avrg: NHBE cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Gene Symbol | Gene ID | Gene Info |
---|---|---|
SMAD4
|
ENSG00000141646.9 | SMAD4 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
SMAD4 | hg19_v2_chr18_+_48556470_48556640 | -0.91 | 1.2e-02 | Click! |
Promoter | Score | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr22_+_30752606 | 1.81 |
ENST00000399824.2 ENST00000405659.1 ENST00000338306.3 |
CCDC157 |
coiled-coil domain containing 157 |
chr4_+_71384257 | 1.38 |
ENST00000339336.4 |
AMTN |
amelotin |
chr2_+_113735575 | 1.24 |
ENST00000376489.2 ENST00000259205.4 |
IL36G |
interleukin 36, gamma |
chr6_+_116937636 | 1.04 |
ENST00000368581.4 ENST00000229554.5 ENST00000368580.4 |
RSPH4A |
radial spoke head 4 homolog A (Chlamydomonas) |
chr8_-_73793975 | 0.98 |
ENST00000523881.1 |
RP11-1145L24.1 |
RP11-1145L24.1 |
chr6_+_27791862 | 0.88 |
ENST00000355057.1 |
HIST1H4J |
histone cluster 1, H4j |
chr4_+_74606223 | 0.87 |
ENST00000307407.3 ENST00000401931.1 |
IL8 |
interleukin 8 |
chr4_+_71384300 | 0.82 |
ENST00000504451.1 |
AMTN |
amelotin |
chr8_+_104383759 | 0.82 |
ENST00000415886.2 |
CTHRC1 |
collagen triple helix repeat containing 1 |
chr22_+_38382163 | 0.80 |
ENST00000333418.4 ENST00000427034.1 |
POLR2F |
polymerase (RNA) II (DNA directed) polypeptide F |
chr8_+_145726472 | 0.79 |
ENST00000528430.1 |
PPP1R16A |
protein phosphatase 1, regulatory subunit 16A |
chr11_-_8739383 | 0.77 |
ENST00000531060.1 |
ST5 |
suppression of tumorigenicity 5 |
chr10_+_81892477 | 0.75 |
ENST00000372263.3 |
PLAC9 |
placenta-specific 9 |
chr12_-_106477805 | 0.74 |
ENST00000553094.1 ENST00000549704.1 |
NUAK1 |
NUAK family, SNF1-like kinase, 1 |
chr17_-_65992544 | 0.73 |
ENST00000580729.1 |
RP11-855A2.5 |
RP11-855A2.5 |
chr19_-_51017127 | 0.73 |
ENST00000389208.4 |
ASPDH |
aspartate dehydrogenase domain containing |
chr19_-_54984354 | 0.71 |
ENST00000301200.2 |
CDC42EP5 |
CDC42 effector protein (Rho GTPase binding) 5 |
chr16_+_2880369 | 0.71 |
ENST00000572863.1 |
ZG16B |
zymogen granule protein 16B |
chr8_+_55466915 | 0.71 |
ENST00000522711.2 |
RP11-53M11.3 |
RP11-53M11.3 |
chr19_-_36643329 | 0.71 |
ENST00000589154.1 |
COX7A1 |
cytochrome c oxidase subunit VIIa polypeptide 1 (muscle) |
chr16_+_812506 | 0.71 |
ENST00000569566.1 |
MSLN |
mesothelin |
chr18_-_8337038 | 0.69 |
ENST00000594251.1 |
AP001094.1 |
Uncharacterized protein |
chr1_-_153321301 | 0.66 |
ENST00000368739.3 |
PGLYRP4 |
peptidoglycan recognition protein 4 |
chr17_-_73874654 | 0.63 |
ENST00000254816.2 |
TRIM47 |
tripartite motif containing 47 |
chr19_-_6720686 | 0.60 |
ENST00000245907.6 |
C3 |
complement component 3 |
chr1_+_155100342 | 0.59 |
ENST00000368406.2 |
EFNA1 |
ephrin-A1 |
chr19_+_46171464 | 0.58 |
ENST00000590918.1 ENST00000263281.3 ENST00000304207.8 |
GIPR |
gastric inhibitory polypeptide receptor |
chr1_+_152956549 | 0.58 |
ENST00000307122.2 |
SPRR1A |
small proline-rich protein 1A |
chr5_-_180242576 | 0.58 |
ENST00000514438.1 |
MGAT1 |
mannosyl (alpha-1,3-)-glycoprotein beta-1,2-N-acetylglucosaminyltransferase |
chr7_+_76109827 | 0.58 |
ENST00000446820.2 |
DTX2 |
deltex homolog 2 (Drosophila) |
chr10_+_104180580 | 0.57 |
ENST00000425536.1 |
FBXL15 |
F-box and leucine-rich repeat protein 15 |
chr12_+_93115281 | 0.57 |
ENST00000549856.1 |
PLEKHG7 |
pleckstrin homology domain containing, family G (with RhoGef domain) member 7 |
chr6_+_131571535 | 0.57 |
ENST00000474850.2 |
AKAP7 |
A kinase (PRKA) anchor protein 7 |
chr8_+_55467072 | 0.57 |
ENST00000602362.1 |
RP11-53M11.3 |
RP11-53M11.3 |
chr7_+_37723336 | 0.56 |
ENST00000450180.1 |
GPR141 |
G protein-coupled receptor 141 |
chr17_+_77018896 | 0.56 |
ENST00000578229.1 |
C1QTNF1 |
C1q and tumor necrosis factor related protein 1 |
chr11_+_64053890 | 0.55 |
ENST00000438980.2 ENST00000313074.3 ENST00000542190.1 ENST00000541952.1 |
GPR137 |
G protein-coupled receptor 137 |
chr6_-_32908765 | 0.55 |
ENST00000416244.2 |
HLA-DMB |
major histocompatibility complex, class II, DM beta |
chr11_-_61647935 | 0.55 |
ENST00000531956.1 |
FADS3 |
fatty acid desaturase 3 |
chr9_+_140119618 | 0.54 |
ENST00000359069.2 |
C9orf169 |
chromosome 9 open reading frame 169 |
chr11_-_72385437 | 0.54 |
ENST00000418754.2 ENST00000542969.2 ENST00000334456.5 |
PDE2A |
phosphodiesterase 2A, cGMP-stimulated |
chr16_-_54963026 | 0.54 |
ENST00000560208.1 ENST00000557792.1 |
CRNDE |
colorectal neoplasia differentially expressed (non-protein coding) |
chr11_+_117070037 | 0.53 |
ENST00000392951.4 ENST00000525531.1 ENST00000278968.6 |
TAGLN |
transgelin |
chr12_+_116985896 | 0.53 |
ENST00000547114.1 |
RP11-809C9.2 |
RP11-809C9.2 |
chrX_-_128782722 | 0.53 |
ENST00000427399.1 |
APLN |
apelin |
chr17_+_74536115 | 0.52 |
ENST00000592014.1 |
PRCD |
progressive rod-cone degeneration |
chr5_+_177540444 | 0.52 |
ENST00000274605.5 |
N4BP3 |
NEDD4 binding protein 3 |
chr8_+_104383728 | 0.52 |
ENST00000330295.5 |
CTHRC1 |
collagen triple helix repeat containing 1 |
chr19_-_6670128 | 0.52 |
ENST00000245912.3 |
TNFSF14 |
tumor necrosis factor (ligand) superfamily, member 14 |
chr2_+_220306238 | 0.52 |
ENST00000435853.1 |
SPEG |
SPEG complex locus |
chr3_-_112127981 | 0.52 |
ENST00000486726.2 |
RP11-231E6.1 |
RP11-231E6.1 |
chr22_-_50968419 | 0.51 |
ENST00000425169.1 ENST00000395680.1 ENST00000395681.1 ENST00000395678.3 ENST00000252029.3 |
TYMP |
thymidine phosphorylase |
chr19_+_49055332 | 0.51 |
ENST00000201586.2 |
SULT2B1 |
sulfotransferase family, cytosolic, 2B, member 1 |
chr5_-_121413974 | 0.51 |
ENST00000231004.4 |
LOX |
lysyl oxidase |
chr17_-_61777459 | 0.51 |
ENST00000578993.1 ENST00000583211.1 ENST00000259006.3 |
LIMD2 |
LIM domain containing 2 |
chr11_-_47270341 | 0.51 |
ENST00000529444.1 ENST00000530453.1 ENST00000537863.1 ENST00000529788.1 ENST00000444355.2 ENST00000527256.1 ENST00000529663.1 ENST00000256997.3 |
ACP2 |
acid phosphatase 2, lysosomal |
chr12_-_53242770 | 0.50 |
ENST00000304620.4 ENST00000547110.1 |
KRT78 |
keratin 78 |
chr14_-_24732738 | 0.50 |
ENST00000558074.1 ENST00000560226.1 |
TGM1 |
transglutaminase 1 |
chr20_-_62199427 | 0.50 |
ENST00000427522.2 |
HELZ2 |
helicase with zinc finger 2, transcriptional coactivator |
chr6_-_31651817 | 0.50 |
ENST00000375863.3 ENST00000375860.2 |
LY6G5C |
lymphocyte antigen 6 complex, locus G5C |
chr3_-_120400960 | 0.50 |
ENST00000476082.2 |
HGD |
homogentisate 1,2-dioxygenase |
chr16_+_2880157 | 0.49 |
ENST00000382280.3 |
ZG16B |
zymogen granule protein 16B |
chr14_-_103989033 | 0.49 |
ENST00000553878.1 ENST00000557530.1 |
CKB |
creatine kinase, brain |
chr15_-_74726283 | 0.49 |
ENST00000543145.2 |
SEMA7A |
semaphorin 7A, GPI membrane anchor (John Milton Hagen blood group) |
chr12_-_42631529 | 0.48 |
ENST00000548917.1 |
YAF2 |
YY1 associated factor 2 |
chr5_+_140514782 | 0.48 |
ENST00000231134.5 |
PCDHB5 |
protocadherin beta 5 |
chr6_-_31938700 | 0.48 |
ENST00000495340.1 |
DXO |
decapping exoribonuclease |
chr17_+_77020325 | 0.48 |
ENST00000311661.4 |
C1QTNF1 |
C1q and tumor necrosis factor related protein 1 |
chr19_-_54824344 | 0.48 |
ENST00000346508.3 ENST00000446712.3 ENST00000432233.3 ENST00000301219.3 |
LILRA5 |
leukocyte immunoglobulin-like receptor, subfamily A (with TM domain), member 5 |
chr10_+_102891048 | 0.48 |
ENST00000467928.2 |
TLX1 |
T-cell leukemia homeobox 1 |
chr17_+_18128896 | 0.47 |
ENST00000316843.4 |
LLGL1 |
lethal giant larvae homolog 1 (Drosophila) |
chr19_-_37178284 | 0.47 |
ENST00000425254.2 ENST00000590952.1 ENST00000433232.1 |
AC074138.3 |
AC074138.3 |
chr16_-_67881588 | 0.46 |
ENST00000561593.1 ENST00000565114.1 |
CENPT |
centromere protein T |
chr19_-_55672037 | 0.46 |
ENST00000588076.1 |
DNAAF3 |
dynein, axonemal, assembly factor 3 |
chr1_-_243418650 | 0.46 |
ENST00000522995.1 |
CEP170 |
centrosomal protein 170kDa |
chr15_-_45670717 | 0.45 |
ENST00000558163.1 ENST00000558336.1 |
GATM |
glycine amidinotransferase (L-arginine:glycine amidinotransferase) |
chr2_+_119699864 | 0.45 |
ENST00000541757.1 ENST00000412481.1 |
MARCO |
macrophage receptor with collagenous structure |
chr10_+_81891416 | 0.45 |
ENST00000372270.2 |
PLAC9 |
placenta-specific 9 |
chr7_+_94023873 | 0.44 |
ENST00000297268.6 |
COL1A2 |
collagen, type I, alpha 2 |
chr12_+_104982622 | 0.44 |
ENST00000549016.1 |
CHST11 |
carbohydrate (chondroitin 4) sulfotransferase 11 |
chr17_+_38121772 | 0.44 |
ENST00000577447.1 |
GSDMA |
gasdermin A |
chr20_-_36794902 | 0.44 |
ENST00000373403.3 |
TGM2 |
transglutaminase 2 |
chr8_-_25281747 | 0.43 |
ENST00000421054.2 |
GNRH1 |
gonadotropin-releasing hormone 1 (luteinizing-releasing hormone) |
chr19_-_51529849 | 0.43 |
ENST00000600362.1 ENST00000453757.3 ENST00000601671.1 |
KLK11 |
kallikrein-related peptidase 11 |
chr10_+_91087651 | 0.43 |
ENST00000371818.4 |
IFIT3 |
interferon-induced protein with tetratricopeptide repeats 3 |
chr8_-_22550815 | 0.43 |
ENST00000317216.2 |
EGR3 |
early growth response 3 |
chr19_-_47231216 | 0.43 |
ENST00000594287.2 |
STRN4 |
striatin, calmodulin binding protein 4 |
chr1_+_155099927 | 0.43 |
ENST00000368407.3 |
EFNA1 |
ephrin-A1 |
chr14_-_91720224 | 0.43 |
ENST00000238699.3 ENST00000531499.2 |
GPR68 |
G protein-coupled receptor 68 |
chr12_+_6419877 | 0.42 |
ENST00000536531.1 |
PLEKHG6 |
pleckstrin homology domain containing, family G (with RhoGef domain) member 6 |
chr12_-_66275350 | 0.42 |
ENST00000536648.1 |
RP11-366L20.2 |
Uncharacterized protein |
chr16_-_66959429 | 0.42 |
ENST00000420652.1 ENST00000299759.6 |
RRAD |
Ras-related associated with diabetes |
chr16_-_25122735 | 0.42 |
ENST00000563176.1 |
RP11-449H11.1 |
RP11-449H11.1 |
chr17_+_77020224 | 0.42 |
ENST00000339142.2 |
C1QTNF1 |
C1q and tumor necrosis factor related protein 1 |
chr11_+_46366918 | 0.42 |
ENST00000528615.1 ENST00000395574.3 |
DGKZ |
diacylglycerol kinase, zeta |
chr19_+_40873617 | 0.41 |
ENST00000599353.1 |
PLD3 |
phospholipase D family, member 3 |
chr2_-_113594279 | 0.41 |
ENST00000416750.1 ENST00000418817.1 ENST00000263341.2 |
IL1B |
interleukin 1, beta |
chr11_+_46366799 | 0.41 |
ENST00000532868.2 |
DGKZ |
diacylglycerol kinase, zeta |
chr9_-_139268068 | 0.41 |
ENST00000371734.3 ENST00000371732.5 ENST00000315908.7 |
CARD9 |
caspase recruitment domain family, member 9 |
chr9_-_125240235 | 0.41 |
ENST00000259357.2 |
OR1J1 |
olfactory receptor, family 1, subfamily J, member 1 |
chr18_+_39739223 | 0.41 |
ENST00000601948.1 |
LINC00907 |
long intergenic non-protein coding RNA 907 |
chr5_-_142065612 | 0.40 |
ENST00000360966.5 ENST00000411960.1 |
FGF1 |
fibroblast growth factor 1 (acidic) |
chr1_-_113257905 | 0.40 |
ENST00000464951.1 |
PPM1J |
protein phosphatase, Mg2+/Mn2+ dependent, 1J |
chr16_+_29840929 | 0.40 |
ENST00000566252.1 |
MVP |
major vault protein |
chr15_-_45670924 | 0.40 |
ENST00000396659.3 |
GATM |
glycine amidinotransferase (L-arginine:glycine amidinotransferase) |
chr22_+_31199037 | 0.40 |
ENST00000424224.1 |
OSBP2 |
oxysterol binding protein 2 |
chr6_+_139349903 | 0.40 |
ENST00000461027.1 |
ABRACL |
ABRA C-terminal like |
chr1_+_10509971 | 0.40 |
ENST00000320498.4 |
CORT |
cortistatin |
chr6_+_13272904 | 0.39 |
ENST00000379335.3 ENST00000379329.1 |
PHACTR1 |
phosphatase and actin regulator 1 |
chr9_+_118950325 | 0.39 |
ENST00000534838.1 |
PAPPA |
pregnancy-associated plasma protein A, pappalysin 1 |
chr14_+_77425972 | 0.39 |
ENST00000553613.1 |
RP11-7F17.7 |
RP11-7F17.7 |
chr3_+_150804676 | 0.38 |
ENST00000474524.1 ENST00000273432.4 |
MED12L |
mediator complex subunit 12-like |
chr20_+_34680698 | 0.38 |
ENST00000447825.1 |
EPB41L1 |
erythrocyte membrane protein band 4.1-like 1 |
chr11_+_66624527 | 0.37 |
ENST00000393952.3 |
LRFN4 |
leucine rich repeat and fibronectin type III domain containing 4 |
chr17_+_47653178 | 0.36 |
ENST00000328741.5 |
NXPH3 |
neurexophilin 3 |
chr11_-_798305 | 0.36 |
ENST00000531514.1 |
SLC25A22 |
solute carrier family 25 (mitochondrial carrier: glutamate), member 22 |
chr11_+_45943169 | 0.36 |
ENST00000529052.1 ENST00000531526.1 |
GYLTL1B |
glycosyltransferase-like 1B |
chr12_-_52604607 | 0.36 |
ENST00000551894.1 ENST00000553017.1 |
C12orf80 |
chromosome 12 open reading frame 80 |
chr16_-_57798253 | 0.36 |
ENST00000565270.1 |
KIFC3 |
kinesin family member C3 |
chr9_+_135754263 | 0.36 |
ENST00000356311.5 ENST00000350499.6 |
C9orf9 |
chromosome 9 open reading frame 9 |
chrX_-_153744434 | 0.36 |
ENST00000369643.1 ENST00000393572.1 |
FAM3A |
family with sequence similarity 3, member A |
chr22_-_33968239 | 0.36 |
ENST00000452586.2 ENST00000421768.1 |
LARGE |
like-glycosyltransferase |
chr9_-_140142222 | 0.35 |
ENST00000344774.4 ENST00000388932.2 |
FAM166A |
family with sequence similarity 166, member A |
chr19_+_55897699 | 0.35 |
ENST00000558131.1 ENST00000558752.1 ENST00000458349.2 |
RPL28 |
ribosomal protein L28 |
chr22_+_30752963 | 0.35 |
ENST00000445005.1 ENST00000430839.1 |
CCDC157 |
coiled-coil domain containing 157 |
chr19_-_47975106 | 0.35 |
ENST00000539381.1 ENST00000594353.1 ENST00000542837.1 |
SLC8A2 |
solute carrier family 8 (sodium/calcium exchanger), member 2 |
chr16_-_68002456 | 0.35 |
ENST00000576616.1 ENST00000572037.1 ENST00000338335.3 ENST00000422611.2 ENST00000316341.3 |
SLC12A4 |
solute carrier family 12 (potassium/chloride transporter), member 4 |
chr19_-_2739992 | 0.34 |
ENST00000545664.1 ENST00000589363.1 ENST00000455372.2 |
SLC39A3 |
solute carrier family 39 (zinc transporter), member 3 |
chr17_-_79533608 | 0.34 |
ENST00000572760.1 ENST00000573876.1 |
NPLOC4 |
nuclear protein localization 4 homolog (S. cerevisiae) |
chr19_+_49661079 | 0.34 |
ENST00000355712.5 |
TRPM4 |
transient receptor potential cation channel, subfamily M, member 4 |
chr8_-_144890847 | 0.34 |
ENST00000531942.1 |
SCRIB |
scribbled planar cell polarity protein |
chr8_+_72755367 | 0.34 |
ENST00000537896.1 |
RP11-383H13.1 |
Protein LOC100132891; cDNA FLJ53548 |
chr19_+_49617581 | 0.34 |
ENST00000391864.3 |
LIN7B |
lin-7 homolog B (C. elegans) |
chr1_+_201592013 | 0.34 |
ENST00000593583.1 |
AC096677.1 |
Uncharacterized protein ENSP00000471857 |
chr19_+_49661037 | 0.34 |
ENST00000427978.2 |
TRPM4 |
transient receptor potential cation channel, subfamily M, member 4 |
chr1_-_11751665 | 0.34 |
ENST00000376667.3 ENST00000235310.3 |
MAD2L2 |
MAD2 mitotic arrest deficient-like 2 (yeast) |
chr3_-_48598547 | 0.34 |
ENST00000536104.1 ENST00000452531.1 |
PFKFB4 |
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 4 |
chr10_+_88718397 | 0.34 |
ENST00000372017.3 |
SNCG |
synuclein, gamma (breast cancer-specific protein 1) |
chr2_-_85108240 | 0.34 |
ENST00000409133.1 |
TRABD2A |
TraB domain containing 2A |
chr12_+_75874580 | 0.33 |
ENST00000456650.3 |
GLIPR1 |
GLI pathogenesis-related 1 |
chr8_-_145028013 | 0.33 |
ENST00000354958.2 |
PLEC |
plectin |
chr7_+_20686946 | 0.33 |
ENST00000443026.2 ENST00000406935.1 |
ABCB5 |
ATP-binding cassette, sub-family B (MDR/TAP), member 5 |
chr4_+_57253672 | 0.33 |
ENST00000602927.1 |
RP11-646I6.5 |
RP11-646I6.5 |
chr8_+_104384616 | 0.33 |
ENST00000520337.1 |
CTHRC1 |
collagen triple helix repeat containing 1 |
chr10_+_75670862 | 0.33 |
ENST00000446342.1 ENST00000372764.3 ENST00000372762.4 |
PLAU |
plasminogen activator, urokinase |
chrX_-_74145273 | 0.33 |
ENST00000055682.6 |
KIAA2022 |
KIAA2022 |
chr19_-_58864848 | 0.32 |
ENST00000263100.3 |
A1BG |
alpha-1-B glycoprotein |
chr11_+_76493294 | 0.32 |
ENST00000533752.1 |
TSKU |
tsukushi, small leucine rich proteoglycan |
chr11_+_72929402 | 0.32 |
ENST00000393596.2 |
P2RY2 |
purinergic receptor P2Y, G-protein coupled, 2 |
chr16_-_54320675 | 0.32 |
ENST00000329734.3 |
IRX3 |
iroquois homeobox 3 |
chr4_+_183370146 | 0.31 |
ENST00000510504.1 |
TENM3 |
teneurin transmembrane protein 3 |
chr10_+_81892347 | 0.31 |
ENST00000372267.2 |
PLAC9 |
placenta-specific 9 |
chr19_-_47734448 | 0.31 |
ENST00000439096.2 |
BBC3 |
BCL2 binding component 3 |
chr11_-_798239 | 0.31 |
ENST00000531437.1 |
SLC25A22 |
solute carrier family 25 (mitochondrial carrier: glutamate), member 22 |
chr1_-_207095324 | 0.31 |
ENST00000530505.1 ENST00000367091.3 ENST00000442471.2 |
FAIM3 |
Fas apoptotic inhibitory molecule 3 |
chr15_+_67420441 | 0.31 |
ENST00000558894.1 |
SMAD3 |
SMAD family member 3 |
chr8_+_118532937 | 0.31 |
ENST00000297347.3 |
MED30 |
mediator complex subunit 30 |
chr19_-_10227503 | 0.31 |
ENST00000593054.1 |
EIF3G |
eukaryotic translation initiation factor 3, subunit G |
chr2_-_208030295 | 0.31 |
ENST00000458272.1 |
KLF7 |
Kruppel-like factor 7 (ubiquitous) |
chr18_+_61223393 | 0.30 |
ENST00000269491.1 ENST00000382768.1 |
SERPINB12 |
serpin peptidase inhibitor, clade B (ovalbumin), member 12 |
chr5_-_56778635 | 0.30 |
ENST00000423391.1 |
ACTBL2 |
actin, beta-like 2 |
chr6_-_31612808 | 0.30 |
ENST00000438149.1 |
BAG6 |
BCL2-associated athanogene 6 |
chr22_+_31644309 | 0.30 |
ENST00000425203.1 |
LIMK2 |
LIM domain kinase 2 |
chr19_-_6333614 | 0.30 |
ENST00000301452.4 |
ACER1 |
alkaline ceramidase 1 |
chr16_-_30905584 | 0.30 |
ENST00000380317.4 |
BCL7C |
B-cell CLL/lymphoma 7C |
chr1_-_150946911 | 0.30 |
ENST00000457392.1 ENST00000421609.1 |
CERS2 |
ceramide synthase 2 |
chr12_-_54813229 | 0.30 |
ENST00000293379.4 |
ITGA5 |
integrin, alpha 5 (fibronectin receptor, alpha polypeptide) |
chr13_+_21750780 | 0.30 |
ENST00000309594.4 |
MRP63 |
mitochondrial ribosomal protein 63 |
chr1_-_44497024 | 0.30 |
ENST00000372306.3 ENST00000372310.3 ENST00000475075.2 |
SLC6A9 |
solute carrier family 6 (neurotransmitter transporter, glycine), member 9 |
chr18_+_77623668 | 0.30 |
ENST00000316249.3 |
KCNG2 |
potassium voltage-gated channel, subfamily G, member 2 |
chr1_+_96208646 | 0.30 |
ENST00000603401.1 |
RP11-286B14.2 |
RP11-286B14.2 |
chr2_+_119699742 | 0.30 |
ENST00000327097.4 |
MARCO |
macrophage receptor with collagenous structure |
chr17_+_30813576 | 0.30 |
ENST00000313401.3 |
CDK5R1 |
cyclin-dependent kinase 5, regulatory subunit 1 (p35) |
chr5_+_66124590 | 0.29 |
ENST00000490016.2 ENST00000403666.1 ENST00000450827.1 |
MAST4 |
microtubule associated serine/threonine kinase family member 4 |
chr19_-_44031341 | 0.29 |
ENST00000600651.1 |
ETHE1 |
ethylmalonic encephalopathy 1 |
chr7_-_143956815 | 0.29 |
ENST00000493325.1 |
OR2A7 |
olfactory receptor, family 2, subfamily A, member 7 |
chr19_+_4229495 | 0.29 |
ENST00000221847.5 |
EBI3 |
Epstein-Barr virus induced 3 |
chr11_-_60623437 | 0.29 |
ENST00000332539.4 |
PTGDR2 |
prostaglandin D2 receptor 2 |
chr20_-_62203808 | 0.29 |
ENST00000467148.1 |
HELZ2 |
helicase with zinc finger 2, transcriptional coactivator |
chr2_-_85108164 | 0.29 |
ENST00000409520.2 |
TRABD2A |
TraB domain containing 2A |
chr11_-_67276100 | 0.29 |
ENST00000301488.3 |
CDK2AP2 |
cyclin-dependent kinase 2 associated protein 2 |
chr17_-_7760779 | 0.29 |
ENST00000335155.5 ENST00000575071.1 |
LSMD1 |
LSM domain containing 1 |
chr1_+_44457261 | 0.29 |
ENST00000372318.3 |
CCDC24 |
coiled-coil domain containing 24 |
chr17_-_39942322 | 0.29 |
ENST00000449889.1 ENST00000465293.1 |
JUP |
junction plakoglobin |
chr17_+_9066252 | 0.29 |
ENST00000436734.1 |
NTN1 |
netrin 1 |
chr1_-_151119087 | 0.28 |
ENST00000341697.3 ENST00000368914.3 |
SEMA6C |
sema domain, transmembrane domain (TM), and cytoplasmic domain, (semaphorin) 6C |
chr1_+_152691998 | 0.28 |
ENST00000368775.2 |
C1orf68 |
chromosome 1 open reading frame 68 |
chr20_+_48789121 | 0.28 |
ENST00000411453.1 |
RP11-112L6.4 |
RP11-112L6.4 |
chr9_-_21368075 | 0.28 |
ENST00000449498.1 |
IFNA13 |
interferon, alpha 13 |
chr11_-_67120974 | 0.28 |
ENST00000539074.1 ENST00000312419.3 |
POLD4 |
polymerase (DNA-directed), delta 4, accessory subunit |
chr22_-_20731541 | 0.28 |
ENST00000292729.8 |
USP41 |
ubiquitin specific peptidase 41 |
chr19_-_49015050 | 0.28 |
ENST00000600059.1 |
LMTK3 |
lemur tyrosine kinase 3 |
chr15_-_40633101 | 0.28 |
ENST00000559313.1 |
C15orf52 |
chromosome 15 open reading frame 52 |
chr11_-_64851496 | 0.28 |
ENST00000404147.3 ENST00000275517.3 |
CDCA5 |
cell division cycle associated 5 |
chr11_-_96239990 | 0.27 |
ENST00000511243.2 |
JRKL-AS1 |
JRKL antisense RNA 1 |
chr20_-_36794938 | 0.27 |
ENST00000453095.1 |
TGM2 |
transglutaminase 2 |
chr8_+_71383312 | 0.27 |
ENST00000520259.1 |
RP11-333A23.4 |
RP11-333A23.4 |
chr20_+_35090150 | 0.27 |
ENST00000340491.4 |
DLGAP4 |
discs, large (Drosophila) homolog-associated protein 4 |
chr19_-_44031375 | 0.27 |
ENST00000292147.2 |
ETHE1 |
ethylmalonic encephalopathy 1 |
chr1_+_206643787 | 0.27 |
ENST00000367120.3 |
IKBKE |
inhibitor of kappa light polypeptide gene enhancer in B-cells, kinase epsilon |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 2.8 | GO:0042488 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) |
0.3 | 1.0 | GO:0014028 | notochord formation(GO:0014028) |
0.3 | 0.9 | GO:0019364 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
0.3 | 1.0 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.3 | 0.8 | GO:2001190 | positive regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001190) |
0.2 | 1.9 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
0.2 | 0.7 | GO:0051714 | positive regulation of cytolysis in other organism(GO:0051714) |
0.2 | 0.9 | GO:1904806 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
0.2 | 0.6 | GO:0002894 | positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type II hypersensitivity(GO:0002894) |
0.2 | 1.5 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.2 | 0.5 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
0.2 | 0.5 | GO:0043397 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) regulation of G-protein coupled receptor internalization(GO:1904020) |
0.2 | 0.7 | GO:1990736 | positive regulation of regulation of vascular smooth muscle cell membrane depolarization(GO:1904199) regulation of vascular smooth muscle cell membrane depolarization(GO:1990736) |
0.1 | 0.4 | GO:0033037 | polysaccharide localization(GO:0033037) |
0.1 | 0.7 | GO:0018153 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
0.1 | 0.4 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
0.1 | 0.8 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
0.1 | 0.5 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.1 | 0.8 | GO:0045229 | cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
0.1 | 0.4 | GO:0045083 | negative regulation of interleukin-12 biosynthetic process(GO:0045083) |
0.1 | 0.3 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
0.1 | 0.4 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
0.1 | 0.4 | GO:1990637 | response to prolactin(GO:1990637) |
0.1 | 0.5 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.1 | 0.3 | GO:1904298 | positive regulation of neutrophil degranulation(GO:0043315) cellular response to gravity(GO:0071258) positive regulation of neutrophil activation(GO:1902565) regulation of transcytosis(GO:1904298) positive regulation of transcytosis(GO:1904300) regulation of maternal process involved in parturition(GO:1904301) positive regulation of maternal process involved in parturition(GO:1904303) response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904316) cellular response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904317) |
0.1 | 0.2 | GO:0001300 | chronological cell aging(GO:0001300) |
0.1 | 0.3 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
0.1 | 0.5 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.1 | 0.6 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
0.1 | 0.3 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
0.1 | 0.5 | GO:0051885 | positive regulation of anagen(GO:0051885) |
0.1 | 0.3 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.1 | 0.5 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
0.1 | 0.4 | GO:0061760 | antifungal innate immune response(GO:0061760) |
0.1 | 0.3 | GO:1903572 | regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
0.1 | 0.3 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
0.1 | 0.1 | GO:1900111 | positive regulation of histone H3-K9 dimethylation(GO:1900111) |
0.1 | 0.3 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
0.1 | 0.3 | GO:0048749 | compound eye development(GO:0048749) |
0.1 | 0.3 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.3 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.3 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.1 | 0.2 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.3 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
0.1 | 0.5 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 0.5 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.3 | GO:0010193 | response to ozone(GO:0010193) |
0.1 | 0.3 | GO:1900148 | Schwann cell proliferation involved in axon regeneration(GO:0014011) negative regulation of Schwann cell migration(GO:1900148) regulation of Schwann cell proliferation involved in axon regeneration(GO:1905044) negative regulation of Schwann cell proliferation involved in axon regeneration(GO:1905045) |
0.1 | 0.6 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.1 | 0.6 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) |
0.1 | 0.2 | GO:0032904 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
0.1 | 0.2 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
0.1 | 0.6 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
0.1 | 0.6 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.2 | GO:0045082 | positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
0.1 | 0.2 | GO:0002118 | aggressive behavior(GO:0002118) |
0.1 | 0.7 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.2 | GO:0038162 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) erythropoietin-mediated signaling pathway(GO:0038162) |
0.1 | 0.2 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
0.1 | 0.2 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
0.1 | 0.2 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
0.1 | 0.5 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 0.2 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
0.1 | 0.3 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.4 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 0.4 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 0.2 | GO:0019417 | sulfur oxidation(GO:0019417) |
0.1 | 0.4 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.2 | GO:0006218 | uridine catabolic process(GO:0006218) |
0.0 | 0.1 | GO:0060827 | regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
0.0 | 0.2 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.0 | 0.1 | GO:0045123 | cellular extravasation(GO:0045123) |
0.0 | 0.2 | GO:0032690 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
0.0 | 0.7 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.2 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
0.0 | 0.2 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.0 | 0.2 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.4 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.0 | 0.6 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.0 | GO:0035931 | mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) regulation of aldosterone secretion(GO:2000858) |
0.0 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.0 | 0.1 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
0.0 | 0.3 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
0.0 | 0.0 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.0 | 0.2 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.0 | GO:1904000 | positive regulation of eating behavior(GO:1904000) |
0.0 | 0.1 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
0.0 | 0.2 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.0 | 0.2 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
0.0 | 0.2 | GO:0021538 | proprioception(GO:0019230) epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.0 | 0.1 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
0.0 | 0.1 | GO:1990654 | sebum secreting cell proliferation(GO:1990654) |
0.0 | 0.2 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.0 | 0.3 | GO:0071603 | endothelial cell-cell adhesion(GO:0071603) |
0.0 | 0.2 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.2 | GO:1902045 | negative regulation of Fas signaling pathway(GO:1902045) |
0.0 | 0.2 | GO:0060426 | lung vasculature development(GO:0060426) |
0.0 | 0.2 | GO:0061143 | alveolar primary septum development(GO:0061143) |
0.0 | 0.2 | GO:0030806 | negative regulation of cyclic nucleotide catabolic process(GO:0030806) negative regulation of cAMP catabolic process(GO:0030821) negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.0 | 0.3 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.0 | 0.1 | GO:0070904 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
0.0 | 0.1 | GO:0046102 | inosine metabolic process(GO:0046102) |
0.0 | 0.2 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.2 | GO:1902161 | positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
0.0 | 0.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
0.0 | 0.2 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
0.0 | 0.0 | GO:0032765 | positive regulation of mast cell cytokine production(GO:0032765) |
0.0 | 0.4 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.4 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.2 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.0 | 0.1 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
0.0 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.1 | GO:0006286 | base-excision repair, base-free sugar-phosphate removal(GO:0006286) |
0.0 | 0.1 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
0.0 | 0.1 | GO:1904784 | NLRP1 inflammasome complex assembly(GO:1904784) |
0.0 | 0.1 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.0 | 0.5 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
0.0 | 0.5 | GO:0051969 | regulation of transmission of nerve impulse(GO:0051969) |
0.0 | 0.4 | GO:0045408 | regulation of interleukin-6 biosynthetic process(GO:0045408) |
0.0 | 0.3 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
0.0 | 0.5 | GO:0002029 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
0.0 | 0.1 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
0.0 | 0.2 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.0 | 0.1 | GO:0003147 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) |
0.0 | 0.2 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
0.0 | 0.0 | GO:0030185 | nitric oxide transport(GO:0030185) |
0.0 | 0.1 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.0 | 0.3 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
0.0 | 0.3 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.0 | 0.4 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.0 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.3 | GO:1904327 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
0.0 | 0.3 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.0 | 0.1 | GO:0048003 | synaptic vesicle recycling via endosome(GO:0036466) antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.0 | 0.1 | GO:2000291 | myoblast proliferation(GO:0051450) regulation of myoblast proliferation(GO:2000291) |
0.0 | 0.5 | GO:0071028 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.0 | 0.5 | GO:0061061 | muscle structure development(GO:0061061) |
0.0 | 0.3 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
0.0 | 0.1 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
0.0 | 0.1 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
0.0 | 0.2 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.0 | 0.1 | GO:0048075 | positive regulation of eye pigmentation(GO:0048075) |
0.0 | 0.2 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.1 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) positive regulation of high-density lipoprotein particle clearance(GO:0010983) |
0.0 | 0.1 | GO:1903597 | negative regulation of gap junction assembly(GO:1903597) |
0.0 | 0.8 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.0 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.1 | GO:0036343 | psychomotor behavior(GO:0036343) |
0.0 | 0.6 | GO:0061081 | positive regulation of myeloid leukocyte cytokine production involved in immune response(GO:0061081) |
0.0 | 0.1 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
0.0 | 0.1 | GO:0048690 | modulation by virus of host transcription(GO:0019056) regulation of sprouting of injured axon(GO:0048686) positive regulation of sprouting of injured axon(GO:0048687) regulation of axon extension involved in regeneration(GO:0048690) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
0.0 | 0.2 | GO:0050680 | negative regulation of epithelial cell proliferation(GO:0050680) |
0.0 | 0.2 | GO:0007320 | insemination(GO:0007320) |
0.0 | 0.7 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.3 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
0.0 | 0.1 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
0.0 | 0.1 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.0 | 0.2 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
0.0 | 0.1 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.0 | 0.1 | GO:0042335 | cuticle development(GO:0042335) |
0.0 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.1 | GO:0061034 | olfactory bulb mitral cell layer development(GO:0061034) |
0.0 | 0.2 | GO:0071105 | response to interleukin-11(GO:0071105) |
0.0 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.1 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
0.0 | 0.4 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.0 | 0.1 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.3 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.0 | 0.2 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.2 | GO:0014718 | positive regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014718) |
0.0 | 0.0 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 0.3 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.2 | GO:0051012 | microtubule sliding(GO:0051012) |
0.0 | 0.3 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.0 | 0.1 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
0.0 | 0.1 | GO:0090131 | mesenchyme migration(GO:0090131) |
0.0 | 0.2 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.0 | 0.2 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.0 | 0.2 | GO:0002028 | regulation of sodium ion transport(GO:0002028) |
0.0 | 0.1 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
0.0 | 0.3 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.7 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
0.0 | 0.3 | GO:0015816 | glycine transport(GO:0015816) |
0.0 | 0.3 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.2 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.1 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
0.0 | 0.1 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.0 | 0.4 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.0 | 0.4 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.2 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
0.0 | 0.1 | GO:0090467 | L-arginine import(GO:0043091) arginine import(GO:0090467) |
0.0 | 0.2 | GO:2000544 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
0.0 | 0.1 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.0 | 0.2 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
0.0 | 0.1 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.0 | 0.2 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.2 | GO:0042797 | 5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
0.0 | 0.1 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.2 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.0 | 0.1 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
0.0 | 0.3 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
0.0 | 0.2 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 1.3 | GO:0035082 | axoneme assembly(GO:0035082) |
0.0 | 0.1 | GO:0043318 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) negative regulation of natural killer cell mediated immune response to tumor cell(GO:0002856) negative regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002859) regulation of cytotoxic T cell degranulation(GO:0043317) negative regulation of cytotoxic T cell degranulation(GO:0043318) |
0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.2 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.0 | 0.1 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
0.0 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.2 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.0 | 0.2 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.0 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.3 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.1 | GO:0051958 | methotrexate transport(GO:0051958) |
0.0 | 0.1 | GO:0007635 | chemosensory behavior(GO:0007635) |
0.0 | 0.2 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.1 | GO:0043383 | negative T cell selection(GO:0043383) |
0.0 | 0.1 | GO:0031337 | cellular response to phosphate starvation(GO:0016036) positive regulation of sulfur amino acid metabolic process(GO:0031337) positive regulation of homocysteine metabolic process(GO:0050668) |
0.0 | 0.9 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.4 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.0 | 0.1 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.0 | 0.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.0 | 0.8 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
0.0 | 0.2 | GO:0008595 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
0.0 | 0.5 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.0 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
0.0 | 0.3 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.0 | 0.3 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.1 | GO:0045667 | regulation of osteoblast differentiation(GO:0045667) |
0.0 | 0.3 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.2 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.2 | GO:0034201 | response to oleic acid(GO:0034201) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.0 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
0.0 | 0.2 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
0.0 | 0.0 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.5 | GO:0006884 | cell volume homeostasis(GO:0006884) |
0.0 | 0.1 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
0.0 | 0.2 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.0 | 0.1 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.0 | 0.4 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
0.0 | 0.1 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
0.0 | 0.1 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.0 | 0.2 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
0.0 | 0.1 | GO:0061591 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.0 | 0.2 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.4 | GO:0014059 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.0 | 0.1 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
0.0 | 0.1 | GO:0019075 | virus maturation(GO:0019075) |
0.0 | 0.2 | GO:0006069 | ethanol oxidation(GO:0006069) |
0.0 | 0.1 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.1 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.1 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
0.0 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.2 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.0 | 0.0 | GO:0050893 | sensory processing(GO:0050893) |
0.0 | 0.2 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.1 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
0.0 | 0.0 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
0.0 | 0.4 | GO:0006825 | copper ion transport(GO:0006825) |
0.0 | 0.1 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.0 | 0.1 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.0 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.0 | 0.1 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.0 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.1 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
0.0 | 0.0 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.0 | 0.1 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.0 | 0.1 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
0.0 | 0.3 | GO:0051930 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.1 | GO:0042048 | olfactory behavior(GO:0042048) |
0.0 | 0.3 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.0 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
0.0 | 0.1 | GO:0042531 | positive regulation of tyrosine phosphorylation of STAT protein(GO:0042531) |
0.0 | 0.1 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.0 | 0.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.0 | GO:0031280 | negative regulation of cyclase activity(GO:0031280) |
0.0 | 0.0 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.0 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.4 | GO:0005584 | collagen type I trimer(GO:0005584) |
0.1 | 0.9 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
0.1 | 0.4 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
0.1 | 0.5 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.3 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
0.1 | 0.3 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
0.1 | 0.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.1 | 0.3 | GO:0071665 | gamma-catenin-TCF7L2 complex(GO:0071665) |
0.1 | 0.3 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 0.5 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.1 | 0.2 | GO:0072563 | endothelial microparticle(GO:0072563) |
0.1 | 0.5 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.8 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.3 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.6 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 1.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.3 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.1 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.3 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.0 | 0.4 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.3 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
0.0 | 0.5 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.3 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 1.8 | GO:0005605 | basal lamina(GO:0005605) |
0.0 | 0.5 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 1.1 | GO:0044447 | axoneme part(GO:0044447) |
0.0 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.1 | GO:0020005 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
0.0 | 4.0 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.2 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.3 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
0.0 | 0.2 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
0.0 | 0.3 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.7 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 0.3 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.1 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.0 | 0.2 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.1 | GO:0031085 | BLOC-3 complex(GO:0031085) |
0.0 | 1.4 | GO:0001533 | cornified envelope(GO:0001533) |
0.0 | 0.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.2 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.1 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 1.0 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.1 | GO:0016013 | syntrophin complex(GO:0016013) |
0.0 | 0.3 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 0.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.4 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.2 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.4 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.1 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.1 | GO:0097486 | multivesicular body lumen(GO:0097486) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.1 | GO:0031905 | early endosome lumen(GO:0031905) |
0.0 | 0.1 | GO:0035976 | AP1 complex(GO:0035976) |
0.0 | 0.2 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
0.0 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.2 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.1 | GO:0032010 | phagolysosome(GO:0032010) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.0 | GO:0043614 | multi-eIF complex(GO:0043614) |
0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.2 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.0 | 0.3 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.2 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.0 | 1.6 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.0 | GO:0070877 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.0 | GO:0015067 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
0.2 | 0.7 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
0.2 | 0.5 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
0.1 | 0.4 | GO:0050577 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
0.1 | 0.5 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.1 | 1.3 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.1 | 0.4 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
0.1 | 0.3 | GO:0071633 | dihydroceramidase activity(GO:0071633) |
0.1 | 0.3 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
0.1 | 0.3 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
0.1 | 0.5 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
0.1 | 0.7 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 0.4 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
0.1 | 0.6 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 0.2 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.1 | 0.4 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
0.1 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.1 | 0.2 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
0.1 | 0.5 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
0.1 | 0.6 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.1 | 0.3 | GO:0005199 | structural constituent of cell wall(GO:0005199) |
0.1 | 0.2 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
0.1 | 0.6 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.1 | 1.6 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.1 | 0.5 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
0.1 | 0.7 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.1 | 0.5 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
0.1 | 0.2 | GO:0050698 | proteoglycan sulfotransferase activity(GO:0050698) |
0.1 | 2.6 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.6 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.2 | GO:0005046 | KDEL sequence binding(GO:0005046) |
0.1 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 1.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 0.5 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.3 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 0.3 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 0.2 | GO:1902379 | receptor tyrosine kinase-like orphan receptor binding(GO:0005115) chemoattractant activity involved in axon guidance(GO:1902379) |
0.1 | 0.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) K48-linked polyubiquitin binding(GO:0036435) |
0.1 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.1 | 0.3 | GO:0050436 | microfibril binding(GO:0050436) |
0.1 | 0.4 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.0 | 0.3 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
0.0 | 0.6 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.0 | 0.5 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.3 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.0 | 0.2 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.0 | 0.3 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
0.0 | 0.3 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.4 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.4 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
0.0 | 0.1 | GO:0070890 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
0.0 | 0.2 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
0.0 | 0.5 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.2 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
0.0 | 0.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.0 | 0.1 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.1 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
0.0 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.4 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.9 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.3 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.2 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.6 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.0 | 0.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.3 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.2 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 0.4 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.1 | GO:0034602 | oxoglutarate dehydrogenase (NAD+) activity(GO:0034602) |
0.0 | 0.1 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
0.0 | 0.2 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.1 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
0.0 | 0.9 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.0 | 0.1 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
0.0 | 1.6 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.9 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.8 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.6 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.1 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
0.0 | 0.1 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.0 | 0.2 | GO:0042806 | fucose binding(GO:0042806) |
0.0 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.0 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.2 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.5 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.8 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.6 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.0 | 0.8 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.1 | GO:0061714 | folic acid receptor activity(GO:0061714) |
0.0 | 0.1 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
0.0 | 0.6 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.0 | 0.1 | GO:0047006 | 17-alpha,20-alpha-dihydroxypregn-4-en-3-one dehydrogenase activity(GO:0047006) |
0.0 | 0.4 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.4 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.3 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 0.0 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
0.0 | 0.1 | GO:0019956 | chemokine binding(GO:0019956) |
0.0 | 0.5 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.6 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.1 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.1 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
0.0 | 0.2 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.1 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.1 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.0 | 0.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.8 | GO:0004984 | olfactory receptor activity(GO:0004984) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.1 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.0 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.0 | 0.4 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.1 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.0 | 0.2 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.1 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.0 | 0.1 | GO:0004797 | deoxycytidine kinase activity(GO:0004137) thymidine kinase activity(GO:0004797) |
0.0 | 0.3 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.3 | GO:0016918 | retinal binding(GO:0016918) |
0.0 | 0.4 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.2 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.1 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
0.0 | 0.4 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.0 | GO:0001156 | TFIIIC-class transcription factor binding(GO:0001156) |
0.0 | 0.4 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.7 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.2 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.1 | GO:0052591 | sn-glycerol-3-phosphate:ubiquinone oxidoreductase activity(GO:0052590) sn-glycerol-3-phosphate:ubiquinone-8 oxidoreductase activity(GO:0052591) |
0.0 | 0.2 | GO:0004465 | lipoprotein lipase activity(GO:0004465) |
0.0 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.5 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.6 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.9 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 0.1 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.0 | 0.1 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.3 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 1.0 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.1 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
0.0 | 0.1 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
0.0 | 0.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.2 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.5 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.1 | GO:0050682 | AF-2 domain binding(GO:0050682) |
0.0 | 0.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.0 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.1 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 0.5 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.4 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.0 | 1.3 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 1.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 1.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 1.1 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.5 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.9 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.6 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.7 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.3 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.2 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.4 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.6 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.2 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.4 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 2.4 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.2 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.4 | PID FGF PATHWAY | FGF signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.4 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 0.2 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 1.2 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.0 | 0.7 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.7 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.5 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.3 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.0 | 0.8 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 1.1 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.5 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.3 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.6 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.3 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.5 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.3 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.4 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.5 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.6 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.7 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.6 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.8 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.7 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.6 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.4 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.0 | 0.5 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.3 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.2 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.3 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.3 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.4 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.3 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.5 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |