avrg: GSE58827: Dynamics of the Mouse Liver
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Wrnip1
|
ENSMUSG00000021400.6 | Werner helicase interacting protein 1 |
Mta3
|
ENSMUSG00000055817.11 | metastasis associated 3 |
Rcor1
|
ENSMUSG00000037896.11 | REST corepressor 1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Wrnip1 | mm10_v2_chr13_+_32802007_32802152 | -0.65 | 1.7e-05 | Click! |
Rcor1 | mm10_v2_chr12_+_111039334_111039400 | -0.42 | 1.0e-02 | Click! |
Mta3 | mm10_v2_chr17_+_83706137_83706169 | 0.41 | 1.2e-02 | Click! |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
13.6 | 40.7 | GO:0002148 | hypochlorous acid metabolic process(GO:0002148) hypochlorous acid biosynthetic process(GO:0002149) |
7.2 | 21.6 | GO:0030221 | basophil differentiation(GO:0030221) |
5.6 | 45.0 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
5.5 | 16.6 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
5.4 | 16.3 | GO:0002215 | defense response to nematode(GO:0002215) |
5.0 | 15.1 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
4.2 | 12.6 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
4.2 | 12.5 | GO:0060217 | hemangioblast cell differentiation(GO:0060217) |
3.8 | 7.7 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
3.8 | 7.5 | GO:0031938 | regulation of chromatin silencing at telomere(GO:0031938) |
3.8 | 3.8 | GO:2000277 | positive regulation of oxidative phosphorylation uncoupler activity(GO:2000277) |
3.7 | 22.1 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
3.6 | 10.9 | GO:0070488 | neutrophil aggregation(GO:0070488) |
3.6 | 28.4 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
3.5 | 10.6 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
3.5 | 20.7 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
3.4 | 3.4 | GO:0007521 | muscle cell fate determination(GO:0007521) |
3.3 | 13.3 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
3.2 | 9.7 | GO:0072299 | negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
3.2 | 16.1 | GO:0072236 | metanephric loop of Henle development(GO:0072236) |
3.2 | 18.9 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
3.1 | 12.5 | GO:0045575 | basophil activation(GO:0045575) |
3.1 | 9.4 | GO:0072138 | mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
3.1 | 15.5 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
3.1 | 3.1 | GO:0070099 | regulation of chemokine-mediated signaling pathway(GO:0070099) |
3.1 | 12.4 | GO:1904800 | regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) |
3.0 | 14.9 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
2.9 | 14.6 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
2.9 | 8.8 | GO:0032690 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
2.9 | 8.8 | GO:0045660 | positive regulation of neutrophil differentiation(GO:0045660) |
2.8 | 8.5 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
2.8 | 2.8 | GO:0060022 | hard palate development(GO:0060022) |
2.8 | 11.2 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
2.8 | 13.9 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
2.7 | 8.2 | GO:0071918 | urea transmembrane transport(GO:0071918) |
2.6 | 18.5 | GO:0030421 | defecation(GO:0030421) |
2.6 | 2.6 | GO:0009414 | response to water deprivation(GO:0009414) |
2.6 | 7.7 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
2.6 | 10.3 | GO:2001287 | negative regulation of caveolin-mediated endocytosis(GO:2001287) |
2.5 | 10.2 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
2.5 | 2.5 | GO:0072166 | posterior mesonephric tubule development(GO:0072166) |
2.5 | 7.6 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
2.5 | 7.4 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
2.5 | 7.4 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
2.4 | 2.4 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
2.4 | 2.4 | GO:1905204 | regulation of connective tissue replacement(GO:1905203) negative regulation of connective tissue replacement(GO:1905204) |
2.4 | 19.2 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
2.4 | 7.1 | GO:0072382 | minus-end-directed vesicle transport along microtubule(GO:0072382) |
2.3 | 30.2 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
2.3 | 7.0 | GO:2000295 | regulation of hydrogen peroxide catabolic process(GO:2000295) |
2.3 | 6.9 | GO:0051714 | regulation of cytolysis in other organism(GO:0051710) positive regulation of cytolysis in other organism(GO:0051714) |
2.3 | 9.2 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
2.3 | 9.2 | GO:0051944 | positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
2.3 | 9.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
2.3 | 40.9 | GO:0015816 | glycine transport(GO:0015816) |
2.3 | 18.0 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
2.2 | 11.2 | GO:0071105 | response to interleukin-11(GO:0071105) |
2.2 | 35.6 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
2.2 | 6.6 | GO:1903367 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
2.2 | 6.5 | GO:0031283 | negative regulation of cGMP metabolic process(GO:0030824) negative regulation of cGMP biosynthetic process(GO:0030827) negative regulation of guanylate cyclase activity(GO:0031283) |
2.2 | 8.6 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
2.1 | 15.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
2.1 | 4.3 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
2.1 | 6.4 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
2.1 | 6.4 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
2.1 | 6.4 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
2.1 | 8.4 | GO:0015825 | L-serine transport(GO:0015825) |
2.1 | 4.2 | GO:0070560 | protein secretion by platelet(GO:0070560) |
2.1 | 2.1 | GO:1901608 | regulation of vesicle transport along microtubule(GO:1901608) |
2.1 | 8.2 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
2.0 | 8.2 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
2.0 | 6.0 | GO:0014064 | positive regulation of serotonin secretion(GO:0014064) |
2.0 | 4.0 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
2.0 | 10.0 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
2.0 | 10.0 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
2.0 | 7.9 | GO:1903575 | cornified envelope assembly(GO:1903575) |
2.0 | 2.0 | GO:0033624 | negative regulation of integrin activation(GO:0033624) |
2.0 | 7.9 | GO:0048769 | sarcomerogenesis(GO:0048769) |
1.9 | 9.7 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
1.9 | 1.9 | GO:0072284 | metanephric S-shaped body morphogenesis(GO:0072284) |
1.9 | 9.6 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
1.9 | 9.6 | GO:0035989 | tendon development(GO:0035989) |
1.9 | 3.8 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
1.9 | 5.7 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
1.9 | 1.9 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
1.9 | 5.6 | GO:0061743 | motor learning(GO:0061743) |
1.9 | 5.6 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
1.8 | 5.5 | GO:0006226 | dUMP biosynthetic process(GO:0006226) |
1.8 | 7.4 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
1.8 | 5.5 | GO:0045004 | DNA replication proofreading(GO:0045004) |
1.8 | 5.5 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
1.8 | 1.8 | GO:1904008 | response to monosodium glutamate(GO:1904008) cellular response to monosodium glutamate(GO:1904009) |
1.8 | 5.5 | GO:1990523 | bone regeneration(GO:1990523) |
1.8 | 7.3 | GO:0060265 | positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
1.8 | 3.6 | GO:0060031 | mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
1.8 | 10.8 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
1.8 | 7.2 | GO:1903288 | positive regulation of potassium ion import(GO:1903288) |
1.8 | 9.0 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
1.8 | 7.2 | GO:0015840 | urea transport(GO:0015840) |
1.8 | 8.9 | GO:0070944 | neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) neutrophil mediated killing of bacterium(GO:0070944) |
1.8 | 5.3 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
1.8 | 1.8 | GO:0035854 | eosinophil fate commitment(GO:0035854) |
1.8 | 7.1 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) |
1.8 | 5.3 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
1.8 | 7.0 | GO:0060032 | notochord regression(GO:0060032) |
1.7 | 5.2 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
1.7 | 3.5 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
1.7 | 5.1 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
1.7 | 17.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
1.7 | 5.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
1.7 | 10.2 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
1.7 | 17.0 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
1.7 | 8.5 | GO:0097167 | circadian regulation of translation(GO:0097167) |
1.7 | 1.7 | GO:0021623 | oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
1.7 | 11.6 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
1.6 | 4.9 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
1.6 | 6.6 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
1.6 | 3.3 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
1.6 | 4.9 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
1.6 | 6.5 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
1.6 | 4.8 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
1.6 | 9.6 | GO:1900204 | pronephric field specification(GO:0039003) pattern specification involved in pronephros development(GO:0039017) kidney field specification(GO:0072004) regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072304) negative regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072305) apoptotic process involved in metanephric collecting duct development(GO:1900204) apoptotic process involved in metanephric nephron tubule development(GO:1900205) regulation of apoptotic process involved in metanephric collecting duct development(GO:1900214) negative regulation of apoptotic process involved in metanephric collecting duct development(GO:1900215) regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900217) negative regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900218) mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:1901147) regulation of metanephric DCT cell differentiation(GO:2000592) positive regulation of metanephric DCT cell differentiation(GO:2000594) |
1.6 | 4.7 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
1.6 | 1.6 | GO:0035566 | regulation of metanephros size(GO:0035566) |
1.6 | 3.2 | GO:0002582 | positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
1.6 | 6.3 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
1.6 | 1.6 | GO:2000388 | positive regulation of ovarian follicle development(GO:2000386) regulation of antral ovarian follicle growth(GO:2000387) positive regulation of antral ovarian follicle growth(GO:2000388) |
1.6 | 1.6 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
1.6 | 4.7 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
1.6 | 4.7 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
1.5 | 6.2 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
1.5 | 6.2 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
1.5 | 21.6 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
1.5 | 3.1 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
1.5 | 1.5 | GO:0072235 | metanephric part of ureteric bud development(GO:0035502) distal convoluted tubule development(GO:0072025) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) |
1.5 | 6.1 | GO:0035470 | positive regulation of vascular wound healing(GO:0035470) regulation of vascular wound healing(GO:0061043) |
1.5 | 4.5 | GO:0050929 | corticospinal neuron axon guidance through spinal cord(GO:0021972) positive regulation of negative chemotaxis(GO:0050924) induction of negative chemotaxis(GO:0050929) negative regulation of mononuclear cell migration(GO:0071676) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
1.5 | 7.5 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
1.5 | 3.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
1.5 | 4.5 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
1.5 | 6.0 | GO:0031296 | B cell costimulation(GO:0031296) |
1.5 | 3.0 | GO:0072162 | metanephric mesenchymal cell differentiation(GO:0072162) |
1.5 | 11.9 | GO:0030220 | platelet formation(GO:0030220) |
1.5 | 1.5 | GO:0061438 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) |
1.5 | 16.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
1.5 | 4.4 | GO:0060166 | olfactory pit development(GO:0060166) |
1.5 | 4.4 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
1.5 | 23.5 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
1.5 | 5.9 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
1.5 | 1.5 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
1.4 | 21.7 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
1.4 | 1.4 | GO:0090314 | positive regulation of protein targeting to membrane(GO:0090314) |
1.4 | 5.8 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
1.4 | 1.4 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
1.4 | 2.9 | GO:0071663 | granzyme B production(GO:0071613) regulation of granzyme B production(GO:0071661) positive regulation of granzyme B production(GO:0071663) |
1.4 | 8.6 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
1.4 | 1.4 | GO:0032808 | lacrimal gland development(GO:0032808) |
1.4 | 4.3 | GO:0014718 | positive regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014718) |
1.4 | 1.4 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
1.4 | 2.8 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
1.4 | 4.2 | GO:0071314 | cellular response to cocaine(GO:0071314) |
1.4 | 9.8 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
1.4 | 7.0 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
1.4 | 4.2 | GO:2000768 | glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
1.4 | 7.0 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
1.4 | 15.3 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
1.4 | 6.9 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
1.4 | 5.5 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
1.4 | 2.7 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
1.4 | 12.2 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
1.4 | 10.9 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
1.3 | 8.1 | GO:0031133 | regulation of axon diameter(GO:0031133) |
1.3 | 1.3 | GO:0015793 | glycerol transport(GO:0015793) |
1.3 | 2.7 | GO:0072053 | renal inner medulla development(GO:0072053) |
1.3 | 1.3 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
1.3 | 25.4 | GO:0007614 | short-term memory(GO:0007614) |
1.3 | 5.3 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
1.3 | 4.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
1.3 | 1.3 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
1.3 | 2.7 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
1.3 | 6.6 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
1.3 | 2.6 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
1.3 | 1.3 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
1.3 | 10.5 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
1.3 | 3.9 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
1.3 | 10.4 | GO:0015671 | oxygen transport(GO:0015671) |
1.3 | 6.5 | GO:1905171 | protein localization to phagocytic vesicle(GO:1905161) regulation of protein localization to phagocytic vesicle(GO:1905169) positive regulation of protein localization to phagocytic vesicle(GO:1905171) |
1.3 | 3.9 | GO:0036292 | DNA rewinding(GO:0036292) |
1.3 | 3.9 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
1.3 | 6.5 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
1.3 | 3.9 | GO:0098971 | anterograde dendritic transport of neurotransmitter receptor complex(GO:0098971) |
1.3 | 13.0 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
1.3 | 9.1 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
1.3 | 7.8 | GO:0001866 | NK T cell proliferation(GO:0001866) |
1.3 | 3.9 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
1.3 | 2.6 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
1.3 | 2.6 | GO:0051795 | positive regulation of catagen(GO:0051795) |
1.3 | 12.8 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
1.3 | 2.6 | GO:0033058 | directional locomotion(GO:0033058) |
1.3 | 2.5 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
1.3 | 7.6 | GO:0060023 | soft palate development(GO:0060023) |
1.3 | 1.3 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
1.3 | 7.6 | GO:0002283 | neutrophil activation involved in immune response(GO:0002283) |
1.3 | 3.8 | GO:0002343 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
1.3 | 5.0 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
1.3 | 22.6 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
1.3 | 2.5 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
1.3 | 5.0 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
1.2 | 3.7 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
1.2 | 3.7 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
1.2 | 19.8 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
1.2 | 1.2 | GO:0051794 | regulation of catagen(GO:0051794) |
1.2 | 6.2 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
1.2 | 2.5 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
1.2 | 1.2 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
1.2 | 1.2 | GO:0032329 | serine transport(GO:0032329) |
1.2 | 1.2 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
1.2 | 3.7 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
1.2 | 3.7 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
1.2 | 3.7 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
1.2 | 2.4 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
1.2 | 3.6 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
1.2 | 3.6 | GO:0071846 | actin filament debranching(GO:0071846) |
1.2 | 1.2 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
1.2 | 4.8 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
1.2 | 2.4 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
1.2 | 3.6 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
1.2 | 2.4 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
1.2 | 3.6 | GO:0002030 | inhibitory G-protein coupled receptor phosphorylation(GO:0002030) |
1.2 | 3.5 | GO:0001928 | regulation of exocyst assembly(GO:0001928) |
1.2 | 3.5 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
1.2 | 3.5 | GO:0051934 | dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) |
1.2 | 9.4 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
1.2 | 2.3 | GO:0071603 | endothelial cell-cell adhesion(GO:0071603) |
1.2 | 3.5 | GO:0051466 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
1.2 | 3.5 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
1.2 | 4.6 | GO:0060242 | contact inhibition(GO:0060242) |
1.2 | 1.2 | GO:1990773 | regulation of matrix metallopeptidase secretion(GO:1904464) matrix metallopeptidase secretion(GO:1990773) |
1.1 | 1.1 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
1.1 | 4.6 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
1.1 | 1.1 | GO:1903056 | regulation of melanosome organization(GO:1903056) |
1.1 | 1.1 | GO:0031335 | regulation of sulfur amino acid metabolic process(GO:0031335) |
1.1 | 1.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
1.1 | 4.6 | GO:0030070 | insulin processing(GO:0030070) |
1.1 | 1.1 | GO:0090172 | microtubule cytoskeleton organization involved in homologous chromosome segregation(GO:0090172) |
1.1 | 4.5 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
1.1 | 9.0 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
1.1 | 21.4 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
1.1 | 3.4 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
1.1 | 6.7 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
1.1 | 4.5 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
1.1 | 1.1 | GO:0099552 | trans-synaptic signaling by lipid, modulating synaptic transmission(GO:0099552) trans-synaptic signaling by endocannabinoid, modulating synaptic transmission(GO:0099553) |
1.1 | 3.3 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
1.1 | 4.4 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
1.1 | 7.7 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
1.1 | 3.3 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
1.1 | 7.6 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
1.1 | 10.9 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
1.1 | 2.2 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
1.1 | 3.3 | GO:1902870 | negative regulation of neural retina development(GO:0061076) negative regulation of retina development in camera-type eye(GO:1902867) negative regulation of amacrine cell differentiation(GO:1902870) |
1.1 | 4.3 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
1.1 | 4.3 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
1.1 | 5.4 | GO:0070586 | negative regulation of heterotypic cell-cell adhesion(GO:0034115) cell-cell adhesion involved in gastrulation(GO:0070586) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
1.1 | 9.7 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
1.1 | 2.1 | GO:0015675 | nickel cation transport(GO:0015675) |
1.1 | 3.2 | GO:0035702 | monocyte homeostasis(GO:0035702) |
1.1 | 4.3 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
1.1 | 2.1 | GO:2000568 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
1.1 | 3.2 | GO:1902283 | negative regulation of primary amine oxidase activity(GO:1902283) |
1.1 | 1.1 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
1.1 | 3.2 | GO:0072049 | comma-shaped body morphogenesis(GO:0072049) |
1.0 | 1.0 | GO:2000328 | regulation of T-helper 17 cell lineage commitment(GO:2000328) |
1.0 | 4.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
1.0 | 1.0 | GO:0071608 | macrophage inflammatory protein-1 alpha production(GO:0071608) |
1.0 | 2.1 | GO:2001201 | regulation of transforming growth factor-beta secretion(GO:2001201) |
1.0 | 7.2 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
1.0 | 5.2 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
1.0 | 2.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
1.0 | 3.1 | GO:0046144 | D-serine catabolic process(GO:0036088) D-alanine family amino acid metabolic process(GO:0046144) D-alanine metabolic process(GO:0046436) D-alanine catabolic process(GO:0055130) |
1.0 | 2.1 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
1.0 | 15.4 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
1.0 | 4.1 | GO:1900120 | regulation of receptor binding(GO:1900120) |
1.0 | 5.1 | GO:0032901 | positive regulation of neurotrophin production(GO:0032901) |
1.0 | 8.1 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
1.0 | 2.0 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
1.0 | 2.0 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
1.0 | 4.0 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
1.0 | 2.0 | GO:0010958 | regulation of amino acid import(GO:0010958) |
1.0 | 1.0 | GO:0006272 | leading strand elongation(GO:0006272) |
1.0 | 5.0 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
1.0 | 2.0 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
1.0 | 3.0 | GO:0072720 | response to dithiothreitol(GO:0072720) |
1.0 | 6.9 | GO:0051013 | microtubule severing(GO:0051013) |
1.0 | 5.0 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
1.0 | 9.9 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
1.0 | 3.0 | GO:0035926 | chemokine (C-C motif) ligand 2 secretion(GO:0035926) regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
1.0 | 3.9 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
1.0 | 1.0 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
1.0 | 2.9 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
1.0 | 2.9 | GO:0044849 | estrous cycle(GO:0044849) |
1.0 | 2.9 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
1.0 | 7.8 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
1.0 | 4.9 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
1.0 | 1.9 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
1.0 | 1.0 | GO:1904170 | regulation of bleb assembly(GO:1904170) |
1.0 | 6.7 | GO:0046208 | spermine catabolic process(GO:0046208) |
1.0 | 13.3 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
1.0 | 1.0 | GO:0072194 | kidney smooth muscle tissue development(GO:0072194) |
0.9 | 2.8 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) |
0.9 | 0.9 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.9 | 1.9 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
0.9 | 2.8 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.9 | 2.8 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.9 | 1.9 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.9 | 5.7 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.9 | 5.7 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.9 | 3.8 | GO:0003192 | mitral valve formation(GO:0003192) |
0.9 | 3.8 | GO:0006868 | glutamine transport(GO:0006868) |
0.9 | 5.6 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.9 | 3.7 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
0.9 | 7.5 | GO:0015074 | DNA integration(GO:0015074) |
0.9 | 0.9 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
0.9 | 14.9 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.9 | 6.5 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.9 | 11.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.9 | 34.2 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.9 | 8.3 | GO:0002432 | granuloma formation(GO:0002432) |
0.9 | 5.5 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.9 | 11.0 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.9 | 12.8 | GO:0051451 | myoblast migration(GO:0051451) |
0.9 | 4.6 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.9 | 2.7 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
0.9 | 0.9 | GO:0007356 | thorax and anterior abdomen determination(GO:0007356) |
0.9 | 5.4 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.9 | 0.9 | GO:1904057 | negative regulation of sensory perception of pain(GO:1904057) |
0.9 | 3.6 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.9 | 0.9 | GO:0035799 | ureter maturation(GO:0035799) |
0.9 | 2.7 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.9 | 16.9 | GO:0001675 | acrosome assembly(GO:0001675) |
0.9 | 2.7 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.9 | 3.6 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.9 | 2.7 | GO:0003051 | angiotensin-mediated drinking behavior(GO:0003051) |
0.9 | 7.1 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
0.9 | 2.6 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.9 | 6.2 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.9 | 2.6 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
0.9 | 2.6 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.9 | 4.4 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.9 | 0.9 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.9 | 4.4 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.9 | 2.6 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.9 | 29.6 | GO:0048821 | erythrocyte development(GO:0048821) |
0.9 | 7.8 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.9 | 2.6 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.9 | 2.6 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.9 | 10.4 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.9 | 3.5 | GO:1901374 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.9 | 5.2 | GO:0007412 | axon target recognition(GO:0007412) |
0.9 | 7.8 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.9 | 39.6 | GO:0051693 | actin filament capping(GO:0051693) |
0.9 | 3.4 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.9 | 4.3 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.9 | 0.9 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
0.9 | 1.7 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
0.8 | 2.5 | GO:0036269 | swimming behavior(GO:0036269) |
0.8 | 4.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.8 | 7.6 | GO:0071231 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
0.8 | 2.5 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.8 | 3.4 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
0.8 | 1.7 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.8 | 6.7 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.8 | 4.2 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.8 | 2.5 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.8 | 4.1 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
0.8 | 4.9 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) negative regulation of DNA damage checkpoint(GO:2000002) |
0.8 | 1.6 | GO:1904578 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
0.8 | 4.9 | GO:0006116 | NADH oxidation(GO:0006116) |
0.8 | 1.6 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.8 | 0.8 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.8 | 1.6 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.8 | 6.5 | GO:0006735 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
0.8 | 5.7 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.8 | 2.4 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
0.8 | 0.8 | GO:0033082 | regulation of extrathymic T cell differentiation(GO:0033082) |
0.8 | 6.4 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.8 | 5.6 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.8 | 0.8 | GO:2000412 | positive regulation of thymocyte migration(GO:2000412) |
0.8 | 3.2 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.8 | 0.8 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.8 | 0.8 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.8 | 16.7 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.8 | 6.4 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.8 | 0.8 | GO:0018307 | enzyme active site formation(GO:0018307) |
0.8 | 6.3 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.8 | 1.6 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.8 | 7.9 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.8 | 3.9 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.8 | 10.9 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.8 | 1.6 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) |
0.8 | 2.3 | GO:0052203 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.8 | 3.9 | GO:1904925 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
0.8 | 0.8 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
0.8 | 1.5 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.8 | 3.1 | GO:0072738 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) |
0.8 | 3.8 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.8 | 2.3 | GO:0015811 | L-cystine transport(GO:0015811) |
0.8 | 3.1 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
0.8 | 3.1 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
0.8 | 9.2 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
0.8 | 1.5 | GO:0055096 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
0.8 | 5.3 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.8 | 5.3 | GO:0086011 | membrane repolarization during action potential(GO:0086011) |
0.8 | 4.5 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.8 | 2.3 | GO:1901994 | negative regulation of meiotic cell cycle phase transition(GO:1901994) |
0.8 | 1.5 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.8 | 4.5 | GO:0007144 | female meiosis I(GO:0007144) |
0.8 | 3.0 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.8 | 1.5 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.8 | 3.0 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.7 | 1.5 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.7 | 2.2 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
0.7 | 0.7 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.7 | 0.7 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.7 | 4.4 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.7 | 0.7 | GO:0018201 | peptidyl-glycine modification(GO:0018201) |
0.7 | 3.0 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.7 | 4.4 | GO:1903182 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
0.7 | 1.5 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
0.7 | 2.9 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
0.7 | 2.9 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.7 | 1.5 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.7 | 2.2 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.7 | 3.7 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.7 | 2.2 | GO:1902913 | positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
0.7 | 1.5 | GO:0006848 | pyruvate transport(GO:0006848) |
0.7 | 2.2 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.7 | 0.7 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.7 | 4.3 | GO:0061615 | glycolytic process through fructose-6-phosphate(GO:0061615) |
0.7 | 2.2 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
0.7 | 1.4 | GO:1900244 | positive regulation of synaptic vesicle endocytosis(GO:1900244) |
0.7 | 13.7 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.7 | 8.6 | GO:0099625 | ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.7 | 5.0 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.7 | 5.8 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.7 | 2.9 | GO:2000178 | negative regulation of neural precursor cell proliferation(GO:2000178) |
0.7 | 2.9 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) |
0.7 | 0.7 | GO:0033122 | regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.7 | 4.3 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
0.7 | 2.1 | GO:2000570 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
0.7 | 4.3 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.7 | 1.4 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.7 | 0.7 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
0.7 | 2.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.7 | 14.2 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.7 | 2.8 | GO:0042125 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
0.7 | 2.8 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) glycolytic process from galactose(GO:0061623) |
0.7 | 0.7 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.7 | 2.1 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.7 | 2.1 | GO:0061056 | sclerotome development(GO:0061056) |
0.7 | 0.7 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.7 | 0.7 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
0.7 | 1.4 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.7 | 12.6 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.7 | 1.4 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
0.7 | 2.8 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.7 | 4.2 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.7 | 5.6 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.7 | 0.7 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.7 | 0.7 | GO:0080144 | amino acid homeostasis(GO:0080144) |
0.7 | 4.2 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
0.7 | 2.8 | GO:0061450 | trophoblast cell migration(GO:0061450) |
0.7 | 1.4 | GO:0060065 | uterus development(GO:0060065) |
0.7 | 2.8 | GO:0040030 | regulation of molecular function, epigenetic(GO:0040030) |
0.7 | 2.1 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.7 | 0.7 | GO:1902460 | mesenchymal stem cell proliferation(GO:0097168) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
0.7 | 1.4 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
0.7 | 5.5 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.7 | 2.7 | GO:0002581 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
0.7 | 2.7 | GO:0030432 | peristalsis(GO:0030432) |
0.7 | 2.0 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.7 | 0.7 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.7 | 2.0 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.7 | 1.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.7 | 2.7 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.7 | 2.0 | GO:0007439 | ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
0.7 | 1.4 | GO:0035666 | TRIF-dependent toll-like receptor signaling pathway(GO:0035666) |
0.7 | 8.1 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.7 | 3.4 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
0.7 | 0.7 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
0.7 | 2.0 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
0.7 | 1.3 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.7 | 2.0 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.7 | 1.3 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.7 | 0.7 | GO:1904959 | regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
0.7 | 1.3 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.7 | 0.7 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) |
0.7 | 1.3 | GO:0009405 | pathogenesis(GO:0009405) |
0.7 | 2.7 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
0.7 | 1.3 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.7 | 2.0 | GO:0032274 | gonadotropin secretion(GO:0032274) |
0.7 | 0.7 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.7 | 1.3 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.7 | 0.7 | GO:0021546 | rhombomere development(GO:0021546) |
0.7 | 0.7 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.7 | 29.8 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
0.7 | 5.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.7 | 7.2 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
0.7 | 4.6 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.7 | 4.6 | GO:0071313 | cellular response to caffeine(GO:0071313) |
0.7 | 2.6 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.7 | 0.7 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
0.7 | 1.3 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.7 | 2.0 | GO:0031268 | pseudopodium organization(GO:0031268) |
0.7 | 3.9 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.7 | 4.6 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
0.6 | 1.3 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.6 | 0.6 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) |
0.6 | 0.6 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.6 | 4.5 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.6 | 0.6 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.6 | 4.5 | GO:0033275 | actin-myosin filament sliding(GO:0033275) |
0.6 | 1.3 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.6 | 2.6 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
0.6 | 0.6 | GO:1901538 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
0.6 | 3.2 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) |
0.6 | 0.6 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.6 | 1.9 | GO:0099526 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
0.6 | 2.5 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.6 | 5.1 | GO:0034651 | cortisol biosynthetic process(GO:0034651) |
0.6 | 0.6 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.6 | 1.9 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.6 | 2.5 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
0.6 | 2.5 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
0.6 | 1.3 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.6 | 4.4 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.6 | 2.5 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.6 | 1.3 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.6 | 6.2 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
0.6 | 1.9 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.6 | 11.2 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.6 | 1.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.6 | 16.1 | GO:0071514 | genetic imprinting(GO:0071514) |
0.6 | 8.0 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.6 | 6.2 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
0.6 | 1.8 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
0.6 | 1.8 | GO:0051014 | actin filament severing(GO:0051014) |
0.6 | 1.8 | GO:0032954 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
0.6 | 1.8 | GO:2000668 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.6 | 1.2 | GO:1904976 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
0.6 | 1.2 | GO:1902896 | terminal web assembly(GO:1902896) |
0.6 | 5.5 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.6 | 1.2 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.6 | 3.0 | GO:0038032 | termination of G-protein coupled receptor signaling pathway(GO:0038032) |
0.6 | 1.2 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
0.6 | 2.4 | GO:0030576 | Cajal body organization(GO:0030576) |
0.6 | 1.2 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.6 | 3.0 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
0.6 | 10.2 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.6 | 1.2 | GO:0002339 | B cell selection(GO:0002339) |
0.6 | 3.6 | GO:0032071 | regulation of deoxyribonuclease activity(GO:0032070) regulation of endodeoxyribonuclease activity(GO:0032071) |
0.6 | 1.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.6 | 3.6 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.6 | 0.6 | GO:0051542 | elastin biosynthetic process(GO:0051542) |
0.6 | 1.2 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) |
0.6 | 3.6 | GO:1904672 | regulation of somatic stem cell population maintenance(GO:1904672) |
0.6 | 3.6 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.6 | 7.1 | GO:0003417 | growth plate cartilage development(GO:0003417) |
0.6 | 3.5 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.6 | 1.8 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.6 | 1.8 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
0.6 | 5.3 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.6 | 1.8 | GO:0090285 | negative regulation of protein glycosylation in Golgi(GO:0090285) |
0.6 | 1.2 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.6 | 1.8 | GO:0099640 | axo-dendritic protein transport(GO:0099640) |
0.6 | 6.4 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.6 | 1.2 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.6 | 0.6 | GO:0072239 | metanephric glomerulus vasculature development(GO:0072239) |
0.6 | 1.2 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) |
0.6 | 3.5 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.6 | 1.7 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.6 | 3.5 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.6 | 1.2 | GO:0060369 | positive regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060369) |
0.6 | 1.7 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.6 | 3.5 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.6 | 3.4 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
0.6 | 2.3 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.6 | 5.1 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.6 | 1.1 | GO:0046502 | uroporphyrinogen III metabolic process(GO:0046502) |
0.6 | 1.1 | GO:0045605 | negative regulation of epidermal cell differentiation(GO:0045605) |
0.6 | 2.3 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.6 | 1.1 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
0.6 | 0.6 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
0.6 | 1.7 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.6 | 4.5 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.6 | 25.5 | GO:0070527 | platelet aggregation(GO:0070527) |
0.6 | 0.6 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.6 | 0.6 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.6 | 3.4 | GO:0051590 | positive regulation of neurotransmitter transport(GO:0051590) |
0.6 | 7.3 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.6 | 1.7 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.6 | 1.1 | GO:0031179 | peptide modification(GO:0031179) |
0.6 | 0.6 | GO:0039020 | pronephric nephron tubule development(GO:0039020) pronephros morphogenesis(GO:0072114) |
0.6 | 1.1 | GO:0098937 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
0.6 | 6.7 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.6 | 2.2 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.6 | 1.7 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
0.6 | 2.2 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.6 | 2.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.6 | 2.2 | GO:0031509 | telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
0.6 | 2.2 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.6 | 1.7 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
0.6 | 2.2 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) response to increased oxygen levels(GO:0036296) |
0.6 | 7.7 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.6 | 12.2 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
0.6 | 3.9 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
0.6 | 3.9 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
0.6 | 0.6 | GO:0036257 | multivesicular body organization(GO:0036257) |
0.5 | 2.2 | GO:0021781 | glial cell fate commitment(GO:0021781) |
0.5 | 1.6 | GO:2000016 | negative regulation of determination of dorsal identity(GO:2000016) |
0.5 | 1.6 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.5 | 1.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.5 | 3.3 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.5 | 1.6 | GO:0048566 | embryonic digestive tract development(GO:0048566) |
0.5 | 1.6 | GO:0042339 | keratan sulfate metabolic process(GO:0042339) |
0.5 | 2.2 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.5 | 3.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.5 | 9.2 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.5 | 3.8 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.5 | 0.5 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.5 | 3.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.5 | 14.0 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
0.5 | 7.5 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.5 | 3.8 | GO:0007616 | long-term memory(GO:0007616) |
0.5 | 1.6 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.5 | 2.1 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
0.5 | 2.1 | GO:0032218 | riboflavin transport(GO:0032218) |
0.5 | 1.6 | GO:0051459 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
0.5 | 4.3 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.5 | 3.2 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
0.5 | 2.1 | GO:0061188 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
0.5 | 2.1 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
0.5 | 2.1 | GO:0010286 | heat acclimation(GO:0010286) |
0.5 | 4.7 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.5 | 31.9 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.5 | 2.1 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.5 | 0.5 | GO:0061193 | taste bud development(GO:0061193) |
0.5 | 2.6 | GO:0018343 | protein farnesylation(GO:0018343) |
0.5 | 3.1 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.5 | 3.1 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.5 | 5.7 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.5 | 1.0 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
0.5 | 1.0 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.5 | 7.1 | GO:0019731 | antibacterial humoral response(GO:0019731) |
0.5 | 1.0 | GO:1904798 | positive regulation of core promoter binding(GO:1904798) |
0.5 | 1.5 | GO:0006907 | pinocytosis(GO:0006907) |
0.5 | 5.1 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
0.5 | 4.0 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.5 | 4.5 | GO:0006968 | cellular defense response(GO:0006968) |
0.5 | 2.5 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.5 | 7.0 | GO:0030261 | chromosome condensation(GO:0030261) |
0.5 | 2.0 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
0.5 | 4.0 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.5 | 6.4 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
0.5 | 2.0 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
0.5 | 1.0 | GO:2000774 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
0.5 | 1.5 | GO:0070723 | response to cholesterol(GO:0070723) cellular response to cholesterol(GO:0071397) |
0.5 | 1.5 | GO:1903632 | positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
0.5 | 0.5 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
0.5 | 2.0 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
0.5 | 1.5 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
0.5 | 5.4 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
0.5 | 3.4 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.5 | 1.9 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
0.5 | 2.4 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.5 | 0.5 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.5 | 1.9 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.5 | 3.4 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) |
0.5 | 2.4 | GO:0033029 | neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) positive regulation of neutrophil apoptotic process(GO:0033031) |
0.5 | 2.4 | GO:0042891 | antibiotic transport(GO:0042891) |
0.5 | 2.4 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
0.5 | 2.4 | GO:0033687 | osteoblast proliferation(GO:0033687) |
0.5 | 0.5 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.5 | 1.9 | GO:0032053 | ciliary basal body organization(GO:0032053) |
0.5 | 0.9 | GO:1903556 | negative regulation of tumor necrosis factor superfamily cytokine production(GO:1903556) |
0.5 | 1.4 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
0.5 | 1.4 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.5 | 1.4 | GO:1903225 | regulation of endodermal cell differentiation(GO:1903224) negative regulation of endodermal cell differentiation(GO:1903225) |
0.5 | 1.9 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.5 | 4.2 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.5 | 7.0 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.5 | 0.9 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.5 | 0.5 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
0.5 | 0.5 | GO:0071287 | cellular response to manganese ion(GO:0071287) |
0.5 | 1.9 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.5 | 1.4 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.5 | 2.3 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.5 | 1.9 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.5 | 5.5 | GO:0071470 | cellular response to osmotic stress(GO:0071470) |
0.5 | 1.4 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.5 | 1.4 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.5 | 0.9 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.5 | 1.8 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.5 | 2.3 | GO:0035617 | stress granule disassembly(GO:0035617) |
0.5 | 2.7 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.5 | 0.9 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.5 | 2.7 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.5 | 4.1 | GO:0090025 | regulation of monocyte chemotaxis(GO:0090025) |
0.5 | 1.4 | GO:0003352 | regulation of cilium movement(GO:0003352) regulation of cilium beat frequency(GO:0003356) |
0.5 | 5.0 | GO:1904867 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.5 | 0.9 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.5 | 7.7 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.5 | 7.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.5 | 0.5 | GO:0061402 | positive regulation of transcription from RNA polymerase II promoter in response to acidic pH(GO:0061402) |
0.5 | 0.9 | GO:0032625 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
0.5 | 1.8 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.4 | 13.9 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
0.4 | 1.8 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.4 | 4.5 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.4 | 1.3 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
0.4 | 5.8 | GO:0033363 | secretory granule organization(GO:0033363) |
0.4 | 1.3 | GO:0032769 | negative regulation of monooxygenase activity(GO:0032769) |
0.4 | 5.8 | GO:0015804 | neutral amino acid transport(GO:0015804) |
0.4 | 4.9 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.4 | 0.9 | GO:0010424 | DNA methylation on cytosine within a CG sequence(GO:0010424) |
0.4 | 4.0 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.4 | 1.3 | GO:0033189 | response to vitamin A(GO:0033189) |
0.4 | 2.2 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.4 | 8.4 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.4 | 1.8 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
0.4 | 0.4 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.4 | 0.4 | GO:0099541 | trans-synaptic signaling by lipid(GO:0099541) trans-synaptic signaling by endocannabinoid(GO:0099542) |
0.4 | 1.3 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.4 | 4.4 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.4 | 11.4 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.4 | 20.9 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.4 | 0.4 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.4 | 1.3 | GO:0048865 | stem cell fate commitment(GO:0048865) stem cell fate specification(GO:0048866) endocardial cell differentiation(GO:0060956) |
0.4 | 0.9 | GO:0045625 | regulation of T-helper 1 cell differentiation(GO:0045625) |
0.4 | 3.5 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.4 | 0.9 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.4 | 1.3 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.4 | 5.6 | GO:0033622 | integrin activation(GO:0033622) |
0.4 | 4.8 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.4 | 1.3 | GO:0097309 | cap1 mRNA methylation(GO:0097309) |
0.4 | 0.9 | GO:0035744 | T-helper 1 cell cytokine production(GO:0035744) |
0.4 | 0.9 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.4 | 1.7 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.4 | 1.3 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.4 | 5.6 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
0.4 | 2.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.4 | 1.7 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
0.4 | 1.7 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
0.4 | 13.6 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.4 | 2.5 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.4 | 0.4 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.4 | 0.8 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.4 | 2.9 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.4 | 6.3 | GO:0032060 | bleb assembly(GO:0032060) |
0.4 | 1.3 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.4 | 1.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.4 | 0.8 | GO:0071372 | response to follicle-stimulating hormone(GO:0032354) cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.4 | 2.1 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.4 | 0.4 | GO:2000969 | positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.4 | 2.1 | GO:0046549 | retinal cone cell development(GO:0046549) |
0.4 | 0.4 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.4 | 7.0 | GO:0061756 | leukocyte adhesion to vascular endothelial cell(GO:0061756) |
0.4 | 0.8 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
0.4 | 0.8 | GO:0032735 | positive regulation of interleukin-12 production(GO:0032735) |
0.4 | 0.4 | GO:1990918 | double-strand break repair involved in meiotic recombination(GO:1990918) |
0.4 | 2.0 | GO:0002159 | desmosome assembly(GO:0002159) |
0.4 | 0.4 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.4 | 2.4 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.4 | 1.2 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
0.4 | 0.4 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
0.4 | 1.6 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.4 | 1.2 | GO:0002946 | tRNA C5-cytosine methylation(GO:0002946) |
0.4 | 1.2 | GO:0044359 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.4 | 0.8 | GO:0046078 | dUMP metabolic process(GO:0046078) |
0.4 | 0.4 | GO:0002676 | regulation of chronic inflammatory response(GO:0002676) |
0.4 | 6.3 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.4 | 1.2 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.4 | 2.0 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.4 | 2.7 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.4 | 0.8 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
0.4 | 1.9 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.4 | 1.2 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.4 | 3.1 | GO:0070986 | left/right axis specification(GO:0070986) |
0.4 | 0.8 | GO:0002266 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
0.4 | 0.8 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.4 | 0.8 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
0.4 | 0.4 | GO:0021852 | pyramidal neuron migration(GO:0021852) |
0.4 | 1.9 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.4 | 0.4 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
0.4 | 6.1 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.4 | 0.8 | GO:0021590 | cerebellum maturation(GO:0021590) cerebellar cortex maturation(GO:0021699) |
0.4 | 0.4 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
0.4 | 1.5 | GO:0015855 | nucleobase transport(GO:0015851) pyrimidine nucleobase transport(GO:0015855) |
0.4 | 0.4 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.4 | 1.5 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.4 | 0.4 | GO:0060920 | cardiac pacemaker cell differentiation(GO:0060920) |
0.4 | 0.4 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
0.4 | 0.4 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.4 | 0.8 | GO:0048298 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
0.4 | 5.2 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
0.4 | 0.7 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.4 | 0.7 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.4 | 0.7 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.4 | 0.7 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.4 | 0.4 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.4 | 6.3 | GO:0014823 | response to activity(GO:0014823) |
0.4 | 1.5 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.4 | 0.7 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.4 | 0.7 | GO:0048478 | replication fork protection(GO:0048478) |
0.4 | 7.7 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.4 | 0.7 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.4 | 4.1 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.4 | 6.2 | GO:0071467 | cellular response to pH(GO:0071467) |
0.4 | 3.6 | GO:1902571 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.4 | 1.8 | GO:0080111 | DNA demethylation(GO:0080111) |
0.4 | 3.3 | GO:0030168 | platelet activation(GO:0030168) |
0.4 | 1.5 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.4 | 1.4 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.4 | 1.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.4 | 1.8 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
0.4 | 1.4 | GO:0032740 | positive regulation of interleukin-17 production(GO:0032740) |
0.4 | 6.1 | GO:0001706 | endoderm formation(GO:0001706) |
0.4 | 0.4 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.4 | 1.4 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.4 | 0.4 | GO:0021933 | radial glia guided migration of cerebellar granule cell(GO:0021933) |
0.4 | 4.3 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.4 | 1.4 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.4 | 0.7 | GO:0097494 | regulation of vesicle size(GO:0097494) |
0.4 | 1.1 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.4 | 6.4 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
0.4 | 3.2 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
0.4 | 2.5 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
0.4 | 0.4 | GO:0060278 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.4 | 3.2 | GO:0051026 | chiasma assembly(GO:0051026) |
0.3 | 2.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.3 | 1.0 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.3 | 7.0 | GO:0090280 | positive regulation of calcium ion import(GO:0090280) |
0.3 | 3.8 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.3 | 9.0 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.3 | 1.0 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) |
0.3 | 2.1 | GO:0098868 | bone growth(GO:0098868) |
0.3 | 0.7 | GO:0008038 | neuron recognition(GO:0008038) |
0.3 | 0.3 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.3 | 0.7 | GO:0072014 | proximal tubule development(GO:0072014) |
0.3 | 1.4 | GO:1902167 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902167) |
0.3 | 1.0 | GO:0061090 | positive regulation of sequestering of zinc ion(GO:0061090) |
0.3 | 1.4 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) artery smooth muscle contraction(GO:0014824) |
0.3 | 1.0 | GO:1902218 | regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) |
0.3 | 0.7 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.3 | 1.0 | GO:0010288 | response to lead ion(GO:0010288) |
0.3 | 0.7 | GO:0044805 | late nucleophagy(GO:0044805) |
0.3 | 1.0 | GO:0060561 | apoptotic process involved in morphogenesis(GO:0060561) |
0.3 | 0.3 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
0.3 | 0.3 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.3 | 4.6 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.3 | 3.6 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.3 | 2.3 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
0.3 | 3.3 | GO:0045730 | respiratory burst(GO:0045730) |
0.3 | 3.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.3 | 1.6 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.3 | 1.3 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.3 | 9.8 | GO:0009409 | response to cold(GO:0009409) |
0.3 | 1.0 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.3 | 2.0 | GO:0032202 | telomere assembly(GO:0032202) |
0.3 | 9.8 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.3 | 1.6 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
0.3 | 3.2 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
0.3 | 4.5 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.3 | 0.3 | GO:0061055 | myotome development(GO:0061055) |
0.3 | 0.6 | GO:0046075 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.3 | 3.9 | GO:0046514 | ceramide catabolic process(GO:0046514) |
0.3 | 0.3 | GO:0014870 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.3 | 1.6 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.3 | 2.2 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.3 | 0.6 | GO:0002358 | B cell homeostatic proliferation(GO:0002358) |
0.3 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.3 | 0.6 | GO:0051350 | negative regulation of lyase activity(GO:0051350) |
0.3 | 0.3 | GO:0002313 | mature B cell differentiation involved in immune response(GO:0002313) |
0.3 | 10.4 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.3 | 0.3 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.3 | 0.3 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.3 | 0.6 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.3 | 2.2 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.3 | 1.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.3 | 0.3 | GO:0060911 | cardiac cell fate commitment(GO:0060911) |
0.3 | 0.6 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.3 | 1.2 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.3 | 0.6 | GO:0009838 | abscission(GO:0009838) |
0.3 | 1.2 | GO:0007135 | meiosis II(GO:0007135) |
0.3 | 0.3 | GO:2000317 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
0.3 | 3.7 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.3 | 0.3 | GO:0019046 | release from viral latency(GO:0019046) |
0.3 | 0.3 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
0.3 | 0.3 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.3 | 3.4 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
0.3 | 1.8 | GO:0071168 | protein localization to chromatin(GO:0071168) |
0.3 | 0.6 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.3 | 3.0 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.3 | 2.1 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.3 | 1.8 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.3 | 0.3 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.3 | 3.0 | GO:0001502 | cartilage condensation(GO:0001502) |
0.3 | 1.8 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.3 | 0.6 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.3 | 0.9 | GO:0043129 | surfactant homeostasis(GO:0043129) |
0.3 | 0.9 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.3 | 0.6 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.3 | 1.2 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.3 | 0.9 | GO:0021578 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
0.3 | 2.4 | GO:0070236 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.3 | 0.6 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
0.3 | 7.3 | GO:0048701 | embryonic cranial skeleton morphogenesis(GO:0048701) |
0.3 | 1.8 | GO:0072610 | interleukin-12 secretion(GO:0072610) |
0.3 | 1.8 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.3 | 1.2 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.3 | 0.9 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.3 | 1.2 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.3 | 3.2 | GO:0043306 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
0.3 | 7.0 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.3 | 1.2 | GO:0009816 | defense response to bacterium, incompatible interaction(GO:0009816) regulation of defense response to bacterium, incompatible interaction(GO:1902477) |
0.3 | 1.5 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.3 | 0.3 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
0.3 | 0.6 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.3 | 0.3 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
0.3 | 3.5 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.3 | 2.3 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.3 | 1.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.3 | 1.1 | GO:0015786 | UDP-glucose transport(GO:0015786) |
0.3 | 0.6 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
0.3 | 1.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.3 | 0.6 | GO:0015961 | diadenosine polyphosphate metabolic process(GO:0015959) diadenosine polyphosphate catabolic process(GO:0015961) |
0.3 | 0.3 | GO:1903978 | regulation of microglial cell activation(GO:1903978) |
0.3 | 7.1 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
0.3 | 2.0 | GO:0071158 | positive regulation of cell cycle arrest(GO:0071158) |
0.3 | 3.4 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.3 | 2.2 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.3 | 1.4 | GO:0036476 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.3 | 1.7 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.3 | 2.8 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.3 | 0.3 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
0.3 | 4.5 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
0.3 | 3.6 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.3 | 0.8 | GO:0036509 | trimming of terminal mannose on B branch(GO:0036509) |
0.3 | 1.1 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.3 | 6.1 | GO:0045761 | regulation of adenylate cyclase activity(GO:0045761) |
0.3 | 0.8 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.3 | 0.8 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
0.3 | 1.6 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.3 | 1.1 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
0.3 | 1.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.3 | 1.4 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.3 | 0.5 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.3 | 0.3 | GO:0098743 | cell aggregation(GO:0098743) |
0.3 | 1.9 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.3 | 0.5 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.3 | 0.8 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
0.3 | 0.5 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.3 | 0.3 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
0.3 | 0.3 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.3 | 0.3 | GO:0002579 | positive regulation of antigen processing and presentation(GO:0002579) |
0.3 | 2.4 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.3 | 0.8 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.3 | 1.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.3 | 1.3 | GO:0009597 | detection of virus(GO:0009597) |
0.3 | 1.6 | GO:0000012 | single strand break repair(GO:0000012) |
0.3 | 2.9 | GO:0002639 | positive regulation of immunoglobulin production(GO:0002639) |
0.3 | 0.5 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.3 | 0.3 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
0.3 | 3.1 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.3 | 0.3 | GO:0010593 | negative regulation of lamellipodium assembly(GO:0010593) |
0.3 | 1.3 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.3 | 2.1 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.3 | 0.8 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
0.3 | 2.1 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
0.3 | 4.1 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.3 | 0.5 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
0.3 | 1.0 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.3 | 2.3 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.3 | 0.3 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.3 | 1.5 | GO:0019730 | antimicrobial humoral response(GO:0019730) |
0.3 | 2.3 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.3 | 1.3 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.3 | 1.5 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.3 | 0.3 | GO:0036451 | cap mRNA methylation(GO:0036451) |
0.3 | 0.3 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.3 | 0.3 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.2 | 1.7 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.2 | 0.2 | GO:0048880 | sensory system development(GO:0048880) |
0.2 | 0.7 | GO:0034969 | histone arginine methylation(GO:0034969) |
0.2 | 0.2 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
0.2 | 0.2 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.2 | 0.2 | GO:1903514 | calcium ion transport from endoplasmic reticulum to cytosol(GO:1903514) |
0.2 | 0.2 | GO:0070253 | somatostatin secretion(GO:0070253) |
0.2 | 0.2 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) |
0.2 | 0.5 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.2 | 1.0 | GO:0009099 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
0.2 | 1.2 | GO:0060539 | diaphragm development(GO:0060539) |
0.2 | 0.5 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.2 | 1.5 | GO:0042531 | positive regulation of tyrosine phosphorylation of STAT protein(GO:0042531) |
0.2 | 1.9 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.2 | 0.2 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.2 | 0.7 | GO:0042756 | drinking behavior(GO:0042756) |
0.2 | 0.2 | GO:0071599 | otic vesicle development(GO:0071599) |
0.2 | 3.8 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.2 | 8.0 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.2 | 0.7 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.2 | 1.2 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.2 | 1.9 | GO:0051255 | spindle midzone assembly(GO:0051255) |
0.2 | 0.5 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
0.2 | 3.0 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.2 | 0.9 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.2 | 0.7 | GO:0003345 | proepicardium cell migration involved in pericardium morphogenesis(GO:0003345) |
0.2 | 3.2 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.2 | 0.2 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
0.2 | 2.3 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.2 | 0.5 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.2 | 1.8 | GO:0043585 | nose morphogenesis(GO:0043585) alveolar primary septum development(GO:0061143) |
0.2 | 0.2 | GO:0046541 | saliva secretion(GO:0046541) |
0.2 | 6.6 | GO:0006284 | base-excision repair(GO:0006284) |
0.2 | 1.4 | GO:0002076 | osteoblast development(GO:0002076) |
0.2 | 0.9 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.2 | 5.0 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.2 | 3.2 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.2 | 0.5 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.2 | 0.5 | GO:0045910 | negative regulation of DNA recombination(GO:0045910) |
0.2 | 0.7 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.2 | 0.2 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
0.2 | 0.9 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.2 | 1.1 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.2 | 0.7 | GO:0001927 | exocyst assembly(GO:0001927) |
0.2 | 0.7 | GO:0002681 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.2 | 5.1 | GO:1902850 | mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
0.2 | 0.7 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.2 | 1.3 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.2 | 3.7 | GO:0032094 | response to food(GO:0032094) |
0.2 | 0.4 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.2 | 1.8 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.2 | 0.7 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.2 | 4.2 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.2 | 0.4 | GO:0009148 | pyrimidine nucleoside triphosphate biosynthetic process(GO:0009148) |
0.2 | 2.8 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.2 | 2.4 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
0.2 | 1.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.2 | 1.5 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.2 | 0.7 | GO:1901970 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.2 | 0.4 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.2 | 0.4 | GO:0014842 | skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
0.2 | 0.9 | GO:0042092 | type 2 immune response(GO:0042092) |
0.2 | 0.4 | GO:0021539 | subthalamus development(GO:0021539) |
0.2 | 0.4 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
0.2 | 0.2 | GO:0090135 | actin filament branching(GO:0090135) |
0.2 | 0.4 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.2 | 1.3 | GO:0010165 | response to X-ray(GO:0010165) |
0.2 | 0.4 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.2 | 1.5 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.2 | 0.8 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.2 | 0.2 | GO:0042335 | cuticle development(GO:0042335) |
0.2 | 1.9 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.2 | 0.6 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.2 | 1.0 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.2 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
0.2 | 0.6 | GO:0002385 | mucosal immune response(GO:0002385) |
0.2 | 0.4 | GO:2000018 | regulation of male gonad development(GO:2000018) |
0.2 | 3.5 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.2 | 1.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.2 | 2.2 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.2 | 2.0 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.2 | 2.6 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
0.2 | 0.6 | GO:0060440 | trachea formation(GO:0060440) |
0.2 | 1.6 | GO:0048678 | response to axon injury(GO:0048678) |
0.2 | 1.0 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.2 | 0.8 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
0.2 | 1.0 | GO:0001830 | trophectodermal cell fate commitment(GO:0001830) |
0.2 | 0.4 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.2 | 0.4 | GO:0072683 | T cell extravasation(GO:0072683) |
0.2 | 2.9 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.2 | 1.4 | GO:0051307 | meiotic chromosome separation(GO:0051307) |
0.2 | 0.2 | GO:0072401 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
0.2 | 1.0 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
0.2 | 0.2 | GO:0072244 | metanephric glomerular epithelium development(GO:0072244) |
0.2 | 0.2 | GO:0072141 | glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) glomerular mesangial cell development(GO:0072144) |
0.2 | 0.6 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.2 | 2.7 | GO:0051601 | exocyst localization(GO:0051601) |
0.2 | 1.0 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.2 | 1.1 | GO:0008228 | opsonization(GO:0008228) |
0.2 | 13.0 | GO:0002377 | immunoglobulin production(GO:0002377) |
0.2 | 1.7 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.2 | 4.9 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.2 | 0.2 | GO:0015965 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
0.2 | 0.7 | GO:0019532 | oxalate transport(GO:0019532) |
0.2 | 0.4 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.2 | 0.6 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.2 | 1.1 | GO:1901724 | positive regulation of cell proliferation involved in kidney development(GO:1901724) |
0.2 | 2.0 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.2 | 0.9 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.2 | 0.2 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.2 | 0.5 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.2 | 8.3 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.2 | 0.7 | GO:0018158 | protein oxidation(GO:0018158) |
0.2 | 1.3 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.2 | 0.9 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.2 | 1.3 | GO:0042167 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.2 | 2.5 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
0.2 | 1.6 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.2 | 9.8 | GO:0007586 | digestion(GO:0007586) |
0.2 | 0.4 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
0.2 | 0.4 | GO:0002551 | mast cell chemotaxis(GO:0002551) |
0.2 | 0.2 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.2 | 2.4 | GO:0040036 | regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
0.2 | 0.3 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
0.2 | 0.7 | GO:0044351 | macropinocytosis(GO:0044351) |
0.2 | 1.9 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.2 | 1.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.2 | 1.0 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.2 | 0.7 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.2 | 0.8 | GO:0016266 | O-glycan processing(GO:0016266) |
0.2 | 0.2 | GO:0061308 | cardiac neural crest cell development involved in heart development(GO:0061308) |
0.2 | 2.2 | GO:0042246 | tissue regeneration(GO:0042246) |
0.2 | 0.2 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
0.2 | 0.3 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.2 | 0.5 | GO:1902590 | viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
0.2 | 0.5 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
0.2 | 0.8 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.2 | 0.5 | GO:0070269 | pyroptosis(GO:0070269) |
0.2 | 1.3 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.2 | 0.5 | GO:1904849 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.2 | 1.6 | GO:1902175 | regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902175) |
0.2 | 0.2 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.2 | 1.8 | GO:0031498 | chromatin disassembly(GO:0031498) |
0.2 | 0.2 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.2 | 0.8 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
0.2 | 6.2 | GO:0006414 | translational elongation(GO:0006414) |
0.2 | 3.3 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
0.2 | 0.5 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.2 | 0.8 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.2 | 0.2 | GO:0002468 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) |
0.2 | 0.2 | GO:0046476 | glycosylceramide biosynthetic process(GO:0046476) |
0.2 | 0.2 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.2 | 0.8 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.2 | 0.2 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) |
0.2 | 0.5 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.2 | 1.2 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.2 | 0.5 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.2 | 0.5 | GO:0097709 | wound healing involved in inflammatory response(GO:0002246) connective tissue replacement involved in inflammatory response wound healing(GO:0002248) inflammatory response to wounding(GO:0090594) connective tissue replacement(GO:0097709) |
0.2 | 4.4 | GO:0048704 | embryonic skeletal system morphogenesis(GO:0048704) |
0.2 | 0.2 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.1 | 2.2 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.1 | 1.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.1 | 0.1 | GO:0021544 | subpallium development(GO:0021544) |
0.1 | 1.5 | GO:0009309 | amine biosynthetic process(GO:0009309) cellular biogenic amine biosynthetic process(GO:0042401) |
0.1 | 0.1 | GO:0033483 | oxygen homeostasis(GO:0032364) gas homeostasis(GO:0033483) |
0.1 | 0.6 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.1 | 0.4 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.1 | 0.7 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.1 | 7.4 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.1 | 0.6 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.1 | 0.1 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.1 | 0.3 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.1 | 2.0 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 1.6 | GO:0043486 | histone exchange(GO:0043486) |
0.1 | 1.3 | GO:0002548 | monocyte chemotaxis(GO:0002548) |
0.1 | 0.7 | GO:0015669 | gas transport(GO:0015669) |
0.1 | 0.3 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 2.5 | GO:0008347 | glial cell migration(GO:0008347) |
0.1 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.4 | GO:0002355 | detection of tumor cell(GO:0002355) |
0.1 | 0.8 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.1 | 0.1 | GO:0046321 | positive regulation of fatty acid oxidation(GO:0046321) |
0.1 | 0.4 | GO:0006833 | water transport(GO:0006833) |
0.1 | 1.0 | GO:0035878 | nail development(GO:0035878) |
0.1 | 0.5 | GO:2000400 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.1 | 0.1 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.1 | 1.1 | GO:0048753 | melanosome organization(GO:0032438) pigment granule organization(GO:0048753) |
0.1 | 1.5 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
0.1 | 1.5 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.1 | 0.5 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 3.1 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
0.1 | 2.5 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.1 | 0.4 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.1 | GO:0010561 | negative regulation of glycoprotein biosynthetic process(GO:0010561) |
0.1 | 0.7 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.1 | 1.7 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.1 | 1.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.5 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.1 | 4.2 | GO:0015991 | ATP hydrolysis coupled proton transport(GO:0015991) |
0.1 | 5.3 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.1 | 0.6 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.1 | 0.1 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
0.1 | 0.9 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
0.1 | 0.5 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.1 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.1 | 0.6 | GO:0070166 | enamel mineralization(GO:0070166) |
0.1 | 0.4 | GO:1904645 | response to beta-amyloid(GO:1904645) |
0.1 | 0.2 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.1 | 3.1 | GO:0033344 | cholesterol efflux(GO:0033344) |
0.1 | 2.2 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.1 | 0.1 | GO:0032736 | positive regulation of interleukin-13 production(GO:0032736) |
0.1 | 0.7 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.1 | 0.5 | GO:0003266 | regulation of secondary heart field cardioblast proliferation(GO:0003266) |
0.1 | 0.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.7 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 3.7 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
0.1 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.3 | GO:0015817 | histidine transport(GO:0015817) |
0.1 | 0.1 | GO:0071731 | response to nitric oxide(GO:0071731) |
0.1 | 0.1 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
0.1 | 0.6 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.1 | 0.1 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.1 | 3.9 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.1 | 3.0 | GO:0007052 | mitotic spindle organization(GO:0007052) |
0.1 | 0.4 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
0.1 | 1.3 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.1 | 2.4 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
0.1 | 0.9 | GO:0015884 | folic acid transport(GO:0015884) |
0.1 | 0.1 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.2 | GO:1904954 | canonical Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904954) |
0.1 | 1.8 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.1 | 1.0 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.1 | 0.4 | GO:0034391 | smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
0.1 | 0.6 | GO:0010747 | positive regulation of plasma membrane long-chain fatty acid transport(GO:0010747) |
0.1 | 0.1 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 1.7 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
0.1 | 0.3 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.1 | GO:0002578 | negative regulation of antigen processing and presentation(GO:0002578) |
0.1 | 0.1 | GO:0045606 | positive regulation of epidermal cell differentiation(GO:0045606) |
0.1 | 0.2 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
0.1 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.4 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
0.1 | 0.2 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.1 | 0.9 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
0.1 | 0.6 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.9 | GO:0030225 | macrophage differentiation(GO:0030225) |
0.1 | 0.1 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.1 | 0.4 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.1 | 5.5 | GO:0010811 | positive regulation of cell-substrate adhesion(GO:0010811) |
0.1 | 1.5 | GO:0048536 | spleen development(GO:0048536) |
0.1 | 1.7 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.1 | 0.6 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.1 | 0.2 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
0.1 | 0.2 | GO:0035655 | interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
0.1 | 0.3 | GO:0015881 | creatine transport(GO:0015881) |
0.1 | 0.4 | GO:0018377 | protein myristoylation(GO:0018377) |
0.1 | 0.4 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.1 | GO:0002407 | dendritic cell chemotaxis(GO:0002407) |
0.1 | 5.3 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.4 | GO:0072010 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
0.1 | 0.2 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.6 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.5 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.1 | 2.9 | GO:0050728 | negative regulation of inflammatory response(GO:0050728) |
0.1 | 0.6 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.1 | 0.2 | GO:0072087 | renal vesicle development(GO:0072087) |
0.1 | 1.5 | GO:0045576 | mast cell activation(GO:0045576) |
0.1 | 0.7 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
0.1 | 0.4 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
0.1 | 1.2 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.1 | 0.4 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.1 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
0.1 | 0.1 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.1 | 0.8 | GO:0015879 | carnitine transport(GO:0015879) |
0.1 | 0.7 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.1 | 0.3 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.1 | 1.4 | GO:0045026 | plasma membrane fusion(GO:0045026) |
0.1 | 1.2 | GO:0002690 | positive regulation of leukocyte chemotaxis(GO:0002690) |
0.1 | 0.1 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
0.1 | 2.1 | GO:1901184 | regulation of ERBB signaling pathway(GO:1901184) |
0.1 | 1.1 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.5 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.1 | 1.2 | GO:0034446 | substrate adhesion-dependent cell spreading(GO:0034446) |
0.1 | 0.2 | GO:0061009 | common bile duct development(GO:0061009) |
0.1 | 0.4 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
0.1 | 0.5 | GO:0046102 | inosine metabolic process(GO:0046102) inosine biosynthetic process(GO:0046103) |
0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.2 | GO:0045655 | regulation of monocyte differentiation(GO:0045655) |
0.1 | 0.8 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.1 | 1.6 | GO:0051225 | spindle assembly(GO:0051225) |
0.1 | 0.2 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.1 | 0.3 | GO:0097503 | sialylation(GO:0097503) |
0.1 | 0.4 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
0.1 | 1.0 | GO:0099612 | protein localization to axon(GO:0099612) |
0.1 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.1 | 0.6 | GO:0038203 | TORC2 signaling(GO:0038203) |
0.1 | 0.9 | GO:0032925 | regulation of activin receptor signaling pathway(GO:0032925) |
0.1 | 0.5 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
0.1 | 0.5 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.1 | 0.7 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.4 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.1 | 0.3 | GO:1990035 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
0.1 | 0.2 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.1 | 0.3 | GO:0055075 | potassium ion homeostasis(GO:0055075) |
0.1 | 0.2 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 0.4 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
0.1 | 0.1 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.1 | 0.6 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.2 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.1 | 0.6 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.3 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
0.1 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
0.1 | 0.1 | GO:0050904 | diapedesis(GO:0050904) |
0.1 | 0.2 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.1 | 1.7 | GO:0030166 | proteoglycan biosynthetic process(GO:0030166) |
0.1 | 0.2 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.1 | 0.4 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.1 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 2.8 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 0.6 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.3 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.0 | 0.0 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.1 | GO:0042697 | menopause(GO:0042697) |
0.0 | 0.9 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.0 | 0.2 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.1 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.0 | 0.1 | GO:0002223 | stimulatory C-type lectin receptor signaling pathway(GO:0002223) |
0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.0 | 0.0 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.0 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 1.1 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.4 | GO:0046688 | response to copper ion(GO:0046688) |
0.0 | 0.0 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.1 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.0 | 0.0 | GO:0032240 | regulation of nucleobase-containing compound transport(GO:0032239) negative regulation of nucleobase-containing compound transport(GO:0032240) regulation of RNA export from nucleus(GO:0046831) negative regulation of RNA export from nucleus(GO:0046832) |
0.0 | 0.3 | GO:1901985 | positive regulation of protein acetylation(GO:1901985) |
0.0 | 0.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.1 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.0 | GO:0048793 | pronephros development(GO:0048793) |
0.0 | 0.1 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.2 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
0.0 | 0.4 | GO:0046596 | regulation of viral entry into host cell(GO:0046596) |
0.0 | 0.0 | GO:0060368 | regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.3 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.0 | 0.1 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
0.0 | 0.2 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.1 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.0 | 0.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.1 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
0.0 | 0.1 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
0.0 | 0.0 | GO:0000239 | pachytene(GO:0000239) |
0.0 | 0.2 | GO:0030042 | actin filament depolymerization(GO:0030042) |
0.0 | 0.0 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
0.0 | 0.0 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.0 | 0.0 | GO:2000273 | positive regulation of receptor activity(GO:2000273) |
0.0 | 0.2 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.1 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.0 | 0.0 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
0.0 | 0.1 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
0.0 | 0.0 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.6 | GO:0032091 | negative regulation of protein binding(GO:0032091) |
0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.0 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.0 | 0.1 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.0 | GO:0097421 | liver regeneration(GO:0097421) |
0.0 | 0.0 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
0.0 | 0.1 | GO:0002716 | negative regulation of natural killer cell mediated immunity(GO:0002716) |
0.0 | 0.1 | GO:0002418 | immune response to tumor cell(GO:0002418) |
0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.1 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
0.0 | 0.1 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
12.8 | 12.8 | GO:0034706 | sodium channel complex(GO:0034706) |
4.3 | 17.4 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
4.2 | 12.5 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
3.8 | 15.3 | GO:0044279 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
2.9 | 11.6 | GO:0070442 | integrin alphaIIb-beta3 complex(GO:0070442) |
2.7 | 13.7 | GO:0031523 | Myb complex(GO:0031523) |
2.6 | 2.6 | GO:1902737 | dendritic filopodium(GO:1902737) |
2.5 | 10.0 | GO:0014802 | terminal cisterna(GO:0014802) |
2.5 | 39.2 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
2.4 | 7.3 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
2.4 | 7.2 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
2.4 | 19.2 | GO:0005833 | hemoglobin complex(GO:0005833) |
2.3 | 13.7 | GO:0032133 | chromosome passenger complex(GO:0032133) |
2.2 | 6.6 | GO:0033186 | CAF-1 complex(GO:0033186) |
2.1 | 8.5 | GO:0032280 | symmetric synapse(GO:0032280) |
2.1 | 35.3 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
2.1 | 8.3 | GO:0005594 | collagen type IX trimer(GO:0005594) |
2.0 | 6.0 | GO:0000799 | nuclear condensin complex(GO:0000799) |
2.0 | 6.0 | GO:0005588 | collagen type V trimer(GO:0005588) |
2.0 | 7.8 | GO:0043511 | inhibin complex(GO:0043511) |
1.9 | 13.3 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
1.9 | 7.5 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
1.8 | 7.2 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
1.8 | 32.4 | GO:0005861 | troponin complex(GO:0005861) |
1.8 | 8.8 | GO:1990769 | proximal neuron projection(GO:1990769) |
1.8 | 7.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
1.7 | 7.0 | GO:0043259 | laminin-10 complex(GO:0043259) |
1.7 | 5.0 | GO:0005584 | collagen type I trimer(GO:0005584) |
1.7 | 16.5 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
1.6 | 4.8 | GO:0044302 | dentate gyrus mossy fiber(GO:0044302) |
1.6 | 1.6 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
1.6 | 9.4 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
1.5 | 10.6 | GO:0019815 | B cell receptor complex(GO:0019815) |
1.5 | 6.0 | GO:0045160 | myosin I complex(GO:0045160) |
1.5 | 30.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
1.5 | 4.5 | GO:1990257 | piccolo-bassoon transport vesicle(GO:1990257) |
1.5 | 19.4 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
1.5 | 5.9 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
1.5 | 4.4 | GO:0005940 | septin ring(GO:0005940) |
1.4 | 5.6 | GO:0099522 | region of cytosol(GO:0099522) postsynaptic cytosol(GO:0099524) |
1.4 | 4.1 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
1.3 | 9.1 | GO:0000796 | condensin complex(GO:0000796) |
1.3 | 11.7 | GO:0042581 | specific granule(GO:0042581) |
1.3 | 11.7 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
1.3 | 9.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
1.3 | 19.3 | GO:0042555 | MCM complex(GO:0042555) |
1.3 | 2.5 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
1.3 | 32.8 | GO:0005859 | muscle myosin complex(GO:0005859) |
1.2 | 6.2 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
1.2 | 11.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
1.2 | 2.5 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
1.2 | 6.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
1.2 | 3.7 | GO:0033269 | internode region of axon(GO:0033269) |
1.2 | 3.6 | GO:0030312 | external encapsulating structure(GO:0030312) |
1.2 | 7.2 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
1.2 | 6.0 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
1.2 | 7.2 | GO:0000235 | astral microtubule(GO:0000235) |
1.2 | 5.9 | GO:0071914 | prominosome(GO:0071914) |
1.2 | 26.7 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
1.2 | 5.8 | GO:0032585 | multivesicular body membrane(GO:0032585) |
1.1 | 4.6 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
1.1 | 4.6 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
1.1 | 18.9 | GO:0019814 | immunoglobulin complex(GO:0019814) |
1.1 | 14.4 | GO:0044327 | dendritic spine head(GO:0044327) |
1.1 | 1.1 | GO:1990812 | growth cone filopodium(GO:1990812) |
1.1 | 7.4 | GO:0032590 | dendrite membrane(GO:0032590) |
1.0 | 5.2 | GO:0042583 | chromaffin granule(GO:0042583) |
1.0 | 9.2 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
1.0 | 9.2 | GO:0005577 | fibrinogen complex(GO:0005577) |
1.0 | 3.1 | GO:0036125 | mitochondrial fatty acid beta-oxidation multienzyme complex(GO:0016507) fatty acid beta-oxidation multienzyme complex(GO:0036125) |
1.0 | 1.0 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
1.0 | 3.0 | GO:0032127 | dense core granule membrane(GO:0032127) |
1.0 | 7.1 | GO:0001740 | Barr body(GO:0001740) |
1.0 | 2.0 | GO:0097470 | ribbon synapse(GO:0097470) |
1.0 | 3.0 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
1.0 | 7.0 | GO:0005638 | lamin filament(GO:0005638) |
1.0 | 11.0 | GO:0005688 | U6 snRNP(GO:0005688) |
1.0 | 1.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
1.0 | 5.0 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.9 | 3.8 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.9 | 3.8 | GO:0060187 | cell pole(GO:0060187) |
0.9 | 2.8 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
0.9 | 3.7 | GO:0044194 | cytolytic granule(GO:0044194) |
0.9 | 4.6 | GO:0044301 | climbing fiber(GO:0044301) |
0.9 | 15.0 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.9 | 3.4 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.9 | 13.6 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.8 | 5.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.8 | 2.5 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.8 | 2.5 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.8 | 3.4 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
0.8 | 1.7 | GO:0071953 | elastic fiber(GO:0071953) |
0.8 | 9.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.8 | 4.9 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.8 | 4.1 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.8 | 4.0 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.8 | 2.4 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.8 | 8.7 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.8 | 2.4 | GO:0072534 | perineuronal net(GO:0072534) |
0.8 | 40.1 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.8 | 2.3 | GO:1990423 | RZZ complex(GO:1990423) |
0.8 | 4.7 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.8 | 8.4 | GO:0070938 | contractile ring(GO:0070938) |
0.8 | 22.1 | GO:0001891 | phagocytic cup(GO:0001891) |
0.8 | 7.6 | GO:0034709 | methylosome(GO:0034709) |
0.7 | 11.2 | GO:0036157 | outer dynein arm(GO:0036157) |
0.7 | 4.4 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.7 | 5.9 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.7 | 5.2 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.7 | 7.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.7 | 19.9 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.7 | 4.4 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
0.7 | 2.2 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.7 | 13.9 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.7 | 0.7 | GO:0032010 | phagolysosome(GO:0032010) |
0.7 | 5.1 | GO:0005652 | nuclear lamina(GO:0005652) |
0.7 | 11.6 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.7 | 3.6 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.7 | 56.7 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.7 | 0.7 | GO:0005683 | U7 snRNP(GO:0005683) |
0.7 | 12.7 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.7 | 1.4 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.7 | 6.9 | GO:0001739 | sex chromatin(GO:0001739) |
0.7 | 3.5 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.7 | 5.4 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.7 | 0.7 | GO:0044393 | microspike(GO:0044393) |
0.7 | 4.6 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.7 | 3.9 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.7 | 3.9 | GO:0097443 | sorting endosome(GO:0097443) |
0.6 | 5.8 | GO:0008278 | cohesin complex(GO:0008278) |
0.6 | 7.7 | GO:0043083 | synaptic cleft(GO:0043083) |
0.6 | 5.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.6 | 3.8 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.6 | 5.0 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.6 | 3.7 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.6 | 2.5 | GO:0098888 | extrinsic component of presynaptic membrane(GO:0098888) |
0.6 | 6.7 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.6 | 3.0 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.6 | 4.7 | GO:0042382 | paraspeckles(GO:0042382) |
0.6 | 3.5 | GO:1990393 | 3M complex(GO:1990393) |
0.6 | 20.0 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.6 | 1.8 | GO:0042642 | actomyosin, myosin complex part(GO:0042642) |
0.6 | 6.4 | GO:0031045 | dense core granule(GO:0031045) |
0.6 | 1.7 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
0.6 | 12.7 | GO:0042588 | zymogen granule(GO:0042588) |
0.6 | 3.5 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.6 | 0.6 | GO:0042585 | germinal vesicle(GO:0042585) |
0.6 | 0.6 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.6 | 7.9 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.6 | 27.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.6 | 6.7 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.6 | 5.0 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.6 | 1.7 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.6 | 5.0 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.6 | 3.3 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.5 | 3.8 | GO:0042629 | mast cell granule(GO:0042629) |
0.5 | 0.5 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.5 | 11.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.5 | 5.4 | GO:0071439 | clathrin complex(GO:0071439) |
0.5 | 11.8 | GO:0005614 | interstitial matrix(GO:0005614) |
0.5 | 9.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.5 | 1.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.5 | 4.7 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.5 | 3.6 | GO:0098574 | cytoplasmic side of lysosomal membrane(GO:0098574) |
0.5 | 22.2 | GO:0015030 | Cajal body(GO:0015030) |
0.5 | 2.1 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.5 | 0.5 | GO:0005607 | laminin-2 complex(GO:0005607) |
0.5 | 5.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.5 | 30.4 | GO:0005844 | polysome(GO:0005844) |
0.5 | 2.0 | GO:0005687 | U4 snRNP(GO:0005687) |
0.5 | 3.0 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.5 | 4.0 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.5 | 12.8 | GO:0005876 | spindle microtubule(GO:0005876) |
0.5 | 2.0 | GO:0035976 | AP1 complex(GO:0035976) |
0.5 | 1.0 | GO:0005818 | aster(GO:0005818) |
0.5 | 14.8 | GO:0002102 | podosome(GO:0002102) |
0.5 | 4.8 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.5 | 2.9 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.5 | 1.8 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.5 | 0.9 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.5 | 4.6 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.5 | 5.0 | GO:0032584 | growth cone membrane(GO:0032584) |
0.5 | 3.6 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.4 | 2.2 | GO:0071797 | LUBAC complex(GO:0071797) |
0.4 | 25.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.4 | 1.8 | GO:0032021 | NELF complex(GO:0032021) |
0.4 | 1.8 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.4 | 1.8 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.4 | 6.7 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.4 | 2.2 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.4 | 4.0 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.4 | 1.3 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
0.4 | 12.7 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.4 | 6.9 | GO:0051233 | spindle midzone(GO:0051233) |
0.4 | 6.5 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.4 | 3.9 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.4 | 2.6 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.4 | 13.3 | GO:0008305 | integrin complex(GO:0008305) |
0.4 | 3.8 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.4 | 0.8 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.4 | 1.2 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
0.4 | 1.6 | GO:0005914 | spot adherens junction(GO:0005914) |
0.4 | 6.1 | GO:0000974 | Prp19 complex(GO:0000974) |
0.4 | 10.0 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.4 | 0.8 | GO:1990037 | Lewy body core(GO:1990037) |
0.4 | 2.4 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.4 | 4.7 | GO:0031527 | filopodium membrane(GO:0031527) |
0.4 | 5.9 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.4 | 45.9 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.4 | 1.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.4 | 0.8 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.4 | 5.8 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.4 | 3.1 | GO:0099634 | postsynaptic specialization membrane(GO:0099634) |
0.4 | 6.2 | GO:0031143 | pseudopodium(GO:0031143) |
0.4 | 2.3 | GO:0071547 | piP-body(GO:0071547) |
0.4 | 1.5 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.4 | 3.4 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.4 | 2.7 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.4 | 0.4 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.4 | 1.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.4 | 20.8 | GO:0072686 | mitotic spindle(GO:0072686) |
0.4 | 5.1 | GO:0005682 | U5 snRNP(GO:0005682) |
0.4 | 4.3 | GO:0005686 | U2 snRNP(GO:0005686) |
0.4 | 3.6 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.4 | 1.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.4 | 1.4 | GO:0090543 | Flemming body(GO:0090543) |
0.4 | 1.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.4 | 5.6 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.4 | 2.8 | GO:0097433 | dense body(GO:0097433) |
0.3 | 1.7 | GO:0030689 | Noc complex(GO:0030689) |
0.3 | 0.7 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.3 | 3.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.3 | 4.8 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.3 | 5.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.3 | 2.7 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.3 | 6.4 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.3 | 12.6 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.3 | 26.5 | GO:0005581 | collagen trimer(GO:0005581) |
0.3 | 1.0 | GO:0030870 | Mre11 complex(GO:0030870) |
0.3 | 3.6 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.3 | 2.6 | GO:0005642 | annulate lamellae(GO:0005642) |
0.3 | 7.8 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.3 | 1.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.3 | 7.4 | GO:0097228 | sperm principal piece(GO:0097228) |
0.3 | 6.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.3 | 2.5 | GO:0072687 | meiotic spindle(GO:0072687) |
0.3 | 15.1 | GO:0005871 | kinesin complex(GO:0005871) |
0.3 | 1.6 | GO:0036396 | MIS complex(GO:0036396) |
0.3 | 2.8 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.3 | 0.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.3 | 0.9 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
0.3 | 2.8 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.3 | 0.9 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.3 | 3.7 | GO:0097542 | ciliary tip(GO:0097542) |
0.3 | 1.8 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.3 | 42.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.3 | 4.8 | GO:0030914 | STAGA complex(GO:0030914) |
0.3 | 0.9 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
0.3 | 2.1 | GO:0070652 | HAUS complex(GO:0070652) |
0.3 | 16.5 | GO:0005657 | replication fork(GO:0005657) |
0.3 | 0.6 | GO:0043219 | lateral loop(GO:0043219) |
0.3 | 1.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.3 | 75.7 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.3 | 2.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.3 | 4.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.3 | 0.3 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.3 | 0.3 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.3 | 2.3 | GO:0043194 | axon initial segment(GO:0043194) |
0.3 | 3.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.3 | 0.9 | GO:0031251 | PAN complex(GO:0031251) |
0.3 | 0.8 | GO:0098845 | postsynaptic endosome(GO:0098845) |
0.3 | 1.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.3 | 0.6 | GO:0044299 | C-fiber(GO:0044299) |
0.3 | 0.6 | GO:0001939 | female pronucleus(GO:0001939) male pronucleus(GO:0001940) |
0.3 | 4.7 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.3 | 0.8 | GO:0098855 | HCN channel complex(GO:0098855) |
0.3 | 2.4 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.3 | 8.9 | GO:0031672 | A band(GO:0031672) |
0.3 | 1.8 | GO:0043073 | germ cell nucleus(GO:0043073) |
0.3 | 1.3 | GO:0005883 | neurofilament(GO:0005883) |
0.3 | 0.5 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
0.3 | 0.8 | GO:0032783 | ELL-EAF complex(GO:0032783) |
0.3 | 1.8 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.3 | 23.8 | GO:0043195 | terminal bouton(GO:0043195) |
0.3 | 1.0 | GO:0032982 | myosin filament(GO:0032982) |
0.2 | 0.7 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
0.2 | 0.7 | GO:0048179 | activin receptor complex(GO:0048179) |
0.2 | 0.7 | GO:1990047 | spindle matrix(GO:1990047) |
0.2 | 1.0 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.2 | 4.8 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.2 | 5.9 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.2 | 5.7 | GO:0001741 | XY body(GO:0001741) |
0.2 | 1.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.2 | 1.6 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.2 | 0.9 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.2 | 1.2 | GO:0031310 | integral component of vacuolar membrane(GO:0031166) intrinsic component of vacuolar membrane(GO:0031310) |
0.2 | 1.6 | GO:0016580 | Sin3 complex(GO:0016580) |
0.2 | 3.7 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.2 | 1.1 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.2 | 6.1 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.2 | 7.0 | GO:0005921 | gap junction(GO:0005921) |
0.2 | 0.7 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.2 | 0.9 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.2 | 0.7 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
0.2 | 2.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.2 | 6.7 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.2 | 3.0 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.2 | 1.1 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.2 | 0.9 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.2 | 1.5 | GO:0097255 | R2TP complex(GO:0097255) |
0.2 | 0.8 | GO:0000221 | vacuolar proton-transporting V-type ATPase, V1 domain(GO:0000221) |
0.2 | 0.2 | GO:1990696 | USH2 complex(GO:1990696) |
0.2 | 1.3 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.2 | 0.8 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.2 | 1.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.2 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.2 | 275.3 | GO:0005615 | extracellular space(GO:0005615) |
0.2 | 3.7 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.2 | 2.0 | GO:0000801 | central element(GO:0000801) |
0.2 | 3.9 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.2 | 6.7 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.2 | 2.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.2 | 0.2 | GO:0042827 | platelet dense granule(GO:0042827) |
0.2 | 3.1 | GO:0032426 | stereocilium tip(GO:0032426) |
0.2 | 1.4 | GO:0043218 | compact myelin(GO:0043218) |
0.2 | 0.8 | GO:0097444 | spine apparatus(GO:0097444) |
0.2 | 3.2 | GO:0000145 | exocyst(GO:0000145) |
0.2 | 0.6 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
0.2 | 0.9 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.2 | 1.5 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.2 | 1.3 | GO:0016600 | flotillin complex(GO:0016600) |
0.2 | 0.5 | GO:0042599 | lamellar body(GO:0042599) |
0.2 | 16.2 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.2 | 1.4 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.2 | 6.4 | GO:0031526 | brush border membrane(GO:0031526) |
0.2 | 0.9 | GO:1990745 | EARP complex(GO:1990745) |
0.2 | 0.7 | GO:0035841 | growing cell tip(GO:0035838) new growing cell tip(GO:0035841) |
0.2 | 1.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.2 | 12.8 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.2 | 0.3 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
0.2 | 4.2 | GO:0090544 | BAF-type complex(GO:0090544) |
0.2 | 1.5 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
0.2 | 1.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.2 | 10.5 | GO:0016363 | nuclear matrix(GO:0016363) |
0.2 | 0.7 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
0.2 | 0.3 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.2 | 2.5 | GO:0036038 | MKS complex(GO:0036038) |
0.2 | 0.6 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.2 | 0.5 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.2 | 0.3 | GO:0099569 | presynaptic cytoskeleton(GO:0099569) |
0.2 | 3.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.2 | 2.0 | GO:0033202 | DNA helicase complex(GO:0033202) |
0.2 | 0.5 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.4 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
0.1 | 0.1 | GO:0097361 | CIA complex(GO:0097361) |
0.1 | 0.6 | GO:0005745 | m-AAA complex(GO:0005745) |
0.1 | 8.4 | GO:0036126 | sperm flagellum(GO:0036126) |
0.1 | 0.6 | GO:0008623 | CHRAC(GO:0008623) |
0.1 | 0.5 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.1 | 1.1 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.1 | 1.1 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 3.6 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 0.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 0.1 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
0.1 | 2.9 | GO:0030990 | intraciliary transport particle(GO:0030990) |
0.1 | 12.0 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.1 | 15.2 | GO:0032993 | protein-DNA complex(GO:0032993) |
0.1 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 6.2 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.1 | 0.7 | GO:0051286 | cell tip(GO:0051286) |
0.1 | 0.8 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 1.6 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 120.1 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
0.1 | 1.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 3.7 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 1.2 | GO:0034703 | cation channel complex(GO:0034703) |
0.1 | 5.1 | GO:0044306 | neuron projection terminus(GO:0044306) |
0.1 | 1.3 | GO:0031082 | BLOC complex(GO:0031082) |
0.1 | 0.6 | GO:0034719 | SMN complex(GO:0032797) SMN-Sm protein complex(GO:0034719) |
0.1 | 0.5 | GO:0034448 | EGO complex(GO:0034448) |
0.1 | 0.7 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.4 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.1 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 8.1 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.1 | 2.6 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.1 | 8.0 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.1 | 0.8 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 1.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 1.6 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.1 | 3.9 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.1 | 0.5 | GO:0045120 | pronucleus(GO:0045120) |
0.1 | 0.7 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 24.7 | GO:0005667 | transcription factor complex(GO:0005667) |
0.1 | 1.0 | GO:0097546 | ciliary base(GO:0097546) |
0.1 | 0.1 | GO:0035101 | FACT complex(GO:0035101) |
0.1 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.4 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.5 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.8 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 2.4 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.3 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.8 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.0 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 2.2 | GO:0005882 | intermediate filament(GO:0005882) |
0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.0 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 2.2 | GO:0005819 | spindle(GO:0005819) |
0.0 | 0.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.6 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.0 | 0.9 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.0 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
0.0 | 0.7 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.4 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.0 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.1 | GO:0042825 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
6.0 | 23.8 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
4.7 | 4.7 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
4.7 | 23.6 | GO:0070051 | fibrinogen binding(GO:0070051) |
4.2 | 16.7 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
4.1 | 12.4 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
3.9 | 11.8 | GO:0033680 | ATP-dependent DNA/RNA helicase activity(GO:0033680) |
3.7 | 11.1 | GO:0004051 | arachidonate 5-lipoxygenase activity(GO:0004051) |
3.5 | 10.5 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
3.2 | 9.5 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
3.0 | 11.9 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
3.0 | 11.9 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
2.7 | 8.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
2.5 | 17.8 | GO:0008481 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
2.5 | 10.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
2.5 | 7.5 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
2.5 | 7.5 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
2.5 | 34.3 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
2.4 | 7.3 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
2.4 | 9.6 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
2.4 | 4.8 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
2.4 | 19.1 | GO:0050786 | RAGE receptor binding(GO:0050786) |
2.3 | 6.8 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
2.3 | 49.5 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
2.2 | 21.9 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
2.2 | 8.6 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
2.1 | 8.5 | GO:0031720 | haptoglobin binding(GO:0031720) |
2.1 | 16.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
2.1 | 8.2 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
2.0 | 6.0 | GO:0030116 | glial cell-derived neurotrophic factor receptor binding(GO:0030116) |
2.0 | 11.8 | GO:0015265 | urea channel activity(GO:0015265) |
1.9 | 23.2 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
1.9 | 16.7 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
1.9 | 70.3 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
1.8 | 9.2 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
1.8 | 5.5 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
1.8 | 9.0 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
1.8 | 5.4 | GO:0004373 | glycogen (starch) synthase activity(GO:0004373) |
1.8 | 7.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
1.7 | 5.2 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
1.7 | 8.6 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
1.7 | 10.3 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
1.7 | 13.7 | GO:0048495 | Roundabout binding(GO:0048495) |
1.7 | 8.5 | GO:0016416 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
1.7 | 5.0 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
1.7 | 1.7 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
1.6 | 6.5 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
1.6 | 3.3 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
1.6 | 24.4 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
1.6 | 19.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
1.6 | 14.3 | GO:0034711 | inhibin binding(GO:0034711) |
1.6 | 23.7 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
1.6 | 4.7 | GO:0004461 | lactose synthase activity(GO:0004461) |
1.6 | 9.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
1.6 | 6.2 | GO:0004104 | cholinesterase activity(GO:0004104) |
1.6 | 31.1 | GO:0005523 | tropomyosin binding(GO:0005523) |
1.5 | 9.3 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
1.5 | 6.2 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
1.5 | 7.7 | GO:0043515 | kinetochore binding(GO:0043515) |
1.5 | 13.8 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
1.5 | 9.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
1.5 | 7.5 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
1.5 | 6.0 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
1.5 | 4.5 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
1.5 | 5.8 | GO:1902379 | chemoattractant activity involved in axon guidance(GO:1902379) |
1.4 | 7.2 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
1.4 | 5.7 | GO:0015057 | thrombin receptor activity(GO:0015057) |
1.4 | 5.6 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
1.4 | 12.7 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
1.4 | 4.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
1.3 | 9.4 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
1.3 | 4.0 | GO:0005151 | interleukin-1, Type II receptor binding(GO:0005151) interleukin-1 Type I receptor antagonist activity(GO:0045352) interleukin-1 Type II receptor antagonist activity(GO:0045353) |
1.3 | 6.7 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
1.3 | 7.8 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
1.3 | 3.9 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
1.3 | 6.4 | GO:0030621 | U4 snRNA binding(GO:0030621) |
1.3 | 9.0 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
1.3 | 10.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
1.3 | 19.1 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
1.3 | 8.9 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
1.3 | 5.0 | GO:0031762 | alpha-1A adrenergic receptor binding(GO:0031691) alpha-1B adrenergic receptor binding(GO:0031692) follicle-stimulating hormone receptor binding(GO:0031762) |
1.3 | 25.1 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
1.2 | 5.0 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
1.2 | 6.2 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
1.2 | 25.9 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
1.2 | 9.9 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
1.2 | 8.5 | GO:0005499 | vitamin D binding(GO:0005499) |
1.2 | 3.6 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
1.2 | 7.2 | GO:0097643 | amylin receptor activity(GO:0097643) |
1.2 | 6.0 | GO:0042610 | CD8 receptor binding(GO:0042610) |
1.2 | 4.7 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
1.2 | 5.8 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
1.2 | 4.6 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
1.2 | 3.5 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
1.1 | 3.4 | GO:0070401 | NADP+ binding(GO:0070401) |
1.1 | 5.6 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
1.1 | 10.0 | GO:0033691 | sialic acid binding(GO:0033691) |
1.1 | 15.6 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
1.1 | 5.6 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
1.1 | 4.4 | GO:0003883 | CTP synthase activity(GO:0003883) |
1.1 | 7.8 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
1.1 | 13.2 | GO:0031628 | opioid receptor binding(GO:0031628) |
1.1 | 1.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
1.1 | 4.4 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
1.1 | 3.3 | GO:0070737 | protein-glycine ligase activity, elongating(GO:0070737) |
1.0 | 6.3 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
1.0 | 4.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
1.0 | 6.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
1.0 | 4.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
1.0 | 1.0 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
1.0 | 4.1 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
1.0 | 3.1 | GO:0052596 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
1.0 | 4.1 | GO:0086077 | gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
1.0 | 5.1 | GO:0043532 | angiostatin binding(GO:0043532) |
1.0 | 3.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
1.0 | 3.0 | GO:0097677 | STAT family protein binding(GO:0097677) |
1.0 | 5.0 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
1.0 | 6.0 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
1.0 | 5.9 | GO:0032027 | myosin light chain binding(GO:0032027) |
1.0 | 2.0 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
1.0 | 2.9 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.9 | 1.9 | GO:0048030 | disaccharide binding(GO:0048030) |
0.9 | 5.7 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.9 | 6.5 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.9 | 18.7 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.9 | 4.6 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.9 | 12.9 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.9 | 1.8 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.9 | 12.6 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.9 | 8.1 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.9 | 9.9 | GO:0008199 | ferric iron binding(GO:0008199) |
0.9 | 7.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.9 | 6.3 | GO:0042834 | peptidoglycan binding(GO:0042834) |
0.9 | 3.6 | GO:0004488 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.9 | 5.3 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.9 | 2.7 | GO:0000700 | mismatch base pair DNA N-glycosylase activity(GO:0000700) |
0.9 | 7.9 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.9 | 4.4 | GO:0035240 | dopamine binding(GO:0035240) |
0.9 | 3.5 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
0.9 | 0.9 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
0.9 | 1.8 | GO:0031701 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
0.9 | 7.0 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.9 | 0.9 | GO:0015254 | glycerol channel activity(GO:0015254) |
0.9 | 6.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.9 | 0.9 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.9 | 4.4 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.9 | 6.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.9 | 0.9 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.9 | 40.0 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.9 | 3.5 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.9 | 5.2 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.8 | 8.5 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.8 | 14.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.8 | 5.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.8 | 8.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.8 | 0.8 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.8 | 4.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.8 | 1.6 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) |
0.8 | 4.1 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
0.8 | 23.8 | GO:0001968 | fibronectin binding(GO:0001968) |
0.8 | 9.0 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.8 | 10.6 | GO:0005522 | profilin binding(GO:0005522) |
0.8 | 3.3 | GO:0004937 | alpha-adrenergic receptor activity(GO:0004936) alpha1-adrenergic receptor activity(GO:0004937) |
0.8 | 0.8 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.8 | 4.0 | GO:0051425 | PTB domain binding(GO:0051425) |
0.8 | 2.4 | GO:0035939 | microsatellite binding(GO:0035939) |
0.8 | 8.0 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.8 | 0.8 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
0.8 | 25.6 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.8 | 3.2 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.8 | 5.5 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
0.8 | 3.2 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.8 | 1.6 | GO:0072510 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
0.8 | 17.2 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.8 | 2.3 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.8 | 8.4 | GO:0030506 | ankyrin binding(GO:0030506) |
0.8 | 2.3 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
0.8 | 2.3 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.8 | 6.0 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.8 | 9.0 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.7 | 3.0 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.7 | 5.2 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.7 | 0.7 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
0.7 | 10.4 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.7 | 8.8 | GO:0016918 | retinal binding(GO:0016918) |
0.7 | 4.4 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
0.7 | 2.2 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.7 | 1.5 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.7 | 2.9 | GO:0070976 | TIR domain binding(GO:0070976) |
0.7 | 15.1 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.7 | 6.5 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.7 | 5.7 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
0.7 | 37.0 | GO:0004601 | peroxidase activity(GO:0004601) |
0.7 | 2.1 | GO:0023030 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
0.7 | 5.0 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.7 | 2.8 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.7 | 2.1 | GO:0004500 | dopamine beta-monooxygenase activity(GO:0004500) |
0.7 | 5.6 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.7 | 1.4 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
0.7 | 9.0 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.7 | 0.7 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
0.7 | 2.7 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
0.7 | 2.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.7 | 6.8 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.7 | 7.5 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.7 | 5.4 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.7 | 2.7 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.7 | 5.3 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.7 | 12.7 | GO:0022842 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.7 | 3.3 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
0.7 | 2.0 | GO:0031013 | troponin I binding(GO:0031013) |
0.7 | 2.0 | GO:0047256 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
0.7 | 2.6 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.6 | 1.9 | GO:0016015 | morphogen activity(GO:0016015) |
0.6 | 2.6 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.6 | 26.4 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.6 | 1.9 | GO:0032190 | acrosin binding(GO:0032190) |
0.6 | 15.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.6 | 5.8 | GO:0038191 | neuropilin binding(GO:0038191) |
0.6 | 0.6 | GO:0032135 | DNA insertion or deletion binding(GO:0032135) single base insertion or deletion binding(GO:0032138) |
0.6 | 37.0 | GO:0070888 | E-box binding(GO:0070888) |
0.6 | 7.0 | GO:0051861 | glycolipid binding(GO:0051861) |
0.6 | 5.7 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.6 | 6.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.6 | 7.6 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.6 | 6.9 | GO:0051870 | methotrexate binding(GO:0051870) |
0.6 | 2.5 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.6 | 5.6 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.6 | 1.2 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.6 | 6.2 | GO:0015026 | coreceptor activity(GO:0015026) |
0.6 | 6.2 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.6 | 4.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.6 | 2.5 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
0.6 | 2.5 | GO:0047726 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
0.6 | 1.2 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.6 | 1.8 | GO:0070138 | isopeptidase activity(GO:0070122) ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
0.6 | 1.2 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
0.6 | 4.2 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.6 | 6.6 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.6 | 4.2 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
0.6 | 3.0 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.6 | 1.8 | GO:0001729 | ceramide kinase activity(GO:0001729) |
0.6 | 3.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.6 | 1.8 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.6 | 11.3 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.6 | 1.8 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
0.6 | 1.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.6 | 1.8 | GO:0002113 | interleukin-33 binding(GO:0002113) |
0.6 | 2.4 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.6 | 2.3 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.6 | 5.2 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.6 | 2.3 | GO:2001069 | glycogen binding(GO:2001069) |
0.6 | 7.5 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.6 | 6.3 | GO:0030274 | LIM domain binding(GO:0030274) |
0.6 | 1.7 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
0.6 | 1.7 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.6 | 1.7 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
0.6 | 1.7 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.6 | 1.7 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.6 | 1.7 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.6 | 1.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.6 | 4.4 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.6 | 2.8 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.6 | 5.5 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.6 | 7.7 | GO:0031432 | titin binding(GO:0031432) |
0.5 | 14.3 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) |
0.5 | 1.6 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.5 | 1.6 | GO:0045159 | myosin II binding(GO:0045159) |
0.5 | 2.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.5 | 4.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.5 | 2.2 | GO:0004092 | carnitine O-acetyltransferase activity(GO:0004092) |
0.5 | 2.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.5 | 1.6 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
0.5 | 15.2 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.5 | 2.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.5 | 3.2 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.5 | 1.6 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.5 | 2.1 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.5 | 2.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.5 | 1.6 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.5 | 1.6 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.5 | 17.9 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.5 | 2.6 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.5 | 3.7 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
0.5 | 1.6 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.5 | 2.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.5 | 12.5 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.5 | 2.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.5 | 18.8 | GO:0003785 | actin monomer binding(GO:0003785) |
0.5 | 28.5 | GO:0030507 | spectrin binding(GO:0030507) |
0.5 | 2.0 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.5 | 1.0 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.5 | 4.5 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.5 | 1.5 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.5 | 3.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.5 | 1.5 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.5 | 2.4 | GO:0031014 | troponin T binding(GO:0031014) |
0.5 | 15.0 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.5 | 6.8 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.5 | 5.3 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.5 | 5.8 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.5 | 1.4 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.5 | 4.3 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.5 | 1.4 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.5 | 1.4 | GO:0030629 | U6 snRNA 3'-end binding(GO:0030629) |
0.5 | 2.4 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.5 | 5.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.5 | 2.9 | GO:0017002 | activin receptor activity, type I(GO:0016361) activin-activated receptor activity(GO:0017002) |
0.5 | 3.8 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
0.5 | 1.4 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
0.5 | 1.9 | GO:0033883 | pyridoxal phosphatase activity(GO:0033883) |
0.5 | 5.6 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.5 | 3.7 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.5 | 16.2 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.5 | 0.5 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.5 | 1.8 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.5 | 31.1 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.5 | 1.4 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
0.5 | 14.5 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.5 | 9.0 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.5 | 1.8 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.4 | 5.8 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.4 | 3.6 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.4 | 0.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.4 | 1.8 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.4 | 0.9 | GO:0045340 | mercury ion binding(GO:0045340) |
0.4 | 2.6 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.4 | 2.2 | GO:0001032 | RNA polymerase III type 3 promoter DNA binding(GO:0001032) |
0.4 | 1.3 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
0.4 | 3.5 | GO:0015925 | galactosidase activity(GO:0015925) |
0.4 | 1.3 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.4 | 8.3 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.4 | 1.7 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.4 | 5.2 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.4 | 3.9 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.4 | 2.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.4 | 4.3 | GO:0008527 | taste receptor activity(GO:0008527) |
0.4 | 2.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.4 | 3.0 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.4 | 3.0 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
0.4 | 1.7 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.4 | 2.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.4 | 8.4 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
0.4 | 2.1 | GO:1990188 | euchromatin binding(GO:1990188) |
0.4 | 0.8 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.4 | 3.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.4 | 7.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.4 | 1.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.4 | 1.2 | GO:0035717 | chemokine (C-C motif) ligand 7 binding(GO:0035717) |
0.4 | 7.0 | GO:0031005 | filamin binding(GO:0031005) |
0.4 | 5.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.4 | 0.8 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.4 | 2.8 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.4 | 2.0 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.4 | 2.8 | GO:0043199 | sulfate binding(GO:0043199) |
0.4 | 2.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.4 | 3.2 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.4 | 2.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.4 | 2.4 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.4 | 2.8 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.4 | 78.7 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.4 | 0.4 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.4 | 64.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.4 | 8.6 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.4 | 1.6 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.4 | 2.0 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.4 | 1.2 | GO:0000150 | recombinase activity(GO:0000150) |
0.4 | 3.9 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.4 | 1.9 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.4 | 4.3 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.4 | 4.2 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.4 | 1.5 | GO:0001847 | opsonin receptor activity(GO:0001847) |
0.4 | 2.3 | GO:0044548 | S100 protein binding(GO:0044548) |
0.4 | 1.5 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
0.4 | 1.5 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.4 | 3.0 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
0.4 | 1.5 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.4 | 2.3 | GO:0042731 | PH domain binding(GO:0042731) |
0.4 | 1.5 | GO:0035242 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.4 | 6.7 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.4 | 1.1 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.4 | 1.1 | GO:0004686 | elongation factor-2 kinase activity(GO:0004686) |
0.4 | 2.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.4 | 1.9 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.4 | 11.4 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.4 | 2.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.4 | 2.6 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.4 | 4.8 | GO:0003796 | lysozyme activity(GO:0003796) |
0.4 | 2.2 | GO:0031404 | chloride ion binding(GO:0031404) |
0.4 | 1.1 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.4 | 1.5 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.4 | 2.5 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
0.4 | 1.5 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
0.4 | 1.1 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
0.4 | 2.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.4 | 1.8 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.4 | 1.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.4 | 0.7 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
0.4 | 10.3 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.4 | 8.1 | GO:0008236 | serine-type peptidase activity(GO:0008236) |
0.4 | 1.4 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.3 | 3.8 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.3 | 0.7 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.3 | 1.4 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
0.3 | 2.7 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.3 | 3.7 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.3 | 13.3 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.3 | 7.1 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.3 | 1.7 | GO:1990405 | protein antigen binding(GO:1990405) |
0.3 | 3.7 | GO:0043028 | cysteine-type endopeptidase regulator activity involved in apoptotic process(GO:0043028) |
0.3 | 0.3 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.3 | 1.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.3 | 0.3 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.3 | 10.3 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.3 | 0.3 | GO:0008988 | rRNA (adenine-N6-)-methyltransferase activity(GO:0008988) |
0.3 | 4.3 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.3 | 2.6 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.3 | 2.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.3 | 2.6 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.3 | 1.6 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.3 | 1.3 | GO:0034452 | dynactin binding(GO:0034452) |
0.3 | 1.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.3 | 6.2 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.3 | 6.8 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.3 | 0.6 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
0.3 | 0.6 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.3 | 1.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.3 | 0.3 | GO:0048185 | activin binding(GO:0048185) |
0.3 | 25.4 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.3 | 1.2 | GO:0005124 | scavenger receptor binding(GO:0005124) |
0.3 | 1.5 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.3 | 4.6 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.3 | 1.5 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.3 | 0.9 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
0.3 | 2.7 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.3 | 2.7 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.3 | 8.8 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.3 | 3.0 | GO:0030553 | cGMP binding(GO:0030553) |
0.3 | 0.9 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.3 | 7.1 | GO:0031489 | myosin V binding(GO:0031489) |
0.3 | 6.2 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.3 | 1.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.3 | 0.9 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
0.3 | 1.5 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.3 | 0.6 | GO:0034046 | poly(G) binding(GO:0034046) |
0.3 | 8.7 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.3 | 2.6 | GO:0070840 | dynein complex binding(GO:0070840) |
0.3 | 0.3 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
0.3 | 13.5 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
0.3 | 1.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.3 | 1.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.3 | 1.4 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.3 | 6.2 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.3 | 0.3 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) |
0.3 | 1.1 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
0.3 | 5.0 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.3 | 0.8 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.3 | 6.7 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.3 | 1.9 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.3 | 2.7 | GO:0019956 | chemokine binding(GO:0019956) |
0.3 | 1.6 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.3 | 9.9 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.3 | 0.8 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.3 | 3.0 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.3 | 1.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.3 | 1.4 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
0.3 | 1.4 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.3 | 6.2 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.3 | 0.8 | GO:0032356 | oxidized DNA binding(GO:0032356) |
0.3 | 1.9 | GO:0035197 | siRNA binding(GO:0035197) |
0.3 | 4.0 | GO:0022839 | ion gated channel activity(GO:0022839) |
0.3 | 0.8 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
0.3 | 6.7 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.3 | 1.1 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
0.3 | 0.5 | GO:0030984 | kininogen binding(GO:0030984) |
0.3 | 1.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.3 | 0.5 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.3 | 2.6 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.3 | 2.6 | GO:0003680 | AT DNA binding(GO:0003680) |
0.3 | 0.5 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.3 | 1.5 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
0.3 | 0.5 | GO:0036004 | GAF domain binding(GO:0036004) |
0.3 | 1.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.3 | 5.6 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.3 | 1.8 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.3 | 1.8 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.3 | 12.8 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.3 | 0.3 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.3 | 2.5 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.2 | 0.7 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
0.2 | 1.2 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.2 | 1.2 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.2 | 2.2 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.2 | 5.5 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.2 | 1.7 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.2 | 1.0 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.2 | 2.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.2 | 0.5 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
0.2 | 1.2 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.2 | 1.9 | GO:0031812 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
0.2 | 8.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.2 | 1.7 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.2 | 0.5 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.2 | 12.1 | GO:0005518 | collagen binding(GO:0005518) |
0.2 | 0.5 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.2 | 7.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.2 | 8.0 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.2 | 0.2 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.2 | 0.9 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
0.2 | 16.7 | GO:0005179 | hormone activity(GO:0005179) |
0.2 | 0.7 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.2 | 0.7 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
0.2 | 18.8 | GO:0005178 | integrin binding(GO:0005178) |
0.2 | 0.7 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.2 | 1.6 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.2 | 29.0 | GO:0008083 | growth factor activity(GO:0008083) |
0.2 | 1.4 | GO:0016684 | oxidoreductase activity, acting on peroxide as acceptor(GO:0016684) |
0.2 | 0.7 | GO:0045545 | syndecan binding(GO:0045545) |
0.2 | 0.2 | GO:0000992 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
0.2 | 0.7 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
0.2 | 1.1 | GO:0071253 | connexin binding(GO:0071253) |
0.2 | 42.7 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.2 | 0.4 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.2 | 0.2 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.2 | 1.1 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.2 | 0.4 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.2 | 1.5 | GO:0015099 | nickel cation transmembrane transporter activity(GO:0015099) |
0.2 | 0.4 | GO:0000339 | RNA cap binding(GO:0000339) |
0.2 | 0.2 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.2 | 2.9 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.2 | 1.3 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.2 | 5.2 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.2 | 0.8 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.2 | 1.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.2 | 1.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.2 | 2.3 | GO:0043495 | protein anchor(GO:0043495) |
0.2 | 0.8 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
0.2 | 1.0 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.2 | 2.0 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.2 | 2.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.2 | 1.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.2 | 0.2 | GO:0005119 | smoothened binding(GO:0005119) |
0.2 | 6.9 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.2 | 5.3 | GO:0019843 | rRNA binding(GO:0019843) |
0.2 | 2.5 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
0.2 | 0.4 | GO:0005113 | patched binding(GO:0005113) |
0.2 | 4.1 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.2 | 0.4 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.2 | 3.9 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.2 | 0.6 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.2 | 0.9 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.2 | 0.6 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.2 | 1.3 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.2 | 0.7 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.2 | 0.7 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.2 | 0.9 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.2 | 0.7 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.2 | 1.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.2 | 26.5 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.2 | 1.4 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.2 | 2.7 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.2 | 1.4 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.2 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.2 | 3.6 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.2 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.2 | 1.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.2 | 0.9 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.2 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.2 | 0.5 | GO:1903136 | cuprous ion binding(GO:1903136) |
0.2 | 1.5 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.2 | 2.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.2 | 0.5 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
0.2 | 0.7 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.2 | 1.0 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.2 | 1.5 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.2 | 0.7 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.2 | 0.3 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.2 | 2.4 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.2 | 1.3 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.2 | 2.1 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.2 | 0.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.2 | 6.1 | GO:0019894 | kinesin binding(GO:0019894) |
0.2 | 2.6 | GO:0042805 | actinin binding(GO:0042805) |
0.2 | 0.5 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.2 | 1.4 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.2 | 1.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.2 | 2.0 | GO:0031386 | protein tag(GO:0031386) |
0.2 | 0.5 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.7 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.4 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.1 | 3.2 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.6 | GO:0004802 | transketolase activity(GO:0004802) |
0.1 | 0.4 | GO:0004088 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
0.1 | 1.1 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.1 | 0.4 | GO:0002153 | steroid receptor RNA activator RNA binding(GO:0002153) |
0.1 | 2.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 6.3 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.1 | 1.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 1.2 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 1.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.1 | 0.7 | GO:0005372 | water transmembrane transporter activity(GO:0005372) water channel activity(GO:0015250) |
0.1 | 0.4 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
0.1 | 0.4 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.1 | 0.7 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.1 | 0.9 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.1 | 0.6 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.9 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 2.4 | GO:0070628 | proteasome binding(GO:0070628) |
0.1 | 0.4 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 3.9 | GO:0005109 | frizzled binding(GO:0005109) |
0.1 | 0.7 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 1.4 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 0.9 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.1 | 0.8 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.5 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 4.6 | GO:0030551 | cyclic nucleotide binding(GO:0030551) |
0.1 | 1.5 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.1 | 1.3 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
0.1 | 1.0 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
0.1 | 1.8 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.1 | 10.0 | GO:0016247 | channel regulator activity(GO:0016247) |
0.1 | 0.2 | GO:1990955 | G-rich single-stranded DNA binding(GO:1990955) |
0.1 | 0.5 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.1 | 0.3 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 1.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.5 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 11.3 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
0.1 | 0.6 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
0.1 | 1.2 | GO:0001618 | virus receptor activity(GO:0001618) |
0.1 | 4.6 | GO:0016279 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
0.1 | 3.0 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.5 | GO:0019864 | IgG binding(GO:0019864) |
0.1 | 0.3 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
0.1 | 0.3 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.1 | 0.3 | GO:0004962 | endothelin receptor activity(GO:0004962) |
0.1 | 0.3 | GO:0004335 | galactokinase activity(GO:0004335) |
0.1 | 0.3 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.1 | 2.7 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.6 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.1 | 0.4 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.1 | 0.3 | GO:0003977 | UDP-N-acetylglucosamine diphosphorylase activity(GO:0003977) |
0.1 | 0.9 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 0.3 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.1 | 1.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 2.8 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.1 | 0.5 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
0.1 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.2 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.1 | 0.1 | GO:0001179 | RNA polymerase I transcription factor binding(GO:0001179) |
0.1 | 0.6 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.1 | 1.0 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 0.8 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.5 | GO:0030547 | receptor inhibitor activity(GO:0030547) |
0.1 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.1 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
0.1 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
0.1 | 1.1 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.1 | 36.9 | GO:0005509 | calcium ion binding(GO:0005509) |
0.1 | 0.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 0.2 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
0.1 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 1.5 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.1 | 0.4 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.1 | 0.6 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 0.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.1 | 0.4 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.1 | 5.4 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.1 | 0.5 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 0.4 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 0.1 | GO:1904315 | transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
0.1 | 0.1 | GO:1903763 | gap junction channel activity involved in cell communication by electrical coupling(GO:1903763) |
0.1 | 0.1 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
0.1 | 0.2 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
0.1 | 6.2 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.1 | 0.1 | GO:0046403 | polynucleotide 3'-phosphatase activity(GO:0046403) |
0.1 | 1.0 | GO:0031491 | nucleosome binding(GO:0031491) |
0.1 | 1.9 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.0 | 0.4 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.0 | 0.3 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 1.8 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 1.4 | GO:0005262 | calcium channel activity(GO:0005262) |
0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.1 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.0 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 1.0 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.8 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 1.5 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.0 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 8.0 | GO:0030695 | GTPase regulator activity(GO:0030695) |
0.0 | 0.5 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
0.0 | 0.2 | GO:0042379 | chemokine receptor binding(GO:0042379) |
0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 3.0 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
0.0 | 0.0 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.0 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.0 | GO:0016211 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) |
0.0 | 0.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 3.3 | GO:0015631 | tubulin binding(GO:0015631) |
0.0 | 2.2 | GO:0005125 | cytokine activity(GO:0005125) |
0.0 | 0.1 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.1 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.0 | 0.0 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 1.6 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
1.3 | 55.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
1.2 | 6.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
1.2 | 11.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
1.2 | 19.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
1.2 | 21.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
1.1 | 7.7 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
1.1 | 26.5 | PID S1P S1P1 PATHWAY | S1P1 pathway |
1.0 | 10.8 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.9 | 42.9 | PID AURORA B PATHWAY | Aurora B signaling |
0.8 | 103.5 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.8 | 44.3 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.8 | 11.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.8 | 19.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.7 | 9.6 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.7 | 21.2 | PID AURORA A PATHWAY | Aurora A signaling |
0.7 | 2.9 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.7 | 12.9 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.7 | 12.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.7 | 31.3 | PID ATR PATHWAY | ATR signaling pathway |
0.7 | 7.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.7 | 7.6 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.7 | 14.2 | PID EPO PATHWAY | EPO signaling pathway |
0.7 | 36.4 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.6 | 16.6 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.6 | 15.9 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.6 | 11.5 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.6 | 12.6 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.6 | 10.8 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.6 | 19.2 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.6 | 19.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.6 | 20.5 | NABA COLLAGENS | Genes encoding collagen proteins |
0.6 | 15.8 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.6 | 2.9 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.6 | 10.5 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.5 | 106.4 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.5 | 16.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.5 | 1.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.5 | 10.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.5 | 18.6 | PID PLK1 PATHWAY | PLK1 signaling events |
0.5 | 13.5 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.5 | 12.7 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.5 | 13.5 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.5 | 141.4 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.4 | 4.5 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.4 | 11.5 | PID IGF1 PATHWAY | IGF1 pathway |
0.4 | 20.6 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.4 | 13.9 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.4 | 19.8 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.4 | 72.7 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.4 | 0.4 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.4 | 4.3 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.4 | 5.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.4 | 1.5 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.4 | 0.7 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.4 | 1.4 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.4 | 11.0 | PID RAS PATHWAY | Regulation of Ras family activation |
0.4 | 26.3 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.3 | 29.0 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.3 | 5.6 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.3 | 7.5 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.3 | 3.4 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.3 | 1.7 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.3 | 3.6 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.3 | 76.1 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
0.3 | 5.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.3 | 9.5 | PID BCR 5PATHWAY | BCR signaling pathway |
0.3 | 18.8 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.3 | 3.7 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.3 | 8.3 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.3 | 4.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.3 | 5.7 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.3 | 0.8 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.3 | 7.7 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.3 | 4.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.3 | 4.0 | PID ENDOTHELIN PATHWAY | Endothelins |
0.2 | 0.7 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.2 | 0.5 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.2 | 3.6 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.2 | 3.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.2 | 4.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.2 | 2.5 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.2 | 7.7 | PID BMP PATHWAY | BMP receptor signaling |
0.2 | 9.3 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.2 | 2.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.2 | 6.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.2 | 0.2 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.2 | 0.6 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.2 | 2.0 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.2 | 3.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.2 | 7.8 | NABA MATRISOME | Ensemble of genes encoding extracellular matrix and extracellular matrix-associated proteins |
0.2 | 2.1 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.2 | 1.9 | PID INSULIN PATHWAY | Insulin Pathway |
0.2 | 3.6 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.2 | 1.8 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.2 | 2.2 | PID RHOA PATHWAY | RhoA signaling pathway |
0.2 | 3.4 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.2 | 1.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.1 | 4.2 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.1 | 1.0 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 2.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.1 | 5.6 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 1.8 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 1.3 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 1.9 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.1 | 3.6 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.1 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.7 | PID ARF 3PATHWAY | Arf1 pathway |
0.1 | 1.5 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 1.2 | PID MYC PATHWAY | C-MYC pathway |
0.1 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.1 | 0.8 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.1 | 0.4 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.1 | 1.6 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.1 | 0.1 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.1 | 1.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.1 | 0.4 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 2.8 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 2.4 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.5 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.0 | 0.9 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.0 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 1.9 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.0 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.4 | PID E2F PATHWAY | E2F transcription factor network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.5 | 53.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
2.5 | 37.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
1.7 | 34.3 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
1.5 | 40.7 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
1.4 | 19.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
1.3 | 17.3 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
1.3 | 68.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
1.3 | 8.9 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
1.3 | 17.8 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
1.2 | 54.5 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
1.1 | 22.9 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
1.1 | 3.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
1.1 | 3.3 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
1.1 | 48.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
1.0 | 11.0 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
1.0 | 12.6 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
1.0 | 37.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.9 | 21.6 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.9 | 103.2 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.9 | 2.8 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.9 | 10.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.9 | 24.9 | REACTOME KINESINS | Genes involved in Kinesins |
0.9 | 23.7 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.9 | 7.7 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.8 | 11.0 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.8 | 14.2 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.8 | 7.0 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.8 | 0.8 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.8 | 23.1 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.7 | 7.3 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.7 | 1.4 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
0.7 | 29.3 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.7 | 10.5 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.7 | 2.8 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.7 | 7.5 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.7 | 33.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.7 | 3.4 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.7 | 8.8 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.7 | 13.5 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.6 | 11.6 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.6 | 15.4 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.6 | 25.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.6 | 5.9 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.6 | 7.0 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.6 | 0.6 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
0.6 | 9.3 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.6 | 4.6 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.6 | 9.5 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.6 | 0.6 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.5 | 12.9 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.5 | 49.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.5 | 11.6 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.5 | 12.7 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.5 | 12.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.5 | 8.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.5 | 6.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.5 | 8.4 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.5 | 8.4 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.5 | 38.0 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.5 | 0.5 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.4 | 0.9 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.4 | 11.5 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.4 | 3.1 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.4 | 18.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.4 | 0.9 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.4 | 10.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.4 | 1.7 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.4 | 10.2 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.4 | 22.9 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.4 | 4.6 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.4 | 9.2 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.4 | 17.8 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.4 | 1.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.4 | 1.6 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.4 | 29.1 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.4 | 12.5 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.4 | 1.2 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
0.4 | 1.5 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.4 | 16.7 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.4 | 20.3 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.4 | 0.8 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.4 | 57.3 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.4 | 4.1 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.4 | 11.3 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.4 | 4.6 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.3 | 0.7 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.3 | 3.0 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.3 | 18.1 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.3 | 4.0 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.3 | 3.7 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.3 | 7.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.3 | 6.9 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.3 | 8.7 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.3 | 1.9 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.3 | 1.9 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.3 | 8.1 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.3 | 5.0 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.3 | 1.2 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.3 | 14.1 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.3 | 0.6 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.3 | 27.4 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.3 | 4.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.3 | 0.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.3 | 6.8 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.3 | 3.1 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.3 | 5.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.3 | 7.6 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.3 | 5.8 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.3 | 4.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.3 | 2.9 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.3 | 3.6 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.3 | 3.9 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.3 | 5.1 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.2 | 10.2 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.2 | 3.5 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.2 | 20.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.2 | 1.5 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.2 | 3.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.2 | 2.8 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.2 | 4.1 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.2 | 8.9 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.2 | 14.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.2 | 8.7 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.2 | 3.5 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.2 | 5.6 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
0.2 | 1.2 | REACTOME DEFENSINS | Genes involved in Defensins |
0.2 | 4.9 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.2 | 11.0 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
0.2 | 2.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.2 | 11.8 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.2 | 2.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.2 | 1.0 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.2 | 2.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.2 | 0.6 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.2 | 0.8 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.2 | 1.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.2 | 1.5 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.2 | 2.1 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.2 | 2.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.2 | 1.7 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
0.2 | 0.9 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.2 | 0.5 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.2 | 1.3 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.2 | 2.5 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.2 | 4.2 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.2 | 1.4 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.2 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.2 | 0.2 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.2 | 1.4 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.1 | 4.7 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.1 | 2.5 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 0.4 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.1 | 4.0 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
0.1 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 0.5 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 1.0 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 2.8 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.1 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.1 | 0.6 | REACTOME TRANSCRIPTION COUPLED NER TC NER | Genes involved in Transcription-coupled NER (TC-NER) |
0.1 | 3.0 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.1 | 3.6 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 2.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.1 | 0.5 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.1 | 1.4 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 9.0 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.1 | 1.6 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 1.5 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.1 | 1.4 | REACTOME MEIOSIS | Genes involved in Meiosis |
0.1 | 3.0 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.1 | 1.3 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.1 | 0.2 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.9 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 0.4 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.1 | 0.1 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |
0.1 | 1.6 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 0.9 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 2.6 | REACTOME DIABETES PATHWAYS | Genes involved in Diabetes pathways |
0.0 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.5 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 1.3 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.2 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.1 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.7 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |