NHBE cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
IKZF1
|
ENSG00000185811.12 | IKAROS family zinc finger 1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| IKZF1 | hg19_v2_chr7_+_50344289_50344378 | -0.10 | 8.5e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr17_+_38171681 | 3.35 |
ENST00000225474.2
ENST00000331769.2 ENST00000394148.3 ENST00000577675.1 |
CSF3
|
colony stimulating factor 3 (granulocyte) |
| chr2_+_113735575 | 3.08 |
ENST00000376489.2
ENST00000259205.4 |
IL36G
|
interleukin 36, gamma |
| chr1_-_153066998 | 2.88 |
ENST00000368750.3
|
SPRR2E
|
small proline-rich protein 2E |
| chr21_+_42798094 | 2.79 |
ENST00000398598.3
ENST00000455164.2 ENST00000424365.1 |
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr17_+_38171614 | 2.57 |
ENST00000583218.1
ENST00000394149.3 |
CSF3
|
colony stimulating factor 3 (granulocyte) |
| chr5_+_131409476 | 2.50 |
ENST00000296871.2
|
CSF2
|
colony stimulating factor 2 (granulocyte-macrophage) |
| chr4_-_74864386 | 2.44 |
ENST00000296027.4
|
CXCL5
|
chemokine (C-X-C motif) ligand 5 |
| chr1_-_153113927 | 2.34 |
ENST00000368752.4
|
SPRR2B
|
small proline-rich protein 2B |
| chr12_-_53242770 | 2.32 |
ENST00000304620.4
ENST00000547110.1 |
KRT78
|
keratin 78 |
| chr12_+_113354341 | 2.22 |
ENST00000553152.1
|
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr20_+_44637526 | 2.16 |
ENST00000372330.3
|
MMP9
|
matrix metallopeptidase 9 (gelatinase B, 92kDa gelatinase, 92kDa type IV collagenase) |
| chr16_+_3115378 | 2.12 |
ENST00000529550.1
ENST00000551122.1 ENST00000525643.2 ENST00000548807.1 ENST00000528163.2 |
IL32
|
interleukin 32 |
| chr9_-_33402506 | 1.96 |
ENST00000377425.4
ENST00000537089.1 ENST00000297988.1 ENST00000539936.1 ENST00000541274.1 |
AQP7
|
aquaporin 7 |
| chr2_+_228678550 | 1.92 |
ENST00000409189.3
ENST00000358813.4 |
CCL20
|
chemokine (C-C motif) ligand 20 |
| chr21_+_42798124 | 1.90 |
ENST00000417963.1
|
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr16_+_3115323 | 1.83 |
ENST00000531965.1
ENST00000396887.3 ENST00000529699.1 ENST00000526464.2 ENST00000440815.3 |
IL32
|
interleukin 32 |
| chr11_-_9482010 | 1.78 |
ENST00000596206.1
|
AC132192.1
|
LOC644656 protein; Uncharacterized protein |
| chr22_-_50970506 | 1.73 |
ENST00000428989.2
ENST00000403326.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr12_+_113376157 | 1.68 |
ENST00000228928.7
|
OAS3
|
2'-5'-oligoadenylate synthetase 3, 100kDa |
| chr10_-_135090338 | 1.66 |
ENST00000415217.3
|
ADAM8
|
ADAM metallopeptidase domain 8 |
| chr16_+_3115298 | 1.66 |
ENST00000325568.5
ENST00000534507.1 |
IL32
|
interleukin 32 |
| chr7_+_22766766 | 1.65 |
ENST00000426291.1
ENST00000401651.1 ENST00000258743.5 ENST00000420258.2 ENST00000407492.1 ENST00000401630.3 ENST00000406575.1 |
IL6
|
interleukin 6 (interferon, beta 2) |
| chr15_-_90039805 | 1.65 |
ENST00000544600.1
ENST00000268122.4 |
RHCG
|
Rh family, C glycoprotein |
| chr4_+_74702214 | 1.62 |
ENST00000226317.5
ENST00000515050.1 |
CXCL6
|
chemokine (C-X-C motif) ligand 6 |
| chr4_+_74735102 | 1.61 |
ENST00000395761.3
|
CXCL1
|
chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha) |
| chr6_-_160114260 | 1.54 |
ENST00000367054.2
ENST00000367055.4 ENST00000444946.2 ENST00000452684.2 |
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr19_+_1041187 | 1.54 |
ENST00000531467.1
|
ABCA7
|
ATP-binding cassette, sub-family A (ABC1), member 7 |
| chr17_+_48351785 | 1.54 |
ENST00000507382.1
|
TMEM92
|
transmembrane protein 92 |
| chr12_-_25150373 | 1.54 |
ENST00000549828.1
|
C12orf77
|
chromosome 12 open reading frame 77 |
| chr11_-_105010320 | 1.52 |
ENST00000532895.1
ENST00000530950.1 |
CARD18
|
caspase recruitment domain family, member 18 |
| chr5_-_150460914 | 1.52 |
ENST00000389378.2
|
TNIP1
|
TNFAIP3 interacting protein 1 |
| chr1_-_27998689 | 1.50 |
ENST00000339145.4
ENST00000362020.4 ENST00000361157.6 |
IFI6
|
interferon, alpha-inducible protein 6 |
| chr6_-_31550192 | 1.49 |
ENST00000429299.2
ENST00000446745.2 |
LTB
|
lymphotoxin beta (TNF superfamily, member 3) |
| chr17_+_41158742 | 1.48 |
ENST00000415816.2
ENST00000438323.2 |
IFI35
|
interferon-induced protein 35 |
| chr11_+_118826999 | 1.48 |
ENST00000264031.2
|
UPK2
|
uroplakin 2 |
| chr19_+_56652643 | 1.48 |
ENST00000586123.1
|
ZNF444
|
zinc finger protein 444 |
| chr17_-_42994283 | 1.47 |
ENST00000593179.1
|
GFAP
|
glial fibrillary acidic protein |
| chrX_-_48937684 | 1.47 |
ENST00000465382.1
ENST00000423215.2 |
WDR45
|
WD repeat domain 45 |
| chr11_+_308143 | 1.45 |
ENST00000399817.4
|
IFITM2
|
interferon induced transmembrane protein 2 |
| chr12_-_7245125 | 1.45 |
ENST00000542285.1
ENST00000540610.1 |
C1R
|
complement component 1, r subcomponent |
| chr22_-_50970566 | 1.43 |
ENST00000405135.1
ENST00000401779.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr11_-_321340 | 1.41 |
ENST00000526811.1
|
IFITM3
|
interferon induced transmembrane protein 3 |
| chr11_-_57194817 | 1.41 |
ENST00000529748.1
ENST00000525474.1 |
SLC43A3
|
solute carrier family 43, member 3 |
| chr19_-_43835582 | 1.39 |
ENST00000595748.1
|
CTC-490G23.2
|
CTC-490G23.2 |
| chr1_+_153330322 | 1.39 |
ENST00000368738.3
|
S100A9
|
S100 calcium binding protein A9 |
| chr19_-_42192189 | 1.38 |
ENST00000401731.1
ENST00000338196.4 ENST00000006724.3 |
CEACAM7
|
carcinoembryonic antigen-related cell adhesion molecule 7 |
| chr16_+_4845379 | 1.37 |
ENST00000588606.1
ENST00000586005.1 |
SMIM22
|
small integral membrane protein 22 |
| chr1_-_153013588 | 1.36 |
ENST00000360379.3
|
SPRR2D
|
small proline-rich protein 2D |
| chr21_+_42792442 | 1.36 |
ENST00000398600.2
|
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr6_+_31916733 | 1.34 |
ENST00000483004.1
|
CFB
|
complement factor B |
| chr11_-_18258342 | 1.34 |
ENST00000278222.4
|
SAA4
|
serum amyloid A4, constitutive |
| chr17_+_67759813 | 1.34 |
ENST00000587241.1
|
AC003051.1
|
AC003051.1 |
| chr1_-_235098935 | 1.33 |
ENST00000423175.1
|
RP11-443B7.1
|
RP11-443B7.1 |
| chr20_+_62185491 | 1.33 |
ENST00000370097.1
|
C20orf195
|
chromosome 20 open reading frame 195 |
| chr11_+_18154059 | 1.31 |
ENST00000531264.1
|
MRGPRX3
|
MAS-related GPR, member X3 |
| chr5_-_150467221 | 1.31 |
ENST00000522226.1
|
TNIP1
|
TNFAIP3 interacting protein 1 |
| chr21_+_42797958 | 1.30 |
ENST00000419044.1
|
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr19_-_6720686 | 1.29 |
ENST00000245907.6
|
C3
|
complement component 3 |
| chr21_+_42733870 | 1.28 |
ENST00000330714.3
ENST00000436410.1 ENST00000435611.1 |
MX2
|
myxovirus (influenza virus) resistance 2 (mouse) |
| chr11_+_93754513 | 1.27 |
ENST00000315765.9
|
HEPHL1
|
hephaestin-like 1 |
| chr16_+_58535372 | 1.27 |
ENST00000566656.1
ENST00000566618.1 |
NDRG4
|
NDRG family member 4 |
| chr17_-_79304150 | 1.27 |
ENST00000574093.1
|
TMEM105
|
transmembrane protein 105 |
| chr16_+_811073 | 1.27 |
ENST00000382862.3
ENST00000563651.1 |
MSLN
|
mesothelin |
| chr22_+_38609538 | 1.25 |
ENST00000407965.1
|
MAFF
|
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog F |
| chr10_-_46342675 | 1.24 |
ENST00000492347.1
|
AGAP4
|
ArfGAP with GTPase domain, ankyrin repeat and PH domain 4 |
| chr4_-_74904398 | 1.22 |
ENST00000296026.4
|
CXCL3
|
chemokine (C-X-C motif) ligand 3 |
| chr17_-_77925806 | 1.22 |
ENST00000574241.2
|
TBC1D16
|
TBC1 domain family, member 16 |
| chr19_+_36239576 | 1.21 |
ENST00000587751.1
|
LIN37
|
lin-37 homolog (C. elegans) |
| chr6_-_133035185 | 1.20 |
ENST00000367928.4
|
VNN1
|
vanin 1 |
| chr8_-_11324273 | 1.19 |
ENST00000284486.4
|
FAM167A
|
family with sequence similarity 167, member A |
| chr1_-_54518865 | 1.18 |
ENST00000371337.3
|
TMEM59
|
transmembrane protein 59 |
| chr12_-_7245018 | 1.18 |
ENST00000543835.1
ENST00000535233.2 |
C1R
|
complement component 1, r subcomponent |
| chr1_-_153321301 | 1.17 |
ENST00000368739.3
|
PGLYRP4
|
peptidoglycan recognition protein 4 |
| chr11_+_65687158 | 1.17 |
ENST00000532933.1
|
DRAP1
|
DR1-associated protein 1 (negative cofactor 2 alpha) |
| chr19_+_46732988 | 1.16 |
ENST00000437936.1
|
IGFL1
|
IGF-like family member 1 |
| chr16_+_3115611 | 1.16 |
ENST00000530890.1
ENST00000444393.3 ENST00000533097.2 ENST00000008180.9 ENST00000396890.2 ENST00000525228.1 ENST00000548652.1 ENST00000525377.2 ENST00000530538.2 ENST00000549213.1 ENST00000552936.1 ENST00000548476.1 ENST00000552664.1 ENST00000552356.1 ENST00000551513.1 ENST00000382213.3 ENST00000548246.1 |
IL32
|
interleukin 32 |
| chr11_+_810221 | 1.16 |
ENST00000530398.1
|
RPLP2
|
ribosomal protein, large, P2 |
| chr3_-_39196049 | 1.15 |
ENST00000514182.1
|
CSRNP1
|
cysteine-serine-rich nuclear protein 1 |
| chr12_-_7245080 | 1.15 |
ENST00000541042.1
ENST00000540242.1 |
C1R
|
complement component 1, r subcomponent |
| chr11_+_69061594 | 1.14 |
ENST00000441339.2
ENST00000308946.3 ENST00000535407.1 |
MYEOV
|
myeloma overexpressed |
| chr10_-_135090360 | 1.13 |
ENST00000486609.1
ENST00000445355.3 ENST00000485491.2 |
ADAM8
|
ADAM metallopeptidase domain 8 |
| chr11_-_47270341 | 1.13 |
ENST00000529444.1
ENST00000530453.1 ENST00000537863.1 ENST00000529788.1 ENST00000444355.2 ENST00000527256.1 ENST00000529663.1 ENST00000256997.3 |
ACP2
|
acid phosphatase 2, lysosomal |
| chr1_+_37947257 | 1.13 |
ENST00000471012.1
|
ZC3H12A
|
zinc finger CCCH-type containing 12A |
| chr19_-_6690723 | 1.12 |
ENST00000601008.1
|
C3
|
complement component 3 |
| chr1_-_47655686 | 1.10 |
ENST00000294338.2
|
PDZK1IP1
|
PDZK1 interacting protein 1 |
| chr15_-_71184724 | 1.10 |
ENST00000560604.1
|
THAP10
|
THAP domain containing 10 |
| chr11_+_107650219 | 1.10 |
ENST00000398067.1
|
AP001024.1
|
Uncharacterized protein |
| chrX_+_115567767 | 1.09 |
ENST00000371900.4
|
SLC6A14
|
solute carrier family 6 (amino acid transporter), member 14 |
| chr14_+_95078714 | 1.09 |
ENST00000393078.3
ENST00000393080.4 ENST00000467132.1 |
SERPINA3
|
serpin peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 3 |
| chr22_+_31488433 | 1.09 |
ENST00000455608.1
|
SMTN
|
smoothelin |
| chr15_+_31658349 | 1.08 |
ENST00000558844.1
|
KLF13
|
Kruppel-like factor 13 |
| chr20_+_43803517 | 1.07 |
ENST00000243924.3
|
PI3
|
peptidase inhibitor 3, skin-derived |
| chr12_+_113376249 | 1.07 |
ENST00000551007.1
ENST00000548514.1 |
OAS3
|
2'-5'-oligoadenylate synthetase 3, 100kDa |
| chr2_-_203735484 | 1.07 |
ENST00000420558.1
ENST00000418208.1 |
ICA1L
|
islet cell autoantigen 1,69kDa-like |
| chr1_+_35247859 | 1.07 |
ENST00000373362.3
|
GJB3
|
gap junction protein, beta 3, 31kDa |
| chr15_-_74284558 | 1.07 |
ENST00000359750.4
ENST00000541638.1 ENST00000562453.1 |
STOML1
|
stomatin (EPB72)-like 1 |
| chr1_+_153004800 | 1.06 |
ENST00000392661.3
|
SPRR1B
|
small proline-rich protein 1B |
| chr19_-_48673552 | 1.06 |
ENST00000536218.1
ENST00000596549.1 |
LIG1
|
ligase I, DNA, ATP-dependent |
| chr19_+_44084696 | 1.06 |
ENST00000562255.1
ENST00000569031.2 |
PINLYP
|
phospholipase A2 inhibitor and LY6/PLAUR domain containing |
| chr5_-_150460539 | 1.05 |
ENST00000520931.1
ENST00000520695.1 ENST00000521591.1 ENST00000518977.1 |
TNIP1
|
TNFAIP3 interacting protein 1 |
| chr22_+_38203898 | 1.05 |
ENST00000323205.6
ENST00000248924.6 ENST00000445195.1 |
GCAT
|
glycine C-acetyltransferase |
| chrX_+_47441712 | 1.05 |
ENST00000218388.4
ENST00000377018.2 ENST00000456754.2 ENST00000377017.1 ENST00000441738.1 |
TIMP1
|
TIMP metallopeptidase inhibitor 1 |
| chr19_+_54372877 | 1.04 |
ENST00000414489.1
|
MYADM
|
myeloid-associated differentiation marker |
| chr17_-_45918539 | 1.03 |
ENST00000584123.1
ENST00000578323.1 ENST00000407215.3 ENST00000290216.9 |
SCRN2
|
secernin 2 |
| chr4_-_189030422 | 1.03 |
ENST00000536972.1
|
TRIML2
|
tripartite motif family-like 2 |
| chr1_+_79086088 | 1.03 |
ENST00000370751.5
ENST00000342282.3 |
IFI44L
|
interferon-induced protein 44-like |
| chr11_+_308217 | 1.03 |
ENST00000602569.1
|
IFITM2
|
interferon induced transmembrane protein 2 |
| chr19_-_46627914 | 1.02 |
ENST00000341415.2
|
IGFL3
|
IGF-like family member 3 |
| chr12_+_7167980 | 1.02 |
ENST00000360817.5
ENST00000402681.3 |
C1S
|
complement component 1, s subcomponent |
| chr11_-_321050 | 1.02 |
ENST00000399808.4
|
IFITM3
|
interferon induced transmembrane protein 3 |
| chr16_+_89988259 | 1.01 |
ENST00000554444.1
ENST00000556565.1 |
TUBB3
|
Tubulin beta-3 chain |
| chr17_+_57274914 | 1.01 |
ENST00000582004.1
ENST00000577660.1 |
PRR11
CTD-2510F5.6
|
proline rich 11 Uncharacterized protein |
| chr15_+_96897466 | 1.00 |
ENST00000558382.1
ENST00000558499.1 |
RP11-522B15.3
|
RP11-522B15.3 |
| chr8_+_72755367 | 1.00 |
ENST00000537896.1
|
RP11-383H13.1
|
Protein LOC100132891; cDNA FLJ53548 |
| chr22_-_30642728 | 1.00 |
ENST00000403987.3
|
LIF
|
leukemia inhibitory factor |
| chr19_+_16607122 | 1.00 |
ENST00000221671.3
ENST00000594035.1 ENST00000599550.1 ENST00000594813.1 |
C19orf44
|
chromosome 19 open reading frame 44 |
| chr17_-_65992544 | 1.00 |
ENST00000580729.1
|
RP11-855A2.5
|
RP11-855A2.5 |
| chr17_+_77018896 | 0.99 |
ENST00000578229.1
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr19_-_50990785 | 0.99 |
ENST00000595005.1
|
CTD-2545M3.8
|
CTD-2545M3.8 |
| chr11_-_64646086 | 0.99 |
ENST00000320631.3
|
EHD1
|
EH-domain containing 1 |
| chr12_-_80084333 | 0.98 |
ENST00000552637.1
|
PAWR
|
PRKC, apoptosis, WT1, regulator |
| chr14_-_24804269 | 0.98 |
ENST00000310677.4
ENST00000554068.2 ENST00000559167.1 ENST00000561138.1 |
ADCY4
|
adenylate cyclase 4 |
| chr12_+_113416191 | 0.98 |
ENST00000342315.4
ENST00000392583.2 |
OAS2
|
2'-5'-oligoadenylate synthetase 2, 69/71kDa |
| chr1_+_152881014 | 0.98 |
ENST00000368764.3
ENST00000392667.2 |
IVL
|
involucrin |
| chr17_-_36997708 | 0.98 |
ENST00000398575.4
|
C17orf98
|
chromosome 17 open reading frame 98 |
| chr22_+_39868786 | 0.98 |
ENST00000429402.1
|
MGAT3
|
mannosyl (beta-1,4-)-glycoprotein beta-1,4-N-acetylglucosaminyltransferase |
| chr1_-_153085984 | 0.97 |
ENST00000468739.1
|
SPRR2F
|
small proline-rich protein 2F |
| chr6_+_33043703 | 0.97 |
ENST00000418931.2
ENST00000535465.1 |
HLA-DPB1
|
major histocompatibility complex, class II, DP beta 1 |
| chr16_-_29934558 | 0.95 |
ENST00000568995.1
ENST00000566413.1 |
KCTD13
|
potassium channel tetramerization domain containing 13 |
| chr11_-_795286 | 0.95 |
ENST00000533385.1
ENST00000527723.1 |
SLC25A22
|
solute carrier family 25 (mitochondrial carrier: glutamate), member 22 |
| chr6_-_160148356 | 0.94 |
ENST00000401980.3
ENST00000545162.1 |
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr14_+_55590646 | 0.94 |
ENST00000553493.1
|
LGALS3
|
lectin, galactoside-binding, soluble, 3 |
| chr11_+_64692143 | 0.94 |
ENST00000164133.2
ENST00000532850.1 |
PPP2R5B
|
protein phosphatase 2, regulatory subunit B', beta |
| chr11_-_57194550 | 0.94 |
ENST00000528187.1
ENST00000524863.1 ENST00000533051.1 ENST00000529494.1 ENST00000395124.1 ENST00000533524.1 ENST00000533245.1 ENST00000530316.1 |
SLC43A3
|
solute carrier family 43, member 3 |
| chr6_-_30712313 | 0.93 |
ENST00000376377.2
ENST00000259874.5 |
IER3
|
immediate early response 3 |
| chr19_+_7745708 | 0.93 |
ENST00000596148.1
ENST00000317378.5 ENST00000426877.2 |
TRAPPC5
|
trafficking protein particle complex 5 |
| chr11_+_313503 | 0.93 |
ENST00000528780.1
ENST00000328221.5 |
IFITM1
|
interferon induced transmembrane protein 1 |
| chr14_-_90097910 | 0.92 |
ENST00000550332.2
|
RP11-944C7.1
|
Protein LOC100506792 |
| chr1_-_155948890 | 0.92 |
ENST00000471589.1
|
ARHGEF2
|
Rho/Rac guanine nucleotide exchange factor (GEF) 2 |
| chr7_-_105926058 | 0.91 |
ENST00000417537.1
|
NAMPT
|
nicotinamide phosphoribosyltransferase |
| chr7_+_76054224 | 0.91 |
ENST00000394857.3
|
ZP3
|
zona pellucida glycoprotein 3 (sperm receptor) |
| chr19_+_49055332 | 0.91 |
ENST00000201586.2
|
SULT2B1
|
sulfotransferase family, cytosolic, 2B, member 1 |
| chr14_+_104177607 | 0.91 |
ENST00000429169.1
|
AL049840.1
|
Uncharacterized protein; cDNA FLJ53535 |
| chr22_-_50700140 | 0.91 |
ENST00000215659.8
|
MAPK12
|
mitogen-activated protein kinase 12 |
| chr17_+_38119216 | 0.91 |
ENST00000301659.4
|
GSDMA
|
gasdermin A |
| chr6_+_32132360 | 0.90 |
ENST00000333845.6
ENST00000395512.1 ENST00000432129.1 |
EGFL8
|
EGF-like-domain, multiple 8 |
| chr17_+_6659354 | 0.90 |
ENST00000574907.1
|
XAF1
|
XIAP associated factor 1 |
| chr20_-_6034672 | 0.89 |
ENST00000378858.4
|
LRRN4
|
leucine rich repeat neuronal 4 |
| chr17_+_77019030 | 0.89 |
ENST00000580454.1
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr11_-_18270182 | 0.89 |
ENST00000528349.1
ENST00000526900.1 ENST00000529528.1 ENST00000414546.2 ENST00000256733.4 |
SAA2
|
serum amyloid A2 |
| chr17_-_6616678 | 0.89 |
ENST00000381074.4
ENST00000293800.6 ENST00000572352.1 ENST00000576323.1 ENST00000573648.1 |
SLC13A5
|
solute carrier family 13 (sodium-dependent citrate transporter), member 5 |
| chr12_-_7281469 | 0.88 |
ENST00000542370.1
ENST00000266560.3 |
RBP5
|
retinol binding protein 5, cellular |
| chr8_-_144099795 | 0.87 |
ENST00000522060.1
ENST00000517833.1 ENST00000502167.2 ENST00000518831.1 |
RP11-273G15.2
|
RP11-273G15.2 |
| chr2_-_241396131 | 0.87 |
ENST00000404327.3
|
AC110619.2
|
Uncharacterized protein |
| chr8_-_74884511 | 0.87 |
ENST00000518127.1
|
TCEB1
|
transcription elongation factor B (SIII), polypeptide 1 (15kDa, elongin C) |
| chr14_+_105266933 | 0.86 |
ENST00000555360.1
|
ZBTB42
|
zinc finger and BTB domain containing 42 |
| chr1_-_152386732 | 0.86 |
ENST00000271835.3
|
CRNN
|
cornulin |
| chr11_-_615942 | 0.86 |
ENST00000397562.3
ENST00000330243.5 ENST00000397570.1 ENST00000397574.2 |
IRF7
|
interferon regulatory factor 7 |
| chr16_-_66586365 | 0.86 |
ENST00000562484.2
|
TK2
|
thymidine kinase 2, mitochondrial |
| chr1_-_151138422 | 0.86 |
ENST00000440902.2
|
LYSMD1
|
LysM, putative peptidoglycan-binding, domain containing 1 |
| chr1_+_113392455 | 0.86 |
ENST00000456651.1
ENST00000422022.1 |
RP3-522D1.1
|
RP3-522D1.1 |
| chr14_+_24630465 | 0.85 |
ENST00000557894.1
ENST00000559284.1 ENST00000560275.1 |
IRF9
|
interferon regulatory factor 9 |
| chr22_-_31536480 | 0.85 |
ENST00000215885.3
|
PLA2G3
|
phospholipase A2, group III |
| chr19_-_2085323 | 0.85 |
ENST00000591638.1
|
MOB3A
|
MOB kinase activator 3A |
| chr21_+_42798158 | 0.84 |
ENST00000441677.1
|
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr19_+_45445491 | 0.84 |
ENST00000592954.1
ENST00000419266.2 ENST00000589057.1 |
APOC4
APOC4-APOC2
|
apolipoprotein C-IV APOC4-APOC2 readthrough (NMD candidate) |
| chr16_-_2770216 | 0.84 |
ENST00000302641.3
|
PRSS27
|
protease, serine 27 |
| chr16_-_2004683 | 0.83 |
ENST00000268661.7
|
RPL3L
|
ribosomal protein L3-like |
| chr1_-_153044083 | 0.83 |
ENST00000341611.2
|
SPRR2B
|
small proline-rich protein 2B |
| chr6_-_32812420 | 0.83 |
ENST00000374881.2
|
PSMB8
|
proteasome (prosome, macropain) subunit, beta type, 8 |
| chr17_-_17399701 | 0.83 |
ENST00000225688.3
ENST00000579152.1 |
RASD1
|
RAS, dexamethasone-induced 1 |
| chr17_+_67590125 | 0.83 |
ENST00000591334.1
|
AC003051.1
|
AC003051.1 |
| chr11_-_45928830 | 0.82 |
ENST00000449465.1
|
C11orf94
|
chromosome 11 open reading frame 94 |
| chr11_+_64004888 | 0.82 |
ENST00000541681.1
|
VEGFB
|
vascular endothelial growth factor B |
| chr5_+_35856951 | 0.81 |
ENST00000303115.3
ENST00000343305.4 ENST00000506850.1 ENST00000511982.1 |
IL7R
|
interleukin 7 receptor |
| chr4_+_57371509 | 0.81 |
ENST00000360096.2
|
ARL9
|
ADP-ribosylation factor-like 9 |
| chr16_+_30709530 | 0.81 |
ENST00000411466.2
|
SRCAP
|
Snf2-related CREBBP activator protein |
| chr10_+_81892477 | 0.81 |
ENST00000372263.3
|
PLAC9
|
placenta-specific 9 |
| chr19_+_13228917 | 0.81 |
ENST00000586171.1
|
NACC1
|
nucleus accumbens associated 1, BEN and BTB (POZ) domain containing |
| chr2_-_26205550 | 0.81 |
ENST00000405914.1
|
KIF3C
|
kinesin family member 3C |
| chr2_-_241835561 | 0.81 |
ENST00000388934.4
|
C2orf54
|
chromosome 2 open reading frame 54 |
| chr3_-_50340996 | 0.81 |
ENST00000266031.4
ENST00000395143.2 ENST00000457214.2 ENST00000447605.2 ENST00000418723.1 ENST00000395144.2 |
HYAL1
|
hyaluronoglucosaminidase 1 |
| chr7_+_99699280 | 0.80 |
ENST00000421755.1
|
AP4M1
|
adaptor-related protein complex 4, mu 1 subunit |
| chr6_-_31938700 | 0.80 |
ENST00000495340.1
|
DXO
|
decapping exoribonuclease |
| chr14_+_103589789 | 0.80 |
ENST00000558056.1
ENST00000560869.1 |
TNFAIP2
|
tumor necrosis factor, alpha-induced protein 2 |
| chr11_+_18287721 | 0.80 |
ENST00000356524.4
|
SAA1
|
serum amyloid A1 |
| chr19_+_10216899 | 0.80 |
ENST00000428358.1
ENST00000393796.4 ENST00000253107.7 ENST00000556468.1 ENST00000393793.1 |
PPAN-P2RY11
PPAN
|
PPAN-P2RY11 readthrough peter pan homolog (Drosophila) |
| chr20_-_62203808 | 0.79 |
ENST00000467148.1
|
HELZ2
|
helicase with zinc finger 2, transcriptional coactivator |
| chr12_-_49259643 | 0.79 |
ENST00000309739.5
|
RND1
|
Rho family GTPase 1 |
| chr1_-_31845914 | 0.79 |
ENST00000373713.2
|
FABP3
|
fatty acid binding protein 3, muscle and heart (mammary-derived growth inhibitor) |
| chr4_-_82965397 | 0.79 |
ENST00000512716.1
ENST00000514050.1 ENST00000512343.1 ENST00000510780.1 ENST00000508294.1 |
RASGEF1B
RP11-689K5.3
|
RasGEF domain family, member 1B RP11-689K5.3 |
| chr11_-_795400 | 0.79 |
ENST00000526152.1
ENST00000456706.2 ENST00000528936.1 |
SLC25A22
|
solute carrier family 25 (mitochondrial carrier: glutamate), member 22 |
| chr3_-_9811595 | 0.79 |
ENST00000256460.3
|
CAMK1
|
calcium/calmodulin-dependent protein kinase I |
| chr10_+_124739964 | 0.79 |
ENST00000406217.2
|
PSTK
|
phosphoseryl-tRNA kinase |
| chr22_-_39639021 | 0.79 |
ENST00000455790.1
|
PDGFB
|
platelet-derived growth factor beta polypeptide |
| chr11_+_60691924 | 0.79 |
ENST00000544065.1
ENST00000453848.2 ENST00000005286.4 |
TMEM132A
|
transmembrane protein 132A |
| chr4_-_74964904 | 0.79 |
ENST00000508487.2
|
CXCL2
|
chemokine (C-X-C motif) ligand 2 |
| chr2_+_89952792 | 0.78 |
ENST00000390265.2
|
IGKV1D-33
|
immunoglobulin kappa variable 1D-33 |
| chr11_+_18287801 | 0.78 |
ENST00000532858.1
ENST00000405158.2 |
SAA1
|
serum amyloid A1 |
| chr17_-_79817091 | 0.78 |
ENST00000570907.1
|
P4HB
|
prolyl 4-hydroxylase, beta polypeptide |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 5.0 | GO:0085032 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.9 | 2.8 | GO:2000410 | regulation of thymocyte migration(GO:2000410) |
| 0.8 | 2.4 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.8 | 2.3 | GO:0001798 | positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.7 | 3.6 | GO:0003069 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.7 | 2.1 | GO:1901076 | positive regulation of engulfment of apoptotic cell(GO:1901076) |
| 0.6 | 1.9 | GO:0045362 | regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
| 0.6 | 1.7 | GO:2000625 | regulation of miRNA catabolic process(GO:2000625) positive regulation of miRNA catabolic process(GO:2000627) |
| 0.5 | 6.2 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.5 | 2.0 | GO:1990637 | response to prolactin(GO:1990637) |
| 0.5 | 1.4 | GO:0090291 | regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) tolerance induction to lipopolysaccharide(GO:0072573) negative regulation of osteoclast proliferation(GO:0090291) negative regulation of CD40 signaling pathway(GO:2000349) |
| 0.5 | 1.4 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.5 | 4.2 | GO:0035931 | mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) regulation of aldosterone secretion(GO:2000858) |
| 0.5 | 1.4 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.4 | 1.8 | GO:0071505 | response to mycophenolic acid(GO:0071505) cellular response to mycophenolic acid(GO:0071506) metanephric glomerular mesangial cell development(GO:0072255) reversible differentiation(GO:0090677) cell dedifferentiation involved in phenotypic switching(GO:0090678) positive regulation of phenotypic switching(GO:1900241) regulation of vascular smooth muscle cell dedifferentiation(GO:1905174) positive regulation of vascular smooth muscle cell dedifferentiation(GO:1905176) vascular smooth muscle cell dedifferentiation(GO:1990936) |
| 0.4 | 9.1 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.4 | 6.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.4 | 2.1 | GO:0018262 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
| 0.4 | 0.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.4 | 1.2 | GO:1903762 | positive regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903762) positive regulation of ventricular cardiac muscle cell action potential(GO:1903947) positive regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905026) positive regulation of membrane repolarization during cardiac muscle cell action potential(GO:1905033) |
| 0.4 | 1.2 | GO:0051714 | positive regulation of cytolysis in other organism(GO:0051714) |
| 0.4 | 0.4 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.4 | 1.5 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.4 | 1.1 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.4 | 1.5 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.4 | 1.5 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.4 | 1.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
| 0.4 | 1.4 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.4 | 1.8 | GO:0030822 | positive regulation of cyclic nucleotide catabolic process(GO:0030807) positive regulation of cAMP catabolic process(GO:0030822) positive regulation of purine nucleotide catabolic process(GO:0033123) |
| 0.4 | 1.1 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
| 0.4 | 1.1 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.3 | 0.3 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 0.3 | 1.7 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.3 | 2.0 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.3 | 1.0 | GO:0035573 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.3 | 1.0 | GO:1900214 | pronephric field specification(GO:0039003) pattern specification involved in pronephros development(GO:0039017) thyroid-stimulating hormone secretion(GO:0070460) kidney field specification(GO:0072004) DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072304) negative regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072305) mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) apoptotic process involved in metanephric collecting duct development(GO:1900204) apoptotic process involved in metanephric nephron tubule development(GO:1900205) regulation of apoptotic process involved in metanephric collecting duct development(GO:1900214) negative regulation of apoptotic process involved in metanephric collecting duct development(GO:1900215) regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900217) negative regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900218) mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:1901147) regulation of metanephric DCT cell differentiation(GO:2000592) positive regulation of metanephric DCT cell differentiation(GO:2000594) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 0.3 | 1.0 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.3 | 8.5 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.3 | 0.7 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.3 | 1.0 | GO:0014028 | notochord formation(GO:0014028) |
| 0.3 | 0.6 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.3 | 1.3 | GO:0006238 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.3 | 1.6 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 0.3 | 0.3 | GO:0061097 | regulation of protein tyrosine kinase activity(GO:0061097) |
| 0.3 | 1.2 | GO:0009183 | purine deoxyribonucleoside diphosphate biosynthetic process(GO:0009183) |
| 0.3 | 0.9 | GO:2000397 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.3 | 0.3 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.3 | 1.2 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.3 | 0.3 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.3 | 1.8 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.3 | 0.9 | GO:1904875 | regulation of DNA ligase activity(GO:1904875) |
| 0.3 | 1.7 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 0.3 | 1.5 | GO:0032796 | uropod organization(GO:0032796) |
| 0.3 | 1.2 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.3 | 1.4 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
| 0.3 | 0.9 | GO:0033037 | polysaccharide localization(GO:0033037) |
| 0.3 | 0.6 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.3 | 0.9 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.3 | 0.3 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
| 0.3 | 0.6 | GO:0000060 | protein import into nucleus, translocation(GO:0000060) |
| 0.3 | 0.3 | GO:0019740 | regulation of nitrogen utilization(GO:0006808) nitrogen utilization(GO:0019740) |
| 0.3 | 1.1 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.3 | 1.7 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.3 | 1.1 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.3 | 0.3 | GO:0010799 | regulation of peptidyl-threonine phosphorylation(GO:0010799) |
| 0.3 | 0.8 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.3 | 1.4 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.3 | 8.6 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.3 | 1.3 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.3 | 1.1 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.3 | 0.8 | GO:1904579 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.3 | 1.0 | GO:0070846 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.3 | 0.8 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.3 | 1.0 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.3 | 1.0 | GO:0009439 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.3 | 1.0 | GO:1904117 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.3 | 1.3 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.3 | 16.8 | GO:0018149 | peptide cross-linking(GO:0018149) |
| 0.2 | 0.7 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.2 | 1.2 | GO:0038155 | interleukin-23-mediated signaling pathway(GO:0038155) |
| 0.2 | 0.7 | GO:1902565 | positive regulation of neutrophil degranulation(GO:0043315) cellular response to gravity(GO:0071258) positive regulation of neutrophil activation(GO:1902565) regulation of transcytosis(GO:1904298) positive regulation of transcytosis(GO:1904300) regulation of maternal process involved in parturition(GO:1904301) positive regulation of maternal process involved in parturition(GO:1904303) response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904316) cellular response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904317) |
| 0.2 | 1.0 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.2 | 0.2 | GO:0006801 | superoxide metabolic process(GO:0006801) |
| 0.2 | 1.0 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) positive regulation of high-density lipoprotein particle clearance(GO:0010983) |
| 0.2 | 1.2 | GO:0002803 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.2 | 1.0 | GO:0031938 | regulation of chromatin silencing at telomere(GO:0031938) |
| 0.2 | 2.4 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.2 | 1.7 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.2 | 0.7 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.2 | 0.7 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.2 | 0.5 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.2 | 0.2 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) |
| 0.2 | 4.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.2 | 0.9 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.2 | 1.6 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.2 | 0.9 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
| 0.2 | 2.0 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.2 | 0.7 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.2 | 0.9 | GO:1901805 | beta-glucoside metabolic process(GO:1901804) beta-glucoside catabolic process(GO:1901805) positive regulation of neuronal action potential(GO:1904457) |
| 0.2 | 1.5 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
| 0.2 | 0.6 | GO:0060381 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
| 0.2 | 1.3 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.2 | 0.6 | GO:1904328 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.2 | 0.4 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.2 | 0.2 | GO:0002823 | negative regulation of adaptive immune response based on somatic recombination of immune receptors built from immunoglobulin superfamily domains(GO:0002823) |
| 0.2 | 0.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.2 | 2.7 | GO:0033089 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
| 0.2 | 4.8 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.2 | 0.2 | GO:0060525 | prostate glandular acinus development(GO:0060525) prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 0.2 | 0.6 | GO:0061713 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) |
| 0.2 | 0.8 | GO:1903516 | regulation of telomere maintenance via recombination(GO:0032207) negative regulation of telomere maintenance via recombination(GO:0032208) regulation of single strand break repair(GO:1903516) negative regulation of single strand break repair(GO:1903517) negative regulation of beta-galactosidase activity(GO:1903770) telomere single strand break repair(GO:1903823) negative regulation of telomere single strand break repair(GO:1903824) |
| 0.2 | 1.7 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.2 | 0.6 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.2 | 0.8 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.2 | 1.6 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.2 | 2.5 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.2 | 0.6 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.2 | 0.6 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 0.2 | 1.4 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.2 | 1.0 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.2 | 0.4 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
| 0.2 | 0.8 | GO:1902661 | positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.2 | 0.8 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
| 0.2 | 1.2 | GO:0052551 | response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
| 0.2 | 1.5 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.2 | 1.7 | GO:0046087 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.2 | 0.8 | GO:0006218 | uridine catabolic process(GO:0006218) |
| 0.2 | 0.6 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.2 | 0.6 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
| 0.2 | 1.3 | GO:0006196 | AMP catabolic process(GO:0006196) |
| 0.2 | 1.3 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.2 | 0.9 | GO:0006549 | allantoin metabolic process(GO:0000255) isoleucine metabolic process(GO:0006549) |
| 0.2 | 0.9 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.2 | 0.2 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.2 | 0.7 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
| 0.2 | 1.1 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.2 | 1.1 | GO:0043126 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.2 | 1.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.2 | 0.2 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
| 0.2 | 1.8 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.2 | 0.2 | GO:1903094 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.2 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.2 | 0.5 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) suppression by virus of host autophagy(GO:0039521) |
| 0.2 | 0.2 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
| 0.2 | 0.3 | GO:0032826 | natural killer cell differentiation involved in immune response(GO:0002325) regulation of natural killer cell differentiation involved in immune response(GO:0032826) |
| 0.2 | 0.2 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.2 | 0.7 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.2 | 0.2 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.2 | 0.3 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.2 | 1.4 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.2 | 0.7 | GO:0033864 | positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 0.2 | 1.0 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.2 | 0.2 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.2 | 2.5 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.2 | 1.3 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.2 | 0.2 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.2 | 0.5 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.2 | 0.8 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.2 | 0.7 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.2 | 0.7 | GO:1900533 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.2 | 0.2 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.2 | 0.5 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.2 | 0.5 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.2 | 0.2 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.2 | 0.6 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.2 | 0.2 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.2 | 1.3 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.2 | 1.0 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.2 | 1.6 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.2 | 0.6 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.2 | 1.0 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.2 | 1.8 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.2 | 0.6 | GO:0052360 | multi-organism catabolic process(GO:0044035) development of symbiont involved in interaction with host(GO:0044115) modulation of development of symbiont involved in interaction with host(GO:0044145) negative regulation of development of symbiont involved in interaction with host(GO:0044147) metabolism of substance in other organism involved in symbiotic interaction(GO:0052214) catabolism of substance in other organism involved in symbiotic interaction(GO:0052227) metabolism of macromolecule in other organism involved in symbiotic interaction(GO:0052229) catabolism by host of symbiont macromolecule(GO:0052360) catabolism by organism of macromolecule in other organism involved in symbiotic interaction(GO:0052361) catabolism by host of symbiont protein(GO:0052362) catabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052363) catabolism by host of substance in symbiont(GO:0052364) metabolism by host of symbiont macromolecule(GO:0052416) metabolism by host of symbiont protein(GO:0052417) metabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052418) metabolism by host of substance in symbiont(GO:0052419) |
| 0.2 | 1.1 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.2 | 0.5 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.2 | 0.9 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.2 | 0.2 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.2 | 0.8 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.2 | 0.6 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.2 | 0.9 | GO:0051595 | response to methylglyoxal(GO:0051595) |
| 0.2 | 0.6 | GO:0090410 | malonate catabolic process(GO:0090410) |
| 0.2 | 0.8 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
| 0.2 | 0.6 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.2 | 0.5 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.2 | 1.5 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.2 | 1.2 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.2 | 0.2 | GO:0071231 | cellular response to folic acid(GO:0071231) |
| 0.2 | 0.8 | GO:0019732 | antifungal humoral response(GO:0019732) |
| 0.2 | 0.5 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.2 | 0.5 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.2 | 0.6 | GO:0021794 | thalamus development(GO:0021794) |
| 0.2 | 0.2 | GO:0002479 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-dependent(GO:0002479) |
| 0.2 | 0.3 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.2 | 0.6 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 | 0.6 | GO:0070945 | neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) neutrophil mediated killing of bacterium(GO:0070944) neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.1 | 1.6 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.1 | 0.1 | GO:0090212 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
| 0.1 | 0.7 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.1 | 0.4 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
| 0.1 | 0.4 | GO:0072737 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) |
| 0.1 | 0.9 | GO:2000538 | regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.1 | 0.3 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.1 | 1.0 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.1 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.1 | 0.6 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.1 | 0.9 | GO:0003404 | optic vesicle morphogenesis(GO:0003404) |
| 0.1 | 0.4 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.1 | 0.6 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.1 | 0.4 | GO:0016062 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.1 | 0.9 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
| 0.1 | 1.6 | GO:0018377 | protein myristoylation(GO:0018377) |
| 0.1 | 1.0 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.1 | 0.4 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.1 | 0.4 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.1 | 1.0 | GO:2000317 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
| 0.1 | 0.4 | GO:1901899 | positive regulation of relaxation of muscle(GO:1901079) positive regulation of relaxation of cardiac muscle(GO:1901899) |
| 0.1 | 2.0 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.1 | 0.4 | GO:0060032 | notochord regression(GO:0060032) |
| 0.1 | 0.6 | GO:0060901 | regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) positive regulation of melanosome transport(GO:1902910) |
| 0.1 | 0.1 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.1 | 0.4 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.1 | 0.1 | GO:0072319 | synaptic vesicle uncoating(GO:0016191) vesicle uncoating(GO:0072319) |
| 0.1 | 0.5 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.1 | 0.5 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.1 | 0.5 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.1 | 0.4 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.1 | 0.4 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.1 | 1.0 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 | 0.4 | GO:1904897 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.1 | 1.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 1.1 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.1 | 0.4 | GO:1900111 | regulation of histone H3-K9 dimethylation(GO:1900109) positive regulation of histone H3-K9 dimethylation(GO:1900111) |
| 0.1 | 0.1 | GO:2000182 | regulation of progesterone biosynthetic process(GO:2000182) |
| 0.1 | 0.5 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 1.1 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
| 0.1 | 0.1 | GO:0070100 | regulation of chemokine-mediated signaling pathway(GO:0070099) negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.1 | 0.3 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.7 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 0.1 | 0.8 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.1 | 0.1 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.1 | 2.0 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 | 0.4 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.1 | 0.1 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
| 0.1 | 0.4 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.1 | 0.5 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 | 0.1 | GO:0070142 | synaptic vesicle budding(GO:0070142) |
| 0.1 | 1.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 0.3 | GO:0035397 | helper T cell enhancement of adaptive immune response(GO:0035397) |
| 0.1 | 0.4 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
| 0.1 | 0.3 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.1 | 0.1 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.1 | 0.8 | GO:0015692 | lead ion transport(GO:0015692) |
| 0.1 | 0.6 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 | 0.5 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 | 0.1 | GO:1902667 | regulation of axon guidance(GO:1902667) |
| 0.1 | 1.3 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.1 | 0.2 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
| 0.1 | 0.5 | GO:0016333 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.1 | 0.5 | GO:0003257 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.1 | 0.4 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.1 | 0.1 | GO:0060775 | mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
| 0.1 | 1.0 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.4 | GO:1901536 | negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 0.7 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.1 | 0.1 | GO:0045799 | positive regulation of chromatin assembly or disassembly(GO:0045799) |
| 0.1 | 0.1 | GO:0060313 | negative regulation of blood vessel remodeling(GO:0060313) |
| 0.1 | 0.6 | GO:0045938 | positive regulation of circadian sleep/wake cycle, sleep(GO:0045938) |
| 0.1 | 0.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.1 | 0.2 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 | 1.0 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.1 | 0.2 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.1 | 0.5 | GO:0090260 | negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.1 | 11.4 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.1 | 0.7 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.1 | 1.1 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.1 | 0.4 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.1 | 0.2 | GO:1901890 | positive regulation of cell junction assembly(GO:1901890) |
| 0.1 | 0.2 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.1 | 0.4 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.1 | 1.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.1 | 0.9 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.1 | 0.1 | GO:0015813 | L-glutamate transport(GO:0015813) |
| 0.1 | 0.4 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.1 | 0.4 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 | 0.4 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.1 | 1.6 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 | 0.8 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.1 | 1.6 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.1 | 0.5 | GO:0045959 | regulation of complement activation, classical pathway(GO:0030450) negative regulation of complement activation, classical pathway(GO:0045959) |
| 0.1 | 0.1 | GO:1903936 | response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.1 | 0.5 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.1 | 0.2 | GO:0043311 | regulation of eosinophil degranulation(GO:0043309) positive regulation of eosinophil degranulation(GO:0043311) regulation of eosinophil activation(GO:1902566) positive regulation of eosinophil activation(GO:1902568) |
| 0.1 | 1.6 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.1 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 0.1 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.1 | 0.5 | GO:0015855 | pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.1 | 0.5 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.8 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.1 | 1.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 | 0.3 | GO:0002661 | B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) |
| 0.1 | 0.8 | GO:0051834 | evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) negative regulation of lung blood pressure(GO:0061767) |
| 0.1 | 3.1 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
| 0.1 | 2.9 | GO:1904874 | positive regulation of telomerase RNA localization to Cajal body(GO:1904874) |
| 0.1 | 1.0 | GO:0009227 | UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 0.1 | 0.3 | GO:1901318 | negative regulation of sperm motility(GO:1901318) |
| 0.1 | 4.0 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.1 | 0.4 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.1 | 1.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 | 0.1 | GO:0014839 | myoblast migration involved in skeletal muscle regeneration(GO:0014839) |
| 0.1 | 0.5 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.1 | 0.3 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 1.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.1 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 0.9 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 | 0.4 | GO:0015785 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.1 | 0.2 | GO:0045073 | regulation of chemokine biosynthetic process(GO:0045073) |
| 0.1 | 0.4 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 0.1 | 0.8 | GO:0009744 | response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.1 | 0.4 | GO:1904806 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.1 | 0.1 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.1 | 0.1 | GO:1990709 | presynaptic active zone organization(GO:1990709) |
| 0.1 | 0.2 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.1 | 0.3 | GO:1904351 | negative regulation of protein catabolic process in the vacuole(GO:1904351) negative regulation of lysosomal protein catabolic process(GO:1905166) |
| 0.1 | 0.3 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.1 | 0.4 | GO:1903722 | regulation of centriole elongation(GO:1903722) |
| 0.1 | 0.1 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 0.1 | 1.1 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
| 0.1 | 0.5 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
| 0.1 | 0.5 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.1 | 0.5 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.1 | 0.3 | GO:0060829 | regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
| 0.1 | 2.1 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.1 | 0.3 | GO:1904784 | NLRP1 inflammasome complex assembly(GO:1904784) |
| 0.1 | 0.3 | GO:0072720 | response to dithiothreitol(GO:0072720) |
| 0.1 | 0.6 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.1 | 0.4 | GO:0045013 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.1 | 0.6 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.6 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.1 | 0.5 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.1 | 0.4 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 1.2 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.1 | 0.3 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.1 | 0.3 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.1 | 0.1 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.1 | 0.9 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.1 | 0.2 | GO:0060482 | lung goblet cell differentiation(GO:0060480) lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.1 | 0.6 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.3 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.1 | 0.4 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.1 | 0.8 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.1 | 0.1 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.1 | 1.5 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.1 | 0.1 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.1 | 0.6 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.1 | 0.7 | GO:0046886 | positive regulation of hormone biosynthetic process(GO:0046886) |
| 0.1 | 0.4 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.6 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
| 0.1 | 0.4 | GO:0009615 | response to virus(GO:0009615) |
| 0.1 | 0.3 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
| 0.1 | 0.3 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.1 | 0.3 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.4 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.1 | 0.4 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.1 | 1.5 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.1 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 | 0.8 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.1 | 1.7 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.5 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
| 0.1 | 0.4 | GO:0070340 | detection of triacyl bacterial lipopeptide(GO:0042495) detection of bacterial lipopeptide(GO:0070340) |
| 0.1 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.1 | 1.0 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.1 | 0.2 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 | 0.8 | GO:0045007 | depurination(GO:0045007) |
| 0.1 | 0.3 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
| 0.1 | 1.9 | GO:0071028 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.1 | 0.8 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.1 | 0.1 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.1 | 0.1 | GO:0035281 | pre-miRNA export from nucleus(GO:0035281) |
| 0.1 | 1.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 0.5 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.1 | 0.3 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.1 | 3.3 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.1 | 0.5 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 1.3 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 0.3 | GO:2000342 | negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.1 | 1.8 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.1 | 0.4 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.1 | 1.0 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.1 | 0.5 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.1 | 0.1 | GO:0050905 | neuromuscular process(GO:0050905) |
| 0.1 | 0.2 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 | 1.0 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
| 0.1 | 0.7 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.1 | 2.2 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
| 0.1 | 0.1 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.1 | 0.7 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.1 | 0.3 | GO:0021571 | rhombomere 5 development(GO:0021571) |
| 0.1 | 0.3 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.4 | GO:0090096 | regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 0.1 | 0.4 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.1 | 0.3 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.1 | 0.1 | GO:0061145 | bronchus cartilage development(GO:0060532) lung smooth muscle development(GO:0061145) |
| 0.1 | 0.3 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
| 0.1 | 0.6 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.1 | 0.7 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
| 0.1 | 1.7 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.1 | 0.3 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.1 | 0.8 | GO:1903756 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.1 | 0.1 | GO:0021557 | oculomotor nerve development(GO:0021557) |
| 0.1 | 0.5 | GO:0030421 | defecation(GO:0030421) |
| 0.1 | 0.5 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.1 | 0.5 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 | 0.1 | GO:1901860 | positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.1 | 0.3 | GO:0060426 | lung vasculature development(GO:0060426) |
| 0.1 | 0.3 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.1 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.1 | 0.3 | GO:2000830 | vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 0.1 | 0.5 | GO:0033383 | geranyl diphosphate metabolic process(GO:0033383) geranyl diphosphate biosynthetic process(GO:0033384) farnesyl diphosphate biosynthetic process(GO:0045337) |
| 0.1 | 0.2 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 | 0.1 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) negative regulation of natural killer cell mediated immune response to tumor cell(GO:0002856) negative regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002859) |
| 0.1 | 0.5 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
| 0.1 | 0.4 | GO:0035552 | oxidative single-stranded DNA demethylation(GO:0035552) |
| 0.1 | 1.1 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.1 | 0.3 | GO:0031063 | regulation of histone deacetylation(GO:0031063) |
| 0.1 | 0.3 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 0.1 | 0.4 | GO:0019046 | release from viral latency(GO:0019046) |
| 0.1 | 0.3 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.1 | 0.1 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
| 0.1 | 1.4 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 1.0 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.1 | 0.2 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
| 0.1 | 0.3 | GO:1903281 | positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.1 | 0.4 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.1 | 0.3 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 0.1 | 0.2 | GO:0010155 | regulation of proton transport(GO:0010155) |
| 0.1 | 0.3 | GO:0002503 | peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 0.1 | 0.6 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
| 0.1 | 1.8 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.1 | 0.2 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.1 | 0.3 | GO:1904867 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) protein localization to nucleoplasm(GO:1990173) |
| 0.1 | 1.0 | GO:0061450 | trophoblast cell migration(GO:0061450) regulation of trophoblast cell migration(GO:1901163) |
| 0.1 | 0.4 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.1 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.1 | 0.4 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.1 | 0.7 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
| 0.1 | 0.3 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.1 | 0.4 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
| 0.1 | 0.3 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.1 | 0.3 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.1 | 2.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.1 | 0.3 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.1 | 0.3 | GO:0051673 | membrane disruption in other organism(GO:0051673) |
| 0.1 | 0.3 | GO:2000656 | regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
| 0.1 | 0.3 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.4 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 1.2 | GO:0032608 | interferon-beta production(GO:0032608) positive regulation of interferon-beta production(GO:0032728) |
| 0.1 | 0.6 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.1 | 0.1 | GO:2000848 | positive regulation of corticosteroid hormone secretion(GO:2000848) |
| 0.1 | 0.3 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.1 | 0.2 | GO:0031056 | regulation of histone modification(GO:0031056) |
| 0.1 | 0.2 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.1 | 0.1 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.1 | 0.1 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.1 | 0.4 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
| 0.1 | 0.2 | GO:0072209 | metanephric mesangial cell differentiation(GO:0072209) metanephric glomerular mesangial cell differentiation(GO:0072254) |
| 0.1 | 0.5 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.1 | 0.7 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.1 | 0.1 | GO:0002588 | positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 0.1 | 0.2 | GO:0052173 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.1 | 0.2 | GO:0030264 | nuclear fragmentation involved in apoptotic nuclear change(GO:0030264) |
| 0.1 | 0.4 | GO:1990180 | mitochondrial tRNA 3'-end processing(GO:1990180) |
| 0.1 | 0.2 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 0.1 | 0.2 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.1 | 0.6 | GO:0016098 | monoterpenoid metabolic process(GO:0016098) |
| 0.1 | 0.6 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.1 | 0.2 | GO:0060809 | mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.1 | 1.6 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.1 | 0.2 | GO:1990258 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.1 | 1.6 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.1 | GO:0051885 | positive regulation of anagen(GO:0051885) |
| 0.1 | 0.2 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.1 | 0.5 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 | 0.3 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.1 | 0.2 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.1 | 0.8 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
| 0.1 | 4.2 | GO:0006007 | glucose catabolic process(GO:0006007) NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.1 | 0.5 | GO:1902044 | regulation of Fas signaling pathway(GO:1902044) negative regulation of Fas signaling pathway(GO:1902045) |
| 0.1 | 1.5 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.1 | 0.2 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.1 | 0.1 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 | 0.4 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.5 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 | 0.6 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.1 | 0.2 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.1 | 0.9 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.1 | 0.1 | GO:1902884 | positive regulation of response to oxidative stress(GO:1902884) |
| 0.1 | 0.6 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.1 | 1.0 | GO:1901538 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.1 | 0.2 | GO:0071104 | response to interleukin-9(GO:0071104) |
| 0.1 | 0.2 | GO:0099612 | protein localization to axon(GO:0099612) |
| 0.1 | 0.9 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.1 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.1 | 0.2 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.1 | 0.6 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.1 | 1.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.1 | GO:0032917 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.1 | 0.1 | GO:1990051 | activation of protein kinase C activity(GO:1990051) |
| 0.1 | 0.2 | GO:0090467 | L-arginine import(GO:0043091) arginine import(GO:0090467) |
| 0.1 | 0.3 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.1 | 0.2 | GO:0048867 | ganglion mother cell fate determination(GO:0007402) stem cell fate commitment(GO:0048865) stem cell fate determination(GO:0048867) |
| 0.1 | 0.4 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 0.5 | GO:0002248 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) |
| 0.1 | 0.5 | GO:0046618 | drug export(GO:0046618) |
| 0.1 | 1.5 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.1 | 0.2 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.1 | 0.1 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.1 | 1.6 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.1 | 0.1 | GO:1904640 | response to methionine(GO:1904640) |
| 0.1 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.1 | 0.3 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.1 | 0.1 | GO:0045670 | regulation of osteoclast differentiation(GO:0045670) |
| 0.1 | 0.3 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
| 0.1 | 0.1 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.1 | 0.2 | GO:0045081 | negative regulation of interleukin-10 biosynthetic process(GO:0045081) |
| 0.1 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.1 | 0.4 | GO:0001554 | luteolysis(GO:0001554) |
| 0.1 | 0.4 | GO:0019303 | D-ribose catabolic process(GO:0019303) |
| 0.1 | 0.1 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.1 | 0.4 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.1 | 0.2 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.1 | 0.4 | GO:0002729 | positive regulation of natural killer cell cytokine production(GO:0002729) |
| 0.1 | 0.2 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 1.5 | GO:0042730 | fibrinolysis(GO:0042730) |
| 0.1 | 0.2 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.1 | 0.1 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 6.7 | GO:0006521 | regulation of cellular amino acid metabolic process(GO:0006521) |
| 0.1 | 0.8 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.1 | 0.2 | GO:0035038 | female pronucleus assembly(GO:0035038) |
| 0.1 | 0.9 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.1 | 0.1 | GO:0042427 | serotonin biosynthetic process(GO:0042427) |
| 0.1 | 0.3 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.1 | 0.4 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 3.8 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.1 | 0.8 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.1 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.1 | 0.1 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.1 | 0.1 | GO:0038194 | thyroid-stimulating hormone signaling pathway(GO:0038194) |
| 0.1 | 0.3 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.1 | 0.3 | GO:0036509 | trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.1 | 0.2 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.1 | 0.3 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.1 | 0.1 | GO:1905065 | positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.1 | 0.1 | GO:0060278 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.1 | 0.1 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.1 | 0.3 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.1 | 1.0 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.1 | 0.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.1 | 0.3 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 0.1 | 0.1 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.1 | 0.2 | GO:1900275 | negative regulation of phospholipase C activity(GO:1900275) regulation of proteinase activated receptor activity(GO:1900276) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
| 0.1 | 1.8 | GO:0030220 | platelet formation(GO:0030220) |
| 0.1 | 0.7 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 | 0.5 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
| 0.1 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 0.2 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.1 | 0.5 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.1 | 0.7 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.5 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 | 0.3 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 0.1 | GO:0015846 | polyamine transport(GO:0015846) |
| 0.1 | 0.2 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.1 | 0.2 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.1 | 0.1 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.1 | 0.3 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 1.1 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.1 | 2.5 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.1 | GO:0040036 | regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.1 | 0.1 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.1 | 0.5 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 | 0.3 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.1 | 0.1 | GO:0060474 | positive regulation of sperm motility involved in capacitation(GO:0060474) |
| 0.1 | 0.5 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.1 | 0.1 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.7 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 | 0.1 | GO:0060440 | trachea formation(GO:0060440) |
| 0.1 | 0.1 | GO:0009189 | deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
| 0.1 | 0.7 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.1 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.1 | 0.4 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 | 0.1 | GO:0046125 | thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 | 0.1 | GO:0071025 | RNA surveillance(GO:0071025) |
| 0.1 | 0.6 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
| 0.1 | 0.3 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
| 0.1 | 0.2 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.1 | 0.3 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 0.3 | GO:0033504 | floor plate development(GO:0033504) |
| 0.1 | 0.1 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.1 | 0.3 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.1 | 0.4 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.1 | 0.5 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.1 | 0.6 | GO:1904379 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.1 | 0.6 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.1 | 0.4 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 0.8 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.1 | 1.8 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.1 | 0.3 | GO:0045209 | MAPK phosphatase export from nucleus(GO:0045208) MAPK phosphatase export from nucleus, leptomycin B sensitive(GO:0045209) |
| 0.1 | 0.4 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.1 | 0.1 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.1 | 0.1 | GO:1902415 | regulation of mRNA binding(GO:1902415) positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.1 | 0.2 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.1 | 1.0 | GO:0007567 | parturition(GO:0007567) |
| 0.1 | 0.1 | GO:0071435 | potassium ion export(GO:0071435) |
| 0.1 | 0.1 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.1 | 1.7 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 0.4 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.1 | 0.1 | GO:1903526 | negative regulation of membrane tubulation(GO:1903526) |
| 0.1 | 0.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.9 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.7 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.1 | 0.1 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.1 | 1.6 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
| 0.1 | 0.1 | GO:0099545 | trans-synaptic signaling by trans-synaptic complex(GO:0099545) |
| 0.1 | 0.4 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.1 | 0.1 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 0.1 | 0.5 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 0.1 | 0.2 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.1 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.1 | 0.1 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 | 0.2 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.1 | 0.2 | GO:0018874 | benzoate metabolic process(GO:0018874) |
| 0.1 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.1 | 0.1 | GO:2000407 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:0035698) regulation of T cell extravasation(GO:2000407) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) regulation of CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:2000452) |
| 0.1 | 0.1 | GO:0001757 | somite specification(GO:0001757) |
| 0.1 | 0.4 | GO:0099566 | regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 0.1 | 0.3 | GO:0051775 | response to redox state(GO:0051775) |
| 0.1 | 0.3 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.1 | 0.5 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.1 | 0.1 | GO:1903401 | lysine transport(GO:0015819) L-lysine transport(GO:1902022) L-lysine transmembrane transport(GO:1903401) |
| 0.1 | 0.5 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.1 | 0.2 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 | 0.1 | GO:1901184 | regulation of ERBB signaling pathway(GO:1901184) |
| 0.1 | 0.2 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.1 | 0.4 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.1 | 1.0 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.1 | 0.8 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.1 | 0.1 | GO:0072313 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.1 | 0.7 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.1 | 1.1 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 | 0.4 | GO:0046898 | response to cycloheximide(GO:0046898) |
| 0.1 | 0.6 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.3 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.1 | 0.5 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
| 0.1 | 0.1 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 0.1 | 0.2 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.1 | 0.1 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
| 0.1 | 0.2 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.1 | 0.2 | GO:0043129 | surfactant homeostasis(GO:0043129) |
| 0.1 | 0.2 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
| 0.1 | 3.0 | GO:0071377 | cellular response to glucagon stimulus(GO:0071377) |
| 0.1 | 0.1 | GO:0060434 | bronchus morphogenesis(GO:0060434) |
| 0.1 | 0.1 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.1 | 0.1 | GO:0009624 | defense response to nematode(GO:0002215) response to nematode(GO:0009624) |
| 0.1 | 0.1 | GO:0071400 | cellular response to oleic acid(GO:0071400) |
| 0.1 | 0.1 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.1 | 0.1 | GO:2001239 | regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001239) |
| 0.1 | 0.8 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.1 | 0.1 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.1 | 0.3 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.1 | 0.7 | GO:2000576 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.1 | 0.1 | GO:0001507 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.1 | 0.2 | GO:0050709 | negative regulation of protein secretion(GO:0050709) |
| 0.1 | 0.2 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.1 | 2.3 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.1 | 0.3 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.1 | 0.2 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.1 | 0.8 | GO:1902993 | positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.1 | 0.2 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.3 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.1 | 0.2 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.1 | 0.4 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.1 | 0.1 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
| 0.1 | 0.9 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.2 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 | 0.2 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.1 | 6.7 | GO:0070268 | cornification(GO:0070268) |
| 0.1 | 0.1 | GO:0042268 | regulation of cytolysis(GO:0042268) |
| 0.1 | 1.2 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 | 0.5 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.1 | 0.3 | GO:0014059 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.1 | 0.2 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.1 | 0.2 | GO:0022011 | Schwann cell development(GO:0014044) myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.1 | 1.5 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 1.0 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 | 0.1 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.1 | 0.8 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
| 0.1 | 0.2 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.1 | 0.1 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) positive regulation of RNA export from nucleus(GO:0046833) |
| 0.1 | 0.2 | GO:0043095 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.1 | 0.2 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.1 | 1.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.7 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 0.3 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.1 | 0.5 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 | 0.1 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) |
| 0.1 | 0.6 | GO:0000052 | citrulline metabolic process(GO:0000052) |
| 0.1 | 0.3 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.1 | 0.3 | GO:1902903 | regulation of fibril organization(GO:1902903) |
| 0.1 | 0.4 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) |
| 0.1 | 0.8 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.1 | 2.5 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.1 | 0.2 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.1 | 0.2 | GO:0015840 | urea transport(GO:0015840) urea transmembrane transport(GO:0071918) |
| 0.1 | 0.1 | GO:0061009 | common bile duct development(GO:0061009) |
| 0.1 | 0.3 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 0.7 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.1 | 1.3 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 | 0.3 | GO:0015862 | uridine transport(GO:0015862) pyrimidine nucleoside transport(GO:0015864) |
| 0.1 | 0.1 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.1 | 0.2 | GO:0052026 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.1 | 0.3 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.1 | 0.2 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.1 | 0.1 | GO:0055095 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
| 0.1 | 0.2 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.1 | 0.4 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.1 | 0.2 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.1 | 0.1 | GO:0071371 | cellular response to gonadotropin stimulus(GO:0071371) |
| 0.1 | 0.1 | GO:0032849 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
| 0.1 | 0.2 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.1 | 0.2 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.1 | 0.1 | GO:0006429 | leucyl-tRNA aminoacylation(GO:0006429) |
| 0.1 | 0.4 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 0.1 | 0.3 | GO:0036343 | psychomotor behavior(GO:0036343) motor behavior(GO:0061744) |
| 0.1 | 0.2 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
| 0.1 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.1 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.1 | 0.1 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.1 | 0.4 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.1 | 0.4 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.1 | 0.5 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
| 0.1 | 0.4 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.1 | 1.3 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 0.5 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.1 | 0.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 0.2 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.1 | 2.5 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.1 | 0.7 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 | 1.2 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.1 | 0.2 | GO:0050757 | thymidylate synthase biosynthetic process(GO:0050757) regulation of thymidylate synthase biosynthetic process(GO:0050758) negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.1 | 0.6 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.1 | 0.2 | GO:0046514 | ceramide catabolic process(GO:0046514) |
| 0.0 | 0.2 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.0 | 0.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.0 | 0.4 | GO:1902307 | positive regulation of sodium ion transmembrane transport(GO:1902307) |
| 0.0 | 0.2 | GO:0000305 | response to oxygen radical(GO:0000305) |
| 0.0 | 0.6 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 0.1 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.0 | 0.3 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.7 | GO:0031076 | embryonic camera-type eye development(GO:0031076) |
| 0.0 | 0.4 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.2 | GO:0045338 | farnesyl diphosphate metabolic process(GO:0045338) |
| 0.0 | 0.2 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.2 | GO:1901073 | N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
| 0.0 | 0.2 | GO:0071354 | cellular response to interleukin-6(GO:0071354) |
| 0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
| 0.0 | 0.6 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.0 | GO:0015960 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.0 | 0.1 | GO:0005985 | sucrose metabolic process(GO:0005985) |
| 0.0 | 0.4 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.0 | 0.3 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.0 | 0.2 | GO:0072262 | posterior mesonephric tubule development(GO:0072166) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) negative regulation of metanephric glomerulus development(GO:0072299) regulation of metanephric glomerular mesangial cell proliferation(GO:0072301) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 0.0 | 0.2 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.4 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.1 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.0 | 0.1 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.0 | 1.7 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.0 | 0.3 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
| 0.0 | 0.1 | GO:0045907 | positive regulation of vasoconstriction(GO:0045907) |
| 0.0 | 0.1 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.0 | 0.4 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 | 0.2 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 1.5 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.0 | 0.4 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.4 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.0 | 0.1 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.0 | 0.5 | GO:0003417 | growth plate cartilage development(GO:0003417) |
| 0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
| 0.0 | 0.1 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.0 | 0.6 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.4 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.0 | 0.3 | GO:2000466 | negative regulation of glycogen (starch) synthase activity(GO:2000466) regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
| 0.0 | 0.5 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.0 | 0.2 | GO:0006844 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.0 | 0.1 | GO:0030199 | collagen fibril organization(GO:0030199) |
| 0.0 | 0.4 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.0 | GO:0021502 | neural fold elevation formation(GO:0021502) |
| 0.0 | 0.2 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.0 | 0.3 | GO:0007173 | epidermal growth factor receptor signaling pathway(GO:0007173) |
| 0.0 | 0.5 | GO:0032930 | positive regulation of superoxide anion generation(GO:0032930) |
| 0.0 | 0.0 | GO:0010934 | macrophage cytokine production(GO:0010934) regulation of macrophage cytokine production(GO:0010935) negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.4 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.0 | 0.3 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 0.5 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 | 0.7 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 | 1.1 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.0 | 0.1 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.0 | 0.3 | GO:0071158 | positive regulation of cell cycle arrest(GO:0071158) |
| 0.0 | 0.4 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.0 | 0.2 | GO:0044571 | [2Fe-2S] cluster assembly(GO:0044571) |
| 0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.1 | GO:0098502 | DNA dephosphorylation(GO:0098502) |
| 0.0 | 0.3 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.0 | 0.6 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.0 | 0.1 | GO:0048241 | epinephrine transport(GO:0048241) |
| 0.0 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.0 | 0.2 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.0 | 0.1 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.0 | 0.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.2 | GO:1904636 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.0 | 0.2 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.0 | 0.3 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.0 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
| 0.0 | 0.1 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 | 0.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.2 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.0 | 0.2 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.9 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.0 | 0.2 | GO:2000489 | regulation of hepatic stellate cell activation(GO:2000489) negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.0 | 0.6 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.6 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.0 | 0.1 | GO:0034343 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.0 | 0.4 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.6 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.2 | GO:0048048 | embryonic eye morphogenesis(GO:0048048) |
| 0.0 | 0.2 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.0 | 0.2 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.2 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.0 | 0.1 | GO:0042695 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.0 | 0.2 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.0 | 0.0 | GO:0061074 | regulation of neural retina development(GO:0061074) |
| 0.0 | 0.2 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.0 | 0.2 | GO:0072488 | carnitine transport(GO:0015879) ammonium transmembrane transport(GO:0072488) fatty acid transmembrane transport(GO:1902001) carnitine transmembrane transport(GO:1902603) |
| 0.0 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.0 | 0.2 | GO:0033081 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
| 0.0 | 0.2 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.0 | 0.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.0 | 0.4 | GO:0042311 | vasodilation(GO:0042311) |
| 0.0 | 0.1 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
| 0.0 | 0.1 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
| 0.0 | 0.1 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 0.0 | 0.1 | GO:0086068 | Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
| 0.0 | 0.2 | GO:0018277 | protein deamination(GO:0018277) |
| 0.0 | 0.2 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.4 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.4 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 2.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.0 | 0.1 | GO:0002192 | IRES-dependent translational initiation(GO:0002192) |
| 0.0 | 0.3 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 | 0.1 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.4 | GO:0043931 | ossification involved in bone maturation(GO:0043931) |
| 0.0 | 1.5 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.0 | 0.3 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.6 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.0 | 0.2 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.0 | 0.1 | GO:0036292 | DNA rewinding(GO:0036292) |
| 0.0 | 0.1 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.0 | 0.2 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
| 0.0 | 0.3 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
| 0.0 | 0.1 | GO:0003360 | brainstem development(GO:0003360) |
| 0.0 | 0.1 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.0 | 1.8 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 | 0.4 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.0 | 0.2 | GO:0050928 | negative regulation of positive chemotaxis(GO:0050928) |
| 0.0 | 0.7 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 0.2 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.0 | 0.3 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.4 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.1 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.0 | 0.1 | GO:2000364 | regulation of STAT protein import into nucleus(GO:2000364) positive regulation of STAT protein import into nucleus(GO:2000366) |
| 0.0 | 3.6 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 0.0 | 0.2 | GO:0035082 | axoneme assembly(GO:0035082) |
| 0.0 | 0.2 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) negative regulation of male germ cell proliferation(GO:2000255) |
| 0.0 | 0.0 | GO:0048570 | notochord morphogenesis(GO:0048570) |
| 0.0 | 0.1 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.0 | 0.4 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 | 0.2 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.0 | 0.3 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
| 0.0 | 0.0 | GO:0042092 | type 2 immune response(GO:0042092) |
| 0.0 | 2.5 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.0 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.0 | 0.1 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.0 | 0.4 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.0 | 0.2 | GO:0009397 | folic acid-containing compound catabolic process(GO:0009397) pteridine-containing compound catabolic process(GO:0042560) |
| 0.0 | 0.5 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 0.3 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.0 | 0.4 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.0 | 0.1 | GO:1904396 | regulation of neuromuscular junction development(GO:1904396) |
| 0.0 | 0.6 | GO:0042554 | superoxide anion generation(GO:0042554) |
| 0.0 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 2.3 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.1 | GO:0015883 | FAD transport(GO:0015883) FAD transmembrane transport(GO:0035350) |
| 0.0 | 0.1 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.0 | 0.1 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
| 0.0 | 0.3 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.2 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.2 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.0 | 0.4 | GO:1990834 | response to odorant(GO:1990834) |
| 0.0 | 0.2 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.0 | 0.6 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.1 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.0 | 0.9 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 3.9 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.3 | GO:0038060 | nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
| 0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.0 | 0.1 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.0 | 0.0 | GO:0060326 | cell chemotaxis(GO:0060326) |
| 0.0 | 0.5 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.0 | 0.1 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.0 | 2.6 | GO:0032526 | response to retinoic acid(GO:0032526) |
| 0.0 | 0.0 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
| 0.0 | 0.2 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.0 | 0.4 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.0 | 0.2 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.0 | 0.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.2 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.0 | 0.1 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 0.4 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.0 | 0.1 | GO:0033341 | regulation of collagen binding(GO:0033341) |
| 0.0 | 0.3 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.1 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.1 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.0 | 0.1 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
| 0.0 | 0.1 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.0 | 0.1 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.2 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.1 | GO:0050704 | regulation of interleukin-1 secretion(GO:0050704) |
| 0.0 | 0.1 | GO:0010626 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.0 | 0.2 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.0 | 0.0 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
| 0.0 | 0.9 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
| 0.0 | 0.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.2 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.0 | 0.1 | GO:1903975 | Schwann cell proliferation involved in axon regeneration(GO:0014011) Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) negative regulation of Schwann cell migration(GO:1900148) regulation of glial cell migration(GO:1903975) negative regulation of glial cell migration(GO:1903976) regulation of Schwann cell proliferation involved in axon regeneration(GO:1905044) negative regulation of Schwann cell proliferation involved in axon regeneration(GO:1905045) |
| 0.0 | 0.3 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.1 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.3 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
| 0.0 | 0.4 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.0 | 0.2 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.0 | 0.3 | GO:0007207 | phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.0 | 0.4 | GO:0052803 | histidine metabolic process(GO:0006547) imidazole-containing compound metabolic process(GO:0052803) |
| 0.0 | 1.0 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 | 0.0 | GO:0003352 | regulation of cilium movement(GO:0003352) regulation of cilium beat frequency(GO:0003356) |
| 0.0 | 0.2 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.0 | 0.1 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
| 0.0 | 0.0 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.0 | 0.1 | GO:1904478 | regulation of intestinal absorption(GO:1904478) |
| 0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.1 | GO:0032915 | positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 0.0 | 0.2 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.0 | 0.0 | GO:0002415 | immune response in mucosal-associated lymphoid tissue(GO:0002386) immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.0 | 0.1 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.0 | 0.3 | GO:0006525 | arginine metabolic process(GO:0006525) |
| 0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.1 | GO:2000742 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.0 | 0.1 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.0 | 0.0 | GO:0035549 | positive regulation of interferon-beta secretion(GO:0035549) positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.0 | 0.1 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
| 0.0 | 0.4 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 | 0.1 | GO:0003010 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
| 0.0 | 0.2 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.0 | GO:0072396 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 0.0 | 0.1 | GO:0046070 | dGTP metabolic process(GO:0046070) |
| 0.0 | 0.2 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.0 | 0.0 | GO:0003158 | endothelium development(GO:0003158) |
| 0.0 | 0.5 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.2 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.1 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
| 0.0 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.0 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 | 0.1 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
| 0.0 | 0.0 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 0.2 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.0 | 0.1 | GO:0051715 | cytolysis in other organism(GO:0051715) |
| 0.0 | 0.2 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 | 0.1 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.8 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 0.0 | 0.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.0 | 0.1 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
| 0.0 | 0.4 | GO:0036065 | fucosylation(GO:0036065) |
| 0.0 | 0.5 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
| 0.0 | 0.2 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.3 | GO:0032026 | response to magnesium ion(GO:0032026) |
| 0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 | 0.3 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.0 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 | 0.1 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.0 | 0.1 | GO:0002304 | gamma-delta intraepithelial T cell differentiation(GO:0002304) CD8-positive, gamma-delta intraepithelial T cell differentiation(GO:0002305) |
| 0.0 | 1.8 | GO:0070527 | platelet aggregation(GO:0070527) |
| 0.0 | 0.1 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.1 | GO:0031047 | gene silencing by RNA(GO:0031047) |
| 0.0 | 0.1 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 0.0 | 0.1 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.0 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.3 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.1 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.0 | 1.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.3 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.0 | 0.0 | GO:0021940 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
| 0.0 | 0.1 | GO:0010732 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.0 | 0.6 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.0 | 0.2 | GO:0007130 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
| 0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.0 | 0.2 | GO:2000406 | positive regulation of T cell migration(GO:2000406) |
| 0.0 | 0.0 | GO:2000765 | regulation of cytoplasmic translation(GO:2000765) |
| 0.0 | 0.4 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 3.1 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 0.1 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.0 | 0.4 | GO:0061037 | negative regulation of cartilage development(GO:0061037) |
| 0.0 | 0.1 | GO:0070874 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.0 | 0.7 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 0.0 | 0.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.8 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 | 0.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.1 | GO:0060730 | regulation of intestinal epithelial structure maintenance(GO:0060730) |
| 0.0 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.2 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.0 | 0.2 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) |
| 0.0 | 0.1 | GO:0048205 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.0 | 0.1 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.0 | 0.1 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.0 | 0.1 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.0 | 0.9 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.2 | GO:0036111 | very long-chain fatty-acyl-CoA metabolic process(GO:0036111) |
| 0.0 | 0.2 | GO:0002029 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) adaptation of signaling pathway(GO:0023058) |
| 0.0 | 0.3 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 0.8 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.0 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.0 | 0.1 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
| 0.0 | 0.2 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 0.2 | GO:0098856 | intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.0 | 0.2 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.2 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.8 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 | 0.1 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.0 | 0.1 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.0 | 0.4 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.4 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.0 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.4 | GO:0042220 | response to cocaine(GO:0042220) |
| 0.0 | 0.4 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.2 | GO:0055007 | cardiac muscle cell differentiation(GO:0055007) |
| 0.0 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.4 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.2 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.0 | 0.2 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 | 0.6 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.0 | 0.3 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 | 0.3 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.1 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.0 | 0.5 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.0 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
| 0.0 | 0.3 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.1 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
| 0.0 | 0.2 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.0 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
| 0.0 | 0.1 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.0 | 0.4 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.0 | 0.1 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.0 | 0.0 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 | 0.1 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.0 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.0 | 0.1 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.0 | 0.1 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.0 | 0.1 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.0 | 0.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.1 | GO:0097107 | postsynaptic density assembly(GO:0097107) gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.0 | 0.0 | GO:0050777 | negative regulation of immune response(GO:0050777) |
| 0.0 | 0.2 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.2 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 | 0.5 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.0 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.1 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.0 | 0.1 | GO:0035809 | regulation of urine volume(GO:0035809) |
| 0.0 | 0.7 | GO:1901998 | toxin transport(GO:1901998) |
| 0.0 | 0.1 | GO:0070670 | response to interleukin-4(GO:0070670) cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.0 | 0.9 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.0 | 0.3 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.0 | 0.1 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.0 | 0.1 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.0 | 0.1 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.1 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) |
| 0.0 | 0.1 | GO:0051931 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.0 | 0.2 | GO:0050974 | detection of mechanical stimulus involved in sensory perception(GO:0050974) |
| 0.0 | 0.0 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.0 | 0.1 | GO:0060745 | mammary gland branching involved in pregnancy(GO:0060745) |
| 0.0 | 0.1 | GO:0048749 | compound eye development(GO:0048749) |
| 0.0 | 0.0 | GO:0099563 | modification of synaptic structure(GO:0099563) |
| 0.0 | 0.2 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.1 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.0 | 0.0 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.0 | 0.1 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.0 | 0.5 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
| 0.0 | 0.1 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
| 0.0 | 0.0 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.0 | 0.1 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 | 0.0 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.1 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.0 | 0.1 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.0 | 0.1 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.8 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 | 0.4 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.0 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
| 0.0 | 0.2 | GO:0097012 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 | 0.1 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.0 | 0.1 | GO:1901993 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.0 | 0.1 | GO:0060740 | prostate gland epithelium morphogenesis(GO:0060740) |
| 0.0 | 0.1 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
| 0.0 | 0.0 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
| 0.0 | 0.1 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
| 0.0 | 0.1 | GO:0008210 | estrogen metabolic process(GO:0008210) |
| 0.0 | 0.5 | GO:0048010 | vascular endothelial growth factor receptor signaling pathway(GO:0048010) |
| 0.0 | 0.1 | GO:0090009 | primitive streak formation(GO:0090009) |
| 0.0 | 0.1 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 0.0 | 0.4 | GO:0043304 | regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
| 0.0 | 0.1 | GO:0009213 | pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
| 0.0 | 0.2 | GO:0015816 | glycine transport(GO:0015816) |
| 0.0 | 0.5 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.0 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.0 | 0.1 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 | 0.0 | GO:0098881 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.0 | 0.2 | GO:1905150 | regulation of voltage-gated sodium channel activity(GO:1905150) |
| 0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.0 | 0.8 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.0 | 0.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 | 0.1 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) |
| 0.0 | 0.1 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
| 0.0 | 0.1 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
| 0.0 | 0.0 | GO:0044117 | growth of symbiont in host(GO:0044117) |
| 0.0 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
| 0.0 | 0.2 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 0.0 | 0.2 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.0 | 0.0 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.0 | 0.1 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.0 | 0.5 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.0 | 0.3 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 0.1 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.0 | 0.1 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.0 | 0.1 | GO:0007129 | synapsis(GO:0007129) |
| 0.0 | 0.1 | GO:0098706 | ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.0 | 0.1 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) |
| 0.0 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.3 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.0 | GO:0032692 | negative regulation of interleukin-1 production(GO:0032692) |
| 0.0 | 0.1 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.0 | 0.9 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 | 0.3 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.0 | 0.1 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic diversification of immunoglobulins(GO:0016445) somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 0.1 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 | 0.0 | GO:0003177 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 0.0 | 0.0 | GO:0045646 | regulation of erythrocyte differentiation(GO:0045646) |
| 0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.1 | GO:2000846 | corticosteroid hormone secretion(GO:0035930) regulation of corticosteroid hormone secretion(GO:2000846) |
| 0.0 | 0.2 | GO:2000401 | regulation of lymphocyte migration(GO:2000401) |
| 0.0 | 0.1 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
| 0.0 | 0.1 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.2 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.3 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
| 0.0 | 0.1 | GO:0033320 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.0 | 0.1 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.0 | 0.1 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
| 0.0 | 0.3 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.1 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.0 | 0.1 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.0 | 0.1 | GO:0036309 | protein localization to M-band(GO:0036309) |
| 0.0 | 0.5 | GO:0019730 | antimicrobial humoral response(GO:0019730) |
| 0.0 | 0.2 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.0 | GO:0090087 | regulation of peptide transport(GO:0090087) |
| 0.0 | 0.1 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 0.1 | GO:0000023 | maltose metabolic process(GO:0000023) |
| 0.0 | 0.0 | GO:0046710 | GDP metabolic process(GO:0046710) |
| 0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.2 | GO:0003299 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.0 | 0.1 | GO:0014904 | myotube cell development(GO:0014904) |
| 0.0 | 0.1 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.0 | 0.1 | GO:0051354 | negative regulation of oxidoreductase activity(GO:0051354) |
| 0.0 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.3 | GO:0006986 | response to unfolded protein(GO:0006986) |
| 0.0 | 0.2 | GO:0010629 | negative regulation of gene expression(GO:0010629) |
| 0.0 | 0.1 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
| 0.0 | 0.1 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.3 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.1 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.0 | 0.0 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.0 | 0.1 | GO:0007272 | ensheathment of neurons(GO:0007272) axon ensheathment(GO:0008366) |
| 0.0 | 0.3 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.7 | GO:0032480 | negative regulation of type I interferon production(GO:0032480) |
| 0.0 | 0.0 | GO:0010518 | positive regulation of phospholipase activity(GO:0010518) |
| 0.0 | 0.3 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
| 0.0 | 0.2 | GO:0042742 | defense response to bacterium(GO:0042742) |
| 0.0 | 0.3 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.0 | 0.0 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.0 | 0.1 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
| 0.0 | 0.0 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
| 0.0 | 0.3 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 | 0.1 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.0 | 0.2 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.0 | 0.2 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
| 0.0 | 0.4 | GO:0048512 | rhythmic behavior(GO:0007622) circadian behavior(GO:0048512) |
| 0.0 | 0.0 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
| 0.0 | 0.2 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.1 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.0 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.0 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.0 | 0.1 | GO:0034397 | telomere localization(GO:0034397) |
| 0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.0 | 0.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.0 | 0.0 | GO:0070339 | toll-like receptor TLR1:TLR2 signaling pathway(GO:0038123) toll-like receptor TLR6:TLR2 signaling pathway(GO:0038124) response to bacterial lipopeptide(GO:0070339) cellular response to bacterial lipoprotein(GO:0071220) cellular response to bacterial lipopeptide(GO:0071221) response to diacyl bacterial lipopeptide(GO:0071724) response to triacyl bacterial lipopeptide(GO:0071725) cellular response to diacyl bacterial lipopeptide(GO:0071726) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.0 | 0.1 | GO:0043507 | positive regulation of JUN kinase activity(GO:0043507) |
| 0.0 | 0.0 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.2 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.0 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) regulation of intracellular estrogen receptor signaling pathway(GO:0033146) |
| 0.0 | 0.1 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.0 | 0.0 | GO:0071287 | cellular response to manganese ion(GO:0071287) |
| 0.0 | 0.0 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 0.0 | 0.0 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.0 | 0.2 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.1 | GO:0045046 | protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.1 | GO:0045026 | plasma membrane fusion(GO:0045026) |
| 0.0 | 0.0 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 | 0.2 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.2 | GO:0060324 | face development(GO:0060324) |
| 0.0 | 0.1 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
| 0.0 | 0.2 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
| 0.0 | 0.0 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 1.8 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.0 | 0.1 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.0 | 0.0 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.0 | 0.1 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.0 | 0.0 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.0 | 0.2 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
| 0.0 | 0.0 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.0 | 0.0 | GO:1903452 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
| 0.0 | 0.2 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 | 0.0 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.0 | 0.0 | GO:1903280 | negative regulation of calcium:sodium antiporter activity(GO:1903280) |
| 0.0 | 0.0 | GO:0045210 | FasL biosynthetic process(GO:0045210) |
| 0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.0 | 0.0 | GO:2000257 | regulation of protein activation cascade(GO:2000257) |
| 0.0 | 0.0 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.0 | 0.0 | GO:0002728 | negative regulation of natural killer cell cytokine production(GO:0002728) |
| 0.0 | 0.0 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) |
| 0.0 | 0.0 | GO:0001958 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.7 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.2 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.3 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.0 | GO:0044245 | polysaccharide digestion(GO:0044245) |
| 0.0 | 0.0 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.0 | 0.5 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
| 0.0 | 0.0 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.0 | 0.2 | GO:0001919 | regulation of receptor recycling(GO:0001919) |
| 0.0 | 0.2 | GO:0051798 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
| 0.0 | 0.4 | GO:0007585 | respiratory gaseous exchange(GO:0007585) |
| 0.0 | 0.1 | GO:0040023 | establishment of nucleus localization(GO:0040023) |
| 0.0 | 0.0 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
| 0.0 | 0.0 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.1 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.5 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.4 | 4.4 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.4 | 3.4 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.4 | 1.5 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.4 | 0.4 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.3 | 1.3 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.3 | 1.3 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.3 | 1.3 | GO:0071665 | gamma-catenin-TCF7L2 complex(GO:0071665) |
| 0.3 | 1.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.3 | 0.3 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.3 | 1.4 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.3 | 1.6 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.3 | 1.8 | GO:0090661 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.3 | 1.3 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.2 | 1.2 | GO:0072536 | interleukin-23 receptor complex(GO:0072536) |
| 0.2 | 0.2 | GO:0071010 | prespliceosome(GO:0071010) |
| 0.2 | 0.5 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.2 | 1.7 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.2 | 5.1 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.2 | 0.7 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 0.2 | 0.4 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.2 | 15.3 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.2 | 1.9 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.2 | 0.6 | GO:0009346 | citrate lyase complex(GO:0009346) |
| 0.2 | 0.8 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.2 | 0.6 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
| 0.2 | 0.4 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.2 | 0.7 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.2 | 0.9 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.2 | 0.7 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.2 | 0.7 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.2 | 0.2 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.2 | 1.2 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.2 | 0.5 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.2 | 0.5 | GO:0005584 | collagen type I trimer(GO:0005584) |
| 0.2 | 2.5 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.2 | 1.3 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.2 | 0.7 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.2 | 0.8 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.2 | 0.6 | GO:1990745 | EARP complex(GO:1990745) |
| 0.2 | 0.6 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.2 | 0.9 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.2 | 1.4 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.2 | 0.5 | GO:1990666 | PCSK9-LDLR complex(GO:1990666) |
| 0.2 | 0.5 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.2 | 0.8 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.2 | 1.4 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.1 | 0.6 | GO:1990923 | PET complex(GO:1990923) |
| 0.1 | 0.7 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 1.1 | GO:0097361 | CIA complex(GO:0097361) |
| 0.1 | 0.3 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.1 | 0.4 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 0.4 | GO:0035101 | FACT complex(GO:0035101) |
| 0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 2.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 0.8 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.1 | 0.8 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.1 | 1.6 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.1 | GO:0034665 | integrin alpha1-beta1 complex(GO:0034665) |
| 0.1 | 0.5 | GO:0070938 | contractile ring(GO:0070938) |
| 0.1 | 0.8 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.1 | 2.2 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.1 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.1 | 3.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 0.8 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 0.6 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 2.3 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.1 | 0.2 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.1 | 3.6 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 0.4 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.1 | 0.9 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 2.0 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.1 | 0.3 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.1 | 0.3 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 2.3 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.3 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 1.3 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 2.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.1 | 0.3 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
| 0.1 | 0.4 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.1 | 3.0 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 1.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 2.5 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.1 | 0.3 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.1 | 1.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.1 | 0.4 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.7 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 0.7 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 0.5 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.1 | 0.1 | GO:0031300 | intrinsic component of organelle membrane(GO:0031300) |
| 0.1 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 0.4 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.1 | 0.2 | GO:0030677 | ribonuclease P complex(GO:0030677) |
| 0.1 | 1.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.7 | GO:0002177 | manchette(GO:0002177) |
| 0.1 | 0.1 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 0.1 | 1.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 1.3 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.1 | 0.4 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 0.9 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.1 | GO:0031224 | intrinsic component of membrane(GO:0031224) |
| 0.1 | 0.7 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 1.4 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) nuclear transcriptional repressor complex(GO:0090568) |
| 0.1 | 0.6 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 0.4 | GO:0038038 | G-protein coupled receptor homodimeric complex(GO:0038038) |
| 0.1 | 2.1 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.1 | 0.2 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.1 | 0.4 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.1 | 1.0 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.1 | 0.1 | GO:0097060 | synaptic membrane(GO:0097060) |
| 0.1 | 0.1 | GO:0043614 | multi-eIF complex(GO:0043614) |
| 0.1 | 0.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.1 | 0.7 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.1 | 1.6 | GO:0090543 | Flemming body(GO:0090543) |
| 0.1 | 0.3 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.1 | 0.2 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.1 | 2.3 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.1 | 0.6 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.1 | 2.2 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 0.2 | GO:0033011 | perinuclear theca(GO:0033011) |
| 0.1 | 0.3 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.1 | 0.8 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.2 | GO:0043257 | laminin-8 complex(GO:0043257) |
| 0.1 | 2.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 0.4 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.1 | 0.2 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 0.1 | 0.2 | GO:0036019 | endolysosome(GO:0036019) endolysosome membrane(GO:0036020) |
| 0.1 | 1.9 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.1 | 2.0 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.7 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.1 | 0.2 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.1 | 0.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.1 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 0.4 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 8.1 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 0.3 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.1 | 0.2 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.1 | 6.6 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.1 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.1 | 0.4 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.1 | 0.4 | GO:0031166 | integral component of vacuolar membrane(GO:0031166) |
| 0.1 | 0.2 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.1 | 0.2 | GO:0039714 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
| 0.1 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 1.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.2 | GO:0060187 | cell pole(GO:0060187) |
| 0.1 | 0.7 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 0.7 | GO:0005605 | basal lamina(GO:0005605) |
| 0.1 | 0.2 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.1 | 1.7 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.1 | 0.5 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.1 | 0.7 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.1 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.2 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
| 0.1 | 3.7 | GO:0002102 | podosome(GO:0002102) |
| 0.1 | 0.5 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.1 | 0.7 | GO:0016589 | NURF complex(GO:0016589) |
| 0.1 | 0.1 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 0.6 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 10.8 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.1 | 0.3 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.1 | 0.6 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 0.4 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.1 | 4.0 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 2.4 | GO:0005921 | gap junction(GO:0005921) |
| 0.1 | 1.8 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.1 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.1 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.1 | 0.3 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.1 | 0.8 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.2 | GO:0036027 | protein C inhibitor-TMPRSS7 complex(GO:0036024) protein C inhibitor-TMPRSS11E complex(GO:0036025) protein C inhibitor-PLAT complex(GO:0036026) protein C inhibitor-PLAU complex(GO:0036027) protein C inhibitor-thrombin complex(GO:0036028) protein C inhibitor-KLK3 complex(GO:0036029) protein C inhibitor-plasma kallikrein complex(GO:0036030) serine protease inhibitor complex(GO:0097180) protein C inhibitor-coagulation factor V complex(GO:0097181) protein C inhibitor-coagulation factor Xa complex(GO:0097182) protein C inhibitor-coagulation factor XI complex(GO:0097183) |
| 0.1 | 0.6 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.1 | 0.3 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.1 | 0.5 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.1 | 0.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.1 | 0.1 | GO:0044094 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.1 | 0.3 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 2.2 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.1 | 0.6 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.1 | 0.8 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.9 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.1 | 0.6 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 0.9 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.1 | 0.5 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.1 | 2.2 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.1 | 0.3 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.1 | 0.1 | GO:0005607 | laminin-2 complex(GO:0005607) |
| 0.1 | 0.7 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.1 | 0.2 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.1 | 0.2 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 0.7 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 0.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 0.2 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.1 | 1.5 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.1 | 0.5 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.2 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.0 | 0.4 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.6 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.2 | GO:0032449 | CBM complex(GO:0032449) |
| 0.0 | 0.2 | GO:0097123 | cyclin A1-CDK2 complex(GO:0097123) |
| 0.0 | 0.1 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.0 | 1.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.1 | GO:0043260 | laminin-11 complex(GO:0043260) |
| 0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 7.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.5 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 1.1 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.5 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 0.6 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.6 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 0.4 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.1 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.0 | 0.3 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.8 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 3.4 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.1 | GO:0075341 | host cell PML body(GO:0075341) |
| 0.0 | 0.4 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.1 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.0 | 0.1 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.0 | 1.2 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 0.5 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 1.3 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.2 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.4 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.0 | 0.1 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.0 | 0.8 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.2 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.0 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.5 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.0 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.2 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.0 | 1.1 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.0 | 3.3 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.0 | 0.0 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.0 | 0.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 4.6 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 0.2 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.1 | GO:0030684 | preribosome(GO:0030684) |
| 0.0 | 1.2 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.3 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.0 | 0.1 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 0.2 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.0 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.0 | 0.2 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.0 | 0.1 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 3.0 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.5 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.2 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.0 | 0.0 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.0 | 2.6 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 1.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.4 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 1.2 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.2 | GO:0036338 | viral envelope(GO:0019031) viral membrane(GO:0036338) |
| 0.0 | 0.9 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.0 | 1.1 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.5 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.3 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.1 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.0 | 2.0 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.0 | 0.5 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.1 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 2.7 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.7 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.4 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.0 | 0.4 | GO:0031256 | leading edge membrane(GO:0031256) |
| 0.0 | 0.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.3 | GO:0070083 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
| 0.0 | 3.8 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.0 | 0.1 | GO:0060203 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.0 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.0 | 0.1 | GO:0000243 | commitment complex(GO:0000243) |
| 0.0 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 3.1 | GO:0101002 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.0 | 0.3 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 1.7 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 0.0 | 0.3 | GO:0032838 | cell projection cytoplasm(GO:0032838) axon cytoplasm(GO:1904115) |
| 0.0 | 2.5 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.1 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 1.0 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.4 | GO:0044456 | synapse part(GO:0044456) |
| 0.0 | 0.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 0.3 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.0 | 0.1 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
| 0.0 | 0.6 | GO:0043186 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.0 | 0.1 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.0 | 0.3 | GO:0045261 | proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.0 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.1 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.0 | 0.3 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 1.7 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 37.2 | GO:0005615 | extracellular space(GO:0005615) |
| 0.0 | 0.1 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.1 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.0 | 0.1 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.0 | 0.5 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 2.4 | GO:0031970 | organelle envelope lumen(GO:0031970) |
| 0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.1 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.0 | 0.7 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.3 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.6 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 1.4 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.0 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.3 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.0 | 0.7 | GO:0097546 | ciliary base(GO:0097546) |
| 0.0 | 0.1 | GO:0045177 | apical part of cell(GO:0045177) |
| 0.0 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.0 | GO:0044753 | amphisome(GO:0044753) |
| 0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.0 | GO:0044853 | plasma membrane raft(GO:0044853) |
| 0.0 | 0.1 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.0 | 0.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.3 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 1.2 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.0 | 0.2 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.1 | GO:0005715 | late recombination nodule(GO:0005715) |
| 0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.0 | 2.0 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 1.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.0 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.0 | 0.1 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.0 | 1.0 | GO:0005840 | ribosome(GO:0005840) |
| 0.0 | 0.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.1 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.1 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
| 0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.0 | 0.1 | GO:0032155 | cell division site(GO:0032153) cell division site part(GO:0032155) |
| 0.0 | 0.0 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 1.1 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.1 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.0 | 0.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.1 | GO:0030532 | small nuclear ribonucleoprotein complex(GO:0030532) |
| 0.0 | 1.6 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.1 | GO:0098797 | plasma membrane protein complex(GO:0098797) |
| 0.0 | 0.3 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.1 | GO:0030139 | endocytic vesicle(GO:0030139) |
| 0.0 | 0.4 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.1 | GO:0030658 | transport vesicle membrane(GO:0030658) |
| 0.0 | 0.4 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.0 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.0 | 1.2 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.4 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.8 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 2.6 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.0 | 0.1 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.0 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 1.1 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.4 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 1.2 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 1.7 | GO:0043209 | myelin sheath(GO:0043209) |
| 0.0 | 6.4 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 2.6 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 0.1 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.4 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.1 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.0 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 2.2 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.0 | 0.1 | GO:0031906 | late endosome lumen(GO:0031906) |
| 0.0 | 0.1 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.0 | 0.3 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.0 | 0.1 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.0 | 1.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.0 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
| 0.0 | 0.0 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.0 | 0.0 | GO:0033597 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.0 | 2.9 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.0 | 0.0 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.8 | GO:0044432 | endoplasmic reticulum part(GO:0044432) |
| 0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.0 | 0.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.1 | GO:0008278 | cohesin complex(GO:0008278) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.0 | GO:0031731 | CCR6 chemokine receptor binding(GO:0031731) |
| 0.6 | 7.4 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.6 | 4.9 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.6 | 1.8 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.6 | 2.8 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.6 | 7.8 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.5 | 1.6 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.5 | 2.0 | GO:0034188 | apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 0.5 | 1.4 | GO:0042356 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
| 0.5 | 1.4 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.4 | 1.3 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 0.4 | 1.3 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.4 | 1.3 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 0.4 | 0.4 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.4 | 3.5 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.4 | 2.7 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.4 | 1.1 | GO:0070362 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.4 | 0.4 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.4 | 1.1 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
| 0.3 | 1.0 | GO:0004324 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.3 | 1.0 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.3 | 1.0 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.3 | 1.0 | GO:0052895 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.3 | 1.3 | GO:0008112 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
| 0.3 | 1.3 | GO:0005199 | structural constituent of cell wall(GO:0005199) |
| 0.3 | 1.6 | GO:0015254 | glycerol channel activity(GO:0015254) |
| 0.3 | 0.3 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.3 | 0.9 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
| 0.3 | 0.3 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.3 | 1.2 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.3 | 1.4 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.3 | 1.7 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.3 | 1.4 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.3 | 0.9 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.3 | 4.2 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.3 | 1.9 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
| 0.3 | 1.6 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.3 | 0.8 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.3 | 1.1 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.3 | 1.1 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.3 | 1.3 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.3 | 1.6 | GO:0004797 | thymidine kinase activity(GO:0004797) |
| 0.3 | 1.6 | GO:0047006 | 17-alpha,20-alpha-dihydroxypregn-4-en-3-one dehydrogenase activity(GO:0047006) |
| 0.3 | 1.0 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| 0.3 | 0.8 | GO:0016250 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
| 0.2 | 0.7 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.2 | 1.2 | GO:0042019 | interleukin-23 binding(GO:0042019) interleukin-23 receptor activity(GO:0042020) |
| 0.2 | 1.2 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.2 | 0.7 | GO:0015068 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
| 0.2 | 0.7 | GO:0004794 | L-threonine ammonia-lyase activity(GO:0004794) |
| 0.2 | 2.2 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.2 | 2.4 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.2 | 0.5 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.2 | 0.7 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.2 | 1.6 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.2 | 0.2 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.2 | 0.9 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.2 | 2.0 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.2 | 2.7 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.2 | 1.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.2 | 0.9 | GO:0032406 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.2 | 0.7 | GO:0046969 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
| 0.2 | 0.7 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.2 | 0.7 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 0.2 | 0.9 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.2 | 0.4 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.2 | 1.7 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.2 | 1.1 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
| 0.2 | 1.9 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.2 | 0.6 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
| 0.2 | 0.9 | GO:0019863 | IgE binding(GO:0019863) |
| 0.2 | 3.8 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.2 | 0.8 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.2 | 0.8 | GO:0005522 | profilin binding(GO:0005522) |
| 0.2 | 0.4 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.2 | 0.8 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.2 | 0.2 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.2 | 0.8 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.2 | 0.2 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.2 | 1.0 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.2 | 0.8 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.2 | 0.8 | GO:0061714 | folic acid receptor activity(GO:0061714) |
| 0.2 | 0.8 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.2 | 1.0 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.2 | 1.3 | GO:0008955 | peptidoglycan glycosyltransferase activity(GO:0008955) |
| 0.2 | 1.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.2 | 0.2 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.2 | 1.7 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.2 | 0.9 | GO:0002046 | opsin binding(GO:0002046) |
| 0.2 | 0.6 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
| 0.2 | 0.7 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.2 | 0.9 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.2 | 2.6 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.2 | 3.7 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.2 | 1.6 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.2 | 1.4 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.2 | 0.7 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.2 | 1.8 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.2 | 0.5 | GO:0019778 | Atg12 activating enzyme activity(GO:0019778) Atg8 activating enzyme activity(GO:0019779) |
| 0.2 | 0.3 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.2 | 0.2 | GO:0032089 | NACHT domain binding(GO:0032089) |
| 0.2 | 0.9 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.2 | 1.2 | GO:0016453 | C-acetyltransferase activity(GO:0016453) |
| 0.2 | 0.5 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
| 0.2 | 0.7 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.2 | 2.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.2 | 0.7 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.2 | 0.5 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
| 0.2 | 0.2 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.2 | 0.5 | GO:0016503 | pheromone receptor activity(GO:0016503) |
| 0.2 | 1.3 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.2 | 0.5 | GO:0030617 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) |
| 0.2 | 0.5 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.2 | 0.6 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.2 | 0.6 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.2 | 0.6 | GO:0090409 | malonyl-CoA synthetase activity(GO:0090409) |
| 0.2 | 0.5 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.2 | 0.9 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.2 | 0.5 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.2 | 1.2 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.2 | 0.5 | GO:0001002 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
| 0.2 | 0.8 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.1 | 0.7 | GO:0016896 | exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 0.1 | 4.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 1.0 | GO:0042806 | fucose binding(GO:0042806) |
| 0.1 | 1.3 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.1 | 0.9 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 1.6 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 1.5 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 1.0 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
| 0.1 | 1.3 | GO:0046978 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) |
| 0.1 | 0.4 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.1 | 0.7 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.1 | 2.0 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 1.9 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.5 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 0.8 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 0.4 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.1 | 0.7 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.1 | 0.5 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.1 | 0.4 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
| 0.1 | 0.8 | GO:0004084 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 0.4 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.1 | 0.3 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.1 | 0.4 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.1 | 1.3 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.1 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 0.1 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.1 | 0.8 | GO:0015094 | cadmium ion transmembrane transporter activity(GO:0015086) cobalt ion transmembrane transporter activity(GO:0015087) lead ion transmembrane transporter activity(GO:0015094) ferrous iron uptake transmembrane transporter activity(GO:0015639) |
| 0.1 | 0.6 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.1 | 0.4 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.1 | 0.5 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.1 | 0.5 | GO:0031812 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.1 | 0.2 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.1 | 0.7 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 0.4 | GO:0033192 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.7 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.1 | 3.0 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 0.5 | GO:0016880 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.1 | 0.1 | GO:0016885 | CoA carboxylase activity(GO:0016421) ligase activity, forming carbon-carbon bonds(GO:0016885) |
| 0.1 | 0.5 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.1 | 0.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.4 | GO:0004608 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.1 | 0.1 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.1 | 0.6 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.1 | 1.0 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.1 | 0.7 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.1 | 0.1 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
| 0.1 | 0.5 | GO:0015389 | pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
| 0.1 | 0.5 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 0.2 | GO:0004913 | interleukin-4 receptor activity(GO:0004913) |
| 0.1 | 0.3 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.1 | 1.1 | GO:0003700 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
| 0.1 | 0.5 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.8 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.1 | 1.0 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.1 | 0.4 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.1 | 0.3 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.1 | 1.2 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.8 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.1 | 0.9 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.1 | 0.1 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.1 | 0.3 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.9 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.1 | 0.4 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.1 | 1.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.2 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.1 | 0.5 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.1 | 0.9 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 4.3 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.1 | 2.5 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.1 | 0.5 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.1 | 0.4 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.1 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.1 | 0.5 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.1 | 0.3 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.1 | 0.4 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 0.4 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.1 | 0.5 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.1 | 0.3 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
| 0.1 | 25.3 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.1 | 0.4 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.1 | 0.6 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.1 | 0.3 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.1 | 0.2 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.1 | 8.5 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.1 | 0.4 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.1 | 0.3 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 0.4 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.1 | 1.8 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 2.8 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.4 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 0.3 | GO:0047536 | 2-aminoadipate transaminase activity(GO:0047536) |
| 0.1 | 0.8 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.3 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 0.1 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.1 | 0.4 | GO:0052590 | sn-glycerol-3-phosphate:ubiquinone oxidoreductase activity(GO:0052590) sn-glycerol-3-phosphate:ubiquinone-8 oxidoreductase activity(GO:0052591) |
| 0.1 | 0.9 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 4.0 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 1.0 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.1 | 1.1 | GO:0042910 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
| 0.1 | 0.5 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.3 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
| 0.1 | 0.3 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.1 | 0.6 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.1 | 0.5 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 0.4 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.1 | 0.4 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.1 | 0.8 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.6 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.1 | 1.1 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.1 | 0.9 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.8 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.7 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.1 | 0.9 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.1 | 0.4 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
| 0.1 | 2.0 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.6 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.7 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.1 | 0.3 | GO:0003842 | 1-pyrroline-5-carboxylate dehydrogenase activity(GO:0003842) |
| 0.1 | 0.5 | GO:0005110 | frizzled-2 binding(GO:0005110) |
| 0.1 | 0.3 | GO:0047291 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.1 | 0.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 2.5 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 0.6 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.1 | 0.7 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.1 | 0.4 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.1 | 0.5 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.1 | 0.5 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.1 | 0.1 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.1 | 0.4 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.3 | GO:0086040 | sodium:proton antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086040) |
| 0.1 | 1.7 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 1.0 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.1 | 0.4 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 1.3 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.3 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 0.3 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.1 | 0.3 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.1 | 1.0 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.1 | 0.8 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 3.0 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.1 | 0.8 | GO:0005497 | androgen binding(GO:0005497) |
| 0.1 | 0.8 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 0.3 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.1 | 0.3 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.1 | 0.3 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.1 | 0.9 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 0.2 | GO:0031751 | D4 dopamine receptor binding(GO:0031751) |
| 0.1 | 0.8 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 1.9 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 0.6 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 0.2 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
| 0.1 | 0.3 | GO:0072590 | N-acetyl-L-aspartate-L-glutamate ligase activity(GO:0072590) |
| 0.1 | 2.4 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.1 | 0.6 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.2 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.1 | 0.2 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.1 | 0.3 | GO:0015085 | calcium ion transmembrane transporter activity(GO:0015085) |
| 0.1 | 0.5 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.1 | 0.7 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.1 | 15.9 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.1 | 0.1 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.1 | 0.7 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.1 | 0.7 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.1 | 0.2 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
| 0.1 | 0.5 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.1 | 0.5 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.1 | 2.5 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 0.2 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 0.8 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 0.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.2 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.1 | 0.4 | GO:0052812 | 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) |
| 0.1 | 1.0 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.2 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
| 0.1 | 0.3 | GO:0004641 | phosphoribosylamine-glycine ligase activity(GO:0004637) phosphoribosylformylglycinamidine cyclo-ligase activity(GO:0004641) phosphoribosylglycinamide formyltransferase activity(GO:0004644) |
| 0.1 | 0.2 | GO:0000384 | first spliceosomal transesterification activity(GO:0000384) |
| 0.1 | 0.4 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.1 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.1 | 0.4 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 0.6 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.1 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.1 | 0.2 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.1 | 1.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 0.4 | GO:1903135 | cupric ion binding(GO:1903135) |
| 0.1 | 0.6 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.3 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.1 | 0.7 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.2 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.1 | 0.4 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.1 | 0.3 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.1 | 0.2 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.1 | 3.5 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.1 | 0.4 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.1 | 0.4 | GO:0004447 | iodide peroxidase activity(GO:0004447) |
| 0.1 | 0.2 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.1 | 0.2 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.1 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 1.2 | GO:0035586 | purinergic receptor activity(GO:0035586) |
| 0.1 | 0.5 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.1 | 0.5 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 0.2 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.1 | 0.8 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.1 | 1.9 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.1 | 0.7 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 1.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.1 | 0.5 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 2.2 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.1 | 0.5 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.1 | 0.2 | GO:0031780 | corticotropin hormone receptor binding(GO:0031780) type 5 melanocortin receptor binding(GO:0031783) |
| 0.1 | 0.4 | GO:0017060 | 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase activity(GO:0017060) |
| 0.1 | 0.1 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
| 0.1 | 0.2 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.1 | 0.4 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.1 | 0.4 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.1 | 0.8 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 0.3 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.1 | 0.6 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.1 | 0.6 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 0.2 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.1 | 0.2 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.1 | 0.1 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.1 | 0.1 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.1 | 0.6 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.1 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 0.3 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 0.3 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.1 | 0.6 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.1 | 0.8 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.1 | 0.4 | GO:0099583 | neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.1 | 0.2 | GO:0001007 | transcription factor activity, RNA polymerase III transcription factor binding(GO:0001007) |
| 0.1 | 1.6 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 1.8 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.1 | 0.2 | GO:0070012 | oligopeptidase activity(GO:0070012) |
| 0.1 | 0.3 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.1 | 0.6 | GO:0004465 | lipoprotein lipase activity(GO:0004465) |
| 0.1 | 0.3 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.1 | 1.0 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.1 | 0.7 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 1.6 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.7 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.8 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 0.6 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 0.5 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.1 | 0.2 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.1 | 0.2 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 0.2 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.5 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.1 | 0.2 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.1 | 0.3 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
| 0.1 | 0.3 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.1 | 0.4 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.1 | 1.5 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.1 | 0.2 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.1 | 0.3 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.1 | 0.5 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 0.2 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.1 | 0.4 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.1 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.1 | 0.6 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.4 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.1 | 0.5 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.1 | 0.2 | GO:1904599 | advanced glycation end-product binding(GO:1904599) |
| 0.1 | 0.4 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.8 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 0.4 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.1 | 0.3 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.1 | 0.2 | GO:0009384 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) N-acylmannosamine kinase activity(GO:0009384) |
| 0.1 | 1.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.4 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.1 | GO:0004823 | leucine-tRNA ligase activity(GO:0004823) |
| 0.1 | 3.8 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.1 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.1 | 0.6 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.1 | 0.2 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.1 | 0.4 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.3 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.1 | 0.4 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.1 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.1 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 0.2 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 0.0 | 0.5 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.0 | 0.4 | GO:0008865 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.6 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 1.1 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 4.0 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.2 | GO:0051996 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
| 0.0 | 0.3 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.0 | 0.1 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.0 | 0.3 | GO:0016672 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.0 | 0.1 | GO:0016898 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
| 0.0 | 0.1 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.0 | 0.1 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.0 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.0 | 0.2 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.0 | 0.2 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.0 | 2.6 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.1 | GO:0017136 | NAD-dependent histone deacetylase activity(GO:0017136) |
| 0.0 | 1.7 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.2 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
| 0.0 | 0.4 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.0 | 0.8 | GO:0016918 | retinal binding(GO:0016918) |
| 0.0 | 0.9 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.0 | 1.1 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.5 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.9 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.5 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 1.2 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.5 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.6 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.0 | 0.6 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.0 | 0.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 0.0 | 0.4 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 0.3 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 0.2 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.0 | 0.2 | GO:0016160 | alpha-amylase activity(GO:0004556) amylase activity(GO:0016160) |
| 0.0 | 0.2 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.0 | 0.8 | GO:0030546 | receptor activator activity(GO:0030546) |
| 0.0 | 0.7 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.0 | 0.8 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.0 | 0.5 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.1 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.0 | 0.1 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.6 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.0 | 0.3 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 0.2 | GO:0047787 | delta4-3-oxosteroid 5beta-reductase activity(GO:0047787) |
| 0.0 | 0.4 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.0 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.4 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.7 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.1 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.0 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.0 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.2 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 0.3 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.0 | 1.0 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.2 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.3 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 0.1 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
| 0.0 | 0.5 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 0.2 | GO:0016708 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) fatty acid peroxidase activity(GO:0047888) |
| 0.0 | 0.5 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.8 | GO:0004890 | GABA-A receptor activity(GO:0004890) GABA receptor activity(GO:0016917) |
| 0.0 | 0.2 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.0 | 2.9 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 1.5 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.2 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.0 | 0.0 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.0 | 0.2 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.0 | 0.2 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.0 | 0.5 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.0 | 0.4 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
| 0.0 | 0.2 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.0 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.5 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 1.0 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 1.6 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.0 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 0.1 | GO:0071633 | dihydroceramidase activity(GO:0071633) |
| 0.0 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.0 | 1.1 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.7 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.0 | 0.3 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.0 | 0.6 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 1.3 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 8.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.1 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.0 | 0.1 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.0 | 0.4 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.0 | 0.2 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.0 | 0.2 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.8 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 1.5 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.7 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 1.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.0 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.6 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.0 | 0.2 | GO:0090484 | drug transporter activity(GO:0090484) |
| 0.0 | 0.5 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.0 | 0.2 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.0 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.1 | GO:0050333 | thiamin-triphosphatase activity(GO:0050333) |
| 0.0 | 0.2 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
| 0.0 | 0.2 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.0 | 0.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.4 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.0 | 0.3 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.0 | 0.4 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.4 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.9 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.1 | GO:0001163 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 0.9 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.3 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) lipoprotein particle receptor activity(GO:0030228) |
| 0.0 | 0.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.6 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.0 | 0.3 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.1 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.0 | 0.8 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
| 0.0 | 0.4 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.3 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.0 | 0.3 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
| 0.0 | 0.1 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 0.1 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.0 | 0.7 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.3 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 1.3 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.1 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.0 | 0.1 | GO:0016499 | orexin receptor activity(GO:0016499) |
| 0.0 | 1.3 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.7 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.2 | GO:0016004 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
| 0.0 | 0.0 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.0 | 0.4 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:1990763 | arrestin family protein binding(GO:1990763) |
| 0.0 | 0.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.1 | GO:0019206 | deoxynucleoside kinase activity(GO:0019136) nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 1.2 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.1 | GO:0023024 | MHC class I protein complex binding(GO:0023024) |
| 0.0 | 1.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 0.1 | GO:0008066 | glutamate receptor activity(GO:0008066) |
| 0.0 | 0.3 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 1.1 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.1 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.0 | 0.1 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
| 0.0 | 0.1 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.0 | 0.3 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.1 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.1 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 0.0 | 0.4 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.0 | 0.1 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.0 | 0.1 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 0.7 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.3 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.0 | 0.3 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.5 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.0 | 0.5 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.1 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.0 | 0.9 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.4 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.0 | 0.1 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
| 0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.9 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.0 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.0 | 0.1 | GO:0047946 | glutamine N-acyltransferase activity(GO:0047946) |
| 0.0 | 0.2 | GO:0033989 | 3alpha,7alpha,12alpha-trihydroxy-5beta-cholest-24-enoyl-CoA hydratase activity(GO:0033989) 17-beta-hydroxysteroid dehydrogenase (NAD+) activity(GO:0044594) |
| 0.0 | 0.2 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.2 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 1.0 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 1.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0031072 | heat shock protein binding(GO:0031072) |
| 0.0 | 0.1 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.0 | 0.2 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.0 | 0.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 2.2 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 2.3 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.2 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.0 | 0.3 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.1 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.0 | 0.1 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.0 | 0.5 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.0 | 0.2 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.1 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 0.4 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 0.1 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.0 | 0.1 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.0 | 0.0 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.4 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.8 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 1.4 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.1 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
| 0.0 | 0.2 | GO:0005549 | odorant binding(GO:0005549) |
| 0.0 | 0.1 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.0 | 4.3 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 1.0 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 1.1 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.1 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.0 | 1.9 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) |
| 0.0 | 0.1 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
| 0.0 | 0.1 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.0 | 0.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.0 | 0.1 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.0 | 0.2 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.0 | 0.2 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.0 | 0.0 | GO:0050997 | quaternary ammonium group binding(GO:0050997) |
| 0.0 | 0.5 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 2.4 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.1 | GO:0004452 | isopentenyl-diphosphate delta-isomerase activity(GO:0004452) |
| 0.0 | 0.4 | GO:0005319 | lipid transporter activity(GO:0005319) |
| 0.0 | 0.0 | GO:0022829 | wide pore channel activity(GO:0022829) |
| 0.0 | 0.1 | GO:0004057 | arginyltransferase activity(GO:0004057) |
| 0.0 | 0.1 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.0 | 0.1 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.0 | 0.2 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.0 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.1 | GO:0072510 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
| 0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.1 | GO:0070026 | nitric oxide binding(GO:0070026) |
| 0.0 | 0.4 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 0.8 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.0 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.0 | 0.4 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.0 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 2.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.1 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.0 | 0.1 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.0 | 0.1 | GO:0009881 | G-protein coupled photoreceptor activity(GO:0008020) photoreceptor activity(GO:0009881) |
| 0.0 | 8.6 | GO:0005198 | structural molecule activity(GO:0005198) |
| 0.0 | 0.0 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 0.0 | 0.3 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.8 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.0 | 7.3 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.0 | 0.1 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 1.5 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.1 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.0 | 0.1 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.0 | 0.1 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
| 0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.1 | GO:0050308 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
| 0.0 | 0.0 | GO:0015322 | proton-dependent oligopeptide secondary active transmembrane transporter activity(GO:0005427) secondary active oligopeptide transmembrane transporter activity(GO:0015322) |
| 0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.0 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.0 | 0.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.1 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.1 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
| 0.0 | 0.2 | GO:0016773 | phosphotransferase activity, alcohol group as acceptor(GO:0016773) |
| 0.0 | 0.1 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.0 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
| 0.0 | 0.0 | GO:0010851 | cyclase regulator activity(GO:0010851) guanylate cyclase regulator activity(GO:0030249) |
| 0.0 | 0.1 | GO:0003920 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.0 | 0.0 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.1 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.1 | GO:0035254 | glutamate receptor binding(GO:0035254) |
| 0.0 | 0.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.0 | 0.5 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 0.4 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.0 | 0.0 | GO:0005124 | scavenger receptor binding(GO:0005124) |
| 0.0 | 0.0 | GO:0008513 | secondary active organic cation transmembrane transporter activity(GO:0008513) |
| 0.0 | 0.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.3 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.0 | GO:0070123 | transforming growth factor beta receptor activity, type III(GO:0070123) |
| 0.0 | 0.2 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.0 | 0.1 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.1 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.0 | 0.0 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.0 | 0.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.0 | 0.0 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.5 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.0 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.0 | 0.1 | GO:0042834 | peptidoglycan binding(GO:0042834) |
| 0.0 | 0.0 | GO:0051861 | glycolipid binding(GO:0051861) |
| 0.0 | 0.0 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.1 | GO:0047298 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.0 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.2 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 0.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.0 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.2 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
| 0.0 | 1.6 | GO:0035591 | signaling adaptor activity(GO:0035591) |
| 0.0 | 0.2 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.1 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.4 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.1 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.2 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.1 | GO:0008556 | sodium:potassium-exchanging ATPase activity(GO:0005391) potassium-transporting ATPase activity(GO:0008556) |
| 0.0 | 0.4 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.1 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.0 | 0.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.0 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.0 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.0 | 0.6 | GO:0003823 | antigen binding(GO:0003823) |
| 0.0 | 0.0 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.1 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.2 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.1 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.2 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.1 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.1 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.2 | 8.5 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.1 | 0.4 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.1 | 7.4 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 1.5 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 1.2 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 4.7 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.1 | 38.5 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.1 | 0.8 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 3.6 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 0.9 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.1 | 5.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 1.9 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 1.5 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 1.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 0.3 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 0.9 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 4.0 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.1 | 0.5 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.1 | 1.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.1 | 1.2 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 1.6 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 1.3 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.1 | 0.7 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.1 | 1.0 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 0.6 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 3.0 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.7 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 3.9 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 1.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 1.5 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 3.0 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.9 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 1.3 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 0.8 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 1.2 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 2.7 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 1.8 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 3.2 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 0.3 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.0 | 0.8 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 1.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 6.2 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.7 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 1.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 1.4 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 1.8 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 1.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 1.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.9 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.6 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 1.7 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 1.0 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 1.1 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.3 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 6.7 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 2.0 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 2.0 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 1.2 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 1.3 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.6 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.6 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 2.0 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.6 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.7 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.5 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 0.5 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.5 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.2 | PID EPO PATHWAY | EPO signaling pathway |
| 0.0 | 0.2 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.6 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 0.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.3 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.8 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.0 | 1.2 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 1.8 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.3 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.7 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.4 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.3 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.0 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.6 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 3.0 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
| 0.0 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.5 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.2 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 36.3 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.4 | 1.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.3 | 4.8 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.2 | 10.1 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.2 | 0.4 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.1 | 6.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.1 | 4.2 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.1 | 1.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 1.3 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 1.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.1 | 2.8 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.1 | 2.3 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.1 | 1.1 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 8.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.1 | 1.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.1 | 1.6 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.1 | 3.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 4.0 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 1.8 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 1.9 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 1.3 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 1.7 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.1 | 1.6 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 1.4 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 6.5 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 0.2 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.1 | 0.5 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.1 | 4.5 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.1 | 0.9 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.1 | 1.9 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 2.6 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.1 | 1.4 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.1 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.1 | 0.6 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.1 | 1.1 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 1.2 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.1 | 1.5 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 1.8 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
| 0.1 | 0.7 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.1 | 2.2 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 2.0 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 2.5 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.1 | 5.3 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.1 | 1.6 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 1.8 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.1 | 0.2 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
| 0.1 | 2.2 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.1 | 0.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.1 | 0.1 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
| 0.1 | 10.6 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.1 | 0.4 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.1 | 0.6 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.1 | 0.7 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 4.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 9.0 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 0.3 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.1 | 1.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 1.4 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 1.4 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.1 | 0.9 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 2.5 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.4 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.0 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 1.8 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 2.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.1 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.7 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
| 0.0 | 0.4 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 0.8 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.2 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 1.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 1.0 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 3.0 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.0 | 0.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 0.8 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.0 | 0.7 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 1.4 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 1.8 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.0 | 0.0 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.5 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.3 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.3 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.8 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 2.1 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.0 | 1.7 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.5 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.3 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.7 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.7 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.3 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.8 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.0 | 2.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.1 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.4 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.0 | 0.8 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.8 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 0.2 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 0.4 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 1.2 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 0.1 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
| 0.0 | 0.4 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.0 | 4.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.4 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 1.1 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.4 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.0 | 0.6 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.3 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 0.9 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 2.3 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.2 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 1.0 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.8 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.6 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.0 | 0.3 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.9 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 1.1 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.1 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.7 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.7 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 1.5 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
| 0.0 | 2.1 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.7 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.4 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.2 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 1.8 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.6 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.0 | 0.3 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.4 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.2 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.0 | 0.0 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.0 | 0.5 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 1.1 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.7 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.2 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.5 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 1.0 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.5 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 1.7 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.6 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 1.4 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.3 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |