avrg: GSE58827: Dynamics of the Mouse Liver
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Zic4
|
ENSMUSG00000036972.8 | zinc finger protein of the cerebellum 4 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Zic4 | mm10_v2_chr9_+_91378636_91378646 | -0.02 | 9.2e-01 | Click! |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 3.7 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.4 | 1.1 | GO:0097274 | urea homeostasis(GO:0097274) |
| 0.3 | 0.9 | GO:0006583 | melanin biosynthetic process from tyrosine(GO:0006583) |
| 0.3 | 1.8 | GO:0015862 | uridine transport(GO:0015862) |
| 0.2 | 0.9 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
| 0.2 | 0.7 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.2 | 0.6 | GO:0045077 | negative regulation of interferon-gamma biosynthetic process(GO:0045077) |
| 0.2 | 1.1 | GO:0097473 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 0.2 | 0.5 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.1 | 1.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.1 | 0.7 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 | 0.6 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.4 | GO:0002266 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.1 | 0.6 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 | 0.5 | GO:0061428 | positive regulation of oocyte development(GO:0060282) negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.1 | 0.4 | GO:0097490 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 0.1 | 0.7 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
| 0.1 | 0.4 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) mesenchymal stem cell proliferation(GO:0097168) |
| 0.1 | 0.5 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.1 | 0.3 | GO:1903406 | regulation of sodium:potassium-exchanging ATPase activity(GO:1903406) |
| 0.1 | 0.3 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) |
| 0.1 | 0.2 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 0.5 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.1 | 0.3 | GO:1903588 | blood vessel lumenization(GO:0072554) negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 | 1.4 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 | 0.9 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.1 | 0.2 | GO:0015920 | regulation of phosphatidylcholine catabolic process(GO:0010899) lipopolysaccharide transport(GO:0015920) |
| 0.1 | 1.0 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 0.6 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 | 0.2 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 0.5 | GO:0060214 | endocardium formation(GO:0060214) |
| 0.1 | 1.1 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.1 | 0.2 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 0.1 | 0.3 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 0.1 | 0.2 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
| 0.1 | 0.2 | GO:0030026 | cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.1 | 0.4 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.1 | 0.3 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 | 0.5 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 1.1 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.0 | 0.2 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 0.0 | 0.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.1 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.0 | 0.3 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.0 | 0.3 | GO:0070317 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) negative regulation of G0 to G1 transition(GO:0070317) |
| 0.0 | 0.8 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.0 | 0.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.2 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.3 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.0 | 0.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 1.5 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.3 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.0 | 1.6 | GO:0048713 | regulation of oligodendrocyte differentiation(GO:0048713) |
| 0.0 | 0.3 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.0 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.7 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.0 | 0.2 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.0 | 0.1 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.0 | 0.4 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.2 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.3 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.5 | GO:0060384 | innervation(GO:0060384) |
| 0.0 | 0.0 | GO:0001743 | optic placode formation(GO:0001743) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.0 | 0.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.2 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.1 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.0 | 0.4 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.0 | 0.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:0015874 | norepinephrine transport(GO:0015874) |
| 0.0 | 0.0 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.0 | 0.2 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.0 | 0.3 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.3 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.4 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.0 | 0.3 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.8 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
| 0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.4 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.1 | 0.4 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.1 | 0.6 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.1 | 0.5 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.1 | 0.7 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 1.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.7 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.0 | 0.2 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.0 | 0.2 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 0.9 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 1.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.0 | 0.3 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 0.1 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.5 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 1.1 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.2 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.3 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.2 | GO:0031528 | microvillus membrane(GO:0031528) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.6 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.4 | 1.2 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.2 | 0.7 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.2 | 0.6 | GO:0004923 | leukemia inhibitory factor receptor activity(GO:0004923) |
| 0.2 | 0.5 | GO:0030977 | taurine binding(GO:0030977) |
| 0.2 | 1.4 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.9 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.1 | 0.4 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.1 | 3.7 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.1 | 0.5 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) tubulin deacetylase activity(GO:0042903) |
| 0.1 | 0.1 | GO:0004915 | interleukin-6 receptor activity(GO:0004915) interleukin-6 binding(GO:0019981) |
| 0.1 | 0.7 | GO:0002054 | nucleobase binding(GO:0002054) hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.1 | 0.4 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.1 | 1.3 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 1.1 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.1 | 1.7 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.9 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.1 | 0.2 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
| 0.1 | 1.0 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 0.2 | GO:0005119 | smoothened binding(GO:0005119) hedgehog receptor activity(GO:0008158) |
| 0.1 | 0.2 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.1 | 0.2 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.1 | 0.2 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.1 | 0.2 | GO:0015410 | manganese-transporting ATPase activity(GO:0015410) |
| 0.1 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.1 | 0.3 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.1 | 0.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.7 | GO:0010314 | DNA binding, bending(GO:0008301) phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.8 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.8 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.0 | 1.9 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 1.1 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.9 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.3 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.3 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.4 | GO:0045499 | neuropilin binding(GO:0038191) chemorepellent activity(GO:0045499) |
| 0.0 | 0.3 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.2 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.3 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.7 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.4 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.2 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
| 0.0 | 0.5 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 0.1 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.0 | 0.2 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.8 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.2 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.2 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.3 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 1.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 1.3 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.4 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 0.9 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.8 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 1.3 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.7 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.4 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.7 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.7 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.3 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 1.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 1.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 1.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 0.9 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 1.1 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 2.0 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.7 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.7 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.3 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.3 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.0 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.5 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.2 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.2 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |