Project
GSE43616: Time-course of wild-type Arabidopsis leaf
Navigation
Downloads
Results for AT1G75080
Z-value: 0.92
Transcription factors associated with AT1G75080
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
AT1G75080
|
AT1G75080 | Brassinosteroid signaling positive regulator (BZR1) family protein |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| BZR1 | arTal_v1_Chr1_+_28185504_28185504 | -0.89 | 3.6e-10 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| arTal_v1_Chr1_+_3157501_3157501 Show fit | 6.66 |
AT1G09750.1
|
Eukaryotic aspartyl protease family protein |
|
| arTal_v1_Chr5_-_25343369_25343369 Show fit | 5.37 |
AT5G63180.1
|
Pectin lyase-like superfamily protein |
|
| arTal_v1_Chr3_+_23345754_23345754 Show fit | 4.47 |
AT3G63200.1
|
PATATIN-like protein 9 |
|
| arTal_v1_Chr3_-_4744263_4744263 Show fit | 4.26 |
AT3G14240.1
|
Subtilase family protein |
|
| arTal_v1_Chr2_-_15137012_15137012 Show fit | 4.23 |
AT2G36050.1
|
ovate family protein 15 |
|
| arTal_v1_Chr5_+_7502427_7502427 Show fit | 4.12 |
AT5G22580.1
|
Stress responsive A/B Barrel Domain-containing protein |
|
| arTal_v1_Chr1_+_25401514_25401514 Show fit | 4.01 |
AT1G67750.1
|
Pectate lyase family protein |
|
| arTal_v1_Chr5_-_2185972_2185972 Show fit | 3.87 |
AT5G07030.1
|
Eukaryotic aspartyl protease family protein |
|
| arTal_v1_Chr1_-_84864_84946 Show fit | 3.86 |
AT1G01190.1
AT1G01190.2 |
cytochrome P450, family 78, subfamily A, polypeptide 8 |
|
| arTal_v1_Chr1_+_5058583_5058680 Show fit | 3.72 |
AT1G14700.4
AT1G14700.1 AT1G14700.3 AT1G14700.2 |
purple acid phosphatase 3 |
Network of associatons between targets according to the STRING database.
First level regulatory network of AT1G75080
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 13.1 | GO:0045490 | pectin catabolic process(GO:0045490) |
| 0.4 | 6.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 | 4.8 | GO:0045492 | xylan biosynthetic process(GO:0045492) |
| 1.1 | 4.4 | GO:0090309 | regulation of methylation-dependent chromatin silencing(GO:0090308) positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.4 | 4.4 | GO:0048354 | mucilage biosynthetic process involved in seed coat development(GO:0048354) |
| 0.1 | 4.3 | GO:0016485 | protein processing(GO:0016485) |
| 0.6 | 3.7 | GO:0016107 | sesquiterpenoid catabolic process(GO:0016107) apocarotenoid catabolic process(GO:0043290) abscisic acid catabolic process(GO:0046345) |
| 0.3 | 3.5 | GO:0043155 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) |
| 0.3 | 3.3 | GO:2000122 | negative regulation of stomatal complex development(GO:2000122) |
| 0.6 | 3.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 30.9 | GO:0005576 | extracellular region(GO:0005576) |
| 0.0 | 21.1 | GO:0044434 | chloroplast part(GO:0044434) |
| 0.0 | 11.4 | GO:0048046 | apoplast(GO:0048046) |
| 0.0 | 7.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.1 | 6.6 | GO:0010287 | plastoglobule(GO:0010287) |
| 0.5 | 4.6 | GO:0010369 | chromocenter(GO:0010369) |
| 0.2 | 3.5 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.1 | 3.2 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.3 | 3.0 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 2.9 | GO:0016607 | nuclear speck(GO:0016607) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 9.8 | GO:0016837 | carbon-oxygen lyase activity, acting on polysaccharides(GO:0016837) pectate lyase activity(GO:0030570) |
| 0.0 | 8.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 7.5 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.5 | 6.6 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 6.2 | GO:0020037 | heme binding(GO:0020037) |
| 0.4 | 4.9 | GO:0016847 | 1-aminocyclopropane-1-carboxylate synthase activity(GO:0016847) |
| 0.2 | 4.9 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.5 | 4.8 | GO:0010429 | methyl-CpNpG binding(GO:0010428) methyl-CpNpN binding(GO:0010429) |
| 0.2 | 4.8 | GO:0008810 | cellulase activity(GO:0008810) |
| 0.1 | 4.6 | GO:0046910 | pectinesterase inhibitor activity(GO:0046910) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 2.8 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.1 | 1.4 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.2 | 0.5 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.0 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 2.4 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.3 | 1.7 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.5 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |