Project
GSE43616: Time-course of wild-type Arabidopsis leaf
Navigation
Downloads
Results for AT3G30210
Z-value: 1.16
Transcription factors associated with AT3G30210
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
AT3G30210
|
AT3G30210 | myb domain protein 121 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| MYB121 | arTal_v1_Chr3_+_11838363_11838363 | -0.22 | 2.6e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| arTal_v1_Chr2_-_4312103_4312162 Show fit | 7.16 |
AT2G10940.2
AT2G10940.1 |
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
|
| arTal_v1_Chr5_+_9072708_9072727 Show fit | 6.82 |
AT5G25980.2
AT5G25980.1 AT5G25980.3 |
glucoside glucohydrolase 2 |
|
| arTal_v1_Chr2_-_16950705_16950705 Show fit | 6.20 |
AT2G40610.1
|
expansin A8 |
|
| arTal_v1_Chr3_+_10255906_10255941 Show fit | 6.10 |
AT3G27690.2
AT3G27690.1 |
photosystem II light harvesting complex protein 2.3 |
|
| arTal_v1_Chr4_-_17777445_17777445 Show fit | 5.08 |
AT4G37800.1
|
xyloglucan endotransglucosylase/hydrolase 7 |
|
| arTal_v1_Chr3_-_16448844_16448844 Show fit | 4.16 |
AT3G44990.1
|
xyloglucan endo-transglycosylase-related 8 |
|
| arTal_v1_Chr4_+_2449434_2449434 Show fit | 4.08 |
AT4G04840.1
|
methionine sulfoxide reductase B6 |
|
| arTal_v1_Chr5_+_4087689_4087689 Show fit | 3.93 |
AT5G12940.1
|
Leucine-rich repeat (LRR) family protein |
|
| arTal_v1_Chr1_+_20614573_20614610 Show fit | 3.71 |
AT1G55260.1
AT1G55260.2 |
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
|
| arTal_v1_Chr5_+_18634041_18634041 Show fit | 3.62 |
AT5G45950.1
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
Network of associatons between targets according to the STRING database.
First level regulatory network of AT3G30210
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 14.8 | GO:0006949 | syncytium formation(GO:0006949) |
| 1.4 | 8.4 | GO:1903428 | photosynthesis, light harvesting in photosystem II(GO:0009769) positive regulation of reactive oxygen species biosynthetic process(GO:1903428) |
| 0.0 | 7.6 | GO:0006631 | fatty acid metabolic process(GO:0006631) |
| 0.1 | 7.3 | GO:0009809 | lignin biosynthetic process(GO:0009809) |
| 0.1 | 6.7 | GO:0010411 | xyloglucan metabolic process(GO:0010411) |
| 0.1 | 6.2 | GO:0007018 | microtubule-based movement(GO:0007018) |
| 0.5 | 5.9 | GO:2000122 | negative regulation of stomatal complex development(GO:2000122) |
| 0.2 | 5.5 | GO:0002213 | defense response to insect(GO:0002213) |
| 0.4 | 4.8 | GO:0043155 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) |
| 0.9 | 4.4 | GO:1903175 | fatty alcohol biosynthetic process(GO:1903175) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 27.9 | GO:0009941 | chloroplast envelope(GO:0009941) |
| 0.1 | 19.9 | GO:0048046 | apoplast(GO:0048046) |
| 0.0 | 12.8 | GO:0009570 | chloroplast stroma(GO:0009570) |
| 0.0 | 12.3 | GO:0030312 | cell wall(GO:0005618) external encapsulating structure(GO:0030312) |
| 0.1 | 9.4 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.9 | 8.4 | GO:0009503 | thylakoid light-harvesting complex(GO:0009503) PSII associated light-harvesting complex II(GO:0009517) light-harvesting complex(GO:0030076) |
| 0.2 | 3.2 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.2 | 3.2 | GO:0009574 | preprophase band(GO:0009574) |
| 0.2 | 3.1 | GO:0010005 | cortical microtubule, transverse to long axis(GO:0010005) |
| 0.2 | 2.5 | GO:0048226 | Casparian strip(GO:0048226) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 12.8 | GO:0016168 | chlorophyll binding(GO:0016168) |
| 0.9 | 6.8 | GO:0019137 | thioglucosidase activity(GO:0019137) |
| 0.1 | 6.6 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.2 | 5.7 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.2 | 5.1 | GO:0016762 | xyloglucan:xyloglucosyl transferase activity(GO:0016762) |
| 0.0 | 4.8 | GO:0009055 | electron carrier activity(GO:0009055) |
| 0.2 | 4.6 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.1 | 4.5 | GO:0043621 | protein self-association(GO:0043621) |
| 0.9 | 4.4 | GO:0042084 | 5-methyltetrahydropteroyltriglutamate-homocysteine S-methyltransferase activity(GO:0003871) methionine synthase activity(GO:0008705) 5-methyltetrahydrofolate-dependent methyltransferase activity(GO:0042084) 5-methyltetrahydropteroyltri-L-glutamate-dependent methyltransferase activity(GO:0042085) |
| 0.5 | 4.2 | GO:0033946 | xyloglucan-specific endo-beta-1,4-glucanase activity(GO:0033946) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.5 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 0.8 | PID ATM PATHWAY | ATM pathway |
| 0.1 | 0.8 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 0.7 | PID E2F PATHWAY | E2F transcription factor network |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 1.2 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.1 | 1.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.1 | 0.9 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.3 | 0.8 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 0.7 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 0.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |