NHBE cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
ID4
|
ENSG00000172201.6 | inhibitor of DNA binding 4, HLH protein |
|
TCF4
|
ENSG00000196628.9 | transcription factor 4 |
|
SNAI2
|
ENSG00000019549.4 | snail family transcriptional repressor 2 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TCF4 | hg19_v2_chr18_-_53257027_53257052 | -0.95 | 3.8e-03 | Click! |
| SNAI2 | hg19_v2_chr8_-_49834299_49834446 | -0.29 | 5.7e-01 | Click! |
| ID4 | hg19_v2_chr6_+_19837592_19837621 | -0.17 | 7.5e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr2_-_241835561 | 2.49 |
ENST00000388934.4
|
C2orf54
|
chromosome 2 open reading frame 54 |
| chr1_-_47655686 | 1.75 |
ENST00000294338.2
|
PDZK1IP1
|
PDZK1 interacting protein 1 |
| chrX_+_115567767 | 1.65 |
ENST00000371900.4
|
SLC6A14
|
solute carrier family 6 (amino acid transporter), member 14 |
| chr16_-_74808710 | 1.54 |
ENST00000219368.3
ENST00000544337.1 |
FA2H
|
fatty acid 2-hydroxylase |
| chr16_+_88704978 | 1.52 |
ENST00000244241.4
|
IL17C
|
interleukin 17C |
| chr22_-_50970506 | 1.46 |
ENST00000428989.2
ENST00000403326.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr11_-_615570 | 1.45 |
ENST00000525445.1
ENST00000348655.6 ENST00000397566.1 |
IRF7
|
interferon regulatory factor 7 |
| chr6_-_160148356 | 1.43 |
ENST00000401980.3
ENST00000545162.1 |
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr6_-_31550192 | 1.30 |
ENST00000429299.2
ENST00000446745.2 |
LTB
|
lymphotoxin beta (TNF superfamily, member 3) |
| chr17_+_77021702 | 1.27 |
ENST00000392445.2
ENST00000354124.3 |
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr1_-_153066998 | 1.26 |
ENST00000368750.3
|
SPRR2E
|
small proline-rich protein 2E |
| chr11_+_45944190 | 1.25 |
ENST00000401752.1
ENST00000389968.3 ENST00000325468.5 ENST00000536139.1 |
GYLTL1B
|
glycosyltransferase-like 1B |
| chr19_+_46732988 | 1.24 |
ENST00000437936.1
|
IGFL1
|
IGF-like family member 1 |
| chr1_-_153113927 | 1.21 |
ENST00000368752.4
|
SPRR2B
|
small proline-rich protein 2B |
| chr1_+_37940153 | 1.20 |
ENST00000373087.6
|
ZC3H12A
|
zinc finger CCCH-type containing 12A |
| chr2_+_74212073 | 1.18 |
ENST00000441217.1
|
AC073046.25
|
AC073046.25 |
| chr12_-_49259643 | 1.18 |
ENST00000309739.5
|
RND1
|
Rho family GTPase 1 |
| chr2_+_113735575 | 1.17 |
ENST00000376489.2
ENST00000259205.4 |
IL36G
|
interleukin 36, gamma |
| chr7_+_149416439 | 1.13 |
ENST00000497895.1
|
KRBA1
|
KRAB-A domain containing 1 |
| chr19_+_6464502 | 1.11 |
ENST00000308243.7
|
CRB3
|
crumbs homolog 3 (Drosophila) |
| chr6_-_160147925 | 1.10 |
ENST00000535561.1
|
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr22_-_50970566 | 1.07 |
ENST00000405135.1
ENST00000401779.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr11_+_102188224 | 1.07 |
ENST00000263464.3
|
BIRC3
|
baculoviral IAP repeat containing 3 |
| chr18_+_61564389 | 0.98 |
ENST00000397996.2
ENST00000418725.1 |
SERPINB10
|
serpin peptidase inhibitor, clade B (ovalbumin), member 10 |
| chr16_+_771663 | 0.98 |
ENST00000568916.1
|
FAM173A
|
family with sequence similarity 173, member A |
| chr19_+_6464243 | 0.96 |
ENST00000600229.1
ENST00000356762.3 |
CRB3
|
crumbs homolog 3 (Drosophila) |
| chr1_-_27998689 | 0.94 |
ENST00000339145.4
ENST00000362020.4 ENST00000361157.6 |
IFI6
|
interferon, alpha-inducible protein 6 |
| chr2_+_228678550 | 0.93 |
ENST00000409189.3
ENST00000358813.4 |
CCL20
|
chemokine (C-C motif) ligand 20 |
| chr11_-_1619524 | 0.91 |
ENST00000412090.1
|
KRTAP5-2
|
keratin associated protein 5-2 |
| chr6_-_133055896 | 0.85 |
ENST00000367927.5
ENST00000425515.2 ENST00000207771.3 ENST00000392393.3 ENST00000450865.2 ENST00000392394.2 |
VNN3
|
vanin 3 |
| chr21_+_42792442 | 0.85 |
ENST00000398600.2
|
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr11_+_102188272 | 0.83 |
ENST00000532808.1
|
BIRC3
|
baculoviral IAP repeat containing 3 |
| chr14_+_95078714 | 0.83 |
ENST00000393078.3
ENST00000393080.4 ENST00000467132.1 |
SERPINA3
|
serpin peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 3 |
| chr6_-_133055815 | 0.81 |
ENST00000509351.1
ENST00000417437.2 ENST00000414302.2 ENST00000423615.2 ENST00000427187.2 ENST00000275223.3 ENST00000519686.2 |
VNN3
|
vanin 3 |
| chr5_-_150466692 | 0.81 |
ENST00000315050.7
ENST00000523338.1 ENST00000522100.1 |
TNIP1
|
TNFAIP3 interacting protein 1 |
| chr7_+_76109827 | 0.80 |
ENST00000446820.2
|
DTX2
|
deltex homolog 2 (Drosophila) |
| chr20_+_44035200 | 0.80 |
ENST00000372717.1
ENST00000360981.4 |
DBNDD2
|
dysbindin (dystrobrevin binding protein 1) domain containing 2 |
| chr17_+_73521763 | 0.79 |
ENST00000167462.5
ENST00000375227.4 ENST00000392550.3 ENST00000578363.1 ENST00000579392.1 |
LLGL2
|
lethal giant larvae homolog 2 (Drosophila) |
| chr1_-_1009683 | 0.79 |
ENST00000453464.2
|
RNF223
|
ring finger protein 223 |
| chr5_+_443280 | 0.79 |
ENST00000508022.1
|
EXOC3
|
exocyst complex component 3 |
| chr11_+_93754513 | 0.77 |
ENST00000315765.9
|
HEPHL1
|
hephaestin-like 1 |
| chr11_+_69061594 | 0.76 |
ENST00000441339.2
ENST00000308946.3 ENST00000535407.1 |
MYEOV
|
myeloma overexpressed |
| chr6_-_47445214 | 0.74 |
ENST00000604014.1
|
RP11-385F7.1
|
RP11-385F7.1 |
| chr5_-_150467221 | 0.73 |
ENST00000522226.1
|
TNIP1
|
TNFAIP3 interacting protein 1 |
| chr8_+_145438870 | 0.72 |
ENST00000527931.1
|
FAM203B
|
family with sequence similarity 203, member B |
| chr7_+_44788430 | 0.71 |
ENST00000457123.1
ENST00000309315.4 |
ZMIZ2
|
zinc finger, MIZ-type containing 2 |
| chr1_-_153013588 | 0.71 |
ENST00000360379.3
|
SPRR2D
|
small proline-rich protein 2D |
| chr1_-_1850697 | 0.70 |
ENST00000378598.4
ENST00000416272.1 ENST00000310991.3 |
TMEM52
|
transmembrane protein 52 |
| chr9_-_86955598 | 0.70 |
ENST00000376238.4
|
SLC28A3
|
solute carrier family 28 (concentrative nucleoside transporter), member 3 |
| chr19_+_18747775 | 0.67 |
ENST00000300976.4
ENST00000595182.1 ENST00000599006.1 |
KLHL26
|
kelch-like family member 26 |
| chr11_-_65667884 | 0.66 |
ENST00000448083.2
ENST00000531493.1 ENST00000532401.1 |
FOSL1
|
FOS-like antigen 1 |
| chr2_-_241836298 | 0.66 |
ENST00000414499.1
|
C2orf54
|
chromosome 2 open reading frame 54 |
| chr22_+_31090793 | 0.66 |
ENST00000332585.6
ENST00000382310.3 ENST00000446658.2 |
OSBP2
|
oxysterol binding protein 2 |
| chr21_+_42798094 | 0.66 |
ENST00000398598.3
ENST00000455164.2 ENST00000424365.1 |
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr2_-_133427767 | 0.65 |
ENST00000397463.2
|
LYPD1
|
LY6/PLAUR domain containing 1 |
| chr1_+_152486950 | 0.64 |
ENST00000368790.3
|
CRCT1
|
cysteine-rich C-terminal 1 |
| chr11_-_65667997 | 0.63 |
ENST00000312562.2
ENST00000534222.1 |
FOSL1
|
FOS-like antigen 1 |
| chr11_-_615942 | 0.63 |
ENST00000397562.3
ENST00000330243.5 ENST00000397570.1 ENST00000397574.2 |
IRF7
|
interferon regulatory factor 7 |
| chr6_-_3227877 | 0.61 |
ENST00000259818.7
|
TUBB2B
|
tubulin, beta 2B class IIb |
| chr21_+_39628780 | 0.61 |
ENST00000417042.1
|
KCNJ15
|
potassium inwardly-rectifying channel, subfamily J, member 15 |
| chr11_-_18258342 | 0.61 |
ENST00000278222.4
|
SAA4
|
serum amyloid A4, constitutive |
| chr14_+_105927191 | 0.60 |
ENST00000550551.1
|
MTA1
|
metastasis associated 1 |
| chr10_+_102891048 | 0.60 |
ENST00000467928.2
|
TLX1
|
T-cell leukemia homeobox 1 |
| chr12_-_48276710 | 0.58 |
ENST00000550314.1
|
VDR
|
vitamin D (1,25- dihydroxyvitamin D3) receptor |
| chr17_-_72968809 | 0.58 |
ENST00000530857.1
ENST00000425042.2 |
HID1
|
HID1 domain containing |
| chr19_+_34895289 | 0.58 |
ENST00000246535.3
|
PDCD2L
|
programmed cell death 2-like |
| chr4_-_54457783 | 0.58 |
ENST00000263925.7
ENST00000512247.1 |
LNX1
|
ligand of numb-protein X 1, E3 ubiquitin protein ligase |
| chr1_-_153348067 | 0.58 |
ENST00000368737.3
|
S100A12
|
S100 calcium binding protein A12 |
| chr11_+_64004888 | 0.57 |
ENST00000541681.1
|
VEGFB
|
vascular endothelial growth factor B |
| chr4_-_74964904 | 0.56 |
ENST00000508487.2
|
CXCL2
|
chemokine (C-X-C motif) ligand 2 |
| chr19_+_40873617 | 0.55 |
ENST00000599353.1
|
PLD3
|
phospholipase D family, member 3 |
| chr19_+_49055332 | 0.55 |
ENST00000201586.2
|
SULT2B1
|
sulfotransferase family, cytosolic, 2B, member 1 |
| chr14_-_55369525 | 0.55 |
ENST00000543643.2
ENST00000536224.2 ENST00000395514.1 ENST00000491895.2 |
GCH1
|
GTP cyclohydrolase 1 |
| chr22_+_38609538 | 0.54 |
ENST00000407965.1
|
MAFF
|
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog F |
| chr3_+_111393501 | 0.54 |
ENST00000393934.3
|
PLCXD2
|
phosphatidylinositol-specific phospholipase C, X domain containing 2 |
| chr14_-_50999373 | 0.54 |
ENST00000554273.1
|
MAP4K5
|
mitogen-activated protein kinase kinase kinase kinase 5 |
| chr1_+_6508571 | 0.54 |
ENST00000478323.1
|
ESPN
|
espin |
| chr17_-_39942322 | 0.54 |
ENST00000449889.1
ENST00000465293.1 |
JUP
|
junction plakoglobin |
| chr2_-_241831424 | 0.53 |
ENST00000402775.2
ENST00000307486.8 |
C2orf54
|
chromosome 2 open reading frame 54 |
| chr1_-_153433120 | 0.53 |
ENST00000368723.3
|
S100A7
|
S100 calcium binding protein A7 |
| chr2_-_241396106 | 0.53 |
ENST00000404891.1
|
AC110619.2
|
Uncharacterized protein |
| chr11_+_44587141 | 0.52 |
ENST00000227155.4
ENST00000342935.3 ENST00000532544.1 |
CD82
|
CD82 molecule |
| chr16_+_4784273 | 0.52 |
ENST00000299320.5
ENST00000586724.1 |
C16orf71
|
chromosome 16 open reading frame 71 |
| chr19_+_39647271 | 0.51 |
ENST00000599657.1
|
PAK4
|
p21 protein (Cdc42/Rac)-activated kinase 4 |
| chr8_-_145086922 | 0.50 |
ENST00000530478.1
|
PARP10
|
poly (ADP-ribose) polymerase family, member 10 |
| chr12_-_25150373 | 0.50 |
ENST00000549828.1
|
C12orf77
|
chromosome 12 open reading frame 77 |
| chr7_-_752577 | 0.50 |
ENST00000544935.1
ENST00000430040.1 ENST00000456696.2 ENST00000406797.1 |
PRKAR1B
|
protein kinase, cAMP-dependent, regulatory, type I, beta |
| chr11_-_31531121 | 0.49 |
ENST00000532287.1
ENST00000526776.1 ENST00000534812.1 ENST00000529749.1 ENST00000278200.1 ENST00000530023.1 ENST00000533642.1 |
IMMP1L
|
IMP1 inner mitochondrial membrane peptidase-like (S. cerevisiae) |
| chr15_-_80263506 | 0.49 |
ENST00000335661.6
|
BCL2A1
|
BCL2-related protein A1 |
| chr16_+_3115378 | 0.49 |
ENST00000529550.1
ENST00000551122.1 ENST00000525643.2 ENST00000548807.1 ENST00000528163.2 |
IL32
|
interleukin 32 |
| chr17_+_77020325 | 0.49 |
ENST00000311661.4
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr12_+_113376157 | 0.49 |
ENST00000228928.7
|
OAS3
|
2'-5'-oligoadenylate synthetase 3, 100kDa |
| chr7_-_994302 | 0.48 |
ENST00000265846.5
|
ADAP1
|
ArfGAP with dual PH domains 1 |
| chr17_-_47925379 | 0.48 |
ENST00000352793.2
ENST00000334568.4 ENST00000398154.1 ENST00000436235.1 ENST00000326219.5 |
TAC4
|
tachykinin 4 (hemokinin) |
| chr3_-_111314230 | 0.48 |
ENST00000317012.4
|
ZBED2
|
zinc finger, BED-type containing 2 |
| chr7_-_73184588 | 0.48 |
ENST00000395145.2
|
CLDN3
|
claudin 3 |
| chr12_-_89918982 | 0.48 |
ENST00000549504.1
|
POC1B
|
POC1 centriolar protein B |
| chr19_-_37178284 | 0.47 |
ENST00000425254.2
ENST00000590952.1 ENST00000433232.1 |
AC074138.3
|
AC074138.3 |
| chr4_+_74606223 | 0.47 |
ENST00000307407.3
ENST00000401931.1 |
IL8
|
interleukin 8 |
| chr1_+_10057274 | 0.47 |
ENST00000294435.7
|
RBP7
|
retinol binding protein 7, cellular |
| chr18_+_66382428 | 0.47 |
ENST00000578970.1
ENST00000582371.1 ENST00000584775.1 |
CCDC102B
|
coiled-coil domain containing 102B |
| chr6_+_106534192 | 0.47 |
ENST00000369091.2
ENST00000369096.4 |
PRDM1
|
PR domain containing 1, with ZNF domain |
| chr16_+_89989687 | 0.46 |
ENST00000315491.7
ENST00000555576.1 ENST00000554336.1 ENST00000553967.1 |
TUBB3
|
Tubulin beta-3 chain |
| chr14_+_96949319 | 0.46 |
ENST00000554706.1
|
AK7
|
adenylate kinase 7 |
| chr3_+_49059038 | 0.46 |
ENST00000451378.2
|
NDUFAF3
|
NADH dehydrogenase (ubiquinone) complex I, assembly factor 3 |
| chr14_+_77582905 | 0.46 |
ENST00000557408.1
|
TMEM63C
|
transmembrane protein 63C |
| chr12_+_122667658 | 0.46 |
ENST00000339777.4
ENST00000425921.1 |
LRRC43
|
leucine rich repeat containing 43 |
| chr9_+_33795533 | 0.46 |
ENST00000379405.3
|
PRSS3
|
protease, serine, 3 |
| chr16_+_811073 | 0.46 |
ENST00000382862.3
ENST00000563651.1 |
MSLN
|
mesothelin |
| chr16_+_3062457 | 0.46 |
ENST00000445369.2
|
CLDN9
|
claudin 9 |
| chr4_-_74904398 | 0.46 |
ENST00000296026.4
|
CXCL3
|
chemokine (C-X-C motif) ligand 3 |
| chr17_+_77030267 | 0.45 |
ENST00000581774.1
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr17_+_77020224 | 0.45 |
ENST00000339142.2
|
C1QTNF1
|
C1q and tumor necrosis factor related protein 1 |
| chr14_+_21492331 | 0.45 |
ENST00000533984.1
ENST00000532213.2 |
AL161668.5
|
AL161668.5 |
| chr6_-_160166218 | 0.45 |
ENST00000537657.1
|
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr14_+_66578299 | 0.45 |
ENST00000554187.1
ENST00000556662.1 ENST00000556291.1 ENST00000557723.1 ENST00000557050.1 |
RP11-783L4.1
|
RP11-783L4.1 |
| chr19_-_43835582 | 0.44 |
ENST00000595748.1
|
CTC-490G23.2
|
CTC-490G23.2 |
| chr21_+_42797958 | 0.44 |
ENST00000419044.1
|
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr2_+_64681219 | 0.43 |
ENST00000238875.5
|
LGALSL
|
lectin, galactoside-binding-like |
| chr18_+_47088401 | 0.43 |
ENST00000261292.4
ENST00000427224.2 ENST00000580036.1 |
LIPG
|
lipase, endothelial |
| chr14_+_103592636 | 0.43 |
ENST00000333007.1
|
TNFAIP2
|
tumor necrosis factor, alpha-induced protein 2 |
| chr12_+_113354341 | 0.43 |
ENST00000553152.1
|
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chrX_-_152939252 | 0.43 |
ENST00000340888.3
|
PNCK
|
pregnancy up-regulated nonubiquitous CaM kinase |
| chr20_+_44637526 | 0.43 |
ENST00000372330.3
|
MMP9
|
matrix metallopeptidase 9 (gelatinase B, 92kDa gelatinase, 92kDa type IV collagenase) |
| chr16_+_30387141 | 0.43 |
ENST00000566955.1
|
MYLPF
|
myosin light chain, phosphorylatable, fast skeletal muscle |
| chr22_+_31489344 | 0.43 |
ENST00000404574.1
|
SMTN
|
smoothelin |
| chr12_-_62653903 | 0.42 |
ENST00000552075.1
|
FAM19A2
|
family with sequence similarity 19 (chemokine (C-C motif)-like), member A2 |
| chr16_-_4039001 | 0.42 |
ENST00000576936.1
|
ADCY9
|
adenylate cyclase 9 |
| chr17_+_41158742 | 0.42 |
ENST00000415816.2
ENST00000438323.2 |
IFI35
|
interferon-induced protein 35 |
| chr19_-_49118067 | 0.42 |
ENST00000593772.1
|
FAM83E
|
family with sequence similarity 83, member E |
| chr9_+_91150016 | 0.42 |
ENST00000375854.3
ENST00000375855.3 |
NXNL2
|
nucleoredoxin-like 2 |
| chr1_+_10490127 | 0.41 |
ENST00000602787.1
ENST00000602296.1 ENST00000400900.2 |
APITD1
APITD1-CORT
|
apoptosis-inducing, TAF9-like domain 1 APITD1-CORT readthrough |
| chr16_-_2770216 | 0.41 |
ENST00000302641.3
|
PRSS27
|
protease, serine 27 |
| chr8_-_144654918 | 0.41 |
ENST00000529971.1
|
MROH6
|
maestro heat-like repeat family member 6 |
| chr1_-_153363452 | 0.41 |
ENST00000368732.1
ENST00000368733.3 |
S100A8
|
S100 calcium binding protein A8 |
| chr1_+_2160134 | 0.41 |
ENST00000378536.4
|
SKI
|
v-ski avian sarcoma viral oncogene homolog |
| chr7_-_8302298 | 0.41 |
ENST00000446305.1
|
ICA1
|
islet cell autoantigen 1, 69kDa |
| chr11_+_107650219 | 0.40 |
ENST00000398067.1
|
AP001024.1
|
Uncharacterized protein |
| chr20_+_43803517 | 0.40 |
ENST00000243924.3
|
PI3
|
peptidase inhibitor 3, skin-derived |
| chr1_-_11118896 | 0.40 |
ENST00000465788.1
|
SRM
|
spermidine synthase |
| chr19_+_50691437 | 0.40 |
ENST00000598205.1
|
MYH14
|
myosin, heavy chain 14, non-muscle |
| chr8_+_126010739 | 0.40 |
ENST00000523430.1
ENST00000265896.5 |
SQLE
|
squalene epoxidase |
| chr22_-_50970919 | 0.40 |
ENST00000329363.4
ENST00000437588.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr6_-_133035185 | 0.40 |
ENST00000367928.4
|
VNN1
|
vanin 1 |
| chr19_+_46531127 | 0.40 |
ENST00000601033.1
|
CTC-344H19.4
|
CTC-344H19.4 |
| chr6_+_31895480 | 0.40 |
ENST00000418949.2
ENST00000383177.3 ENST00000477310.1 |
C2
CFB
|
complement component 2 Complement factor B; Uncharacterized protein; cDNA FLJ55673, highly similar to Complement factor B |
| chr19_+_2096868 | 0.40 |
ENST00000395296.1
ENST00000395301.3 |
IZUMO4
|
IZUMO family member 4 |
| chr3_+_167453493 | 0.40 |
ENST00000295777.5
ENST00000472747.2 |
SERPINI1
|
serpin peptidase inhibitor, clade I (neuroserpin), member 1 |
| chr17_+_7942424 | 0.40 |
ENST00000573359.1
|
ALOX15B
|
arachidonate 15-lipoxygenase, type B |
| chr16_-_3086927 | 0.39 |
ENST00000572449.1
|
CCDC64B
|
coiled-coil domain containing 64B |
| chr6_-_2842219 | 0.39 |
ENST00000380739.5
|
SERPINB1
|
serpin peptidase inhibitor, clade B (ovalbumin), member 1 |
| chr13_-_20767037 | 0.39 |
ENST00000382848.4
|
GJB2
|
gap junction protein, beta 2, 26kDa |
| chr3_+_14474178 | 0.39 |
ENST00000452775.1
|
SLC6A6
|
solute carrier family 6 (neurotransmitter transporter), member 6 |
| chr11_-_417308 | 0.39 |
ENST00000397632.3
ENST00000382520.2 |
SIGIRR
|
single immunoglobulin and toll-interleukin 1 receptor (TIR) domain |
| chr7_-_2883928 | 0.39 |
ENST00000275364.3
|
GNA12
|
guanine nucleotide binding protein (G protein) alpha 12 |
| chr2_-_165477971 | 0.39 |
ENST00000446413.2
|
GRB14
|
growth factor receptor-bound protein 14 |
| chr16_-_4784128 | 0.39 |
ENST00000592711.1
ENST00000590147.1 ENST00000304283.4 ENST00000592190.1 ENST00000589065.1 ENST00000585773.1 ENST00000450067.2 ENST00000592698.1 ENST00000586166.1 ENST00000586605.1 ENST00000592421.1 |
ANKS3
|
ankyrin repeat and sterile alpha motif domain containing 3 |
| chr16_-_31076332 | 0.39 |
ENST00000539836.3
ENST00000535577.1 ENST00000442862.2 |
ZNF668
|
zinc finger protein 668 |
| chr6_+_30851205 | 0.39 |
ENST00000515881.1
|
DDR1
|
discoidin domain receptor tyrosine kinase 1 |
| chr11_+_313503 | 0.38 |
ENST00000528780.1
ENST00000328221.5 |
IFITM1
|
interferon induced transmembrane protein 1 |
| chr22_+_41697520 | 0.38 |
ENST00000352645.4
|
ZC3H7B
|
zinc finger CCCH-type containing 7B |
| chr22_+_42665742 | 0.38 |
ENST00000332965.3
ENST00000415205.1 ENST00000446578.1 |
Z83851.3
|
Z83851.3 |
| chr3_+_167453026 | 0.38 |
ENST00000472941.1
|
SERPINI1
|
serpin peptidase inhibitor, clade I (neuroserpin), member 1 |
| chr19_+_35739280 | 0.38 |
ENST00000602122.1
|
LSR
|
lipolysis stimulated lipoprotein receptor |
| chr1_-_153029980 | 0.38 |
ENST00000392653.2
|
SPRR2A
|
small proline-rich protein 2A |
| chr1_-_739137 | 0.38 |
ENST00000599533.1
|
AL669831.1
|
Uncharacterized protein |
| chr2_+_223289208 | 0.38 |
ENST00000321276.7
|
SGPP2
|
sphingosine-1-phosphate phosphatase 2 |
| chr1_-_40237020 | 0.38 |
ENST00000327582.5
|
OXCT2
|
3-oxoacid CoA transferase 2 |
| chr11_-_67397371 | 0.38 |
ENST00000376693.2
ENST00000301490.4 |
NUDT8
|
nudix (nucleoside diphosphate linked moiety X)-type motif 8 |
| chr19_+_3721719 | 0.38 |
ENST00000589378.1
ENST00000382008.3 |
TJP3
|
tight junction protein 3 |
| chr12_-_110318226 | 0.38 |
ENST00000544393.1
|
GLTP
|
glycolipid transfer protein |
| chr17_-_18160584 | 0.37 |
ENST00000581349.1
ENST00000473425.2 |
FLII
|
flightless I homolog (Drosophila) |
| chr7_-_131241361 | 0.37 |
ENST00000378555.3
ENST00000322985.9 ENST00000541194.1 ENST00000537928.1 |
PODXL
|
podocalyxin-like |
| chr8_-_79717750 | 0.37 |
ENST00000263851.4
ENST00000379113.2 |
IL7
|
interleukin 7 |
| chr11_+_64879317 | 0.37 |
ENST00000526809.1
ENST00000279263.7 ENST00000524986.1 ENST00000534371.1 ENST00000540748.1 ENST00000525385.1 ENST00000345348.5 ENST00000531321.1 ENST00000529414.1 ENST00000526085.1 ENST00000530750.1 |
TM7SF2
|
transmembrane 7 superfamily member 2 |
| chr22_-_42765174 | 0.37 |
ENST00000432473.1
ENST00000412060.1 ENST00000424852.1 |
Z83851.1
|
Z83851.1 |
| chr4_+_74735102 | 0.37 |
ENST00000395761.3
|
CXCL1
|
chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha) |
| chr15_+_45722727 | 0.37 |
ENST00000396650.2
ENST00000558435.1 ENST00000344300.3 |
C15orf48
|
chromosome 15 open reading frame 48 |
| chr19_+_35739597 | 0.37 |
ENST00000361790.3
|
LSR
|
lipolysis stimulated lipoprotein receptor |
| chr3_-_50383096 | 0.37 |
ENST00000442887.1
ENST00000360165.3 |
ZMYND10
|
zinc finger, MYND-type containing 10 |
| chr1_-_24126023 | 0.37 |
ENST00000429356.1
|
GALE
|
UDP-galactose-4-epimerase |
| chr3_-_156534754 | 0.37 |
ENST00000472943.1
ENST00000473352.1 |
LINC00886
|
long intergenic non-protein coding RNA 886 |
| chrX_-_153279697 | 0.36 |
ENST00000444254.1
|
IRAK1
|
interleukin-1 receptor-associated kinase 1 |
| chr17_+_43299241 | 0.36 |
ENST00000328118.3
|
FMNL1
|
formin-like 1 |
| chr19_-_6670128 | 0.36 |
ENST00000245912.3
|
TNFSF14
|
tumor necrosis factor (ligand) superfamily, member 14 |
| chr12_+_58148842 | 0.36 |
ENST00000266643.5
|
MARCH9
|
membrane-associated ring finger (C3HC4) 9 |
| chr2_-_220118631 | 0.36 |
ENST00000248437.4
|
TUBA4A
|
tubulin, alpha 4a |
| chr19_+_54960790 | 0.36 |
ENST00000443957.1
|
LENG8
|
leukocyte receptor cluster (LRC) member 8 |
| chr21_+_42798124 | 0.36 |
ENST00000417963.1
|
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr6_+_126240442 | 0.36 |
ENST00000448104.1
ENST00000438495.1 ENST00000444128.1 |
NCOA7
|
nuclear receptor coactivator 7 |
| chr4_-_101111615 | 0.36 |
ENST00000273990.2
|
DDIT4L
|
DNA-damage-inducible transcript 4-like |
| chr6_+_31895467 | 0.36 |
ENST00000556679.1
ENST00000456570.1 |
CFB
CFB
|
complement factor B Complement factor B; Uncharacterized protein; cDNA FLJ55673, highly similar to Complement factor B |
| chr17_-_74497432 | 0.36 |
ENST00000590288.1
ENST00000313080.4 ENST00000592123.1 ENST00000591255.1 ENST00000585989.1 ENST00000591697.1 ENST00000389760.4 |
RHBDF2
|
rhomboid 5 homolog 2 (Drosophila) |
| chr19_-_40732594 | 0.36 |
ENST00000430325.2
ENST00000433940.1 |
CNTD2
|
cyclin N-terminal domain containing 2 |
| chr19_-_51538148 | 0.35 |
ENST00000319590.4
ENST00000250351.4 |
KLK12
|
kallikrein-related peptidase 12 |
| chr1_-_17338386 | 0.35 |
ENST00000341676.5
ENST00000452699.1 |
ATP13A2
|
ATPase type 13A2 |
| chr12_-_1703331 | 0.35 |
ENST00000339235.3
|
FBXL14
|
F-box and leucine-rich repeat protein 14 |
| chr6_+_31916733 | 0.35 |
ENST00000483004.1
|
CFB
|
complement factor B |
| chr19_+_535835 | 0.35 |
ENST00000607527.1
ENST00000606065.1 |
CDC34
|
cell division cycle 34 |
| chr15_+_89182178 | 0.35 |
ENST00000559876.1
|
ISG20
|
interferon stimulated exonuclease gene 20kDa |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 3.2 | GO:0003069 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.6 | 2.2 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.4 | 1.1 | GO:2000625 | regulation of miRNA catabolic process(GO:2000625) positive regulation of miRNA catabolic process(GO:2000627) |
| 0.4 | 2.9 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.4 | 1.8 | GO:0085032 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.3 | 0.9 | GO:0045362 | regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
| 0.3 | 0.9 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.2 | 1.4 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.2 | 0.7 | GO:1904351 | negative regulation of protein catabolic process in the vacuole(GO:1904351) negative regulation of lysosomal protein catabolic process(GO:1905166) |
| 0.2 | 1.0 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.2 | 1.4 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.2 | 1.0 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.2 | 0.7 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.2 | 1.1 | GO:1904823 | pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.2 | 1.4 | GO:0097396 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.2 | 0.8 | GO:0006051 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.2 | 0.5 | GO:0051714 | positive regulation of cytolysis in other organism(GO:0051714) |
| 0.2 | 0.6 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.2 | 1.1 | GO:0045229 | cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 0.2 | 1.3 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.2 | 0.9 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.2 | 0.5 | GO:1990654 | sebum secreting cell proliferation(GO:1990654) |
| 0.1 | 1.0 | GO:0071603 | endothelial cell-cell adhesion(GO:0071603) |
| 0.1 | 1.9 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.1 | 0.7 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.1 | 0.3 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 | 0.9 | GO:0052551 | response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
| 0.1 | 0.6 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
| 0.1 | 2.9 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.1 | 0.5 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.1 | 0.1 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.1 | 0.7 | GO:0002803 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.1 | 2.1 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 0.3 | GO:1902339 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.1 | 0.4 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.1 | 0.5 | GO:2000359 | negative regulation of fertilization(GO:0060467) acrosomal vesicle exocytosis(GO:0060478) regulation of binding of sperm to zona pellucida(GO:2000359) negative regulation of binding of sperm to zona pellucida(GO:2000360) |
| 0.1 | 0.2 | GO:0042987 | amyloid precursor protein catabolic process(GO:0042987) regulation of beta-amyloid formation(GO:1902003) positive regulation of beta-amyloid formation(GO:1902004) regulation of amyloid precursor protein catabolic process(GO:1902991) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.1 | 1.3 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.1 | 0.2 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 | 0.3 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.1 | 0.3 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.1 | 0.4 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 0.1 | 0.9 | GO:0043585 | nose morphogenesis(GO:0043585) |
| 0.1 | 0.3 | GO:0031394 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
| 0.1 | 0.2 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.1 | 0.3 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 | 0.4 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 0.4 | GO:0036116 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.1 | 0.6 | GO:0015692 | lead ion transport(GO:0015692) |
| 0.1 | 0.9 | GO:0007519 | skeletal muscle tissue development(GO:0007519) |
| 0.1 | 0.3 | GO:0072034 | renal vesicle induction(GO:0072034) |
| 0.1 | 0.5 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.1 | 1.8 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.2 | GO:1990927 | calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.1 | 0.3 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.1 | 1.0 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
| 0.1 | 0.3 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.1 | 0.1 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.1 | 0.1 | GO:1903433 | regulation of constitutive secretory pathway(GO:1903433) |
| 0.1 | 0.5 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.1 | 0.2 | GO:0051592 | response to calcium ion(GO:0051592) |
| 0.1 | 0.4 | GO:0034344 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.1 | 0.3 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.1 | 0.8 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.1 | 6.0 | GO:0018149 | peptide cross-linking(GO:0018149) |
| 0.1 | 0.2 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
| 0.1 | 0.3 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.1 | 0.3 | GO:0072289 | pronephric field specification(GO:0039003) pattern specification involved in pronephros development(GO:0039017) thyroid-stimulating hormone secretion(GO:0070460) kidney field specification(GO:0072004) DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) metanephric nephron tubule formation(GO:0072289) regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072304) negative regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072305) mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) apoptotic process involved in metanephric collecting duct development(GO:1900204) apoptotic process involved in metanephric nephron tubule development(GO:1900205) regulation of apoptotic process involved in metanephric collecting duct development(GO:1900214) negative regulation of apoptotic process involved in metanephric collecting duct development(GO:1900215) regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900217) negative regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900218) mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:1901147) regulation of metanephric DCT cell differentiation(GO:2000592) positive regulation of metanephric DCT cell differentiation(GO:2000594) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 0.1 | 0.2 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.1 | 0.1 | GO:0002260 | lymphocyte homeostasis(GO:0002260) |
| 0.1 | 2.0 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.1 | 0.2 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.1 | 0.4 | GO:0045073 | regulation of chemokine biosynthetic process(GO:0045073) positive regulation of chemokine biosynthetic process(GO:0045080) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.7 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.1 | 0.3 | GO:0072308 | negative regulation by virus of viral protein levels in host cell(GO:0046725) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) |
| 0.1 | 0.2 | GO:0060380 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
| 0.1 | 0.2 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.1 | 1.5 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 | 0.2 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.1 | 0.2 | GO:1902283 | negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.1 | 0.2 | GO:0070904 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.1 | 0.5 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.3 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.1 | 0.2 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.4 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.1 | 0.3 | GO:1903823 | regulation of telomere maintenance via recombination(GO:0032207) negative regulation of telomere maintenance via recombination(GO:0032208) negative regulation of single strand break repair(GO:1903517) negative regulation of beta-galactosidase activity(GO:1903770) telomere single strand break repair(GO:1903823) negative regulation of telomere single strand break repair(GO:1903824) |
| 0.1 | 0.2 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.1 | 0.3 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 | 1.3 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.1 | 0.3 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.1 | 0.4 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.1 | 0.4 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
| 0.1 | 0.2 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.1 | 0.3 | GO:1904117 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.1 | 0.2 | GO:0005986 | sucrose biosynthetic process(GO:0005986) |
| 0.1 | 0.3 | GO:0045209 | MAPK phosphatase export from nucleus(GO:0045208) MAPK phosphatase export from nucleus, leptomycin B sensitive(GO:0045209) |
| 0.1 | 0.1 | GO:0036466 | synaptic vesicle recycling via endosome(GO:0036466) |
| 0.1 | 0.4 | GO:0048817 | negative regulation of hair follicle maturation(GO:0048817) |
| 0.1 | 0.1 | GO:0035932 | mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) regulation of aldosterone secretion(GO:2000858) |
| 0.1 | 0.4 | GO:2001153 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
| 0.1 | 0.4 | GO:0042695 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 | 0.2 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.1 | 0.4 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 | 0.3 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.1 | 0.2 | GO:0002731 | negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.1 | 0.3 | GO:0015688 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.1 | 0.3 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.1 | 0.2 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.1 | 0.8 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.1 | 0.5 | GO:0016128 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.1 | 0.4 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.1 | 0.3 | GO:0044571 | [2Fe-2S] cluster assembly(GO:0044571) |
| 0.1 | 0.3 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.1 | 0.2 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.1 | 0.2 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 | 0.5 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.1 | 0.3 | GO:0044752 | response to human chorionic gonadotropin(GO:0044752) |
| 0.1 | 0.1 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.1 | 0.3 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.1 | 0.2 | GO:0014028 | notochord formation(GO:0014028) |
| 0.1 | 0.3 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.1 | 0.4 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.1 | 0.8 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.1 | 0.2 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
| 0.1 | 0.3 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 | 0.3 | GO:1903381 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.1 | 0.3 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.2 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 0.3 | GO:0032796 | uropod organization(GO:0032796) |
| 0.1 | 0.2 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.1 | 0.1 | GO:0030432 | peristalsis(GO:0030432) |
| 0.1 | 0.2 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.1 | 0.4 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 0.2 | GO:0051466 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.1 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.1 | 0.4 | GO:0032954 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.1 | 1.1 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.1 | 0.3 | GO:0015864 | pyrimidine nucleoside transport(GO:0015864) |
| 0.1 | 0.2 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.1 | 0.5 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.1 | 1.1 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.1 | 0.2 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.1 | 0.2 | GO:0042262 | DNA protection(GO:0042262) |
| 0.1 | 0.1 | GO:0001798 | positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.1 | 1.0 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.2 | GO:1904482 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 0.1 | 0.2 | GO:0097018 | renal albumin absorption(GO:0097018) regulation of renal albumin absorption(GO:2000532) |
| 0.1 | 0.2 | GO:0010983 | regulation of high-density lipoprotein particle clearance(GO:0010982) positive regulation of high-density lipoprotein particle clearance(GO:0010983) |
| 0.1 | 0.5 | GO:2000371 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.1 | 0.5 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.1 | 0.2 | GO:1902908 | regulation of melanosome transport(GO:1902908) |
| 0.1 | 0.3 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.2 | GO:0010193 | response to ozone(GO:0010193) |
| 0.1 | 0.2 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.2 | GO:0072616 | interleukin-18 secretion(GO:0072616) |
| 0.1 | 0.5 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.1 | 0.6 | GO:0018377 | protein myristoylation(GO:0018377) |
| 0.1 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 0.3 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.1 | 0.3 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.1 | 0.2 | GO:0032903 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.1 | 0.2 | GO:0003147 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) |
| 0.1 | 0.2 | GO:0090678 | response to mycophenolic acid(GO:0071505) cellular response to mycophenolic acid(GO:0071506) metanephric glomerular mesangial cell development(GO:0072255) reversible differentiation(GO:0090677) cell dedifferentiation involved in phenotypic switching(GO:0090678) positive regulation of phenotypic switching(GO:1900241) regulation of vascular smooth muscle cell dedifferentiation(GO:1905174) positive regulation of vascular smooth muscle cell dedifferentiation(GO:1905176) vascular smooth muscle cell dedifferentiation(GO:1990936) |
| 0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.0 | 0.2 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.0 | 0.1 | GO:0050975 | sensory perception of touch(GO:0050975) presynaptic active zone organization(GO:1990709) |
| 0.0 | 0.3 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.0 | 1.8 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.0 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) positive regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000340) |
| 0.0 | 0.1 | GO:0061536 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.0 | 0.5 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) |
| 0.0 | 0.1 | GO:0003097 | renal water transport(GO:0003097) |
| 0.0 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.0 | 0.2 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.0 | 0.2 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.0 | 0.0 | GO:1903526 | negative regulation of membrane tubulation(GO:1903526) |
| 0.0 | 0.3 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.2 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.0 | 0.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.0 | 0.1 | GO:0019085 | early viral transcription(GO:0019085) |
| 0.0 | 0.0 | GO:0052199 | negative regulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052199) |
| 0.0 | 0.0 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) |
| 0.0 | 1.5 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.0 | 0.4 | GO:0010957 | negative regulation of vitamin D biosynthetic process(GO:0010957) |
| 0.0 | 0.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.0 | 0.1 | GO:0001923 | B-1 B cell differentiation(GO:0001923) B-1a B cell differentiation(GO:0002337) |
| 0.0 | 0.1 | GO:1904976 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.0 | 0.1 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.0 | 0.9 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.2 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.1 | GO:0051563 | smooth endoplasmic reticulum calcium ion homeostasis(GO:0051563) |
| 0.0 | 0.1 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.0 | 0.4 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.0 | 0.2 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.0 | 0.3 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.0 | 0.0 | GO:0071371 | cellular response to gonadotropin stimulus(GO:0071371) |
| 0.0 | 0.2 | GO:0045338 | farnesyl diphosphate metabolic process(GO:0045338) |
| 0.0 | 0.0 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
| 0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.0 | 0.1 | GO:0018201 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) peptidyl-glycine modification(GO:0018201) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.0 | 0.0 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.2 | GO:0097403 | cellular response to raffinose(GO:0097403) response to raffinose(GO:1901545) |
| 0.0 | 0.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.5 | GO:0039526 | suppression by virus of host apoptotic process(GO:0019050) negative regulation by symbiont of host apoptotic process(GO:0033668) modulation by virus of host apoptotic process(GO:0039526) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
| 0.0 | 0.1 | GO:2000979 | hepatocyte cell migration(GO:0002194) otic placode formation(GO:0043049) branching involved in pancreas morphogenesis(GO:0061114) negative regulation of bile acid biosynthetic process(GO:0070858) acinar cell differentiation(GO:0090425) negative regulation of bile acid metabolic process(GO:1904252) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 0.0 | 0.3 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.1 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.0 | 0.0 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.0 | 0.9 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 | 0.1 | GO:1901291 | negative regulation of double-strand break repair via single-strand annealing(GO:1901291) |
| 0.0 | 0.2 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.0 | 0.7 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 0.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.0 | 0.4 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.7 | GO:0000052 | citrulline metabolic process(GO:0000052) |
| 0.0 | 0.3 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.1 | GO:0002305 | gamma-delta intraepithelial T cell differentiation(GO:0002304) CD8-positive, gamma-delta intraepithelial T cell differentiation(GO:0002305) |
| 0.0 | 0.1 | GO:0072684 | mitochondrial tRNA 3'-trailer cleavage, endonucleolytic(GO:0072684) |
| 0.0 | 0.1 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
| 0.0 | 0.1 | GO:0071400 | cellular response to oleic acid(GO:0071400) |
| 0.0 | 0.0 | GO:0052203 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.0 | 0.2 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.0 | 0.2 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.0 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.0 | GO:2000573 | positive regulation of DNA biosynthetic process(GO:2000573) |
| 0.0 | 0.4 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.0 | 0.3 | GO:0035900 | response to isolation stress(GO:0035900) |
| 0.0 | 0.2 | GO:0070431 | nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.2 | GO:0021769 | orbitofrontal cortex development(GO:0021769) |
| 0.0 | 0.0 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.4 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 | 0.8 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.8 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.0 | 0.8 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.4 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.1 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.0 | 0.3 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.4 | GO:0015870 | acetylcholine transport(GO:0015870) acetylcholine secretion(GO:0061526) |
| 0.0 | 0.3 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.0 | 0.0 | GO:0048320 | axial mesoderm morphogenesis(GO:0048319) axial mesoderm formation(GO:0048320) |
| 0.0 | 0.2 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 | 0.4 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 | 0.1 | GO:2000656 | regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
| 0.0 | 1.0 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.0 | 0.1 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.0 | 0.3 | GO:0010731 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.0 | GO:1902938 | regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 0.0 | 0.0 | GO:0042268 | regulation of cytolysis(GO:0042268) |
| 0.0 | 0.2 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.0 | 0.0 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
| 0.0 | 0.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 | 0.1 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
| 0.0 | 0.2 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.0 | 0.1 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.0 | 0.2 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.0 | 0.2 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.0 | 0.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.3 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.0 | 0.2 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.0 | 0.1 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
| 0.0 | 0.1 | GO:0002551 | mast cell chemotaxis(GO:0002551) |
| 0.0 | 0.1 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.0 | 0.6 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.1 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.0 | 0.1 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 0.0 | 0.5 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.0 | 0.5 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 0.0 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.1 | GO:0070316 | regulation of G0 to G1 transition(GO:0070316) |
| 0.0 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.0 | GO:2000542 | negative regulation of endodermal cell differentiation(GO:1903225) negative regulation of gastrulation(GO:2000542) |
| 0.0 | 0.0 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.0 | 0.1 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.0 | 0.1 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 | 0.3 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.0 | 0.1 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.0 | 0.1 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.0 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.0 | 0.1 | GO:0044771 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.0 | 0.4 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.7 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 0.1 | GO:2000397 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.0 | 0.1 | GO:0007009 | plasma membrane organization(GO:0007009) |
| 0.0 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.3 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.8 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.0 | 0.8 | GO:1905144 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.0 | 0.8 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.1 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.0 | 0.1 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.0 | 0.5 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 | 0.2 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.2 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.0 | 0.1 | GO:0090650 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.0 | 0.2 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.0 | 0.3 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.0 | 0.1 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
| 0.0 | 0.1 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 0.0 | 0.2 | GO:0061034 | olfactory bulb mitral cell layer development(GO:0061034) |
| 0.0 | 0.2 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.0 | 0.2 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
| 0.0 | 0.1 | GO:0043281 | regulation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0043281) |
| 0.0 | 1.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.1 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
| 0.0 | 0.1 | GO:0033864 | positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 0.0 | 0.3 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.1 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.0 | 0.6 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.0 | 0.3 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.0 | 0.2 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 | 0.1 | GO:0021644 | vagus nerve morphogenesis(GO:0021644) |
| 0.0 | 0.6 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.0 | GO:1901655 | cellular response to ketone(GO:1901655) |
| 0.0 | 0.3 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.0 | 0.2 | GO:0006196 | AMP catabolic process(GO:0006196) |
| 0.0 | 0.0 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
| 0.0 | 0.2 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.2 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.0 | 0.0 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.0 | 0.1 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) |
| 0.0 | 0.3 | GO:0006534 | cysteine metabolic process(GO:0006534) |
| 0.0 | 0.1 | GO:0042033 | chemokine biosynthetic process(GO:0042033) |
| 0.0 | 0.1 | GO:1901073 | N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
| 0.0 | 0.1 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.0 | 0.3 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.1 | GO:0002316 | follicular B cell differentiation(GO:0002316) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.1 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.0 | 0.0 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.0 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.0 | 0.1 | GO:0070142 | synaptic vesicle budding(GO:0070142) |
| 0.0 | 0.2 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.0 | 0.2 | GO:0002729 | positive regulation of natural killer cell cytokine production(GO:0002729) |
| 0.0 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.2 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.5 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.2 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
| 0.0 | 0.1 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.1 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.4 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 0.0 | 0.3 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.0 | 0.4 | GO:0008212 | mineralocorticoid biosynthetic process(GO:0006705) mineralocorticoid metabolic process(GO:0008212) |
| 0.0 | 1.0 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.0 | 0.2 | GO:0000050 | urea cycle(GO:0000050) |
| 0.0 | 0.1 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
| 0.0 | 0.1 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.0 | 0.2 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 | 0.1 | GO:0072738 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) |
| 0.0 | 0.1 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.0 | 0.6 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.1 | GO:0090410 | malonate catabolic process(GO:0090410) |
| 0.0 | 0.7 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.0 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.0 | 0.2 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.0 | 0.5 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.0 | 0.2 | GO:0045006 | DNA deamination(GO:0045006) DNA cytosine deamination(GO:0070383) |
| 0.0 | 0.1 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.0 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.0 | 0.4 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.0 | 0.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.3 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 0.0 | GO:0045066 | regulatory T cell differentiation(GO:0045066) |
| 0.0 | 0.1 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.0 | 0.2 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.0 | 0.1 | GO:0090108 | positive regulation of high-density lipoprotein particle assembly(GO:0090108) positive regulation of pancreatic juice secretion(GO:0090187) positive regulation of secretion of lysosomal enzymes(GO:0090340) |
| 0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.1 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
| 0.0 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.0 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
| 0.0 | 0.0 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.0 | 0.1 | GO:0006311 | meiotic gene conversion(GO:0006311) |
| 0.0 | 0.1 | GO:0070997 | neuron death(GO:0070997) |
| 0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.1 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 | 0.1 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.0 | 0.5 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.6 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 0.1 | GO:0090659 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
| 0.0 | 0.1 | GO:0007260 | tyrosine phosphorylation of STAT protein(GO:0007260) regulation of tyrosine phosphorylation of STAT protein(GO:0042509) |
| 0.0 | 0.1 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.0 | 0.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.0 | 0.0 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.2 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.0 | 0.0 | GO:0051097 | negative regulation of helicase activity(GO:0051097) |
| 0.0 | 0.0 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) determination of digestive tract left/right asymmetry(GO:0071907) determination of liver left/right asymmetry(GO:0071910) |
| 0.0 | 0.0 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
| 0.0 | 0.3 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.0 | 0.0 | GO:2001023 | regulation of response to drug(GO:2001023) |
| 0.0 | 0.1 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
| 0.0 | 0.1 | GO:0071423 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 0.0 | 0.3 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.0 | 0.1 | GO:0021557 | optic cup structural organization(GO:0003409) oculomotor nerve development(GO:0021557) oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.0 | 0.1 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
| 0.0 | 0.1 | GO:0009224 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.0 | 0.3 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.0 | 0.0 | GO:0071104 | response to interleukin-9(GO:0071104) |
| 0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.0 | 0.0 | GO:0097267 | omega-hydroxylase P450 pathway(GO:0097267) |
| 0.0 | 0.0 | GO:1905073 | occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.0 | 0.1 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.0 | 0.1 | GO:1902745 | positive regulation of lamellipodium organization(GO:1902745) |
| 0.0 | 0.0 | GO:0019836 | hemolysis by symbiont of host erythrocytes(GO:0019836) hemolysis in other organism(GO:0044179) hemolysis in other organism involved in symbiotic interaction(GO:0052331) |
| 0.0 | 0.0 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.0 | 0.0 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 0.0 | 0.0 | GO:0034698 | response to gonadotropin(GO:0034698) |
| 0.0 | 0.1 | GO:0072237 | ascending thin limb development(GO:0072021) metanephric ascending thin limb development(GO:0072218) metanephric proximal tubule development(GO:0072237) metanephric distal tubule morphogenesis(GO:0072287) |
| 0.0 | 0.0 | GO:1904744 | positive regulation of telomeric DNA binding(GO:1904744) |
| 0.0 | 0.1 | GO:0090009 | primitive streak formation(GO:0090009) |
| 0.0 | 0.1 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.0 | 0.1 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 | 0.1 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.0 | 0.0 | GO:0046618 | drug export(GO:0046618) |
| 0.0 | 0.1 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.0 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.3 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 | 0.3 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 | 0.3 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.0 | 0.0 | GO:0050673 | epithelial cell proliferation(GO:0050673) |
| 0.0 | 0.0 | GO:0032185 | septin cytoskeleton organization(GO:0032185) |
| 0.0 | 0.1 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.0 | 0.1 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) general adaptation syndrome(GO:0051866) |
| 0.0 | 0.1 | GO:1990441 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.0 | 0.1 | GO:0045953 | negative regulation of natural killer cell mediated cytotoxicity(GO:0045953) |
| 0.0 | 0.1 | GO:0048691 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.0 | 0.1 | GO:0006147 | guanine catabolic process(GO:0006147) |
| 0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.4 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 | 0.1 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.0 | 0.0 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) mitochondrial tRNA 3'-end processing(GO:1990180) |
| 0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.0 | GO:0050852 | T cell receptor signaling pathway(GO:0050852) |
| 0.0 | 0.4 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.2 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.0 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.0 | 0.0 | GO:0060389 | pathway-restricted SMAD protein phosphorylation(GO:0060389) |
| 0.0 | 0.1 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
| 0.0 | 0.1 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.0 | 0.1 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.0 | 0.2 | GO:0099612 | protein localization to axon(GO:0099612) |
| 0.0 | 0.0 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.0 | 0.0 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.0 | 0.1 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
| 0.0 | 0.0 | GO:0008637 | apoptotic mitochondrial changes(GO:0008637) |
| 0.0 | 0.0 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.0 | 0.2 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.1 | GO:0021747 | cochlear nucleus development(GO:0021747) neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.0 | 0.1 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.0 | 0.0 | GO:1990535 | neuron projection maintenance(GO:1990535) |
| 0.0 | 0.1 | GO:1903033 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
| 0.0 | 0.5 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.0 | 0.0 | GO:0035698 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:0035698) regulation of T cell extravasation(GO:2000407) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) regulation of CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:2000452) |
| 0.0 | 0.2 | GO:0009227 | UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 0.0 | 0.2 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
| 0.0 | 0.1 | GO:0070875 | positive regulation of glycogen metabolic process(GO:0070875) |
| 0.0 | 0.0 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.0 | 0.1 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.0 | 0.1 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.0 | 0.0 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.0 | 0.1 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
| 0.0 | 0.1 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.0 | 0.6 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
| 0.0 | 0.2 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.4 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.0 | 0.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 | 0.2 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.0 | GO:2000179 | positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.0 | 0.0 | GO:0019049 | evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) |
| 0.0 | 0.1 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.0 | 0.4 | GO:0055022 | negative regulation of cardiac muscle tissue growth(GO:0055022) negative regulation of cardiac muscle cell proliferation(GO:0060044) negative regulation of heart growth(GO:0061117) |
| 0.0 | 1.2 | GO:0071357 | type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.0 | 0.1 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.0 | 0.4 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.0 | 0.1 | GO:0032769 | negative regulation of monooxygenase activity(GO:0032769) |
| 0.0 | 0.0 | GO:0034442 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 0.0 | 0.0 | GO:0019233 | sensory perception of pain(GO:0019233) |
| 0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 | 0.2 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.0 | 0.0 | GO:0051167 | glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.0 | 0.1 | GO:1902904 | negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.0 | 0.0 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.1 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.0 | 0.1 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
| 0.0 | 0.1 | GO:0060191 | regulation of lipase activity(GO:0060191) |
| 0.0 | 0.2 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.1 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.0 | 0.2 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.1 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.0 | 0.0 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.1 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
| 0.0 | 0.1 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.0 | 1.4 | GO:0001895 | retina homeostasis(GO:0001895) |
| 0.0 | 0.1 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 | 0.2 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
| 0.0 | 0.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 | 0.2 | GO:0051056 | regulation of small GTPase mediated signal transduction(GO:0051056) |
| 0.0 | 0.1 | GO:0036367 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.0 | 0.4 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.0 | 0.0 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.0 | 0.3 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.0 | 0.0 | GO:0006195 | purine nucleotide catabolic process(GO:0006195) |
| 0.0 | 0.2 | GO:0010962 | regulation of glycogen biosynthetic process(GO:0005979) regulation of glucan biosynthetic process(GO:0010962) |
| 0.0 | 0.0 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.2 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.0 | 0.1 | GO:1902269 | positive regulation of polyamine transmembrane transport(GO:1902269) |
| 0.0 | 0.1 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.0 | 0.0 | GO:0033037 | polysaccharide localization(GO:0033037) |
| 0.0 | 0.1 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 | 0.0 | GO:1904580 | regulation of intracellular mRNA localization(GO:1904580) positive regulation of intracellular mRNA localization(GO:1904582) |
| 0.0 | 0.7 | GO:0007520 | myoblast fusion(GO:0007520) |
| 0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.2 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.0 | 0.0 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
| 0.0 | 0.4 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.0 | 0.2 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.0 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.0 | 0.2 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.0 | 0.1 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
| 0.0 | 0.0 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.0 | 0.2 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.0 | 0.1 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.0 | 0.2 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.0 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.0 | 0.1 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.0 | 0.0 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.0 | 0.0 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.0 | 0.1 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
| 0.0 | 0.0 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
| 0.0 | 0.0 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
| 0.0 | 0.3 | GO:0007172 | signal complex assembly(GO:0007172) |
| 0.0 | 0.1 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.0 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.0 | 0.3 | GO:0015695 | organic cation transport(GO:0015695) |
| 0.0 | 0.1 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.3 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.0 | 0.0 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.0 | GO:0050822 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.0 | 0.3 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.0 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.0 | 0.0 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 | 0.0 | GO:0048538 | thymus development(GO:0048538) |
| 0.0 | 0.1 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.0 | 0.2 | GO:0007567 | parturition(GO:0007567) |
| 0.0 | 0.1 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.1 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.0 | 0.0 | GO:1990258 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.0 | 0.0 | GO:0072312 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.0 | 0.2 | GO:0043306 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.0 | 0.1 | GO:0003197 | endocardial cushion development(GO:0003197) |
| 0.0 | 0.3 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
| 0.0 | 0.0 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.0 | 0.0 | GO:0043383 | negative T cell selection(GO:0043383) |
| 0.0 | 1.3 | GO:0002479 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-dependent(GO:0002479) |
| 0.0 | 0.1 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 | 0.1 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.0 | 0.2 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 0.0 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.0 | 0.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 | 0.2 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.0 | GO:0098700 | sequestering of neurotransmitter(GO:0042137) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.0 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.0 | 0.2 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
| 0.0 | 0.1 | GO:0060313 | negative regulation of blood vessel remodeling(GO:0060313) |
| 0.0 | 0.2 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.0 | GO:0009744 | response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.0 | GO:0045907 | positive regulation of vasoconstriction(GO:0045907) |
| 0.0 | 0.2 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.0 | 0.2 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
| 0.0 | 0.0 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 1.5 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
| 0.0 | 0.2 | GO:0051284 | negative regulation of release of sequestered calcium ion into cytosol(GO:0051280) positive regulation of sequestering of calcium ion(GO:0051284) negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 0.0 | 0.4 | GO:0061620 | NADH regeneration(GO:0006735) glycolytic process through fructose-6-phosphate(GO:0061615) glycolytic process through glucose-6-phosphate(GO:0061620) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.0 | 0.1 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
| 0.0 | 0.1 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.0 | 0.0 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.0 | 0.0 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.0 | 0.2 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.0 | 0.1 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) positive regulation of transforming growth factor beta3 production(GO:0032916) |
| 0.0 | 0.0 | GO:0036309 | protein localization to M-band(GO:0036309) |
| 0.0 | 0.0 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.0 | 0.1 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.0 | 0.1 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.1 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.0 | 0.0 | GO:0006844 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.0 | 0.2 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.0 | 0.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.1 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
| 0.0 | 0.1 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 0.0 | 0.0 | GO:1901143 | insulin catabolic process(GO:1901143) |
| 0.0 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.0 | 0.1 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
| 0.0 | 0.1 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
| 0.0 | 0.1 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.0 | GO:0007343 | egg activation(GO:0007343) |
| 0.0 | 0.3 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.0 | GO:0002933 | lipid hydroxylation(GO:0002933) |
| 0.0 | 0.2 | GO:0051775 | response to redox state(GO:0051775) |
| 0.0 | 0.1 | GO:0030320 | cellular anion homeostasis(GO:0030002) cellular monovalent inorganic anion homeostasis(GO:0030320) cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.3 | GO:0032878 | regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.0 | 0.0 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.0 | 0.0 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.0 | 0.0 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.0 | 0.1 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
| 0.0 | 1.5 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) telencephalon regionalization(GO:0021978) |
| 0.0 | 0.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 | 0.2 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.6 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.0 | 0.1 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.0 | 0.1 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.0 | 0.1 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
| 0.0 | 0.1 | GO:0070508 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 | 0.1 | GO:0071344 | diphosphate metabolic process(GO:0071344) |
| 0.0 | 0.0 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
| 0.0 | 0.2 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.0 | 0.0 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.0 | 0.0 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
| 0.0 | 0.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 0.1 | GO:0021842 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) ERBB3 signaling pathway(GO:0038129) |
| 0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.1 | GO:0045023 | G0 to G1 transition(GO:0045023) |
| 0.0 | 0.1 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.0 | 0.1 | GO:2000582 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.0 | 0.2 | GO:0032092 | positive regulation of protein binding(GO:0032092) |
| 0.0 | 0.0 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 | 0.0 | GO:1904994 | negative regulation of cellular extravasation(GO:0002692) regulation of leukocyte tethering or rolling(GO:1903236) negative regulation of leukocyte tethering or rolling(GO:1903237) regulation of leukocyte adhesion to vascular endothelial cell(GO:1904994) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.0 | 0.1 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.1 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.0 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.1 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.0 | 0.0 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.2 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 | 0.1 | GO:0010042 | response to manganese ion(GO:0010042) |
| 0.0 | 0.0 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
| 0.0 | 0.3 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.0 | 0.1 | GO:0009209 | UTP biosynthetic process(GO:0006228) CTP biosynthetic process(GO:0006241) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
| 0.0 | 0.0 | GO:0034433 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.0 | 0.5 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.0 | 0.4 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
| 0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.0 | 0.3 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.1 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.1 | GO:0032459 | regulation of protein oligomerization(GO:0032459) positive regulation of protein oligomerization(GO:0032461) |
| 0.0 | 0.0 | GO:1900164 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.0 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) leukocyte adhesion to vascular endothelial cell(GO:0061756) |
| 0.0 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.0 | 0.0 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.0 | 0.2 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.0 | 0.2 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.0 | 0.2 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
| 0.0 | 0.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.0 | GO:2000506 | negative regulation of energy homeostasis(GO:2000506) |
| 0.0 | 0.0 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.0 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.0 | 0.0 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.2 | GO:0033198 | response to ATP(GO:0033198) |
| 0.0 | 0.0 | GO:0032733 | positive regulation of interleukin-10 production(GO:0032733) |
| 0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.0 | 0.0 | GO:0007398 | ectoderm development(GO:0007398) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.1 | GO:0071665 | gamma-catenin-TCF7L2 complex(GO:0071665) |
| 0.2 | 0.6 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.2 | 0.7 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.2 | 1.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.1 | 0.7 | GO:0031166 | integral component of vacuolar membrane(GO:0031166) |
| 0.1 | 0.5 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.1 | 0.3 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
| 0.1 | 0.6 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.1 | 0.6 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.1 | 0.7 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.1 | 1.6 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 0.7 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.1 | 0.3 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.1 | 0.3 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 0.3 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 5.6 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.1 | 0.2 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.1 | 0.7 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.1 | 0.1 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.1 | 0.2 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 0.4 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.1 | 0.3 | GO:0097233 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.1 | 0.7 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.5 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 0.1 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.2 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.1 | 0.3 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.1 | 0.2 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 0.1 | 0.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.0 | 0.3 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.0 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.3 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.4 | GO:0097361 | CIA complex(GO:0097361) |
| 0.0 | 1.6 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.0 | GO:0070081 | clathrin-sculpted monoamine transport vesicle(GO:0070081) clathrin-sculpted monoamine transport vesicle membrane(GO:0070083) |
| 0.0 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.0 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.2 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.2 | GO:0005607 | laminin-2 complex(GO:0005607) |
| 0.0 | 0.5 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0005584 | collagen type I trimer(GO:0005584) |
| 0.0 | 0.9 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.3 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
| 0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 0.1 | GO:0016935 | glycine-gated chloride channel complex(GO:0016935) |
| 0.0 | 0.4 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.0 | 1.1 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.0 | 0.1 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.2 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.0 | 0.1 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.0 | 0.2 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.0 | 0.2 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.0 | 1.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.6 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.3 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.1 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.0 | 0.3 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.0 | 0.3 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.0 | 0.2 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.0 | 1.1 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.1 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.0 | 0.7 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.7 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.1 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.1 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.0 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.1 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.0 | 0.1 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.6 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.1 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.0 | 0.1 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
| 0.0 | 1.0 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.2 | GO:0070554 | synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
| 0.0 | 3.2 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.1 | GO:0032449 | CBM complex(GO:0032449) |
| 0.0 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.0 | 0.2 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.1 | GO:0009346 | citrate lyase complex(GO:0009346) |
| 0.0 | 0.3 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.2 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.5 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.3 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.0 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
| 0.0 | 0.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 0.1 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 0.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 1.9 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.5 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.0 | 1.3 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.4 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.3 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.0 | 4.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.6 | GO:0005912 | adherens junction(GO:0005912) |
| 0.0 | 0.1 | GO:0072589 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.1 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.0 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.0 | 0.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.2 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 0.3 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.1 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.0 | 1.4 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.3 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.4 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.1 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.0 | 0.0 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.0 | 0.1 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.0 | 0.1 | GO:0002133 | polycystin complex(GO:0002133) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.2 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.0 | 0.0 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.0 | 0.0 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.3 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 0.1 | GO:0036502 | Derlin-1-VIMP complex(GO:0036502) |
| 0.0 | 0.4 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 1.9 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 0.1 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.0 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.0 | 0.5 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.3 | GO:0043235 | receptor complex(GO:0043235) |
| 0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.2 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.4 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.0 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.3 | GO:0005604 | basement membrane(GO:0005604) extracellular matrix component(GO:0044420) |
| 0.0 | 0.3 | GO:0071682 | endocytic vesicle lumen(GO:0071682) |
| 0.0 | 0.3 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.0 | 0.0 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
| 0.0 | 0.2 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.0 | 0.0 | GO:0075341 | host cell PML body(GO:0075341) |
| 0.0 | 0.1 | GO:0042825 | TAP complex(GO:0042825) |
| 0.0 | 0.0 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.0 | 0.0 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.0 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.2 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.1 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.0 | 0.5 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 1.8 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.0 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.0 | 0.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.0 | 0.3 | GO:0061702 | inflammasome complex(GO:0061702) |
| 0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.1 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
| 0.0 | 0.1 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.0 | 0.2 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.3 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.0 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 2.4 | GO:0005923 | bicellular tight junction(GO:0005923) |
| 0.0 | 0.1 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.0 | 0.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.5 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.5 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.3 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.1 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.7 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 1.0 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.0 | 0.1 | GO:0044447 | axoneme part(GO:0044447) |
| 0.0 | 0.0 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.2 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
| 0.0 | 0.0 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 2.2 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.3 | 3.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.3 | 0.9 | GO:0031731 | CCR6 chemokine receptor binding(GO:0031731) |
| 0.3 | 0.9 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.3 | 1.1 | GO:0005199 | structural constituent of cell wall(GO:0005199) |
| 0.3 | 1.1 | GO:0015389 | pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
| 0.3 | 2.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.2 | 0.7 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 0.2 | 1.0 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.2 | 0.2 | GO:0016885 | CoA carboxylase activity(GO:0016421) ligase activity, forming carbon-carbon bonds(GO:0016885) |
| 0.2 | 0.7 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.2 | 0.8 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.2 | 2.2 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.2 | 0.7 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.2 | 0.9 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.2 | 0.3 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.2 | 0.5 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.2 | 0.5 | GO:0004513 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.2 | 1.8 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.1 | 0.4 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.1 | 0.4 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.1 | 0.8 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.1 | 0.5 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.1 | 0.3 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.1 | 0.7 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.1 | 0.6 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.1 | 0.3 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.1 | 0.6 | GO:1903135 | cupric ion binding(GO:1903135) |
| 0.1 | 0.6 | GO:0015094 | cadmium ion transmembrane transporter activity(GO:0015086) cobalt ion transmembrane transporter activity(GO:0015087) lead ion transmembrane transporter activity(GO:0015094) ferrous iron uptake transmembrane transporter activity(GO:0015639) |
| 0.1 | 0.4 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.1 | 1.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 1.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.1 | 0.5 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.1 | 0.3 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.1 | 0.5 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 0.9 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.3 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.3 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
| 0.1 | 0.3 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.1 | 0.3 | GO:0042356 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
| 0.1 | 1.3 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.1 | 0.3 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.1 | 0.3 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.1 | 0.2 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.1 | 0.6 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.1 | 0.2 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.1 | 0.5 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.1 | 2.0 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.1 | 0.2 | GO:0015229 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.1 | 0.3 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.1 | 0.4 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.1 | 0.2 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.1 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 0.4 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.1 | 0.5 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.2 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 0.1 | 0.2 | GO:0004458 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
| 0.1 | 0.3 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.1 | 0.2 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.1 | 0.2 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
| 0.1 | 0.4 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 1.6 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.1 | 0.3 | GO:0019863 | IgE binding(GO:0019863) |
| 0.1 | 0.7 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.3 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.1 | 0.3 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.1 | 0.3 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 0.1 | 0.6 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.1 | 0.2 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.1 | 0.2 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.1 | 0.4 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
| 0.1 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 0.2 | GO:0052594 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
| 0.1 | 1.3 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.1 | 0.7 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 0.4 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.1 | 1.6 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 0.2 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.1 | 0.3 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.1 | 0.4 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 0.3 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.1 | 0.3 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.1 | 0.4 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.1 | 0.3 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.2 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.1 | 0.3 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 0.6 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.1 | 0.2 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.1 | 0.3 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 0.1 | 0.2 | GO:0035643 | L-DOPA receptor activity(GO:0035643) L-DOPA binding(GO:0072544) |
| 0.1 | 0.3 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.4 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.1 | 0.2 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.1 | GO:0052813 | phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.1 | 0.2 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.1 | 0.8 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 0.6 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 0.2 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.0 | 0.8 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.0 | 0.2 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.0 | 0.9 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.0 | 0.2 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.0 | 0.3 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
| 0.0 | 0.1 | GO:0045142 | triplex DNA binding(GO:0045142) |
| 0.0 | 0.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.0 | 0.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.0 | 0.2 | GO:0004310 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
| 0.0 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.0 | 0.6 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.0 | 0.2 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.0 | 0.0 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.3 | GO:0032089 | NACHT domain binding(GO:0032089) |
| 0.0 | 0.4 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.2 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.0 | 0.2 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.0 | 0.2 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 0.2 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.0 | 0.1 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.0 | 2.1 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 0.4 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.9 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.6 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 0.3 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.9 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 0.7 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.8 | GO:0008201 | heparin binding(GO:0008201) |
| 0.0 | 0.2 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 0.0 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.0 | 0.2 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
| 0.0 | 0.0 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.0 | 0.0 | GO:0046935 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.2 | GO:0034602 | oxoglutarate dehydrogenase (NAD+) activity(GO:0034602) |
| 0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.0 | 0.2 | GO:0061714 | folic acid receptor activity(GO:0061714) |
| 0.0 | 0.2 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.0 | 0.1 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
| 0.0 | 0.1 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.5 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.1 | GO:0072591 | citrate-L-glutamate ligase activity(GO:0072591) |
| 0.0 | 0.4 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.4 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 1.9 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.1 | GO:0008841 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
| 0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 1.0 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 0.1 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.0 | 0.2 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.0 | 0.2 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.1 | GO:0047006 | 17-alpha,20-alpha-dihydroxypregn-4-en-3-one dehydrogenase activity(GO:0047006) |
| 0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.0 | 0.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.0 | 0.1 | GO:0033858 | N-acetylgalactosamine kinase activity(GO:0033858) |
| 0.0 | 0.2 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.0 | 0.2 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.0 | 0.1 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.0 | 1.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 0.1 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.4 | GO:0004465 | lipoprotein lipase activity(GO:0004465) |
| 0.0 | 0.3 | GO:0045118 | azole transporter activity(GO:0045118) |
| 0.0 | 0.1 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.0 | 0.1 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.0 | 0.1 | GO:0015068 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
| 0.0 | 0.2 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
| 0.0 | 0.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.6 | GO:0016918 | retinal binding(GO:0016918) |
| 0.0 | 0.1 | GO:0016250 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
| 0.0 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.2 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 0.1 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
| 0.0 | 0.1 | GO:0043178 | alcohol binding(GO:0043178) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.0 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.0 | 0.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
| 0.0 | 0.4 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.1 | GO:0047787 | delta4-3-oxosteroid 5beta-reductase activity(GO:0047787) |
| 0.0 | 0.1 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.0 | 0.6 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.1 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.0 | 3.8 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.1 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 1.7 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.0 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.0 | 0.2 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.0 | 0.6 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.6 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.1 | GO:0016503 | pheromone receptor activity(GO:0016503) |
| 0.0 | 0.0 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.0 | 0.2 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.0 | 0.1 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.0 | 0.1 | GO:0008112 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
| 0.0 | 0.2 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.0 | 0.1 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 0.0 | 0.0 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.1 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
| 0.0 | 0.4 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.2 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.3 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.0 | 0.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.0 | 0.1 | GO:0090409 | malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.0 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.0 | 0.7 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.1 | GO:0001133 | RNA polymerase II transcription factor activity, sequence-specific transcription regulatory region DNA binding(GO:0001133) |
| 0.0 | 2.6 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.4 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.1 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.2 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.0 | 0.3 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.2 | GO:0030614 | oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) |
| 0.0 | 0.1 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.0 | 0.1 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.0 | 0.3 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.3 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.0 | 0.1 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 0.0 | 0.3 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.2 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.0 | 0.4 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.0 | 0.1 | GO:0070283 | lipoate synthase activity(GO:0016992) radical SAM enzyme activity(GO:0070283) |
| 0.0 | 0.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.5 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.6 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.4 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.1 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.0 | 0.1 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.0 | 0.7 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.1 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.0 | 0.7 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.0 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
| 0.0 | 0.8 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.1 | GO:0045569 | TRAIL binding(GO:0045569) |
| 0.0 | 0.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.0 | 0.1 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.0 | 0.1 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.0 | 0.1 | GO:0033823 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
| 0.0 | 0.1 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.0 | 0.1 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.0 | 0.1 | GO:0052655 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.0 | 0.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.4 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.8 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.1 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.0 | 0.2 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 0.1 | GO:0008892 | guanine deaminase activity(GO:0008892) |
| 0.0 | 0.2 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.0 | 0.1 | GO:0005110 | frizzled-2 binding(GO:0005110) |
| 0.0 | 0.7 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 1.7 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.2 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.1 | GO:0052642 | lysophosphatidic acid phosphatase activity(GO:0052642) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.8 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.3 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.2 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.6 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.1 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 0.1 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.0 | 0.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.2 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.2 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 1.1 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.0 | 0.1 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 0.0 | 0.1 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.0 | 0.2 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.3 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.0 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.0 | 0.6 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.2 | GO:0016791 | phosphatase activity(GO:0016791) |
| 0.0 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.2 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.4 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.0 | 0.0 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.4 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.2 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.1 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.0 | 0.5 | GO:0030546 | receptor activator activity(GO:0030546) |
| 0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.5 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.2 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.1 | GO:0019840 | retinoid binding(GO:0005501) isoprenoid binding(GO:0019840) |
| 0.0 | 0.1 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.0 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.4 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.1 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.0 | 0.4 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.0 | 0.1 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.0 | 0.0 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.0 | 0.7 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.1 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.0 | 0.4 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.0 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.0 | 0.1 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.0 | 0.1 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.0 | 0.3 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.1 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.0 | 0.0 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.0 | 0.1 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.4 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.0 | 0.0 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.0 | 0.7 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.6 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.1 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.0 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.1 | GO:0052812 | 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) |
| 0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.0 | 0.0 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.0 | 0.1 | GO:0009881 | G-protein coupled photoreceptor activity(GO:0008020) photoreceptor activity(GO:0009881) |
| 0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.3 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.1 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.1 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.0 | GO:0052894 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.0 | 0.1 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.1 | GO:0042806 | fucose binding(GO:0042806) |
| 0.0 | 0.0 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.0 | 0.0 | GO:0015432 | bile acid-exporting ATPase activity(GO:0015432) |
| 0.0 | 0.5 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 0.1 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
| 0.0 | 0.0 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 0.0 | 0.1 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.0 | GO:0031626 | beta-endorphin binding(GO:0031626) |
| 0.0 | 0.1 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.0 | 0.6 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.3 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.0 | 0.1 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.0 | 0.6 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.0 | 0.0 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 0.1 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.0 | 0.2 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 1.4 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.2 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.3 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.0 | 0.0 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.0 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.0 | 0.0 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.1 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
| 0.0 | 0.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.5 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.1 | GO:0015254 | glycerol channel activity(GO:0015254) |
| 0.0 | 0.1 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.1 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.0 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.0 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.0 | 0.0 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.0 | 0.3 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.0 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.1 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.0 | 0.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.2 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.0 | 0.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.1 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.9 | GO:0020037 | heme binding(GO:0020037) |
| 0.0 | 0.0 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.0 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.1 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.0 | 0.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.0 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.0 | 0.1 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 2.3 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 0.0 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.0 | 0.0 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.7 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 2.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 1.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.2 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 0.6 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.5 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 2.4 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.0 | 2.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 2.8 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.2 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 0.4 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.5 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 0.8 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 1.9 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.8 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.1 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 1.1 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 1.7 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 0.2 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 3.4 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 2.2 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.8 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.0 | 1.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 3.1 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 6.5 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 0.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 0.6 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.4 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 4.7 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 1.1 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.8 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 3.4 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
| 0.0 | 0.2 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.6 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 1.3 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.2 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.7 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.7 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 0.3 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.6 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.4 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.4 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.6 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.2 | 0.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 8.5 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.1 | 2.1 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 4.2 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.1 | 1.2 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.1 | 2.5 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.1 | 2.2 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 0.9 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 2.5 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.0 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.0 | 0.6 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.9 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.4 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 1.2 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 2.0 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 1.7 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.8 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.7 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.4 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.2 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
| 0.0 | 1.5 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 1.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 1.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.1 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.4 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 1.2 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.0 | 0.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 1.6 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.0 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.0 | 0.6 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 0.6 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 1.4 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
| 0.0 | 0.8 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.5 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 0.3 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.5 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.3 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.4 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.4 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.5 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.7 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.5 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.0 | 0.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.8 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 1.5 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.4 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.5 | REACTOME NUCLEOTIDE BINDING DOMAIN LEUCINE RICH REPEAT CONTAINING RECEPTOR NLR SIGNALING PATHWAYS | Genes involved in Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways |
| 0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 1.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.6 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.1 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 1.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.7 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 0.4 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.0 | 0.4 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.3 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 0.6 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.3 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.8 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.1 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.0 | 0.3 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.0 | 0.4 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 0.2 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.1 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.6 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.1 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |