avrg: GSE58827: Dynamics of the Mouse Liver
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Ctcfl
|
ENSMUSG00000070495.12 | Ctcfl |
|
Ctcf
|
ENSMUSG00000005698.16 | Ctcf |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Ctcfl | mm39_v1_chr2_-_172961168_172961318 | -0.58 | 2.0e-04 | Click! |
| Ctcf | mm39_v1_chr8_+_106363141_106363221 | 0.43 | 9.1e-03 | Click! |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 7.0 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
| 1.0 | 3.1 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 1.0 | 3.1 | GO:0070194 | synaptonemal complex disassembly(GO:0070194) |
| 0.8 | 3.1 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.8 | 1.5 | GO:1902167 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902167) |
| 0.7 | 2.7 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.7 | 2.0 | GO:0035934 | corticosterone secretion(GO:0035934) |
| 0.6 | 2.6 | GO:0060265 | positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
| 0.6 | 2.5 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.6 | 2.4 | GO:0046898 | response to cycloheximide(GO:0046898) |
| 0.6 | 7.2 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.6 | 1.8 | GO:1903632 | positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
| 0.6 | 1.8 | GO:2000422 | regulation of eosinophil chemotaxis(GO:2000422) positive regulation of eosinophil chemotaxis(GO:2000424) |
| 0.5 | 1.6 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.5 | 1.5 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
| 0.5 | 2.0 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.5 | 3.9 | GO:0015675 | nickel cation transport(GO:0015675) |
| 0.5 | 1.9 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.5 | 1.4 | GO:0051542 | elastin biosynthetic process(GO:0051542) |
| 0.5 | 2.3 | GO:0002266 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.4 | 2.6 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.4 | 3.7 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.4 | 1.2 | GO:2000813 | negative regulation of barbed-end actin filament capping(GO:2000813) |
| 0.4 | 3.8 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.4 | 3.7 | GO:0098706 | ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.4 | 1.8 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.4 | 1.1 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 0.3 | 1.7 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.3 | 2.0 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.3 | 1.3 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.3 | 0.9 | GO:0019230 | proprioception(GO:0019230) |
| 0.3 | 1.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.3 | 1.8 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.3 | 1.5 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.3 | 0.8 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.3 | 1.8 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
| 0.3 | 1.0 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.2 | 0.9 | GO:1903923 | renal protein absorption(GO:0097017) protein processing in phagocytic vesicle(GO:1900756) positive regulation of keratinocyte apoptotic process(GO:1902174) regulation of protein processing in phagocytic vesicle(GO:1903921) positive regulation of protein processing in phagocytic vesicle(GO:1903923) |
| 0.2 | 0.9 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.2 | 2.4 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.2 | 0.9 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 0.2 | 1.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.2 | 1.1 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
| 0.2 | 1.7 | GO:0090666 | telomere assembly(GO:0032202) scaRNA localization to Cajal body(GO:0090666) |
| 0.2 | 3.7 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.2 | 0.8 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.2 | 2.9 | GO:0039532 | negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
| 0.2 | 0.5 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.2 | 0.5 | GO:0046021 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 0.2 | 1.2 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.2 | 0.5 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
| 0.2 | 3.9 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.2 | 0.8 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.2 | 1.9 | GO:0015870 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
| 0.2 | 0.9 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.2 | 1.2 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.2 | 5.0 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.2 | 0.8 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.1 | 1.2 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 0.1 | 2.6 | GO:0032486 | Rap protein signal transduction(GO:0032486) nerve growth factor signaling pathway(GO:0038180) |
| 0.1 | 2.5 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.1 | 1.6 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.1 | 1.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 0.9 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.1 | 1.5 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.1 | 0.5 | GO:0099541 | diacylglycerol catabolic process(GO:0046340) trans-synaptic signaling by lipid(GO:0099541) trans-synaptic signaling by endocannabinoid(GO:0099542) |
| 0.1 | 1.1 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.1 | 3.3 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 0.3 | GO:0061193 | taste bud development(GO:0061193) |
| 0.1 | 1.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 1.2 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.5 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.4 | GO:2000983 | regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.1 | 3.3 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.1 | 0.6 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.1 | 0.9 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.3 | GO:0046832 | RNA import into nucleus(GO:0006404) mRNA export from nucleus in response to heat stress(GO:0031990) negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.1 | 2.4 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 1.4 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 | 1.0 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.1 | 0.6 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.1 | 0.9 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.1 | 2.1 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.1 | 0.9 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.8 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.1 | 0.3 | GO:0070340 | detection of triacyl bacterial lipopeptide(GO:0042495) detection of bacterial lipopeptide(GO:0070340) |
| 0.1 | 0.6 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 0.8 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.1 | 0.7 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.1 | 3.1 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.1 | 0.2 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) |
| 0.1 | 0.9 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.1 | 1.9 | GO:2000193 | positive regulation of fatty acid transport(GO:2000193) |
| 0.1 | 0.5 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
| 0.1 | 0.7 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.1 | 0.8 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 0.4 | GO:0048069 | eye pigmentation(GO:0048069) |
| 0.1 | 2.2 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 | 0.4 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.1 | 0.9 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.1 | 0.5 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.1 | 0.2 | GO:1903028 | regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
| 0.1 | 0.4 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.1 | 0.6 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.5 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 1.3 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.1 | 1.1 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.1 | 1.7 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.1 | 0.3 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.1 | 1.0 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.3 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.6 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) |
| 0.1 | 0.4 | GO:0002158 | osteoclast proliferation(GO:0002158) |
| 0.1 | 0.9 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 | 0.5 | GO:1901838 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 | 0.8 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.9 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 3.8 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 | 0.4 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 | 0.9 | GO:0030238 | male sex determination(GO:0030238) |
| 0.0 | 1.4 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.1 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.0 | 0.1 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.0 | 0.3 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 1.0 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 1.9 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.2 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.1 | GO:0003220 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
| 0.0 | 3.4 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.0 | 0.4 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 | 1.0 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.3 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.1 | GO:0071033 | generation of catalytic spliceosome for second transesterification step(GO:0000350) nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
| 0.0 | 0.3 | GO:2001214 | dimeric G-protein coupled receptor signaling pathway(GO:0038042) calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) positive regulation of vasculogenesis(GO:2001214) |
| 0.0 | 0.8 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.5 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.0 | 1.6 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 | 1.5 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.8 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.2 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.0 | 0.2 | GO:2000676 | negative regulation of translation in response to stress(GO:0032055) positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 | 0.7 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) |
| 0.0 | 0.1 | GO:0072275 | metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
| 0.0 | 0.1 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 1.2 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.0 | 1.6 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.3 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.0 | 0.4 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.0 | 1.1 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
| 0.0 | 0.4 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.2 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.0 | 0.2 | GO:0090009 | primitive streak formation(GO:0090009) |
| 0.0 | 0.1 | GO:0048808 | male genitalia morphogenesis(GO:0048808) interphase(GO:0051325) mitotic interphase(GO:0051329) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.2 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.2 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 | 0.2 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.0 | 0.3 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.0 | 0.2 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
| 0.0 | 0.6 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
| 0.0 | 0.3 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.0 | 0.4 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.0 | 4.7 | GO:0000398 | RNA splicing, via transesterification reactions with bulged adenosine as nucleophile(GO:0000377) mRNA splicing, via spliceosome(GO:0000398) |
| 0.0 | 0.9 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.0 | 1.8 | GO:0051028 | mRNA transport(GO:0051028) |
| 0.0 | 0.5 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.0 | 0.1 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.0 | 0.6 | GO:0035825 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.7 | GO:0016239 | positive regulation of macroautophagy(GO:0016239) |
| 0.0 | 0.3 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.0 | 0.0 | GO:2001074 | negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.0 | 0.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.1 | GO:2000143 | negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.0 | 0.2 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
| 0.0 | 0.2 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.0 | 0.4 | GO:0032026 | response to magnesium ion(GO:0032026) |
| 0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.2 | GO:1990035 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 0.3 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.0 | 0.3 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.0 | GO:0050925 | negative regulation of negative chemotaxis(GO:0050925) |
| 0.0 | 0.3 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
| 0.0 | 0.1 | GO:1904259 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.0 | 0.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.8 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.0 | 0.4 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.3 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.2 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 7.0 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.8 | 3.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.8 | 3.0 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.7 | 3.9 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.5 | 2.3 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.5 | 1.8 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.4 | 6.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.3 | 3.9 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.3 | 3.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.3 | 0.8 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.2 | 2.0 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.2 | 2.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.2 | 1.2 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.2 | 2.6 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.2 | 1.4 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.2 | 0.2 | GO:0043614 | multi-eIF complex(GO:0043614) |
| 0.2 | 1.2 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.2 | 2.6 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.2 | 2.5 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.2 | 0.5 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.2 | 3.3 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.2 | 2.0 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.2 | 0.9 | GO:0097226 | sperm mitochondrial sheath(GO:0097226) |
| 0.2 | 0.9 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.2 | 0.9 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.2 | 0.9 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.2 | 1.4 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 3.3 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 2.0 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.9 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 2.7 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 1.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) RISC-loading complex(GO:0070578) |
| 0.1 | 1.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 0.9 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 2.9 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 1.5 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.1 | 2.0 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 0.6 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.1 | 1.0 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.1 | 0.5 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 1.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.1 | 0.9 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.4 | GO:0098833 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
| 0.1 | 0.3 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.1 | 2.5 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.1 | 0.3 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.1 | 4.8 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.1 | 5.6 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 1.1 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 1.7 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 0.6 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 2.7 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.1 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 0.6 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 1.4 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 0.3 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.1 | 0.5 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 0.3 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 1.0 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.5 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 2.2 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.0 | 0.2 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.0 | 3.8 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.7 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.5 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.3 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 1.1 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 5.4 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 1.0 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.5 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.3 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.0 | 0.3 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.0 | 3.3 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.6 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.0 | 0.2 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.0 | 1.0 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 0.3 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.5 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.0 | 0.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 1.2 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.7 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.3 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.6 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 1.4 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.0 | 1.1 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.1 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.6 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.0 | 0.2 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.0 | 0.4 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 1.0 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 1.1 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 3.6 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.0 | 0.1 | GO:0043224 | nuclear SCF ubiquitin ligase complex(GO:0043224) |
| 0.0 | 0.7 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.1 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.0 | 0.0 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.6 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.4 | GO:0031082 | BLOC complex(GO:0031082) |
| 0.0 | 0.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.2 | GO:0097346 | Ino80 complex(GO:0031011) INO80-type complex(GO:0097346) |
| 0.0 | 0.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 1.6 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 1.2 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 4.5 | GO:0004373 | glycogen (starch) synthase activity(GO:0004373) |
| 0.8 | 3.1 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
| 0.7 | 3.9 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.6 | 1.8 | GO:0031755 | endothelial differentiation G-protein coupled receptor binding(GO:0031753) Edg-2 lysophosphatidic acid receptor binding(GO:0031755) |
| 0.5 | 3.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.5 | 3.9 | GO:0015099 | nickel cation transmembrane transporter activity(GO:0015099) |
| 0.4 | 3.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.4 | 1.3 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.3 | 0.6 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.3 | 1.2 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.3 | 1.5 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.3 | 1.2 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.3 | 2.5 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.3 | 0.8 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.3 | 2.0 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.3 | 1.0 | GO:0043682 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
| 0.2 | 1.5 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.2 | 2.4 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.2 | 0.9 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.2 | 0.9 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.2 | 2.9 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.2 | 0.9 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.2 | 1.5 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.2 | 2.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.2 | 1.8 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.2 | 1.8 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.2 | 1.6 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.2 | 0.9 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.2 | 1.8 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.2 | 2.4 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.2 | 1.8 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.2 | 0.8 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.2 | 0.9 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 0.4 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.1 | 12.1 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.1 | 0.5 | GO:0051435 | BH4 domain binding(GO:0051435) |
| 0.1 | 0.9 | GO:0002135 | CTP binding(GO:0002135) |
| 0.1 | 3.3 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 1.4 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.1 | 0.8 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.1 | 1.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 0.3 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.1 | 0.5 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.8 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.1 | 0.9 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.1 | 0.7 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.1 | 0.4 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 1.7 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.1 | 3.7 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.1 | 2.4 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.5 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 0.6 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 2.7 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.1 | 2.4 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.6 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.1 | 0.3 | GO:0042497 | triacyl lipopeptide binding(GO:0042497) |
| 0.1 | 0.8 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 0.7 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 1.0 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.1 | 0.4 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.1 | 0.8 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.1 | 1.9 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 1.3 | GO:0004143 | lipid kinase activity(GO:0001727) diacylglycerol kinase activity(GO:0004143) |
| 0.1 | 0.6 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.2 | GO:0005302 | L-tyrosine transmembrane transporter activity(GO:0005302) |
| 0.1 | 0.5 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.1 | 2.6 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.1 | 0.2 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.1 | 1.9 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 1.4 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.5 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.1 | 0.8 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 1.5 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.1 | 4.3 | GO:0003724 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) |
| 0.1 | 1.2 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 0.8 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 1.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.1 | 3.5 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 1.7 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.1 | 0.9 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.1 | 0.3 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.1 | 0.9 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.3 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.1 | 0.4 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 1.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 3.3 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 2.4 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.0 | 0.1 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) |
| 0.0 | 0.2 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) |
| 0.0 | 1.5 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 1.4 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.0 | 0.6 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 1.9 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.6 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.8 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.3 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.6 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 5.2 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.0 | 0.7 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 1.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.3 | GO:0004579 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.2 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.0 | 0.3 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.2 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.3 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.0 | 0.1 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
| 0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.7 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.6 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.3 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
| 0.0 | 1.1 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 0.7 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 1.0 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.9 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 1.7 | GO:0004527 | exonuclease activity(GO:0004527) |
| 0.0 | 0.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.4 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 0.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.4 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 6.9 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.0 | 0.4 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.0 | 0.6 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.9 | GO:0019209 | kinase activator activity(GO:0019209) |
| 0.0 | 0.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 1.9 | GO:0005179 | hormone activity(GO:0005179) |
| 0.0 | 0.6 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.9 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 3.9 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.5 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 3.4 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 5.0 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 1.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.1 | 1.5 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 4.8 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 5.6 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.1 | 1.8 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 9.6 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.1 | 3.9 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 2.4 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.1 | 3.1 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 1.8 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 4.1 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.1 | 3.1 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.1 | 0.4 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 2.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 2.6 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.6 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 3.2 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 1.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.4 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 1.1 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.8 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 2.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.4 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 1.2 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.7 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.9 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.7 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.7 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.3 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.6 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.7 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.2 | 3.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.2 | 3.3 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.2 | 3.5 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.2 | 3.9 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 2.9 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.1 | 7.3 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.1 | 1.8 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.1 | 4.2 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.1 | 2.4 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.1 | 3.7 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.1 | 8.3 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 2.3 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.1 | 2.7 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 3.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 0.4 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 2.1 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.1 | 1.1 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.1 | 1.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 1.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 0.9 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 3.0 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 0.9 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.1 | 3.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 1.6 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.1 | 4.8 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
| 0.1 | 1.9 | REACTOME NUCLEOTIDE BINDING DOMAIN LEUCINE RICH REPEAT CONTAINING RECEPTOR NLR SIGNALING PATHWAYS | Genes involved in Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways |
| 0.0 | 1.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 1.1 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 2.3 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.0 | 1.2 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 1.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.9 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 0.6 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 2.9 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.2 | REACTOME TRANSCRIPTION COUPLED NER TC NER | Genes involved in Transcription-coupled NER (TC-NER) |
| 0.0 | 1.6 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.3 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 3.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 1.9 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 1.2 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.3 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.4 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.8 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.1 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 0.1 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.4 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |