| 3.1 |
18.7 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 1.8 |
5.5 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 1.6 |
4.8 |
GO:0042998 |
positive regulation of Golgi to plasma membrane protein transport(GO:0042998) positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 1.4 |
14.5 |
GO:1900194 |
negative regulation of oocyte maturation(GO:1900194) |
| 1.4 |
7.0 |
GO:0032902 |
nerve growth factor production(GO:0032902) |
| 1.4 |
6.9 |
GO:0070178 |
D-serine metabolic process(GO:0070178) |
| 1.2 |
3.7 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) |
| 1.2 |
3.7 |
GO:0090341 |
negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 1.2 |
1.2 |
GO:0045077 |
negative regulation of interferon-gamma biosynthetic process(GO:0045077) |
| 1.2 |
4.8 |
GO:0006522 |
alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) |
| 1.2 |
4.6 |
GO:0000711 |
meiotic DNA repair synthesis(GO:0000711) |
| 1.1 |
1.1 |
GO:1902728 |
positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 1.1 |
3.2 |
GO:0006562 |
proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) |
| 1.0 |
9.4 |
GO:0035754 |
B cell chemotaxis(GO:0035754) |
| 1.0 |
3.1 |
GO:1903070 |
negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 1.0 |
4.1 |
GO:0099527 |
postsynapse to nucleus signaling pathway(GO:0099527) |
| 1.0 |
3.1 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 1.0 |
6.2 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 1.0 |
3.1 |
GO:0010512 |
negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 1.0 |
3.0 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 1.0 |
4.0 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 1.0 |
2.0 |
GO:0033092 |
positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 1.0 |
2.9 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 1.0 |
2.9 |
GO:0090650 |
response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 1.0 |
2.9 |
GO:1904760 |
myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.9 |
1.9 |
GO:0090206 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.9 |
2.8 |
GO:0034334 |
adherens junction maintenance(GO:0034334) |
| 0.9 |
0.9 |
GO:0071462 |
cellular response to water stimulus(GO:0071462) |
| 0.9 |
3.7 |
GO:0061625 |
fructose catabolic process(GO:0006001) response to sucrose(GO:0009744) response to disaccharide(GO:0034285) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.9 |
4.6 |
GO:0032485 |
regulation of Ral protein signal transduction(GO:0032485) |
| 0.9 |
2.7 |
GO:0071492 |
cellular response to UV-A(GO:0071492) |
| 0.9 |
2.6 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.9 |
3.4 |
GO:1904412 |
regulation of cardiac ventricle development(GO:1904412) |
| 0.9 |
2.6 |
GO:0071332 |
cellular response to fructose stimulus(GO:0071332) |
| 0.9 |
3.4 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 0.8 |
0.8 |
GO:0070428 |
regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
| 0.8 |
1.7 |
GO:0014858 |
positive regulation of skeletal muscle cell proliferation(GO:0014858) |
| 0.8 |
2.5 |
GO:1904719 |
excitatory chemical synaptic transmission(GO:0098976) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.8 |
5.0 |
GO:0010730 |
negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.8 |
8.2 |
GO:0061727 |
methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.8 |
2.5 |
GO:0043323 |
positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.8 |
2.4 |
GO:0007529 |
establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.8 |
2.4 |
GO:0035928 |
rRNA import into mitochondrion(GO:0035928) |
| 0.8 |
5.5 |
GO:0070054 |
mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) |
| 0.8 |
3.2 |
GO:0010982 |
regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.8 |
8.6 |
GO:0090503 |
RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.8 |
2.3 |
GO:0010046 |
response to mycotoxin(GO:0010046) |
| 0.7 |
0.7 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.7 |
2.2 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.7 |
2.2 |
GO:0019464 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.7 |
0.7 |
GO:0042196 |
chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 0.7 |
5.0 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.7 |
3.5 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 0.7 |
0.7 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.7 |
2.8 |
GO:1903237 |
negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.7 |
2.1 |
GO:0006542 |
glutamine biosynthetic process(GO:0006542) |
| 0.7 |
3.5 |
GO:0090234 |
regulation of kinetochore assembly(GO:0090234) |
| 0.7 |
3.4 |
GO:1904352 |
positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.7 |
2.7 |
GO:0003349 |
epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.7 |
2.0 |
GO:0031590 |
wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.7 |
2.7 |
GO:0048294 |
negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.7 |
0.7 |
GO:0045829 |
negative regulation of isotype switching(GO:0045829) |
| 0.7 |
2.0 |
GO:1901355 |
response to rapamycin(GO:1901355) |
| 0.7 |
1.3 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.7 |
2.0 |
GO:0097065 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.7 |
2.0 |
GO:0034959 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.7 |
4.6 |
GO:1904017 |
response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.6 |
2.6 |
GO:2000017 |
positive regulation of determination of dorsal identity(GO:2000017) |
| 0.6 |
2.6 |
GO:1903069 |
regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
| 0.6 |
0.6 |
GO:0033122 |
negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.6 |
2.6 |
GO:0006651 |
diacylglycerol biosynthetic process(GO:0006651) |
| 0.6 |
3.2 |
GO:0009730 |
detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.6 |
1.9 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.6 |
5.7 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.6 |
3.8 |
GO:0045585 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.6 |
6.3 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.6 |
0.6 |
GO:1904173 |
regulation of histone demethylase activity (H3-K4 specific)(GO:1904173) |
| 0.6 |
1.9 |
GO:0042726 |
flavin-containing compound metabolic process(GO:0042726) |
| 0.6 |
1.8 |
GO:0060466 |
activation of meiosis involved in egg activation(GO:0060466) |
| 0.6 |
5.5 |
GO:0046449 |
creatinine metabolic process(GO:0046449) |
| 0.6 |
1.8 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.6 |
1.8 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.6 |
6.7 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.6 |
2.4 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.6 |
1.8 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.6 |
1.2 |
GO:0090427 |
activation of meiosis(GO:0090427) |
| 0.6 |
3.6 |
GO:0098964 |
dendritic transport of ribonucleoprotein complex(GO:0098961) dendritic transport of messenger ribonucleoprotein complex(GO:0098963) anterograde dendritic transport of messenger ribonucleoprotein complex(GO:0098964) |
| 0.6 |
3.5 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.6 |
1.8 |
GO:0031335 |
regulation of sulfur amino acid metabolic process(GO:0031335) |
| 0.6 |
0.6 |
GO:1990535 |
neuron projection maintenance(GO:1990535) |
| 0.6 |
1.1 |
GO:2000563 |
positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.6 |
3.3 |
GO:0034756 |
regulation of iron ion transport(GO:0034756) regulation of iron ion transmembrane transport(GO:0034759) |
| 0.6 |
3.3 |
GO:0001757 |
somite specification(GO:0001757) |
| 0.5 |
3.3 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.5 |
1.6 |
GO:0031161 |
phosphatidylinositol catabolic process(GO:0031161) |
| 0.5 |
1.6 |
GO:0036228 |
protein targeting to nuclear inner membrane(GO:0036228) |
| 0.5 |
2.2 |
GO:0006668 |
sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.5 |
2.2 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.5 |
3.7 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.5 |
2.1 |
GO:1903896 |
positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
| 0.5 |
2.1 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.5 |
1.5 |
GO:0009073 |
tyrosine biosynthetic process(GO:0006571) aromatic amino acid family biosynthetic process(GO:0009073) aromatic amino acid family biosynthetic process, prephenate pathway(GO:0009095) |
| 0.5 |
1.5 |
GO:1990166 |
protein localization to site of double-strand break(GO:1990166) |
| 0.5 |
0.5 |
GO:0071211 |
protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.5 |
1.5 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.5 |
1.5 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.5 |
0.5 |
GO:0072425 |
signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) |
| 0.5 |
4.0 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.5 |
1.5 |
GO:0002842 |
positive regulation of T cell mediated immune response to tumor cell(GO:0002842) |
| 0.5 |
2.5 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.5 |
1.0 |
GO:0046512 |
sphingosine biosynthetic process(GO:0046512) |
| 0.5 |
2.0 |
GO:0046951 |
ketone body biosynthetic process(GO:0046951) |
| 0.5 |
1.5 |
GO:0060084 |
synaptic transmission involved in micturition(GO:0060084) |
| 0.5 |
1.9 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.5 |
2.9 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.5 |
2.4 |
GO:2000766 |
negative regulation of cytoplasmic translation(GO:2000766) |
| 0.5 |
1.9 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.5 |
1.4 |
GO:0071579 |
regulation of zinc ion transport(GO:0071579) |
| 0.5 |
2.8 |
GO:0003383 |
apical constriction(GO:0003383) |
| 0.5 |
3.8 |
GO:0008611 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.5 |
3.3 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.5 |
5.6 |
GO:0014807 |
regulation of somitogenesis(GO:0014807) |
| 0.5 |
1.4 |
GO:0043570 |
maintenance of DNA repeat elements(GO:0043570) |
| 0.5 |
1.4 |
GO:1903002 |
regulation of lipid transport across blood brain barrier(GO:1903000) positive regulation of lipid transport across blood brain barrier(GO:1903002) |
| 0.5 |
3.2 |
GO:0042738 |
exogenous drug catabolic process(GO:0042738) |
| 0.5 |
1.4 |
GO:0061763 |
multivesicular body-lysosome fusion(GO:0061763) |
| 0.5 |
0.5 |
GO:0097384 |
cellular lipid biosynthetic process(GO:0097384) |
| 0.5 |
3.2 |
GO:0051792 |
medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.5 |
2.3 |
GO:0015746 |
tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.4 |
1.3 |
GO:0046370 |
fructose biosynthetic process(GO:0046370) |
| 0.4 |
0.9 |
GO:1903542 |
negative regulation of exosomal secretion(GO:1903542) |
| 0.4 |
1.8 |
GO:0060431 |
primary lung bud formation(GO:0060431) |
| 0.4 |
2.2 |
GO:0015788 |
UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.4 |
2.7 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.4 |
1.3 |
GO:0006154 |
adenosine catabolic process(GO:0006154) |
| 0.4 |
5.3 |
GO:0098787 |
mRNA cleavage involved in mRNA processing(GO:0098787) |
| 0.4 |
0.4 |
GO:1900275 |
negative regulation of phospholipase C activity(GO:1900275) |
| 0.4 |
1.3 |
GO:1905223 |
epicardium morphogenesis(GO:1905223) |
| 0.4 |
1.3 |
GO:0035336 |
long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
| 0.4 |
0.4 |
GO:1903999 |
negative regulation of eating behavior(GO:1903999) |
| 0.4 |
1.3 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.4 |
0.4 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.4 |
1.3 |
GO:1990168 |
protein K33-linked deubiquitination(GO:1990168) |
| 0.4 |
1.7 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.4 |
3.0 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.4 |
1.3 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.4 |
5.0 |
GO:0001574 |
ganglioside biosynthetic process(GO:0001574) |
| 0.4 |
1.7 |
GO:0034031 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.4 |
0.8 |
GO:0032058 |
positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.4 |
3.3 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.4 |
1.7 |
GO:0003165 |
Purkinje myocyte development(GO:0003165) |
| 0.4 |
7.4 |
GO:0045717 |
negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.4 |
1.2 |
GO:0001193 |
maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 0.4 |
2.0 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.4 |
1.2 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.4 |
1.6 |
GO:1900740 |
regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.4 |
1.2 |
GO:0033629 |
negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.4 |
0.8 |
GO:1903181 |
regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) |
| 0.4 |
0.8 |
GO:1902809 |
regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.4 |
1.6 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.4 |
1.2 |
GO:0060720 |
spongiotrophoblast cell proliferation(GO:0060720) cell proliferation involved in embryonic placenta development(GO:0060722) |
| 0.4 |
2.4 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.4 |
1.6 |
GO:1904694 |
negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.4 |
1.6 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.4 |
1.2 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.4 |
14.5 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.4 |
2.4 |
GO:0071630 |
nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.4 |
1.2 |
GO:0035441 |
cell migration involved in vasculogenesis(GO:0035441) |
| 0.4 |
1.2 |
GO:1900247 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.4 |
1.9 |
GO:0044805 |
late nucleophagy(GO:0044805) |
| 0.4 |
5.8 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.4 |
8.2 |
GO:0006101 |
citrate metabolic process(GO:0006101) |
| 0.4 |
2.3 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.4 |
1.5 |
GO:0036482 |
neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.4 |
3.1 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.4 |
0.4 |
GO:0032627 |
interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.4 |
6.9 |
GO:0015936 |
coenzyme A metabolic process(GO:0015936) |
| 0.4 |
1.5 |
GO:2000468 |
regulation of peroxidase activity(GO:2000468) |
| 0.4 |
2.3 |
GO:1903275 |
positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.4 |
1.9 |
GO:0043097 |
pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.4 |
2.3 |
GO:0018992 |
germ-line sex determination(GO:0018992) |
| 0.4 |
1.1 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.4 |
3.8 |
GO:0055089 |
fatty acid homeostasis(GO:0055089) |
| 0.4 |
1.9 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.4 |
1.9 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.4 |
2.2 |
GO:1902998 |
regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
| 0.4 |
1.1 |
GO:0090204 |
protein localization to nuclear pore(GO:0090204) |
| 0.4 |
2.6 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.4 |
2.6 |
GO:0001302 |
replicative cell aging(GO:0001302) |
| 0.4 |
1.9 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.4 |
2.6 |
GO:0075071 |
autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.4 |
1.1 |
GO:0010166 |
wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.4 |
2.9 |
GO:1903551 |
regulation of extracellular exosome assembly(GO:1903551) |
| 0.4 |
1.5 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.4 |
3.6 |
GO:0061734 |
parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
| 0.4 |
4.7 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.4 |
2.5 |
GO:1990035 |
calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.4 |
1.4 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.4 |
2.2 |
GO:0033540 |
fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.4 |
0.7 |
GO:0014878 |
response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.4 |
1.8 |
GO:0044331 |
cell-cell adhesion mediated by cadherin(GO:0044331) |
| 0.4 |
2.5 |
GO:0033578 |
protein glycosylation in Golgi(GO:0033578) |
| 0.4 |
1.4 |
GO:0044268 |
multicellular organismal protein metabolic process(GO:0044268) |
| 0.4 |
0.7 |
GO:0018894 |
dibenzo-p-dioxin metabolic process(GO:0018894) |
| 0.4 |
3.2 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.4 |
1.1 |
GO:0002014 |
vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
| 0.4 |
2.5 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.4 |
0.4 |
GO:0015744 |
succinate transport(GO:0015744) |
| 0.4 |
5.6 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.4 |
0.4 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.4 |
1.1 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.4 |
0.7 |
GO:0010877 |
lipid transport involved in lipid storage(GO:0010877) |
| 0.3 |
0.3 |
GO:2000182 |
regulation of progesterone biosynthetic process(GO:2000182) |
| 0.3 |
1.4 |
GO:0060715 |
syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.3 |
0.3 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.3 |
2.4 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.3 |
1.4 |
GO:2001106 |
regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.3 |
1.0 |
GO:0021526 |
medial motor column neuron differentiation(GO:0021526) |
| 0.3 |
1.0 |
GO:0015680 |
intracellular copper ion transport(GO:0015680) |
| 0.3 |
0.3 |
GO:0006990 |
positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.3 |
1.0 |
GO:0043153 |
entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.3 |
2.1 |
GO:0072092 |
ureteric bud invasion(GO:0072092) |
| 0.3 |
1.7 |
GO:0010636 |
positive regulation of mitochondrial fusion(GO:0010636) |
| 0.3 |
1.4 |
GO:0097577 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.3 |
1.7 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.3 |
1.3 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.3 |
2.0 |
GO:1900145 |
regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) |
| 0.3 |
2.0 |
GO:0044860 |
protein localization to plasma membrane raft(GO:0044860) |
| 0.3 |
2.0 |
GO:2000630 |
positive regulation of miRNA metabolic process(GO:2000630) |
| 0.3 |
2.0 |
GO:2000774 |
positive regulation of cellular senescence(GO:2000774) |
| 0.3 |
1.0 |
GO:0017187 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.3 |
1.3 |
GO:0016240 |
autophagosome docking(GO:0016240) |
| 0.3 |
1.7 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.3 |
0.3 |
GO:0007172 |
signal complex assembly(GO:0007172) |
| 0.3 |
0.6 |
GO:1903895 |
negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.3 |
1.3 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) |
| 0.3 |
0.6 |
GO:0034551 |
respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.3 |
3.9 |
GO:0060789 |
hair follicle placode formation(GO:0060789) |
| 0.3 |
1.3 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.3 |
1.6 |
GO:0042866 |
pyruvate biosynthetic process(GO:0042866) |
| 0.3 |
1.0 |
GO:0070602 |
regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 0.3 |
1.3 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.3 |
1.0 |
GO:0034382 |
chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.3 |
0.6 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.3 |
1.3 |
GO:2000562 |
negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.3 |
0.9 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.3 |
1.3 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.3 |
0.9 |
GO:0071680 |
response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.3 |
0.9 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.3 |
9.0 |
GO:0006896 |
Golgi to vacuole transport(GO:0006896) |
| 0.3 |
0.9 |
GO:0042760 |
very long-chain fatty acid catabolic process(GO:0042760) |
| 0.3 |
1.2 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.3 |
1.5 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.3 |
0.3 |
GO:1902445 |
regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.3 |
1.2 |
GO:2000292 |
regulation of defecation(GO:2000292) negative regulation of defecation(GO:2000293) |
| 0.3 |
1.2 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.3 |
1.2 |
GO:0034769 |
basement membrane disassembly(GO:0034769) |
| 0.3 |
1.5 |
GO:0032237 |
activation of store-operated calcium channel activity(GO:0032237) |
| 0.3 |
2.8 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.3 |
12.8 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.3 |
4.6 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.3 |
0.3 |
GO:0060701 |
negative regulation of ribonuclease activity(GO:0060701) negative regulation of endoribonuclease activity(GO:0060702) |
| 0.3 |
0.6 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.3 |
1.2 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
| 0.3 |
2.1 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.3 |
0.9 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.3 |
1.2 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.3 |
1.2 |
GO:0034653 |
diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.3 |
2.7 |
GO:0006707 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.3 |
2.1 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.3 |
0.6 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.3 |
4.1 |
GO:1903748 |
negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.3 |
1.2 |
GO:0019853 |
L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.3 |
1.2 |
GO:1901582 |
post-embryonic appendage morphogenesis(GO:0035120) post-embryonic limb morphogenesis(GO:0035127) post-embryonic forelimb morphogenesis(GO:0035128) telomeric repeat-containing RNA transcription(GO:0097393) telomeric repeat-containing RNA transcription from RNA pol II promoter(GO:0097394) regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901580) negative regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901581) positive regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901582) |
| 0.3 |
3.5 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.3 |
3.5 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.3 |
0.6 |
GO:0042758 |
long-chain fatty acid catabolic process(GO:0042758) |
| 0.3 |
0.3 |
GO:0034146 |
toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.3 |
0.9 |
GO:1990859 |
cellular response to endothelin(GO:1990859) |
| 0.3 |
2.0 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.3 |
0.6 |
GO:0042126 |
nitrate metabolic process(GO:0042126) |
| 0.3 |
2.6 |
GO:0071941 |
nitrogen cycle metabolic process(GO:0071941) |
| 0.3 |
2.6 |
GO:0009301 |
snRNA transcription(GO:0009301) |
| 0.3 |
1.1 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.3 |
1.1 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.3 |
0.3 |
GO:0090365 |
regulation of mRNA modification(GO:0090365) |
| 0.3 |
2.5 |
GO:0071569 |
protein ufmylation(GO:0071569) |
| 0.3 |
0.3 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.3 |
1.4 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.3 |
2.8 |
GO:0046959 |
habituation(GO:0046959) |
| 0.3 |
1.4 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.3 |
0.6 |
GO:1990401 |
embryonic lung development(GO:1990401) |
| 0.3 |
1.1 |
GO:0060800 |
regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.3 |
0.8 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 0.3 |
1.1 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.3 |
0.3 |
GO:1904339 |
negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.3 |
0.8 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.3 |
2.7 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.3 |
1.9 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 0.3 |
0.8 |
GO:0030450 |
regulation of complement activation, classical pathway(GO:0030450) |
| 0.3 |
1.9 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) |
| 0.3 |
0.5 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.3 |
0.5 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.3 |
3.3 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.3 |
0.3 |
GO:0032805 |
positive regulation of low-density lipoprotein particle receptor catabolic process(GO:0032805) |
| 0.3 |
0.8 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.3 |
1.3 |
GO:0002485 |
antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.3 |
1.3 |
GO:1903361 |
protein localization to basolateral plasma membrane(GO:1903361) |
| 0.3 |
0.8 |
GO:0019858 |
cytosine metabolic process(GO:0019858) |
| 0.3 |
4.3 |
GO:0009083 |
branched-chain amino acid catabolic process(GO:0009083) |
| 0.3 |
1.1 |
GO:0035553 |
oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.3 |
1.1 |
GO:0003273 |
cell migration involved in endocardial cushion formation(GO:0003273) |
| 0.3 |
1.6 |
GO:0008078 |
mesodermal cell migration(GO:0008078) |
| 0.3 |
9.0 |
GO:0008333 |
endosome to lysosome transport(GO:0008333) |
| 0.3 |
3.4 |
GO:0046051 |
UTP metabolic process(GO:0046051) |
| 0.3 |
1.6 |
GO:0032483 |
regulation of Rab protein signal transduction(GO:0032483) |
| 0.3 |
3.4 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.3 |
1.3 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.3 |
0.5 |
GO:2000328 |
regulation of T-helper 17 cell lineage commitment(GO:2000328) |
| 0.3 |
0.3 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.3 |
0.8 |
GO:0030210 |
heparin biosynthetic process(GO:0030210) |
| 0.3 |
1.3 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.3 |
6.8 |
GO:0010866 |
regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.3 |
1.0 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.3 |
0.8 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.3 |
1.0 |
GO:1903964 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.3 |
0.8 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.3 |
2.3 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.3 |
1.3 |
GO:0019720 |
Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.3 |
1.8 |
GO:2000508 |
regulation of dendritic cell chemotaxis(GO:2000508) |
| 0.3 |
0.8 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) |
| 0.3 |
0.8 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.3 |
0.8 |
GO:0043328 |
protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.3 |
2.0 |
GO:0007191 |
adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.3 |
2.8 |
GO:0019363 |
pyridine nucleotide biosynthetic process(GO:0019363) |
| 0.3 |
1.0 |
GO:0007621 |
negative regulation of female receptivity(GO:0007621) |
| 0.3 |
2.3 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.3 |
2.8 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.3 |
1.0 |
GO:0046604 |
positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.3 |
1.8 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.3 |
0.3 |
GO:0046949 |
fatty-acyl-CoA biosynthetic process(GO:0046949) |
| 0.2 |
1.0 |
GO:0045358 |
negative regulation of interferon-beta biosynthetic process(GO:0045358) |
| 0.2 |
1.0 |
GO:0045922 |
negative regulation of fatty acid metabolic process(GO:0045922) |
| 0.2 |
0.7 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.2 |
0.7 |
GO:1903286 |
regulation of potassium ion import(GO:1903286) |
| 0.2 |
2.0 |
GO:1990504 |
dense core granule exocytosis(GO:1990504) |
| 0.2 |
1.5 |
GO:0050882 |
voluntary musculoskeletal movement(GO:0050882) |
| 0.2 |
2.0 |
GO:2000074 |
regulation of type B pancreatic cell development(GO:2000074) |
| 0.2 |
2.0 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.2 |
2.0 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 |
0.7 |
GO:0010705 |
meiotic DNA double-strand break processing involved in reciprocal meiotic recombination(GO:0010705) |
| 0.2 |
1.5 |
GO:0015679 |
plasma membrane copper ion transport(GO:0015679) copper ion import across plasma membrane(GO:0098705) copper ion import into cell(GO:1902861) |
| 0.2 |
3.4 |
GO:0055059 |
asymmetric neuroblast division(GO:0055059) |
| 0.2 |
0.2 |
GO:0090467 |
L-arginine import(GO:0043091) arginine import(GO:0090467) |
| 0.2 |
0.2 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.2 |
0.2 |
GO:0046619 |
optic placode formation(GO:0001743) optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.2 |
1.2 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 |
1.0 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.2 |
0.7 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.2 |
1.0 |
GO:1902309 |
negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.2 |
0.7 |
GO:0061075 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.2 |
2.2 |
GO:0006646 |
phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.2 |
0.2 |
GO:0010901 |
regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 0.2 |
0.5 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.2 |
0.7 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.2 |
3.3 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.2 |
0.5 |
GO:2001055 |
positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
| 0.2 |
1.4 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.2 |
0.7 |
GO:0048619 |
embryonic hindgut morphogenesis(GO:0048619) |
| 0.2 |
0.5 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.2 |
0.7 |
GO:0070900 |
mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.2 |
5.6 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.2 |
0.2 |
GO:0090394 |
negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.2 |
0.2 |
GO:0002465 |
peripheral T cell tolerance induction(GO:0002458) peripheral tolerance induction(GO:0002465) |
| 0.2 |
0.5 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 0.2 |
0.2 |
GO:0003218 |
cardiac left ventricle formation(GO:0003218) |
| 0.2 |
0.9 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.2 |
3.9 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.2 |
1.4 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 0.2 |
0.7 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 0.2 |
0.5 |
GO:0030970 |
retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.2 |
1.8 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.2 |
9.6 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.2 |
0.9 |
GO:0070127 |
tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.2 |
2.5 |
GO:0097421 |
liver regeneration(GO:0097421) |
| 0.2 |
0.7 |
GO:1905053 |
regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.2 |
0.9 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.2 |
0.7 |
GO:1904098 |
regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.2 |
0.2 |
GO:0002913 |
positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.2 |
9.7 |
GO:0006890 |
retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.2 |
0.7 |
GO:0002143 |
tRNA wobble position uridine thiolation(GO:0002143) |
| 0.2 |
1.1 |
GO:0043366 |
beta selection(GO:0043366) |
| 0.2 |
0.7 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.2 |
0.9 |
GO:1902949 |
positive regulation of tau-protein kinase activity(GO:1902949) |
| 0.2 |
0.7 |
GO:0061193 |
taste bud development(GO:0061193) |
| 0.2 |
0.2 |
GO:0098501 |
polynucleotide dephosphorylation(GO:0098501) |
| 0.2 |
1.5 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.2 |
0.7 |
GO:1904811 |
dense core granule localization(GO:0032253) dense core granule transport(GO:1901950) regulation of dense core granule transport(GO:1904809) positive regulation of dense core granule transport(GO:1904811) |
| 0.2 |
0.7 |
GO:0051775 |
response to redox state(GO:0051775) |
| 0.2 |
0.2 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.2 |
0.9 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.2 |
1.9 |
GO:0061088 |
sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.2 |
5.4 |
GO:0061157 |
mRNA destabilization(GO:0061157) |
| 0.2 |
0.2 |
GO:1903273 |
regulation of sodium ion export(GO:1903273) regulation of sodium ion export from cell(GO:1903276) |
| 0.2 |
2.8 |
GO:0099563 |
modification of synaptic structure(GO:0099563) |
| 0.2 |
0.6 |
GO:1904579 |
response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.2 |
0.9 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.2 |
0.9 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.2 |
1.5 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 |
0.6 |
GO:0070375 |
ERK5 cascade(GO:0070375) |
| 0.2 |
0.4 |
GO:0021898 |
commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.2 |
1.5 |
GO:0001712 |
ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.2 |
0.4 |
GO:0019471 |
4-hydroxyproline metabolic process(GO:0019471) |
| 0.2 |
0.2 |
GO:1990791 |
dorsal root ganglion development(GO:1990791) |
| 0.2 |
0.4 |
GO:0009649 |
entrainment of circadian clock(GO:0009649) |
| 0.2 |
1.9 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.2 |
1.0 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.2 |
0.6 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.2 |
1.0 |
GO:0006558 |
L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) tyrosine catabolic process(GO:0006572) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.2 |
9.4 |
GO:0006749 |
glutathione metabolic process(GO:0006749) |
| 0.2 |
0.6 |
GO:1902605 |
heterotrimeric G-protein complex assembly(GO:1902605) |
| 0.2 |
0.8 |
GO:0002322 |
B cell proliferation involved in immune response(GO:0002322) |
| 0.2 |
3.1 |
GO:0044804 |
nucleophagy(GO:0044804) |
| 0.2 |
1.4 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.2 |
1.8 |
GO:0035021 |
negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.2 |
1.6 |
GO:0051103 |
DNA ligation involved in DNA repair(GO:0051103) |
| 0.2 |
1.8 |
GO:0032308 |
positive regulation of prostaglandin secretion(GO:0032308) |
| 0.2 |
0.2 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.2 |
1.0 |
GO:0038108 |
negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.2 |
0.4 |
GO:0002188 |
translation reinitiation(GO:0002188) |
| 0.2 |
0.4 |
GO:0071316 |
cellular response to nicotine(GO:0071316) |
| 0.2 |
0.6 |
GO:0032466 |
negative regulation of cytokinesis(GO:0032466) |
| 0.2 |
0.6 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.2 |
3.6 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.2 |
1.4 |
GO:0032380 |
regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.2 |
2.5 |
GO:0033617 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.2 |
0.8 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.2 |
0.4 |
GO:1904253 |
positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.2 |
1.0 |
GO:1905150 |
regulation of voltage-gated sodium channel activity(GO:1905150) |
| 0.2 |
0.2 |
GO:0035509 |
negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
| 0.2 |
1.0 |
GO:0000738 |
DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.2 |
1.4 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.2 |
0.4 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.2 |
1.0 |
GO:0042138 |
meiotic DNA double-strand break formation(GO:0042138) |
| 0.2 |
0.6 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.2 |
1.0 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.2 |
1.7 |
GO:0070842 |
aggresome assembly(GO:0070842) |
| 0.2 |
7.2 |
GO:0034243 |
regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
| 0.2 |
2.7 |
GO:2001256 |
regulation of store-operated calcium entry(GO:2001256) |
| 0.2 |
0.6 |
GO:0006642 |
triglyceride mobilization(GO:0006642) |
| 0.2 |
0.8 |
GO:0003219 |
cardiac right ventricle formation(GO:0003219) |
| 0.2 |
0.6 |
GO:0060785 |
regulation of apoptosis involved in tissue homeostasis(GO:0060785) |
| 0.2 |
1.7 |
GO:0015732 |
prostaglandin transport(GO:0015732) |
| 0.2 |
0.2 |
GO:0006295 |
nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.2 |
1.1 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 |
0.6 |
GO:2000312 |
regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.2 |
0.9 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.2 |
0.4 |
GO:0021979 |
hypothalamus cell differentiation(GO:0021979) |
| 0.2 |
0.7 |
GO:0071847 |
TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.2 |
0.2 |
GO:2001160 |
regulation of histone H3-K79 methylation(GO:2001160) |
| 0.2 |
1.7 |
GO:0051665 |
membrane raft localization(GO:0051665) |
| 0.2 |
1.5 |
GO:0035435 |
phosphate ion transmembrane transport(GO:0035435) |
| 0.2 |
1.3 |
GO:1990009 |
retinal cell apoptotic process(GO:1990009) |
| 0.2 |
6.1 |
GO:0030433 |
ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.2 |
1.1 |
GO:0030579 |
ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.2 |
0.6 |
GO:0006216 |
cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.2 |
0.5 |
GO:0048807 |
female genitalia morphogenesis(GO:0048807) |
| 0.2 |
1.6 |
GO:1901621 |
negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.2 |
0.4 |
GO:0032074 |
negative regulation of nuclease activity(GO:0032074) |
| 0.2 |
0.4 |
GO:1903294 |
regulation of glutamate secretion, neurotransmission(GO:1903294) positive regulation of glutamate secretion, neurotransmission(GO:1903296) |
| 0.2 |
0.7 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.2 |
0.2 |
GO:1990481 |
mRNA pseudouridine synthesis(GO:1990481) |
| 0.2 |
0.5 |
GO:0046032 |
ADP catabolic process(GO:0046032) |
| 0.2 |
1.6 |
GO:0090308 |
regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.2 |
1.6 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.2 |
11.3 |
GO:0070936 |
protein K48-linked ubiquitination(GO:0070936) |
| 0.2 |
0.5 |
GO:0030862 |
positive regulation of polarized epithelial cell differentiation(GO:0030862) |
| 0.2 |
2.7 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.2 |
0.7 |
GO:0030300 |
regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
| 0.2 |
1.4 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.2 |
1.6 |
GO:0060717 |
chorion development(GO:0060717) |
| 0.2 |
1.1 |
GO:0097502 |
mannosylation(GO:0097502) |
| 0.2 |
0.2 |
GO:0010710 |
regulation of collagen catabolic process(GO:0010710) |
| 0.2 |
0.4 |
GO:2000584 |
regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
| 0.2 |
2.7 |
GO:0006855 |
drug transmembrane transport(GO:0006855) |
| 0.2 |
0.5 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.2 |
1.1 |
GO:0015014 |
heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.2 |
1.1 |
GO:0035093 |
spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.2 |
2.3 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.2 |
1.1 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.2 |
1.8 |
GO:0060768 |
epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.2 |
0.5 |
GO:0006659 |
phosphatidylserine biosynthetic process(GO:0006659) |
| 0.2 |
1.0 |
GO:2000819 |
regulation of nucleotide-excision repair(GO:2000819) |
| 0.2 |
0.3 |
GO:0097026 |
dendritic cell dendrite assembly(GO:0097026) |
| 0.2 |
1.4 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.2 |
0.5 |
GO:2000836 |
positive regulation of androgen secretion(GO:2000836) positive regulation of testosterone secretion(GO:2000845) |
| 0.2 |
1.4 |
GO:0001915 |
negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.2 |
0.9 |
GO:0042045 |
epithelial fluid transport(GO:0042045) |
| 0.2 |
0.5 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.2 |
1.0 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.2 |
8.8 |
GO:0022900 |
electron transport chain(GO:0022900) |
| 0.2 |
0.3 |
GO:0019626 |
short-chain fatty acid catabolic process(GO:0019626) |
| 0.2 |
0.3 |
GO:2000157 |
regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.2 |
0.8 |
GO:0021902 |
commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.2 |
0.3 |
GO:0044240 |
multicellular organism lipid catabolic process(GO:0044240) |
| 0.2 |
0.8 |
GO:0070536 |
protein K63-linked deubiquitination(GO:0070536) |
| 0.2 |
1.0 |
GO:0023021 |
termination of signal transduction(GO:0023021) |
| 0.2 |
0.5 |
GO:0033262 |
regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.2 |
1.2 |
GO:1902669 |
positive regulation of axon guidance(GO:1902669) |
| 0.2 |
1.2 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.2 |
0.8 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.2 |
1.0 |
GO:0090201 |
negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.2 |
1.5 |
GO:0042473 |
outer ear morphogenesis(GO:0042473) |
| 0.2 |
0.5 |
GO:1902513 |
regulation of organelle transport along microtubule(GO:1902513) |
| 0.2 |
0.5 |
GO:0072717 |
cellular response to actinomycin D(GO:0072717) |
| 0.2 |
0.3 |
GO:1901620 |
regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.2 |
2.3 |
GO:0060732 |
positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.2 |
1.7 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.2 |
2.8 |
GO:0060081 |
membrane hyperpolarization(GO:0060081) |
| 0.2 |
0.2 |
GO:1904109 |
positive regulation of cholesterol import(GO:1904109) positive regulation of sterol import(GO:2000911) |
| 0.2 |
2.5 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.2 |
2.8 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.2 |
0.7 |
GO:0006290 |
pyrimidine dimer repair(GO:0006290) |
| 0.2 |
1.0 |
GO:0006655 |
phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
| 0.2 |
0.2 |
GO:1901630 |
negative regulation of presynaptic membrane organization(GO:1901630) |
| 0.2 |
0.8 |
GO:0016081 |
synaptic vesicle docking(GO:0016081) |
| 0.2 |
0.5 |
GO:1900104 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.2 |
1.1 |
GO:1904152 |
regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.2 |
0.3 |
GO:0071550 |
death-inducing signaling complex assembly(GO:0071550) |
| 0.2 |
2.7 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.2 |
1.5 |
GO:0035610 |
protein side chain deglutamylation(GO:0035610) |
| 0.2 |
1.0 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.2 |
1.3 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.2 |
0.6 |
GO:0070120 |
ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.2 |
0.5 |
GO:1902037 |
negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.2 |
1.0 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.2 |
0.3 |
GO:0070427 |
nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.2 |
1.0 |
GO:0061668 |
mitochondrial ribosome assembly(GO:0061668) |
| 0.2 |
0.2 |
GO:2000193 |
positive regulation of fatty acid transport(GO:2000193) |
| 0.2 |
0.8 |
GO:0016080 |
synaptic vesicle targeting(GO:0016080) |
| 0.2 |
1.1 |
GO:0021912 |
regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.2 |
0.6 |
GO:0097298 |
regulation of nucleus size(GO:0097298) |
| 0.2 |
0.6 |
GO:0044376 |
RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.2 |
0.5 |
GO:0015882 |
L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.2 |
1.1 |
GO:1903427 |
negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
| 0.2 |
0.9 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.2 |
0.8 |
GO:1990416 |
cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.2 |
0.8 |
GO:1902952 |
positive regulation of dendritic spine maintenance(GO:1902952) |
| 0.2 |
0.5 |
GO:1903587 |
regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.2 |
1.1 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.2 |
1.4 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.2 |
0.3 |
GO:0008594 |
photoreceptor cell morphogenesis(GO:0008594) |
| 0.2 |
1.9 |
GO:0036503 |
ERAD pathway(GO:0036503) |
| 0.2 |
0.8 |
GO:0008295 |
spermidine biosynthetic process(GO:0008295) |
| 0.2 |
0.6 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.2 |
0.5 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.2 |
6.6 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.2 |
0.6 |
GO:0001827 |
inner cell mass cell fate commitment(GO:0001827) |
| 0.2 |
0.2 |
GO:1901026 |
ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.2 |
0.8 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.2 |
0.6 |
GO:0009992 |
cellular water homeostasis(GO:0009992) |
| 0.2 |
0.5 |
GO:0016598 |
protein arginylation(GO:0016598) |
| 0.2 |
0.9 |
GO:0070070 |
proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 |
0.5 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.2 |
3.7 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.2 |
1.1 |
GO:0045916 |
negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.2 |
2.0 |
GO:0032958 |
inositol phosphate biosynthetic process(GO:0032958) |
| 0.2 |
0.3 |
GO:0034312 |
diol biosynthetic process(GO:0034312) |
| 0.2 |
0.5 |
GO:0010890 |
positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.2 |
0.5 |
GO:0035962 |
response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.2 |
0.6 |
GO:0007199 |
G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
| 0.2 |
0.6 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.2 |
0.3 |
GO:2000485 |
regulation of glutamine transport(GO:2000485) |
| 0.2 |
0.3 |
GO:1904478 |
regulation of intestinal absorption(GO:1904478) |
| 0.2 |
0.6 |
GO:0006361 |
transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.2 |
0.3 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.2 |
0.3 |
GO:0010990 |
regulation of SMAD protein complex assembly(GO:0010990) |
| 0.2 |
0.5 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.1 |
0.4 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.1 |
0.9 |
GO:0036066 |
protein O-linked fucosylation(GO:0036066) |
| 0.1 |
0.7 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.1 |
0.6 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 |
1.3 |
GO:0042026 |
protein refolding(GO:0042026) |
| 0.1 |
3.2 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 |
0.6 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.1 |
1.5 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.1 |
1.9 |
GO:0097264 |
self proteolysis(GO:0097264) |
| 0.1 |
0.9 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
1.3 |
GO:2000576 |
positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.1 |
0.4 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 |
0.6 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.1 |
0.6 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
0.4 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 0.1 |
0.3 |
GO:0046967 |
cytosol to ER transport(GO:0046967) |
| 0.1 |
1.9 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 |
0.4 |
GO:0051866 |
general adaptation syndrome(GO:0051866) |
| 0.1 |
0.4 |
GO:0071879 |
positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 |
0.1 |
GO:0002589 |
regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
| 0.1 |
0.4 |
GO:0016256 |
N-glycan processing to lysosome(GO:0016256) |
| 0.1 |
3.1 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.1 |
2.5 |
GO:0015986 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 |
0.4 |
GO:0001788 |
antibody-dependent cellular cytotoxicity(GO:0001788) |
| 0.1 |
0.4 |
GO:0021502 |
columnar/cuboidal epithelial cell maturation(GO:0002069) neural fold elevation formation(GO:0021502) intestinal epithelial cell maturation(GO:0060574) |
| 0.1 |
0.4 |
GO:0044029 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.1 |
0.4 |
GO:1900034 |
regulation of cellular response to heat(GO:1900034) |
| 0.1 |
0.3 |
GO:0002296 |
T-helper 1 cell lineage commitment(GO:0002296) |
| 0.1 |
0.3 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 |
0.6 |
GO:2000623 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 |
0.6 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.1 |
1.6 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.1 |
0.7 |
GO:1900165 |
negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.1 |
0.5 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.1 |
1.4 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.1 |
1.5 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.1 |
1.0 |
GO:0003223 |
ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.1 |
0.5 |
GO:0014054 |
positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.1 |
0.3 |
GO:0050968 |
detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.1 |
0.4 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.1 |
0.4 |
GO:0043587 |
tongue morphogenesis(GO:0043587) |
| 0.1 |
0.1 |
GO:2001271 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 |
0.3 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) |
| 0.1 |
0.3 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
1.3 |
GO:0006691 |
leukotriene metabolic process(GO:0006691) |
| 0.1 |
1.6 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 |
2.5 |
GO:0071108 |
protein K48-linked deubiquitination(GO:0071108) |
| 0.1 |
0.5 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.1 |
0.4 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 |
0.8 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.1 |
0.5 |
GO:0030638 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 |
0.1 |
GO:1903760 |
regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) |
| 0.1 |
0.4 |
GO:0072734 |
response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.1 |
0.3 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 |
0.1 |
GO:0090135 |
actin filament branching(GO:0090135) |
| 0.1 |
1.2 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.1 |
0.1 |
GO:1901668 |
regulation of superoxide dismutase activity(GO:1901668) |
| 0.1 |
0.5 |
GO:0042270 |
protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.1 |
0.1 |
GO:0060729 |
intestinal epithelial structure maintenance(GO:0060729) |
| 0.1 |
0.5 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.1 |
1.0 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.1 |
0.3 |
GO:0090154 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 |
0.4 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.1 |
1.0 |
GO:0071501 |
response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.1 |
0.4 |
GO:0060054 |
positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.1 |
2.7 |
GO:0042059 |
negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.1 |
0.3 |
GO:0071431 |
tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 |
0.4 |
GO:0051305 |
meiotic chromosome movement towards spindle pole(GO:0016344) chromosome movement towards spindle pole(GO:0051305) |
| 0.1 |
0.6 |
GO:0017004 |
cytochrome complex assembly(GO:0017004) |
| 0.1 |
1.7 |
GO:0000712 |
resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 |
0.1 |
GO:0032025 |
response to cobalt ion(GO:0032025) |
| 0.1 |
3.6 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.1 |
0.6 |
GO:0032484 |
Ral protein signal transduction(GO:0032484) |
| 0.1 |
0.5 |
GO:0017183 |
peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 |
0.1 |
GO:0061762 |
CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 |
0.6 |
GO:1904816 |
positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.1 |
1.6 |
GO:0060416 |
response to growth hormone(GO:0060416) |
| 0.1 |
0.8 |
GO:0042905 |
9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 |
1.9 |
GO:0002327 |
immature B cell differentiation(GO:0002327) |
| 0.1 |
0.8 |
GO:0072615 |
interleukin-17 secretion(GO:0072615) |
| 0.1 |
1.5 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.1 |
1.0 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 |
1.9 |
GO:0006743 |
ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 |
0.6 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 |
1.5 |
GO:0042095 |
interferon-gamma biosynthetic process(GO:0042095) |
| 0.1 |
0.5 |
GO:0051341 |
regulation of oxidoreductase activity(GO:0051341) |
| 0.1 |
0.4 |
GO:0001543 |
ovarian follicle rupture(GO:0001543) |
| 0.1 |
0.6 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 |
1.5 |
GO:0051353 |
positive regulation of oxidoreductase activity(GO:0051353) |
| 0.1 |
4.1 |
GO:0015988 |
energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.1 |
0.7 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.1 |
0.5 |
GO:1903028 |
asymmetric Golgi ribbon formation(GO:0090164) regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
| 0.1 |
0.2 |
GO:1904395 |
positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) positive regulation of neuromuscular junction development(GO:1904398) |
| 0.1 |
0.9 |
GO:0033133 |
positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.1 |
1.5 |
GO:0071786 |
endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.1 |
5.4 |
GO:0032543 |
mitochondrial translation(GO:0032543) |
| 0.1 |
0.7 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.1 |
0.5 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 |
0.5 |
GO:1902938 |
regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 0.1 |
1.8 |
GO:0071420 |
cellular response to histamine(GO:0071420) |
| 0.1 |
0.7 |
GO:0042448 |
progesterone metabolic process(GO:0042448) |
| 0.1 |
3.1 |
GO:0034308 |
primary alcohol metabolic process(GO:0034308) |
| 0.1 |
1.8 |
GO:0035634 |
response to stilbenoid(GO:0035634) |
| 0.1 |
0.6 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 |
0.2 |
GO:0048840 |
otolith development(GO:0048840) |
| 0.1 |
0.6 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 |
0.1 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.1 |
0.6 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.1 |
0.2 |
GO:1902162 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 0.1 |
0.5 |
GO:0060164 |
regulation of timing of neuron differentiation(GO:0060164) |
| 0.1 |
2.3 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.1 |
1.4 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 |
0.5 |
GO:0044565 |
dendritic cell proliferation(GO:0044565) |
| 0.1 |
0.6 |
GO:1904970 |
brush border assembly(GO:1904970) |
| 0.1 |
1.2 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.1 |
0.9 |
GO:0006449 |
regulation of translational termination(GO:0006449) |
| 0.1 |
1.7 |
GO:0021707 |
cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 |
0.2 |
GO:0010808 |
positive regulation of synaptic vesicle priming(GO:0010808) |
| 0.1 |
0.3 |
GO:0046337 |
phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.1 |
0.9 |
GO:0036093 |
germ cell proliferation(GO:0036093) |
| 0.1 |
3.9 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.1 |
0.6 |
GO:0015886 |
heme transport(GO:0015886) |
| 0.1 |
2.3 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.1 |
0.7 |
GO:1901908 |
diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.1 |
3.3 |
GO:0008089 |
anterograde axonal transport(GO:0008089) |
| 0.1 |
0.6 |
GO:0032482 |
Rab protein signal transduction(GO:0032482) |
| 0.1 |
0.3 |
GO:0050779 |
RNA destabilization(GO:0050779) |
| 0.1 |
1.5 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.1 |
2.0 |
GO:0071364 |
cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.1 |
0.2 |
GO:0060060 |
post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.1 |
12.6 |
GO:0042787 |
protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.1 |
0.7 |
GO:0000097 |
sulfur amino acid biosynthetic process(GO:0000097) amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.1 |
0.3 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.1 |
0.1 |
GO:0070071 |
proton-transporting two-sector ATPase complex assembly(GO:0070071) |
| 0.1 |
0.3 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.1 |
0.4 |
GO:0098909 |
regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
| 0.1 |
0.3 |
GO:1901674 |
histone H3-K27 acetylation(GO:0043974) response to methylglyoxal(GO:0051595) regulation of histone H3-K27 acetylation(GO:1901674) negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.1 |
0.2 |
GO:0070676 |
intralumenal vesicle formation(GO:0070676) |
| 0.1 |
0.7 |
GO:0006491 |
N-glycan processing(GO:0006491) |
| 0.1 |
1.4 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.1 |
0.3 |
GO:0090361 |
platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 |
1.7 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.1 |
0.2 |
GO:0034141 |
regulation of toll-like receptor 3 signaling pathway(GO:0034139) positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.1 |
1.5 |
GO:1990126 |
retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.1 |
0.5 |
GO:0016557 |
peroxisome membrane biogenesis(GO:0016557) |
| 0.1 |
5.7 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.1 |
0.5 |
GO:0002098 |
tRNA wobble uridine modification(GO:0002098) |
| 0.1 |
0.3 |
GO:0042823 |
pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.1 |
0.5 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
2.3 |
GO:0033169 |
histone H3-K9 demethylation(GO:0033169) |
| 0.1 |
0.6 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 0.1 |
0.4 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 |
0.4 |
GO:0008355 |
olfactory learning(GO:0008355) |
| 0.1 |
0.4 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 |
0.1 |
GO:0033861 |
negative regulation of NAD(P)H oxidase activity(GO:0033861) |
| 0.1 |
0.5 |
GO:1902004 |
positive regulation of beta-amyloid formation(GO:1902004) |
| 0.1 |
1.0 |
GO:0035745 |
T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 |
5.3 |
GO:0070646 |
protein modification by small protein removal(GO:0070646) |
| 0.1 |
0.2 |
GO:0036112 |
medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 |
0.8 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.1 |
0.5 |
GO:0042048 |
olfactory behavior(GO:0042048) |
| 0.1 |
0.3 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 |
0.7 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.1 |
0.4 |
GO:0031642 |
negative regulation of myelination(GO:0031642) |
| 0.1 |
0.6 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.1 |
0.7 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.1 |
0.3 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.1 |
1.1 |
GO:1901407 |
regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.1 |
0.4 |
GO:0006415 |
translational termination(GO:0006415) |
| 0.1 |
0.8 |
GO:0015684 |
ferrous iron transport(GO:0015684) |
| 0.1 |
0.4 |
GO:1902045 |
regulation of Fas signaling pathway(GO:1902044) negative regulation of Fas signaling pathway(GO:1902045) |
| 0.1 |
0.4 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.1 |
0.3 |
GO:0097534 |
lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.1 |
0.2 |
GO:0090003 |
regulation of Golgi to plasma membrane protein transport(GO:0042996) regulation of establishment of protein localization to plasma membrane(GO:0090003) |
| 0.1 |
0.3 |
GO:0043181 |
vacuolar sequestering(GO:0043181) |
| 0.1 |
0.6 |
GO:0043928 |
exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.1 |
0.7 |
GO:0009074 |
aromatic amino acid family catabolic process(GO:0009074) |
| 0.1 |
0.4 |
GO:0021564 |
vagus nerve development(GO:0021564) |
| 0.1 |
2.6 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.1 |
0.7 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.1 |
0.4 |
GO:1901317 |
regulation of sperm motility(GO:1901317) |
| 0.1 |
1.3 |
GO:0046697 |
decidualization(GO:0046697) |
| 0.1 |
0.7 |
GO:0045162 |
clustering of voltage-gated sodium channels(GO:0045162) |
| 0.1 |
0.4 |
GO:0009445 |
putrescine metabolic process(GO:0009445) |
| 0.1 |
1.3 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 |
1.6 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.1 |
0.4 |
GO:0019482 |
beta-alanine metabolic process(GO:0019482) |
| 0.1 |
0.4 |
GO:0031441 |
negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.1 |
0.7 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 |
0.2 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.1 |
0.3 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.1 |
0.5 |
GO:1990573 |
potassium ion import across plasma membrane(GO:1990573) |
| 0.1 |
0.1 |
GO:1901301 |
regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 |
7.1 |
GO:0006457 |
protein folding(GO:0006457) |
| 0.1 |
0.2 |
GO:0048069 |
eye pigmentation(GO:0048069) |
| 0.1 |
0.6 |
GO:0098877 |
neurotransmitter receptor transport to plasma membrane(GO:0098877) |
| 0.1 |
0.6 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.1 |
0.5 |
GO:1903351 |
response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.1 |
0.4 |
GO:1904715 |
negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 0.1 |
0.4 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 |
0.6 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
1.0 |
GO:0000038 |
very long-chain fatty acid metabolic process(GO:0000038) |
| 0.1 |
2.6 |
GO:0046856 |
phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 |
1.3 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.5 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.1 |
0.3 |
GO:1903358 |
regulation of Golgi organization(GO:1903358) |
| 0.1 |
0.5 |
GO:0048104 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.1 |
0.5 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.1 |
0.3 |
GO:0060831 |
smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:0060831) |
| 0.1 |
0.3 |
GO:0060523 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) prostate epithelial cord elongation(GO:0060523) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) branch elongation involved in salivary gland morphogenesis(GO:0060667) prostate gland morphogenetic growth(GO:0060737) mesenchymal cell differentiation involved in lung development(GO:0060915) |
| 0.1 |
0.3 |
GO:2000619 |
negative regulation of histone H4-K16 acetylation(GO:2000619) |
| 0.1 |
0.6 |
GO:0033227 |
dsRNA transport(GO:0033227) |
| 0.1 |
0.2 |
GO:0048050 |
post-embryonic eye morphogenesis(GO:0048050) post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 |
0.4 |
GO:0061760 |
antifungal innate immune response(GO:0061760) |
| 0.1 |
0.5 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.1 |
1.3 |
GO:0097352 |
autophagosome maturation(GO:0097352) |
| 0.1 |
1.0 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.1 |
3.2 |
GO:0060612 |
adipose tissue development(GO:0060612) |
| 0.1 |
1.0 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.1 |
2.6 |
GO:0006376 |
mRNA splice site selection(GO:0006376) |
| 0.1 |
0.4 |
GO:0000117 |
regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.1 |
0.3 |
GO:1900038 |
negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.1 |
0.2 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.1 |
0.3 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.1 |
0.2 |
GO:2001226 |
negative regulation of chloride transport(GO:2001226) |
| 0.1 |
0.3 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 |
0.8 |
GO:1900119 |
positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.1 |
0.8 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.1 |
0.3 |
GO:0075522 |
IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 |
0.1 |
GO:0051790 |
short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.1 |
0.3 |
GO:0060982 |
coronary artery morphogenesis(GO:0060982) |
| 0.1 |
0.1 |
GO:0006296 |
nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.1 |
0.3 |
GO:0090153 |
regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
| 0.1 |
0.4 |
GO:0007028 |
cytoplasm organization(GO:0007028) |
| 0.1 |
0.7 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 |
0.3 |
GO:0006544 |
glycine metabolic process(GO:0006544) |
| 0.1 |
0.5 |
GO:1903691 |
positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.1 |
1.2 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 |
0.1 |
GO:0033686 |
positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.1 |
0.9 |
GO:0006662 |
glycerol ether metabolic process(GO:0006662) |
| 0.1 |
0.2 |
GO:0097680 |
double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 |
0.1 |
GO:0002874 |
chronic inflammatory response to antigenic stimulus(GO:0002439) regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 0.1 |
6.3 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.1 |
0.2 |
GO:0032908 |
transforming growth factor beta1 production(GO:0032905) regulation of transforming growth factor beta1 production(GO:0032908) |
| 0.1 |
0.3 |
GO:1902683 |
regulation of receptor localization to synapse(GO:1902683) |
| 0.1 |
0.1 |
GO:1904868 |
telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.1 |
0.9 |
GO:0018231 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 |
0.6 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.1 |
0.5 |
GO:0015669 |
gas transport(GO:0015669) carbon dioxide transport(GO:0015670) |
| 0.1 |
0.8 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.1 |
2.3 |
GO:0019373 |
epoxygenase P450 pathway(GO:0019373) |
| 0.1 |
1.1 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.1 |
0.2 |
GO:0070268 |
cornification(GO:0070268) |
| 0.1 |
0.2 |
GO:0035376 |
sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.1 |
0.2 |
GO:0008300 |
isoprenoid catabolic process(GO:0008300) |
| 0.1 |
0.2 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 |
0.2 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.1 |
0.2 |
GO:1902527 |
regulation of protein monoubiquitination(GO:1902525) positive regulation of protein monoubiquitination(GO:1902527) |
| 0.1 |
0.3 |
GO:0050975 |
sensory perception of touch(GO:0050975) |
| 0.1 |
0.5 |
GO:0060573 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.1 |
0.3 |
GO:0016062 |
adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.1 |
1.1 |
GO:1903077 |
negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.1 |
0.2 |
GO:1900477 |
negative regulation of G1/S transition of mitotic cell cycle by negative regulation of transcription from RNA polymerase II promoter(GO:1900477) |
| 0.1 |
0.1 |
GO:0010635 |
regulation of mitochondrial fusion(GO:0010635) |
| 0.1 |
0.3 |
GO:0071895 |
odontoblast differentiation(GO:0071895) |
| 0.1 |
0.3 |
GO:1902477 |
defense response to bacterium, incompatible interaction(GO:0009816) regulation of defense response to bacterium, incompatible interaction(GO:1902477) |
| 0.1 |
0.8 |
GO:0044857 |
plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
| 0.1 |
1.0 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 0.1 |
0.1 |
GO:0061000 |
negative regulation of dendritic spine development(GO:0061000) |
| 0.1 |
0.2 |
GO:1901052 |
sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.1 |
1.3 |
GO:0071480 |
cellular response to gamma radiation(GO:0071480) |
| 0.1 |
0.4 |
GO:0097491 |
trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 0.1 |
0.3 |
GO:0005984 |
disaccharide metabolic process(GO:0005984) |
| 0.1 |
0.7 |
GO:0015747 |
urate transport(GO:0015747) |
| 0.1 |
0.5 |
GO:0006072 |
glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.1 |
0.3 |
GO:0030223 |
neutrophil differentiation(GO:0030223) |
| 0.1 |
0.1 |
GO:0014050 |
negative regulation of glutamate secretion(GO:0014050) |
| 0.1 |
1.2 |
GO:0006308 |
DNA catabolic process(GO:0006308) |
| 0.1 |
0.4 |
GO:0008105 |
asymmetric protein localization(GO:0008105) |
| 0.1 |
0.2 |
GO:0070358 |
actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 |
0.7 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.1 |
0.1 |
GO:2000188 |
regulation of cholesterol homeostasis(GO:2000188) |
| 0.1 |
1.4 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.1 |
0.1 |
GO:0060849 |
regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.1 |
0.6 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 0.1 |
0.3 |
GO:0051205 |
protein insertion into membrane(GO:0051205) |
| 0.1 |
0.4 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.1 |
0.1 |
GO:0046122 |
purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.1 |
0.5 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.1 |
0.8 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.1 |
0.3 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.1 |
1.8 |
GO:0046854 |
phosphatidylinositol phosphorylation(GO:0046854) |
| 0.1 |
0.3 |
GO:0045945 |
positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 |
0.7 |
GO:0015879 |
carnitine transport(GO:0015879) |
| 0.1 |
0.9 |
GO:0021819 |
layer formation in cerebral cortex(GO:0021819) |
| 0.1 |
0.1 |
GO:0034033 |
nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.1 |
0.9 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.1 |
0.5 |
GO:0060468 |
prevention of polyspermy(GO:0060468) |
| 0.1 |
0.1 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.1 |
0.3 |
GO:0045657 |
positive regulation of monocyte differentiation(GO:0045657) |
| 0.1 |
0.2 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.1 |
0.2 |
GO:0002084 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.1 |
0.1 |
GO:0002426 |
immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 |
0.3 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.1 |
0.1 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.1 |
0.7 |
GO:2001273 |
regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.1 |
0.2 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.1 |
0.4 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 |
0.2 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.1 |
0.4 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.1 |
0.6 |
GO:0021854 |
hypothalamus development(GO:0021854) |
| 0.1 |
0.8 |
GO:0016558 |
protein import into peroxisome matrix(GO:0016558) |
| 0.1 |
0.8 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 |
0.1 |
GO:0042637 |
catagen(GO:0042637) |
| 0.1 |
0.8 |
GO:1904030 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.1 |
0.1 |
GO:1903543 |
positive regulation of exosomal secretion(GO:1903543) |
| 0.1 |
0.3 |
GO:1904453 |
regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.1 |
0.1 |
GO:0032429 |
regulation of phospholipase A2 activity(GO:0032429) |
| 0.1 |
0.4 |
GO:0015705 |
iodide transport(GO:0015705) |
| 0.1 |
0.1 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 |
0.5 |
GO:1901844 |
regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.1 |
0.8 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 |
0.4 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.1 |
0.6 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.1 |
0.2 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 |
0.1 |
GO:0070309 |
lens fiber cell morphogenesis(GO:0070309) |
| 0.1 |
0.2 |
GO:0051798 |
positive regulation of hair follicle development(GO:0051798) |
| 0.1 |
0.5 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
0.1 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 |
0.2 |
GO:0016093 |
polyprenol metabolic process(GO:0016093) |
| 0.1 |
0.7 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.1 |
0.1 |
GO:0060300 |
regulation of cytokine activity(GO:0060300) |
| 0.1 |
0.4 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 |
0.2 |
GO:0009397 |
10-formyltetrahydrofolate catabolic process(GO:0009258) folic acid-containing compound catabolic process(GO:0009397) pteridine-containing compound catabolic process(GO:0042560) |
| 0.1 |
0.7 |
GO:0032793 |
positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.1 |
1.1 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.1 |
0.2 |
GO:2000674 |
regulation of type B pancreatic cell apoptotic process(GO:2000674) |
| 0.1 |
1.6 |
GO:0034198 |
cellular response to amino acid starvation(GO:0034198) |
| 0.1 |
0.3 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 0.1 |
0.3 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.1 |
0.2 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.1 |
0.4 |
GO:0048845 |
venous blood vessel morphogenesis(GO:0048845) |
| 0.1 |
0.2 |
GO:0006600 |
creatine metabolic process(GO:0006600) |
| 0.1 |
1.0 |
GO:0002673 |
regulation of acute inflammatory response(GO:0002673) |
| 0.1 |
0.2 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.1 |
0.3 |
GO:0098532 |
histone H3-K27 trimethylation(GO:0098532) |
| 0.1 |
0.2 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 |
1.6 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.1 |
0.2 |
GO:0021943 |
formation of radial glial scaffolds(GO:0021943) |
| 0.1 |
0.4 |
GO:0017144 |
drug metabolic process(GO:0017144) |
| 0.1 |
0.4 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 |
0.1 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 |
0.1 |
GO:0010915 |
regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
| 0.1 |
0.2 |
GO:0060437 |
lung growth(GO:0060437) |
| 0.1 |
0.2 |
GO:0015866 |
ADP transport(GO:0015866) |
| 0.1 |
0.2 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 |
0.4 |
GO:0048714 |
positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.1 |
0.6 |
GO:0061099 |
negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.1 |
0.4 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.1 |
0.8 |
GO:0021692 |
cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.1 |
0.1 |
GO:0003285 |
septum secundum development(GO:0003285) |
| 0.1 |
0.9 |
GO:1901897 |
regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.1 |
0.2 |
GO:0030950 |
establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 |
0.1 |
GO:0051462 |
cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
| 0.1 |
0.2 |
GO:1900039 |
positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.1 |
0.2 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 |
1.6 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.0 |
0.1 |
GO:0006713 |
glucocorticoid catabolic process(GO:0006713) |
| 0.0 |
0.2 |
GO:0000480 |
endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 |
0.1 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.0 |
0.2 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.0 |
0.3 |
GO:0001514 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 |
1.0 |
GO:0097320 |
membrane tubulation(GO:0097320) |
| 0.0 |
1.3 |
GO:0006879 |
cellular iron ion homeostasis(GO:0006879) |
| 0.0 |
0.3 |
GO:0010918 |
positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.0 |
0.1 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.0 |
0.4 |
GO:1990440 |
positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.0 |
0.1 |
GO:2000298 |
regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.0 |
0.4 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 |
0.2 |
GO:0033326 |
cerebrospinal fluid secretion(GO:0033326) |
| 0.0 |
0.1 |
GO:0002183 |
cytoplasmic translational initiation(GO:0002183) |
| 0.0 |
0.4 |
GO:0046007 |
negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 |
0.2 |
GO:0051012 |
microtubule sliding(GO:0051012) |
| 0.0 |
0.1 |
GO:1901725 |
regulation of histone deacetylase activity(GO:1901725) positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 |
0.2 |
GO:0045838 |
positive regulation of membrane potential(GO:0045838) |
| 0.0 |
0.1 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 0.0 |
0.6 |
GO:0034340 |
response to type I interferon(GO:0034340) |
| 0.0 |
3.8 |
GO:0035308 |
negative regulation of dephosphorylation(GO:0035305) negative regulation of protein dephosphorylation(GO:0035308) |
| 0.0 |
0.2 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.0 |
0.2 |
GO:0009452 |
7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 |
0.1 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 |
0.1 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.0 |
0.0 |
GO:0043397 |
corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
| 0.0 |
0.0 |
GO:0015760 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 |
0.5 |
GO:0050910 |
detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 |
1.1 |
GO:0032728 |
positive regulation of interferon-beta production(GO:0032728) |
| 0.0 |
0.2 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.0 |
0.2 |
GO:0046880 |
regulation of follicle-stimulating hormone secretion(GO:0046880) |
| 0.0 |
0.2 |
GO:0090400 |
stress-induced premature senescence(GO:0090400) |
| 0.0 |
0.2 |
GO:0010820 |
positive regulation of T cell chemotaxis(GO:0010820) |
| 0.0 |
0.1 |
GO:0035999 |
tetrahydrofolate interconversion(GO:0035999) |
| 0.0 |
0.5 |
GO:0007288 |
sperm axoneme assembly(GO:0007288) |
| 0.0 |
0.2 |
GO:0043691 |
reverse cholesterol transport(GO:0043691) |
| 0.0 |
0.1 |
GO:0040010 |
positive regulation of growth rate(GO:0040010) |
| 0.0 |
0.6 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 |
0.1 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.0 |
0.0 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 0.0 |
0.3 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 |
0.2 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.0 |
0.1 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 |
1.0 |
GO:0007020 |
microtubule nucleation(GO:0007020) |
| 0.0 |
1.7 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.0 |
0.1 |
GO:0033577 |
protein glycosylation in endoplasmic reticulum(GO:0033577) |
| 0.0 |
0.4 |
GO:0051608 |
histamine transport(GO:0051608) |
| 0.0 |
0.2 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 0.0 |
0.5 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 |
0.1 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 |
0.4 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.0 |
0.2 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.0 |
0.2 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 |
0.5 |
GO:0030828 |
positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.0 |
0.5 |
GO:0014047 |
glutamate secretion(GO:0014047) |
| 0.0 |
0.2 |
GO:0090161 |
Golgi ribbon formation(GO:0090161) |
| 0.0 |
0.2 |
GO:0051901 |
positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.0 |
0.4 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.0 |
0.0 |
GO:0038001 |
paracrine signaling(GO:0038001) |
| 0.0 |
0.3 |
GO:0060088 |
auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 |
0.4 |
GO:0003094 |
glomerular filtration(GO:0003094) |
| 0.0 |
0.9 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.0 |
0.1 |
GO:0034134 |
toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.0 |
0.2 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.0 |
0.1 |
GO:0061470 |
T follicular helper cell differentiation(GO:0061470) |
| 0.0 |
0.4 |
GO:0070262 |
peptidyl-serine dephosphorylation(GO:0070262) |
| 0.0 |
0.1 |
GO:0070444 |
oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.0 |
0.0 |
GO:0033108 |
mitochondrial respiratory chain complex assembly(GO:0033108) |
| 0.0 |
0.0 |
GO:0090647 |
modulation of age-related behavioral decline(GO:0090647) |
| 0.0 |
0.2 |
GO:0035024 |
negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 |
0.2 |
GO:0006689 |
ganglioside catabolic process(GO:0006689) |
| 0.0 |
0.2 |
GO:1903671 |
negative regulation of sprouting angiogenesis(GO:1903671) |
| 0.0 |
0.4 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 |
1.0 |
GO:0010508 |
positive regulation of autophagy(GO:0010508) |
| 0.0 |
0.2 |
GO:0006499 |
N-terminal protein myristoylation(GO:0006499) |
| 0.0 |
0.4 |
GO:1902230 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.0 |
0.7 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.0 |
0.2 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 |
0.1 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 |
0.1 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.0 |
0.0 |
GO:0002524 |
hypersensitivity(GO:0002524) |
| 0.0 |
0.2 |
GO:1904358 |
positive regulation of telomere maintenance via telomere lengthening(GO:1904358) |
| 0.0 |
0.3 |
GO:0060012 |
synaptic transmission, glycinergic(GO:0060012) |
| 0.0 |
0.2 |
GO:0033504 |
floor plate development(GO:0033504) |
| 0.0 |
2.7 |
GO:0090630 |
activation of GTPase activity(GO:0090630) |
| 0.0 |
0.1 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.0 |
0.7 |
GO:1903078 |
positive regulation of protein localization to plasma membrane(GO:1903078) |
| 0.0 |
0.4 |
GO:0052696 |
flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
| 0.0 |
0.1 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 |
0.1 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.0 |
0.2 |
GO:1905097 |
regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
| 0.0 |
0.2 |
GO:0010735 |
positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 |
0.9 |
GO:0032088 |
negative regulation of NF-kappaB transcription factor activity(GO:0032088) |
| 0.0 |
0.1 |
GO:0070562 |
regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 |
0.1 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.0 |
0.2 |
GO:1902254 |
negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
| 0.0 |
0.3 |
GO:0006805 |
xenobiotic metabolic process(GO:0006805) |
| 0.0 |
0.7 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.0 |
0.5 |
GO:0016601 |
Rac protein signal transduction(GO:0016601) |
| 0.0 |
0.1 |
GO:0070317 |
negative regulation of G0 to G1 transition(GO:0070317) |
| 0.0 |
0.2 |
GO:1904222 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 |
0.1 |
GO:0021934 |
hindbrain tangential cell migration(GO:0021934) |
| 0.0 |
0.1 |
GO:1902514 |
regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.0 |
0.1 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 |
0.1 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 0.0 |
0.4 |
GO:0071850 |
mitotic cell cycle arrest(GO:0071850) |
| 0.0 |
0.1 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.0 |
0.0 |
GO:0051138 |
positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 |
1.9 |
GO:0006821 |
chloride transport(GO:0006821) |
| 0.0 |
0.1 |
GO:0072695 |
negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.0 |
1.4 |
GO:0033138 |
positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
| 0.0 |
0.2 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.0 |
1.1 |
GO:0000381 |
regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 |
0.1 |
GO:0042053 |
regulation of dopamine metabolic process(GO:0042053) |
| 0.0 |
0.5 |
GO:0007339 |
binding of sperm to zona pellucida(GO:0007339) |
| 0.0 |
0.2 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 |
0.2 |
GO:0045792 |
negative regulation of cell size(GO:0045792) |
| 0.0 |
0.1 |
GO:0006404 |
MAPK import into nucleus(GO:0000189) RNA import into nucleus(GO:0006404) |
| 0.0 |
1.4 |
GO:0006633 |
fatty acid biosynthetic process(GO:0006633) |
| 0.0 |
0.1 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.0 |
0.5 |
GO:0006399 |
tRNA metabolic process(GO:0006399) |
| 0.0 |
6.2 |
GO:0051603 |
proteolysis involved in cellular protein catabolic process(GO:0051603) |
| 0.0 |
0.2 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.0 |
0.0 |
GO:0099543 |
trans-synaptic signaling by soluble gas(GO:0099543) trans-synaptic signaling by nitric oxide(GO:0099548) |
| 0.0 |
0.6 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.0 |
0.1 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.0 |
0.1 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.0 |
0.1 |
GO:0010571 |
positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.0 |
0.5 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 |
1.1 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.0 |
0.1 |
GO:0015874 |
norepinephrine transport(GO:0015874) |
| 0.0 |
0.0 |
GO:1902950 |
regulation of dendritic spine maintenance(GO:1902950) |
| 0.0 |
0.2 |
GO:1903818 |
positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 |
0.0 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.0 |
4.6 |
GO:0007608 |
sensory perception of smell(GO:0007608) |
| 0.0 |
0.1 |
GO:0002369 |
T cell cytokine production(GO:0002369) |
| 0.0 |
0.4 |
GO:1902259 |
regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.0 |
0.1 |
GO:0045579 |
positive regulation of B cell differentiation(GO:0045579) |
| 0.0 |
0.0 |
GO:0002266 |
follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.0 |
0.2 |
GO:0061143 |
alveolar primary septum development(GO:0061143) |
| 0.0 |
0.1 |
GO:0090043 |
regulation of tubulin deacetylation(GO:0090043) |
| 0.0 |
0.2 |
GO:0006198 |
cAMP catabolic process(GO:0006198) |
| 0.0 |
0.0 |
GO:0010807 |
regulation of synaptic vesicle priming(GO:0010807) |
| 0.0 |
0.1 |
GO:0051280 |
negative regulation of release of sequestered calcium ion into cytosol(GO:0051280) positive regulation of sequestering of calcium ion(GO:0051284) |
| 0.0 |
0.2 |
GO:0006903 |
vesicle targeting(GO:0006903) |
| 0.0 |
0.1 |
GO:0032469 |
endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
| 0.0 |
0.2 |
GO:0060712 |
spongiotrophoblast layer development(GO:0060712) |
| 0.0 |
0.3 |
GO:0010738 |
regulation of protein kinase A signaling(GO:0010738) |
| 0.0 |
0.2 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.0 |
0.3 |
GO:0051482 |
positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.0 |
0.1 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 |
0.3 |
GO:0007029 |
endoplasmic reticulum organization(GO:0007029) |
| 0.0 |
0.1 |
GO:0060259 |
regulation of feeding behavior(GO:0060259) |
| 0.0 |
0.2 |
GO:0007202 |
activation of phospholipase C activity(GO:0007202) |
| 0.0 |
0.0 |
GO:1904263 |
positive regulation of TORC1 signaling(GO:1904263) |
| 0.0 |
0.1 |
GO:0000414 |
regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 |
0.1 |
GO:0043981 |
histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 |
0.1 |
GO:0060083 |
smooth muscle contraction involved in micturition(GO:0060083) |
| 0.0 |
0.0 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.0 |
0.0 |
GO:0006283 |
transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 |
0.0 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.0 |
0.0 |
GO:1904354 |
negative regulation of telomere capping(GO:1904354) |
| 0.0 |
0.1 |
GO:0010984 |
regulation of lipoprotein particle clearance(GO:0010984) |
| 0.0 |
0.5 |
GO:0009062 |
fatty acid catabolic process(GO:0009062) |
| 0.0 |
0.0 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.0 |
0.0 |
GO:1904953 |
Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904953) |
