Motif ID: GTF2I
Z-value: 0.976

Transcription factors associated with GTF2I:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
GTF2I | ENSG00000077809.8 | GTF2I |
Activity-expression correlation:
Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
GTF2I | hg19_v2_chr7_+_74072011_74072119 | 0.71 | 1.1e-04 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 3.0 | GO:0048389 | intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
0.6 | 3.3 | GO:0010734 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
0.5 | 1.6 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
0.5 | 1.9 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.4 | 1.7 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
0.4 | 1.2 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
0.4 | 0.4 | GO:0072053 | renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
0.3 | 1.3 | GO:0002503 | peptide antigen assembly with MHC class II protein complex(GO:0002503) |
0.3 | 1.2 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
0.3 | 0.6 | GO:0061010 | gall bladder development(GO:0061010) |
0.3 | 1.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
0.3 | 6.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.3 | 2.0 | GO:0071233 | cellular response to leucine(GO:0071233) |
0.3 | 0.8 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
0.2 | 1.2 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) seminal vesicle development(GO:0061107) |
0.2 | 0.9 | GO:2000721 | pilomotor reflex(GO:0097195) positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.2 | 0.7 | GO:0015817 | acyl carnitine transport(GO:0006844) histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) acyl carnitine transmembrane transport(GO:1902616) |
0.2 | 1.4 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.2 | 0.7 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.2 | 0.8 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.2 | 2.7 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.2 | 1.0 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.2 | 0.6 | GO:0050823 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
0.2 | 1.2 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.2 | 0.2 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.2 | 1.2 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.2 | 1.2 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.2 | 0.7 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
0.2 | 0.5 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
0.2 | 0.3 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
0.2 | 0.5 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) |
0.2 | 1.6 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.2 | 0.5 | GO:0072229 | carbon dioxide transmembrane transport(GO:0035378) proximal convoluted tubule development(GO:0072019) metanephric proximal convoluted tubule development(GO:0072229) |
0.2 | 0.6 | GO:0010157 | response to chlorate(GO:0010157) |
0.1 | 0.4 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.1 | 1.0 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
0.1 | 0.4 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.1 | 0.4 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
0.1 | 2.0 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.1 | 0.4 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.1 | 0.7 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.1 | 0.9 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
0.1 | 0.4 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.4 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
0.1 | 0.5 | GO:0097676 | histone H3-K36 dimethylation(GO:0097676) |
0.1 | 0.4 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
0.1 | 0.4 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
0.1 | 1.0 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.1 | 0.8 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.1 | 0.7 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.4 | GO:1990926 | short-term synaptic potentiation(GO:1990926) |
0.1 | 0.6 | GO:0032474 | otolith morphogenesis(GO:0032474) sensory system development(GO:0048880) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 2.3 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.1 | 0.4 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
0.1 | 0.7 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.5 | GO:0061357 | positive regulation of Wnt protein secretion(GO:0061357) |
0.1 | 0.6 | GO:1903281 | protein transport into plasma membrane raft(GO:0044861) regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) positive regulation of calcium:sodium antiporter activity(GO:1903281) positive regulation of potassium ion import(GO:1903288) |
0.1 | 0.7 | GO:1901908 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
0.1 | 0.3 | GO:0098582 | innate vocalization behavior(GO:0098582) |
0.1 | 0.7 | GO:2000795 | negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
0.1 | 0.9 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
0.1 | 0.4 | GO:1904844 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
0.1 | 0.3 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
0.1 | 0.4 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.2 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.4 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 1.3 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.1 | 0.4 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 1.2 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 0.7 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.1 | 0.3 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
0.1 | 0.8 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.1 | 0.5 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.3 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
0.1 | 0.4 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
0.1 | 0.3 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.1 | 0.3 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.1 | 1.1 | GO:1904936 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.1 | 0.5 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 0.3 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
0.1 | 0.2 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.1 | 0.4 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
0.1 | 0.5 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
0.1 | 0.1 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
0.1 | 0.3 | GO:0072658 | maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
0.1 | 1.3 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.1 | 0.4 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
0.1 | 0.5 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.1 | 0.4 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.1 | 0.4 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.7 | GO:0021759 | globus pallidus development(GO:0021759) |
0.1 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.1 | 0.3 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.1 | 0.4 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.3 | GO:0021592 | midbrain-hindbrain boundary morphogenesis(GO:0021555) fourth ventricle development(GO:0021592) |
0.1 | 2.0 | GO:0006337 | nucleosome disassembly(GO:0006337) |
0.1 | 0.2 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.1 | 1.2 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.1 | 0.4 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
0.1 | 0.2 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
0.1 | 0.4 | GO:0015853 | adenine transport(GO:0015853) |
0.1 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.3 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
0.1 | 0.8 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.1 | 0.3 | GO:0007499 | ectoderm and mesoderm interaction(GO:0007499) |
0.1 | 0.3 | GO:0032972 | diaphragm contraction(GO:0002086) regulation of muscle filament sliding speed(GO:0032972) |
0.1 | 0.2 | GO:0003193 | pulmonary valve formation(GO:0003193) regulation of cell communication by chemical coupling(GO:0010645) positive regulation of cell communication by chemical coupling(GO:0010652) foramen ovale closure(GO:0035922) regulation of bundle of His cell action potential(GO:0098905) |
0.1 | 0.3 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
0.1 | 0.6 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.1 | 0.2 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
0.1 | 0.4 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.1 | 0.9 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.1 | 0.3 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.1 | 0.2 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) |
0.1 | 0.3 | GO:0071350 | interleukin-15-mediated signaling pathway(GO:0035723) cellular response to interleukin-15(GO:0071350) |
0.1 | 0.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.1 | 1.2 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.1 | 0.4 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
0.1 | 0.3 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
0.1 | 0.2 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.1 | 0.2 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
0.1 | 0.2 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
0.1 | 0.7 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.1 | 2.3 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.1 | 0.4 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.1 | 0.5 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.1 | 0.2 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
0.1 | 0.2 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
0.1 | 1.6 | GO:0010669 | epithelial structure maintenance(GO:0010669) |
0.1 | 0.2 | GO:0034125 | negative regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034125) |
0.1 | 0.2 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.1 | 0.2 | GO:0006404 | RNA import into nucleus(GO:0006404) |
0.1 | 1.5 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.3 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.2 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.3 | GO:0043366 | beta selection(GO:0043366) |
0.0 | 0.3 | GO:0070560 | protein secretion by platelet(GO:0070560) |
0.0 | 0.7 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 1.0 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
0.0 | 0.0 | GO:0010159 | specification of organ position(GO:0010159) |
0.0 | 0.6 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
0.0 | 0.0 | GO:0008356 | asymmetric cell division(GO:0008356) |
0.0 | 0.4 | GO:0010761 | fibroblast migration(GO:0010761) |
0.0 | 0.2 | GO:0008584 | male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) male sex differentiation(GO:0046661) |
0.0 | 0.1 | GO:0003032 | detection of oxygen(GO:0003032) uterine wall breakdown(GO:0042704) |
0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) regulation of G-protein coupled receptor internalization(GO:1904020) |
0.0 | 0.4 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.2 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.3 | GO:1990785 | response to water-immersion restraint stress(GO:1990785) |
0.0 | 0.1 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
0.0 | 0.2 | GO:0009386 | translational attenuation(GO:0009386) |
0.0 | 0.2 | GO:0043335 | protein unfolding(GO:0043335) |
0.0 | 0.4 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.0 | 0.3 | GO:0051106 | positive regulation of DNA ligation(GO:0051106) |
0.0 | 0.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.2 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.0 | 0.2 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.0 | 0.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.1 | GO:0007412 | axon target recognition(GO:0007412) |
0.0 | 0.1 | GO:0061197 | fungiform papilla morphogenesis(GO:0061197) |
0.0 | 0.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.5 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.1 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.0 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.0 | 0.2 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.0 | 0.1 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
0.0 | 0.1 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
0.0 | 0.2 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.9 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
0.0 | 0.3 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 1.0 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.4 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.5 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.8 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 2.7 | GO:0007585 | respiratory gaseous exchange(GO:0007585) |
0.0 | 0.2 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.0 | 0.7 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 1.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.8 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.0 | 0.6 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.1 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
0.0 | 0.1 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.0 | 0.2 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
0.0 | 0.2 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
0.0 | 0.1 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.7 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
0.0 | 0.1 | GO:0019566 | arabinose metabolic process(GO:0019566) L-arabinose metabolic process(GO:0046373) |
0.0 | 0.2 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.0 | 0.3 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.7 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.3 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 1.0 | GO:0002244 | hematopoietic progenitor cell differentiation(GO:0002244) |
0.0 | 0.1 | GO:0060431 | primary lung bud formation(GO:0060431) |
0.0 | 0.1 | GO:0060964 | regulation of gene silencing by miRNA(GO:0060964) |
0.0 | 0.1 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
0.0 | 0.2 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.3 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 0.7 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.2 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.0 | 0.0 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.0 | 0.2 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.2 | GO:0060482 | lobar bronchus development(GO:0060482) |
0.0 | 1.6 | GO:0042073 | intraciliary transport(GO:0042073) |
0.0 | 0.8 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.0 | 0.2 | GO:0045924 | regulation of female receptivity(GO:0045924) |
0.0 | 0.1 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.1 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.0 | 0.4 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.0 | 0.1 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.4 | GO:0044320 | cellular response to leptin stimulus(GO:0044320) |
0.0 | 0.4 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.0 | 0.1 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.1 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
0.0 | 1.6 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.1 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
0.0 | 0.2 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
0.0 | 0.2 | GO:0032355 | response to estradiol(GO:0032355) |
0.0 | 0.3 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.1 | GO:1903595 | positive regulation of histamine secretion by mast cell(GO:1903595) |
0.0 | 0.6 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
0.0 | 0.4 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
0.0 | 1.7 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.5 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.4 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
0.0 | 0.1 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
0.0 | 0.1 | GO:0048865 | ganglion mother cell fate determination(GO:0007402) stem cell fate commitment(GO:0048865) stem cell fate determination(GO:0048867) |
0.0 | 0.1 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
0.0 | 0.3 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
0.0 | 0.3 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.1 | GO:1903762 | regulation of heart looping(GO:1901207) positive regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903762) positive regulation of ventricular cardiac muscle cell action potential(GO:1903947) positive regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905026) positive regulation of membrane repolarization during cardiac muscle cell action potential(GO:1905033) |
0.0 | 0.6 | GO:0036150 | phosphatidylserine acyl-chain remodeling(GO:0036150) |
0.0 | 0.3 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.1 | GO:0019072 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
0.0 | 0.3 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.9 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 1.7 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.0 | 0.1 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
0.0 | 0.2 | GO:0003073 | regulation of systemic arterial blood pressure(GO:0003073) |
0.0 | 0.5 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 1.2 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.0 | 0.2 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.4 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.0 | 0.2 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.1 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.0 | 0.1 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
0.0 | 0.1 | GO:2000672 | regulation of motor neuron apoptotic process(GO:2000671) negative regulation of motor neuron apoptotic process(GO:2000672) |
0.0 | 0.4 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
0.0 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.1 | GO:0001889 | liver development(GO:0001889) hepaticobiliary system development(GO:0061008) |
0.0 | 0.2 | GO:1990034 | calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
0.0 | 0.1 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
0.0 | 0.1 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.9 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.0 | 2.7 | GO:0030449 | regulation of complement activation(GO:0030449) |
0.0 | 1.7 | GO:0016575 | histone deacetylation(GO:0016575) |
0.0 | 0.1 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.6 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.0 | 0.2 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.0 | 0.1 | GO:0050758 | thymidylate synthase biosynthetic process(GO:0050757) regulation of thymidylate synthase biosynthetic process(GO:0050758) cellular response to folic acid(GO:0071231) |
0.0 | 0.1 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
0.0 | 0.4 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.4 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.1 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.1 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.0 | 0.2 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.0 | 0.1 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.0 | 0.1 | GO:0033490 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
0.0 | 0.3 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.0 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.0 | 0.6 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
0.0 | 0.2 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.1 | GO:0060965 | negative regulation of gene silencing by miRNA(GO:0060965) |
0.0 | 0.8 | GO:0008542 | visual learning(GO:0008542) |
0.0 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.0 | GO:1902299 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
0.0 | 0.2 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.0 | 0.3 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
0.0 | 0.2 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
0.0 | 0.1 | GO:0032264 | IMP salvage(GO:0032264) |
0.0 | 0.2 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
0.0 | 0.2 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.7 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
0.0 | 0.0 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
0.0 | 0.1 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.0 | 0.4 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.1 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
0.0 | 0.1 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
0.0 | 0.5 | GO:1901685 | glutathione derivative metabolic process(GO:1901685) glutathione derivative biosynthetic process(GO:1901687) |
0.0 | 0.0 | GO:1902804 | negative regulation of synaptic vesicle transport(GO:1902804) |
0.0 | 0.2 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.0 | 0.1 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) |
0.0 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.1 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.1 | GO:0019317 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
0.0 | 0.1 | GO:1903756 | positive regulation of dendritic spine maintenance(GO:1902952) regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
0.0 | 0.2 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.2 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.1 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.0 | 0.2 | GO:1904714 | chaperone-mediated autophagy(GO:0061684) regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 1.3 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
0.0 | 0.5 | GO:0007520 | myoblast fusion(GO:0007520) |
0.0 | 0.2 | GO:0000768 | syncytium formation by plasma membrane fusion(GO:0000768) |
0.0 | 0.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.1 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
0.0 | 0.0 | GO:1901656 | glycoside transport(GO:1901656) |
0.0 | 0.0 | GO:0048075 | positive regulation of eye pigmentation(GO:0048075) |
0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.0 | 0.1 | GO:0014068 | positive regulation of phosphatidylinositol 3-kinase signaling(GO:0014068) |
0.0 | 0.2 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.1 | GO:0045657 | apoptotic chromosome condensation(GO:0030263) positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.3 | GO:0031103 | axon regeneration(GO:0031103) |
0.0 | 0.0 | GO:0044111 | development involved in symbiotic interaction(GO:0044111) |
0.0 | 0.3 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
0.0 | 0.1 | GO:0001554 | luteolysis(GO:0001554) |
0.0 | 0.2 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.0 | 0.1 | GO:0017145 | stem cell division(GO:0017145) |
0.0 | 0.1 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
0.0 | 0.1 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 4.7 | GO:0071953 | elastic fiber(GO:0071953) |
0.4 | 2.5 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.3 | 2.0 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.3 | 1.0 | GO:0072534 | perineuronal net(GO:0072534) |
0.3 | 1.6 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.3 | 1.1 | GO:0005667 | transcription factor complex(GO:0005667) |
0.2 | 1.2 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
0.2 | 1.1 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
0.2 | 0.5 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.2 | 4.0 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.2 | 0.8 | GO:0034678 | integrin alpha8-beta1 complex(GO:0034678) |
0.2 | 0.5 | GO:0020005 | symbiont-containing vacuole(GO:0020003) symbiont-containing vacuole membrane(GO:0020005) |
0.1 | 2.4 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 1.5 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
0.1 | 1.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.1 | 1.6 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 1.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.3 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.1 | 0.6 | GO:0042825 | TAP complex(GO:0042825) |
0.1 | 0.3 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.8 | GO:0001739 | sex chromatin(GO:0001739) |
0.1 | 0.6 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.7 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 1.3 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.1 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.2 | GO:0036398 | TCR signalosome(GO:0036398) |
0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.8 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 3.7 | GO:1990391 | DNA repair complex(GO:1990391) |
0.1 | 0.9 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.1 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 1.9 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.2 | GO:0060187 | cell pole(GO:0060187) |
0.1 | 0.4 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
0.0 | 1.6 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
0.0 | 0.8 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.2 | GO:0031673 | H zone(GO:0031673) |
0.0 | 0.3 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.3 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
0.0 | 1.0 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.2 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 1.7 | GO:0090544 | BAF-type complex(GO:0090544) |
0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.4 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.2 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
0.0 | 0.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.4 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.3 | GO:0000235 | astral microtubule(GO:0000235) aster(GO:0005818) |
0.0 | 0.2 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
0.0 | 1.0 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.2 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
0.0 | 0.7 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.3 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.2 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 1.4 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.1 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
0.0 | 0.5 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.4 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
0.0 | 0.9 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.8 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 1.0 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) GAIT complex(GO:0097452) |
0.0 | 0.6 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.8 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.2 | GO:0014802 | terminal cisterna(GO:0014802) |
0.0 | 0.6 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.0 | 0.4 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.8 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.8 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 2.1 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 2.2 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 1.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.5 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 0.6 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 1.2 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.5 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 1.6 | GO:0035577 | azurophil granule membrane(GO:0035577) |
0.0 | 0.2 | GO:0001741 | XY body(GO:0001741) |
0.0 | 0.8 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.2 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.0 | 0.6 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 0.1 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.3 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
0.0 | 0.4 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.4 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
0.0 | 0.8 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 1.2 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 2.0 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.4 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
0.0 | 0.3 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.5 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 1.8 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 1.4 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.5 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.3 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.1 | GO:0097227 | sperm annulus(GO:0097227) |
0.0 | 0.1 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.7 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.5 | 1.6 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
0.3 | 1.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.3 | 3.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.3 | 2.9 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.2 | 1.0 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
0.2 | 1.6 | GO:0004522 | ribonuclease A activity(GO:0004522) |
0.2 | 0.7 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
0.2 | 6.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.2 | 0.7 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
0.2 | 1.7 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.2 | 0.5 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
0.2 | 1.2 | GO:0050682 | AF-2 domain binding(GO:0050682) |
0.2 | 0.5 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
0.1 | 0.6 | GO:0036033 | mediator complex binding(GO:0036033) |
0.1 | 0.5 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.4 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
0.1 | 1.2 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.7 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
0.1 | 0.6 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
0.1 | 1.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.1 | 0.7 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
0.1 | 0.4 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
0.1 | 0.3 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
0.1 | 0.6 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.6 | GO:0045118 | azole transporter activity(GO:0045118) |
0.1 | 0.3 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
0.1 | 1.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.3 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.6 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 1.0 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.1 | 0.9 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.1 | 1.1 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.1 | 0.8 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 1.2 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) TFIIB-class transcription factor binding(GO:0001093) |
0.1 | 0.4 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
0.1 | 0.5 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.3 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.3 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
0.1 | 0.8 | GO:0048039 | ubiquinone binding(GO:0048039) |
0.1 | 0.7 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 3.8 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.8 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.3 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 0.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 0.4 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 0.9 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.1 | 0.3 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.4 | GO:0043532 | angiostatin binding(GO:0043532) |
0.1 | 0.4 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
0.1 | 0.4 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.3 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
0.1 | 2.1 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.1 | 0.5 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.3 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
0.1 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 1.4 | GO:0051400 | BH domain binding(GO:0051400) |
0.1 | 1.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 1.0 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 1.3 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.2 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
0.1 | 0.3 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.1 | 0.2 | GO:0031751 | D4 dopamine receptor binding(GO:0031751) |
0.1 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.3 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.1 | 0.5 | GO:0039706 | co-receptor binding(GO:0039706) |
0.1 | 0.2 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 4.2 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.1 | 0.2 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
0.1 | 0.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.9 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.1 | 0.4 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
0.0 | 1.4 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.0 | 0.7 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
0.0 | 0.8 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
0.0 | 0.2 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
0.0 | 1.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.6 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
0.0 | 0.3 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.0 | GO:0051022 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.2 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 3.4 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.5 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.2 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.5 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
0.0 | 0.1 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
0.0 | 1.1 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.8 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.4 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.2 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
0.0 | 2.5 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 1.0 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
0.0 | 0.1 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
0.0 | 0.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 1.3 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 4.8 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.5 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.2 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.2 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.0 | 0.4 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.0 | 0.1 | GO:0046556 | alpha-L-arabinofuranosidase activity(GO:0046556) |
0.0 | 0.6 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.4 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.5 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.1 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
0.0 | 1.2 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
0.0 | 0.2 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
0.0 | 0.1 | GO:0015616 | DNA translocase activity(GO:0015616) |
0.0 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 1.0 | GO:0034061 | DNA-directed DNA polymerase activity(GO:0003887) DNA polymerase activity(GO:0034061) |
0.0 | 0.3 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.2 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
0.0 | 0.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.2 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.0 | 0.0 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
0.0 | 0.2 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.0 | 0.1 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
0.0 | 0.7 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.0 | 0.4 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.2 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.3 | GO:0031013 | troponin I binding(GO:0031013) |
0.0 | 0.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.3 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.4 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.3 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.3 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 1.8 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.2 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.1 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
0.0 | 0.3 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.0 | 1.6 | GO:0043621 | protein self-association(GO:0043621) |
0.0 | 0.3 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 1.1 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.0 | 0.6 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.0 | 2.0 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 1.2 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
0.0 | 0.6 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.1 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.0 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.0 | 0.1 | GO:0061714 | folic acid receptor activity(GO:0061714) |
0.0 | 1.0 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.2 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
0.0 | 0.2 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.0 | 0.9 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.2 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.0 | 0.1 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.0 | 0.4 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.4 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.4 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.0 | GO:0004961 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
0.0 | 0.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.2 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.0 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.1 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
0.0 | 0.3 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 0.3 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.0 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
0.0 | 0.2 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 1.1 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.2 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.7 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.4 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
0.0 | 0.0 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.1 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
0.0 | 0.2 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.3 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.0 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.5 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.0 | GO:0051748 | UTP:glucose-1-phosphate uridylyltransferase activity(GO:0003983) UTP-monosaccharide-1-phosphate uridylyltransferase activity(GO:0051748) |
0.0 | 0.2 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.0 | 0.3 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
Gene overrepresentation in C2:CP category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.7 | ST_G_ALPHA_I_PATHWAY | G alpha i Pathway |
0.1 | 1.8 | PID_ALK2_PATHWAY | ALK2 signaling events |
0.1 | 5.6 | NABA_PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 1.4 | ST_STAT3_PATHWAY | STAT3 Pathway |
0.1 | 2.7 | ST_MYOCYTE_AD_PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 1.9 | ST_WNT_CA2_CYCLIC_GMP_PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 0.3 | SIG_BCR_SIGNALING_PATHWAY | Members of the BCR signaling pathway |
0.1 | 0.4 | PID_AVB3_INTEGRIN_PATHWAY | Integrins in angiogenesis |
0.0 | 1.1 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.6 | PID_WNT_CANONICAL_PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.8 | PID_CIRCADIAN_PATHWAY | Circadian rhythm pathway |
0.0 | 2.0 | PID_IL6_7_PATHWAY | IL6-mediated signaling events |
0.0 | 0.2 | PID_HDAC_CLASSII_PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 3.0 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.6 | PID_ERB_GENOMIC_PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.6 | PID_TCR_JNK_PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 1.3 | PID_HEDGEHOG_GLI_PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.3 | PID_P38_GAMMA_DELTA_PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.7 | PID_AVB3_OPN_PATHWAY | Osteopontin-mediated events |
0.0 | 0.7 | PID_MAPK_TRK_PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 2.3 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 1.7 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
0.0 | 0.2 | PID_ANGIOPOIETIN_RECEPTOR_PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.9 | PID_WNT_NONCANONICAL_PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 1.1 | PID_ARF6_PATHWAY | Arf6 signaling events |
0.0 | 0.6 | PID_HDAC_CLASSIII_PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 1.0 | PID_BMP_PATHWAY | BMP receptor signaling |
0.0 | 0.8 | PID_PS1_PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.5 | PID_EPO_PATHWAY | EPO signaling pathway |
0.0 | 0.9 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.1 | PID_IL3_PATHWAY | IL3-mediated signaling events |
0.0 | 0.3 | PID_A6B1_A6B4_INTEGRIN_PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.3 | PID_RB_1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.4 | PID_EPHB_FWD_PATHWAY | EPHB forward signaling |
0.0 | 1.1 | PID_REG_GR_PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.6 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.2 | PID_KIT_PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.2 | PID_ARF_3PATHWAY | Arf1 pathway |
0.0 | 3.1 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.2 | PID_ARF6_DOWNSTREAM_PATHWAY | Arf6 downstream pathway |
Gene overrepresentation in C2:CP:REACTOME category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.0 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_ATF6_ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.1 | 2.1 | REACTOME_CIRCADIAN_REPRESSION_OF_EXPRESSION_BY_REV_ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 2.7 | REACTOME_SPHINGOLIPID_DE_NOVO_BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.1 | 0.3 | REACTOME_BINDING_AND_ENTRY_OF_HIV_VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 1.1 | REACTOME_IL_6_SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 0.8 | REACTOME_REGULATION_OF_GENE_EXPRESSION_IN_BETA_CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 0.8 | REACTOME_CDC6_ASSOCIATION_WITH_THE_ORC_ORIGIN_COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.1 | 1.0 | REACTOME_ERK_MAPK_TARGETS | Genes involved in ERK/MAPK targets |
0.0 | 1.2 | REACTOME_OTHER_SEMAPHORIN_INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 1.3 | REACTOME_TERMINATION_OF_O_GLYCAN_BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 2.2 | REACTOME_MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.9 | REACTOME_CTNNB1_PHOSPHORYLATION_CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.7 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 0.3 | REACTOME_APOBEC3G_MEDIATED_RESISTANCE_TO_HIV1_INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.6 | REACTOME_SIGNAL_ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.4 | REACTOME_SYNTHESIS_OF_BILE_ACIDS_AND_BILE_SALTS_VIA_24_HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 1.1 | REACTOME_RNA_POL_I_TRANSCRIPTION_INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.0 | 0.5 | REACTOME_PASSIVE_TRANSPORT_BY_AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.3 | REACTOME_DOPAMINE_NEUROTRANSMITTER_RELEASE_CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.7 | REACTOME_REGULATION_OF_KIT_SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.8 | REACTOME_BOTULINUM_NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.0 | 0.5 | REACTOME_CLASS_C_3_METABOTROPIC_GLUTAMATE_PHEROMONE_RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 1.4 | REACTOME_RNA_POL_III_TRANSCRIPTION | Genes involved in RNA Polymerase III Transcription |
0.0 | 1.1 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.6 | REACTOME_SIGNALING_BY_FGFR1_FUSION_MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.4 | REACTOME_RETROGRADE_NEUROTROPHIN_SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.2 | REACTOME_ACTIVATION_OF_THE_AP1_FAMILY_OF_TRANSCRIPTION_FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.5 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_GOLGI_MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.4 | REACTOME_ACTIVATION_OF_BH3_ONLY_PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.6 | REACTOME_DEGRADATION_OF_THE_EXTRACELLULAR_MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.5 | REACTOME_ADP_SIGNALLING_THROUGH_P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.0 | 0.1 | REACTOME_REGULATION_OF_HYPOXIA_INDUCIBLE_FACTOR_HIF_BY_OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.0 | REACTOME_NEP_NS2_INTERACTS_WITH_THE_CELLULAR_EXPORT_MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 0.5 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_PLASMA_MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.4 | REACTOME_PEROXISOMAL_LIPID_METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 1.2 | REACTOME_LOSS_OF_NLP_FROM_MITOTIC_CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.5 | REACTOME_TRAF6_MEDIATED_IRF7_ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.4 | REACTOME_SIGNALING_BY_HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.4 | REACTOME_CYTOSOLIC_SULFONATION_OF_SMALL_MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.2 | REACTOME_HIGHLY_CALCIUM_PERMEABLE_POSTSYNAPTIC_NICOTINIC_ACETYLCHOLINE_RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.4 | REACTOME_SYNTHESIS_OF_PC | Genes involved in Synthesis of PC |
0.0 | 0.5 | REACTOME_O_LINKED_GLYCOSYLATION_OF_MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.8 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.3 | REACTOME_BRANCHED_CHAIN_AMINO_ACID_CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.6 | REACTOME_ION_TRANSPORT_BY_P_TYPE_ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.2 | REACTOME_LYSOSOME_VESICLE_BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.2 | REACTOME_SIGNALING_BY_NODAL | Genes involved in Signaling by NODAL |