avrg: NHBE cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
RCOR1
|
ENSG00000089902.8 | RCOR1 |
|
MTA3
|
ENSG00000057935.9 | MTA3 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| RCOR1 | hg19_v2_chr14_+_103058948_103059005 | 0.92 | 9.4e-03 | Click! |
| MTA3 | hg19_v2_chr2_+_42795745_42795824 | 0.83 | 4.0e-02 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr19_-_48673465 | 2.12 |
ENST00000598938.1 |
LIG1 |
ligase I, DNA, ATP-dependent |
| chr21_+_38338737 | 2.08 |
ENST00000430068.1 |
AP000704.5 |
AP000704.5 |
| chr21_+_37529055 | 1.76 |
ENST00000270190.4 |
DOPEY2 |
dopey family member 2 |
| chr9_+_96928516 | 1.48 |
ENST00000602703.1 |
RP11-2B6.3 |
RP11-2B6.3 |
| chr6_-_110500826 | 1.42 |
ENST00000265601.3 ENST00000447287.1 ENST00000444391.1 |
WASF1 |
WAS protein family, member 1 |
| chr10_-_126849626 | 1.37 |
ENST00000530884.1 |
CTBP2 |
C-terminal binding protein 2 |
| chr3_+_121554046 | 1.29 |
ENST00000273668.2 ENST00000451944.2 |
EAF2 |
ELL associated factor 2 |
| chr2_-_178129551 | 1.27 |
ENST00000430047.1 |
NFE2L2 |
nuclear factor, erythroid 2-like 2 |
| chr9_-_4679419 | 1.22 |
ENST00000609131.1 ENST00000607997.1 |
RP11-6J24.6 |
RP11-6J24.6 |
| chr17_-_72968837 | 1.18 |
ENST00000581676.1 |
HID1 |
HID1 domain containing |
| chr17_-_41465674 | 1.18 |
ENST00000592135.1 ENST00000587874.1 ENST00000588654.1 ENST00000592094.1 |
LINC00910 |
long intergenic non-protein coding RNA 910 |
| chrX_-_135056106 | 1.14 |
ENST00000433339.2 |
MMGT1 |
membrane magnesium transporter 1 |
| chr11_-_111383064 | 1.13 |
ENST00000525791.1 ENST00000456861.2 ENST00000356018.2 |
BTG4 |
B-cell translocation gene 4 |
| chr12_+_105724613 | 1.13 |
ENST00000549934.2 |
C12orf75 |
chromosome 12 open reading frame 75 |
| chr11_-_12030681 | 1.10 |
ENST00000529338.1 |
DKK3 |
dickkopf WNT signaling pathway inhibitor 3 |
| chr8_+_103876528 | 1.09 |
ENST00000522939.1 ENST00000524007.1 |
KB-1507C5.2 |
HCG15011, isoform CRA_a; Protein LOC100996457 |
| chr3_+_178865887 | 1.09 |
ENST00000477735.1 |
PIK3CA |
phosphatidylinositol-4,5-bisphosphate 3-kinase, catalytic subunit alpha |
| chr19_+_57742369 | 1.07 |
ENST00000415300.2 ENST00000448930.1 |
AURKC |
aurora kinase C |
| chr1_+_6052700 | 1.07 |
ENST00000378092.1 ENST00000445501.1 |
KCNAB2 |
potassium voltage-gated channel, shaker-related subfamily, beta member 2 |
| chr11_+_12108410 | 1.06 |
ENST00000527997.1 |
RP13-631K18.5 |
RP13-631K18.5 |
| chr1_+_120839005 | 1.05 |
ENST00000369390.3 ENST00000452190.1 |
FAM72B |
family with sequence similarity 72, member B |
| chr21_-_38338773 | 1.03 |
ENST00000399120.1 ENST00000419461.1 |
HLCS |
holocarboxylase synthetase (biotin-(proprionyl-CoA-carboxylase (ATP-hydrolysing)) ligase) |
| chr2_+_9563769 | 1.03 |
ENST00000475482.1 |
CPSF3 |
cleavage and polyadenylation specific factor 3, 73kDa |
| chr2_+_48757278 | 1.01 |
ENST00000404752.1 ENST00000406226.1 |
STON1 |
stonin 1 |
| chr17_+_4692230 | 1.01 |
ENST00000331264.7 |
GLTPD2 |
glycolipid transfer protein domain containing 2 |
| chr19_+_57742431 | 1.00 |
ENST00000302804.7 |
AURKC |
aurora kinase C |
| chr4_+_89300158 | 0.98 |
ENST00000502870.1 |
HERC6 |
HECT and RLD domain containing E3 ubiquitin protein ligase family member 6 |
| chr9_-_113018746 | 0.98 |
ENST00000374515.5 |
TXN |
thioredoxin |
| chr2_+_112813134 | 0.98 |
ENST00000452614.1 |
TMEM87B |
transmembrane protein 87B |
| chr19_+_53970970 | 0.94 |
ENST00000468450.1 ENST00000396403.4 ENST00000490956.1 ENST00000396421.4 |
ZNF813 |
zinc finger protein 813 |
| chrX_-_108868390 | 0.94 |
ENST00000372101.2 |
KCNE1L |
KCNE1-like |
| chr3_+_37903432 | 0.92 |
ENST00000443503.2 |
CTDSPL |
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase-like |
| chrX_+_154444643 | 0.92 |
ENST00000286428.5 |
VBP1 |
von Hippel-Lindau binding protein 1 |
| chr4_+_141294628 | 0.91 |
ENST00000512749.1 ENST00000608372.1 ENST00000506597.1 ENST00000394201.4 ENST00000510586.1 |
SCOC |
short coiled-coil protein |
| chr1_+_65886262 | 0.91 |
ENST00000371065.4 |
LEPROT |
leptin receptor overlapping transcript |
| chr17_-_58469591 | 0.91 |
ENST00000589335.1 |
USP32 |
ubiquitin specific peptidase 32 |
| chr15_+_63414760 | 0.90 |
ENST00000557972.1 |
LACTB |
lactamase, beta |
| chr16_+_56703703 | 0.90 |
ENST00000332374.4 |
MT1H |
metallothionein 1H |
| chr16_+_2533020 | 0.89 |
ENST00000562105.1 |
TBC1D24 |
TBC1 domain family, member 24 |
| chr7_+_102715315 | 0.89 |
ENST00000428183.2 ENST00000323716.3 ENST00000441711.2 ENST00000454559.1 ENST00000425331.1 ENST00000541300.1 |
ARMC10 |
armadillo repeat containing 10 |
| chr4_-_83483094 | 0.88 |
ENST00000508701.1 ENST00000454948.3 |
TMEM150C |
transmembrane protein 150C |
| chr19_-_1876156 | 0.87 |
ENST00000565797.1 |
CTB-31O20.2 |
CTB-31O20.2 |
| chr3_-_52312337 | 0.87 |
ENST00000469000.1 |
WDR82 |
WD repeat domain 82 |
| chr13_-_44453826 | 0.86 |
ENST00000444614.3 |
CCDC122 |
coiled-coil domain containing 122 |
| chr7_-_77427676 | 0.86 |
ENST00000257663.3 |
TMEM60 |
transmembrane protein 60 |
| chr3_-_195163584 | 0.86 |
ENST00000439666.1 |
ACAP2 |
ArfGAP with coiled-coil, ankyrin repeat and PH domains 2 |
| chr10_-_33625154 | 0.86 |
ENST00000265371.4 |
NRP1 |
neuropilin 1 |
| chr7_+_33945132 | 0.84 |
ENST00000436222.1 |
BMPER |
BMP binding endothelial regulator |
| chr12_+_27175476 | 0.84 |
ENST00000546323.1 ENST00000282892.3 |
MED21 |
mediator complex subunit 21 |
| chr1_+_100435535 | 0.84 |
ENST00000427993.2 |
SLC35A3 |
solute carrier family 35 (UDP-N-acetylglucosamine (UDP-GlcNAc) transporter), member A3 |
| chr4_-_120549163 | 0.84 |
ENST00000394439.1 ENST00000420633.1 |
PDE5A |
phosphodiesterase 5A, cGMP-specific |
| chr6_+_27215471 | 0.84 |
ENST00000421826.2 |
PRSS16 |
protease, serine, 16 (thymus) |
| chr3_+_111393659 | 0.82 |
ENST00000477665.1 |
PLCXD2 |
phosphatidylinositol-specific phospholipase C, X domain containing 2 |
| chr9_+_86238016 | 0.82 |
ENST00000530832.1 ENST00000405990.3 ENST00000376417.4 ENST00000376419.4 |
IDNK |
idnK, gluconokinase homolog (E. coli) |
| chr15_+_66585950 | 0.81 |
ENST00000525109.1 |
DIS3L |
DIS3 mitotic control homolog (S. cerevisiae)-like |
| chr13_+_43148281 | 0.81 |
ENST00000239849.6 ENST00000398795.2 ENST00000544862.1 |
TNFSF11 |
tumor necrosis factor (ligand) superfamily, member 11 |
| chr1_-_68962744 | 0.81 |
ENST00000525124.1 |
DEPDC1 |
DEP domain containing 1 |
| chrX_+_118892545 | 0.79 |
ENST00000343905.3 |
SOWAHD |
sosondowah ankyrin repeat domain family member D |
| chr17_-_1419941 | 0.79 |
ENST00000498390.1 |
INPP5K |
inositol polyphosphate-5-phosphatase K |
| chr19_-_43702231 | 0.78 |
ENST00000597374.1 ENST00000599371.1 |
PSG4 |
pregnancy specific beta-1-glycoprotein 4 |
| chr14_+_74960423 | 0.78 |
ENST00000556816.1 ENST00000298818.8 ENST00000554924.1 |
ISCA2 |
iron-sulfur cluster assembly 2 |
| chr17_+_76142434 | 0.78 |
ENST00000340363.5 ENST00000586999.1 |
C17orf99 |
chromosome 17 open reading frame 99 |
| chr19_+_39786962 | 0.78 |
ENST00000333625.2 |
IFNL1 |
interferon, lambda 1 |
| chr22_+_50925213 | 0.77 |
ENST00000395733.3 ENST00000216075.6 ENST00000395732.3 |
MIOX |
myo-inositol oxygenase |
| chr10_+_98592009 | 0.77 |
ENST00000540664.1 ENST00000371103.3 |
LCOR |
ligand dependent nuclear receptor corepressor |
| chr10_+_48355024 | 0.77 |
ENST00000395702.2 ENST00000442001.1 ENST00000433077.1 ENST00000436850.1 ENST00000494156.1 ENST00000586537.1 |
ZNF488 |
zinc finger protein 488 |
| chr4_+_175205038 | 0.77 |
ENST00000457424.2 ENST00000514712.1 |
CEP44 |
centrosomal protein 44kDa |
| chr17_-_26926005 | 0.76 |
ENST00000536674.2 |
SPAG5 |
sperm associated antigen 5 |
| chrX_-_16730688 | 0.76 |
ENST00000359276.4 |
CTPS2 |
CTP synthase 2 |
| chr13_-_52026730 | 0.76 |
ENST00000420668.2 |
INTS6 |
integrator complex subunit 6 |
| chr2_-_46385 | 0.76 |
ENST00000327669.4 |
FAM110C |
family with sequence similarity 110, member C |
| chr18_-_658244 | 0.76 |
ENST00000585033.1 ENST00000323813.3 |
C18orf56 |
chromosome 18 open reading frame 56 |
| chr20_+_19738792 | 0.76 |
ENST00000412571.1 |
RP1-122P22.2 |
RP1-122P22.2 |
| chr4_+_103790120 | 0.76 |
ENST00000273986.4 |
CISD2 |
CDGSH iron sulfur domain 2 |
| chr5_-_177659539 | 0.76 |
ENST00000476170.2 |
PHYKPL |
5-phosphohydroxy-L-lysine phospho-lyase |
| chr2_+_46926326 | 0.76 |
ENST00000394861.2 |
SOCS5 |
suppressor of cytokine signaling 5 |
| chr11_-_118272610 | 0.75 |
ENST00000534438.1 |
RP11-770J1.5 |
Uncharacterized protein |
| chr6_-_33714667 | 0.75 |
ENST00000293756.4 |
IP6K3 |
inositol hexakisphosphate kinase 3 |
| chr19_+_2867325 | 0.75 |
ENST00000307635.2 ENST00000586426.1 |
ZNF556 |
zinc finger protein 556 |
| chr10_+_35416223 | 0.75 |
ENST00000489321.1 ENST00000427847.2 ENST00000345491.3 ENST00000395895.2 ENST00000374728.3 ENST00000487132.1 |
CREM |
cAMP responsive element modulator |
| chr16_+_67563250 | 0.75 |
ENST00000566907.1 |
FAM65A |
family with sequence similarity 65, member A |
| chr11_-_2906979 | 0.74 |
ENST00000380725.1 ENST00000313407.6 ENST00000430149.2 ENST00000440480.2 ENST00000414822.3 |
CDKN1C |
cyclin-dependent kinase inhibitor 1C (p57, Kip2) |
| chr2_-_114514181 | 0.74 |
ENST00000409342.1 |
SLC35F5 |
solute carrier family 35, member F5 |
| chr5_+_2752216 | 0.74 |
ENST00000457752.2 |
C5orf38 |
chromosome 5 open reading frame 38 |
| chr16_-_81129845 | 0.74 |
ENST00000569885.1 ENST00000566566.1 |
GCSH |
glycine cleavage system protein H (aminomethyl carrier) |
| chr4_-_56412713 | 0.74 |
ENST00000435527.2 |
CLOCK |
clock circadian regulator |
| chr6_-_167369612 | 0.74 |
ENST00000507747.1 |
RP11-514O12.4 |
RP11-514O12.4 |
| chr7_+_107220899 | 0.74 |
ENST00000379117.2 ENST00000473124.1 |
BCAP29 |
B-cell receptor-associated protein 29 |
| chrX_-_107019181 | 0.74 |
ENST00000315660.4 ENST00000372384.2 ENST00000502650.1 ENST00000506724.1 |
TSC22D3 |
TSC22 domain family, member 3 |
| chr12_-_51785083 | 0.73 |
ENST00000603563.1 |
GALNT6 |
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase 6 (GalNAc-T6) |
| chr2_+_39893043 | 0.73 |
ENST00000281961.2 |
TMEM178A |
transmembrane protein 178A |
| chr15_-_77712477 | 0.73 |
ENST00000560626.2 |
PEAK1 |
pseudopodium-enriched atypical kinase 1 |
| chr6_+_27215494 | 0.73 |
ENST00000230582.3 |
PRSS16 |
protease, serine, 16 (thymus) |
| chr10_+_82116529 | 0.73 |
ENST00000411538.1 ENST00000256039.2 |
DYDC2 |
DPY30 domain containing 2 |
| chr3_-_113464906 | 0.72 |
ENST00000477813.1 |
NAA50 |
N(alpha)-acetyltransferase 50, NatE catalytic subunit |
| chr17_-_43210580 | 0.72 |
ENST00000538093.1 ENST00000590644.1 |
PLCD3 |
phospholipase C, delta 3 |
| chr7_+_107220660 | 0.72 |
ENST00000465919.1 ENST00000445771.2 ENST00000479917.1 ENST00000421217.1 ENST00000457837.1 |
BCAP29 |
B-cell receptor-associated protein 29 |
| chr4_-_175205407 | 0.72 |
ENST00000393674.2 |
FBXO8 |
F-box protein 8 |
| chr16_-_3285144 | 0.72 |
ENST00000431561.3 ENST00000396870.4 |
ZNF200 |
zinc finger protein 200 |
| chr17_+_1733251 | 0.72 |
ENST00000570451.1 |
RPA1 |
replication protein A1, 70kDa |
| chr16_-_89768035 | 0.72 |
ENST00000569918.1 |
SPATA2L |
spermatogenesis associated 2-like |
| chr11_-_96123022 | 0.72 |
ENST00000542662.1 |
CCDC82 |
coiled-coil domain containing 82 |
| chr22_-_22090043 | 0.72 |
ENST00000403503.1 |
YPEL1 |
yippee-like 1 (Drosophila) |
| chr9_-_21995249 | 0.71 |
ENST00000494262.1 |
CDKN2A |
cyclin-dependent kinase inhibitor 2A |
| chr14_-_24685246 | 0.71 |
ENST00000396833.2 ENST00000288087.7 |
MDP1 |
magnesium-dependent phosphatase 1 |
| chr8_+_42396936 | 0.71 |
ENST00000416469.2 |
SMIM19 |
small integral membrane protein 19 |
| chr14_+_77564440 | 0.71 |
ENST00000361786.2 ENST00000555437.1 ENST00000555611.1 ENST00000554658.1 |
KIAA1737 |
CLOCK-interacting pacemaker |
| chr15_+_66585555 | 0.70 |
ENST00000319194.5 ENST00000525134.2 ENST00000441424.2 |
DIS3L |
DIS3 mitotic control homolog (S. cerevisiae)-like |
| chr11_-_35547151 | 0.70 |
ENST00000378878.3 ENST00000529303.1 ENST00000278360.3 |
PAMR1 |
peptidase domain containing associated with muscle regeneration 1 |
| chr2_+_30369859 | 0.70 |
ENST00000402003.3 |
YPEL5 |
yippee-like 5 (Drosophila) |
| chr6_+_53659877 | 0.69 |
ENST00000370882.1 |
LRRC1 |
leucine rich repeat containing 1 |
| chr11_+_111896090 | 0.69 |
ENST00000393051.1 |
DLAT |
dihydrolipoamide S-acetyltransferase |
| chr1_+_40723779 | 0.69 |
ENST00000372759.3 |
ZMPSTE24 |
zinc metallopeptidase STE24 |
| chr11_-_61596753 | 0.69 |
ENST00000448607.1 ENST00000421879.1 |
FADS1 |
fatty acid desaturase 1 |
| chr17_-_58603482 | 0.69 |
ENST00000585368.1 |
APPBP2 |
amyloid beta precursor protein (cytoplasmic tail) binding protein 2 |
| chr4_-_170679024 | 0.68 |
ENST00000393381.2 |
C4orf27 |
chromosome 4 open reading frame 27 |
| chr16_-_66907139 | 0.68 |
ENST00000561579.2 |
NAE1 |
NEDD8 activating enzyme E1 subunit 1 |
| chr8_-_99837856 | 0.68 |
ENST00000518165.1 ENST00000419617.2 |
STK3 |
serine/threonine kinase 3 |
| chr7_+_111846741 | 0.67 |
ENST00000421043.1 ENST00000425229.1 ENST00000450657.1 |
ZNF277 |
zinc finger protein 277 |
| chr19_+_16435625 | 0.67 |
ENST00000248071.5 ENST00000592003.1 |
KLF2 |
Kruppel-like factor 2 |
| chr15_+_96904487 | 0.67 |
ENST00000600790.1 |
AC087477.1 |
Uncharacterized protein |
| chr5_-_141703713 | 0.67 |
ENST00000511815.1 |
SPRY4 |
sprouty homolog 4 (Drosophila) |
| chr1_-_113615699 | 0.67 |
ENST00000421157.1 |
RP11-31F15.2 |
RP11-31F15.2 |
| chr10_+_45869652 | 0.67 |
ENST00000542434.1 ENST00000374391.2 |
ALOX5 |
arachidonate 5-lipoxygenase |
| chr8_-_90996459 | 0.67 |
ENST00000517337.1 ENST00000409330.1 |
NBN |
nibrin |
| chr2_-_174828892 | 0.67 |
ENST00000418194.2 |
SP3 |
Sp3 transcription factor |
| chr12_+_34175398 | 0.67 |
ENST00000538927.1 |
ALG10 |
ALG10, alpha-1,2-glucosyltransferase |
| chr15_+_82555125 | 0.67 |
ENST00000566205.1 ENST00000339465.5 ENST00000569120.1 ENST00000566861.1 |
FAM154B |
family with sequence similarity 154, member B |
| chr15_-_35280426 | 0.67 |
ENST00000559564.1 ENST00000356321.4 |
ZNF770 |
zinc finger protein 770 |
| chr11_-_914774 | 0.67 |
ENST00000528154.1 ENST00000525840.1 |
CHID1 |
chitinase domain containing 1 |
| chr8_+_25042192 | 0.66 |
ENST00000410074.1 |
DOCK5 |
dedicator of cytokinesis 5 |
| chr1_+_7844312 | 0.66 |
ENST00000377541.1 |
PER3 |
period circadian clock 3 |
| chr22_+_22676808 | 0.66 |
ENST00000390290.2 |
IGLV1-51 |
immunoglobulin lambda variable 1-51 |
| chr12_+_27091387 | 0.66 |
ENST00000544111.1 |
FGFR1OP2 |
FGFR1 oncogene partner 2 |
| chr3_+_23986748 | 0.66 |
ENST00000312521.4 |
NR1D2 |
nuclear receptor subfamily 1, group D, member 2 |
| chr14_+_38065052 | 0.66 |
ENST00000556845.1 |
TTC6 |
tetratricopeptide repeat domain 6 |
| chr11_+_124824000 | 0.65 |
ENST00000529051.1 ENST00000344762.5 |
CCDC15 |
coiled-coil domain containing 15 |
| chr6_-_109703634 | 0.65 |
ENST00000324953.5 ENST00000310786.4 ENST00000275080.7 ENST00000413644.2 |
CD164 |
CD164 molecule, sialomucin |
| chr15_-_41120896 | 0.65 |
ENST00000299174.5 ENST00000427255.2 |
PPP1R14D |
protein phosphatase 1, regulatory (inhibitor) subunit 14D |
| chr2_+_171627597 | 0.65 |
ENST00000429172.1 ENST00000426475.1 |
AC007405.6 |
AC007405.6 |
| chr3_-_42845922 | 0.65 |
ENST00000452906.2 |
HIGD1A |
HIG1 hypoxia inducible domain family, member 1A |
| chr16_-_56701933 | 0.65 |
ENST00000568675.1 ENST00000569500.1 ENST00000444837.2 ENST00000379811.3 |
MT1G |
metallothionein 1G |
| chr8_+_26149274 | 0.65 |
ENST00000522535.1 |
PPP2R2A |
protein phosphatase 2, regulatory subunit B, alpha |
| chr19_-_39360561 | 0.65 |
ENST00000593809.1 ENST00000593424.1 |
RINL |
Ras and Rab interactor-like |
| chr1_-_112281875 | 0.65 |
ENST00000527621.1 ENST00000534365.1 ENST00000357260.5 |
FAM212B |
family with sequence similarity 212, member B |
| chr7_-_32931623 | 0.65 |
ENST00000452926.1 |
KBTBD2 |
kelch repeat and BTB (POZ) domain containing 2 |
| chr2_+_112656176 | 0.64 |
ENST00000421804.2 ENST00000409780.1 |
MERTK |
c-mer proto-oncogene tyrosine kinase |
| chr12_+_105724414 | 0.64 |
ENST00000443585.1 ENST00000552457.1 ENST00000549893.1 |
C12orf75 |
chromosome 12 open reading frame 75 |
| chr1_-_17676070 | 0.64 |
ENST00000602074.1 |
AC004824.2 |
Uncharacterized protein |
| chr1_+_35734616 | 0.64 |
ENST00000441447.1 |
ZMYM4 |
zinc finger, MYM-type 4 |
| chr4_+_1723512 | 0.64 |
ENST00000493975.1 |
TACC3 |
transforming, acidic coiled-coil containing protein 3 |
| chr16_-_84178728 | 0.63 |
ENST00000562224.1 ENST00000434463.3 ENST00000564998.1 ENST00000219439.4 |
HSDL1 |
hydroxysteroid dehydrogenase like 1 |
| chr4_-_76439483 | 0.63 |
ENST00000380840.2 ENST00000513257.1 ENST00000507014.1 |
RCHY1 |
ring finger and CHY zinc finger domain containing 1, E3 ubiquitin protein ligase |
| chr7_+_111846643 | 0.63 |
ENST00000361822.3 |
ZNF277 |
zinc finger protein 277 |
| chr3_-_185542761 | 0.63 |
ENST00000457616.2 ENST00000346192.3 |
IGF2BP2 |
insulin-like growth factor 2 mRNA binding protein 2 |
| chr2_-_106015527 | 0.63 |
ENST00000344213.4 ENST00000358129.4 |
FHL2 |
four and a half LIM domains 2 |
| chr4_+_71859156 | 0.63 |
ENST00000286648.5 ENST00000504730.1 ENST00000504952.1 |
DCK |
deoxycytidine kinase |
| chr8_+_22457127 | 0.63 |
ENST00000289989.5 |
C8orf58 |
chromosome 8 open reading frame 58 |
| chrX_-_15872914 | 0.63 |
ENST00000380291.1 ENST00000545766.1 ENST00000421527.2 ENST00000329235.2 |
AP1S2 |
adaptor-related protein complex 1, sigma 2 subunit |
| chr2_+_216946589 | 0.63 |
ENST00000433112.1 ENST00000454545.1 ENST00000437356.2 ENST00000295658.4 ENST00000455479.1 ENST00000406027.2 |
TMEM169 |
transmembrane protein 169 |
| chr18_-_14132422 | 0.63 |
ENST00000589498.1 ENST00000590202.1 |
ZNF519 |
zinc finger protein 519 |
| chr7_-_55640141 | 0.63 |
ENST00000452832.1 |
VOPP1 |
vesicular, overexpressed in cancer, prosurvival protein 1 |
| chr6_-_74363636 | 0.63 |
ENST00000393019.3 |
SLC17A5 |
solute carrier family 17 (acidic sugar transporter), member 5 |
| chr11_-_128775930 | 0.62 |
ENST00000524878.1 |
C11orf45 |
chromosome 11 open reading frame 45 |
| chr17_+_72733350 | 0.62 |
ENST00000392613.5 ENST00000392612.3 ENST00000392610.1 |
RAB37 |
RAB37, member RAS oncogene family |
| chr9_+_19230433 | 0.62 |
ENST00000434457.2 ENST00000602925.1 |
DENND4C |
DENN/MADD domain containing 4C |
| chr19_+_46000506 | 0.62 |
ENST00000396737.2 |
PPM1N |
protein phosphatase, Mg2+/Mn2+ dependent, 1N (putative) |
| chr1_+_120839412 | 0.62 |
ENST00000355228.4 |
FAM72B |
family with sequence similarity 72, member B |
| chr9_+_137000484 | 0.62 |
ENST00000608937.1 ENST00000608739.1 |
WDR5 |
WD repeat domain 5 |
| chr1_+_2477831 | 0.62 |
ENST00000606645.1 |
RP3-395M20.12 |
RP3-395M20.12 |
| chr20_+_52824367 | 0.62 |
ENST00000371419.2 |
PFDN4 |
prefoldin subunit 4 |
| chr15_+_80351977 | 0.62 |
ENST00000559157.1 ENST00000561012.1 ENST00000564367.1 ENST00000558494.1 |
ZFAND6 |
zinc finger, AN1-type domain 6 |
| chr7_+_73082152 | 0.62 |
ENST00000324941.4 ENST00000451519.1 |
VPS37D |
vacuolar protein sorting 37 homolog D (S. cerevisiae) |
| chr19_+_38880695 | 0.61 |
ENST00000587947.1 ENST00000338502.4 |
SPRED3 |
sprouty-related, EVH1 domain containing 3 |
| chr11_+_86749035 | 0.61 |
ENST00000305494.5 ENST00000535167.1 |
TMEM135 |
transmembrane protein 135 |
| chr14_+_32546485 | 0.61 |
ENST00000345122.3 ENST00000432921.1 ENST00000433497.1 |
ARHGAP5 |
Rho GTPase activating protein 5 |
| chr19_-_47922750 | 0.61 |
ENST00000331559.5 |
MEIS3 |
Meis homeobox 3 |
| chrX_-_101771645 | 0.61 |
ENST00000289373.4 |
TMSB15A |
thymosin beta 15a |
| chr4_-_15683118 | 0.61 |
ENST00000507899.1 ENST00000510802.1 |
FBXL5 |
F-box and leucine-rich repeat protein 5 |
| chr10_-_72201423 | 0.61 |
ENST00000287139.3 |
NODAL |
nodal growth differentiation factor |
| chr2_-_40006357 | 0.61 |
ENST00000505747.1 |
THUMPD2 |
THUMP domain containing 2 |
| chr6_-_10694766 | 0.61 |
ENST00000460742.2 ENST00000259983.3 ENST00000379586.1 |
C6orf52 |
chromosome 6 open reading frame 52 |
| chr11_-_82612549 | 0.61 |
ENST00000528082.1 ENST00000533126.1 |
PRCP |
prolylcarboxypeptidase (angiotensinase C) |
| chr1_-_231175964 | 0.61 |
ENST00000366654.4 |
FAM89A |
family with sequence similarity 89, member A |
| chr4_+_184365841 | 0.61 |
ENST00000510928.1 |
CDKN2AIP |
CDKN2A interacting protein |
| chr5_+_133707252 | 0.61 |
ENST00000506787.1 ENST00000507277.1 |
UBE2B |
ubiquitin-conjugating enzyme E2B |
| chr19_+_56813305 | 0.61 |
ENST00000593151.1 |
AC006116.20 |
Uncharacterized protein |
| chr5_+_61602055 | 0.61 |
ENST00000381103.2 |
KIF2A |
kinesin heavy chain member 2A |
| chr9_+_74526384 | 0.60 |
ENST00000334731.2 ENST00000377031.3 |
C9orf85 |
chromosome 9 open reading frame 85 |
| chrX_-_107018969 | 0.60 |
ENST00000372383.4 |
TSC22D3 |
TSC22 domain family, member 3 |
| chr11_+_76571911 | 0.60 |
ENST00000534206.1 ENST00000532485.1 ENST00000526597.1 ENST00000533873.1 ENST00000538157.1 |
ACER3 |
alkaline ceramidase 3 |
| chr2_+_67624430 | 0.60 |
ENST00000272342.5 |
ETAA1 |
Ewing tumor-associated antigen 1 |
| chr19_+_10527449 | 0.60 |
ENST00000592685.1 ENST00000380702.2 |
PDE4A |
phosphodiesterase 4A, cAMP-specific |
| chr19_-_14064114 | 0.60 |
ENST00000585607.1 ENST00000538517.2 ENST00000587458.1 ENST00000538371.2 |
PODNL1 |
podocan-like 1 |
| chr19_+_50832943 | 0.60 |
ENST00000542413.1 |
NR1H2 |
nuclear receptor subfamily 1, group H, member 2 |
| chr2_-_239148599 | 0.60 |
ENST00000409182.1 ENST00000409002.3 ENST00000450098.1 ENST00000409356.1 ENST00000409160.3 ENST00000409574.1 ENST00000272937.5 |
HES6 |
hes family bHLH transcription factor 6 |
| chr8_-_102217515 | 0.60 |
ENST00000520347.1 ENST00000523922.1 ENST00000520984.1 |
ZNF706 |
zinc finger protein 706 |
| chr2_-_241500168 | 0.60 |
ENST00000443318.1 ENST00000411765.1 |
ANKMY1 |
ankyrin repeat and MYND domain containing 1 |
| chr12_+_104235229 | 0.60 |
ENST00000551650.1 |
RP11-650K20.3 |
Uncharacterized protein |
| chr2_-_40006289 | 0.60 |
ENST00000260619.6 ENST00000454352.2 |
THUMPD2 |
THUMP domain containing 2 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 0.5 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.5 | 0.5 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.4 | 0.4 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.4 | 0.8 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.4 | 1.2 | GO:0070510 | regulation of histone H4-K20 methylation(GO:0070510) positive regulation of histone H4-K20 methylation(GO:0070512) |
| 0.4 | 1.2 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.4 | 0.4 | GO:0010039 | response to iron ion(GO:0010039) |
| 0.4 | 0.4 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
| 0.4 | 1.1 | GO:1904761 | negative regulation of myofibroblast differentiation(GO:1904761) |
| 0.4 | 1.8 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
| 0.4 | 1.4 | GO:0019521 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.3 | 1.0 | GO:2001247 | positive regulation of phosphatidylcholine biosynthetic process(GO:2001247) |
| 0.3 | 2.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.3 | 1.0 | GO:1903609 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 0.3 | 0.3 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.3 | 0.3 | GO:0030225 | macrophage differentiation(GO:0030225) |
| 0.3 | 2.2 | GO:1903788 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.3 | 2.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.3 | 0.9 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
| 0.3 | 0.9 | GO:1901291 | negative regulation of double-strand break repair via single-strand annealing(GO:1901291) |
| 0.3 | 1.5 | GO:0021649 | vestibulocochlear nerve structural organization(GO:0021649) positive regulation of cytokine activity(GO:0060301) ganglion morphogenesis(GO:0061552) sensory neuron axon guidance(GO:0097374) VEGF-activated neuropilin signaling pathway involved in axon guidance(GO:1902378) dorsal root ganglion morphogenesis(GO:1904835) otic placode development(GO:1905040) |
| 0.3 | 1.2 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.3 | 2.4 | GO:1990262 | regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
| 0.3 | 0.9 | GO:0090108 | positive regulation of high-density lipoprotein particle assembly(GO:0090108) positive regulation of pancreatic juice secretion(GO:0090187) positive regulation of secretion of lysosomal enzymes(GO:0090340) |
| 0.3 | 0.9 | GO:0071812 | regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.3 | 0.6 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.3 | 0.3 | GO:0071402 | cellular response to lipoprotein particle stimulus(GO:0071402) |
| 0.3 | 1.4 | GO:0055014 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.3 | 1.4 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.3 | 0.9 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.3 | 0.3 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 0.3 | 1.1 | GO:0044028 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.3 | 0.3 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
| 0.3 | 2.4 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.3 | 1.1 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.3 | 0.8 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.3 | 1.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.3 | 0.3 | GO:0046449 | creatinine metabolic process(GO:0046449) |
| 0.3 | 0.5 | GO:0060139 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.3 | 0.8 | GO:0051037 | regulation of transcription involved in meiotic cell cycle(GO:0051037) |
| 0.3 | 0.8 | GO:0046041 | ITP metabolic process(GO:0046041) |
| 0.3 | 1.8 | GO:0035709 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.3 | 1.8 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.3 | 0.5 | GO:1900034 | regulation of cellular response to heat(GO:1900034) |
| 0.2 | 0.2 | GO:0007099 | centriole replication(GO:0007099) |
| 0.2 | 1.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.2 | 0.2 | GO:0001743 | optic placode formation(GO:0001743) optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.2 | 1.2 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 0.2 | 1.7 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.2 | 0.2 | GO:0031497 | chromatin assembly(GO:0031497) |
| 0.2 | 0.5 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 | 0.7 | GO:1903926 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.2 | 1.2 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.2 | 0.7 | GO:0036451 | cap mRNA methylation(GO:0036451) |
| 0.2 | 0.7 | GO:1901383 | negative regulation of chorionic trophoblast cell proliferation(GO:1901383) |
| 0.2 | 1.4 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.2 | 1.0 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.2 | 0.9 | GO:0072134 | nephrogenic mesenchyme morphogenesis(GO:0072134) |
| 0.2 | 2.6 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.2 | 0.7 | GO:0003164 | His-Purkinje system development(GO:0003164) |
| 0.2 | 0.7 | GO:0098939 | dendritic transport of mitochondrion(GO:0098939) anterograde dendritic transport of mitochondrion(GO:0098972) |
| 0.2 | 0.7 | GO:0031106 | septin ring assembly(GO:0000921) septin ring organization(GO:0031106) |
| 0.2 | 1.6 | GO:0007079 | mitotic chromosome movement towards spindle pole(GO:0007079) |
| 0.2 | 0.2 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.2 | 0.2 | GO:0071283 | cellular response to iron(III) ion(GO:0071283) |
| 0.2 | 1.3 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 | 0.4 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.2 | 1.1 | GO:2000690 | regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.2 | 0.2 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
| 0.2 | 0.2 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.2 | 1.5 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.2 | 0.4 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.2 | 0.6 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
| 0.2 | 0.6 | GO:0010845 | positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.2 | 1.7 | GO:1902847 | regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.2 | 0.8 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
| 0.2 | 1.2 | GO:0070981 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.2 | 0.8 | GO:0042361 | menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 0.2 | 0.8 | GO:0006617 | SRP-dependent cotranslational protein targeting to membrane, signal sequence recognition(GO:0006617) |
| 0.2 | 0.8 | GO:0021897 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.2 | 0.8 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.2 | 0.2 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.2 | 0.6 | GO:0010160 | sensory organ boundary specification(GO:0008052) formation of organ boundary(GO:0010160) taste bud development(GO:0061193) |
| 0.2 | 0.2 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
| 0.2 | 0.6 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.2 | 0.8 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.2 | 0.6 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
| 0.2 | 0.6 | GO:0035261 | external genitalia morphogenesis(GO:0035261) |
| 0.2 | 1.2 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.2 | 0.2 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 0.2 | 0.6 | GO:2000616 | negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.2 | 0.2 | GO:1904238 | kidney interstitial fibroblast differentiation(GO:0072071) pericyte cell differentiation(GO:1904238) |
| 0.2 | 0.6 | GO:0033341 | regulation of collagen binding(GO:0033341) |
| 0.2 | 1.0 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.2 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.2 | 0.6 | GO:0046022 | positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 0.2 | 0.4 | GO:1904437 | positive regulation of iron ion transport(GO:0034758) positive regulation of iron ion transmembrane transport(GO:0034761) regulation of iron ion import(GO:1900390) regulation of ferrous iron import into cell(GO:1903989) positive regulation of ferrous iron import into cell(GO:1903991) regulation of ferrous iron binding(GO:1904432) positive regulation of ferrous iron binding(GO:1904434) regulation of transferrin receptor binding(GO:1904435) positive regulation of transferrin receptor binding(GO:1904437) regulation of ferrous iron import across plasma membrane(GO:1904438) positive regulation of ferrous iron import across plasma membrane(GO:1904440) |
| 0.2 | 1.9 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 0.2 | 1.3 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.2 | 0.2 | GO:0061441 | renal artery morphogenesis(GO:0061441) |
| 0.2 | 0.6 | GO:0006579 | amino-acid betaine catabolic process(GO:0006579) |
| 0.2 | 0.4 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.2 | 0.6 | GO:0060491 | regulation of cell projection assembly(GO:0060491) |
| 0.2 | 1.3 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.2 | 0.7 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.2 | 1.7 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.2 | 0.6 | GO:0051102 | DNA ligation involved in DNA recombination(GO:0051102) |
| 0.2 | 0.7 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.2 | 0.5 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.2 | 0.9 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.2 | 0.5 | GO:0046081 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
| 0.2 | 0.4 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.2 | 1.8 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.2 | 0.9 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.2 | 1.3 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.2 | 0.5 | GO:1903515 | calcium ion transport from cytosol to endoplasmic reticulum(GO:1903515) |
| 0.2 | 2.8 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.2 | 0.2 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.2 | 1.1 | GO:1901911 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.2 | 0.7 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.2 | 0.5 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.2 | 0.2 | GO:0034759 | regulation of iron ion transport(GO:0034756) regulation of iron ion transmembrane transport(GO:0034759) |
| 0.2 | 0.7 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
| 0.2 | 0.7 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.2 | 0.5 | GO:0046709 | IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.2 | 0.5 | GO:0051086 | chaperone mediated protein folding independent of cofactor(GO:0051086) |
| 0.2 | 0.7 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) positive regulation of connective tissue replacement(GO:1905205) |
| 0.2 | 1.2 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.2 | 0.5 | GO:1990426 | homologous recombination-dependent replication fork processing(GO:1990426) |
| 0.2 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
| 0.2 | 0.3 | GO:2000793 | cell proliferation involved in heart valve development(GO:2000793) |
| 0.2 | 0.5 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.2 | 0.2 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.2 | 1.4 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.2 | 1.7 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.2 | 1.0 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.2 | 0.5 | GO:1903565 | negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 0.2 | 1.0 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.2 | 0.5 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.2 | 1.3 | GO:1904386 | response to thyroxine(GO:0097068) response to L-phenylalanine derivative(GO:1904386) |
| 0.2 | 0.7 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
| 0.2 | 0.8 | GO:0032109 | positive regulation of macroautophagy(GO:0016239) positive regulation of response to extracellular stimulus(GO:0032106) positive regulation of response to nutrient levels(GO:0032109) |
| 0.2 | 0.8 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
| 0.2 | 0.7 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.2 | 0.5 | GO:0071449 | cellular response to lipid hydroperoxide(GO:0071449) |
| 0.2 | 0.3 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.2 | 1.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.2 | 0.7 | GO:0031081 | nuclear pore distribution(GO:0031081) nuclear pore localization(GO:0051664) |
| 0.2 | 0.5 | GO:0060733 | regulation of eIF2 alpha phosphorylation by amino acid starvation(GO:0060733) regulation of translational initiation in response to starvation(GO:0071262) positive regulation of translational initiation in response to starvation(GO:0071264) |
| 0.2 | 0.7 | GO:0046469 | platelet activating factor metabolic process(GO:0046469) |
| 0.2 | 0.8 | GO:2000501 | regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.2 | 1.5 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) |
| 0.2 | 1.0 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.2 | 0.5 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.2 | 0.2 | GO:2000812 | regulation of barbed-end actin filament capping(GO:2000812) |
| 0.2 | 1.1 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.2 | 0.2 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.2 | 0.3 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
| 0.2 | 0.5 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.2 | 0.6 | GO:0061763 | multivesicular body-lysosome fusion(GO:0061763) |
| 0.2 | 1.0 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.2 | 0.6 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.2 | 1.3 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.2 | 1.0 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.2 | 0.5 | GO:0071301 | cellular response to vitamin B1(GO:0071301) response to formaldehyde(GO:1904404) |
| 0.2 | 0.6 | GO:0060995 | cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.2 | 0.5 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.2 | 0.3 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.2 | 0.5 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.2 | 0.5 | GO:0002877 | acute inflammatory response to non-antigenic stimulus(GO:0002525) regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.2 | 1.3 | GO:0044565 | dendritic cell proliferation(GO:0044565) |
| 0.2 | 1.6 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.2 | 0.8 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.2 | 0.3 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.2 | 0.5 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.2 | 0.6 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
| 0.2 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.2 | 2.8 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.2 | 0.5 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.2 | 0.3 | GO:0032470 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) |
| 0.2 | 0.6 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.2 | 0.6 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
| 0.1 | 0.4 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.1 | 0.4 | GO:0033386 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.1 | 0.1 | GO:0060921 | sinoatrial node development(GO:0003163) sinoatrial node cell differentiation(GO:0060921) |
| 0.1 | 0.3 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.1 | 1.2 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
| 0.1 | 1.8 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
| 0.1 | 0.4 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.1 | 0.4 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.1 | 1.9 | GO:0030091 | protein repair(GO:0030091) |
| 0.1 | 2.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 1.0 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 | 0.4 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.1 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.1 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.1 | 0.3 | GO:0072434 | signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) |
| 0.1 | 0.1 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.1 | 0.6 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.1 | 1.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 2.7 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 | 0.6 | GO:0006781 | succinyl-CoA pathway(GO:0006781) |
| 0.1 | 0.3 | GO:1903998 | regulation of eating behavior(GO:1903998) |
| 0.1 | 0.7 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.1 | 0.4 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.1 | 0.7 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.1 | 0.3 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.1 | 3.4 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.1 | 0.1 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) |
| 0.1 | 0.6 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.4 | GO:0034402 | recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
| 0.1 | 0.7 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.1 | 0.7 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.1 | 0.9 | GO:0097676 | histone H3-K36 dimethylation(GO:0097676) |
| 0.1 | 0.3 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 | 1.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.1 | GO:0061740 | protein targeting to lysosome involved in chaperone-mediated autophagy(GO:0061740) |
| 0.1 | 1.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 0.6 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.1 | 0.8 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.1 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.1 | 1.5 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.7 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.1 | 3.7 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.1 | 0.4 | GO:1904815 | negative regulation of protein localization to chromosome, telomeric region(GO:1904815) |
| 0.1 | 0.7 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 1.5 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.1 | 1.0 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.1 | 0.5 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.1 | 0.8 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.1 | 0.4 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.1 | 0.4 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.1 | 1.1 | GO:0002829 | negative regulation of type 2 immune response(GO:0002829) |
| 0.1 | 1.2 | GO:0030242 | pexophagy(GO:0030242) |
| 0.1 | 0.9 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.1 | 0.1 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
| 0.1 | 0.4 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 | 0.4 | GO:0000961 | negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
| 0.1 | 0.4 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.1 | 0.5 | GO:0070895 | transposon integration(GO:0070893) regulation of transposon integration(GO:0070894) negative regulation of transposon integration(GO:0070895) |
| 0.1 | 0.7 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.1 | 0.1 | GO:0010939 | regulation of necrotic cell death(GO:0010939) |
| 0.1 | 0.3 | GO:1900673 | olefin metabolic process(GO:1900673) |
| 0.1 | 0.7 | GO:0009216 | purine deoxyribonucleoside triphosphate biosynthetic process(GO:0009216) |
| 0.1 | 0.5 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.1 | 0.5 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.1 | 0.4 | GO:0042418 | epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.1 | 0.1 | GO:0060967 | negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by miRNA(GO:0060965) negative regulation of gene silencing by RNA(GO:0060967) |
| 0.1 | 0.5 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.1 | 0.8 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 | 0.3 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.1 | 1.3 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.1 | 0.7 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 | 0.8 | GO:2001153 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
| 0.1 | 0.8 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 | 0.5 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.1 | GO:1902957 | negative regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902957) |
| 0.1 | 0.5 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.1 | 1.7 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.1 | 0.5 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.1 | 1.2 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.1 | 0.5 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.1 | 1.7 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.1 | 0.6 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.1 | 0.4 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
| 0.1 | 1.0 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.1 | 0.4 | GO:0051866 | general adaptation syndrome(GO:0051866) |
| 0.1 | 0.3 | GO:0060913 | cardiac cell fate determination(GO:0060913) |
| 0.1 | 0.6 | GO:2000007 | apoptotic process involved in endocardial cushion morphogenesis(GO:0003277) mesodermal cell fate determination(GO:0007500) intermediate mesoderm morphogenesis(GO:0048390) intermediate mesoderm formation(GO:0048391) intermediate mesodermal cell differentiation(GO:0048392) regulation of cardiac muscle fiber development(GO:0055018) positive regulation of cardiac muscle fiber development(GO:0055020) bud dilation involved in lung branching(GO:0060503) BMP signaling pathway involved in ureter morphogenesis(GO:0061149) renal system segmentation(GO:0061150) BMP signaling pathway involved in renal system segmentation(GO:0061151) pulmonary artery endothelial tube morphogenesis(GO:0061155) regulation of transcription from RNA polymerase II promoter involved in mesonephros development(GO:0061216) BMP signaling pathway involved in nephric duct formation(GO:0071893) negative regulation of branch elongation involved in ureteric bud branching(GO:0072096) negative regulation of branch elongation involved in ureteric bud branching by BMP signaling pathway(GO:0072097) anterior/posterior pattern specification involved in ureteric bud development(GO:0072099) specification of ureteric bud anterior/posterior symmetry(GO:0072100) specification of ureteric bud anterior/posterior symmetry by BMP signaling pathway(GO:0072101) ureter epithelial cell differentiation(GO:0072192) negative regulation of mesenchymal cell proliferation involved in ureter development(GO:0072200) regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901963) positive regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901964) cardiac jelly development(GO:1905072) regulation of metanephric S-shaped body morphogenesis(GO:2000004) negative regulation of metanephric S-shaped body morphogenesis(GO:2000005) regulation of metanephric comma-shaped body morphogenesis(GO:2000006) negative regulation of metanephric comma-shaped body morphogenesis(GO:2000007) negative regulation of cell proliferation involved in heart morphogenesis(GO:2000137) |
| 0.1 | 0.1 | GO:0035739 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.1 | 0.3 | GO:0035712 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.1 | 0.4 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.1 | 1.0 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.1 | 1.0 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.1 | 0.6 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.1 | 0.8 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 0.4 | GO:0002276 | basophil activation involved in immune response(GO:0002276) basophil activation(GO:0045575) |
| 0.1 | 0.5 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.1 | 0.4 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.1 | 1.6 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 | 0.3 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 | 0.1 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.1 | 0.6 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 0.1 | 0.4 | GO:0003091 | renal water homeostasis(GO:0003091) |
| 0.1 | 0.1 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.1 | 0.6 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) |
| 0.1 | 1.0 | GO:1901189 | positive regulation of ephrin receptor signaling pathway(GO:1901189) positive regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901297) positive regulation of canonical Wnt signaling pathway involved in heart development(GO:1905068) |
| 0.1 | 0.6 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.1 | 0.9 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 0.1 | 1.2 | GO:0071901 | negative regulation of protein serine/threonine kinase activity(GO:0071901) |
| 0.1 | 0.4 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.1 | 1.7 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.1 | 1.6 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
| 0.1 | 0.2 | GO:0003064 | regulation of heart rate by hormone(GO:0003064) |
| 0.1 | 0.6 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 | 0.5 | GO:0070839 | divalent metal ion export(GO:0070839) |
| 0.1 | 0.5 | GO:0036100 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.1 | 0.4 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.1 | 0.4 | GO:0098906 | pulmonary valve formation(GO:0003193) atrial ventricular junction remodeling(GO:0003294) foramen ovale closure(GO:0035922) atrial cardiac muscle cell to AV node cell communication by electrical coupling(GO:0086044) bundle of His cell to Purkinje myocyte communication by electrical coupling(GO:0086054) Purkinje myocyte to ventricular cardiac muscle cell communication by electrical coupling(GO:0086055) regulation of Purkinje myocyte action potential(GO:0098906) vasomotion(GO:1990029) |
| 0.1 | 0.1 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.1 | 0.4 | GO:0006433 | prolyl-tRNA aminoacylation(GO:0006433) |
| 0.1 | 1.5 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.1 | 0.2 | GO:0072366 | regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.1 | 0.7 | GO:1903588 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 | 0.8 | GO:0034670 | chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.1 | 0.6 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.1 | 3.0 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.1 | 0.2 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.1 | 0.5 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.6 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.1 | 0.2 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.1 | 0.1 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.1 | 0.3 | GO:0038066 | p38MAPK cascade(GO:0038066) |
| 0.1 | 0.2 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.1 | 1.0 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.1 | 0.6 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.1 | 0.1 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.1 | 0.5 | GO:0010430 | fatty acid omega-oxidation(GO:0010430) |
| 0.1 | 0.3 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
| 0.1 | 4.0 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.2 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
| 0.1 | 0.3 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.1 | 0.6 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 0.1 | 1.9 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.1 | 0.2 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.1 | 0.4 | GO:2000176 | regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.1 | 0.6 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.1 | 1.0 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.2 | GO:0071158 | positive regulation of cell cycle arrest(GO:0071158) |
| 0.1 | 0.7 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.6 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.1 | 1.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.1 | 1.2 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.1 | 0.3 | GO:0097359 | UDP-glucosylation(GO:0097359) |
| 0.1 | 0.1 | GO:0097201 | negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.1 | 0.7 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 0.1 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.1 | 1.7 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.1 | 0.1 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
| 0.1 | 0.2 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.1 | 1.4 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
| 0.1 | 0.4 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.1 | 0.5 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.1 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.1 | 0.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.1 | 0.9 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 | 0.3 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.1 | 0.5 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 1.2 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.1 | 0.7 | GO:0097202 | activation of cysteine-type endopeptidase activity(GO:0097202) |
| 0.1 | 0.9 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.1 | 0.4 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.1 | 0.3 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.1 | 0.1 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 0.1 | 0.2 | GO:0060434 | bronchus morphogenesis(GO:0060434) |
| 0.1 | 0.2 | GO:0002209 | behavioral fear response(GO:0001662) behavioral defense response(GO:0002209) |
| 0.1 | 1.3 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.1 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.1 | 0.3 | GO:0007388 | anterior compartment pattern formation(GO:0007387) posterior compartment specification(GO:0007388) |
| 0.1 | 0.3 | GO:0034371 | chylomicron remodeling(GO:0034371) |
| 0.1 | 1.1 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.1 | 0.9 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 | 0.6 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 | 2.9 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.1 | 0.3 | GO:0051685 | maintenance of ER location(GO:0051685) |
| 0.1 | 0.3 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 0.1 | 0.6 | GO:0018032 | protein amidation(GO:0018032) |
| 0.1 | 0.7 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 | 0.4 | GO:0001808 | negative regulation of type IV hypersensitivity(GO:0001808) |
| 0.1 | 0.3 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.1 | 0.6 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.3 | GO:1902868 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.1 | 0.2 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
| 0.1 | 0.3 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.1 | 0.2 | GO:0031392 | regulation of prostaglandin biosynthetic process(GO:0031392) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) |
| 0.1 | 0.2 | GO:0042214 | terpene metabolic process(GO:0042214) |
| 0.1 | 0.4 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.1 | 0.1 | GO:1902074 | response to salt(GO:1902074) |
| 0.1 | 0.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.2 | GO:0002424 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.1 | 0.5 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.1 | 0.7 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.1 | 0.5 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.1 | 0.5 | GO:0060431 | primary lung bud formation(GO:0060431) |
| 0.1 | 0.3 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.1 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.1 | 6.2 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 | 0.2 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.1 | 0.8 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.2 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.1 | 0.4 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.1 | 0.2 | GO:1903979 | negative regulation of microglial cell activation(GO:1903979) |
| 0.1 | 0.8 | GO:0060701 | negative regulation of ribonuclease activity(GO:0060701) negative regulation of endoribonuclease activity(GO:0060702) |
| 0.1 | 0.2 | GO:0070541 | response to platinum ion(GO:0070541) |
| 0.1 | 0.1 | GO:0003208 | cardiac ventricle morphogenesis(GO:0003208) |
| 0.1 | 0.1 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.1 | 0.3 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.1 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 0.1 | 1.1 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.1 | 1.3 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) |
| 0.1 | 0.3 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.1 | 0.4 | GO:0035668 | TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.1 | 1.0 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 1.0 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.1 | 0.2 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.1 | 0.3 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
| 0.1 | 0.5 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.1 | 0.2 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.1 | 0.3 | GO:1902523 | positive regulation of protein K63-linked ubiquitination(GO:1902523) |
| 0.1 | 0.3 | GO:1903288 | positive regulation of potassium ion import(GO:1903288) |
| 0.1 | 0.3 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.1 | 0.3 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.1 | 0.1 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.1 | 0.4 | GO:0018209 | peptidyl-serine modification(GO:0018209) |
| 0.1 | 0.4 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.1 | 0.1 | GO:0032922 | circadian regulation of gene expression(GO:0032922) |
| 0.1 | 0.1 | GO:1904884 | establishment of RNA localization to telomere(GO:0097694) establishment of macromolecular complex localization to telomere(GO:0097695) telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.1 | 0.9 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 | 0.7 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.1 | 0.3 | GO:0097032 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.1 | 2.2 | GO:0046174 | polyol catabolic process(GO:0046174) |
| 0.1 | 0.3 | GO:1904784 | NLRP1 inflammasome complex assembly(GO:1904784) |
| 0.1 | 0.3 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 | 0.7 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.1 | 0.3 | GO:0090650 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.1 | 0.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.1 | 0.5 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 | 0.3 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.1 | 1.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 | 0.1 | GO:1902739 | interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.1 | 0.9 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.1 | 0.9 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.1 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.1 | 0.1 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 0.4 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.1 | 0.3 | GO:0098884 | postsynaptic neurotransmitter receptor internalization(GO:0098884) |
| 0.1 | 0.9 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.1 | 0.5 | GO:0030047 | actin modification(GO:0030047) |
| 0.1 | 1.0 | GO:0060613 | fat pad development(GO:0060613) |
| 0.1 | 0.1 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.1 | 0.4 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
| 0.1 | 0.5 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.1 | 0.2 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.1 | 2.6 | GO:0006294 | nucleotide-excision repair, preincision complex assembly(GO:0006294) |
| 0.1 | 0.7 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 | 1.7 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.5 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 0.4 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.1 | 0.3 | GO:0060262 | regulation of N-terminal protein palmitoylation(GO:0060254) negative regulation of N-terminal protein palmitoylation(GO:0060262) negative regulation of protein lipidation(GO:1903060) |
| 0.1 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.1 | 0.4 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 0.1 | 0.3 | GO:0061357 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
| 0.1 | 0.4 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.1 | 0.1 | GO:0010716 | negative regulation of extracellular matrix disassembly(GO:0010716) |
| 0.1 | 0.3 | GO:0072599 | establishment of protein localization to endoplasmic reticulum(GO:0072599) |
| 0.1 | 0.4 | GO:1900063 | regulation of peroxisome organization(GO:1900063) |
| 0.1 | 0.4 | GO:0070495 | regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
| 0.1 | 0.3 | GO:2000282 | regulation of cellular amino acid biosynthetic process(GO:2000282) |
| 0.1 | 0.2 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
| 0.1 | 0.5 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.1 | 1.2 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 1.7 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.1 | 0.1 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.1 | 1.8 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.1 | 0.1 | GO:2000426 | negative regulation of apoptotic cell clearance(GO:2000426) |
| 0.1 | 2.1 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.1 | 0.2 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 | 0.3 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.1 | 1.1 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.1 | 0.1 | GO:1904871 | regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) |
| 0.1 | 0.5 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.1 | 0.5 | GO:0098746 | fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.1 | 0.3 | GO:1902528 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.1 | 2.0 | GO:0006853 | carnitine shuttle(GO:0006853) |
| 0.1 | 0.3 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.1 | 0.3 | GO:0071373 | cellular response to luteinizing hormone stimulus(GO:0071373) |
| 0.1 | 0.3 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 2.4 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.1 | 0.5 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 | 0.3 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) |
| 0.1 | 0.3 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.1 | 0.2 | GO:0042148 | strand invasion(GO:0042148) |
| 0.1 | 0.2 | GO:0010873 | positive regulation of cholesterol esterification(GO:0010873) |
| 0.1 | 0.7 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.1 | 1.5 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.1 | 1.1 | GO:0071455 | cellular response to hyperoxia(GO:0071455) |
| 0.1 | 0.3 | GO:0042701 | progesterone secretion(GO:0042701) |
| 0.1 | 0.6 | GO:0017085 | response to insecticide(GO:0017085) |
| 0.1 | 0.1 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.1 | 0.3 | GO:0098507 | polynucleotide 5' dephosphorylation(GO:0098507) |
| 0.1 | 0.7 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.1 | 3.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 0.2 | GO:0046086 | adenosine biosynthetic process(GO:0046086) |
| 0.1 | 0.2 | GO:0002372 | myeloid dendritic cell cytokine production(GO:0002372) |
| 0.1 | 0.5 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
| 0.1 | 0.2 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) |
| 0.1 | 1.1 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.1 | 0.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.1 | 0.1 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.1 | 0.2 | GO:0072506 | cellular phosphate ion homeostasis(GO:0030643) phosphate ion homeostasis(GO:0055062) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) divalent inorganic anion homeostasis(GO:0072505) trivalent inorganic anion homeostasis(GO:0072506) |
| 0.1 | 0.2 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
| 0.1 | 0.4 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.1 | 1.0 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 0.3 | GO:0060178 | regulation of exocyst assembly(GO:0001928) regulation of exocyst localization(GO:0060178) |
| 0.1 | 0.6 | GO:0021834 | chemorepulsion involved in embryonic olfactory bulb interneuron precursor migration(GO:0021834) |
| 0.1 | 0.5 | GO:0061187 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.1 | 0.3 | GO:0072019 | proximal convoluted tubule development(GO:0072019) metanephric proximal convoluted tubule development(GO:0072229) |
| 0.1 | 0.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.1 | 1.3 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 | 0.2 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.1 | 0.2 | GO:0050720 | interleukin-1 beta biosynthetic process(GO:0050720) |
| 0.1 | 1.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 | 1.6 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.1 | 0.3 | GO:0006226 | dUMP biosynthetic process(GO:0006226) |
| 0.1 | 1.2 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.1 | 0.4 | GO:0071344 | diphosphate metabolic process(GO:0071344) |
| 0.1 | 0.2 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.1 | 0.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 0.2 | GO:0060152 | peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.1 | 1.8 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.1 | 0.2 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
| 0.1 | 0.2 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.1 | 0.2 | GO:0036292 | DNA rewinding(GO:0036292) |
| 0.1 | 0.2 | GO:0030186 | melatonin metabolic process(GO:0030186) melatonin biosynthetic process(GO:0030187) |
| 0.1 | 0.2 | GO:0035508 | positive regulation of myosin-light-chain-phosphatase activity(GO:0035508) |
| 0.1 | 0.4 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.1 | 0.1 | GO:0032148 | activation of protein kinase B activity(GO:0032148) |
| 0.1 | 0.7 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.1 | 0.5 | GO:0070987 | error-free translesion synthesis(GO:0070987) |
| 0.1 | 0.2 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.1 | 0.2 | GO:0042023 | regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 0.1 | 0.5 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
| 0.1 | 0.2 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.1 | 0.9 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 | 0.3 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.1 | 0.4 | GO:0070124 | mitochondrial translational initiation(GO:0070124) |
| 0.1 | 1.2 | GO:0030953 | astral microtubule organization(GO:0030953) |
| 0.1 | 1.2 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 0.6 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 1.1 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.1 | 0.3 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 | 0.3 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.1 | 0.2 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.1 | 0.5 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.1 | 0.5 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.1 | 0.5 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 | 0.2 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.1 | 0.2 | GO:0016487 | sesquiterpenoid metabolic process(GO:0006714) polyprenol catabolic process(GO:0016095) sesquiterpenoid catabolic process(GO:0016107) farnesol metabolic process(GO:0016487) farnesol catabolic process(GO:0016488) |
| 0.1 | 0.3 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.1 | 0.2 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.1 | 0.3 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 0.1 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.1 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.1 | 0.1 | GO:0071320 | cellular response to cAMP(GO:0071320) |
| 0.1 | 0.1 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.1 | 0.1 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.1 | 0.7 | GO:0048262 | determination of dorsal/ventral asymmetry(GO:0048262) |
| 0.1 | 0.2 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
| 0.1 | 2.3 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.1 | 0.1 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.1 | 0.1 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.1 | 0.5 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.1 | 0.2 | GO:0015993 | molecular hydrogen transport(GO:0015993) |
| 0.1 | 0.5 | GO:0072106 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
| 0.1 | 0.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.1 | 0.4 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.1 | 0.5 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.1 | 0.4 | GO:1904977 | lymphatic endothelial cell migration(GO:1904977) |
| 0.1 | 0.1 | GO:2000177 | regulation of neural precursor cell proliferation(GO:2000177) |
| 0.1 | 0.9 | GO:0021892 | cerebral cortex GABAergic interneuron differentiation(GO:0021892) cerebral cortex GABAergic interneuron development(GO:0021894) |
| 0.1 | 0.3 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 | 1.9 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.1 | 0.9 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.1 | 0.1 | GO:1903204 | neuron death in response to oxidative stress(GO:0036475) regulation of oxidative stress-induced neuron death(GO:1903203) negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.1 | 0.4 | GO:0050893 | sensory processing(GO:0050893) |
| 0.1 | 0.1 | GO:0032499 | detection of peptidoglycan(GO:0032499) |
| 0.1 | 1.3 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.1 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 | 0.9 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.1 | 0.1 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.1 | 0.3 | GO:0060966 | regulation of posttranscriptional gene silencing(GO:0060147) regulation of gene silencing by miRNA(GO:0060964) regulation of gene silencing by RNA(GO:0060966) |
| 0.1 | 0.8 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 0.3 | GO:0021816 | lamellipodium assembly involved in ameboidal cell migration(GO:0003363) extension of a leading process involved in cell motility in cerebral cortex radial glia guided migration(GO:0021816) |
| 0.1 | 0.1 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.1 | 1.6 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 | 0.4 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.1 | 0.1 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.1 | 0.5 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.1 | 0.6 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) |
| 0.1 | 2.0 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.1 | 0.3 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.1 | 0.1 | GO:0002519 | natural killer cell tolerance induction(GO:0002519) regulation of tolerance induction dependent upon immune response(GO:0002652) negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) negative regulation of natural killer cell mediated immune response to tumor cell(GO:0002856) negative regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002859) |
| 0.1 | 0.3 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) positive regulation of metalloendopeptidase activity(GO:1904685) |
| 0.1 | 0.3 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 0.1 | GO:1904888 | cranial skeletal system development(GO:1904888) |
| 0.1 | 0.5 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.1 | GO:0000915 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.1 | 0.8 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.1 | 0.5 | GO:2001171 | positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.1 | 0.1 | GO:1902954 | regulation of early endosome to recycling endosome transport(GO:1902954) |
| 0.1 | 0.4 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.1 | 0.9 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 | 0.3 | GO:0019605 | butyrate metabolic process(GO:0019605) |
| 0.1 | 0.7 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 | 0.1 | GO:0044254 | multicellular organismal protein catabolic process(GO:0044254) protein digestion(GO:0044256) multicellular organismal macromolecule catabolic process(GO:0044266) |
| 0.1 | 0.2 | GO:0060915 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) mammary gland bud morphogenesis(GO:0060648) branch elongation involved in salivary gland morphogenesis(GO:0060667) mesenchymal cell differentiation involved in lung development(GO:0060915) |
| 0.1 | 0.2 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
| 0.1 | 0.7 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.1 | 0.2 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 | 0.5 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 | 0.4 | GO:0055015 | ventricular cardiac muscle cell development(GO:0055015) |
| 0.1 | 0.3 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.1 | 0.2 | GO:1904772 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.1 | 0.1 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.1 | 0.7 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.1 | 0.2 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.1 | 0.8 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 0.3 | GO:0060260 | regulation of transcription initiation from RNA polymerase II promoter(GO:0060260) |
| 0.1 | 0.3 | GO:0001828 | inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
| 0.1 | 1.7 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.1 | 0.1 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
| 0.1 | 0.7 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 | 0.1 | GO:1904978 | regulation of endosome organization(GO:1904978) |
| 0.1 | 0.4 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 0.1 | GO:0042369 | vitamin D catabolic process(GO:0042369) |
| 0.1 | 1.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 0.2 | GO:0033488 | cholesterol biosynthetic process via 24,25-dihydrolanosterol(GO:0033488) |
| 0.1 | 0.1 | GO:0008300 | isoprenoid catabolic process(GO:0008300) diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) fat-soluble vitamin catabolic process(GO:0042363) |
| 0.1 | 1.3 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.5 | GO:0006071 | glycerol metabolic process(GO:0006071) |
| 0.1 | 0.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.1 | 0.1 | GO:0046222 | mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
| 0.1 | 0.1 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.1 | 0.2 | GO:0032632 | interleukin-3 production(GO:0032632) positive regulation of interleukin-3 production(GO:0032752) interleukin-3 biosynthetic process(GO:0042223) regulation of interleukin-3 biosynthetic process(GO:0045399) positive regulation of interleukin-3 biosynthetic process(GO:0045401) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) positive regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045425) |
| 0.1 | 0.2 | GO:1904049 | negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 0.1 | 0.7 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.1 | 0.2 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
| 0.1 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) inositol biosynthetic process(GO:0006021) |
| 0.1 | 0.8 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.1 | 0.8 | GO:0035826 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.1 | 0.4 | GO:0019427 | acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
| 0.1 | 1.4 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.1 | 0.2 | GO:1901895 | negative regulation of calcium-transporting ATPase activity(GO:1901895) |
| 0.1 | 0.4 | GO:0006789 | bilirubin conjugation(GO:0006789) |
| 0.1 | 0.3 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.1 | 0.1 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.1 | 0.2 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.1 | 0.3 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
| 0.1 | 0.3 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 0.4 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.1 | 0.5 | GO:0060717 | chorion development(GO:0060717) |
| 0.1 | 0.5 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 0.1 | 2.1 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.1 | 0.8 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine salvage(GO:0071267) |
| 0.1 | 0.1 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.1 | 0.2 | GO:1903056 | regulation of melanosome organization(GO:1903056) |
| 0.1 | 0.9 | GO:0052695 | cellular glucuronidation(GO:0052695) |
| 0.1 | 0.2 | GO:0009106 | lipoate metabolic process(GO:0009106) lipoate biosynthetic process(GO:0009107) |
| 0.1 | 0.2 | GO:0007077 | mitotic nuclear envelope disassembly(GO:0007077) |
| 0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.1 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.1 | 0.4 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 | 0.6 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.1 | 0.1 | GO:0031063 | regulation of histone deacetylation(GO:0031063) |
| 0.1 | 0.2 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.1 | 0.4 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.1 | 0.1 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
| 0.1 | 2.3 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
| 0.1 | 0.6 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 0.9 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.1 | 0.4 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.1 | 0.1 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.1 | 1.3 | GO:0000732 | strand displacement(GO:0000732) |
| 0.1 | 0.2 | GO:0060849 | radial pattern formation(GO:0009956) regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.1 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.1 | 0.7 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 | 0.4 | GO:0042816 | vitamin B6 metabolic process(GO:0042816) |
| 0.1 | 0.4 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.1 | 0.2 | GO:0032908 | transforming growth factor beta1 production(GO:0032905) regulation of transforming growth factor beta1 production(GO:0032908) |
| 0.1 | 0.4 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.1 | 0.2 | GO:0036378 | calcitriol biosynthetic process from calciol(GO:0036378) |
| 0.1 | 0.5 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
| 0.1 | 0.1 | GO:0034059 | response to anoxia(GO:0034059) |
| 0.1 | 0.2 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.1 | 0.6 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.1 | 0.3 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.1 | 0.1 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.1 | 0.5 | GO:0089712 | L-aspartate transport(GO:0070778) L-aspartate transmembrane transport(GO:0089712) |
| 0.1 | 0.4 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.1 | 0.6 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.1 | 0.2 | GO:0051413 | response to cortisone(GO:0051413) |
| 0.1 | 0.3 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.1 | 0.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.1 | 0.4 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.1 | 0.2 | GO:0090222 | centrosome-templated microtubule nucleation(GO:0090222) |
| 0.1 | 0.1 | GO:0010664 | negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.1 | 1.0 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 | 0.2 | GO:1901350 | cell-cell signaling involved in cell-cell junction organization(GO:1901350) |
| 0.1 | 0.8 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
| 0.1 | 0.1 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.1 | 0.4 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.1 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.1 | 0.2 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.1 | 0.4 | GO:1904381 | Golgi apparatus mannose trimming(GO:1904381) |
| 0.1 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.1 | 0.7 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 0.4 | GO:0051351 | positive regulation of ligase activity(GO:0051351) |
| 0.1 | 0.1 | GO:0010595 | positive regulation of endothelial cell migration(GO:0010595) |
| 0.1 | 0.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.1 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.1 | 0.2 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.1 | 0.3 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.1 | 0.2 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.1 | 0.3 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
| 0.1 | 0.6 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.1 | 0.3 | GO:0044856 | plasma membrane raft distribution(GO:0044855) plasma membrane raft localization(GO:0044856) plasma membrane raft polarization(GO:0044858) regulation of plasma membrane raft polarization(GO:1903906) |
| 0.1 | 0.2 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.1 | 0.2 | GO:0001754 | eye photoreceptor cell differentiation(GO:0001754) |
| 0.1 | 0.8 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.1 | 0.1 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.1 | 0.6 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 0.2 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.1 | 0.2 | GO:1904647 | response to rotenone(GO:1904647) |
| 0.1 | 0.3 | GO:0009820 | alkaloid metabolic process(GO:0009820) |
| 0.1 | 0.2 | GO:0090101 | negative regulation of transmembrane receptor protein serine/threonine kinase signaling pathway(GO:0090101) |
| 0.1 | 0.1 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 0.1 | 0.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 0.1 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.1 | 1.4 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.1 | 0.5 | GO:1904753 | negative regulation of vascular associated smooth muscle cell migration(GO:1904753) |
| 0.1 | 0.2 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.1 | 0.2 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.1 | 0.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 | 0.4 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.1 | 0.3 | GO:0015862 | uridine transport(GO:0015862) |
| 0.1 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 | 0.1 | GO:0044346 | fibroblast apoptotic process(GO:0044346) |
| 0.1 | 0.3 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 0.7 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.1 | 0.4 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.1 | 0.2 | GO:0006408 | snRNA export from nucleus(GO:0006408) |
| 0.1 | 0.7 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.3 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.1 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 0.2 | GO:0023019 | signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.1 | 0.7 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.1 | 0.8 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 0.2 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
| 0.1 | 0.4 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.1 | 0.1 | GO:0051954 | regulation of glutamate secretion(GO:0014048) positive regulation of glutamate secretion(GO:0014049) positive regulation of amine transport(GO:0051954) positive regulation of amino acid transport(GO:0051957) |
| 0.1 | 1.5 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.1 | 0.1 | GO:0051231 | spindle elongation(GO:0051231) |
| 0.1 | 0.7 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.1 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 0.3 | GO:1900827 | positive regulation of cell communication by electrical coupling(GO:0010650) maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.1 | 0.4 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 0.3 | GO:0006983 | ER overload response(GO:0006983) |
| 0.1 | 0.8 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.1 | 0.2 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.1 | 0.5 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.1 | 0.2 | GO:1902173 | negative regulation of keratinocyte apoptotic process(GO:1902173) |
| 0.1 | 0.2 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 | 0.6 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 0.5 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.1 | 1.5 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.1 | 0.4 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 0.5 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
| 0.1 | 1.4 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.1 | 0.3 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.1 | 0.3 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.1 | 0.3 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.1 | 0.1 | GO:0031179 | peptide amidation(GO:0001519) peptide modification(GO:0031179) |
| 0.1 | 0.1 | GO:2000779 | regulation of double-strand break repair(GO:2000779) |
| 0.1 | 0.1 | GO:2000861 | estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
| 0.1 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.7 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
| 0.1 | 0.6 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.1 | 0.2 | GO:0048304 | regulation of isotype switching to IgG isotypes(GO:0048302) positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 0.5 | GO:0009414 | response to water deprivation(GO:0009414) |
| 0.1 | 0.4 | GO:0075713 | establishment of integrated proviral latency(GO:0075713) |
| 0.1 | 0.2 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.1 | 2.6 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 0.3 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.1 | 0.5 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.1 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.1 | 0.2 | GO:0010710 | regulation of collagen catabolic process(GO:0010710) |
| 0.1 | 0.7 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 | 0.1 | GO:0001569 | patterning of blood vessels(GO:0001569) |
| 0.1 | 0.2 | GO:0045210 | FasL biosynthetic process(GO:0045210) |
| 0.1 | 1.3 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.1 | 0.3 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.1 | 0.6 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.1 | 0.3 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.1 | 0.3 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 0.2 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.1 | 0.3 | GO:0045764 | cellular response to phosphate starvation(GO:0016036) positive regulation of sulfur amino acid metabolic process(GO:0031337) positive regulation of cellular amino acid metabolic process(GO:0045764) positive regulation of homocysteine metabolic process(GO:0050668) |
| 0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.2 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.1 | 0.1 | GO:0018307 | enzyme active site formation(GO:0018307) |
| 0.1 | 0.3 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.1 | GO:0035350 | FAD transport(GO:0015883) FAD transmembrane transport(GO:0035350) |
| 0.1 | 0.2 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.1 | 0.3 | GO:1901534 | positive regulation of megakaryocyte differentiation(GO:0045654) positive regulation of hematopoietic progenitor cell differentiation(GO:1901534) |
| 0.1 | 0.2 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.1 | 1.1 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.1 | 0.2 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.1 | 0.8 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.1 | 0.3 | GO:0090182 | regulation of secretion of lysosomal enzymes(GO:0090182) |
| 0.1 | 0.1 | GO:2000049 | cell-cell adhesion mediated by cadherin(GO:0044331) regulation of cell-cell adhesion mediated by cadherin(GO:2000047) positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.1 | 0.5 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 0.1 | GO:1990918 | double-strand break repair involved in meiotic recombination(GO:1990918) |
| 0.1 | 0.9 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.1 | 0.3 | GO:0007135 | meiosis II(GO:0007135) |
| 0.1 | 0.2 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.1 | 0.2 | GO:1903676 | regulation of cap-dependent translational initiation(GO:1903674) positive regulation of cap-dependent translational initiation(GO:1903676) |
| 0.1 | 0.4 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.1 | 0.8 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.1 | 0.2 | GO:0001832 | blastocyst growth(GO:0001832) |
| 0.1 | 0.3 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.0 | 0.3 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.0 | 0.0 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.0 | GO:0021539 | subthalamus development(GO:0021539) |
| 0.0 | 0.3 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.0 | 0.3 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.0 | 0.0 | GO:1904903 | ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
| 0.0 | 0.7 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.0 | GO:0003214 | cardiac left ventricle morphogenesis(GO:0003214) |
| 0.0 | 0.5 | GO:0043401 | steroid hormone mediated signaling pathway(GO:0043401) |
| 0.0 | 0.3 | GO:0052203 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.0 | 0.2 | GO:1904799 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.0 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.0 | 0.5 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 0.7 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.0 | 0.1 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
| 0.0 | 0.8 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.0 | 0.2 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 | 0.1 | GO:0044727 | DNA demethylation of male pronucleus(GO:0044727) |
| 0.0 | 0.2 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.1 | GO:0046098 | guanine catabolic process(GO:0006147) guanine metabolic process(GO:0046098) |
| 0.0 | 0.1 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.0 | 0.0 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 1.0 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.0 | GO:2001023 | regulation of response to drug(GO:2001023) |
| 0.0 | 0.2 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
| 0.0 | 0.2 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.0 | 0.6 | GO:0019614 | phenol-containing compound catabolic process(GO:0019336) catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.0 | 0.0 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.0 | 0.1 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.0 | 0.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.5 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.0 | 0.2 | GO:0032435 | negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
| 0.0 | 0.1 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.0 | 0.8 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.1 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 | 0.1 | GO:1902722 | positive regulation of prolactin secretion(GO:1902722) |
| 0.0 | 0.3 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.4 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.6 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.0 | 0.7 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.0 | 0.6 | GO:0038007 | netrin-activated signaling pathway(GO:0038007) |
| 0.0 | 0.8 | GO:0032196 | transposition(GO:0032196) |
| 0.0 | 0.0 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
| 0.0 | 0.1 | GO:0007494 | midgut development(GO:0007494) |
| 0.0 | 0.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.0 | 0.1 | GO:0060730 | regulation of intestinal epithelial structure maintenance(GO:0060730) |
| 0.0 | 0.8 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.1 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.0 | 0.1 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
| 0.0 | 0.2 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.0 | 0.5 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.3 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.0 | 0.3 | GO:0021699 | cerebellum maturation(GO:0021590) cerebellar cortex maturation(GO:0021699) |
| 0.0 | 0.2 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.0 | 0.2 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.2 | GO:0015810 | aspartate transport(GO:0015810) |
| 0.0 | 0.0 | GO:0030185 | nitric oxide transport(GO:0030185) |
| 0.0 | 0.5 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.0 | GO:0010652 | regulation of cell communication by chemical coupling(GO:0010645) positive regulation of cell communication by chemical coupling(GO:0010652) |
| 0.0 | 0.3 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.0 | 0.1 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.5 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.3 | GO:1904383 | response to sodium phosphate(GO:1904383) |
| 0.0 | 0.1 | GO:0099625 | ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
| 0.0 | 0.3 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.0 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.0 | 0.0 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 | 0.4 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.7 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.2 | GO:0030031 | cell projection assembly(GO:0030031) |
| 0.0 | 0.6 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 | 0.5 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 0.2 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.8 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.3 | GO:2000535 | regulation of entry of bacterium into host cell(GO:2000535) |
| 0.0 | 0.9 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
| 0.0 | 0.2 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.0 | 0.2 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 1.2 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.0 | 0.1 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 2.2 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.0 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.0 | 0.6 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.0 | 1.0 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.0 | 0.0 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.0 | 0.1 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.0 | 0.4 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
| 0.0 | 0.7 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.0 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.0 | 0.2 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.0 | 0.2 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.0 | 0.1 | GO:0051780 | mevalonate transport(GO:0015728) behavioral response to nutrient(GO:0051780) |
| 0.0 | 0.3 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.3 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.1 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
| 0.0 | 0.1 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.0 | 1.0 | GO:1901687 | glutathione derivative metabolic process(GO:1901685) glutathione derivative biosynthetic process(GO:1901687) |
| 0.0 | 0.0 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.0 | 0.1 | GO:0032242 | regulation of nucleoside transport(GO:0032242) |
| 0.0 | 0.2 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.0 | 0.1 | GO:0006864 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.0 | 0.1 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) beta selection(GO:0043366) |
| 0.0 | 0.5 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 | 0.4 | GO:0098967 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.0 | 0.1 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.0 | 0.3 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.0 | 0.1 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 | 0.1 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.0 | 0.3 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
| 0.0 | 0.1 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) |
| 0.0 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) |
| 0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.1 | GO:0008057 | eye pigment granule organization(GO:0008057) |
| 0.0 | 0.2 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.2 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 | 0.2 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.0 | 0.5 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.4 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.0 | 0.0 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.0 | 0.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.0 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.0 | 0.1 | GO:0010755 | regulation of plasminogen activation(GO:0010755) |
| 0.0 | 0.1 | GO:0002933 | lipid hydroxylation(GO:0002933) |
| 0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.0 | 0.4 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.0 | 0.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.0 | 0.2 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.2 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) |
| 0.0 | 0.2 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.0 | 0.1 | GO:0015991 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) |
| 0.0 | 0.6 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.1 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.0 | 0.2 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.4 | GO:0015820 | leucine transport(GO:0015820) |
| 0.0 | 0.1 | GO:0017157 | regulation of exocytosis(GO:0017157) |
| 0.0 | 0.4 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.0 | 0.3 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 3.5 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.9 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.3 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.0 | 0.4 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.1 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.0 | 0.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.3 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
| 0.0 | 0.9 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.5 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.0 | 0.3 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.4 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.0 | 0.1 | GO:1902544 | regulation of DNA N-glycosylase activity(GO:1902544) |
| 0.0 | 0.3 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.3 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 0.2 | GO:0007598 | blood coagulation, extrinsic pathway(GO:0007598) |
| 0.0 | 0.2 | GO:0030862 | positive regulation of polarized epithelial cell differentiation(GO:0030862) |
| 0.0 | 0.1 | GO:0001967 | suckling behavior(GO:0001967) |
| 0.0 | 0.3 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.1 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.0 | 2.4 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 0.1 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.0 | 0.1 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.0 | 0.1 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.0 | 0.4 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.3 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.0 | 0.0 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.0 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.0 | 0.1 | GO:0042762 | regulation of sulfur metabolic process(GO:0042762) |
| 0.0 | 0.4 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.0 | 0.6 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
| 0.0 | 0.2 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 | 1.7 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.7 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.0 | 0.4 | GO:1903944 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.0 | 0.1 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
| 0.0 | 0.0 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.0 | 0.0 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.0 | 0.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.2 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 | 0.4 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.0 | 0.1 | GO:1904017 | cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.0 | 0.5 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.1 | GO:0072757 | cellular response to camptothecin(GO:0072757) |
| 0.0 | 0.2 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.0 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.0 | 0.2 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.0 | 0.4 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 | 0.5 | GO:0036258 | multivesicular body assembly(GO:0036258) |
| 0.0 | 0.2 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.0 | 0.2 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.0 | 0.6 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.0 | 0.1 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.0 | 0.2 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.0 | 1.2 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.0 | 0.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.0 | 0.1 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.0 | 0.1 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.0 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.0 | 0.5 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 0.0 | GO:0060023 | soft palate development(GO:0060023) |
| 0.0 | 0.2 | GO:0090646 | mitochondrial tRNA processing(GO:0090646) |
| 0.0 | 0.3 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.0 | 0.9 | GO:0016246 | RNA interference(GO:0016246) |
| 0.0 | 0.4 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.0 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.4 | GO:0006541 | glutamine metabolic process(GO:0006541) |
| 0.0 | 0.3 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 | 0.5 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
| 0.0 | 0.3 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.0 | 0.0 | GO:1901374 | acetate ester transport(GO:1901374) |
| 0.0 | 0.0 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.0 | 0.2 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
| 0.0 | 0.3 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.3 | GO:0048793 | pronephros development(GO:0048793) |
| 0.0 | 0.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.9 | GO:0045103 | intermediate filament-based process(GO:0045103) |
| 0.0 | 0.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.2 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.0 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
| 0.0 | 0.2 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.0 | 0.5 | GO:0060008 | Sertoli cell differentiation(GO:0060008) |
| 0.0 | 0.4 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.1 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 | 0.0 | GO:0034122 | negative regulation of toll-like receptor signaling pathway(GO:0034122) |
| 0.0 | 0.1 | GO:0060041 | retina development in camera-type eye(GO:0060041) |
| 0.0 | 0.2 | GO:0034128 | negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.0 | 0.0 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
| 0.0 | 0.3 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.0 | 0.2 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.0 | 0.2 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.0 | 0.2 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 0.0 | 0.2 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.0 | 0.5 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.0 | 0.0 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.0 | 0.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.2 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.0 | 0.0 | GO:0032641 | lymphotoxin A production(GO:0032641) lymphotoxin A biosynthetic process(GO:0042109) |
| 0.0 | 0.9 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.0 | 0.2 | GO:0003266 | regulation of secondary heart field cardioblast proliferation(GO:0003266) positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 | 0.1 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.0 | 0.3 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.0 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.0 | 0.0 | GO:0019377 | glycolipid catabolic process(GO:0019377) |
| 0.0 | 1.0 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
| 0.0 | 0.2 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.0 | 0.1 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.0 | 0.0 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.0 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.0 | 0.1 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.0 | 0.4 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.0 | 0.0 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) regulation of homologous chromosome segregation(GO:0060629) |
| 0.0 | 1.9 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.0 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.0 | 0.3 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 0.0 | 0.1 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.0 | 1.1 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.1 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.0 | 0.1 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) negative regulation of hypersensitivity(GO:0002884) |
| 0.0 | 0.3 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
| 0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.0 | 0.2 | GO:0007052 | mitotic spindle organization(GO:0007052) |
| 0.0 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.0 | 0.9 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.2 | GO:0032468 | Golgi calcium ion homeostasis(GO:0032468) |
| 0.0 | 0.6 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.1 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.0 | 0.0 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.0 | 0.2 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
| 0.0 | 0.1 | GO:0019060 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.0 | 0.1 | GO:0042733 | embryonic digit morphogenesis(GO:0042733) |
| 0.0 | 0.4 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
| 0.0 | 0.0 | GO:0099545 | trans-synaptic signaling by trans-synaptic complex(GO:0099545) |
| 0.0 | 0.5 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.5 | GO:0034969 | histone arginine methylation(GO:0034969) |
| 0.0 | 0.1 | GO:1904717 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.0 | 0.2 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.0 | 0.4 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.8 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.1 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.0 | 0.0 | GO:0098828 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.0 | 0.0 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.0 | 0.8 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
| 0.0 | 0.3 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
| 0.0 | 0.2 | GO:0097354 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.0 | 0.1 | GO:0051030 | snRNA transport(GO:0051030) |
| 0.0 | 0.3 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 | 0.4 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.0 | 0.4 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.0 | 0.1 | GO:0097581 | lamellipodium organization(GO:0097581) |
| 0.0 | 0.0 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 | 0.0 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.0 | 0.5 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.6 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.0 | 0.1 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.0 | 0.0 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.0 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
| 0.0 | 2.3 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.0 | 1.1 | GO:0007031 | peroxisome organization(GO:0007031) |
| 0.0 | 0.0 | GO:0033028 | inflammatory cell apoptotic process(GO:0006925) myeloid cell apoptotic process(GO:0033028) |
| 0.0 | 0.1 | GO:0010872 | regulation of cholesterol esterification(GO:0010872) |
| 0.0 | 0.1 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.0 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 | 0.0 | GO:0060920 | cardiac pacemaker cell differentiation(GO:0060920) |
| 0.0 | 0.0 | GO:2001056 | positive regulation of cysteine-type endopeptidase activity(GO:2001056) |
| 0.0 | 0.4 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.1 | GO:0042640 | anagen(GO:0042640) |
| 0.0 | 0.2 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
| 0.0 | 0.2 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.0 | 0.0 | GO:0097267 | omega-hydroxylase P450 pathway(GO:0097267) |
| 0.0 | 0.2 | GO:0038172 | interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.0 | 0.1 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.0 | GO:0032342 | aldosterone metabolic process(GO:0032341) aldosterone biosynthetic process(GO:0032342) |
| 0.0 | 0.1 | GO:0051084 | 'de novo' posttranslational protein folding(GO:0051084) |
| 0.0 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.1 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.0 | 0.1 | GO:0001971 | negative regulation of activation of membrane attack complex(GO:0001971) |
| 0.0 | 0.3 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.0 | 0.1 | GO:0032223 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.0 | 0.2 | GO:0071435 | potassium ion export(GO:0071435) |
| 0.0 | 0.3 | GO:0097286 | iron ion import(GO:0097286) |
| 0.0 | 0.1 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.0 | 0.0 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.0 | 0.1 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.0 | 0.0 | GO:0048538 | thymus development(GO:0048538) |
| 0.0 | 0.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.1 | GO:0051254 | positive regulation of RNA metabolic process(GO:0051254) |
| 0.0 | 0.0 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.0 | 0.1 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.1 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.0 | 0.1 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.0 | 0.1 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 0.0 | 0.2 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.0 | 0.2 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.0 | 0.3 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.0 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.0 | 0.1 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
| 0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.0 | 0.3 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) |
| 0.0 | 0.2 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.0 | 0.3 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 0.2 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.0 | 0.1 | GO:0098868 | bone growth(GO:0098868) |
| 0.0 | 0.0 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.0 | 1.5 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
| 0.0 | 0.0 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.0 | 0.1 | GO:0015827 | tryptophan transport(GO:0015827) |
| 0.0 | 0.1 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.0 | 0.0 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 | 0.0 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.0 | 0.5 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 | 0.3 | GO:0014874 | response to muscle inactivity(GO:0014870) response to stimulus involved in regulation of muscle adaptation(GO:0014874) |
| 0.0 | 0.1 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.0 | 0.0 | GO:0006429 | leucyl-tRNA aminoacylation(GO:0006429) |
| 0.0 | 0.3 | GO:2000142 | regulation of DNA-templated transcription, initiation(GO:2000142) |
| 0.0 | 0.0 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.1 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.0 | 0.0 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) |
| 0.0 | 0.0 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.0 | 0.4 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.1 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.1 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.0 | 0.1 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
| 0.0 | 0.1 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
| 0.0 | 0.0 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.0 | 0.5 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 1.1 | GO:0046580 | negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 0.0 | 0.1 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 1.3 | GO:0000725 | recombinational repair(GO:0000725) |
| 0.0 | 0.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.0 | 0.1 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.0 | 0.0 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.0 | 0.1 | GO:0043438 | acetoacetic acid metabolic process(GO:0043438) |
| 0.0 | 0.0 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.2 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.0 | 0.2 | GO:0090003 | regulation of establishment of protein localization to plasma membrane(GO:0090003) |
| 0.0 | 0.1 | GO:0033292 | T-tubule organization(GO:0033292) |
| 0.0 | 0.4 | GO:0097484 | dendrite extension(GO:0097484) |
| 0.0 | 0.2 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.0 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.2 | GO:0015908 | fatty acid transport(GO:0015908) |
| 0.0 | 0.1 | GO:0044359 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) modification by host of symbiont molecular function(GO:0052428) |
| 0.0 | 0.0 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.0 | 0.1 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
| 0.0 | 0.0 | GO:0006448 | regulation of translational elongation(GO:0006448) regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.5 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.0 | 0.1 | GO:0001783 | B cell apoptotic process(GO:0001783) |
| 0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.0 | GO:0035989 | tendon development(GO:0035989) |
| 0.0 | 0.1 | GO:0032048 | cardiolipin metabolic process(GO:0032048) cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.1 | GO:1901202 | negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.0 | 0.2 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.0 | 0.0 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) |
| 0.0 | 0.1 | GO:1903431 | positive regulation of cell maturation(GO:1903431) |
| 0.0 | 0.1 | GO:0048880 | sensory system development(GO:0048880) |
| 0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.3 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.2 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.0 | GO:0031000 | response to caffeine(GO:0031000) |
| 0.0 | 0.0 | GO:0045649 | regulation of macrophage differentiation(GO:0045649) |
| 0.0 | 0.1 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.2 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.0 | 0.9 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.0 | GO:0051598 | meiotic recombination checkpoint(GO:0051598) |
| 0.0 | 0.3 | GO:0006691 | leukotriene metabolic process(GO:0006691) leukotriene biosynthetic process(GO:0019370) |
| 0.0 | 0.0 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.0 | 0.2 | GO:0015865 | purine nucleotide transport(GO:0015865) |
| 0.0 | 0.1 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.0 | 0.1 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.0 | 0.3 | GO:0022400 | regulation of rhodopsin mediated signaling pathway(GO:0022400) |
| 0.0 | 0.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.1 | GO:0032720 | negative regulation of tumor necrosis factor production(GO:0032720) |
| 0.0 | 0.5 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.0 | 0.1 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) |
| 0.0 | 0.0 | GO:0060037 | pharyngeal system development(GO:0060037) |
| 0.0 | 0.1 | GO:0044782 | cilium organization(GO:0044782) |
| 0.0 | 0.0 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.9 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.0 | GO:0060462 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.1 | GO:0021569 | rhombomere 3 development(GO:0021569) |
| 0.0 | 0.3 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.0 | 0.3 | GO:0036152 | phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.3 | GO:0051057 | positive regulation of small GTPase mediated signal transduction(GO:0051057) |
| 0.0 | 0.1 | GO:0032094 | response to food(GO:0032094) |
| 0.0 | 0.1 | GO:0038060 | nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
| 0.0 | 0.2 | GO:0050428 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.0 | 0.1 | GO:0016102 | retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
| 0.0 | 0.2 | GO:0015684 | ferrous iron transport(GO:0015684) ferrous iron transmembrane transport(GO:1903874) |
| 0.0 | 0.2 | GO:0070071 | proton-transporting two-sector ATPase complex assembly(GO:0070071) |
| 0.0 | 0.1 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
| 0.0 | 0.1 | GO:0008089 | anterograde axonal transport(GO:0008089) |
| 0.0 | 0.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.3 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.1 | GO:0090520 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 | 0.2 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.0 | 0.1 | GO:0043542 | endothelial cell migration(GO:0043542) |
| 0.0 | 0.1 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.0 | 0.0 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.0 | 0.0 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.0 | 0.4 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 | 0.0 | GO:0001553 | luteinization(GO:0001553) |
| 0.0 | 0.0 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.0 | 0.4 | GO:0051168 | nuclear export(GO:0051168) |
| 0.0 | 0.0 | GO:0002507 | tolerance induction(GO:0002507) |
| 0.0 | 0.0 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.0 | 0.9 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.2 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.0 | 0.1 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.1 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
| 0.0 | 0.0 | GO:0097300 | programmed necrotic cell death(GO:0097300) |
| 0.0 | 0.0 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.0 | GO:0043324 | eye pigment biosynthetic process(GO:0006726) eye pigment metabolic process(GO:0042441) pigment metabolic process involved in developmental pigmentation(GO:0043324) pigment metabolic process involved in pigmentation(GO:0043474) |
| 0.0 | 0.3 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.3 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.0 | 0.1 | GO:1903670 | regulation of sprouting angiogenesis(GO:1903670) |
| 0.0 | 0.0 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.0 | GO:0006085 | acetyl-CoA biosynthetic process(GO:0006085) |
| 0.0 | 0.1 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 | 0.1 | GO:0019556 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.0 | 0.0 | GO:0042501 | serine phosphorylation of STAT protein(GO:0042501) |
| 0.0 | 0.0 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.0 | 0.2 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.0 | 0.0 | GO:0034142 | toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.0 | 0.0 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.0 | 0.9 | GO:0007608 | sensory perception of smell(GO:0007608) |
| 0.0 | 0.1 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.0 | 0.1 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 | 0.1 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.1 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.0 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.2 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.0 | 0.3 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
| 0.0 | 0.2 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.0 | 0.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.0 | 0.2 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.0 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.0 | 0.4 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.0 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.0 | 0.1 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.0 | 0.1 | GO:0060113 | inner ear receptor cell differentiation(GO:0060113) |
| 0.0 | 0.1 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.0 | 0.0 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
| 0.0 | 0.1 | GO:0006997 | nucleus organization(GO:0006997) |
| 0.0 | 0.1 | GO:2001045 | negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.0 | 0.2 | GO:0007032 | endosome organization(GO:0007032) |
| 0.0 | 0.1 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.3 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.3 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
| 0.0 | 0.1 | GO:0045625 | regulation of T-helper 1 cell differentiation(GO:0045625) |
| 0.0 | 0.1 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) |
| 0.0 | 0.1 | GO:0035581 | sequestering of extracellular ligand from receptor(GO:0035581) |
| 0.0 | 0.0 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.0 | 0.0 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.0 | 0.0 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.0 | 0.1 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.0 | 0.6 | GO:0006405 | RNA export from nucleus(GO:0006405) |
| 0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.0 | 0.0 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 | 0.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.0 | GO:1903332 | regulation of protein folding(GO:1903332) regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.0 | 0.0 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.0 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.0 | 0.0 | GO:0033197 | response to vitamin E(GO:0033197) |
| 0.0 | 0.0 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.0 | 0.1 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.0 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
| 0.0 | 0.0 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.5 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.0 | GO:0043038 | amino acid activation(GO:0043038) |
| 0.0 | 0.1 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 | 0.5 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
| 0.0 | 0.3 | GO:0018196 | peptidyl-asparagine modification(GO:0018196) |
| 0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.0 | GO:0045056 | transcytosis(GO:0045056) |
| 0.0 | 0.1 | GO:0051000 | positive regulation of nitric-oxide synthase activity(GO:0051000) |
| 0.0 | 0.0 | GO:0042220 | response to cocaine(GO:0042220) |
| 0.0 | 0.3 | GO:0048813 | dendrite morphogenesis(GO:0048813) |
| 0.0 | 0.0 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.0 | 0.0 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) |
| 0.0 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.0 | 0.0 | GO:0035696 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.0 | 0.0 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
| 0.0 | 0.0 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.0 | 0.1 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 | 0.0 | GO:0048146 | positive regulation of fibroblast proliferation(GO:0048146) |
| 0.0 | 0.1 | GO:0051017 | actin filament bundle assembly(GO:0051017) actin filament bundle organization(GO:0061572) |
| 0.0 | 0.0 | GO:0021587 | cerebellum morphogenesis(GO:0021587) |
| 0.0 | 0.0 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.0 | GO:0033014 | tetrapyrrole biosynthetic process(GO:0033014) |
| 0.0 | 0.0 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.0 | 0.1 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
| 0.0 | 0.0 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.4 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.4 | 1.1 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 0.3 | 1.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.3 | 1.2 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.3 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.3 | 0.3 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.3 | 0.8 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.3 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.3 | 0.8 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 0.2 | 1.2 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.2 | 1.4 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.2 | 0.4 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.2 | 0.7 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.2 | 1.7 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.2 | 1.7 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.2 | 1.2 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.2 | 1.2 | GO:0031673 | H zone(GO:0031673) |
| 0.2 | 1.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.2 | 0.4 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.2 | 2.6 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.2 | 0.6 | GO:0005694 | chromosome(GO:0005694) |
| 0.2 | 2.1 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
| 0.2 | 0.2 | GO:1990234 | transferase complex(GO:1990234) |
| 0.2 | 1.1 | GO:0000221 | vacuolar proton-transporting V-type ATPase, V1 domain(GO:0000221) |
| 0.2 | 0.8 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.2 | 0.2 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.2 | 1.5 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.2 | 2.4 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.2 | 0.9 | GO:0031417 | NatC complex(GO:0031417) |
| 0.2 | 0.7 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.2 | 1.3 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.2 | 0.5 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.2 | 0.5 | GO:0070993 | translation preinitiation complex(GO:0070993) |
| 0.2 | 1.4 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.2 | 0.7 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.2 | 0.5 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.2 | 2.3 | GO:0000796 | condensin complex(GO:0000796) |
| 0.2 | 0.7 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.2 | 0.7 | GO:0034676 | integrin alpha6-beta4 complex(GO:0034676) |
| 0.2 | 0.7 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.2 | 2.8 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.2 | 1.0 | GO:0034678 | integrin alpha8-beta1 complex(GO:0034678) |
| 0.2 | 0.6 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.2 | 0.5 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.2 | 0.8 | GO:0071942 | XPC complex(GO:0071942) |
| 0.2 | 0.3 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 0.2 | 0.6 | GO:0034271 | phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) |
| 0.2 | 1.2 | GO:1990357 | terminal web(GO:1990357) |
| 0.2 | 1.4 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.2 | 1.2 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.2 | 2.7 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.2 | 2.7 | GO:0005818 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.2 | 0.5 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
| 0.1 | 1.3 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.1 | 2.2 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.1 | 1.5 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.6 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.1 | 0.4 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.1 | 1.0 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.1 | 0.4 | GO:0005668 | RNA polymerase transcription factor SL1 complex(GO:0005668) |
| 0.1 | 0.7 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 1.4 | GO:0033503 | HULC complex(GO:0033503) |
| 0.1 | 0.9 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.1 | 0.8 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.1 | 0.5 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.1 | 0.4 | GO:0005940 | septin ring(GO:0005940) septin collar(GO:0032173) |
| 0.1 | 1.5 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.1 | 0.9 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.1 | 0.4 | GO:0070762 | nuclear pore transmembrane ring(GO:0070762) |
| 0.1 | 1.4 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.1 | 4.0 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.1 | 0.4 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.1 | 0.5 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 1.1 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.6 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.1 | 1.6 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.1 | 0.2 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.1 | 1.2 | GO:0051286 | cell tip(GO:0051286) |
| 0.1 | 1.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.1 | 0.5 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 1.9 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 1.5 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.1 | 0.5 | GO:0070985 | TFIIK complex(GO:0070985) |
| 0.1 | 1.4 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.5 | GO:0097196 | Shu complex(GO:0097196) |
| 0.1 | 1.8 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 0.8 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 1.0 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.3 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.1 | 1.6 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 0.9 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 0.8 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.3 | GO:0075341 | host cell PML body(GO:0075341) |
| 0.1 | 1.7 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.1 | 0.9 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.4 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.1 | 0.3 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.1 | 0.5 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 0.1 | 0.8 | GO:0001740 | Barr body(GO:0001740) |
| 0.1 | 0.7 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 3.9 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 1.7 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.1 | 0.8 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 0.9 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.1 | 0.7 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 2.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.3 | GO:0070701 | mucus layer(GO:0070701) |
| 0.1 | 0.5 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 0.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 0.8 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.1 | 1.0 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 0.4 | GO:0070931 | Golgi-associated vesicle lumen(GO:0070931) |
| 0.1 | 0.4 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 0.4 | GO:0031213 | RSF complex(GO:0031213) |
| 0.1 | 0.5 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.3 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.1 | 0.5 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.5 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.1 | 0.4 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.1 | 0.1 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.1 | 0.1 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
| 0.1 | 1.4 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 0.3 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) postsynaptic endocytic zone membrane(GO:0098844) |
| 0.1 | 0.3 | GO:0008623 | CHRAC(GO:0008623) |
| 0.1 | 1.4 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 0.4 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.1 | 1.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.1 | 1.0 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.1 | 0.7 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.1 | 1.9 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.1 | 6.0 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 1.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 1.5 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 0.8 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 0.3 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.1 | 5.5 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.1 | 1.1 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.3 | GO:0005840 | ribosome(GO:0005840) |
| 0.1 | 0.3 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.1 | 0.3 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.1 | 0.8 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.8 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.1 | 1.8 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 0.7 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.3 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
| 0.1 | 0.2 | GO:0048500 | signal recognition particle(GO:0048500) |
| 0.1 | 0.7 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 2.0 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 2.7 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
| 0.1 | 0.5 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.1 | 0.5 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.1 | 0.2 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.1 | 0.5 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 0.5 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 0.5 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 1.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 0.2 | GO:0034515 | proteasome storage granule(GO:0034515) |
| 0.1 | 3.1 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.1 | 0.4 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.1 | 0.5 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.1 | 0.4 | GO:0097179 | protease inhibitor complex(GO:0097179) |
| 0.1 | 0.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.5 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
| 0.1 | 1.7 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.1 | 0.2 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 0.4 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.1 | 0.3 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.3 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.1 | 0.8 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 0.3 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 0.5 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.1 | 1.0 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.4 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 1.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.1 | 1.9 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.1 | 0.1 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.1 | 0.7 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.1 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.4 | GO:0002169 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.1 | 1.3 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.1 | 0.7 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.1 | 0.8 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.1 | 0.4 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.1 | 0.3 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.1 | 0.3 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 0.3 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 2.2 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.1 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.6 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 1.5 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.1 | 0.9 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
| 0.1 | 0.4 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.3 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.1 | 0.4 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.1 | 1.0 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.1 | 0.9 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.1 | 0.1 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
| 0.1 | 0.8 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.1 | 0.6 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.6 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.6 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.1 | 1.0 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 0.3 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.1 | 0.1 | GO:0032421 | stereocilium bundle(GO:0032421) |
| 0.1 | 1.8 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.1 | 0.4 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.5 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 0.4 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 0.6 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 0.1 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.1 | 0.6 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 0.2 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.1 | 0.2 | GO:0005713 | recombination nodule(GO:0005713) |
| 0.1 | 0.3 | GO:0097362 | MCM8-MCM9 complex(GO:0097362) |
| 0.1 | 0.4 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.1 | 1.3 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.1 | 0.2 | GO:0034753 | nuclear aryl hydrocarbon receptor complex(GO:0034753) |
| 0.1 | 1.1 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.2 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.1 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
| 0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 0.1 | GO:0035101 | FACT complex(GO:0035101) |
| 0.1 | 1.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 1.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.2 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 0.1 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.1 | 0.6 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.1 | 0.3 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.1 | 1.1 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.1 | 0.3 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.1 | 0.1 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 0.2 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.1 | 0.3 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.1 | 1.3 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.1 | 0.6 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.1 | 1.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.1 | 0.8 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.0 | 0.7 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 5.1 | GO:0044439 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.0 | 0.3 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.0 | 1.8 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.5 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.5 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.0 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.2 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.0 | 0.7 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.6 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.0 | 0.2 | GO:0016528 | sarcoplasm(GO:0016528) |
| 0.0 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.0 | 0.2 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 0.2 | GO:0031251 | PAN complex(GO:0031251) |
| 0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.0 | 0.0 | GO:1902911 | protein kinase complex(GO:1902911) |
| 0.0 | 1.5 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 1.5 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.0 | 0.6 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.3 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.0 | 0.7 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.6 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 2.1 | GO:0099738 | cell cortex region(GO:0099738) |
| 0.0 | 1.3 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 0.2 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.0 | 1.0 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 0.1 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.4 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.5 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.4 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.0 | 0.5 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.5 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.1 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 0.3 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.2 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.0 | 0.9 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.6 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 1.2 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.3 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 3.7 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.0 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.4 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.0 | 1.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.1 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.0 | 3.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.0 | 0.0 | GO:0072563 | endothelial microparticle(GO:0072563) |
| 0.0 | 2.1 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.3 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.2 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.0 | 0.2 | GO:0019867 | outer membrane(GO:0019867) |
| 0.0 | 0.7 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 2.1 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.4 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.0 | 0.2 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.0 | 0.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.1 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.0 | 0.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.6 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.7 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.0 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 0.0 | 0.8 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.3 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 6.0 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.8 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.0 | 1.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.0 | 0.4 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 1.5 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.1 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.0 | 0.5 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.1 | GO:0034680 | integrin alpha10-beta1 complex(GO:0034680) |
| 0.0 | 0.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 2.2 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.4 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.4 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.4 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 2.9 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 0.0 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.0 | 0.2 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.0 | 0.8 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.1 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 0.0 | 0.1 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.0 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.2 | GO:0098574 | cytoplasmic side of lysosomal membrane(GO:0098574) |
| 0.0 | 0.8 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
| 0.0 | 0.2 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.0 | 0.1 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.0 | 0.1 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.4 | GO:0044754 | autolysosome(GO:0044754) |
| 0.0 | 0.6 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.2 | GO:0070822 | Sin3-type complex(GO:0070822) |
| 0.0 | 1.9 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.1 | GO:0030017 | sarcomere(GO:0030017) |
| 0.0 | 1.3 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 1.0 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.3 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.0 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.0 | 0.1 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.1 | GO:0045281 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.0 | 1.7 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.3 | GO:0033643 | host cell part(GO:0033643) |
| 0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.0 | GO:0036379 | myofilament(GO:0036379) |
| 0.0 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.2 | GO:0044423 | virion(GO:0019012) virion part(GO:0044423) |
| 0.0 | 0.2 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.1 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.1 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.0 | 0.4 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.5 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.2 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.0 | 0.3 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.1 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.0 | 0.2 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 0.3 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.5 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 0.2 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.0 | 1.3 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.8 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.2 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.0 | 3.3 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.0 | 0.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.0 | 2.6 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.1 | GO:0071020 | post-spliceosomal complex(GO:0071020) |
| 0.0 | 0.3 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.0 | 0.0 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.0 | 0.2 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 0.6 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 1.0 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.5 | GO:0001726 | ruffle(GO:0001726) |
| 0.0 | 0.1 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 1.4 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.0 | 1.2 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.6 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.0 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.0 | 0.6 | GO:0043209 | myelin sheath(GO:0043209) |
| 0.0 | 1.8 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 1.5 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.0 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.0 | 0.1 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.1 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.0 | 0.7 | GO:0043657 | host(GO:0018995) host cell(GO:0043657) |
| 0.0 | 0.7 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.0 | GO:0031674 | I band(GO:0031674) |
| 0.0 | 0.6 | GO:0030027 | lamellipodium(GO:0030027) |
| 0.0 | 0.2 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.0 | 1.6 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.0 | 4.0 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.1 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.0 | 4.9 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.0 | 0.0 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.2 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 2.5 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.0 | 0.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.0 | GO:0009346 | citrate lyase complex(GO:0009346) |
| 0.0 | 0.9 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.1 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.7 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 1.8 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.0 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.0 | 0.0 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 4.5 | GO:0005813 | centrosome(GO:0005813) |
| 0.0 | 0.0 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.1 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
| 0.0 | 0.0 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.0 | 0.1 | GO:0032809 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.0 | 0.5 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.0 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.4 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.0 | 0.3 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
| 0.0 | 2.1 | GO:0030018 | Z disc(GO:0030018) |
| 0.0 | 0.0 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.1 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.0 | 0.2 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.3 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.2 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.4 | 1.1 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.4 | 1.1 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
| 0.4 | 1.8 | GO:0005462 | UDP-N-acetylglucosamine transmembrane transporter activity(GO:0005462) |
| 0.3 | 1.0 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.3 | 1.0 | GO:0000224 | peptide-N4-(N-acetyl-beta-glucosaminyl)asparagine amidase activity(GO:0000224) |
| 0.3 | 1.3 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.3 | 0.9 | GO:0034039 | 8-oxo-7,8-dihydroguanine DNA N-glycosylase activity(GO:0034039) |
| 0.3 | 0.3 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.3 | 1.2 | GO:0070704 | C-5 sterol desaturase activity(GO:0000248) sterol desaturase activity(GO:0070704) |
| 0.3 | 0.9 | GO:0001133 | RNA polymerase II transcription factor activity, sequence-specific transcription regulatory region DNA binding(GO:0001133) |
| 0.3 | 1.2 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.3 | 0.9 | GO:0051500 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 0.3 | 1.1 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 0.3 | 1.1 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.3 | 1.7 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.3 | 0.3 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.3 | 0.5 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.3 | 0.3 | GO:0004559 | alpha-mannosidase activity(GO:0004559) mannosidase activity(GO:0015923) |
| 0.3 | 1.0 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.3 | 2.3 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.2 | 0.7 | GO:0043337 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) CDP-diacylglycerol-phosphatidylglycerol phosphatidyltransferase activity(GO:0043337) |
| 0.2 | 0.7 | GO:0005365 | myo-inositol transmembrane transporter activity(GO:0005365) |
| 0.2 | 1.2 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.2 | 0.7 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 0.2 | 1.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.2 | 0.9 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
| 0.2 | 0.7 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
| 0.2 | 1.2 | GO:0047256 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.2 | 0.9 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 0.7 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.2 | 0.2 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.2 | 0.7 | GO:0003955 | NAD(P)H dehydrogenase (quinone) activity(GO:0003955) |
| 0.2 | 0.7 | GO:0030626 | U12 snRNA binding(GO:0030626) |
| 0.2 | 1.1 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.2 | 1.3 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.2 | 0.7 | GO:0070260 | tyrosyl-RNA phosphodiesterase activity(GO:0036317) 5'-tyrosyl-DNA phosphodiesterase activity(GO:0070260) |
| 0.2 | 0.9 | GO:0033265 | choline binding(GO:0033265) |
| 0.2 | 0.4 | GO:0051734 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.2 | 1.7 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.2 | 0.6 | GO:0070119 | ciliary neurotrophic factor binding(GO:0070119) |
| 0.2 | 0.2 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
| 0.2 | 1.9 | GO:0043426 | MRF binding(GO:0043426) |
| 0.2 | 0.6 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
| 0.2 | 1.7 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.2 | 1.5 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.2 | 0.8 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.2 | 0.6 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.2 | 0.6 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.2 | 0.6 | GO:0051908 | double-stranded DNA 5'-3' exodeoxyribonuclease activity(GO:0051908) |
| 0.2 | 1.4 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.2 | 0.6 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.2 | 0.4 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.2 | 0.6 | GO:0005427 | proton-dependent oligopeptide secondary active transmembrane transporter activity(GO:0005427) secondary active oligopeptide transmembrane transporter activity(GO:0015322) |
| 0.2 | 1.0 | GO:0004441 | inositol-1,4-bisphosphate 1-phosphatase activity(GO:0004441) inositol-1,3,4-trisphosphate 1-phosphatase activity(GO:0052829) |
| 0.2 | 0.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.2 | 0.8 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.2 | 0.6 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.2 | 0.2 | GO:0004915 | interleukin-6 receptor activity(GO:0004915) interleukin-6 binding(GO:0019981) |
| 0.2 | 0.2 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.2 | 2.6 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.2 | 0.6 | GO:0047676 | arachidonate-CoA ligase activity(GO:0047676) |
| 0.2 | 0.7 | GO:0047860 | diiodophenylpyruvate reductase activity(GO:0047860) |
| 0.2 | 1.5 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.2 | 0.7 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.2 | 0.6 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.2 | 1.1 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.2 | 0.5 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 0.2 | 1.6 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.2 | 1.3 | GO:0051748 | UTP:glucose-1-phosphate uridylyltransferase activity(GO:0003983) UTP-monosaccharide-1-phosphate uridylyltransferase activity(GO:0051748) |
| 0.2 | 0.5 | GO:0031775 | lutropin-choriogonadotropic hormone receptor binding(GO:0031775) calcium-transporting ATPase activity involved in regulation of cardiac muscle cell membrane potential(GO:0086039) |
| 0.2 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.2 | 1.1 | GO:0008486 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.2 | 0.7 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.2 | 0.9 | GO:0052839 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.2 | 0.2 | GO:0001160 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.2 | 0.5 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.2 | 0.7 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.2 | 1.0 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.2 | 1.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.2 | 1.0 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.2 | 0.2 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.2 | 0.8 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.2 | 1.3 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.2 | 0.2 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.2 | 0.5 | GO:0070336 | flap-structured DNA binding(GO:0070336) |
| 0.2 | 0.3 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.2 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.2 | 0.5 | GO:0061663 | NEDD8 ligase activity(GO:0061663) |
| 0.2 | 0.9 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.2 | 0.5 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.2 | 1.1 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.2 | 0.5 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 0.2 | 1.5 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.2 | 0.2 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
| 0.2 | 0.9 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.1 | 0.6 | GO:0016005 | phospholipase A2 activator activity(GO:0016005) |
| 0.1 | 0.4 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.1 | 0.9 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.1 | 1.6 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.1 | 0.3 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.1 | 3.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.9 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.1 | 0.1 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.4 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.1 | 1.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.7 | GO:0050115 | myosin-light-chain-phosphatase activity(GO:0050115) |
| 0.1 | 0.8 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.1 | 0.6 | GO:0032551 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) pyrimidine ribonucleotide binding(GO:0032557) |
| 0.1 | 0.4 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.1 | 0.4 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.1 | 0.4 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 0.1 | 0.3 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.1 | 0.7 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.1 | 0.5 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
| 0.1 | 1.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 1.2 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.1 | 0.7 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
| 0.1 | 0.5 | GO:0047273 | galactosylgalactosylglucosylceramide beta-D-acetylgalactosaminyltransferase activity(GO:0047273) |
| 0.1 | 0.5 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.1 | 1.5 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 1.2 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.1 | 0.3 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.1 | 1.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.1 | 0.5 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.1 | 0.5 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.1 | 0.1 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
| 0.1 | 1.6 | GO:0009374 | biotin binding(GO:0009374) |
| 0.1 | 0.5 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.1 | 0.5 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 0.4 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.1 | 0.5 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.1 | 0.8 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.1 | 0.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 0.5 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 0.9 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.1 | 4.1 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 3.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.1 | 0.7 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.1 | 0.9 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 1.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.1 | 1.7 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.9 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.1 | 1.6 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.2 | GO:0070259 | tyrosyl-DNA phosphodiesterase activity(GO:0070259) |
| 0.1 | 0.7 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.1 | 0.4 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 0.8 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.1 | 0.5 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 1.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 0.4 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.4 | GO:0071566 | UFM1 activating enzyme activity(GO:0071566) |
| 0.1 | 0.4 | GO:0097259 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.1 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 1.1 | GO:0038051 | glucocorticoid receptor activity(GO:0004883) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.1 | 0.4 | GO:0086076 | gap junction channel activity involved in atrial cardiac muscle cell-AV node cell electrical coupling(GO:0086076) gap junction channel activity involved in bundle of His cell-Purkinje myocyte electrical coupling(GO:0086078) gap junction channel activity involved in Purkinje myocyte-ventricular cardiac muscle cell electrical coupling(GO:0086079) |
| 0.1 | 0.4 | GO:0016768 | spermine synthase activity(GO:0016768) |
| 0.1 | 0.4 | GO:0004827 | proline-tRNA ligase activity(GO:0004827) |
| 0.1 | 0.5 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
| 0.1 | 0.7 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.1 | 0.5 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.1 | 0.4 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.1 | 1.0 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.7 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 0.3 | GO:1904713 | beta-catenin destruction complex binding(GO:1904713) |
| 0.1 | 1.0 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.1 | 1.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 0.3 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.1 | 0.5 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.1 | 0.1 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.1 | 0.5 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.1 | 0.5 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.1 | 0.7 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.1 | 0.3 | GO:0003980 | UDP-glucose:glycoprotein glucosyltransferase activity(GO:0003980) |
| 0.1 | 0.2 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.7 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 1.0 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.1 | 0.3 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.1 | 0.7 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 1.2 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.1 | 0.9 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
| 0.1 | 0.6 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 0.3 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
| 0.1 | 0.3 | GO:0004961 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.1 | 1.5 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.3 | GO:0004781 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.1 | 0.5 | GO:0032143 | single thymine insertion binding(GO:0032143) |
| 0.1 | 0.2 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.1 | 0.3 | GO:0047150 | betaine-homocysteine S-methyltransferase activity(GO:0047150) |
| 0.1 | 0.5 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.8 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.1 | 1.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 0.3 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 0.1 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.1 | 0.3 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.1 | 0.4 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.1 | 0.7 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.1 | 0.1 | GO:0031177 | acyl binding(GO:0000035) phosphopantetheine binding(GO:0031177) |
| 0.1 | 0.4 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 0.4 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
| 0.1 | 0.4 | GO:0004803 | transposase activity(GO:0004803) |
| 0.1 | 0.4 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.1 | 0.4 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.1 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.1 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 0.1 | 1.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 0.4 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
| 0.1 | 0.9 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.9 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) acyl-CoA desaturase activity(GO:0016215) |
| 0.1 | 0.3 | GO:0010309 | acireductone dioxygenase [iron(II)-requiring] activity(GO:0010309) |
| 0.1 | 1.0 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 0.3 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.1 | 0.8 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.1 | 0.5 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.1 | 0.4 | GO:0004641 | phosphoribosylamine-glycine ligase activity(GO:0004637) phosphoribosylformylglycinamidine cyclo-ligase activity(GO:0004641) phosphoribosylglycinamide formyltransferase activity(GO:0004644) |
| 0.1 | 0.4 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.1 | 0.4 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 0.4 | GO:0008670 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) |
| 0.1 | 0.5 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.1 | 0.9 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.1 | 0.3 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.1 | 0.8 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.1 | 0.2 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.1 | 1.9 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
| 0.1 | 0.4 | GO:0005537 | mannose binding(GO:0005537) |
| 0.1 | 0.7 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.1 | 0.5 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.4 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.1 | 1.7 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.3 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.1 | 0.6 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.1 | 0.8 | GO:1990763 | arrestin family protein binding(GO:1990763) |
| 0.1 | 0.3 | GO:0035248 | alpha-1,4-N-acetylgalactosaminyltransferase activity(GO:0035248) |
| 0.1 | 0.2 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.1 | 0.6 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.1 | 1.0 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.1 | 0.8 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.1 | 0.4 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.1 | 0.4 | GO:0070643 | vitamin D3 25-hydroxylase activity(GO:0030343) vitamin D 25-hydroxylase activity(GO:0070643) |
| 0.1 | 1.8 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
| 0.1 | 0.3 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
| 0.1 | 0.3 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) |
| 0.1 | 0.3 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
| 0.1 | 0.8 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 0.5 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.1 | 0.4 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.1 | 0.3 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
| 0.1 | 2.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.7 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.1 | 0.4 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.1 | 0.7 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.1 | 0.5 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.1 | 3.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 0.3 | GO:0036487 | nitric-oxide synthase inhibitor activity(GO:0036487) |
| 0.1 | 0.5 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.1 | 0.4 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.1 | 0.3 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.1 | 0.7 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 0.3 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 0.4 | GO:0051120 | hepoxilin A3 synthase activity(GO:0051120) |
| 0.1 | 0.7 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.1 | 0.8 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.4 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.1 | 0.9 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.1 | 0.6 | GO:0070404 | NADH binding(GO:0070404) |
| 0.1 | 0.1 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.1 | 0.7 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.1 | 0.3 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.1 | 0.7 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.1 | 0.8 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 0.2 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.1 | 0.3 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.6 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
| 0.1 | 1.7 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 0.2 | GO:0004397 | histidine ammonia-lyase activity(GO:0004397) |
| 0.1 | 1.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 0.2 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.1 | 0.7 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 1.1 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 0.6 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.1 | 0.9 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.1 | 0.3 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.1 | 0.3 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.1 | 1.0 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 0.2 | GO:0000404 | heteroduplex DNA loop binding(GO:0000404) |
| 0.1 | 0.6 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.1 | 0.4 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.1 | 0.9 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 1.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 1.1 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 1.6 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 0.7 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.3 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.1 | 1.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.1 | 0.6 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.1 | 0.4 | GO:0060961 | phospholipase D inhibitor activity(GO:0060961) |
| 0.1 | 0.5 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 0.2 | GO:0045550 | geranylgeranyl reductase activity(GO:0045550) |
| 0.1 | 0.8 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.2 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.1 | 0.1 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.1 | 0.4 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.1 | 0.2 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.1 | 0.1 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 0.1 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.1 | 0.4 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.1 | 0.9 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.1 | 0.9 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.1 | 0.4 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.1 | 0.4 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.1 | 2.6 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.1 | 0.1 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.1 | 0.1 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.1 | 0.1 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.1 | 0.2 | GO:0008386 | cholesterol monooxygenase (side-chain-cleaving) activity(GO:0008386) |
| 0.1 | 0.4 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.1 | 0.1 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.1 | 0.4 | GO:0031403 | lithium ion binding(GO:0031403) |
| 0.1 | 0.9 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 1.2 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.1 | 0.4 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.1 | 0.2 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
| 0.1 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 0.4 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.1 | 0.6 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.1 | 0.4 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 1.3 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 1.6 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 0.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.1 | 0.4 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.1 | 6.5 | GO:0019003 | GDP binding(GO:0019003) |
| 0.1 | 0.5 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.8 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.4 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.1 | 0.3 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.1 | 0.8 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 4.0 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.1 | 0.9 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.3 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.1 | 1.9 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 0.3 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
| 0.1 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.1 | 0.2 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.1 | 0.3 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 1.7 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.5 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
| 0.1 | 0.2 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
| 0.1 | 0.2 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
| 0.1 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.4 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.1 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 0.1 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
| 0.1 | 0.3 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.1 | 0.3 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.1 | 2.5 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.6 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 0.3 | GO:0001512 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.1 | 0.5 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 0.1 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.1 | 0.2 | GO:0008398 | sterol 14-demethylase activity(GO:0008398) |
| 0.1 | 0.5 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.2 | GO:0033961 | cis-stilbene-oxide hydrolase activity(GO:0033961) |
| 0.1 | 1.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 0.6 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.1 | 0.2 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.1 | 0.1 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.1 | 0.2 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.1 | 0.8 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.6 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 0.2 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.1 | 0.2 | GO:0035643 | L-DOPA receptor activity(GO:0035643) L-DOPA binding(GO:0072544) |
| 0.1 | 0.1 | GO:0051287 | NAD binding(GO:0051287) |
| 0.1 | 0.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 0.6 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 1.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.1 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.1 | 0.6 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.1 | 0.2 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.1 | 0.2 | GO:0010348 | lithium:proton antiporter activity(GO:0010348) |
| 0.1 | 1.8 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 0.5 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.2 | GO:0031896 | vasopressin receptor binding(GO:0031893) V2 vasopressin receptor binding(GO:0031896) |
| 0.1 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.1 | 0.3 | GO:0047298 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.1 | 0.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.1 | 0.6 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.2 | GO:0060001 | minus-end directed microfilament motor activity(GO:0060001) |
| 0.1 | 0.2 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.1 | 0.2 | GO:0019976 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.1 | 0.5 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.4 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.1 | 0.4 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) |
| 0.1 | 0.2 | GO:0004368 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) sn-glycerol-3-phosphate:ubiquinone oxidoreductase activity(GO:0052590) sn-glycerol-3-phosphate:ubiquinone-8 oxidoreductase activity(GO:0052591) |
| 0.1 | 1.6 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 1.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 0.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.1 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.1 | 0.2 | GO:0004823 | leucine-tRNA ligase activity(GO:0004823) |
| 0.1 | 1.3 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 0.3 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.1 | 1.0 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.1 | 0.6 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.8 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 1.7 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.1 | 0.2 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.1 | 0.6 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 0.3 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.1 | 2.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.1 | 0.3 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.1 | 0.3 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.1 | 0.1 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.1 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 0.3 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.1 | 0.2 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.1 | 0.3 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 6.6 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.1 | 0.1 | GO:0019208 | phosphatase regulator activity(GO:0019208) |
| 0.1 | 0.6 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.1 | 1.3 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.1 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 0.4 | GO:0003920 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.1 | 1.1 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.1 | 0.2 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
| 0.1 | 0.1 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 0.4 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.1 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 0.4 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 0.4 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 0.4 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.1 | 0.5 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.1 | 0.4 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 0.5 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.1 | 0.1 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.1 | 0.3 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.1 | 0.2 | GO:0004923 | leukemia inhibitory factor receptor activity(GO:0004923) |
| 0.1 | 0.2 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.1 | 1.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.2 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.1 | 0.4 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 0.3 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 0.3 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.1 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 0.2 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 0.1 | 0.2 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.1 | 0.7 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.1 | 0.7 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 0.5 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.1 | 0.2 | GO:0001181 | transcription factor activity, core RNA polymerase I binding(GO:0001181) |
| 0.1 | 1.2 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 0.4 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 0.1 | GO:0016416 | O-palmitoyltransferase activity(GO:0016416) |
| 0.1 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
| 0.1 | 0.3 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.1 | 1.5 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.1 | 1.1 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.1 | 0.3 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 0.2 | GO:0048244 | phytanoyl-CoA dioxygenase activity(GO:0048244) |
| 0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.0 | 0.9 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.8 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 1.1 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.1 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.0 | 0.5 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.1 | GO:0034736 | sterol O-acyltransferase activity(GO:0004772) cholesterol O-acyltransferase activity(GO:0034736) |
| 0.0 | 0.7 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.5 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.0 | 0.2 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.0 | 1.9 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.1 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.0 | 0.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.1 | GO:0008892 | guanine deaminase activity(GO:0008892) |
| 0.0 | 1.0 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.4 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 3.7 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.0 | 0.2 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.3 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.0 | 0.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.1 | GO:0072591 | citrate-L-glutamate ligase activity(GO:0072591) |
| 0.0 | 0.1 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
| 0.0 | 0.2 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.0 | 0.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.4 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.2 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
| 0.0 | 1.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.3 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 0.1 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.0 | 0.1 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.0 | 0.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 1.5 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.3 | GO:0051378 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.0 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.0 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.2 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.0 | 0.8 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.5 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 1.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.3 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.0 | 0.2 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.1 | GO:0004651 | polynucleotide 5'-phosphatase activity(GO:0004651) |
| 0.0 | 2.8 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 0.3 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
| 0.0 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.0 | 2.5 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.0 | 0.2 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.2 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.0 | 0.1 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.0 | 0.7 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.2 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.1 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.0 | 0.6 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.3 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.6 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.3 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.2 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.0 | 3.7 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 0.2 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.0 | 2.1 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.1 | GO:0004139 | deoxyribose-phosphate aldolase activity(GO:0004139) |
| 0.0 | 4.5 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 0.3 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.1 | GO:0015130 | mevalonate transmembrane transporter activity(GO:0015130) |
| 0.0 | 0.1 | GO:0002113 | interleukin-33 binding(GO:0002113) |
| 0.0 | 0.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.3 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.5 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.0 | 0.2 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.1 | GO:0034061 | DNA polymerase activity(GO:0034061) |
| 0.0 | 0.1 | GO:0008441 | 3'(2'),5'-bisphosphate nucleotidase activity(GO:0008441) |
| 0.0 | 0.0 | GO:0010851 | cyclase regulator activity(GO:0010851) guanylate cyclase regulator activity(GO:0030249) |
| 0.0 | 1.5 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.9 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.3 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.0 | 0.6 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.0 | 0.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.0 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.0 | 0.2 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
| 0.0 | 0.1 | GO:0046970 | tubulin deacetylase activity(GO:0042903) NAD-dependent histone deacetylase activity (H4-K16 specific)(GO:0046970) |
| 0.0 | 0.4 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.5 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.0 | 0.5 | GO:0051429 | corticotropin-releasing hormone receptor binding(GO:0051429) |
| 0.0 | 0.2 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.0 | 0.3 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.0 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.0 | 0.1 | GO:1904854 | proteasome core complex binding(GO:1904854) |
| 0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.0 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.0 | 0.2 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.7 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.2 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 3.3 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.2 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
| 0.0 | 0.1 | GO:0016855 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.0 | 0.1 | GO:0031628 | opioid receptor binding(GO:0031628) |
| 0.0 | 0.8 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.0 | 0.3 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.4 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.4 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.1 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.4 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.0 | 0.1 | GO:0001132 | RNA polymerase II transcription factor activity, TBP-class protein binding, involved in preinitiation complex assembly(GO:0001129) RNA polymerase II transcription factor activity, TBP-class protein binding(GO:0001132) |
| 0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 1.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.2 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) |
| 0.0 | 0.1 | GO:0019107 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 0.0 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 2.0 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.1 | GO:0004423 | iduronate-2-sulfatase activity(GO:0004423) |
| 0.0 | 0.1 | GO:0005298 | proline:sodium symporter activity(GO:0005298) |
| 0.0 | 0.1 | GO:0015230 | FAD transmembrane transporter activity(GO:0015230) |
| 0.0 | 0.3 | GO:0004620 | phospholipase activity(GO:0004620) |
| 0.0 | 0.0 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.0 | 0.7 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.0 | 0.1 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.0 | 0.5 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.3 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.9 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.1 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
| 0.0 | 0.0 | GO:0004520 | endodeoxyribonuclease activity(GO:0004520) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.8 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 0.1 | GO:0001855 | complement component C4b binding(GO:0001855) |
| 0.0 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.1 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.0 | 0.2 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
| 0.0 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.6 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 0.1 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.0 | 0.2 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
| 0.0 | 0.1 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.1 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.0 | 0.1 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.0 | 0.2 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.2 | GO:0016775 | creatine kinase activity(GO:0004111) phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
| 0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.0 | 0.5 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 1.1 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.4 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.2 | GO:1903763 | gap junction channel activity involved in cell communication by electrical coupling(GO:1903763) |
| 0.0 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.4 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.2 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.2 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.0 | 0.9 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.3 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.0 | 1.3 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 1.1 | GO:0004629 | phospholipase C activity(GO:0004629) |
| 0.0 | 0.1 | GO:0016405 | acyl-CoA ligase activity(GO:0003996) CoA-ligase activity(GO:0016405) |
| 0.0 | 0.1 | GO:0052857 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 0.0 | 0.3 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.1 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.0 | 0.1 | GO:0016725 | oxidoreductase activity, acting on CH or CH2 groups(GO:0016725) oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.0 | 0.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.1 | GO:0015216 | purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 0.1 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.0 | 0.3 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.8 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.0 | 0.1 | GO:0031768 | growth hormone-releasing hormone activity(GO:0016608) ghrelin receptor binding(GO:0031768) |
| 0.0 | 0.1 | GO:0050543 | icosanoid binding(GO:0050542) icosatetraenoic acid binding(GO:0050543) arachidonic acid binding(GO:0050544) fatty acid derivative binding(GO:1901567) |
| 0.0 | 0.2 | GO:0042835 | BRE binding(GO:0042835) |
| 0.0 | 0.1 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.0 | 0.1 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.3 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 1.6 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.1 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.0 | 0.5 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 0.1 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
| 0.0 | 0.0 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 0.7 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.2 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.4 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.0 | 0.2 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.0 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 1.4 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.0 | 0.6 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.1 | GO:0031626 | beta-endorphin binding(GO:0031626) |
| 0.0 | 0.1 | GO:0015361 | low-affinity sodium:dicarboxylate symporter activity(GO:0015361) |
| 0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.0 | 0.0 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
| 0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 1.5 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
| 0.0 | 0.8 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.2 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.0 | 0.7 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.0 | 0.1 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.0 | 5.8 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
| 0.0 | 0.4 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) |
| 0.0 | 0.2 | GO:0016595 | glutamate binding(GO:0016595) |
| 0.0 | 0.8 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.0 | GO:0016248 | channel inhibitor activity(GO:0016248) |
| 0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.0 | 0.2 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.0 | 0.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.0 | 0.1 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.0 | 0.0 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.0 | 0.2 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.1 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.0 | 0.8 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.0 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.0 | 0.4 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.0 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.1 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.0 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.0 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.0 | 0.1 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.0 | 0.0 | GO:0047017 | prostaglandin-F synthase activity(GO:0047017) |
| 0.0 | 0.2 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.0 | 0.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.0 | GO:0051380 | beta-adrenergic receptor activity(GO:0004939) norepinephrine binding(GO:0051380) |
| 0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.0 | 0.1 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.0 | 4.6 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.6 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.0 | 0.3 | GO:0003823 | antigen binding(GO:0003823) |
| 0.0 | 0.0 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.0 | GO:0035254 | glutamate receptor binding(GO:0035254) |
| 0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.0 | 0.1 | GO:1990175 | EH domain binding(GO:1990175) |
| 0.0 | 0.0 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.0 | 0.1 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.1 | GO:0043849 | Ras palmitoyltransferase activity(GO:0043849) |
| 0.0 | 0.2 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 0.7 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.1 | GO:0052642 | lysophosphatidic acid phosphatase activity(GO:0052642) |
| 0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 0.3 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.0 | 0.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.0 | 0.4 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 1.2 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.1 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.0 | 0.6 | GO:0015248 | sterol transporter activity(GO:0015248) |
| 0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.2 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 6.1 | GO:0061659 | ubiquitin-like protein ligase activity(GO:0061659) |
| 0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.2 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.0 | 0.1 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.0 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.2 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.0 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.0 | 0.0 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.0 | 0.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.0 | GO:0030695 | GTPase regulator activity(GO:0030695) |
| 0.0 | 0.1 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.0 | 0.0 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.0 | 0.2 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.0 | 0.0 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 0.1 | GO:0004597 | peptide-aspartate beta-dioxygenase activity(GO:0004597) |
| 0.0 | 0.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.4 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.0 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
| 0.0 | 0.5 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.0 | GO:0004807 | triose-phosphate isomerase activity(GO:0004807) |
| 0.0 | 0.2 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.6 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.2 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.0 | 0.5 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.3 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.0 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.1 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) |
| 0.0 | 0.1 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.0 | 0.3 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.9 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.1 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.1 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.0 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
| 0.0 | 0.1 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.1 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.0 | 0.1 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.0 | 0.0 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.0 | 0.0 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.0 | 0.2 | GO:0036310 | annealing helicase activity(GO:0036310) annealing activity(GO:0097617) |
| 0.0 | 0.0 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.0 | 0.1 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
| 0.0 | 0.1 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.4 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.1 | GO:0002114 | interleukin-33 receptor activity(GO:0002114) |
| 0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.0 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:0045569 | TRAIL binding(GO:0045569) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.0 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.0 | 0.1 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.0 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.0 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.0 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
| 0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.1 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.0 | 0.1 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.0 | 1.7 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.0 | GO:0005548 | phospholipid transporter activity(GO:0005548) |
| 0.0 | 0.1 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.2 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.0 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.0 | 0.0 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.0 | 0.2 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.0 | GO:0016878 | acid-thiol ligase activity(GO:0016878) |
| 0.0 | 0.0 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.0 | 0.3 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.0 | 0.0 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.0 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.0 | 0.1 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.1 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.0 | 0.0 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
| 0.0 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 0.3 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.0 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.0 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.0 | 0.3 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
| 0.0 | 0.1 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.0 | 0.4 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 0.5 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.3 | 0.8 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.2 | 0.4 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.2 | 0.7 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 9.8 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 0.3 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.1 | 2.4 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 8.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 7.6 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 0.4 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 3.2 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.1 | 2.9 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 2.5 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 6.5 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.1 | 0.3 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.1 | 2.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 2.9 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.1 | 0.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.1 | 0.2 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.1 | 2.7 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.1 | 0.4 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 0.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 2.3 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.2 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 1.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.5 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.0 | 2.9 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.3 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.7 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 1.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 2.3 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 1.2 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 2.6 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.5 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 1.9 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 2.6 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.9 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.0 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.5 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 2.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 1.7 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.9 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.5 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 1.4 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 1.1 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.3 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 1.9 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.2 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 0.9 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.6 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.1 | PID EPO PATHWAY | EPO signaling pathway |
| 0.0 | 1.0 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 1.0 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.2 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.3 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.7 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.2 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.4 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 0.4 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.2 | 0.5 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.2 | 5.6 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.1 | 2.8 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 2.7 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 1.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 2.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 0.8 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.1 | 1.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 1.4 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.1 | 3.1 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 2.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 2.5 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 0.9 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 2.1 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.1 | 1.0 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.1 | 4.0 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.1 | 0.3 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 1.5 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 0.7 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.1 | 1.6 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 1.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.1 | 0.3 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.1 | 3.4 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.1 | 1.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 2.8 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.1 | 1.7 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.1 | 0.4 | REACTOME G1 S TRANSITION | Genes involved in G1/S Transition |
| 0.1 | 2.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 2.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.1 | 2.1 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 3.1 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.1 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.1 | 0.4 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
| 0.1 | 3.7 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 1.4 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 9.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 0.3 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 3.9 | REACTOME NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Neurotransmitter Release Cycle |
| 0.1 | 0.3 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
| 0.1 | 2.5 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 2.0 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 1.0 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.1 | 1.8 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 0.5 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 3.4 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 2.5 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 2.8 | REACTOME G2 M CHECKPOINTS | Genes involved in G2/M Checkpoints |
| 0.1 | 5.5 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.1 | 2.1 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.1 | 0.2 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.1 | 2.4 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.1 | 0.3 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.1 | 1.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 1.0 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.1 | 0.4 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.1 | 1.6 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 0.5 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 1.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 1.7 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.1 | 0.2 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.1 | 3.3 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 1.5 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 0.7 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.0 | 0.6 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 2.5 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 1.1 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 1.2 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.0 | 0.0 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.0 | 1.4 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.4 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 1.4 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 1.0 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 2.2 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
| 0.0 | 3.0 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 2.3 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 2.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 1.0 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.5 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 1.9 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.0 | 0.9 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 1.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 2.4 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.8 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 3.9 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.3 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.8 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.5 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.0 | 0.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 1.5 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.3 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.8 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 1.5 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.0 | 0.9 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.6 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.0 | 0.5 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.0 | 1.4 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.6 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.6 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 15.0 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.0 | 2.2 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 0.6 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.0 | 0.4 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.0 | 0.8 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.1 | REACTOME GPCR DOWNSTREAM SIGNALING | Genes involved in GPCR downstream signaling |
| 0.0 | 0.4 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 1.9 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.0 | 0.7 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 1.2 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.6 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
| 0.0 | 0.3 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 1.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.5 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.5 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.0 | 0.8 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.4 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.9 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 0.5 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 1.1 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.5 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.0 | 0.9 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.5 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.8 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.3 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
| 0.0 | 5.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.2 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.5 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.8 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.2 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
| 0.0 | 0.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.2 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.0 | 0.4 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.4 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.1 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.0 | 0.0 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
| 0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.3 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.3 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.0 | 0.6 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.2 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |