avrg: GSE58827: Dynamics of the Mouse Liver
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Tfap2d
|
ENSMUSG00000042596.7 | transcription factor AP-2, delta |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.1 | GO:0003167 | atrioventricular bundle cell differentiation(GO:0003167) |
0.3 | 1.6 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.2 | 1.1 | GO:0032902 | nerve growth factor production(GO:0032902) |
0.2 | 0.7 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.2 | 1.0 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
0.2 | 0.6 | GO:0048627 | myoblast development(GO:0048627) |
0.2 | 0.8 | GO:0032805 | positive regulation of low-density lipoprotein particle receptor catabolic process(GO:0032805) |
0.2 | 0.9 | GO:0045994 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
0.2 | 1.4 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
0.2 | 0.5 | GO:1904580 | regulation of intracellular mRNA localization(GO:1904580) |
0.2 | 1.5 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.2 | 0.6 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.1 | 0.7 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 0.4 | GO:0060220 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) camera-type eye photoreceptor cell fate commitment(GO:0060220) |
0.1 | 0.6 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 1.0 | GO:0019695 | choline metabolic process(GO:0019695) |
0.1 | 0.5 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.1 | 0.5 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.1 | 0.3 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.1 | 0.8 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 1.2 | GO:0097421 | liver regeneration(GO:0097421) |
0.1 | 0.3 | GO:0015881 | creatine transport(GO:0015881) |
0.1 | 0.3 | GO:0015755 | fructose transport(GO:0015755) |
0.1 | 1.1 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.1 | 0.1 | GO:0007521 | muscle cell fate determination(GO:0007521) |
0.1 | 0.6 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.5 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
0.1 | 0.3 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
0.1 | 0.5 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 1.1 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.1 | 0.4 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.2 | GO:0010705 | meiotic DNA double-strand break processing involved in reciprocal meiotic recombination(GO:0010705) |
0.1 | 0.4 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.1 | 0.3 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
0.1 | 0.3 | GO:0016240 | autophagosome docking(GO:0016240) |
0.1 | 0.1 | GO:0060492 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
0.1 | 0.2 | GO:0021589 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
0.1 | 0.3 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
0.1 | 0.2 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.1 | 0.2 | GO:1901994 | negative regulation of meiotic cell cycle phase transition(GO:1901994) |
0.1 | 0.2 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
0.1 | 0.4 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.1 | 0.5 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.1 | 0.3 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
0.1 | 1.0 | GO:1990403 | embryonic brain development(GO:1990403) |
0.1 | 0.2 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) enzyme active site formation(GO:0018307) |
0.1 | 0.2 | GO:0045645 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
0.1 | 0.2 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) |
0.1 | 0.3 | GO:0060313 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
0.1 | 0.5 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) sensory neuron axon guidance(GO:0097374) |
0.1 | 0.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.1 | 0.2 | GO:0070676 | intralumenal vesicle formation(GO:0070676) negative regulation of early endosome to late endosome transport(GO:2000642) |
0.1 | 0.4 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.0 | 0.1 | GO:0097360 | inhibition of neuroepithelial cell differentiation(GO:0002085) axial mesoderm formation(GO:0048320) chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.0 | 0.2 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.0 | 0.2 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.3 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.0 | 0.6 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.0 | 0.3 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.2 | GO:0032218 | riboflavin transport(GO:0032218) |
0.0 | 0.3 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.0 | 0.1 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
0.0 | 0.2 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.0 | 0.5 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.2 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.2 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
0.0 | 0.1 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
0.0 | 1.3 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.2 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.0 | 0.2 | GO:0002159 | desmosome assembly(GO:0002159) |
0.0 | 0.3 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.0 | 0.1 | GO:0060709 | glycogen cell differentiation involved in embryonic placenta development(GO:0060709) |
0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.4 | GO:0007183 | SMAD protein complex assembly(GO:0007183) |
0.0 | 0.5 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.0 | 0.5 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.0 | GO:1904173 | negative regulation of RNA interference(GO:1900369) regulation of histone demethylase activity (H3-K4 specific)(GO:1904173) |
0.0 | 0.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) tail-anchored membrane protein insertion into ER membrane(GO:0071816) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.0 | 0.1 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.1 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.6 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.2 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
0.0 | 1.0 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.1 | GO:0061188 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
0.0 | 0.4 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.7 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.2 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.0 | 0.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.3 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.7 | GO:0001958 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.0 | 0.7 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.4 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.0 | 0.2 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.0 | 0.6 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.0 | 0.1 | GO:1905161 | protein localization to phagocytic vesicle(GO:1905161) regulation of protein localization to phagocytic vesicle(GO:1905169) positive regulation of protein localization to phagocytic vesicle(GO:1905171) |
0.0 | 0.2 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.3 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 0.1 | GO:1901970 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.0 | 0.5 | GO:0034629 | cellular protein complex localization(GO:0034629) |
0.0 | 0.3 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
0.0 | 0.0 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.0 | 0.6 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.0 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
0.0 | 0.3 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.0 | 0.4 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.2 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.0 | 0.1 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.0 | GO:1904954 | canonical Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904954) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.8 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
0.2 | 0.7 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.2 | 1.1 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.1 | 0.6 | GO:0044194 | cytolytic granule(GO:0044194) |
0.1 | 0.3 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 1.1 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.1 | 0.9 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 0.4 | GO:0072487 | MSL complex(GO:0072487) |
0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.7 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.5 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 0.5 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.2 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.3 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 1.0 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.7 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.3 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.7 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 1.7 | GO:0031901 | early endosome membrane(GO:0031901) |
0.0 | 0.3 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.2 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.0 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.2 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.4 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.2 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.0 | 1.6 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 0.1 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.2 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.6 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.2 | GO:1902710 | GABA receptor complex(GO:1902710) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.6 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.3 | 0.8 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) |
0.2 | 1.0 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.2 | 1.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.2 | 0.7 | GO:0070052 | collagen V binding(GO:0070052) |
0.2 | 0.6 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
0.1 | 2.5 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 0.9 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.1 | 0.4 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.1 | 0.3 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
0.1 | 0.3 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.3 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 1.1 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.1 | 1.6 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.1 | 0.3 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 1.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.2 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
0.1 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 0.4 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 0.7 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.4 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.3 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.9 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.0 | 0.6 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.4 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.2 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.0 | 0.3 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.4 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.0 | 1.0 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) |
0.0 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.4 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.4 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.5 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.0 | 0.6 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.3 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.3 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
0.0 | 0.5 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.7 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.6 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.8 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.3 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.0 | 0.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 1.1 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.2 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.0 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.3 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.3 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.1 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
0.0 | 0.4 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.6 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.4 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.0 | 0.1 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.0 | 0.4 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.6 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.6 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 1.4 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 1.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.6 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 1.2 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.4 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.4 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.1 | 1.0 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 1.3 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 1.4 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 1.1 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.7 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
0.0 | 0.7 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.9 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 0.9 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.8 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.5 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.3 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.2 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.0 | 0.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.0 | 1.0 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.3 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.3 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.0 | 0.5 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 0.4 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |