883.3 ENST00000557011.1 ENST00000556047.1 |
C14orf178 |
chromosome 14 open reading frame 178 |
| chr19_-_11039261 | 0.26 |
ENST00000590329.1 ENST00000587943.1 ENST00000585858.1 ENST00000586748.1 ENST00000586575.1 ENST00000253031.2 |
YIPF2 |
Yip1 domain family, member 2 |
| chr4_+_57371509 | 0.26 |
ENST00000360096.2 |
ARL9 |
ADP-ribosylation factor-like 9 |
| chr1_-_27286897 | 0.26 |
ENST00000320567.5 |
C1orf172 |
chromosome 1 open reading frame 172 |
| chr2_+_130939235 | 0.26 |
ENST00000425361.1 ENST00000457492.1 |
MZT2B |
mitotic spindle organizing protein 2B |
| chr17_-_39942940 | 0.26 |
ENST00000310706.5 ENST00000393931.3 ENST00000424457.1 ENST00000591690.1 |
JUP |
junction plakoglobin |
| chr19_-_11039188 | 0.26 |
ENST00000588347.1 |
YIPF2 |
Yip1 domain family, member 2 |
| chr14_+_103592636 | 0.25 |
ENST00000333007.1 |
TNFAIP2 |
tumor necrosis factor, alpha-induced protein 2 |
| chr19_-_51512804 | 0.25 |
ENST00000594211.1 ENST00000376832.4 |
KLK9 |
kallikrein-related peptidase 9 |
| chr11_-_65314905 | 0.25 |
ENST00000527339.1 |
LTBP3 |
latent transforming growth factor beta binding protein 3 |
| chr1_+_79086088 | 0.25 |
ENST00000370751.5 ENST00000342282.3 |
IFI44L |
interferon-induced protein 44-like |
| chr7_+_66800928 | 0.25 |
ENST00000430244.1 |
RP11-166O4.5 |
RP11-166O4.5 |
| chr19_+_39897943 | 0.25 |
ENST00000600033.1 |
ZFP36 |
ZFP36 ring finger protein |
| chr17_-_76124812 | 0.24 |
ENST00000592063.1 ENST00000589271.1 ENST00000322933.4 ENST00000589553.1 |
TMC6 |
transmembrane channel-like 6 |
| chr13_-_99738867 | 0.24 |
ENST00000427887.1 |
DOCK9 |
dedicator of cytokinesis 9 |
| chr6_-_160148356 | 0.24 |
ENST00000401980.3 ENST00000545162.1 |
SOD2 |
superoxide dismutase 2, mitochondrial |
| chr3_+_52454971 | 0.24 |
ENST00000465863.1 |
PHF7 |
PHD finger protein 7 |
| chr12_+_6419877 | 0.24 |
ENST00000536531.1 |
PLEKHG6 |
pleckstrin homology domain containing, family G (with RhoGef domain) member 6 |
| chr19_+_35739897 | 0.24 |
ENST00000605618.1 ENST00000427250.1 ENST00000601623.1 |
LSR |
lipolysis stimulated lipoprotein receptor |
| chr1_+_3370990 | 0.24 |
ENST00000378378.4 |
ARHGEF16 |
Rho guanine nucleotide exchange factor (GEF) 16 |
| chr16_-_30006922 | 0.24 |
ENST00000564026.1 |
HIRIP3 |
HIRA interacting protein 3 |
| chr11_+_33061336 | 0.24 |
ENST00000602733.1 |
TCP11L1 |
t-complex 11, testis-specific-like 1 |
| chr3_-_49055991 | 0.23 |
ENST00000441576.2 ENST00000420952.2 ENST00000341949.4 ENST00000395462.4 |
DALRD3 |
DALR anticodon binding domain containing 3 |
| chr14_-_89960395 | 0.23 |
ENST00000555034.1 ENST00000553904.1 |
FOXN3 |
forkhead box N3 |
| chr11_-_67236691 | 0.23 |
ENST00000544903.1 ENST00000308022.2 ENST00000393877.3 ENST00000452789.2 |
TMEM134 |
transmembrane protein 134 |
| chr17_+_48351785 | 0.23 |
ENST00000507382.1 |
TMEM92 |
transmembrane protein 92 |
| chr12_+_7072354 | 0.23 |
ENST00000537269.1 |
U47924.27 |
U47924.27 |
| chr22_+_45148432 | 0.23 |
ENST00000389774.2 ENST00000396119.2 ENST00000336963.4 ENST00000356099.6 ENST00000412433.1 |
ARHGAP8 |
Rho GTPase activating protein 8 |
| chr6_-_31613280 | 0.23 |
ENST00000453833.1 |
BAG6 |
BCL2-associated athanogene 6 |
| chr19_+_55987998 | 0.23 |
ENST00000591164.1 |
ZNF628 |
zinc finger protein 628 |
| chr19_-_14016877 | 0.23 |
ENST00000454313.1 ENST00000591586.1 ENST00000346736.2 |
C19orf57 |
chromosome 19 open reading frame 57 |
| chr7_+_99905325 | 0.23 |
ENST00000332397.6 ENST00000437326.2 |
SPDYE3 |
speedy/RINGO cell cycle regulator family member E3 |
| chr11_-_64856497 | 0.23 |
ENST00000524632.1 ENST00000530719.1 |
AP003068.6 |
transmembrane protein 262 |
| chr19_-_17007026 | 0.23 |
ENST00000598792.1 |
CPAMD8 |
C3 and PZP-like, alpha-2-macroglobulin domain containing 8 |
| chr19_-_55791563 | 0.23 |
ENST00000588971.1 ENST00000255631.5 ENST00000587551.1 |
HSPBP1 |
HSPA (heat shock 70kDa) binding protein, cytoplasmic cochaperone 1 |
| chr14_+_101302041 | 0.23 |
ENST00000522618.1 |
MEG3 |
maternally expressed 3 (non-protein coding) |
| chr11_+_69061594 | 0.23 |
ENST00000441339.2 ENST00000308946.3 ENST00000535407.1 |
MYEOV |
myeloma overexpressed |
| chr8_+_32406179 | 0.23 |
ENST00000405005.3 |
NRG1 |
neuregulin 1 |
| chr5_+_133562095 | 0.23 |
ENST00000602919.1 |
CTD-2410N18.3 |
CTD-2410N18.3 |
| chr6_-_160166218 | 0.22 |
ENST00000537657.1 |
SOD2 |
superoxide dismutase 2, mitochondrial |
| chr9_-_140317605 | 0.22 |
ENST00000479452.1 ENST00000465160.2 |
EXD3 |
exonuclease 3'-5' domain containing 3 |
| chr21_-_31588338 | 0.22 |
ENST00000286809.1 |
CLDN8 |
claudin 8 |
| chr16_+_1832902 | 0.22 |
ENST00000262302.9 ENST00000563136.1 ENST00000565987.1 ENST00000543305.1 ENST00000568287.1 ENST00000565134.1 |
NUBP2 |
nucleotide binding protein 2 |
| chr8_-_79717750 | 0.22 |
ENST00000263851.4 ENST00000379113.2 |
IL7 |
interleukin 7 |
| chr11_+_65779283 | 0.22 |
ENST00000312134.2 |
CST6 |
cystatin E/M |
| chr21_-_31588365 | 0.22 |
ENST00000399899.1 |
CLDN8 |
claudin 8 |
| chr6_-_37225391 | 0.22 |
ENST00000356757.2 |
TMEM217 |
transmembrane protein 217 |
| chr11_+_73087309 | 0.22 |
ENST00000064780.2 ENST00000545687.1 |
RELT |
RELT tumor necrosis factor receptor |
| chr4_-_74964904 | 0.22 |
ENST00000508487.2 |
CXCL2 |
chemokine (C-X-C motif) ligand 2 |
| chr17_-_48277552 | 0.22 |
ENST00000507689.1 |
COL1A1 |
collagen, type I, alpha 1 |
| chr12_-_1703331 | 0.22 |
ENST00000339235.3 |
FBXL14 |
F-box and leucine-rich repeat protein 14 |
| chr5_-_147211226 | 0.22 |
ENST00000296695.5 |
SPINK1 |
serine peptidase inhibitor, Kazal type 1 |
| chr11_-_2292182 | 0.22 |
ENST00000331289.4 |
ASCL2 |
achaete-scute family bHLH transcription factor 2 |
| chr17_+_38334501 | 0.22 |
ENST00000541245.1 |
RAPGEFL1 |
Rap guanine nucleotide exchange factor (GEF)-like 1 |
| chr8_+_38065104 | 0.22 |
ENST00000521311.1 |
BAG4 |
BCL2-associated athanogene 4 |
| chr2_+_74212073 | 0.22 |
ENST00000441217.1 |
AC073046.25 |
AC073046.25 |
| chr11_+_72975524 | 0.22 |
ENST00000540342.1 ENST00000542092.1 |
P2RY6 |
pyrimidinergic receptor P2Y, G-protein coupled, 6 |
| chr3_+_32280159 | 0.22 |
ENST00000458535.2 ENST00000307526.3 |
CMTM8 |
CKLF-like MARVEL transmembrane domain containing 8 |
| chr12_-_80084333 | 0.21 |
ENST00000552637.1 |
PAWR |
PRKC, apoptosis, WT1, regulator |
| chr16_-_2168079 | 0.21 |
ENST00000488185.2 |
PKD1 |
polycystic kidney disease 1 (autosomal dominant) |
| chr9_-_34662651 | 0.21 |
ENST00000259631.4 |
CCL27 |
chemokine (C-C motif) ligand 27 |
| chr16_-_1823114 | 0.21 |
ENST00000177742.3 ENST00000397375.2 |
MRPS34 |
mitochondrial ribosomal protein S34 |
| chr19_-_19314162 | 0.21 |
ENST00000420605.3 ENST00000544883.1 ENST00000538165.2 ENST00000331552.7 |
NR2C2AP |
nuclear receptor 2C2-associated protein |
| chr11_-_441964 | 0.21 |
ENST00000332826.6 |
ANO9 |
anoctamin 9 |
| chr19_-_7939319 | 0.21 |
ENST00000539422.1 |
CTD-3193O13.9 |
Protein FLJ22184 |
| chr1_+_154975110 | 0.20 |
ENST00000535420.1 ENST00000368426.3 |
ZBTB7B |
zinc finger and BTB domain containing 7B |
| chr19_-_40324255 | 0.20 |
ENST00000593685.1 ENST00000600611.1 |
DYRK1B |
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1B |
| chr3_-_53080644 | 0.20 |
ENST00000497586.1 |
SFMBT1 |
Scm-like with four mbt domains 1 |
| chr17_-_80009650 | 0.20 |
ENST00000310496.4 |
RFNG |
RFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
| chr19_+_35630926 | 0.20 |
ENST00000588081.1 ENST00000589121.1 |
FXYD1 |
FXYD domain containing ion transport regulator 1 |
| chr3_+_47021168 | 0.20 |
ENST00000450053.3 ENST00000292309.5 ENST00000383740.2 |
NBEAL2 |
neurobeachin-like 2 |
| chr19_+_3721719 | 0.20 |
ENST00000589378.1 ENST00000382008.3 |
TJP3 |
tight junction protein 3 |
| chr3_+_167453026 | 0.20 |
ENST00000472941.1 |
SERPINI1 |
serpin peptidase inhibitor, clade I (neuroserpin), member 1 |
| chr1_+_8378140 | 0.20 |
ENST00000377479.2 |
SLC45A1 |
solute carrier family 45, member 1 |
| chr10_-_102746953 | 0.20 |
ENST00000523148.1 |
MRPL43 |
mitochondrial ribosomal protein L43 |
| chr12_+_123717967 | 0.20 |
ENST00000536130.1 ENST00000546132.1 |
C12orf65 |
chromosome 12 open reading frame 65 |
| chr2_+_90248739 | 0.20 |
ENST00000468879.1 |
IGKV1D-43 |
immunoglobulin kappa variable 1D-43 |
| chr16_-_67450325 | 0.20 |
ENST00000348579.2 |
ZDHHC1 |
zinc finger, DHHC-type containing 1 |
| chr6_+_31895467 | 0.19 |
ENST00000556679.1 ENST00000456570.1 |
CFB CFB |
complement factor B Complement factor B; Uncharacterized protein; cDNA FLJ55673, highly similar to Complement factor B |
| chr16_-_3086927 | 0.19 |
ENST00000572449.1 |
CCDC64B |
coiled-coil domain containing 64B |
| chr3_-_121740969 | 0.19 |
ENST00000393631.1 ENST00000273691.3 ENST00000344209.5 |
ILDR1 |
immunoglobulin-like domain containing receptor 1 |
| chr16_-_2301563 | 0.19 |
ENST00000562238.1 ENST00000566379.1 ENST00000301729.4 |
ECI1 |
enoyl-CoA delta isomerase 1 |
| chr16_+_69796209 | 0.19 |
ENST00000359154.2 ENST00000561780.1 ENST00000563659.1 ENST00000448661.1 |
WWP2 |
WW domain containing E3 ubiquitin protein ligase 2 |
| chr17_-_39684550 | 0.19 |
ENST00000455635.1 ENST00000361566.3 |
KRT19 |
keratin 19 |
| chr17_+_26833250 | 0.19 |
ENST00000577936.1 ENST00000579795.1 |
FOXN1 |
forkhead box N1 |
| chr11_+_72975559 | 0.19 |
ENST00000349767.2 |
P2RY6 |
pyrimidinergic receptor P2Y, G-protein coupled, 6 |
| chr19_-_10341948 | 0.19 |
ENST00000590320.1 ENST00000592342.1 ENST00000588952.1 |
S1PR2 DNMT1 |
sphingosine-1-phosphate receptor 2 DNA (cytosine-5-)-methyltransferase 1 |
| chr1_-_9262678 | 0.19 |
ENST00000437157.2 |
RP3-510D11.1 |
RP3-510D11.1 |
| chr3_-_50336548 | 0.19 |
ENST00000450489.1 ENST00000513170.1 ENST00000450982.1 |
NAT6 HYAL3 |
N-acetyltransferase 6 (GCN5-related) hyaluronoglucosaminidase 3 |
| chr19_+_36239576 | 0.19 |
ENST00000587751.1 |
LIN37 |
lin-37 homolog (C. elegans) |
| chr17_+_7123207 | 0.19 |
ENST00000584103.1 ENST00000579886.2 |
ACADVL |
acyl-CoA dehydrogenase, very long chain |
| chr10_+_12391685 | 0.19 |
ENST00000378845.1 |
CAMK1D |
calcium/calmodulin-dependent protein kinase ID |
| chr3_-_50336278 | 0.19 |
ENST00000359051.3 ENST00000417393.1 ENST00000442620.1 ENST00000452674.1 |
HYAL3 NAT6 |
hyaluronoglucosaminidase 3 N-acetyltransferase 6 (GCN5-related) |
| chr16_+_616995 | 0.19 |
ENST00000293874.2 ENST00000409527.2 ENST00000424439.2 ENST00000540585.1 |
PIGQ NHLRC4 |
phosphatidylinositol glycan anchor biosynthesis, class Q NHL repeat containing 4 |
| chr15_+_45722727 | 0.19 |
ENST00000396650.2 ENST00000558435.1 ENST00000344300.3 |
C15orf48 |
chromosome 15 open reading frame 48 |
| chr13_-_24476794 | 0.19 |
ENST00000382140.2 |
C1QTNF9B |
C1q and tumor necrosis factor related protein 9B |
| chrX_-_102565932 | 0.19 |
ENST00000372674.1 ENST00000372677.3 |
BEX2 |
brain expressed X-linked 2 |
| chr1_-_32827682 | 0.19 |
ENST00000432622.1 |
FAM229A |
family with sequence similarity 229, member A |
| chr19_+_56159362 | 0.19 |
ENST00000593069.1 ENST00000308964.3 |
CCDC106 |
coiled-coil domain containing 106 |
| chr8_+_22844913 | 0.19 |
ENST00000519685.1 |
RHOBTB2 |
Rho-related BTB domain containing 2 |
| chr14_+_75745477 | 0.19 |
ENST00000303562.4 ENST00000554617.1 ENST00000554212.1 ENST00000535987.1 ENST00000555242.1 |
FOS |
FBJ murine osteosarcoma viral oncogene homolog |
| chr16_+_4421841 | 0.19 |
ENST00000304735.3 |
VASN |
vasorin |
| chr16_-_3068171 | 0.19 |
ENST00000572154.1 ENST00000328796.4 |
CLDN6 |
claudin 6 |
| chr12_-_48276710 | 0.19 |
ENST00000550314.1 |
VDR |
vitamin D (1,25- dihydroxyvitamin D3) receptor |
| chr2_-_113999260 | 0.18 |
ENST00000468980.2 |
PAX8 |
paired box 8 |
| chr16_-_30134441 | 0.18 |
ENST00000395200.1 |
MAPK3 |
mitogen-activated protein kinase 3 |
| chr21_+_30503282 | 0.18 |
ENST00000399925.1 |
MAP3K7CL |
MAP3K7 C-terminal like |
| chr14_-_24732738 | 0.18 |
ENST00000558074.1 ENST00000560226.1 |
TGM1 |
transglutaminase 1 |
| chr16_-_66968265 | 0.18 |
ENST00000567511.1 ENST00000422424.2 |
FAM96B |
family with sequence similarity 96, member B |
| chr9_-_140142222 | 0.18 |
ENST00000344774.4 ENST00000388932.2 |
FAM166A |
family with sequence similarity 166, member A |
| chr19_-_45579762 | 0.18 |
ENST00000303809.2 |
ZNF296 |
zinc finger protein 296 |
| chr17_+_74732889 | 0.18 |
ENST00000591864.1 |
MFSD11 |
major facilitator superfamily domain containing 11 |
| chr22_-_42765174 | 0.18 |
ENST00000432473.1 ENST00000412060.1 ENST00000424852.1 |
Z83851.1 |
Z83851.1 |
| chr11_-_18270182 | 0.18 |
ENST00000528349.1 ENST00000526900.1 ENST00000529528.1 ENST00000414546.2 ENST00000256733.4 |
SAA2 |
serum amyloid A2 |
| chr14_-_105635090 | 0.18 |
ENST00000331782.3 ENST00000347004.2 |
JAG2 |
jagged 2 |
| chr1_-_52870104 | 0.18 |
ENST00000371568.3 |
ORC1 |
origin recognition complex, subunit 1 |
| chr17_+_3539998 | 0.18 |
ENST00000452111.1 ENST00000574776.1 ENST00000441220.2 ENST00000414524.2 |
CTNS |
cystinosin, lysosomal cystine transporter |
| chr19_+_18492973 | 0.18 |
ENST00000595973.2 |
GDF15 |
growth differentiation factor 15 |
| chr16_+_30006997 | 0.18 |
ENST00000304516.7 |
INO80E |
INO80 complex subunit E |
| chr19_+_41509851 | 0.18 |
ENST00000593831.1 ENST00000330446.5 |
CYP2B6 |
cytochrome P450, family 2, subfamily B, polypeptide 6 |
| chr20_+_49348109 | 0.18 |
ENST00000396039.1 |
PARD6B |
par-6 family cell polarity regulator beta |
| chr11_+_394196 | 0.18 |
ENST00000331563.2 ENST00000531857.1 |
PKP3 |
plakophilin 3 |
| chr12_-_58220078 | 0.18 |
ENST00000549039.1 |
CTDSP2 |
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase 2 |
| chr1_+_153330322 | 0.18 |
ENST00000368738.3 |
S100A9 |
S100 calcium binding protein A9 |
| chr17_-_79817091 | 0.18 |
ENST00000570907.1 |
P4HB |
prolyl 4-hydroxylase, beta polypeptide |
| chr22_+_41865109 | 0.18 |
ENST00000216254.4 ENST00000396512.3 |
ACO2 |
aconitase 2, mitochondrial |
| chr15_+_76030311 | 0.18 |
ENST00000543887.1 |
AC019294.1 |
AC019294.1 |
| chr19_-_2427536 | 0.18 |
ENST00000591871.1 |
TIMM13 |
translocase of inner mitochondrial membrane 13 homolog (yeast) |
| chr19_+_13906250 | 0.17 |
ENST00000254323.2 |
ZSWIM4 |
zinc finger, SWIM-type containing 4 |
| chr2_-_72374948 | 0.17 |
ENST00000546307.1 ENST00000474509.1 |
CYP26B1 |
cytochrome P450, family 26, subfamily B, polypeptide 1 |
| chr7_+_150065879 | 0.17 |
ENST00000397281.2 ENST00000444957.1 ENST00000466559.1 ENST00000489432.2 ENST00000475514.1 ENST00000482680.1 ENST00000488943.1 ENST00000518514.1 ENST00000478789.1 |
REPIN1 ZNF775 |
replication initiator 1 zinc finger protein 775 |
| chr1_+_209941827 | 0.17 |
ENST00000367023.1 |
TRAF3IP3 |
TRAF3 interacting protein 3 |
| chr1_-_235098935 | 0.17 |
ENST00000423175.1 |
RP11-443B7.1 |
RP11-443B7.1 |
| chr19_-_46627914 | 0.17 |
ENST00000341415.2 |
IGFL3 |
IGF-like family member 3 |
| chr19_+_56159509 | 0.17 |
ENST00000586790.1 ENST00000591578.1 ENST00000588740.1 |
CCDC106 |
coiled-coil domain containing 106 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 1.4 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.2 | 0.2 | GO:0046356 | acetyl-CoA catabolic process(GO:0046356) |
| 0.2 | 0.5 | GO:2000656 | regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
| 0.1 | 0.4 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.1 | 0.6 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 0.5 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.1 | 0.9 | GO:0038129 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) ERBB3 signaling pathway(GO:0038129) |
| 0.1 | 0.8 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.1 | 0.5 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.1 | 0.3 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.1 | 0.5 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 0.3 | GO:0035981 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.1 | 0.4 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 | 0.8 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.1 | 0.3 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.1 | 0.6 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.1 | 0.3 | GO:0072003 | kidney rudiment formation(GO:0072003) |
| 0.1 | 0.3 | GO:1900190 | biofilm formation(GO:0042710) single-species biofilm formation(GO:0044010) single-species biofilm formation in or on host organism(GO:0044407) regulation of single-species biofilm formation(GO:1900190) negative regulation of single-species biofilm formation(GO:1900191) regulation of single-species biofilm formation in or on host organism(GO:1900228) negative regulation of single-species biofilm formation in or on host organism(GO:1900229) |
| 0.1 | 0.5 | GO:0045229 | cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 0.1 | 0.3 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.1 | 0.4 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 | 0.3 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.1 | 0.2 | GO:1904351 | negative regulation of protein catabolic process in the vacuole(GO:1904351) negative regulation of lysosomal protein catabolic process(GO:1905166) |
| 0.1 | 0.2 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) negative regulation of chloride transport(GO:2001226) |
| 0.1 | 0.3 | GO:1904566 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.1 | 0.3 | GO:0032771 | regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) positive regulation of melanosome transport(GO:1902910) |
| 0.1 | 0.2 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.1 | 0.5 | GO:0010734 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.1 | 0.3 | GO:0060032 | notochord regression(GO:0060032) |
| 0.1 | 0.2 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 0.5 | GO:0016128 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.1 | 0.3 | GO:0072287 | metanephric distal tubule morphogenesis(GO:0072287) |
| 0.1 | 0.1 | GO:1900211 | mesenchymal cell apoptotic process involved in metanephros development(GO:1900200) regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900211) negative regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900212) |
| 0.1 | 0.3 | GO:0009608 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
| 0.1 | 0.3 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.1 | 0.4 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.1 | 0.4 | GO:0052565 | response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
| 0.1 | 0.2 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.1 | 0.1 | GO:0031346 | positive regulation of cell projection organization(GO:0031346) |
| 0.1 | 0.2 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.1 | 0.2 | GO:1902566 | regulation of eosinophil degranulation(GO:0043309) positive regulation of eosinophil degranulation(GO:0043311) regulation of eosinophil activation(GO:1902566) positive regulation of eosinophil activation(GO:1902568) |
| 0.1 | 0.2 | GO:0061713 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) |
| 0.1 | 0.2 | GO:1903939 | negative regulation of histone H3-K9 dimethylation(GO:1900110) regulation of TORC2 signaling(GO:1903939) |
| 0.1 | 0.3 | GO:0052027 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.1 | 0.2 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.1 | 0.3 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 | 0.1 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.1 | 0.2 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.1 | 0.2 | GO:1903450 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
| 0.1 | 0.2 | GO:1903824 | regulation of telomere maintenance via recombination(GO:0032207) negative regulation of telomere maintenance via recombination(GO:0032208) negative regulation of single strand break repair(GO:1903517) negative regulation of beta-galactosidase activity(GO:1903770) telomere single strand break repair(GO:1903823) negative regulation of telomere single strand break repair(GO:1903824) |
| 0.1 | 0.4 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.1 | 0.1 | GO:0035249 | synaptic transmission, glutamatergic(GO:0035249) |
| 0.1 | 0.2 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 0.4 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.1 | 0.2 | GO:0032848 | negative regulation of cellular pH reduction(GO:0032848) CD8-positive, alpha-beta T cell lineage commitment(GO:0043375) negative regulation of retinal cell programmed cell death(GO:0046671) |
| 0.1 | 0.4 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.2 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.1 | 0.2 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.0 | 0.1 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.0 | 0.3 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.0 | 0.2 | GO:1903381 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.0 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.2 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
| 0.0 | 0.0 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.0 | 0.3 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.0 | 0.2 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.0 | 0.2 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.0 | 0.3 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.0 | 0.5 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
| 0.0 | 0.0 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.0 | 0.2 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.0 | 0.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.0 | 0.2 | GO:0032796 | uropod organization(GO:0032796) |
| 0.0 | 0.3 | GO:0060482 | lobar bronchus development(GO:0060482) |
| 0.0 | 0.5 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.4 | GO:1904379 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.0 | 0.2 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.0 | 0.2 | GO:0045013 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.0 | 0.2 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.0 | 0.3 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.0 | 0.2 | GO:0014874 | response to stimulus involved in regulation of muscle adaptation(GO:0014874) |
| 0.0 | 0.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.2 | GO:0044028 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.0 | 0.1 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
| 0.0 | 0.2 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.0 | 0.0 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.1 | GO:0098582 | innate vocalization behavior(GO:0098582) |
| 0.0 | 0.2 | GO:1901993 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.0 | 0.0 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.0 | 0.1 | GO:0009100 | glycoprotein metabolic process(GO:0009100) |
| 0.0 | 0.2 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.3 | GO:0002440 | production of molecular mediator of immune response(GO:0002440) |
| 0.0 | 0.1 | GO:0018282 | metal incorporation into metallo-sulfur cluster(GO:0018282) iron incorporation into metallo-sulfur cluster(GO:0018283) |
| 0.0 | 0.1 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.0 | 0.2 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.0 | 0.6 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.0 | 0.2 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
| 0.0 | 0.2 | GO:0060579 | ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.0 | 0.1 | GO:0021644 | vagus nerve morphogenesis(GO:0021644) |
| 0.0 | 0.2 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.0 | 0.1 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.0 | 0.1 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.0 | 0.4 | GO:0032119 | sequestering of zinc ion(GO:0032119) |
| 0.0 | 1.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.0 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.0 | 0.1 | GO:1904204 | skeletal muscle hypertrophy(GO:0014734) regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.0 | 0.2 | GO:1901859 | negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0048075 | positive regulation of eye pigmentation(GO:0048075) |
| 0.0 | 0.8 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.0 | 0.1 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) |
| 0.0 | 0.1 | GO:1904428 | negative regulation of tubulin deacetylation(GO:1904428) |
| 0.0 | 0.2 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 0.0 | 0.3 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.4 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.2 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.0 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.0 | 0.2 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.0 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.0 | 0.1 | GO:0060129 | thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 0.0 | 0.2 | GO:0001555 | oocyte growth(GO:0001555) |
| 0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.0 | 0.5 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.0 | 0.1 | GO:0045659 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.0 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.2 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.0 | 0.3 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.1 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.0 | 0.1 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.0 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 | 0.0 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 0.1 | GO:0044035 | multi-organism catabolic process(GO:0044035) development of symbiont involved in interaction with host(GO:0044115) modulation of development of symbiont involved in interaction with host(GO:0044145) negative regulation of development of symbiont involved in interaction with host(GO:0044147) metabolism of substance in other organism involved in symbiotic interaction(GO:0052214) catabolism of substance in other organism involved in symbiotic interaction(GO:0052227) metabolism of macromolecule in other organism involved in symbiotic interaction(GO:0052229) catabolism by host of symbiont macromolecule(GO:0052360) catabolism by organism of macromolecule in other organism involved in symbiotic interaction(GO:0052361) catabolism by host of symbiont protein(GO:0052362) catabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052363) catabolism by host of substance in symbiont(GO:0052364) metabolism by host of symbiont macromolecule(GO:0052416) metabolism by host of symbiont protein(GO:0052417) metabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052418) metabolism by host of substance in symbiont(GO:0052419) |
| 0.0 | 0.1 | GO:0003409 | optic cup structural organization(GO:0003409) oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.0 | 0.1 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.0 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.5 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.0 | 0.1 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.0 | 0.1 | GO:0018262 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
| 0.0 | 0.1 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.0 | 0.6 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
| 0.0 | 0.1 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.0 | 0.1 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.0 | 0.1 | GO:2000170 | negative regulation of gap junction assembly(GO:1903597) positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.0 | 0.1 | GO:0045337 | geranyl diphosphate metabolic process(GO:0033383) geranyl diphosphate biosynthetic process(GO:0033384) farnesyl diphosphate biosynthetic process(GO:0045337) farnesyl diphosphate metabolic process(GO:0045338) |
| 0.0 | 0.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.1 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.0 | 0.5 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 | 0.1 | GO:0051246 | regulation of protein metabolic process(GO:0051246) |
| 0.0 | 0.1 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.0 | 0.1 | GO:0030807 | positive regulation of cyclic nucleotide catabolic process(GO:0030807) positive regulation of cAMP catabolic process(GO:0030822) positive regulation of purine nucleotide catabolic process(GO:0033123) |
| 0.0 | 0.6 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.1 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.0 | 0.0 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.0 | 0.2 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.0 | GO:0036482 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.0 | 0.2 | GO:0071486 | cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 0.0 | 0.1 | GO:1903979 | negative regulation of microglial cell activation(GO:1903979) |
| 0.0 | 0.4 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.8 | GO:0030220 | platelet formation(GO:0030220) |
| 0.0 | 0.1 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.0 | 0.1 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.0 | 0.0 | GO:0006816 | calcium ion transport(GO:0006816) |
| 0.0 | 0.1 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.0 | 0.1 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 | 0.2 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.0 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.0 | 0.1 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.0 | 0.1 | GO:0019085 | early viral transcription(GO:0019085) |
| 0.0 | 0.4 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.0 | 0.2 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.0 | 0.1 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.0 | 0.1 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.0 | 0.3 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.0 | 0.1 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.0 | 0.1 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.0 | 0.1 | GO:1904899 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.0 | 0.2 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.0 | 0.1 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
| 0.0 | 0.2 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.0 | GO:0002514 | B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) |
| 0.0 | 0.2 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.0 | 0.1 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.0 | 0.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.0 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.0 | 0.1 | GO:1990654 | sebum secreting cell proliferation(GO:1990654) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.2 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.0 | 0.0 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
| 0.0 | 0.2 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.8 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.1 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.0 | 0.1 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.0 | 0.1 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.0 | 0.1 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.0 | 0.1 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 0.0 | 0.4 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.1 | GO:0060214 | endocardium formation(GO:0060214) |
| 0.0 | 0.0 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.2 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
| 0.0 | 0.1 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.0 | 0.5 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.0 | 0.2 | GO:0051715 | cytolysis in other organism(GO:0051715) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.1 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.0 | 0.2 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.0 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.2 | GO:0030473 | nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) |
| 0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.3 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.0 | 0.1 | GO:0051673 | membrane disruption in other organism(GO:0051673) |
| 0.0 | 0.2 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.0 | 0.1 | GO:0061485 | memory T cell proliferation(GO:0061485) |
| 0.0 | 0.1 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.0 | 0.1 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.0 | 0.0 | GO:0072209 | metanephric mesangial cell differentiation(GO:0072209) metanephric glomerular mesangial cell differentiation(GO:0072254) |
| 0.0 | 0.3 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.0 | 0.1 | GO:1901545 | cellular response to raffinose(GO:0097403) response to raffinose(GO:1901545) |
| 0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.0 | 0.2 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.0 | 0.1 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.0 | 0.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.1 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.0 | 0.1 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
| 0.0 | 0.1 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.0 | 0.2 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.0 | 0.1 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.0 | 0.1 | GO:0070431 | nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.0 | 0.1 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.0 | 0.0 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.1 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
| 0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 | 0.2 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
| 0.0 | 0.1 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
| 0.0 | 0.3 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 | 0.7 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.0 | GO:0097069 | cellular response to thyroxine stimulus(GO:0097069) cellular response to L-phenylalanine derivative(GO:1904387) |
| 0.0 | 0.3 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.0 | 0.1 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.0 | GO:0072387 | flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.0 | 0.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.0 | 0.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 0.1 | GO:1902941 | positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) regulation of voltage-gated chloride channel activity(GO:1902941) positive regulation of voltage-gated chloride channel activity(GO:1902943) |
| 0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.0 | 0.1 | GO:0002729 | positive regulation of natural killer cell cytokine production(GO:0002729) |
| 0.0 | 0.0 | GO:0070904 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.0 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.0 | GO:0051389 | inactivation of MAPKK activity(GO:0051389) |
| 0.0 | 0.0 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
| 0.0 | 0.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.1 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.0 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.0 | 0.5 | GO:0050716 | positive regulation of interleukin-1 secretion(GO:0050716) |
| 0.0 | 0.1 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
| 0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) determination of liver left/right asymmetry(GO:0071910) |
| 0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.1 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
| 0.0 | 0.1 | GO:0006050 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.0 | 0.1 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.0 | 0.1 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.0 | 0.1 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
| 0.0 | 0.1 | GO:0043585 | nose morphogenesis(GO:0043585) |
| 0.0 | 0.1 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.0 | 0.4 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.0 | 0.2 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 | 0.0 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.0 | 0.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.0 | 0.1 | GO:0030819 | positive regulation of cAMP biosynthetic process(GO:0030819) |
| 0.0 | 0.1 | GO:0045209 | MAPK phosphatase export from nucleus(GO:0045208) MAPK phosphatase export from nucleus, leptomycin B sensitive(GO:0045209) |
| 0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.0 | 0.1 | GO:0019303 | D-ribose catabolic process(GO:0019303) |
| 0.0 | 0.2 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.0 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.0 | GO:0070105 | positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.0 | 0.0 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.0 | 0.0 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.0 | 0.1 | GO:0030324 | lung development(GO:0030324) |
| 0.0 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.0 | 0.1 | GO:0050428 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.0 | 0.1 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
| 0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 | 0.3 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.0 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.0 | 0.1 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
| 0.0 | 0.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.0 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.0 | 0.1 | GO:0099566 | regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 0.0 | 0.1 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.0 | 0.1 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.0 | 0.1 | GO:0010958 | regulation of amino acid import(GO:0010958) |
| 0.0 | 0.3 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.0 | 0.0 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.0 | 0.1 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 0.0 | GO:0048754 | branching morphogenesis of an epithelial tube(GO:0048754) |
| 0.0 | 0.1 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.2 | GO:0031274 | regulation of pseudopodium assembly(GO:0031272) positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.1 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 | 0.0 | GO:0034344 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.0 | 0.0 | GO:0042704 | uterine wall breakdown(GO:0042704) |
| 0.0 | 0.6 | GO:0007520 | myoblast fusion(GO:0007520) |
| 0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.1 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.0 | 0.0 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 0.0 | 0.1 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) |
| 0.0 | 0.0 | GO:0061525 | hindgut development(GO:0061525) |
| 0.0 | 0.1 | GO:0015864 | pyrimidine nucleoside transport(GO:0015864) |
| 0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.0 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.0 | 0.0 | GO:0031455 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.0 | 0.0 | GO:0048749 | compound eye development(GO:0048749) |
| 0.0 | 0.1 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.0 | 0.3 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.0 | 0.0 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.0 | 0.0 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 | 0.0 | GO:0040023 | establishment of nucleus localization(GO:0040023) |
| 0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.3 | GO:0036065 | fucosylation(GO:0036065) |
| 0.0 | 0.0 | GO:0043438 | acetoacetic acid metabolic process(GO:0043438) |
| 0.0 | 0.0 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.0 | 0.0 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 0.0 | 0.0 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 0.0 | 0.1 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.1 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.1 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 | 0.1 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.0 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.0 | 0.0 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 0.0 | 0.0 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.0 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.1 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.6 | GO:0071665 | gamma-catenin-TCF7L2 complex(GO:0071665) |
| 0.1 | 1.6 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.2 | GO:0005584 | collagen type I trimer(GO:0005584) |
| 0.1 | 0.5 | GO:0097361 | CIA complex(GO:0097361) |
| 0.1 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.2 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.3 | GO:0002133 | polycystin complex(GO:0002133) |
| 0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.3 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 1.5 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.2 | GO:0031166 | integral component of vacuolar membrane(GO:0031166) |
| 0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.2 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.0 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.0 | 0.1 | GO:1990666 | PCSK9-LDLR complex(GO:1990666) |
| 0.0 | 0.3 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 0.4 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.0 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.3 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.0 | 0.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 1.3 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.0 | 0.1 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.0 | 0.2 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.8 | GO:0071682 | endocytic vesicle lumen(GO:0071682) |
| 0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.0 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.0 | 0.1 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:0031310 | intrinsic component of endosome membrane(GO:0031302) intrinsic component of vacuolar membrane(GO:0031310) |
| 0.0 | 0.7 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.2 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.1 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.2 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.0 | 0.1 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.1 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.0 | 0.2 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.3 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.0 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.4 | GO:0032059 | bleb(GO:0032059) |
| 0.0 | 0.2 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.0 | 0.1 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.0 | 0.1 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.0 | 0.1 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.0 | 0.4 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.5 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.0 | 0.0 | GO:0031261 | nuclear pre-replicative complex(GO:0005656) DNA replication preinitiation complex(GO:0031261) pre-replicative complex(GO:0036387) |
| 0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.0 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.0 | 0.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.0 | 0.1 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.0 | 0.1 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.0 | 0.0 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.1 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.0 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.1 | GO:0043260 | laminin-11 complex(GO:0043260) |
| 0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.1 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.0 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.0 | 0.3 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.0 | 0.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.4 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.0 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.0 | GO:0000806 | Y chromosome(GO:0000806) |
| 0.0 | 0.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.0 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.5 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 0.2 | 0.6 | GO:0005199 | structural constituent of cell wall(GO:0005199) |
| 0.1 | 0.7 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.1 | 0.3 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.1 | 0.1 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.1 | 0.8 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.1 | 0.6 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
| 0.1 | 0.6 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.1 | 0.4 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.1 | 0.5 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.1 | 0.9 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.2 | GO:0042356 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
| 0.1 | 0.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.1 | 0.2 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.1 | 0.2 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.1 | 0.3 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.2 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.1 | 0.3 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.1 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 0.7 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.1 | 0.2 | GO:0051996 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
| 0.1 | 0.2 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 0.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.1 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
| 0.0 | 0.7 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.2 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.0 | 0.3 | GO:0004084 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.0 | 0.2 | GO:0061714 | folic acid receptor activity(GO:0061714) |
| 0.0 | 0.5 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.0 | 0.2 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.0 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.1 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.0 | 0.2 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.0 | 0.2 | GO:1903135 | cupric ion binding(GO:1903135) |
| 0.0 | 0.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.1 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.0 | 0.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.3 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.1 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.0 | 0.2 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.0 | 0.0 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.2 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.2 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.1 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.0 | 0.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 0.4 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.0 | 0.2 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.2 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.0 | 0.1 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 0.1 | GO:0031812 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.0 | 0.8 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.1 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.2 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.0 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.1 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.0 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.0 | 0.1 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.0 | 0.1 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.1 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.0 | 0.1 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.1 | GO:0047888 | fatty acid peroxidase activity(GO:0047888) |
| 0.0 | 0.1 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.0 | 0.1 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.4 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.0 | 0.2 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.2 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.0 | 0.0 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.0 | 0.1 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.0 | 0.2 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.0 | 0.2 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.1 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.8 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.4 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.0 | 0.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.2 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.0 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.0 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.1 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.0 | 0.0 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.0 | 0.7 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.1 | GO:0005055 | laminin receptor activity(GO:0005055) |
| 0.0 | 0.1 | GO:0016672 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.0 | 0.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.0 | 0.3 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.1 | GO:0017060 | 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase activity(GO:0017060) |
| 0.0 | 0.4 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.0 | 0.1 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.0 | 0.4 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.1 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.0 | 0.1 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.0 | 0.1 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.0 | 0.1 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.0 | 0.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.0 | 0.4 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.4 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.1 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
| 0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.5 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.1 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.0 | 0.0 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.0 | 0.2 | GO:0045125 | sphingosine-1-phosphate receptor activity(GO:0038036) bioactive lipid receptor activity(GO:0045125) |
| 0.0 | 0.0 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 1.3 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.1 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.0 | 0.6 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.0 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.0 | 0.1 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.1 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.0 | GO:0015229 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 0.0 | GO:0003870 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.4 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.0 | 0.4 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.3 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.0 | 0.1 | GO:0098960 | postsynaptic neurotransmitter receptor activity(GO:0098960) |
| 0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.1 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.1 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.0 | 0.4 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.1 | GO:0015389 | pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
| 0.0 | 0.4 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.1 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.1 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 0.0 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
| 0.0 | 0.0 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.0 | 0.2 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.2 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.0 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.4 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.3 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.3 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.1 | GO:0004797 | thymidine kinase activity(GO:0004797) |
| 0.0 | 0.1 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.0 | 0.0 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.0 | 0.0 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 0.0 | 0.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.0 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.1 | GO:0052739 | phosphatidylserine 1-acylhydrolase activity(GO:0052739) |
| 0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.0 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.0 | 0.0 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.0 | 0.0 | GO:0031731 | CCR6 chemokine receptor binding(GO:0031731) |
| 0.0 | 0.2 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.0 | 0.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.0 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.0 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.0 | 0.5 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.0 | GO:0022832 | voltage-gated ion channel activity(GO:0005244) voltage-gated channel activity(GO:0022832) |
| 0.0 | 0.1 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.0 | 0.1 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.0 | 0.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.0 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.0 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.0 | 0.1 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.3 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.0 | 0.0 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.2 | GO:0042608 | T cell receptor binding(GO:0042608) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.7 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 1.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.7 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 0.9 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 1.0 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.0 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.9 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.2 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.0 | 0.4 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 0.0 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 0.2 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.5 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.2 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 0.2 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 0.8 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.2 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.8 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 0.9 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.0 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.0 | 0.9 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.4 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 2.1 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.7 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
| 0.0 | 1.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.3 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 0.5 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.6 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.9 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 1.4 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.0 | 0.3 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.4 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.4 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 0.4 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.5 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 0.3 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.4 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.1 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.4 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 1.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 0.2 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.0 | 0.5 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.5 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |