Project
GSE130291:vernalization in Arabidopsis thaliana
Navigation
Downloads
Results for AT5G01380
Z-value: 2.37
Transcription factors associated with AT5G01380
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
AT5G01380
|
AT5G01380 | Homeodomain-like superfamily protein |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| AT5G01380 | arTal_v1_Chr5_-_157601_157601 | 0.51 | 6.1e-02 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| arTal_v1_Chr4_+_2449434_2449434 Show fit | 6.24 |
AT4G04840.1
|
methionine sulfoxide reductase B6 |
|
| arTal_v1_Chr5_+_19434758_19434758 Show fit | 5.53 |
AT5G47990.1
|
cytochrome P450, family 705, subfamily A, polypeptide 5 |
|
| arTal_v1_Chr5_-_15167859_15167864 Show fit | 5.22 |
AT5G38020.2
AT5G38020.1 |
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
|
| arTal_v1_Chr4_+_1931883_1931883 Show fit | 3.53 |
AT4G04020.1
|
fibrillin |
|
| arTal_v1_Chr4_+_9759203_9759203 Show fit | 3.51 |
AT4G17500.1
|
ethylene responsive element binding factor 1 |
|
| arTal_v1_Chr3_+_22142856_22142856 Show fit | 3.51 |
AT3G59940.1
|
Galactose oxidase/kelch repeat superfamily protein |
|
| arTal_v1_Chr1_-_2747936_2747967 Show fit | 3.44 |
AT1G08630.6
AT1G08630.7 AT1G08630.5 AT1G08630.2 |
threonine aldolase 1 |
|
| arTal_v1_Chr4_-_11592238_11592238 Show fit | 3.32 |
AT4G21850.2
|
methionine sulfoxide reductase B9 |
|
| arTal_v1_Chr2_+_13036814_13036925 Show fit | 3.25 |
AT2G30600.4
AT2G30600.5 AT2G30600.1 AT2G30600.3 |
BTB/POZ domain-containing protein |
|
| arTal_v1_Chr4_-_11592425_11592425 Show fit | 3.24 |
AT4G21850.1
|
methionine sulfoxide reductase B9 |
Network of associatons between targets according to the STRING database.
First level regulatory network of AT5G01380
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 18.3 | GO:0030091 | protein repair(GO:0030091) |
| 0.3 | 12.0 | GO:2000022 | regulation of jasmonic acid mediated signaling pathway(GO:2000022) |
| 0.1 | 10.3 | GO:0010200 | response to chitin(GO:0010200) |
| 1.5 | 8.7 | GO:0006567 | threonine catabolic process(GO:0006567) |
| 0.1 | 6.3 | GO:0006633 | fatty acid biosynthetic process(GO:0006633) |
| 1.4 | 5.5 | GO:0080003 | thalianol metabolic process(GO:0080003) |
| 0.1 | 4.0 | GO:0010411 | xyloglucan metabolic process(GO:0010411) |
| 0.6 | 3.9 | GO:0010438 | cellular response to sulfur starvation(GO:0010438) |
| 0.2 | 3.6 | GO:0006032 | aminoglycan catabolic process(GO:0006026) chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) amino sugar catabolic process(GO:0046348) glucosamine-containing compound catabolic process(GO:1901072) |
| 0.4 | 3.5 | GO:0043155 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 5.1 | GO:0010319 | stromule(GO:0010319) |
| 0.0 | 4.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.3 | 3.4 | GO:0010168 | ER body(GO:0010168) |
| 0.1 | 2.0 | GO:0012511 | monolayer-surrounded lipid storage body(GO:0012511) |
| 0.1 | 1.8 | GO:0005811 | lipid particle(GO:0005811) |
| 0.3 | 1.7 | GO:0090397 | stigma papilla(GO:0090397) |
| 0.2 | 1.6 | GO:0009538 | photosystem I reaction center(GO:0009538) |
| 0.0 | 1.6 | GO:0009523 | photosystem II(GO:0009523) |
| 0.0 | 1.4 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.1 | 1.2 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.7 | 18.3 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 1.7 | 8.7 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 4.7 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
| 0.0 | 4.5 | GO:0001012 | RNA polymerase II regulatory region sequence-specific DNA binding(GO:0000977) RNA polymerase II regulatory region DNA binding(GO:0001012) |
| 0.8 | 4.1 | GO:0016629 | 12-oxophytodienoate reductase activity(GO:0016629) |
| 0.0 | 3.8 | GO:0008757 | S-adenosylmethionine-dependent methyltransferase activity(GO:0008757) |
| 0.1 | 3.6 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.1 | 3.1 | GO:0016682 | oxidoreductase activity, acting on diphenols and related substances as donors, oxygen as acceptor(GO:0016682) |
| 0.1 | 3.0 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) |
| 0.2 | 2.9 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.8 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.1 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |