avrg: NHBE cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Gene Symbol | Gene ID | Gene Info |
---|---|---|
MECP2
|
ENSG00000169057.15 | MECP2 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
MECP2 | hg19_v2_chrX_-_153363125_153363182 | 0.93 | 6.4e-03 | Click! |
Promoter | Score | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr22_-_50699972 | 1.37 |
ENST00000395778.3 |
MAPK12 |
mitogen-activated protein kinase 12 |
chr9_-_138987115 | 1.33 |
ENST00000277554.2 |
NACC2 |
NACC family member 2, BEN and BTB (POZ) domain containing |
chr9_-_35658007 | 1.33 |
ENST00000602361.1 |
RMRP |
RNA component of mitochondrial RNA processing endoribonuclease |
chr1_+_895930 | 1.03 |
ENST00000338591.3 |
KLHL17 |
kelch-like family member 17 |
chr14_-_103989033 | 0.94 |
ENST00000553878.1 ENST00000557530.1 |
CKB |
creatine kinase, brain |
chr19_+_33685490 | 0.93 |
ENST00000253193.7 |
LRP3 |
low density lipoprotein receptor-related protein 3 |
chr11_+_842928 | 0.93 |
ENST00000397408.1 |
TSPAN4 |
tetraspanin 4 |
chr12_+_132312931 | 0.88 |
ENST00000360564.1 ENST00000545671.1 ENST00000545790.1 |
MMP17 |
matrix metallopeptidase 17 (membrane-inserted) |
chr19_+_13228917 | 0.87 |
ENST00000586171.1 |
NACC1 |
nucleus accumbens associated 1, BEN and BTB (POZ) domain containing |
chr11_+_842808 | 0.84 |
ENST00000397397.2 ENST00000397411.2 ENST00000397396.1 |
TSPAN4 |
tetraspanin 4 |
chr9_-_139581848 | 0.83 |
ENST00000538402.1 ENST00000371694.3 |
AGPAT2 |
1-acylglycerol-3-phosphate O-acyltransferase 2 |
chr16_-_75284758 | 0.81 |
ENST00000561970.1 |
BCAR1 |
breast cancer anti-estrogen resistance 1 |
chr1_+_33722080 | 0.80 |
ENST00000483388.1 ENST00000539719.1 |
ZNF362 |
zinc finger protein 362 |
chr7_-_1543981 | 0.79 |
ENST00000404767.3 |
INTS1 |
integrator complex subunit 1 |
chr11_-_2950642 | 0.79 |
ENST00000314222.4 |
PHLDA2 |
pleckstrin homology-like domain, family A, member 2 |
chr22_+_50639408 | 0.77 |
ENST00000380903.2 |
SELO |
Selenoprotein O |
chr19_-_49622348 | 0.75 |
ENST00000408991.2 |
C19orf73 |
chromosome 19 open reading frame 73 |
chr2_+_74212073 | 0.74 |
ENST00000441217.1 |
AC073046.25 |
AC073046.25 |
chr10_+_134210672 | 0.73 |
ENST00000305233.5 ENST00000368609.4 |
PWWP2B |
PWWP domain containing 2B |
chr11_+_65686952 | 0.72 |
ENST00000527119.1 |
DRAP1 |
DR1-associated protein 1 (negative cofactor 2 alpha) |
chr1_-_1051455 | 0.71 |
ENST00000379339.1 ENST00000480643.1 ENST00000434641.1 ENST00000421241.2 |
C1orf159 |
chromosome 1 open reading frame 159 |
chr17_+_73083816 | 0.71 |
ENST00000580123.1 ENST00000578847.1 |
SLC16A5 |
solute carrier family 16 (monocarboxylate transporter), member 5 |
chr1_-_22469459 | 0.71 |
ENST00000290167.6 |
WNT4 |
wingless-type MMTV integration site family, member 4 |
chr16_-_4664382 | 0.71 |
ENST00000591113.1 |
UBALD1 |
UBA-like domain containing 1 |
chr11_+_849816 | 0.70 |
ENST00000527644.1 |
TSPAN4 |
tetraspanin 4 |
chr16_-_4466565 | 0.69 |
ENST00000572467.1 ENST00000423908.2 ENST00000572044.1 ENST00000571052.1 |
CORO7-PAM16 CORO7 |
CORO7-PAM16 readthrough coronin 7 |
chr17_+_80009741 | 0.69 |
ENST00000578552.1 ENST00000320548.4 ENST00000581578.1 ENST00000583885.1 ENST00000583641.1 ENST00000581418.1 ENST00000355130.2 ENST00000306823.6 ENST00000392358.2 |
GPS1 |
G protein pathway suppressor 1 |
chr17_-_73761222 | 0.68 |
ENST00000437911.1 ENST00000225614.2 |
GALK1 |
galactokinase 1 |
chr1_-_1284730 | 0.68 |
ENST00000378888.5 |
DVL1 |
dishevelled segment polarity protein 1 |
chr22_-_50708781 | 0.68 |
ENST00000449719.2 ENST00000330651.6 |
MAPK11 |
mitogen-activated protein kinase 11 |
chr19_-_1848451 | 0.67 |
ENST00000170168.4 |
REXO1 |
REX1, RNA exonuclease 1 homolog (S. cerevisiae) |
chr14_+_105266933 | 0.67 |
ENST00000555360.1 |
ZBTB42 |
zinc finger and BTB domain containing 42 |
chr19_-_36643329 | 0.66 |
ENST00000589154.1 |
COX7A1 |
cytochrome c oxidase subunit VIIa polypeptide 1 (muscle) |
chr16_-_420338 | 0.66 |
ENST00000450882.1 ENST00000441883.1 ENST00000447696.1 ENST00000389675.2 |
MRPL28 |
mitochondrial ribosomal protein L28 |
chr14_+_105559784 | 0.65 |
ENST00000548104.1 |
RP11-44N21.1 |
RP11-44N21.1 |
chr19_+_532049 | 0.65 |
ENST00000606136.1 |
CDC34 |
cell division cycle 34 |
chr20_+_34680595 | 0.65 |
ENST00000406771.2 |
EPB41L1 |
erythrocyte membrane protein band 4.1-like 1 |
chr11_-_615942 | 0.64 |
ENST00000397562.3 ENST00000330243.5 ENST00000397570.1 ENST00000397574.2 |
IRF7 |
interferon regulatory factor 7 |
chr17_-_80056099 | 0.63 |
ENST00000306749.2 |
FASN |
fatty acid synthase |
chr19_+_1000418 | 0.62 |
ENST00000234389.3 |
GRIN3B |
glutamate receptor, ionotropic, N-methyl-D-aspartate 3B |
chr1_+_955448 | 0.61 |
ENST00000379370.2 |
AGRN |
agrin |
chr12_+_3068544 | 0.60 |
ENST00000540314.1 ENST00000536826.1 ENST00000359864.2 |
TEAD4 |
TEA domain family member 4 |
chr22_+_50624323 | 0.60 |
ENST00000380909.4 ENST00000303434.4 |
TRABD |
TraB domain containing |
chr19_-_18391708 | 0.59 |
ENST00000600972.1 |
JUND |
jun D proto-oncogene |
chr10_+_26986582 | 0.59 |
ENST00000376215.5 ENST00000376203.5 |
PDSS1 |
prenyl (decaprenyl) diphosphate synthase, subunit 1 |
chr2_+_241526126 | 0.58 |
ENST00000391984.2 ENST00000391982.2 ENST00000404753.3 ENST00000270364.7 ENST00000352879.4 ENST00000354082.4 |
CAPN10 |
calpain 10 |
chr1_+_1407133 | 0.58 |
ENST00000378741.3 ENST00000308647.7 |
ATAD3B |
ATPase family, AAA domain containing 3B |
chr15_+_73976715 | 0.58 |
ENST00000558689.1 ENST00000560786.2 ENST00000561213.1 ENST00000563584.1 ENST00000561416.1 |
CD276 |
CD276 molecule |
chr12_-_122238464 | 0.57 |
ENST00000546227.1 |
RHOF |
ras homolog family member F (in filopodia) |
chr19_+_531713 | 0.56 |
ENST00000215574.4 |
CDC34 |
cell division cycle 34 |
chr9_+_137218362 | 0.56 |
ENST00000481739.1 |
RXRA |
retinoid X receptor, alpha |
chr11_+_65383227 | 0.56 |
ENST00000355703.3 |
PCNXL3 |
pecanex-like 3 (Drosophila) |
chrX_+_153238220 | 0.56 |
ENST00000425274.1 |
TMEM187 |
transmembrane protein 187 |
chr19_-_11039261 | 0.56 |
ENST00000590329.1 ENST00000587943.1 ENST00000585858.1 ENST00000586748.1 ENST00000586575.1 ENST00000253031.2 |
YIPF2 |
Yip1 domain family, member 2 |
chr20_-_60942326 | 0.55 |
ENST00000370677.3 ENST00000370692.3 |
LAMA5 |
laminin, alpha 5 |
chr1_+_1447517 | 0.55 |
ENST00000378756.3 ENST00000378755.5 |
ATAD3A |
ATPase family, AAA domain containing 3A |
chr17_+_80009330 | 0.55 |
ENST00000580716.1 ENST00000583961.1 |
GPS1 |
G protein pathway suppressor 1 |
chr20_-_60942361 | 0.55 |
ENST00000252999.3 |
LAMA5 |
laminin, alpha 5 |
chr13_+_114462193 | 0.55 |
ENST00000375353.3 |
TMEM255B |
transmembrane protein 255B |
chr19_-_17414179 | 0.55 |
ENST00000594194.1 ENST00000247706.3 |
ABHD8 |
abhydrolase domain containing 8 |
chr21_-_45759250 | 0.55 |
ENST00000397956.3 ENST00000339818.4 ENST00000325223.7 |
C21orf2 |
chromosome 21 open reading frame 2 |
chr17_-_80009650 | 0.54 |
ENST00000310496.4 |
RFNG |
RFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
chr8_-_141645645 | 0.54 |
ENST00000519980.1 ENST00000220592.5 |
AGO2 |
argonaute RISC catalytic component 2 |
chr8_+_145202939 | 0.54 |
ENST00000423230.2 ENST00000398656.4 |
MROH1 |
maestro heat-like repeat family member 1 |
chr7_+_2281843 | 0.54 |
ENST00000356714.1 ENST00000397049.1 |
NUDT1 |
nudix (nucleoside diphosphate linked moiety X)-type motif 1 |
chr1_-_1167346 | 0.53 |
ENST00000545427.1 ENST00000360001.6 |
SDF4 |
stromal cell derived factor 4 |
chr9_-_139581875 | 0.53 |
ENST00000371696.2 |
AGPAT2 |
1-acylglycerol-3-phosphate O-acyltransferase 2 |
chr7_+_148982396 | 0.53 |
ENST00000418158.2 |
ZNF783 |
zinc finger family member 783 |
chr8_+_145137489 | 0.53 |
ENST00000355091.4 ENST00000525087.1 ENST00000361036.6 ENST00000524418.1 |
GPAA1 |
glycosylphosphatidylinositol anchor attachment 1 |
chr8_-_146017736 | 0.53 |
ENST00000528957.1 |
RPL8 |
ribosomal protein L8 |
chr5_+_149865377 | 0.53 |
ENST00000522491.1 |
NDST1 |
N-deacetylase/N-sulfotransferase (heparan glucosaminyl) 1 |
chr19_+_41305612 | 0.53 |
ENST00000594380.1 ENST00000593397.1 ENST00000601733.1 |
EGLN2 |
egl-9 family hypoxia-inducible factor 2 |
chr11_+_65687158 | 0.53 |
ENST00000532933.1 |
DRAP1 |
DR1-associated protein 1 (negative cofactor 2 alpha) |
chr7_+_2281882 | 0.53 |
ENST00000397046.1 ENST00000397048.1 ENST00000454650.1 |
NUDT1 |
nudix (nucleoside diphosphate linked moiety X)-type motif 1 |
chr9_-_139839064 | 0.52 |
ENST00000325285.3 ENST00000428398.1 |
FBXW5 |
F-box and WD repeat domain containing 5 |
chr19_-_11039188 | 0.52 |
ENST00000588347.1 |
YIPF2 |
Yip1 domain family, member 2 |
chr17_+_40118773 | 0.52 |
ENST00000472031.1 |
CNP |
2',3'-cyclic nucleotide 3' phosphodiesterase |
chr19_-_4065730 | 0.52 |
ENST00000601588.1 |
ZBTB7A |
zinc finger and BTB domain containing 7A |
chr11_-_615570 | 0.52 |
ENST00000525445.1 ENST00000348655.6 ENST00000397566.1 |
IRF7 |
interferon regulatory factor 7 |
chr22_-_50968419 | 0.52 |
ENST00000425169.1 ENST00000395680.1 ENST00000395681.1 ENST00000395678.3 ENST00000252029.3 |
TYMP |
thymidine phosphorylase |
chr11_+_66025091 | 0.51 |
ENST00000526758.1 ENST00000440228.2 |
KLC2 |
kinesin light chain 2 |
chr1_-_1051736 | 0.51 |
ENST00000448924.1 ENST00000294576.5 ENST00000437760.1 ENST00000462097.1 ENST00000475119.1 |
C1orf159 |
chromosome 1 open reading frame 159 |
chr6_+_41514305 | 0.50 |
ENST00000409208.1 ENST00000373057.3 |
FOXP4 |
forkhead box P4 |
chr19_+_2096868 | 0.50 |
ENST00000395296.1 ENST00000395301.3 |
IZUMO4 |
IZUMO family member 4 |
chr9_-_140317605 | 0.50 |
ENST00000479452.1 ENST00000465160.2 |
EXD3 |
exonuclease 3'-5' domain containing 3 |
chr7_+_76090993 | 0.50 |
ENST00000425780.1 ENST00000456590.1 ENST00000451769.1 ENST00000324432.5 ENST00000307569.8 ENST00000457529.1 ENST00000446600.1 ENST00000413936.2 ENST00000423646.1 ENST00000438930.1 ENST00000430490.2 |
DTX2 |
deltex homolog 2 (Drosophila) |
chr1_+_156698708 | 0.50 |
ENST00000519086.1 |
RRNAD1 |
ribosomal RNA adenine dimethylase domain containing 1 |
chr12_+_96588368 | 0.50 |
ENST00000547860.1 |
ELK3 |
ELK3, ETS-domain protein (SRF accessory protein 2) |
chr1_+_161068179 | 0.49 |
ENST00000368011.4 ENST00000392192.2 |
KLHDC9 |
kelch domain containing 9 |
chr19_-_16653325 | 0.49 |
ENST00000546361.2 |
CHERP |
calcium homeostasis endoplasmic reticulum protein |
chr16_-_75467274 | 0.49 |
ENST00000566254.1 |
CFDP1 |
craniofacial development protein 1 |
chr16_+_577697 | 0.49 |
ENST00000562370.1 ENST00000568988.1 ENST00000219611.2 |
CAPN15 |
calpain 15 |
chr11_-_842509 | 0.49 |
ENST00000322028.4 |
POLR2L |
polymerase (RNA) II (DNA directed) polypeptide L, 7.6kDa |
chr17_-_78194716 | 0.49 |
ENST00000576707.1 |
SGSH |
N-sulfoglucosamine sulfohydrolase |
chr17_-_79481666 | 0.49 |
ENST00000575659.1 |
ACTG1 |
actin, gamma 1 |
chr19_+_10381769 | 0.49 |
ENST00000423829.2 ENST00000588645.1 |
ICAM1 |
intercellular adhesion molecule 1 |
chr16_-_88717482 | 0.48 |
ENST00000261623.3 |
CYBA |
cytochrome b-245, alpha polypeptide |
chr19_+_1285890 | 0.48 |
ENST00000344663.3 |
MUM1 |
melanoma associated antigen (mutated) 1 |
chr1_+_2160134 | 0.48 |
ENST00000378536.4 |
SKI |
v-ski avian sarcoma viral oncogene homolog |
chr17_+_81037473 | 0.48 |
ENST00000320095.7 |
METRNL |
meteorin, glial cell differentiation regulator-like |
chr12_+_30948600 | 0.48 |
ENST00000550292.1 |
LINC00941 |
long intergenic non-protein coding RNA 941 |
chr16_-_2185899 | 0.48 |
ENST00000262304.4 ENST00000423118.1 |
PKD1 |
polycystic kidney disease 1 (autosomal dominant) |
chr12_+_122667658 | 0.48 |
ENST00000339777.4 ENST00000425921.1 |
LRRC43 |
leucine rich repeat containing 43 |
chr16_+_1832902 | 0.48 |
ENST00000262302.9 ENST00000563136.1 ENST00000565987.1 ENST00000543305.1 ENST00000568287.1 ENST00000565134.1 |
NUBP2 |
nucleotide binding protein 2 |
chr22_-_37415475 | 0.47 |
ENST00000403892.3 ENST00000249042.3 ENST00000438203.1 |
TST |
thiosulfate sulfurtransferase (rhodanese) |
chr2_+_241392227 | 0.47 |
ENST00000420138.1 |
GPC1 |
glypican 1 |
chr16_-_80838160 | 0.47 |
ENST00000562812.1 ENST00000563890.1 ENST00000566173.1 |
CDYL2 |
chromodomain protein, Y-like 2 |
chr19_+_3572925 | 0.47 |
ENST00000333651.6 ENST00000417382.1 ENST00000453933.1 ENST00000262949.7 |
HMG20B |
high mobility group 20B |
chr18_-_77711625 | 0.47 |
ENST00000357575.4 ENST00000590381.1 ENST00000397778.2 |
PQLC1 |
PQ loop repeat containing 1 |
chr19_-_663277 | 0.47 |
ENST00000292363.5 |
RNF126 |
ring finger protein 126 |
chr19_-_16653226 | 0.47 |
ENST00000198939.6 |
CHERP |
calcium homeostasis endoplasmic reticulum protein |
chr15_+_90744533 | 0.47 |
ENST00000411539.2 |
SEMA4B |
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4B |
chr22_+_38004723 | 0.47 |
ENST00000381756.5 |
GGA1 |
golgi-associated, gamma adaptin ear containing, ARF binding protein 1 |
chr17_+_21188012 | 0.47 |
ENST00000529517.1 |
MAP2K3 |
mitogen-activated protein kinase kinase 3 |
chr17_-_80023401 | 0.46 |
ENST00000354321.7 ENST00000306796.5 |
DUS1L |
dihydrouridine synthase 1-like (S. cerevisiae) |
chr17_-_18266818 | 0.46 |
ENST00000583780.1 |
SHMT1 |
serine hydroxymethyltransferase 1 (soluble) |
chr16_+_85646763 | 0.46 |
ENST00000411612.1 ENST00000253458.7 |
GSE1 |
Gse1 coiled-coil protein |
chr17_+_29815013 | 0.46 |
ENST00000394744.2 |
RAB11FIP4 |
RAB11 family interacting protein 4 (class II) |
chr9_+_116638630 | 0.46 |
ENST00000452710.1 ENST00000374124.4 |
ZNF618 |
zinc finger protein 618 |
chr11_+_65686728 | 0.46 |
ENST00000312515.2 ENST00000525501.1 |
DRAP1 |
DR1-associated protein 1 (negative cofactor 2 alpha) |
chr6_-_109776901 | 0.46 |
ENST00000431946.1 |
MICAL1 |
microtubule associated monooxygenase, calponin and LIM domain containing 1 |
chr19_+_572543 | 0.46 |
ENST00000333511.3 ENST00000573216.1 ENST00000353555.4 |
BSG |
basigin (Ok blood group) |
chr19_+_8455200 | 0.46 |
ENST00000601897.1 ENST00000594216.1 |
RAB11B |
RAB11B, member RAS oncogene family |
chr5_+_172484377 | 0.46 |
ENST00000523161.1 |
CREBRF |
CREB3 regulatory factor |
chr11_+_66624527 | 0.46 |
ENST00000393952.3 |
LRFN4 |
leucine rich repeat and fibronectin type III domain containing 4 |
chr17_+_74261413 | 0.46 |
ENST00000587913.1 |
UBALD2 |
UBA-like domain containing 2 |
chr22_-_19419205 | 0.46 |
ENST00000340170.4 ENST00000263208.5 |
HIRA |
histone cell cycle regulator |
chr2_-_132249955 | 0.45 |
ENST00000309451.6 |
MZT2A |
mitotic spindle organizing protein 2A |
chr8_+_22446763 | 0.45 |
ENST00000450780.2 ENST00000430850.2 ENST00000447849.1 |
AC037459.4 |
Uncharacterized protein |
chr9_+_130922537 | 0.45 |
ENST00000372994.1 |
C9orf16 |
chromosome 9 open reading frame 16 |
chr19_+_1383890 | 0.45 |
ENST00000539480.1 ENST00000313408.7 ENST00000414651.2 |
NDUFS7 |
NADH dehydrogenase (ubiquinone) Fe-S protein 7, 20kDa (NADH-coenzyme Q reductase) |
chr11_+_64008443 | 0.45 |
ENST00000309366.4 |
FKBP2 |
FK506 binding protein 2, 13kDa |
chr19_-_21512144 | 0.45 |
ENST00000602023.1 |
ZNF708 |
zinc finger protein 708 |
chr17_+_73521763 | 0.45 |
ENST00000167462.5 ENST00000375227.4 ENST00000392550.3 ENST00000578363.1 ENST00000579392.1 |
LLGL2 |
lethal giant larvae homolog 2 (Drosophila) |
chr1_+_1550795 | 0.45 |
ENST00000520777.1 ENST00000357210.4 ENST00000360522.4 ENST00000378710.3 ENST00000355826.5 ENST00000518681.1 ENST00000505820.2 |
MIB2 |
mindbomb E3 ubiquitin protein ligase 2 |
chrY_-_1461617 | 0.45 |
ENSTR0000381401.5 |
SLC25A6 |
solute carrier family 25 (mitochondrial carrier; adenine nucleotide translocator), member 6 |
chr2_+_130939827 | 0.45 |
ENST00000409255.1 ENST00000455239.1 |
MZT2B |
mitotic spindle organizing protein 2B |
chr16_-_402639 | 0.45 |
ENST00000262320.3 |
AXIN1 |
axin 1 |
chr16_+_54964740 | 0.44 |
ENST00000394636.4 |
IRX5 |
iroquois homeobox 5 |
chr19_+_1241732 | 0.44 |
ENST00000215375.2 ENST00000395633.1 ENST00000591660.1 |
ATP5D |
ATP synthase, H+ transporting, mitochondrial F1 complex, delta subunit |
chr9_+_140317802 | 0.44 |
ENST00000341349.2 ENST00000392815.2 |
NOXA1 |
NADPH oxidase activator 1 |
chr22_+_20119320 | 0.44 |
ENST00000334554.7 ENST00000320602.7 ENST00000405930.3 |
ZDHHC8 |
zinc finger, DHHC-type containing 8 |
chr22_+_45898712 | 0.44 |
ENST00000455233.1 ENST00000348697.2 ENST00000402984.3 ENST00000262722.7 ENST00000327858.6 ENST00000442170.2 ENST00000340923.5 ENST00000439835.1 |
FBLN1 |
fibulin 1 |
chr16_+_30194916 | 0.44 |
ENST00000570045.1 ENST00000565497.1 ENST00000570244.1 |
CORO1A |
coronin, actin binding protein, 1A |
chr22_-_50700140 | 0.44 |
ENST00000215659.8 |
MAPK12 |
mitogen-activated protein kinase 12 |
chr2_+_23608064 | 0.44 |
ENST00000486442.1 |
KLHL29 |
kelch-like family member 29 |
chr19_-_2015699 | 0.43 |
ENST00000255608.4 |
BTBD2 |
BTB (POZ) domain containing 2 |
chr10_+_3109695 | 0.43 |
ENST00000381125.4 |
PFKP |
phosphofructokinase, platelet |
chr20_-_49639631 | 0.43 |
ENST00000424171.1 ENST00000439216.1 ENST00000371571.4 |
KCNG1 |
potassium voltage-gated channel, subfamily G, member 1 |
chr18_-_59561417 | 0.43 |
ENST00000591306.1 |
RNF152 |
ring finger protein 152 |
chr15_-_64338521 | 0.43 |
ENST00000457488.1 ENST00000558069.1 |
DAPK2 |
death-associated protein kinase 2 |
chr1_-_6545502 | 0.43 |
ENST00000535355.1 |
PLEKHG5 |
pleckstrin homology domain containing, family G (with RhoGef domain) member 5 |
chr17_-_77813186 | 0.43 |
ENST00000448310.1 ENST00000269397.4 |
CBX4 |
chromobox homolog 4 |
chr19_+_10216899 | 0.43 |
ENST00000428358.1 ENST00000393796.4 ENST00000253107.7 ENST00000556468.1 ENST00000393793.1 |
PPAN-P2RY11 PPAN |
PPAN-P2RY11 readthrough peter pan homolog (Drosophila) |
chr19_-_1237990 | 0.43 |
ENST00000382477.2 ENST00000215376.6 ENST00000590083.1 |
C19orf26 |
chromosome 19 open reading frame 26 |
chr14_-_105647606 | 0.43 |
ENST00000392568.2 |
NUDT14 |
nudix (nucleoside diphosphate linked moiety X)-type motif 14 |
chr12_+_122064673 | 0.43 |
ENST00000537188.1 |
ORAI1 |
ORAI calcium release-activated calcium modulator 1 |
chr19_+_41305330 | 0.43 |
ENST00000593972.1 |
EGLN2 |
egl-9 family hypoxia-inducible factor 2 |
chr17_+_80186908 | 0.43 |
ENST00000582743.1 ENST00000578684.1 ENST00000577650.1 ENST00000582715.1 |
SLC16A3 |
solute carrier family 16 (monocarboxylate transporter), member 3 |
chr9_-_139440314 | 0.43 |
ENST00000277541.6 |
NOTCH1 |
notch 1 |
chr17_-_80009209 | 0.42 |
ENST00000429557.3 ENST00000578356.1 |
RFNG |
RFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
chr14_-_105635090 | 0.42 |
ENST00000331782.3 ENST00000347004.2 |
JAG2 |
jagged 2 |
chr19_-_2427863 | 0.42 |
ENST00000215570.3 |
TIMM13 |
translocase of inner mitochondrial membrane 13 homolog (yeast) |
chr10_+_15001430 | 0.42 |
ENST00000407572.1 |
MEIG1 |
meiosis/spermiogenesis associated 1 |
chr1_+_1551220 | 0.42 |
ENST00000378712.1 |
MIB2 |
mindbomb E3 ubiquitin protein ligase 2 |
chr20_-_44600810 | 0.42 |
ENST00000322927.2 ENST00000426788.1 |
ZNF335 |
zinc finger protein 335 |
chr12_-_108154705 | 0.42 |
ENST00000547188.1 |
PRDM4 |
PR domain containing 4 |
chr1_+_156698743 | 0.42 |
ENST00000524343.1 |
RRNAD1 |
ribosomal RNA adenine dimethylase domain containing 1 |
chr1_-_935491 | 0.42 |
ENST00000304952.6 |
HES4 |
hes family bHLH transcription factor 4 |
chr19_+_40697514 | 0.42 |
ENST00000253055.3 |
MAP3K10 |
mitogen-activated protein kinase kinase kinase 10 |
chr16_-_4466622 | 0.42 |
ENST00000570645.1 ENST00000574025.1 ENST00000572898.1 ENST00000537233.2 ENST00000571059.1 ENST00000251166.4 |
CORO7 |
coronin 7 |
chr1_-_16302608 | 0.41 |
ENST00000375743.4 ENST00000375733.2 |
ZBTB17 |
zinc finger and BTB domain containing 17 |
chr2_-_97523721 | 0.41 |
ENST00000393537.4 |
ANKRD39 |
ankyrin repeat domain 39 |
chr8_-_145550571 | 0.41 |
ENST00000332324.4 |
DGAT1 |
diacylglycerol O-acyltransferase 1 |
chr1_-_160068645 | 0.41 |
ENST00000448417.1 |
IGSF8 |
immunoglobulin superfamily, member 8 |
chr1_+_1370903 | 0.41 |
ENST00000338660.5 ENST00000404702.3 ENST00000476993.1 ENST00000471398.1 |
VWA1 |
von Willebrand factor A domain containing 1 |
chr7_-_130080681 | 0.41 |
ENST00000469826.1 |
CEP41 |
centrosomal protein 41kDa |
chr16_-_4784128 | 0.40 |
ENST00000592711.1 ENST00000590147.1 ENST00000304283.4 ENST00000592190.1 ENST00000589065.1 ENST00000585773.1 ENST00000450067.2 ENST00000592698.1 ENST00000586166.1 ENST00000586605.1 ENST00000592421.1 |
ANKS3 |
ankyrin repeat and sterile alpha motif domain containing 3 |
chr19_+_13885252 | 0.40 |
ENST00000221576.4 |
C19orf53 |
chromosome 19 open reading frame 53 |
chr5_+_176873789 | 0.40 |
ENST00000323249.3 ENST00000502922.1 |
PRR7 |
proline rich 7 (synaptic) |
chr17_+_78388959 | 0.40 |
ENST00000518137.1 ENST00000520367.1 ENST00000523999.1 ENST00000323854.5 ENST00000522751.1 |
ENDOV |
endonuclease V |
chr7_-_3083472 | 0.40 |
ENST00000356408.3 |
CARD11 |
caspase recruitment domain family, member 11 |
chr21_+_45719921 | 0.40 |
ENST00000349048.4 |
PFKL |
phosphofructokinase, liver |
chr20_+_49411523 | 0.40 |
ENST00000371608.2 |
BCAS4 |
breast carcinoma amplified sequence 4 |
chr12_-_122241812 | 0.40 |
ENST00000538335.1 |
AC084018.1 |
AC084018.1 |
chr19_+_2164173 | 0.39 |
ENST00000452696.1 |
DOT1L |
DOT1-like histone H3K79 methyltransferase |
chr5_+_3596168 | 0.39 |
ENST00000302006.3 |
IRX1 |
iroquois homeobox 1 |
chr1_-_1243392 | 0.39 |
ENST00000354700.5 |
ACAP3 |
ArfGAP with coiled-coil, ankyrin repeat and PH domains 3 |
chr17_+_77751931 | 0.39 |
ENST00000310942.4 ENST00000269399.5 |
CBX2 |
chromobox homolog 2 |
chr19_-_14201776 | 0.39 |
ENST00000269724.5 |
SAMD1 |
sterile alpha motif domain containing 1 |
chr11_+_64851729 | 0.39 |
ENST00000526791.1 ENST00000526945.1 |
ZFPL1 |
zinc finger protein-like 1 |
chr16_-_88851618 | 0.39 |
ENST00000301015.9 |
PIEZO1 |
piezo-type mechanosensitive ion channel component 1 |
chr17_+_73084038 | 0.39 |
ENST00000578376.1 ENST00000329783.4 |
SLC16A5 |
solute carrier family 16 (monocarboxylate transporter), member 5 |
chr5_-_524445 | 0.39 |
ENST00000514375.1 ENST00000264938.3 |
SLC9A3 |
solute carrier family 9, subfamily A (NHE3, cation proton antiporter 3), member 3 |
chr20_+_34894247 | 0.39 |
ENST00000373913.3 |
DLGAP4 |
discs, large (Drosophila) homolog-associated protein 4 |
chr1_+_4714792 | 0.39 |
ENST00000378190.3 |
AJAP1 |
adherens junctions associated protein 1 |
chr12_+_132379160 | 0.39 |
ENST00000321867.4 |
ULK1 |
unc-51 like autophagy activating kinase 1 |
chr7_+_150811705 | 0.39 |
ENST00000335367.3 |
AGAP3 |
ArfGAP with GTPase domain, ankyrin repeat and PH domain 3 |
chr19_+_18530184 | 0.39 |
ENST00000601357.2 |
SSBP4 |
single stranded DNA binding protein 4 |
chr20_+_55966444 | 0.39 |
ENST00000356208.5 ENST00000440234.2 |
RBM38 |
RNA binding motif protein 38 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.9 | GO:0072034 | renal vesicle induction(GO:0072034) |
0.3 | 1.1 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
0.3 | 0.8 | GO:0060721 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
0.2 | 0.7 | GO:0075528 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
0.2 | 1.2 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
0.2 | 0.7 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.2 | 0.4 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.2 | 1.1 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
0.2 | 1.1 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.2 | 0.6 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
0.2 | 1.1 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.2 | 1.0 | GO:0032218 | riboflavin transport(GO:0032218) |
0.2 | 0.6 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
0.2 | 0.6 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
0.2 | 1.2 | GO:1902462 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
0.2 | 0.8 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
0.2 | 0.8 | GO:0072287 | metanephric distal tubule morphogenesis(GO:0072287) |
0.2 | 0.4 | GO:0061145 | bronchus cartilage development(GO:0060532) lung smooth muscle development(GO:0061145) |
0.2 | 1.4 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.2 | 0.8 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.2 | 0.6 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
0.2 | 0.6 | GO:1903450 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
0.2 | 0.6 | GO:0015709 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
0.2 | 0.5 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.2 | 0.5 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
0.2 | 0.9 | GO:0032796 | uropod organization(GO:0032796) |
0.2 | 0.7 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
0.2 | 1.2 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.2 | 0.5 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.2 | 0.7 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.2 | 0.5 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
0.2 | 0.5 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.2 | 0.5 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.2 | 0.6 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
0.1 | 0.3 | GO:0060488 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
0.1 | 0.4 | GO:0051795 | positive regulation of catagen(GO:0051795) |
0.1 | 0.6 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
0.1 | 0.6 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
0.1 | 0.6 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
0.1 | 1.8 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 2.0 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.1 | 0.6 | GO:0019417 | sulfur oxidation(GO:0019417) |
0.1 | 0.4 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.1 | 0.8 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
0.1 | 0.7 | GO:1904845 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
0.1 | 0.8 | GO:0030421 | defecation(GO:0030421) |
0.1 | 0.8 | GO:0009189 | deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
0.1 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.6 | GO:0009608 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
0.1 | 0.6 | GO:0042350 | GDP-L-fucose biosynthetic process(GO:0042350) |
0.1 | 0.4 | GO:2001035 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
0.1 | 0.8 | GO:0035897 | proteolysis in other organism(GO:0035897) |
0.1 | 0.1 | GO:0072070 | loop of Henle development(GO:0072070) |
0.1 | 0.6 | GO:0052250 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
0.1 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.1 | 0.5 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.1 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.1 | 0.3 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
0.1 | 0.3 | GO:1901207 | regulation of heart looping(GO:1901207) |
0.1 | 0.6 | GO:0071733 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.1 | 0.5 | GO:0010133 | proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) |
0.1 | 0.1 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) |
0.1 | 0.9 | GO:0045007 | depurination(GO:0045007) |
0.1 | 0.3 | GO:0007037 | vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
0.1 | 1.1 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
0.1 | 0.3 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
0.1 | 0.3 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
0.1 | 0.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.1 | 1.0 | GO:0042756 | drinking behavior(GO:0042756) |
0.1 | 1.1 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.1 | GO:0003197 | endocardial cushion development(GO:0003197) |
0.1 | 0.4 | GO:1990736 | positive regulation of regulation of vascular smooth muscle cell membrane depolarization(GO:1904199) regulation of vascular smooth muscle cell membrane depolarization(GO:1990736) |
0.1 | 0.5 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
0.1 | 0.4 | GO:0061760 | antifungal innate immune response(GO:0061760) |
0.1 | 0.8 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.1 | 0.8 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.1 | 0.3 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
0.1 | 0.5 | GO:0051295 | polar body extrusion after meiotic divisions(GO:0040038) establishment of meiotic spindle localization(GO:0051295) formin-nucleated actin cable assembly(GO:0070649) |
0.1 | 0.5 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.1 | 0.3 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
0.1 | 1.3 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
0.1 | 0.4 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.1 | 0.4 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
0.1 | 0.3 | GO:0030821 | negative regulation of cyclic nucleotide catabolic process(GO:0030806) negative regulation of cAMP catabolic process(GO:0030821) negative regulation of purine nucleotide catabolic process(GO:0033122) regulation of ERK5 cascade(GO:0070376) negative regulation of ERK5 cascade(GO:0070377) |
0.1 | 0.4 | GO:1904482 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
0.1 | 0.3 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.1 | 0.4 | GO:0046439 | cysteine biosynthetic process from serine(GO:0006535) cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.1 | 0.7 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
0.1 | 0.1 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.1 | 0.4 | GO:2000182 | regulation of progesterone biosynthetic process(GO:2000182) |
0.1 | 0.5 | GO:0018153 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
0.1 | 0.4 | GO:0002537 | nitric oxide production involved in inflammatory response(GO:0002537) |
0.1 | 0.6 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.1 | 0.3 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
0.1 | 0.4 | GO:1904806 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
0.1 | 0.4 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.1 | 0.3 | GO:0048627 | myoblast development(GO:0048627) |
0.1 | 0.7 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.6 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.1 | GO:1990051 | activation of protein kinase C activity(GO:1990051) |
0.1 | 0.4 | GO:0090410 | malonate catabolic process(GO:0090410) |
0.1 | 0.6 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.1 | 0.3 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
0.1 | 0.3 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) positive regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000340) |
0.1 | 0.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.4 | GO:0016334 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
0.1 | 0.4 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.1 | 0.3 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
0.1 | 0.3 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.1 | 0.3 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.3 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.5 | GO:0045765 | regulation of angiogenesis(GO:0045765) |
0.1 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.1 | 0.3 | GO:0072573 | regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) tolerance induction to lipopolysaccharide(GO:0072573) negative regulation of osteoclast proliferation(GO:0090291) negative regulation of CD40 signaling pathway(GO:2000349) |
0.1 | 0.3 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.1 | 0.3 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.1 | 0.3 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.1 | 2.0 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.1 | 0.2 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
0.1 | 1.6 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.1 | 0.6 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.1 | 0.2 | GO:1902559 | 3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
0.1 | 0.6 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.6 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.2 | GO:2001244 | positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
0.1 | 0.2 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
0.1 | 0.2 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
0.1 | 0.2 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
0.1 | 0.2 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
0.1 | 0.3 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
0.1 | 0.2 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
0.1 | 0.2 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.1 | 0.6 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.6 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.2 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.1 | 0.4 | GO:0015887 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
0.1 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.1 | 0.3 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
0.1 | 0.1 | GO:0097018 | renal albumin absorption(GO:0097018) regulation of renal albumin absorption(GO:2000532) |
0.1 | 0.4 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.1 | 0.3 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.1 | 0.1 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.1 | 0.8 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.1 | 0.2 | GO:0099541 | trans-synaptic signaling by lipid(GO:0099541) trans-synaptic signaling by endocannabinoid(GO:0099542) |
0.1 | 0.5 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 0.2 | GO:0019516 | lactate oxidation(GO:0019516) |
0.1 | 0.3 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
0.1 | 0.5 | GO:0051697 | protein delipidation(GO:0051697) |
0.1 | 0.3 | GO:0014011 | Schwann cell proliferation involved in axon regeneration(GO:0014011) negative regulation of Schwann cell migration(GO:1900148) regulation of Schwann cell proliferation involved in axon regeneration(GO:1905044) negative regulation of Schwann cell proliferation involved in axon regeneration(GO:1905045) |
0.1 | 0.1 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.1 | 0.3 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
0.1 | 0.3 | GO:0099640 | axo-dendritic protein transport(GO:0099640) |
0.1 | 0.3 | GO:0070384 | Harderian gland development(GO:0070384) |
0.1 | 0.2 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
0.1 | 0.6 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
0.1 | 0.6 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
0.1 | 0.1 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
0.1 | 0.2 | GO:0044209 | AMP salvage(GO:0044209) |
0.1 | 0.1 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
0.1 | 0.2 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
0.1 | 0.2 | GO:0009405 | pathogenesis(GO:0009405) |
0.1 | 0.2 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
0.1 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 0.7 | GO:0051715 | cytolysis in other organism(GO:0051715) |
0.1 | 0.9 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.1 | 0.3 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.1 | 0.7 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.8 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.1 | 0.4 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.1 | 0.3 | GO:0061034 | olfactory bulb mitral cell layer development(GO:0061034) |
0.1 | 0.1 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.1 | 0.4 | GO:0051673 | membrane disruption in other organism(GO:0051673) |
0.1 | 0.6 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.3 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.3 | GO:0086092 | regulation of the force of heart contraction by cardiac conduction(GO:0086092) |
0.1 | 0.3 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.1 | 0.1 | GO:0100012 | regulation of heart induction(GO:0090381) regulation of heart induction by canonical Wnt signaling pathway(GO:0100012) |
0.1 | 0.1 | GO:0046103 | adenosine catabolic process(GO:0006154) inosine biosynthetic process(GO:0046103) |
0.1 | 0.3 | GO:0044691 | tooth eruption(GO:0044691) |
0.1 | 0.3 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
0.1 | 0.2 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 1.7 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.3 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 0.2 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
0.1 | 0.1 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.1 | 0.1 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
0.1 | 0.8 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.2 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) |
0.1 | 0.1 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.1 | 0.2 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
0.1 | 0.3 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 0.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.1 | 0.2 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
0.1 | 0.5 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.1 | 0.4 | GO:0090035 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
0.1 | 0.2 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
0.1 | 0.1 | GO:0030279 | negative regulation of ossification(GO:0030279) |
0.1 | 0.1 | GO:0051604 | protein maturation(GO:0051604) |
0.1 | 0.4 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
0.1 | 0.3 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.1 | 0.5 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 0.1 | GO:0071874 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
0.1 | 0.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.1 | 0.4 | GO:1904582 | regulation of intracellular mRNA localization(GO:1904580) positive regulation of intracellular mRNA localization(GO:1904582) |
0.1 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
0.1 | 0.2 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
0.1 | 0.1 | GO:0052042 | killing by symbiont of host cells(GO:0001907) induction of programmed cell death(GO:0012502) disruption by symbiont of host cell(GO:0044004) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
0.1 | 0.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 0.3 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.1 | 0.7 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.1 | 0.2 | GO:0043525 | positive regulation of neuron apoptotic process(GO:0043525) |
0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.1 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
0.1 | 0.6 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
0.1 | 0.2 | GO:0021722 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
0.1 | 0.3 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 0.3 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
0.1 | 2.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.2 | GO:0018013 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
0.1 | 0.1 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
0.1 | 0.2 | GO:0046035 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
0.1 | 0.3 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.2 | GO:0043095 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.3 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.2 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.1 | 0.2 | GO:0036034 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
0.1 | 0.2 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.1 | GO:0072425 | signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) |
0.1 | 0.4 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
0.1 | 0.3 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.1 | 0.5 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.1 | 0.5 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
0.1 | 0.2 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
0.1 | 0.3 | GO:2000969 | positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.1 | 0.2 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) |
0.1 | 1.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.1 | 0.1 | GO:0061763 | multivesicular body-lysosome fusion(GO:0061763) |
0.1 | 0.3 | GO:0046203 | spermidine catabolic process(GO:0046203) |
0.1 | 0.5 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
0.1 | 0.8 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.1 | 0.2 | GO:0032411 | positive regulation of transporter activity(GO:0032411) |
0.1 | 0.6 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.1 | 0.2 | GO:0003308 | negative regulation of Wnt signaling pathway involved in heart development(GO:0003308) |
0.1 | 0.4 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.1 | 0.2 | GO:0006218 | uridine catabolic process(GO:0006218) |
0.1 | 0.1 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
0.1 | 0.1 | GO:0006844 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
0.1 | 0.8 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.3 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.0 | 1.0 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.0 | 0.3 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
0.0 | 0.3 | GO:0042635 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
0.0 | 0.7 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
0.0 | 0.2 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.0 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) glucocorticoid receptor signaling pathway(GO:0042921) |
0.0 | 1.0 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.2 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
0.0 | 0.1 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.0 | 0.1 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.0 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.0 | 0.3 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
0.0 | 0.3 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
0.0 | 0.3 | GO:0061143 | alveolar primary septum development(GO:0061143) |
0.0 | 1.3 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.0 | 0.3 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.0 | 0.2 | GO:0010983 | regulation of high-density lipoprotein particle clearance(GO:0010982) positive regulation of high-density lipoprotein particle clearance(GO:0010983) |
0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.1 | GO:1904100 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
0.0 | 0.1 | GO:0090298 | negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
0.0 | 0.3 | GO:0001781 | neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) |
0.0 | 0.0 | GO:0007588 | excretion(GO:0007588) |
0.0 | 0.1 | GO:1902566 | regulation of eosinophil degranulation(GO:0043309) positive regulation of eosinophil degranulation(GO:0043311) regulation of eosinophil activation(GO:1902566) positive regulation of eosinophil activation(GO:1902568) |
0.0 | 0.1 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.0 | 0.2 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
0.0 | 0.1 | GO:0035397 | helper T cell enhancement of adaptive immune response(GO:0035397) |
0.0 | 0.1 | GO:0034444 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
0.0 | 0.0 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.2 | GO:0006740 | NADPH regeneration(GO:0006740) |
0.0 | 0.0 | GO:0070370 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
0.0 | 0.3 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.4 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 1.0 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
0.0 | 0.1 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.0 | 0.3 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
0.0 | 0.1 | GO:0086098 | cellular response to progesterone stimulus(GO:0071393) angiotensin-activated signaling pathway involved in heart process(GO:0086098) |
0.0 | 0.7 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.0 | 0.4 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.2 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.3 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.0 | 0.4 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.2 | GO:0030820 | regulation of cyclic nucleotide catabolic process(GO:0030805) regulation of cAMP catabolic process(GO:0030820) regulation of purine nucleotide catabolic process(GO:0033121) |
0.0 | 0.2 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.0 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.2 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.1 | GO:1903998 | regulation of eating behavior(GO:1903998) |
0.0 | 0.0 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.0 | 0.1 | GO:1901216 | positive regulation of neuron death(GO:1901216) |
0.0 | 0.2 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
0.0 | 0.2 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
0.0 | 0.8 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
0.0 | 0.5 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.6 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.0 | 0.3 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
0.0 | 0.1 | GO:0008057 | eye pigment granule organization(GO:0008057) |
0.0 | 0.1 | GO:1990169 | detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to copper ion(GO:1990169) |
0.0 | 0.7 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 1.1 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.0 | 0.2 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.0 | 0.2 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
0.0 | 0.0 | GO:1903707 | negative regulation of hemopoiesis(GO:1903707) |
0.0 | 0.0 | GO:0044752 | response to human chorionic gonadotropin(GO:0044752) |
0.0 | 0.0 | GO:2000506 | negative regulation of energy homeostasis(GO:2000506) |
0.0 | 0.1 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.0 | 0.2 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.0 | 0.4 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.0 | 1.7 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
0.0 | 0.1 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.0 | 0.0 | GO:0007179 | transforming growth factor beta receptor signaling pathway(GO:0007179) |
0.0 | 0.3 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.0 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.2 | GO:0033489 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
0.0 | 0.0 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
0.0 | 0.5 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
0.0 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.0 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.2 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
0.0 | 0.0 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
0.0 | 0.6 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.0 | 1.0 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.0 | 0.5 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
0.0 | 0.0 | GO:0044346 | fibroblast apoptotic process(GO:0044346) regulation of fibroblast apoptotic process(GO:2000269) |
0.0 | 0.5 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
0.0 | 0.4 | GO:0002084 | protein depalmitoylation(GO:0002084) |
0.0 | 0.2 | GO:1904744 | positive regulation of telomeric DNA binding(GO:1904744) |
0.0 | 0.0 | GO:0033280 | response to vitamin D(GO:0033280) |
0.0 | 0.4 | GO:0075071 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.0 | 0.1 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
0.0 | 0.1 | GO:0045081 | negative regulation of interleukin-10 biosynthetic process(GO:0045081) |
0.0 | 0.1 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
0.0 | 0.1 | GO:0032811 | negative regulation of norepinephrine secretion(GO:0010700) regulation of epinephrine secretion(GO:0014060) negative regulation of epinephrine secretion(GO:0032811) epinephrine secretion(GO:0048242) |
0.0 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.9 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
0.0 | 0.2 | GO:0006235 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
0.0 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
0.0 | 0.1 | GO:2000330 | interleukin-23-mediated signaling pathway(GO:0038155) positive regulation of T-helper 17 cell lineage commitment(GO:2000330) |
0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.5 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.0 | 0.4 | GO:0048243 | norepinephrine secretion(GO:0048243) |
0.0 | 0.0 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.0 | 0.3 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.2 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
0.0 | 0.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.3 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
0.0 | 0.3 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.5 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.3 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
0.0 | 0.2 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.0 | 0.5 | GO:0038203 | TORC2 signaling(GO:0038203) |
0.0 | 0.1 | GO:1903412 | response to bile acid(GO:1903412) |
0.0 | 0.2 | GO:0098502 | DNA dephosphorylation(GO:0098502) |
0.0 | 0.1 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.8 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.0 | 0.3 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.1 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 0.8 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.0 | 0.2 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.0 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.2 | GO:0052551 | response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
0.0 | 0.4 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.3 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 0.9 | GO:0031167 | rRNA methylation(GO:0031167) |
0.0 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.1 | GO:1903401 | lysine transport(GO:0015819) L-lysine transport(GO:1902022) L-lysine transmembrane transport(GO:1903401) |
0.0 | 0.1 | GO:0042369 | vitamin D catabolic process(GO:0042369) |
0.0 | 0.1 | GO:0033037 | polysaccharide localization(GO:0033037) |
0.0 | 0.3 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.1 | GO:0002428 | antigen processing and presentation of peptide antigen via MHC class Ib(GO:0002428) antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
0.0 | 0.0 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
0.0 | 0.1 | GO:0006788 | heme oxidation(GO:0006788) |
0.0 | 0.2 | GO:1990834 | response to odorant(GO:1990834) |
0.0 | 0.4 | GO:0046689 | response to mercury ion(GO:0046689) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.1 | GO:1904528 | positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.1 | GO:0034378 | chylomicron assembly(GO:0034378) |
0.0 | 0.2 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
0.0 | 0.1 | GO:0019046 | release from viral latency(GO:0019046) |
0.0 | 0.2 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
0.0 | 0.1 | GO:0002182 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
0.0 | 0.3 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.0 | 0.2 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.0 | 0.1 | GO:0072720 | response to dithiothreitol(GO:0072720) |
0.0 | 0.2 | GO:0006513 | protein monoubiquitination(GO:0006513) |
0.0 | 0.4 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
0.0 | 0.1 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
0.0 | 0.1 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
0.0 | 0.1 | GO:0051389 | inactivation of MAPKK activity(GO:0051389) |
0.0 | 0.2 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
0.0 | 0.2 | GO:0000101 | sulfur amino acid transport(GO:0000101) L-cystine transport(GO:0015811) |
0.0 | 0.6 | GO:0001702 | gastrulation with mouth forming second(GO:0001702) |
0.0 | 0.1 | GO:0042637 | regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) catagen(GO:0042637) regulation of catagen(GO:0051794) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) positive regulation of melanosome transport(GO:1902910) |
0.0 | 0.0 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.0 | 0.2 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
0.0 | 0.1 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
0.0 | 0.5 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.3 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.2 | GO:0015783 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
0.0 | 0.6 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.2 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
0.0 | 0.0 | GO:0044146 | negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
0.0 | 0.1 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
0.0 | 0.1 | GO:0071462 | cellular response to water deprivation(GO:0042631) cellular response to water stimulus(GO:0071462) |
0.0 | 0.1 | GO:1904616 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
0.0 | 0.2 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
0.0 | 0.2 | GO:0046016 | positive regulation of transcription by glucose(GO:0046016) |
0.0 | 0.2 | GO:0043163 | cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
0.0 | 0.1 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.0 | 0.2 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
0.0 | 0.1 | GO:0031247 | actin rod assembly(GO:0031247) |
0.0 | 0.5 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
0.0 | 0.4 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.1 | GO:1901094 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
0.0 | 0.1 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.0 | 0.6 | GO:0050832 | defense response to fungus(GO:0050832) |
0.0 | 0.3 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 0.2 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.0 | 0.1 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
0.0 | 0.1 | GO:0021888 | hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
0.0 | 0.1 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
0.0 | 0.2 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
0.0 | 0.0 | GO:0021730 | trigeminal sensory nucleus development(GO:0021730) principal sensory nucleus of trigeminal nerve development(GO:0021740) |
0.0 | 0.1 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
0.0 | 0.1 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
0.0 | 0.7 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.0 | 0.1 | GO:0051808 | translocation of peptides or proteins into host(GO:0042000) translocation of peptides or proteins into host cell cytoplasm(GO:0044053) translocation of molecules into host(GO:0044417) translocation of peptides or proteins into other organism involved in symbiotic interaction(GO:0051808) translocation of molecules into other organism involved in symbiotic interaction(GO:0051836) |
0.0 | 0.2 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
0.0 | 0.2 | GO:0070142 | synaptic vesicle budding(GO:0070142) |
0.0 | 0.1 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
0.0 | 0.1 | GO:0051782 | negative regulation of cell division(GO:0051782) |
0.0 | 0.8 | GO:0022038 | corpus callosum development(GO:0022038) |
0.0 | 0.1 | GO:1904923 | regulation of mitophagy in response to mitochondrial depolarization(GO:1904923) |
0.0 | 0.1 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.4 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.4 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.0 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.0 | 0.1 | GO:0042262 | DNA protection(GO:0042262) |
0.0 | 0.1 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.3 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.1 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.2 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
0.0 | 0.1 | GO:0060426 | lung vasculature development(GO:0060426) |
0.0 | 0.5 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
0.0 | 0.2 | GO:0046880 | regulation of follicle-stimulating hormone secretion(GO:0046880) positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.4 | GO:0045008 | depyrimidination(GO:0045008) |
0.0 | 0.1 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
0.0 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.3 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.0 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 0.0 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.0 | 0.2 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.0 | 0.2 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.0 | 0.1 | GO:0035350 | FAD transport(GO:0015883) FAD transmembrane transport(GO:0035350) |
0.0 | 0.0 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
0.0 | 0.1 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.1 | GO:1990654 | sebum secreting cell proliferation(GO:1990654) |
0.0 | 0.1 | GO:0070221 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
0.0 | 0.1 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
0.0 | 0.2 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.0 | 0.1 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
0.0 | 0.5 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.0 | 0.0 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.0 | 0.2 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.0 | 0.1 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
0.0 | 0.1 | GO:0000050 | urea cycle(GO:0000050) |
0.0 | 0.1 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
0.0 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.1 | GO:0090092 | regulation of transforming growth factor beta receptor signaling pathway(GO:0017015) regulation of transmembrane receptor protein serine/threonine kinase signaling pathway(GO:0090092) |
0.0 | 0.1 | GO:0006500 | N-terminal protein palmitoylation(GO:0006500) |
0.0 | 0.4 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
0.0 | 0.1 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.0 | 0.0 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.2 | GO:0061511 | centriole elongation(GO:0061511) |
0.0 | 0.1 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
0.0 | 0.0 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.1 | GO:0036114 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
0.0 | 0.0 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
0.0 | 0.5 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
0.0 | 0.3 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.3 | GO:0015866 | ADP transport(GO:0015866) |
0.0 | 0.2 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.0 | 0.3 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.0 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.0 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.0 | 0.4 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.0 | 0.1 | GO:0071105 | response to interleukin-11(GO:0071105) |
0.0 | 0.1 | GO:0002249 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.0 | 0.3 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.1 | GO:0032330 | regulation of chondrocyte differentiation(GO:0032330) |
0.0 | 0.0 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.1 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
0.0 | 0.7 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.7 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.0 | 0.1 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
0.0 | 0.0 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.0 | 0.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.0 | 0.2 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.7 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.1 | GO:0035878 | nail development(GO:0035878) |
0.0 | 0.3 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.2 | GO:0045408 | regulation of interleukin-6 biosynthetic process(GO:0045408) |
0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.4 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.3 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.4 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.4 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.1 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.0 | 0.2 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.0 | GO:0070206 | protein trimerization(GO:0070206) |
0.0 | 0.2 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
0.0 | 0.2 | GO:0046618 | drug export(GO:0046618) |
0.0 | 0.1 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
0.0 | 0.1 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.0 | GO:0010899 | regulation of phosphatidylcholine catabolic process(GO:0010899) |
0.0 | 0.0 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
0.0 | 0.2 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.1 | GO:0097476 | spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
0.0 | 0.4 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.3 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.1 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.0 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.0 | GO:0048333 | mesodermal cell differentiation(GO:0048333) |
0.0 | 0.0 | GO:0090212 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
0.0 | 0.5 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.0 | 0.1 | GO:2001287 | negative regulation of caveolin-mediated endocytosis(GO:2001287) |
0.0 | 0.0 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) |
0.0 | 0.1 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.0 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
0.0 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.1 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
0.0 | 0.1 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.1 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.0 | 0.1 | GO:0061744 | motor behavior(GO:0061744) |
0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.0 | GO:0009180 | purine nucleoside diphosphate biosynthetic process(GO:0009136) purine ribonucleoside diphosphate biosynthetic process(GO:0009180) ribonucleoside diphosphate biosynthetic process(GO:0009188) |
0.0 | 0.0 | GO:1903526 | negative regulation of membrane tubulation(GO:1903526) |
0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.0 | 0.2 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.0 | 0.3 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.0 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.0 | 0.5 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.0 | 0.0 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.0 | 0.4 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 0.2 | GO:0043090 | amino acid import(GO:0043090) |
0.0 | 0.2 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.0 | 0.0 | GO:0034629 | cellular protein complex localization(GO:0034629) |
0.0 | 0.0 | GO:0060594 | mammary gland specification(GO:0060594) |
0.0 | 0.0 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.0 | 0.2 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
0.0 | 0.2 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.0 | 0.1 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.0 | 0.1 | GO:2000616 | negative regulation of histone H3-K9 acetylation(GO:2000616) |
0.0 | 0.0 | GO:0046967 | cytosol to ER transport(GO:0046967) |
0.0 | 0.0 | GO:0043144 | snoRNA processing(GO:0043144) |
0.0 | 0.4 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
0.0 | 1.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.0 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
0.0 | 0.1 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
0.0 | 1.1 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
0.0 | 0.1 | GO:1990764 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
0.0 | 0.1 | GO:0002027 | regulation of heart rate(GO:0002027) |
0.0 | 0.1 | GO:0033700 | detection of endogenous stimulus(GO:0009726) phospholipid efflux(GO:0033700) |
0.0 | 0.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.3 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.2 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.3 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.1 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
0.0 | 0.1 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.0 | 0.1 | GO:0030473 | nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) |
0.0 | 0.1 | GO:0046596 | regulation of viral entry into host cell(GO:0046596) |
0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.2 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
0.0 | 0.0 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.0 | 0.1 | GO:0072520 | seminiferous tubule development(GO:0072520) |
0.0 | 0.4 | GO:0032094 | response to food(GO:0032094) |
0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 1.6 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.0 | 0.1 | GO:0046958 | nonassociative learning(GO:0046958) |
0.0 | 0.0 | GO:2000195 | gonadal mesoderm development(GO:0007506) negative regulation of female gonad development(GO:2000195) |
0.0 | 0.0 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
0.0 | 0.1 | GO:0019557 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.2 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.1 | GO:0035137 | hindlimb morphogenesis(GO:0035137) |
0.0 | 0.2 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
0.0 | 0.5 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
0.0 | 0.0 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.0 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.1 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.1 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.0 | 0.1 | GO:1902564 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) negative regulation of neutrophil activation(GO:1902564) |
0.0 | 0.2 | GO:0060180 | female mating behavior(GO:0060180) |
0.0 | 0.0 | GO:1990709 | presynaptic active zone organization(GO:1990709) |
0.0 | 0.1 | GO:0070383 | DNA cytosine deamination(GO:0070383) |
0.0 | 0.1 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
0.0 | 0.1 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:1905232 | cellular response to L-glutamate(GO:1905232) |
0.0 | 0.2 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.1 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.0 | 0.1 | GO:0045210 | FasL biosynthetic process(GO:0045210) |
0.0 | 0.6 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.0 | 0.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.1 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.0 | 0.0 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
0.0 | 0.4 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.0 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
0.0 | 0.1 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
0.0 | 0.3 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.1 | GO:0071529 | cementum mineralization(GO:0071529) |
0.0 | 0.1 | GO:0070092 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
0.0 | 0.1 | GO:0051595 | response to methylglyoxal(GO:0051595) negative regulation of histone H3-K27 acetylation(GO:1901675) |
0.0 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.1 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.0 | 0.0 | GO:0060031 | mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
0.0 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.0 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.0 | 0.0 | GO:0055095 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
0.0 | 0.0 | GO:0098923 | retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by soluble gas(GO:0099543) |
0.0 | 0.0 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.0 | 0.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.3 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.1 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
0.0 | 0.1 | GO:0072334 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
0.0 | 0.7 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.2 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 0.1 | GO:0072156 | distal tubule morphogenesis(GO:0072156) |
0.0 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.0 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) |
0.0 | 0.3 | GO:0050691 | regulation of defense response to virus by host(GO:0050691) |
0.0 | 0.0 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.0 | 0.0 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
0.0 | 0.2 | GO:0007035 | vacuolar acidification(GO:0007035) |
0.0 | 0.1 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
0.0 | 0.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.0 | 0.3 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
0.0 | 0.6 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.0 | 0.0 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
0.0 | 0.1 | GO:0034138 | toll-like receptor 3 signaling pathway(GO:0034138) |
0.0 | 0.0 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.0 | 0.1 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.1 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
0.0 | 0.0 | GO:0035456 | response to interferon-beta(GO:0035456) |
0.0 | 0.0 | GO:0015698 | inorganic anion transport(GO:0015698) |
0.0 | 0.2 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.0 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.0 | 0.1 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
0.0 | 0.1 | GO:1903527 | regulation of membrane tubulation(GO:1903525) positive regulation of membrane tubulation(GO:1903527) |
0.0 | 0.1 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.0 | 0.1 | GO:0021511 | spinal cord patterning(GO:0021511) |
0.0 | 0.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.0 | 0.3 | GO:0051014 | actin filament severing(GO:0051014) |
0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.3 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.0 | 0.0 | GO:1900111 | regulation of histone H3-K9 dimethylation(GO:1900109) positive regulation of histone H3-K9 dimethylation(GO:1900111) |
0.0 | 0.0 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.0 | 0.0 | GO:0006734 | NADH metabolic process(GO:0006734) |
0.0 | 0.0 | GO:0071888 | macrophage apoptotic process(GO:0071888) |
0.0 | 0.1 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.0 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.0 | 0.1 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
0.0 | 0.3 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
0.0 | 0.5 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.1 | GO:0032373 | positive regulation of sterol transport(GO:0032373) positive regulation of cholesterol transport(GO:0032376) |
0.0 | 0.1 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.3 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.1 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
0.0 | 0.1 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.1 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.2 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.0 | 0.2 | GO:1902961 | positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
0.0 | 0.3 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.0 | 0.3 | GO:0006751 | glutathione catabolic process(GO:0006751) |
0.0 | 0.1 | GO:0046490 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
0.0 | 0.1 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.0 | 0.0 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.0 | 0.1 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.0 | 0.1 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.0 | 0.0 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
0.0 | 1.7 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) positive regulation of rhodopsin gene expression(GO:0045872) |
0.0 | 0.1 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.0 | 0.0 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.3 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.0 | GO:0051461 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
0.0 | 0.0 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.0 | GO:0003220 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
0.0 | 0.1 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.0 | 0.0 | GO:0039019 | pronephric nephron development(GO:0039019) |
0.0 | 0.5 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.0 | 0.0 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
0.0 | 0.0 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.0 | 0.0 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
0.0 | 0.0 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.5 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.1 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.0 | 0.0 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
0.0 | 0.1 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
0.0 | 0.2 | GO:0060736 | prostate gland growth(GO:0060736) |
0.0 | 0.0 | GO:0035801 | adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) |
0.0 | 0.5 | GO:0035411 | catenin import into nucleus(GO:0035411) |
0.0 | 0.0 | GO:0009644 | response to high light intensity(GO:0009644) |
0.0 | 0.1 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.0 | 0.3 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.6 | GO:0032456 | endocytic recycling(GO:0032456) |
0.0 | 0.1 | GO:0044804 | nucleophagy(GO:0044804) |
0.0 | 0.0 | GO:0033319 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
0.0 | 0.0 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
0.0 | 0.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.0 | 0.0 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.0 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.2 | GO:0097205 | renal filtration(GO:0097205) |
0.0 | 0.1 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.0 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.0 | 0.1 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
0.0 | 0.1 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.0 | GO:0033028 | myeloid cell apoptotic process(GO:0033028) |
0.0 | 0.4 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
0.0 | 0.0 | GO:0000060 | protein import into nucleus, translocation(GO:0000060) |
0.0 | 0.2 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.0 | 0.1 | GO:1902269 | positive regulation of polyamine transmembrane transport(GO:1902269) |
0.0 | 0.2 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.0 | 0.1 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.1 | GO:0097647 | dimeric G-protein coupled receptor signaling pathway(GO:0038042) calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
0.0 | 0.0 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.0 | 0.2 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.0 | 0.0 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
0.0 | 0.1 | GO:0045732 | positive regulation of protein catabolic process(GO:0045732) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.0 | 0.4 | GO:0042554 | superoxide anion generation(GO:0042554) |
0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.7 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 0.1 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) ERBB3 signaling pathway(GO:0038129) |
0.0 | 0.0 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 0.2 | GO:1903541 | regulation of exosomal secretion(GO:1903541) |
0.0 | 0.7 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.0 | 0.0 | GO:0010594 | regulation of endothelial cell migration(GO:0010594) |
0.0 | 0.1 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.0 | 0.3 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
0.0 | 0.0 | GO:1903803 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
0.0 | 0.1 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
0.0 | 0.0 | GO:1904327 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
0.0 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.1 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.0 | 0.0 | GO:0019401 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
0.0 | 0.3 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
0.0 | 0.0 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
0.0 | 0.0 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.0 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
0.0 | 0.0 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.0 | 0.0 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.2 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
0.0 | 0.8 | GO:0070527 | platelet aggregation(GO:0070527) |
0.0 | 0.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 0.0 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
0.0 | 0.0 | GO:0000961 | negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.1 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.6 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.0 | 0.0 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.2 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.1 | GO:0021759 | globus pallidus development(GO:0021759) |
0.0 | 0.0 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.0 | 0.1 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.1 | GO:0019075 | virus maturation(GO:0019075) |
0.0 | 0.0 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
0.0 | 0.0 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.1 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
0.0 | 0.1 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.0 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.0 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.0 | 0.0 | GO:0061042 | vascular wound healing(GO:0061042) |
0.0 | 0.3 | GO:0050919 | negative chemotaxis(GO:0050919) |
0.0 | 0.1 | GO:0072578 | neurotransmitter-gated ion channel clustering(GO:0072578) |
0.0 | 0.1 | GO:0007602 | phototransduction(GO:0007602) |
0.0 | 0.0 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.0 | 0.1 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.0 | 0.5 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.0 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
0.0 | 0.1 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
0.0 | 0.0 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.0 | 0.0 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.0 | GO:1902299 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
0.0 | 0.2 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
0.0 | 0.0 | GO:0090189 | regulation of mesonephros development(GO:0061217) regulation of branching involved in ureteric bud morphogenesis(GO:0090189) |
0.0 | 0.1 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 1.8 | GO:0007219 | Notch signaling pathway(GO:0007219) |
0.0 | 0.1 | GO:0072503 | cellular divalent inorganic cation homeostasis(GO:0072503) |
0.0 | 0.1 | GO:0048484 | enteric nervous system development(GO:0048484) |
0.0 | 0.0 | GO:1904579 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) response to hypobaric hypoxia(GO:1990910) |
0.0 | 0.0 | GO:0033081 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
0.0 | 0.0 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.0 | GO:0061107 | seminal vesicle development(GO:0061107) |
0.0 | 0.3 | GO:0003299 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
0.0 | 0.0 | GO:0061726 | mitophagy(GO:0000422) mitochondrion disassembly(GO:0061726) |
0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.4 | GO:0031648 | protein destabilization(GO:0031648) |
0.0 | 0.1 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 0.0 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
0.0 | 0.0 | GO:1902913 | positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
0.0 | 0.3 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.0 | 0.1 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.1 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
0.0 | 0.1 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.0 | 0.1 | GO:0036511 | trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
0.0 | 0.0 | GO:0055090 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.0 | 0.1 | GO:1903430 | negative regulation of cell maturation(GO:1903430) |
0.0 | 0.5 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.0 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.2 | 1.0 | GO:0043260 | laminin-11 complex(GO:0043260) |
0.2 | 0.9 | GO:0016938 | kinesin I complex(GO:0016938) |
0.2 | 0.7 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
0.2 | 1.0 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.7 | GO:0002133 | polycystin complex(GO:0002133) |
0.1 | 0.6 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 0.6 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.4 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 0.4 | GO:0032010 | phagolysosome(GO:0032010) |
0.1 | 0.4 | GO:0097635 | extrinsic component of autophagosome membrane(GO:0097635) |
0.1 | 0.3 | GO:0035101 | FACT complex(GO:0035101) |
0.1 | 0.4 | GO:0036284 | tubulobulbar complex(GO:0036284) |
0.1 | 0.3 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
0.1 | 0.7 | GO:0097361 | CIA complex(GO:0097361) |
0.1 | 0.3 | GO:0005584 | collagen type I trimer(GO:0005584) |
0.1 | 0.8 | GO:0035976 | AP1 complex(GO:0035976) |
0.1 | 0.3 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.1 | 0.3 | GO:1990032 | parallel fiber(GO:1990032) |
0.1 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.9 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.1 | 0.4 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 1.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.1 | 0.5 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 0.1 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
0.1 | 0.3 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
0.1 | 0.2 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
0.1 | 0.4 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 1.1 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
0.1 | 0.7 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.4 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 0.5 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 1.4 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.1 | 0.4 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
0.1 | 0.5 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.1 | 0.6 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.3 | GO:0032449 | CBM complex(GO:0032449) |
0.1 | 0.5 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.3 | GO:0045160 | myosin I complex(GO:0045160) |
0.1 | 0.3 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.1 | 0.7 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.2 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.1 | 0.2 | GO:0031085 | BLOC-3 complex(GO:0031085) |
0.1 | 0.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.1 | 0.2 | GO:0034657 | GID complex(GO:0034657) |
0.1 | 0.5 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.3 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.3 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.1 | 0.3 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 0.2 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
0.1 | 0.1 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
0.1 | 0.6 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 0.5 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.0 | GO:0070470 | plasma membrane respiratory chain(GO:0070470) |
0.0 | 0.4 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.5 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.5 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 1.5 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.8 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.7 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.3 | GO:0072589 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
0.0 | 0.3 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.2 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.0 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.6 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 1.2 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.6 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.8 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.2 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.0 | 0.7 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.2 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
0.0 | 0.5 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.5 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.1 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
0.0 | 0.2 | GO:0044753 | amphisome(GO:0044753) |
0.0 | 0.5 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.2 | GO:0033268 | node of Ranvier(GO:0033268) |
0.0 | 0.5 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.1 | GO:0036117 | hyaluranon cable(GO:0036117) |
0.0 | 0.2 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
0.0 | 0.0 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
0.0 | 0.1 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
0.0 | 0.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.1 | GO:0042022 | interleukin-12 receptor complex(GO:0042022) |
0.0 | 0.1 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
0.0 | 0.2 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.4 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.0 | 0.1 | GO:0014802 | terminal cisterna(GO:0014802) |
0.0 | 4.7 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.5 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.0 | 0.2 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.2 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.2 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
0.0 | 0.1 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
0.0 | 0.5 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.2 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
0.0 | 0.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.1 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.1 | GO:0031251 | PAN complex(GO:0031251) |
0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 0.1 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
0.0 | 0.1 | GO:0039713 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.1 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
0.0 | 0.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.1 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.0 | 0.2 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.2 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.1 | GO:0019034 | viral replication complex(GO:0019034) |
0.0 | 0.7 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.0 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.0 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.3 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.1 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
0.0 | 0.4 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.8 | GO:0031527 | filopodium membrane(GO:0031527) |
0.0 | 0.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.0 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
0.0 | 0.0 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.7 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.1 | GO:0044305 | calyx of Held(GO:0044305) |
0.0 | 0.4 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.9 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.1 | GO:0005589 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.1 | GO:1990666 | PCSK9-LDLR complex(GO:1990666) |
0.0 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.1 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.2 | GO:0016013 | syntrophin complex(GO:0016013) |
0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.2 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 0.0 | GO:0034678 | integrin alpha8-beta1 complex(GO:0034678) |
0.0 | 0.1 | GO:0032302 | MutSbeta complex(GO:0032302) |
0.0 | 0.9 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.0 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.0 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 0.6 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.4 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.1 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.1 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.0 | 0.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.0 | GO:1903349 | omegasome membrane(GO:1903349) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) inhibin A complex(GO:0043512) |
0.0 | 0.0 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
0.0 | 0.4 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.0 | 1.4 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.1 | GO:0036020 | endolysosome membrane(GO:0036020) |
0.0 | 0.3 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.2 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.1 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
0.0 | 1.3 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.2 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.6 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.0 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.2 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.0 | 1.3 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.0 | 1.3 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.3 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.3 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.0 | 0.5 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 1.9 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.0 | GO:0030677 | ribonuclease P complex(GO:0030677) |
0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.7 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.0 | 0.0 | GO:0098797 | plasma membrane protein complex(GO:0098797) |
0.0 | 0.5 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.1 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.0 | 0.0 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.2 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.0 | 0.0 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.0 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.1 | GO:0042825 | TAP complex(GO:0042825) |
0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.0 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.9 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 1.4 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.1 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
0.0 | 0.3 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.2 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.0 | 0.1 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
0.0 | 0.9 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.1 | GO:0005685 | U1 snRNP(GO:0005685) |
0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.0 | 0.0 | GO:0036398 | TCR signalosome(GO:0036398) |
0.0 | 0.3 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.1 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 0.1 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.1 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
0.0 | 1.6 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.0 | 0.3 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.3 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 1.2 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.3 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.1 | GO:0070826 | paraferritin complex(GO:0070826) |
0.0 | 0.0 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.0 | 0.0 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.1 | GO:0060198 | clathrin-sculpted vesicle(GO:0060198) |
0.0 | 0.4 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 0.4 | GO:0000323 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.0 | 0.0 | GO:0060187 | cell pole(GO:0060187) |
0.0 | 0.1 | GO:0005579 | membrane attack complex(GO:0005579) |
0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.1 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
0.3 | 1.0 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
0.2 | 0.7 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
0.2 | 0.7 | GO:0003842 | 1-pyrroline-5-carboxylate dehydrogenase activity(GO:0003842) |
0.2 | 1.0 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.2 | 0.6 | GO:0004324 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
0.2 | 1.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.2 | 1.0 | GO:0031208 | POZ domain binding(GO:0031208) |
0.2 | 0.6 | GO:0016250 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
0.2 | 0.6 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
0.2 | 0.9 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.2 | 0.6 | GO:0015117 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
0.2 | 0.5 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.2 | 1.0 | GO:0070026 | nitric oxide binding(GO:0070026) |
0.2 | 0.5 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
0.2 | 0.7 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.2 | 0.5 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
0.2 | 0.2 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.2 | 0.5 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
0.2 | 0.6 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.2 | 0.6 | GO:0004335 | galactokinase activity(GO:0004335) |
0.2 | 0.3 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
0.2 | 2.2 | GO:0019826 | oxygen sensor activity(GO:0019826) |
0.2 | 0.6 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.1 | 0.4 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
0.1 | 0.4 | GO:0042356 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
0.1 | 0.4 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 0.6 | GO:0015207 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
0.1 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.6 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.1 | 0.4 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.1 | 0.6 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.1 | 0.5 | GO:0032408 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
0.1 | 0.3 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.1 | 0.8 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
0.1 | 0.6 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.1 | 0.4 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.1 | 0.5 | GO:0098808 | mRNA cap binding(GO:0098808) |
0.1 | 0.6 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
0.1 | 0.2 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.1 | 0.5 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.4 | GO:0015068 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
0.1 | 0.4 | GO:0005174 | CD40 receptor binding(GO:0005174) |
0.1 | 0.3 | GO:0070984 | SET domain binding(GO:0070984) |
0.1 | 1.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 2.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 0.4 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.1 | 0.5 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.1 | 0.4 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.9 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.5 | GO:0070905 | serine binding(GO:0070905) |
0.1 | 0.6 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.4 | GO:0090409 | malonyl-CoA synthetase activity(GO:0090409) |
0.1 | 0.9 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 1.0 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.3 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
0.1 | 0.3 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.1 | 0.3 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
0.1 | 0.3 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
0.1 | 0.3 | GO:0086040 | sodium:proton antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086040) |
0.1 | 0.6 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.8 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.1 | 0.2 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
0.1 | 0.4 | GO:0005287 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
0.1 | 0.2 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
0.1 | 0.2 | GO:0001003 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
0.1 | 0.2 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
0.1 | 0.4 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 0.4 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 0.4 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 0.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.6 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.2 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 0.2 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
0.1 | 0.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.5 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
0.1 | 0.3 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
0.1 | 0.2 | GO:0004458 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
0.1 | 0.3 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.2 | GO:0048244 | phytanoyl-CoA dioxygenase activity(GO:0048244) |
0.1 | 0.3 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
0.1 | 0.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 0.1 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.3 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 1.5 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.1 | 0.1 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.1 | 0.3 | GO:0052901 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
0.1 | 0.4 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.1 | 0.2 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
0.1 | 0.5 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.1 | 0.5 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.1 | 0.1 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) platelet-derived growth factor-activated receptor activity(GO:0005017) |
0.1 | 0.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 2.3 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.6 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 1.0 | GO:0005537 | mannose binding(GO:0005537) |
0.1 | 0.6 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.1 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.3 | GO:0042806 | fucose binding(GO:0042806) |
0.1 | 0.2 | GO:0008841 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
0.1 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 0.7 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.1 | 0.4 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.2 | GO:0047888 | fatty acid peroxidase activity(GO:0047888) |
0.1 | 0.2 | GO:0034602 | oxoglutarate dehydrogenase (NAD+) activity(GO:0034602) |
0.1 | 0.2 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
0.1 | 0.2 | GO:0030617 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) |
0.1 | 0.1 | GO:0015230 | FAD transmembrane transporter activity(GO:0015230) |
0.1 | 0.7 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.1 | 0.2 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
0.1 | 0.6 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.1 | 0.2 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
0.1 | 0.4 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.2 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
0.1 | 0.3 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.1 | 0.1 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
0.1 | 0.7 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 0.1 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.1 | 0.2 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
0.1 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.6 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 0.3 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.1 | 0.3 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.1 | 0.2 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.1 | 0.2 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.1 | 0.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 0.2 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
0.1 | 0.2 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.1 | 0.5 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 1.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.4 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.1 | 0.1 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
0.1 | 0.3 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 0.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.2 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
0.0 | 1.0 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.4 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 1.0 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.0 | 1.0 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.1 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.0 | 0.3 | GO:0008481 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
0.0 | 0.2 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
0.0 | 0.7 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.2 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.0 | 0.3 | GO:0046979 | TAP2 binding(GO:0046979) |
0.0 | 0.8 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.0 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.2 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.2 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.3 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.6 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.0 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.0 | 0.2 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
0.0 | 0.2 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
0.0 | 0.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.1 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
0.0 | 0.2 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.2 | GO:0004803 | transposase activity(GO:0004803) |
0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.1 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
0.0 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.0 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
0.0 | 0.3 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
0.0 | 1.1 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.3 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.2 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
0.0 | 0.5 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.0 | GO:0042731 | PH domain binding(GO:0042731) |
0.0 | 0.5 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.2 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
0.0 | 0.2 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
0.0 | 0.5 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.5 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 0.2 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
0.0 | 0.4 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.5 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.4 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 1.7 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 1.0 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.2 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.4 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.7 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.2 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.0 | 0.4 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.7 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 0.9 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.0 | 0.1 | GO:0001133 | RNA polymerase II transcription factor activity, sequence-specific transcription regulatory region DNA binding(GO:0001133) |
0.0 | 0.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.7 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.2 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
0.0 | 0.5 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.1 | GO:0016517 | interleukin-12 receptor activity(GO:0016517) |
0.0 | 0.3 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 1.1 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.4 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.4 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.1 | GO:0047017 | prostaglandin-F synthase activity(GO:0047017) |
0.0 | 0.7 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.1 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
0.0 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.3 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.8 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.4 | GO:0004465 | lipoprotein lipase activity(GO:0004465) |
0.0 | 0.4 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.4 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
0.0 | 0.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.0 | 0.4 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
0.0 | 0.2 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
0.0 | 0.5 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.4 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.0 | 0.6 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.1 | GO:0050333 | thiamin-triphosphatase activity(GO:0050333) |
0.0 | 0.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.3 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 0.1 | GO:0046977 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) |
0.0 | 2.3 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.0 | 0.2 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
0.0 | 0.9 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.3 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.1 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 0.1 | GO:0004913 | interleukin-4 receptor activity(GO:0004913) |
0.0 | 0.1 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
0.0 | 0.1 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
0.0 | 0.4 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.3 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.2 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.2 | GO:0030375 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.5 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.0 | 0.3 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.1 | GO:0098770 | FBXO family protein binding(GO:0098770) |
0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.2 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
0.0 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.3 | GO:0032810 | sterol response element binding(GO:0032810) |
0.0 | 0.2 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.9 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.0 | 0.1 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.0 | 0.1 | GO:0047536 | 2-aminoadipate transaminase activity(GO:0047536) |
0.0 | 0.1 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.1 | GO:0019239 | deaminase activity(GO:0019239) |
0.0 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.3 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.0 | 0.1 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
0.0 | 0.5 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.0 | 0.4 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
0.0 | 1.1 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.1 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.1 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
0.0 | 0.7 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
0.0 | 0.0 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.1 | GO:0031812 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
0.0 | 0.1 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
0.0 | 0.1 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
0.0 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.7 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.2 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
0.0 | 0.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.3 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.1 | GO:0052812 | phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) |
0.0 | 0.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.2 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.6 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.1 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
0.0 | 0.1 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.1 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 1.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.2 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
0.0 | 0.2 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.7 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.1 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
0.0 | 0.2 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
0.0 | 0.1 | GO:0019779 | Atg12 activating enzyme activity(GO:0019778) Atg8 activating enzyme activity(GO:0019779) |
0.0 | 0.2 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.2 | GO:0030614 | oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) |
0.0 | 0.1 | GO:0032451 | demethylase activity(GO:0032451) |
0.0 | 0.1 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
0.0 | 0.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 0.2 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.9 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.1 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
0.0 | 0.3 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.0 | 0.3 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.3 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.1 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
0.0 | 0.1 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
0.0 | 0.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.0 | 0.1 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
0.0 | 0.8 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.0 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.1 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.0 | 0.1 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.0 | 0.1 | GO:0051765 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol tetrakisphosphate kinase activity(GO:0051765) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
0.0 | 0.4 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 0.2 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
0.0 | 0.6 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.3 | GO:0045159 | myosin II binding(GO:0045159) |
0.0 | 0.7 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
0.0 | 0.2 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
0.0 | 0.1 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
0.0 | 0.2 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.7 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.2 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.1 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
0.0 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0004766 | spermidine synthase activity(GO:0004766) |
0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.0 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.0 | 0.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.1 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
0.0 | 0.1 | GO:0034188 | apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
0.0 | 0.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.1 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.0 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.1 | GO:0032181 | double-strand/single-strand DNA junction binding(GO:0000406) dinucleotide repeat insertion binding(GO:0032181) |
0.0 | 0.1 | GO:0047025 | 3-oxoacyl-[acyl-carrier-protein] reductase (NADH) activity(GO:0047025) |
0.0 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.0 | 0.8 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 0.0 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.1 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.0 | 0.0 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.0 | 0.7 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.4 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.1 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
0.0 | 0.4 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
0.0 | 0.1 | GO:0005503 | all-trans retinal binding(GO:0005503) |
0.0 | 0.3 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.0 | 0.3 | GO:0048156 | tau protein binding(GO:0048156) |
0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.0 | 0.1 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
0.0 | 0.2 | GO:0035586 | purinergic receptor activity(GO:0035586) |
0.0 | 0.5 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.1 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
0.0 | 0.1 | GO:0016403 | dimethylargininase activity(GO:0016403) |
0.0 | 0.1 | GO:0000384 | first spliceosomal transesterification activity(GO:0000384) |
0.0 | 0.2 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 0.1 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.0 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.5 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.2 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
0.0 | 0.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.2 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.1 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.0 | 3.7 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.1 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.0 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.1 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
0.0 | 0.1 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
0.0 | 0.1 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.5 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.0 | 0.6 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
0.0 | 0.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.5 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.4 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.5 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.2 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.0 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.1 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.1 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
0.0 | 0.1 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.1 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
0.0 | 0.0 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.4 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.1 | GO:0035276 | ethanol binding(GO:0035276) |
0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.0 | 0.0 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
0.0 | 0.2 | GO:0031014 | troponin T binding(GO:0031014) |
0.0 | 0.0 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) L-threonine ammonia-lyase activity(GO:0004794) |
0.0 | 0.4 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.6 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.1 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.2 | GO:0015929 | hexosaminidase activity(GO:0015929) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.0 | GO:0052856 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
0.0 | 0.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.4 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.3 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.1 | GO:0016453 | C-acetyltransferase activity(GO:0016453) |
0.0 | 0.0 | GO:0005055 | laminin receptor activity(GO:0005055) |
0.0 | 0.2 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
0.0 | 1.0 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.1 | GO:0004452 | isopentenyl-diphosphate delta-isomerase activity(GO:0004452) |
0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 1.0 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
0.0 | 0.2 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.3 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.1 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.0 | 0.6 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.1 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
0.0 | 0.0 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
0.0 | 0.5 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.0 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
0.0 | 0.1 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.0 | 0.4 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.0 | 1.2 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 0.3 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.1 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
0.0 | 0.2 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.1 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.1 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.1 | GO:0004797 | thymidine kinase activity(GO:0004797) |
0.0 | 0.1 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.0 | 0.0 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.0 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
0.0 | 0.0 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) cholesterol O-acyltransferase activity(GO:0034736) |
0.0 | 0.1 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.4 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.1 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.0 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.0 | 0.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.0 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.0 | 0.0 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
0.0 | 0.3 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.0 | 0.6 | GO:0001071 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
0.0 | 0.7 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.5 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.0 | GO:0008670 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) |
0.0 | 0.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.1 | GO:0015926 | glucosidase activity(GO:0015926) |
0.0 | 0.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.0 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.2 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.0 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.1 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
0.0 | 0.0 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.0 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.0 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.7 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 1.3 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 1.4 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 2.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 2.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 1.8 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 1.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 1.0 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 2.0 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 2.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 1.0 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 1.0 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.6 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.0 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 1.6 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.5 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.3 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 1.9 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.2 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.9 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.3 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.2 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.7 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 1.7 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.5 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 0.9 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.4 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.6 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.4 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 1.3 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.8 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.1 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 0.7 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.2 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 1.4 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.5 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.3 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.2 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 2.6 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.7 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.4 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.5 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.7 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.1 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.1 | 2.7 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 1.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 0.4 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.1 | 2.8 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 0.1 | REACTOME PI3K EVENTS IN ERBB4 SIGNALING | Genes involved in PI3K events in ERBB4 signaling |
0.1 | 1.3 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 1.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 1.0 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 0.2 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.1 | 0.5 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 0.2 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.1 | 0.2 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 1.6 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.6 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.8 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 1.4 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.6 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 2.1 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.9 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.5 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.5 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.2 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 1.5 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 1.0 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 1.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.7 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.8 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.5 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 1.5 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.5 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.4 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.1 | REACTOME SYNTHESIS OF DNA | Genes involved in Synthesis of DNA |
0.0 | 0.5 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.0 | 1.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.7 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.9 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.4 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 1.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 1.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 1.1 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.5 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.0 | 0.8 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.3 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
0.0 | 0.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 1.0 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.9 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.2 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.1 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 1.1 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.5 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 1.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.6 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.6 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.0 | 1.1 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.9 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 0.5 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.6 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.6 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.5 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.0 | 1.9 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.8 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.0 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.6 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 1.2 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.0 | 0.2 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.4 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 1.4 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.6 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.1 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.5 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.5 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 1.8 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.1 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.1 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
0.0 | 0.5 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.4 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.4 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 1.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |