GSE58827: Dynamics of the Mouse Liver
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Nhlh1
|
ENSMUSG00000051251.3 | nescient helix loop helix 1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Nhlh1 | mm10_v2_chr1_-_172057573_172057598 | -0.21 | 2.3e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr11_+_99864476 | 2.36 |
ENSMUST00000092694.3
|
Gm11559
|
predicted gene 11559 |
| chr15_-_60921270 | 1.42 |
ENSMUST00000096418.3
|
A1bg
|
alpha-1-B glycoprotein |
| chr11_+_99857915 | 1.26 |
ENSMUST00000107434.1
|
Gm11568
|
predicted gene 11568 |
| chr11_-_99851608 | 1.16 |
ENSMUST00000107437.1
|
Krtap4-16
|
keratin associated protein 4-16 |
| chr9_+_54764748 | 1.10 |
ENSMUST00000034830.8
|
Crabp1
|
cellular retinoic acid binding protein I |
| chr2_+_102658640 | 1.07 |
ENSMUST00000080210.3
|
Slc1a2
|
solute carrier family 1 (glial high affinity glutamate transporter), member 2 |
| chr14_-_37048957 | 1.06 |
ENSMUST00000022338.5
|
Rgr
|
retinal G protein coupled receptor |
| chr2_-_172940299 | 1.05 |
ENSMUST00000009143.7
|
Bmp7
|
bone morphogenetic protein 7 |
| chr14_+_56887795 | 1.03 |
ENSMUST00000022511.8
|
Zmym2
|
zinc finger, MYM-type 2 |
| chr8_+_45658666 | 0.99 |
ENSMUST00000134675.1
ENSMUST00000139869.1 ENSMUST00000126067.1 |
Sorbs2
|
sorbin and SH3 domain containing 2 |
| chr19_+_7056731 | 0.94 |
ENSMUST00000040261.5
|
Macrod1
|
MACRO domain containing 1 |
| chr19_-_45560508 | 0.94 |
ENSMUST00000026239.6
|
Poll
|
polymerase (DNA directed), lambda |
| chr4_+_152008803 | 0.93 |
ENSMUST00000097773.3
|
Klhl21
|
kelch-like 21 |
| chr12_-_103457195 | 0.88 |
ENSMUST00000044687.6
|
Ifi27l2b
|
interferon, alpha-inducible protein 27 like 2B |
| chr2_-_181043540 | 0.84 |
ENSMUST00000124400.1
|
Chrna4
|
cholinergic receptor, nicotinic, alpha polypeptide 4 |
| chr1_+_42697146 | 0.82 |
ENSMUST00000054883.2
|
Pou3f3
|
POU domain, class 3, transcription factor 3 |
| chr11_-_119547744 | 0.79 |
ENSMUST00000026670.4
|
Nptx1
|
neuronal pentraxin 1 |
| chr15_+_41788979 | 0.76 |
ENSMUST00000170127.1
|
Oxr1
|
oxidation resistance 1 |
| chr7_-_28302238 | 0.74 |
ENSMUST00000108315.3
|
Dll3
|
delta-like 3 (Drosophila) |
| chr18_-_74961252 | 0.73 |
ENSMUST00000066532.4
|
Lipg
|
lipase, endothelial |
| chr8_-_84011442 | 0.71 |
ENSMUST00000056686.5
|
2210011C24Rik
|
RIKEN cDNA 2210011C24 gene |
| chr12_+_108334341 | 0.70 |
ENSMUST00000021684.4
|
Cyp46a1
|
cytochrome P450, family 46, subfamily a, polypeptide 1 |
| chr15_+_41789495 | 0.70 |
ENSMUST00000090095.5
ENSMUST00000022918.7 |
Oxr1
|
oxidation resistance 1 |
| chr2_-_167833642 | 0.67 |
ENSMUST00000143649.1
|
1200007C13Rik
|
RIKEN cDNA 1200007C13 gene |
| chr17_+_88440711 | 0.67 |
ENSMUST00000112238.2
ENSMUST00000155640.1 |
Foxn2
|
forkhead box N2 |
| chr1_-_52500679 | 0.66 |
ENSMUST00000069792.7
|
Nab1
|
Ngfi-A binding protein 1 |
| chr6_-_52246214 | 0.66 |
ENSMUST00000048026.8
|
Hoxa11
|
homeobox A11 |
| chr11_-_113710017 | 0.66 |
ENSMUST00000018871.1
|
Cpsf4l
|
cleavage and polyadenylation specific factor 4-like |
| chr8_+_45658731 | 0.65 |
ENSMUST00000143820.1
ENSMUST00000132139.1 |
Sorbs2
|
sorbin and SH3 domain containing 2 |
| chr2_-_37703275 | 0.65 |
ENSMUST00000072186.5
|
Strbp
|
spermatid perinuclear RNA binding protein |
| chr8_+_45658273 | 0.63 |
ENSMUST00000153798.1
|
Sorbs2
|
sorbin and SH3 domain containing 2 |
| chr6_+_85187438 | 0.63 |
ENSMUST00000045942.8
|
Emx1
|
empty spiracles homeobox 1 |
| chr11_+_99879187 | 0.63 |
ENSMUST00000078442.3
|
Gm11567
|
predicted gene 11567 |
| chr11_-_78422217 | 0.62 |
ENSMUST00000001122.5
|
Slc13a2
|
solute carrier family 13 (sodium-dependent dicarboxylate transporter), member 2 |
| chr10_-_88503952 | 0.62 |
ENSMUST00000020253.8
|
Chpt1
|
choline phosphotransferase 1 |
| chr1_-_180697034 | 0.61 |
ENSMUST00000027778.7
|
Mixl1
|
Mix1 homeobox-like 1 (Xenopus laevis) |
| chr14_-_29721835 | 0.61 |
ENSMUST00000022567.7
|
Cacna2d3
|
calcium channel, voltage-dependent, alpha2/delta subunit 3 |
| chr1_+_194976342 | 0.61 |
ENSMUST00000181226.1
ENSMUST00000181947.1 |
A330023F24Rik
|
RIKEN cDNA A330023F24 gene |
| chr14_+_37054818 | 0.60 |
ENSMUST00000120052.1
|
Lrit1
|
leucine-rich repeat, immunoglobulin-like and transmembrane domains 1 |
| chr3_-_84304762 | 0.59 |
ENSMUST00000107692.1
|
Trim2
|
tripartite motif-containing 2 |
| chr11_+_72435565 | 0.59 |
ENSMUST00000100903.2
|
Ggt6
|
gamma-glutamyltransferase 6 |
| chrX_+_109095359 | 0.58 |
ENSMUST00000033598.8
|
Sh3bgrl
|
SH3-binding domain glutamic acid-rich protein like |
| chr9_+_62341329 | 0.57 |
ENSMUST00000085519.6
|
Anp32a
|
acidic (leucine-rich) nuclear phosphoprotein 32 family, member A |
| chr15_+_44619551 | 0.57 |
ENSMUST00000022964.7
|
Ebag9
|
estrogen receptor-binding fragment-associated gene 9 |
| chr17_-_46763576 | 0.56 |
ENSMUST00000041012.7
|
Ptcra
|
pre T cell antigen receptor alpha |
| chr2_-_71750083 | 0.55 |
ENSMUST00000180494.1
|
Gm17250
|
predicted gene, 17250 |
| chr19_-_29047847 | 0.55 |
ENSMUST00000025696.4
|
Ak3
|
adenylate kinase 3 |
| chr2_-_103485068 | 0.55 |
ENSMUST00000111168.3
|
Cat
|
catalase |
| chr16_+_91269759 | 0.55 |
ENSMUST00000056882.5
|
Olig1
|
oligodendrocyte transcription factor 1 |
| chr8_-_22398588 | 0.55 |
ENSMUST00000033871.6
|
Slc25a15
|
solute carrier family 25 (mitochondrial carrier ornithine transporter), member 15 |
| chr19_+_20601958 | 0.54 |
ENSMUST00000087638.3
|
Aldh1a1
|
aldehyde dehydrogenase family 1, subfamily A1 |
| chr1_+_181051232 | 0.54 |
ENSMUST00000036819.6
|
9130409I23Rik
|
RIKEN cDNA 9130409I23 gene |
| chr7_-_97417730 | 0.54 |
ENSMUST00000043077.7
|
Thrsp
|
thyroid hormone responsive |
| chr19_+_8617991 | 0.54 |
ENSMUST00000010250.2
|
Slc22a6
|
solute carrier family 22 (organic anion transporter), member 6 |
| chrX_-_162643575 | 0.54 |
ENSMUST00000101102.1
|
Reps2
|
RALBP1 associated Eps domain containing protein 2 |
| chr5_-_107687990 | 0.53 |
ENSMUST00000180428.1
|
Gm26692
|
predicted gene, 26692 |
| chr18_-_12862341 | 0.53 |
ENSMUST00000121888.1
|
Osbpl1a
|
oxysterol binding protein-like 1A |
| chr1_+_16665189 | 0.53 |
ENSMUST00000177501.1
ENSMUST00000065373.5 |
Tmem70
|
transmembrane protein 70 |
| chr6_+_29471437 | 0.53 |
ENSMUST00000171317.1
|
Gm9047
|
predicted gene 9047 |
| chr11_-_121388186 | 0.52 |
ENSMUST00000106107.2
|
Rab40b
|
Rab40b, member RAS oncogene family |
| chr17_+_35320529 | 0.52 |
ENSMUST00000105041.3
ENSMUST00000073208.5 |
H2-Q1
|
histocompatibility 2, Q region locus 1 |
| chr2_-_90580578 | 0.52 |
ENSMUST00000168621.2
|
Ptprj
|
protein tyrosine phosphatase, receptor type, J |
| chr2_-_103485138 | 0.51 |
ENSMUST00000028610.3
|
Cat
|
catalase |
| chr9_-_121759788 | 0.50 |
ENSMUST00000181325.1
|
E530011L22Rik
|
RIKEN cDNA E530011L22 gene |
| chr11_+_99785191 | 0.50 |
ENSMUST00000105059.2
|
Krtap4-9
|
keratin associated protein 4-9 |
| chr13_+_4228682 | 0.50 |
ENSMUST00000118663.1
|
Akr1c19
|
aldo-keto reductase family 1, member C19 |
| chr19_-_42202150 | 0.48 |
ENSMUST00000018966.7
|
Sfrp5
|
secreted frizzled-related sequence protein 5 |
| chr12_-_65073927 | 0.48 |
ENSMUST00000021332.8
|
Fkbp3
|
FK506 binding protein 3 |
| chr2_-_24048857 | 0.48 |
ENSMUST00000114497.1
|
Hnmt
|
histamine N-methyltransferase |
| chr1_+_82586942 | 0.48 |
ENSMUST00000113457.2
|
Col4a3
|
collagen, type IV, alpha 3 |
| chr11_+_75468040 | 0.48 |
ENSMUST00000043598.7
ENSMUST00000108435.1 |
Tlcd2
|
TLC domain containing 2 |
| chr7_+_123982799 | 0.47 |
ENSMUST00000106437.1
|
Hs3st4
|
heparan sulfate (glucosamine) 3-O-sulfotransferase 4 |
| chr8_-_4217261 | 0.47 |
ENSMUST00000168386.2
|
BC068157
|
cDNA sequence BC068157 |
| chr4_+_94556546 | 0.47 |
ENSMUST00000094969.1
|
Gm10306
|
predicted gene 10306 |
| chr10_-_88504073 | 0.47 |
ENSMUST00000117440.1
|
Chpt1
|
choline phosphotransferase 1 |
| chr10_-_88503912 | 0.47 |
ENSMUST00000117579.1
ENSMUST00000073783.5 |
Chpt1
|
choline phosphotransferase 1 |
| chr18_+_6765171 | 0.47 |
ENSMUST00000097680.5
|
Rab18
|
RAB18, member RAS oncogene family |
| chr6_+_56017489 | 0.47 |
ENSMUST00000052827.4
|
Ppp1r17
|
protein phosphatase 1, regulatory subunit 17 |
| chr6_+_48593883 | 0.46 |
ENSMUST00000154010.1
ENSMUST00000163452.1 ENSMUST00000118229.1 ENSMUST00000009420.8 |
Repin1
|
replication initiator 1 |
| chr14_-_31019055 | 0.46 |
ENSMUST00000037739.6
|
Gnl3
|
guanine nucleotide binding protein-like 3 (nucleolar) |
| chr4_+_98726734 | 0.46 |
ENSMUST00000152889.2
ENSMUST00000154279.2 |
L1td1
|
LINE-1 type transposase domain containing 1 |
| chr6_-_119544282 | 0.46 |
ENSMUST00000119369.1
ENSMUST00000178696.1 |
Wnt5b
|
wingless-related MMTV integration site 5B |
| chr12_+_44269145 | 0.46 |
ENSMUST00000043082.8
|
Pnpla8
|
patatin-like phospholipase domain containing 8 |
| chr1_+_127729405 | 0.46 |
ENSMUST00000038006.6
|
Acmsd
|
amino carboxymuconate semialdehyde decarboxylase |
| chr5_-_72587544 | 0.46 |
ENSMUST00000031124.4
|
Gm5868
|
predicted gene 5868 |
| chr4_+_95967205 | 0.45 |
ENSMUST00000030306.7
|
Hook1
|
hook homolog 1 (Drosophila) |
| chr10_+_98915117 | 0.45 |
ENSMUST00000020107.7
|
Atp2b1
|
ATPase, Ca++ transporting, plasma membrane 1 |
| chr17_-_23745829 | 0.45 |
ENSMUST00000046525.8
|
Kremen2
|
kringle containing transmembrane protein 2 |
| chr2_+_25242227 | 0.45 |
ENSMUST00000154498.1
|
Rnf208
|
ring finger protein 208 |
| chr16_+_58670208 | 0.45 |
ENSMUST00000060077.5
|
Cpox
|
coproporphyrinogen oxidase |
| chr9_+_100643605 | 0.45 |
ENSMUST00000041418.6
|
Stag1
|
stromal antigen 1 |
| chr4_+_137862237 | 0.45 |
ENSMUST00000102518.3
|
Ece1
|
endothelin converting enzyme 1 |
| chr6_-_23839137 | 0.45 |
ENSMUST00000166458.2
ENSMUST00000142913.2 ENSMUST00000115357.1 ENSMUST00000069074.7 ENSMUST00000115361.2 ENSMUST00000018122.7 ENSMUST00000115355.1 ENSMUST00000115356.2 |
Cadps2
|
Ca2+-dependent activator protein for secretion 2 |
| chr18_-_64660981 | 0.45 |
ENSMUST00000025482.8
|
Atp8b1
|
ATPase, class I, type 8B, member 1 |
| chrX_+_13071500 | 0.44 |
ENSMUST00000089302.4
|
Usp9x
|
ubiquitin specific peptidase 9, X chromosome |
| chr4_+_129287614 | 0.44 |
ENSMUST00000102599.3
|
Sync
|
syncoilin |
| chr7_-_4789541 | 0.43 |
ENSMUST00000168578.1
|
Tmem238
|
transmembrane protein 238 |
| chr16_+_21794320 | 0.43 |
ENSMUST00000181780.1
ENSMUST00000181960.1 |
1300002E11Rik
|
RIKEN cDNA 1300002E11 gene |
| chr4_-_108071327 | 0.43 |
ENSMUST00000106701.1
|
Scp2
|
sterol carrier protein 2, liver |
| chr4_+_53440516 | 0.43 |
ENSMUST00000107651.2
ENSMUST00000107647.1 |
Slc44a1
|
solute carrier family 44, member 1 |
| chr7_+_16309577 | 0.43 |
ENSMUST00000002152.6
|
Bbc3
|
BCL2 binding component 3 |
| chr3_+_66981352 | 0.42 |
ENSMUST00000162036.1
|
Rsrc1
|
arginine/serine-rich coiled-coil 1 |
| chrX_-_162643629 | 0.42 |
ENSMUST00000112334.1
|
Reps2
|
RALBP1 associated Eps domain containing protein 2 |
| chr17_-_23844155 | 0.42 |
ENSMUST00000122936.1
ENSMUST00000024926.7 ENSMUST00000151797.1 |
Prss41
|
protease, serine, 41 |
| chr7_-_142229971 | 0.42 |
ENSMUST00000097942.2
|
Krtap5-5
|
keratin associated protein 5-5 |
| chr9_-_67760208 | 0.42 |
ENSMUST00000068526.5
|
M5C1000I18Rik
|
RIKEN cDNA M5C1000I18 gene |
| chr7_-_119523477 | 0.42 |
ENSMUST00000033267.2
|
Pdilt
|
protein disulfide isomerase-like, testis expressed |
| chr11_+_73234292 | 0.42 |
ENSMUST00000102526.2
|
Trpv1
|
transient receptor potential cation channel, subfamily V, member 1 |
| chr17_-_45686214 | 0.42 |
ENSMUST00000113523.2
|
Tmem63b
|
transmembrane protein 63b |
| chr6_+_88724828 | 0.42 |
ENSMUST00000089449.2
|
Mgll
|
monoglyceride lipase |
| chr8_+_25808474 | 0.42 |
ENSMUST00000033979.4
|
Star
|
steroidogenic acute regulatory protein |
| chr2_-_132578244 | 0.41 |
ENSMUST00000110142.1
|
Gpcpd1
|
glycerophosphocholine phosphodiesterase GDE1 homolog (S. cerevisiae) |
| chr6_+_97807014 | 0.41 |
ENSMUST00000043637.7
|
Mitf
|
microphthalmia-associated transcription factor |
| chr11_-_120784183 | 0.41 |
ENSMUST00000026156.7
|
Rfng
|
RFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
| chr1_+_159232299 | 0.41 |
ENSMUST00000076894.5
|
Rfwd2
|
ring finger and WD repeat domain 2 |
| chr7_+_6439836 | 0.41 |
ENSMUST00000168341.1
|
Olfr1344
|
olfactory receptor 1344 |
| chr6_-_127109517 | 0.40 |
ENSMUST00000039913.8
|
9630033F20Rik
|
RIKEN cDNA 9630033F20 gene |
| chr5_-_66618772 | 0.40 |
ENSMUST00000162994.1
ENSMUST00000159512.1 ENSMUST00000159786.1 |
Apbb2
|
amyloid beta (A4) precursor protein-binding, family B, member 2 |
| chr19_+_44757394 | 0.39 |
ENSMUST00000004340.4
|
Pax2
|
paired box gene 2 |
| chr7_-_30612731 | 0.39 |
ENSMUST00000006476.4
|
Upk1a
|
uroplakin 1A |
| chr19_+_44756049 | 0.39 |
ENSMUST00000174490.2
|
Pax2
|
paired box gene 2 |
| chr15_+_102966794 | 0.39 |
ENSMUST00000001699.7
|
Hoxc10
|
homeobox C10 |
| chr6_+_51432663 | 0.39 |
ENSMUST00000005103.5
|
Nfe2l3
|
nuclear factor, erythroid derived 2, like 3 |
| chr6_-_23839420 | 0.39 |
ENSMUST00000115358.2
ENSMUST00000163871.2 |
Cadps2
|
Ca2+-dependent activator protein for secretion 2 |
| chrX_-_142390491 | 0.39 |
ENSMUST00000112904.1
ENSMUST00000112903.1 ENSMUST00000033634.4 |
Acsl4
|
acyl-CoA synthetase long-chain family member 4 |
| chr5_+_139543889 | 0.38 |
ENSMUST00000174792.1
ENSMUST00000031523.8 |
Uncx
|
UNC homeobox |
| chr17_+_45686322 | 0.38 |
ENSMUST00000024734.7
|
Mrpl14
|
mitochondrial ribosomal protein L14 |
| chr16_+_31664130 | 0.38 |
ENSMUST00000023454.5
|
Dlg1
|
discs, large homolog 1 (Drosophila) |
| chr7_+_16310412 | 0.38 |
ENSMUST00000136781.1
|
Bbc3
|
BCL2 binding component 3 |
| chr6_-_72235559 | 0.38 |
ENSMUST00000042646.7
|
Atoh8
|
atonal homolog 8 (Drosophila) |
| chr7_+_44590886 | 0.38 |
ENSMUST00000107906.3
|
Kcnc3
|
potassium voltage gated channel, Shaw-related subfamily, member 3 |
| chr14_+_34673888 | 0.38 |
ENSMUST00000048263.7
|
Wapal
|
wings apart-like homolog (Drosophila) |
| chr19_+_45560569 | 0.37 |
ENSMUST00000047057.7
|
Dpcd
|
deleted in primary ciliary dyskinesia |
| chr14_+_34673948 | 0.37 |
ENSMUST00000090027.3
|
Wapal
|
wings apart-like homolog (Drosophila) |
| chr4_+_116877376 | 0.37 |
ENSMUST00000044823.3
|
Zswim5
|
zinc finger SWIM-type containing 5 |
| chr7_+_122289297 | 0.37 |
ENSMUST00000064989.5
ENSMUST00000064921.4 |
Prkcb
|
protein kinase C, beta |
| chr9_+_60794468 | 0.37 |
ENSMUST00000050183.6
|
Uaca
|
uveal autoantigen with coiled-coil domains and ankyrin repeats |
| chr13_-_71963713 | 0.37 |
ENSMUST00000077337.8
|
Irx1
|
Iroquois related homeobox 1 (Drosophila) |
| chr9_+_83834684 | 0.37 |
ENSMUST00000070326.7
|
Ttk
|
Ttk protein kinase |
| chr1_+_66700831 | 0.37 |
ENSMUST00000027157.3
ENSMUST00000113995.1 |
Rpe
|
ribulose-5-phosphate-3-epimerase |
| chr19_+_3992752 | 0.36 |
ENSMUST00000041871.7
|
Tbx10
|
T-box 10 |
| chr16_+_21794384 | 0.36 |
ENSMUST00000180830.1
|
1300002E11Rik
|
RIKEN cDNA 1300002E11 gene |
| chr15_-_72034202 | 0.36 |
ENSMUST00000159993.1
|
Col22a1
|
collagen, type XXII, alpha 1 |
| chr7_-_51862216 | 0.36 |
ENSMUST00000169357.1
|
Fancf
|
Fanconi anemia, complementation group F |
| chr18_+_51117754 | 0.36 |
ENSMUST00000116639.2
|
Prr16
|
proline rich 16 |
| chr4_+_85205417 | 0.36 |
ENSMUST00000030212.8
ENSMUST00000107189.1 ENSMUST00000107184.1 |
Sh3gl2
|
SH3-domain GRB2-like 2 |
| chr4_-_8239034 | 0.36 |
ENSMUST00000066674.7
|
Car8
|
carbonic anhydrase 8 |
| chr8_-_84937347 | 0.36 |
ENSMUST00000109741.2
ENSMUST00000119820.1 |
Mast1
|
microtubule associated serine/threonine kinase 1 |
| chr1_-_183345296 | 0.36 |
ENSMUST00000109158.3
|
Mia3
|
melanoma inhibitory activity 3 |
| chr7_+_121707189 | 0.36 |
ENSMUST00000065310.2
|
1700069B07Rik
|
RIKEN cDNA 1700069B07 gene |
| chr13_+_75707484 | 0.36 |
ENSMUST00000001583.6
|
Ell2
|
elongation factor RNA polymerase II 2 |
| chr19_+_21653302 | 0.36 |
ENSMUST00000052556.3
|
Abhd17b
|
abhydrolase domain containing 17B |
| chr8_-_123754138 | 0.36 |
ENSMUST00000181805.1
|
4732419C18Rik
|
RIKEN cDNA 4732419C18 gene |
| chr15_-_36598019 | 0.36 |
ENSMUST00000155116.1
|
Pabpc1
|
poly(A) binding protein, cytoplasmic 1 |
| chr11_+_99873389 | 0.35 |
ENSMUST00000093936.3
|
Krtap9-1
|
keratin associated protein 9-1 |
| chr15_-_98807910 | 0.35 |
ENSMUST00000075444.6
|
Ddn
|
dendrin |
| chr7_-_30973464 | 0.35 |
ENSMUST00000001279.8
|
Lsr
|
lipolysis stimulated lipoprotein receptor |
| chr10_+_94514825 | 0.35 |
ENSMUST00000065060.5
|
Tmcc3
|
transmembrane and coiled coil domains 3 |
| chr10_-_24101951 | 0.35 |
ENSMUST00000170267.1
|
Taar8c
|
trace amine-associated receptor 8C |
| chr4_-_46196298 | 0.35 |
ENSMUST00000142380.1
ENSMUST00000058232.4 ENSMUST00000030013.5 |
Xpa
|
xeroderma pigmentosum, complementation group A |
| chr19_+_32757497 | 0.34 |
ENSMUST00000013807.7
|
Pten
|
phosphatase and tensin homolog |
| chr2_-_73214323 | 0.34 |
ENSMUST00000100015.4
|
Ola1
|
Obg-like ATPase 1 |
| chr3_-_144720315 | 0.34 |
ENSMUST00000163279.1
|
Sh3glb1
|
SH3-domain GRB2-like B1 (endophilin) |
| chr10_+_3366125 | 0.34 |
ENSMUST00000043374.5
|
Ppp1r14c
|
protein phosphatase 1, regulatory (inhibitor) subunit 14c |
| chr6_+_147091379 | 0.34 |
ENSMUST00000036003.7
|
Klhl42
|
kelch-like 42 |
| chr17_+_69383768 | 0.34 |
ENSMUST00000112676.2
|
Zbtb14
|
zinc finger and BTB domain containing 14 |
| chr19_-_4698315 | 0.34 |
ENSMUST00000096325.3
|
Gm960
|
predicted gene 960 |
| chr12_-_98737405 | 0.34 |
ENSMUST00000170188.1
|
Ptpn21
|
protein tyrosine phosphatase, non-receptor type 21 |
| chr4_+_19818722 | 0.34 |
ENSMUST00000035890.7
|
Slc7a13
|
solute carrier family 7, (cationic amino acid transporter, y+ system) member 13 |
| chrX_-_145348932 | 0.34 |
ENSMUST00000040084.9
ENSMUST00000123443.1 |
Lhfpl1
|
lipoma HMGIC fusion partner-like 1 |
| chr4_+_97777780 | 0.33 |
ENSMUST00000107062.2
ENSMUST00000052018.5 ENSMUST00000107057.1 |
Nfia
|
nuclear factor I/A |
| chr19_+_3958803 | 0.33 |
ENSMUST00000179433.1
|
1700055N04Rik
|
RIKEN cDNA 1700055N04 gene |
| chrX_-_142390334 | 0.33 |
ENSMUST00000112907.1
|
Acsl4
|
acyl-CoA synthetase long-chain family member 4 |
| chr17_-_24220738 | 0.33 |
ENSMUST00000024930.7
|
1600002H07Rik
|
RIKEN cDNA 1600002H07 gene |
| chr14_+_58075115 | 0.33 |
ENSMUST00000074654.5
|
Fgf9
|
fibroblast growth factor 9 |
| chr15_-_82912134 | 0.33 |
ENSMUST00000048966.5
ENSMUST00000109510.2 |
Tcf20
|
transcription factor 20 |
| chrX_-_53370470 | 0.33 |
ENSMUST00000096447.2
ENSMUST00000023836.3 |
Mospd1
|
motile sperm domain containing 1 |
| chr5_+_53998417 | 0.33 |
ENSMUST00000117661.2
ENSMUST00000071083.7 |
Stim2
|
stromal interaction molecule 2 |
| chr11_-_43836243 | 0.33 |
ENSMUST00000167574.1
|
Adra1b
|
adrenergic receptor, alpha 1b |
| chr1_-_51478390 | 0.32 |
ENSMUST00000027279.5
|
Nabp1
|
nucleic acid binding protein 1 |
| chr2_-_136387929 | 0.32 |
ENSMUST00000035264.2
ENSMUST00000077200.3 |
Pak7
|
p21 protein (Cdc42/Rac)-activated kinase 7 |
| chrX_+_10717390 | 0.32 |
ENSMUST00000115524.1
ENSMUST00000008179.6 |
Mid1ip1
|
Mid1 interacting protein 1 (gastrulation specific G12-like (zebrafish)) |
| chr17_-_56982120 | 0.32 |
ENSMUST00000056113.4
|
Acer1
|
alkaline ceramidase 1 |
| chr2_-_160313616 | 0.32 |
ENSMUST00000109475.2
|
Gm826
|
predicted gene 826 |
| chr17_-_45686120 | 0.32 |
ENSMUST00000143907.1
ENSMUST00000127065.1 |
Tmem63b
|
transmembrane protein 63b |
| chr8_-_40634776 | 0.32 |
ENSMUST00000048898.10
ENSMUST00000174205.1 |
Mtmr7
|
myotubularin related protein 7 |
| chr17_-_44105728 | 0.32 |
ENSMUST00000143137.1
|
Enpp4
|
ectonucleotide pyrophosphatase/phosphodiesterase 4 |
| chr2_-_37703845 | 0.32 |
ENSMUST00000155237.1
|
Strbp
|
spermatid perinuclear RNA binding protein |
| chrX_+_21714896 | 0.32 |
ENSMUST00000033414.7
|
Slc6a14
|
solute carrier family 6 (neurotransmitter transporter), member 14 |
| chr8_-_93337195 | 0.32 |
ENSMUST00000044602.7
|
Ces1g
|
carboxylesterase 1G |
| chr1_+_43092588 | 0.32 |
ENSMUST00000039080.3
|
8430432A02Rik
|
RIKEN cDNA 8430432A02 gene |
| chr3_-_73708399 | 0.32 |
ENSMUST00000029367.5
|
Bche
|
butyrylcholinesterase |
| chrX_-_38252398 | 0.32 |
ENSMUST00000089056.3
ENSMUST00000089054.4 ENSMUST00000066498.7 |
Tmem255a
|
transmembrane protein 255A |
| chr11_-_50931612 | 0.31 |
ENSMUST00000109124.3
|
Zfp354b
|
zinc finger protein 354B |
| chr11_+_72435534 | 0.31 |
ENSMUST00000108499.1
|
Ggt6
|
gamma-glutamyltransferase 6 |
| chr14_+_56365004 | 0.31 |
ENSMUST00000007340.2
|
Atp12a
|
ATPase, H+/K+ transporting, nongastric, alpha polypeptide |
| chr9_-_72111651 | 0.31 |
ENSMUST00000185117.1
|
Tcf12
|
transcription factor 12 |
| chr7_-_71351485 | 0.31 |
ENSMUST00000094315.2
|
Gm10295
|
predicted gene 10295 |
| chr2_-_136891363 | 0.31 |
ENSMUST00000028730.6
ENSMUST00000110089.2 |
Mkks
|
McKusick-Kaufman syndrome |
| chr12_+_32954179 | 0.31 |
ENSMUST00000020885.6
|
Sypl
|
synaptophysin-like protein |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.1 | GO:1900104 | hyaluranon cable assembly(GO:0036118) nephrogenic mesenchyme development(GO:0072076) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.3 | 1.1 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.3 | 0.9 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.3 | 0.8 | GO:1903048 | regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.3 | 1.1 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.3 | 0.8 | GO:2000595 | optic nerve formation(GO:0021634) optic chiasma development(GO:0061360) regulation of optic nerve formation(GO:2000595) positive regulation of optic nerve formation(GO:2000597) |
| 0.3 | 1.6 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.3 | 0.8 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.2 | 0.4 | GO:0021650 | vestibulocochlear nerve formation(GO:0021650) |
| 0.2 | 0.8 | GO:0072240 | DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
| 0.2 | 0.6 | GO:1903382 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.2 | 0.7 | GO:0010986 | regulation of high-density lipoprotein particle clearance(GO:0010982) positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.2 | 0.5 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.2 | 1.2 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.2 | 0.5 | GO:2000040 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 0.2 | 0.9 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.2 | 0.8 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.2 | 0.6 | GO:1903760 | regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) |
| 0.2 | 1.1 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.1 | 0.4 | GO:0010816 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.1 | 0.3 | GO:0010808 | positive regulation of synaptic vesicle priming(GO:0010808) |
| 0.1 | 0.4 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 | 1.0 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.1 | 0.9 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.4 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.1 | 0.4 | GO:1901994 | negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.1 | 1.4 | GO:0009650 | UV protection(GO:0009650) |
| 0.1 | 0.2 | GO:1901204 | regulation of adrenergic receptor signaling pathway involved in heart process(GO:1901204) |
| 0.1 | 1.4 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 | 0.6 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 | 0.3 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.1 | 0.3 | GO:0001982 | baroreceptor response to decreased systemic arterial blood pressure(GO:0001982) |
| 0.1 | 0.4 | GO:0032379 | positive regulation of intracellular lipid transport(GO:0032379) positive regulation of intracellular sterol transport(GO:0032382) positive regulation of intracellular cholesterol transport(GO:0032385) lipid hydroperoxide transport(GO:1901373) |
| 0.1 | 0.2 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.1 | 0.3 | GO:0010446 | response to alkaline pH(GO:0010446) |
| 0.1 | 0.4 | GO:1901594 | detection of temperature stimulus involved in thermoception(GO:0050960) response to capsazepine(GO:1901594) |
| 0.1 | 0.8 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.1 | 0.3 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 0.3 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.1 | 0.4 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.1 | 1.1 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.3 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.1 | 0.2 | GO:0006507 | GPI anchor release(GO:0006507) |
| 0.1 | 0.3 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 0.5 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.1 | 0.2 | GO:1900175 | regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) |
| 0.1 | 0.2 | GO:0072289 | metanephric nephron tubule formation(GO:0072289) |
| 0.1 | 0.6 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.1 | 0.4 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 0.1 | 0.4 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 0.1 | 0.5 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 | 0.4 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.1 | 0.4 | GO:0003349 | epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.1 | 0.6 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.1 | 0.2 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 | 0.4 | GO:0070859 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.1 | 0.1 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 0.1 | 0.4 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.1 | 0.2 | GO:0042335 | cuticle development(GO:0042335) cornification(GO:0070268) |
| 0.1 | 0.5 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 | 0.3 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.1 | 0.5 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.1 | 0.5 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.3 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.1 | 0.6 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.3 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.1 | 0.1 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.1 | 0.2 | GO:0050925 | negative regulation of negative chemotaxis(GO:0050925) |
| 0.1 | 0.2 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.1 | 0.4 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 0.3 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.1 | 0.6 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.1 | 0.7 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.5 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.1 | 0.7 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 | 0.3 | GO:0040010 | positive regulation of growth rate(GO:0040010) |
| 0.1 | 0.1 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) |
| 0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.2 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.1 | 0.2 | GO:0071550 | regulation of muscle atrophy(GO:0014735) death-inducing signaling complex assembly(GO:0071550) |
| 0.1 | 0.3 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.1 | 0.5 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.1 | 0.3 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 0.1 | 0.9 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.1 | 0.3 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.1 | 0.3 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 | 0.3 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.1 | 0.1 | GO:0060025 | regulation of synaptic activity(GO:0060025) |
| 0.1 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 | 0.2 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.1 | 0.2 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.1 | 0.4 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.1 | 0.4 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.1 | 0.3 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 0.7 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.1 | 0.1 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.1 | 0.1 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.2 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.1 | 0.7 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 | 0.2 | GO:2000451 | positive regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000451) |
| 0.1 | 0.1 | GO:0060913 | cardiac cell fate determination(GO:0060913) |
| 0.1 | 0.2 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 | 0.2 | GO:0097274 | urea homeostasis(GO:0097274) |
| 0.1 | 0.2 | GO:0046381 | CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.1 | 0.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 0.3 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.1 | 0.2 | GO:1900673 | olefin metabolic process(GO:1900673) |
| 0.1 | 0.2 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.1 | 0.2 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.1 | 0.4 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 | 0.3 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) fungiform papilla formation(GO:0061198) |
| 0.1 | 0.2 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 0.3 | GO:0006041 | glucosamine metabolic process(GO:0006041) UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.1 | 0.3 | GO:1903278 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.1 | 0.4 | GO:0015862 | uridine transport(GO:0015862) |
| 0.0 | 0.2 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.0 | 0.5 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.0 | 0.2 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.0 | GO:0036115 | fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.0 | 0.6 | GO:0072501 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.7 | GO:0007501 | mesodermal cell fate specification(GO:0007501) |
| 0.0 | 0.3 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.0 | 0.5 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 | 0.5 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.0 | 0.2 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.0 | 0.3 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.0 | 0.2 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.0 | 0.2 | GO:0055096 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
| 0.0 | 0.2 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) telomerase RNA stabilization(GO:0090669) |
| 0.0 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.2 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.0 | 0.2 | GO:1903027 | regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
| 0.0 | 0.2 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.0 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.1 | GO:0032470 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) |
| 0.0 | 0.6 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 | 0.4 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 | 0.2 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.0 | 0.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.0 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.4 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.0 | 0.1 | GO:0060722 | spongiotrophoblast cell proliferation(GO:0060720) cell proliferation involved in embryonic placenta development(GO:0060722) |
| 0.0 | 0.1 | GO:0030719 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
| 0.0 | 0.0 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
| 0.0 | 0.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.0 | 0.1 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.0 | 0.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.0 | 0.1 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.0 | 0.5 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.0 | 0.3 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
| 0.0 | 0.6 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 | 0.2 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.0 | 0.2 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.0 | 0.3 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 | 0.5 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.0 | 0.5 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.2 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.2 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.2 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.0 | 0.3 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.1 | GO:1905034 | regulation of antifungal innate immune response(GO:1905034) negative regulation of antifungal innate immune response(GO:1905035) |
| 0.0 | 0.1 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.0 | 0.1 | GO:0003308 | negative regulation of Wnt signaling pathway involved in heart development(GO:0003308) |
| 0.0 | 0.1 | GO:0090298 | negative regulation of mitochondrial DNA replication(GO:0090298) |
| 0.0 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.1 | GO:0046087 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.0 | 0.2 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 | 0.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.1 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 0.0 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
| 0.0 | 0.1 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.0 | 0.5 | GO:0071599 | otic vesicle development(GO:0071599) |
| 0.0 | 0.1 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.0 | 0.1 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.0 | 0.2 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
| 0.0 | 0.2 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.0 | 0.2 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 | 0.1 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.0 | 0.4 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.2 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.0 | 0.4 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.0 | 0.2 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.4 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.0 | 0.2 | GO:0034331 | cell junction maintenance(GO:0034331) |
| 0.0 | 0.1 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.0 | 0.2 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.0 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.5 | GO:0032196 | transposition(GO:0032196) |
| 0.0 | 0.3 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
| 0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 | 0.2 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.0 | 0.1 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.0 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.0 | 0.1 | GO:2000794 | regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
| 0.0 | 0.2 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.2 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.7 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.4 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
| 0.0 | 0.1 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.0 | 0.1 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
| 0.0 | 0.2 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.0 | 0.4 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.0 | 0.5 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
| 0.0 | 0.1 | GO:1904798 | regulation of core promoter binding(GO:1904796) positive regulation of core promoter binding(GO:1904798) |
| 0.0 | 0.6 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.1 | GO:1903999 | regulation of eating behavior(GO:1903998) negative regulation of eating behavior(GO:1903999) |
| 0.0 | 0.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.3 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.0 | 0.2 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.1 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
| 0.0 | 0.1 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.1 | GO:2000567 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.0 | 0.1 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 0.0 | 0.4 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.3 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.0 | 1.3 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.0 | 0.1 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 | 0.1 | GO:0036363 | transforming growth factor beta activation(GO:0036363) |
| 0.0 | 0.2 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.0 | 1.0 | GO:0034629 | cellular protein complex localization(GO:0034629) |
| 0.0 | 0.8 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.0 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
| 0.0 | 0.7 | GO:2000191 | regulation of fatty acid transport(GO:2000191) |
| 0.0 | 0.2 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.0 | 0.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.0 | 0.1 | GO:2000744 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.0 | 0.2 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.0 | 0.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 | 0.2 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.2 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.2 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.0 | 0.1 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.0 | 0.0 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.0 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.0 | 0.3 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.0 | 0.8 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
| 0.0 | 0.1 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.0 | 1.1 | GO:0045022 | early endosome to late endosome transport(GO:0045022) |
| 0.0 | 0.0 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
| 0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.1 | GO:1902953 | endoplasmic reticulum membrane organization(GO:0090158) positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 | 0.2 | GO:0046959 | habituation(GO:0046959) |
| 0.0 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.0 | 0.1 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
| 0.0 | 0.1 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.3 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.1 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.0 | 0.1 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.0 | 0.0 | GO:0046271 | phenylpropanoid metabolic process(GO:0009698) coumarin metabolic process(GO:0009804) phenylpropanoid catabolic process(GO:0046271) |
| 0.0 | 0.2 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.1 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.0 | 0.8 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 | 0.2 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.2 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 | 0.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.0 | 0.2 | GO:0075071 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.4 | GO:0044146 | negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.0 | 0.2 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.0 | 0.1 | GO:0021660 | rhombomere formation(GO:0021594) rhombomere 3 formation(GO:0021660) rhombomere 5 morphogenesis(GO:0021664) rhombomere 5 formation(GO:0021666) |
| 0.0 | 0.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.1 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.4 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.0 | 0.2 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.5 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.1 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
| 0.0 | 0.1 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.3 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.1 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.0 | 0.3 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.0 | 0.0 | GO:0061009 | common bile duct development(GO:0061009) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.1 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
| 0.0 | 0.1 | GO:0009624 | response to nematode(GO:0009624) |
| 0.0 | 0.2 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.0 | 0.1 | GO:0060676 | ureteric bud formation(GO:0060676) |
| 0.0 | 0.2 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.0 | 0.4 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.0 | 0.2 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) |
| 0.0 | 0.1 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.0 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.0 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.0 | 0.1 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.0 | 0.2 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.2 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
| 0.0 | 0.2 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.1 | GO:1904637 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.0 | 0.1 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.2 | GO:0055075 | potassium ion homeostasis(GO:0055075) |
| 0.0 | 0.1 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.0 | 0.2 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.0 | 0.2 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.1 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 | 0.2 | GO:0021678 | third ventricle development(GO:0021678) |
| 0.0 | 0.1 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.2 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.1 | GO:1904417 | negative regulation of receptor recycling(GO:0001920) regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.0 | 0.2 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.6 | GO:0010613 | positive regulation of cardiac muscle hypertrophy(GO:0010613) positive regulation of muscle hypertrophy(GO:0014742) |
| 0.0 | 0.2 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.1 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
| 0.0 | 0.0 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.0 | 0.3 | GO:0008210 | estrogen metabolic process(GO:0008210) |
| 0.0 | 0.0 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
| 0.0 | 0.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.0 | 0.4 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.0 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.0 | 0.0 | GO:0051794 | regulation of catagen(GO:0051794) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.0 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.0 | 0.1 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.1 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.0 | 0.1 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.1 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.2 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.0 | 0.4 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
| 0.0 | 0.8 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.3 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.1 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
| 0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.2 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
| 0.0 | 0.7 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.1 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.0 | 0.5 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.4 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
| 0.0 | 0.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.1 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.0 | 0.4 | GO:0003170 | heart valve development(GO:0003170) |
| 0.0 | 0.2 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.1 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.0 | 0.2 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.0 | 0.1 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.3 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.0 | 0.0 | GO:1901660 | calcium ion export(GO:1901660) |
| 0.0 | 0.2 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.0 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.0 | 0.3 | GO:0060337 | type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.0 | 0.2 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
| 0.0 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.2 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 | 0.1 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.0 | 0.1 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.0 | 0.0 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.0 | 0.2 | GO:0044062 | regulation of excretion(GO:0044062) |
| 0.0 | 0.1 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.0 | 0.2 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.1 | GO:0032891 | negative regulation of organic acid transport(GO:0032891) |
| 0.0 | 0.1 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.1 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 0.1 | GO:1901162 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.0 | 0.3 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.1 | GO:0006544 | glycine metabolic process(GO:0006544) |
| 0.0 | 0.2 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.0 | 0.1 | GO:0061157 | mRNA destabilization(GO:0061157) |
| 0.0 | 0.1 | GO:0070933 | regulation of skeletal muscle fiber development(GO:0048742) histone H4 deacetylation(GO:0070933) |
| 0.0 | 0.0 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.0 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 | 0.1 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.4 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.1 | GO:0010996 | response to auditory stimulus(GO:0010996) |
| 0.0 | 0.2 | GO:0006744 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) |
| 0.0 | 0.1 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.0 | 0.1 | GO:0016559 | peroxisome fission(GO:0016559) |
| 0.0 | 0.3 | GO:0060479 | lung cell differentiation(GO:0060479) lung epithelial cell differentiation(GO:0060487) |
| 0.0 | 0.3 | GO:0070232 | regulation of T cell apoptotic process(GO:0070232) |
| 0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.1 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
| 0.0 | 0.1 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
| 0.0 | 0.3 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.7 | GO:0032922 | circadian regulation of gene expression(GO:0032922) |
| 0.0 | 0.5 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.9 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.3 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 0.8 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 0.9 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.3 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.1 | 0.4 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 0.6 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 0.8 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 0.2 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.1 | 0.5 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.1 | 0.3 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.1 | 0.3 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 0.3 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.1 | 0.3 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 0.3 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.2 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.0 | 0.6 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 0.2 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 0.0 | 0.4 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.9 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 1.4 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.2 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.0 | 0.4 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.2 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 0.1 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.0 | 0.2 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 0.0 | 0.4 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.5 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.0 | 0.1 | GO:0044307 | dendritic branch(GO:0044307) |
| 0.0 | 1.2 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.5 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 2.8 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.0 | 0.7 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.1 | GO:0060187 | cell pole(GO:0060187) |
| 0.0 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.2 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 0.4 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.0 | 0.3 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.0 | 0.1 | GO:0005940 | septin ring(GO:0005940) |
| 0.0 | 0.2 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.2 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.2 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.1 | GO:0097447 | dendritic tree(GO:0097447) |
| 0.0 | 0.3 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 0.1 | GO:0060473 | cortical granule(GO:0060473) |
| 0.0 | 0.3 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.2 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 0.4 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.0 | 0.3 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.2 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.0 | 0.5 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.6 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.3 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.0 | 0.3 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.3 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.5 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.0 | 0.3 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.0 | 0.5 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.3 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.0 | 1.8 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.1 | GO:0044753 | amphisome(GO:0044753) |
| 0.0 | 0.2 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.5 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.5 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.5 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.0 | 0.3 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.1 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 0.1 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.1 | GO:0071664 | beta-catenin-TCF7L2 complex(GO:0070369) catenin-TCF7L2 complex(GO:0071664) |
| 0.0 | 0.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.2 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.0 | 0.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 1.0 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.0 | 0.1 | GO:0031673 | H zone(GO:0031673) |
| 0.0 | 0.5 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.1 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 0.0 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.0 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.1 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.6 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.2 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.0 | 0.4 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.1 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.0 | 0.1 | GO:0030677 | ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 0.2 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.0 | 0.2 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.3 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.4 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.7 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.4 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.2 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.3 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.5 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 0.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.4 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.6 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.3 | 1.1 | GO:0004096 | catalase activity(GO:0004096) |
| 0.2 | 0.6 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.2 | 0.5 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.2 | 1.1 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.2 | 0.9 | GO:2001070 | starch binding(GO:2001070) |
| 0.2 | 0.6 | GO:0047710 | bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
| 0.1 | 0.5 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.1 | 1.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.1 | 0.7 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.1 | 0.4 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.1 | 0.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.3 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.1 | 0.6 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.4 | GO:0050632 | propanoyl-CoA C-acyltransferase activity(GO:0033814) propionyl-CoA C2-trimethyltridecanoyltransferase activity(GO:0050632) phosphatidylethanolamine transporter activity(GO:1904121) |
| 0.1 | 0.3 | GO:0071633 | dihydroceramidase activity(GO:0071633) |
| 0.1 | 0.5 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.1 | 0.3 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.1 | 0.3 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.1 | 0.3 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 0.6 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 0.8 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.9 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 0.3 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.1 | 1.3 | GO:0019841 | retinol binding(GO:0019841) |
| 0.1 | 0.4 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.1 | 0.5 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.1 | 0.3 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.1 | 0.6 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.4 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.1 | 0.2 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.1 | 0.3 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 0.3 | GO:0019962 | interferon receptor activity(GO:0004904) type I interferon receptor activity(GO:0004905) type I interferon binding(GO:0019962) |
| 0.1 | 0.3 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.1 | 0.5 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.1 | 0.2 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.1 | 0.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 0.9 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.4 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.1 | 0.4 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.1 | 0.2 | GO:0030338 | CMP-N-acetylneuraminate monooxygenase activity(GO:0030338) |
| 0.1 | 0.3 | GO:0043682 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
| 0.1 | 0.5 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.9 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.4 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.1 | 0.2 | GO:0098809 | nitrite reductase activity(GO:0098809) |
| 0.1 | 0.7 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.1 | 0.9 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.4 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.3 | GO:0035851 | histone deacetylase activity (H4-K16 specific)(GO:0034739) Krueppel-associated box domain binding(GO:0035851) |
| 0.1 | 0.2 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.1 | 0.3 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.1 | 0.6 | GO:0008556 | sodium:potassium-exchanging ATPase activity(GO:0005391) potassium-transporting ATPase activity(GO:0008556) |
| 0.1 | 0.5 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.1 | 0.6 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.1 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.1 | 0.5 | GO:0031404 | chloride ion binding(GO:0031404) |
| 0.1 | 0.2 | GO:0047661 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 0.9 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.1 | 0.2 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 0.1 | 0.3 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.2 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.1 | 0.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.0 | 0.2 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
| 0.0 | 2.0 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.1 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
| 0.0 | 0.3 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.0 | 0.9 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.0 | 0.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.7 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.6 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.1 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.0 | 0.5 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.2 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.0 | 0.4 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.6 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 0.0 | 0.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.2 | GO:0000010 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
| 0.0 | 0.1 | GO:0001132 | RNA polymerase II transcription factor activity, TBP-class protein binding, involved in preinitiation complex assembly(GO:0001129) RNA polymerase II transcription factor activity, TBP-class protein binding(GO:0001132) |
| 0.0 | 0.2 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.4 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.3 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 1.3 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 0.7 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.0 | 0.2 | GO:0070012 | oligopeptidase activity(GO:0070012) |
| 0.0 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.1 | GO:0086077 | gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
| 0.0 | 0.1 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 0.0 | 0.3 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.4 | GO:0042165 | neurotransmitter binding(GO:0042165) |
| 0.0 | 0.1 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.0 | 0.5 | GO:0043855 | cyclic nucleotide-gated ion channel activity(GO:0043855) |
| 0.0 | 0.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.0 | 0.1 | GO:0070002 | glutamic-type peptidase activity(GO:0070002) |
| 0.0 | 0.5 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.1 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.2 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.6 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.6 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.0 | 0.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 1.0 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.1 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.0 | 0.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 1.3 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.1 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.0 | 0.1 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
| 0.0 | 0.5 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.1 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.2 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.0 | 1.0 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 1.1 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.1 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.0 | 0.2 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.0 | 0.0 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.2 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
| 0.0 | 0.1 | GO:0008486 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
| 0.0 | 0.1 | GO:0002134 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.0 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.0 | 0.2 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 1.1 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 0.2 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 0.2 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
| 0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 1.1 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.0 | 0.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.5 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.2 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.1 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.2 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 0.2 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.6 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.4 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.1 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.0 | 0.4 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.0 | 0.2 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.0 | 0.5 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.4 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.2 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.0 | 0.4 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.0 | 1.2 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.0 | 0.5 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 0.2 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.0 | 0.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.0 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.0 | 0.0 | GO:0000700 | mismatch base pair DNA N-glycosylase activity(GO:0000700) |
| 0.0 | 0.2 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.0 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.1 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.0 | 0.7 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.1 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.4 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.1 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
| 0.0 | 0.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.1 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.3 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.4 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.3 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.0 | 0.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.0 | GO:0005118 | sevenless binding(GO:0005118) |
| 0.0 | 0.1 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.0 | 0.3 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.6 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 3.3 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.0 | 0.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.0 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
| 0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.2 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.4 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.0 | 0.1 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.0 | 0.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.0 | 0.2 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.0 | 0.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.0 | 0.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.0 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 1.1 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 0.3 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.0 | 0.1 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 1.1 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.5 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.9 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 0.3 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 0.6 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.9 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.8 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.8 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 1.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 1.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.9 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 1.1 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.4 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 1.6 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.5 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.3 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 1.3 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.2 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.5 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.2 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.6 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.1 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.2 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.5 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.6 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.2 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.4 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.3 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.5 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.1 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 1.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.1 | 0.5 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 1.0 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 0.9 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.1 | 0.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.1 | 1.9 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 0.2 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 1.0 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 0.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.9 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.5 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.3 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.6 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.6 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.5 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 0.4 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 1.1 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.3 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 0.7 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.4 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 0.5 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.5 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.4 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 0.3 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
| 0.0 | 0.4 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.4 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 0.1 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 1.3 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |
| 0.0 | 0.3 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.4 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.8 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 0.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.8 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 0.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.3 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 1.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 1.2 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 0.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.3 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.4 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.8 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.0 | 0.3 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 1.2 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.2 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.0 | 0.3 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.3 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.3 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.2 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.1 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.0 | 0.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.9 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
| 0.0 | 0.5 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |