GSE130291:vernalization in Arabidopsis thaliana
Gene Symbol | Gene ID | Gene Info |
---|---|---|
AT3G50260
|
AT3G50260 | cooperatively regulated by ethylene and jasmonate 1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
CEJ1 | arTal_v1_Chr3_+_18634546_18634546 | -0.20 | 4.9e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
Chr2_-_17712290 | 4.65 |
AT2G42540.2
AT2G42540.4 AT2G42540.1 AT2G42540.3 |
COR15A
|
cold-regulated 15a |
Chr5_+_5209717 | 3.91 |
AT5G15960.1
|
KIN1
|
stress-responsive protein (KIN1) / stress-induced protein (KIN1) |
Chr1_+_28975255 | 3.78 |
AT1G77120.1
|
ADH1
|
alcohol dehydrogenase 1 |
Chr2_-_17710433 | 3.65 |
AT2G42530.1
|
COR15B
|
cold regulated 15b |
Chr5_+_21240717 | 3.20 |
AT5G52310.1
|
LTI78
|
low-temperature-responsive protein 78 (LTI78) / desiccation-responsive protein 29A (RD29A) |
Chr5_-_14753088 | 2.94 |
AT5G37260.1
|
RVE2
|
Homeodomain-like superfamily protein |
Chr1_+_3019639 | 2.92 |
AT1G09350.1
|
GolS3
|
galactinol synthase 3 |
Chr5_-_17199793 | 2.87 |
AT5G42900.1
AT5G42900.3 AT5G42900.2 |
COR27
|
cold regulated protein 27 |
Chr1_-_10289666 | 2.84 |
AT1G29395.1
|
COR413IM1
|
COLD REGULATED 314 INNER MEMBRANE 1 |
Chr3_+_4104463 | 2.76 |
AT3G12900.1
|
AT3G12900
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
Chr1_+_3020221 | 2.74 |
AT1G09350.2
|
GolS3
|
galactinol synthase 3 |
Chr3_+_20612693 | 2.61 |
AT3G55580.1
|
AT3G55580
|
Regulator of chromosome condensation (RCC1) family protein |
Chr4_+_14954204 | 2.61 |
AT4G30650.1
|
AT4G30650
|
Low temperature and salt responsive protein family |
Chr4_+_10707344 | 2.44 |
AT4G19690.2
AT4G19690.1 |
IRT1
|
iron-regulated transporter 1 |
Chr5_+_5211719 | 2.42 |
AT5G15970.1
|
KIN2
|
stress-responsive protein (KIN2) / stress-induced protein (KIN2) / cold-responsive protein (COR6.6) / cold-regulated protein (COR6.6) |
Chr1_-_5765798 | 2.41 |
AT1G16850.1
|
AT1G16850
|
transmembrane protein |
Chr1_+_209208 | 2.33 |
AT1G01580.1
|
FRO2
|
ferric reduction oxidase 2 |
Chr1_+_208995 | 2.32 |
AT1G01580.2
|
FRO2
|
ferric reduction oxidase 2 |
Chr4_-_15954803 | 2.29 |
AT4G33070.1
|
AT4G33070
|
Thiamine pyrophosphate dependent pyruvate decarboxylase family protein |
Chr5_+_20151163 | 2.26 |
AT5G49640.1
|
AT5G49640
|
hypothetical protein |
Chr2_+_15106940 | 2.03 |
AT2G35960.1
|
NHL12
|
NDR1/HIN1-like 12 |
Chr3_-_23334034 | 1.98 |
AT3G63160.1
|
OEP6
|
outer envelope membrane protein |
Chr2_+_6893949 | 1.98 |
AT2G15830.1
|
AT2G15830
|
hypothetical protein |
Chr3_-_20576249 | 1.89 |
AT3G55500.1
|
EXPA16
|
expansin A16 |
Chr1_-_22280593 | 1.87 |
AT1G60470.1
|
GolS4
|
galactinol synthase 4 |
Chr3_+_6023844 | 1.86 |
AT3G17609.2
AT3G17609.3 AT3G17609.4 AT3G17609.1 |
HYH
|
HY5-homolog |
Chr3_-_7796310 | 1.84 |
AT3G22120.1
AT3G22120.2 |
CWLP
|
cell wall-plasma membrane linker protein |
Chr2_-_19370478 | 1.84 |
AT2G47180.1
|
GolS1
|
galactinol synthase 1 |
Chr2_+_12004658 | 1.81 |
AT2G28160.1
AT2G28160.2 |
FRU
|
FER-like regulator of iron uptake |
Chr2_-_12415661 | 1.81 |
AT2G28900.1
|
OEP16-1
|
outer plastid envelope protein 16-1 |
Chr1_-_3756998 | 1.81 |
AT1G11210.1
|
AT1G11210
|
cotton fiber protein, putative (DUF761) |
Chr3_+_19845097 | 1.75 |
AT3G53530.2
AT3G53530.1 |
NAKR3
|
Chloroplast-targeted copper chaperone protein |
Chr3_-_8085669 | 1.74 |
AT3G22840.1
|
ELIP1
|
Chlorophyll A-B binding family protein |
Chr3_+_2441565 | 1.73 |
AT3G07650.4
AT3G07650.1 AT3G07650.3 AT3G07650.2 |
COL9
|
CONSTANS-like 9 |
Chr4_+_9028262 | 1.72 |
AT4G15910.1
|
DI21
|
drought-induced 21 |
Chr5_-_6725966 | 1.71 |
AT5G19890.1
|
AT5G19890
|
Peroxidase superfamily protein |
Chr2_+_13381767 | 1.70 |
AT2G31380.1
|
STH
|
salt tolerance homologue |
Chr2_+_9126263 | 1.69 |
AT2G21320.1
|
BBX18
|
B-box zinc finger family protein |
Chr2_-_12343443 | 1.67 |
AT2G28780.1
|
AT2G28780
|
P-hydroxybenzoic acid efflux pump subunit |
Chr5_-_7054281 | 1.66 |
AT5G20830.3
|
SUS1
|
sucrose synthase 1 |
Chr1_-_18238497 | 1.65 |
AT1G49310.1
|
AT1G49310
|
transmembrane protein |
Chr5_-_7054713 | 1.62 |
AT5G20830.1
|
SUS1
|
sucrose synthase 1 |
Chr5_+_19481897 | 1.62 |
AT5G48070.1
|
XTH20
|
xyloglucan endotransglucosylase/hydrolase 20 |
Chr3_-_17475274 | 1.58 |
AT3G47420.3
AT3G47420.1 AT3G47420.2 |
G3Pp1
|
putative glycerol-3-phosphate transporter 1 |
Chr2_+_528179 | 1.58 |
AT2G02100.1
|
LCR69
|
low-molecular-weight cysteine-rich 69 |
Chr5_-_7055398 | 1.58 |
AT5G20830.2
|
SUS1
|
sucrose synthase 1 |
Chr1_-_17266724 | 1.58 |
AT1G46768.3
AT1G46768.2 AT1G46768.1 |
RAP2.1
|
related to AP2 1 |
Chr1_+_4662698 | 1.56 |
AT1G13609.1
AT1G13609.2 |
AT1G13609
|
Defensin-like (DEFL) family protein |
Chr1_+_16263805 | 1.54 |
AT1G43160.1
|
RAP2.6
|
related to AP2 6 |
Chr1_-_7086873 | 1.53 |
AT1G20440.1
|
COR47
|
cold-regulated 47 |
Chr4_+_17639 | 1.52 |
AT4G00050.1
AT4G00050.3 AT4G00050.2 |
UNE10
|
basic helix-loop-helix (bHLH) DNA-binding superfamily protein |
Chr5_-_19563832 | 1.52 |
AT5G48250.1
|
BBX8
|
B-box type zinc finger protein with CCT domain-containing protein |
Chr1_-_16917053 | 1.51 |
AT1G44800.1
|
SIAR1
|
nodulin MtN21 /EamA-like transporter family protein |
Chr3_-_23195917 | 1.49 |
AT3G62700.1
|
ABCC14
|
multidrug resistance-associated protein 10 |
Chr1_+_27538190 | 1.49 |
AT1G73220.1
|
OCT1
|
organic cation/carnitine transporter1 |
Chr3_-_10599042 | 1.45 |
AT3G28345.1
|
ABCB15
|
ABC transporter family protein |
Chr2_-_18082776 | 1.45 |
AT2G43590.1
|
AT2G43590
|
Chitinase family protein |
Chr1_+_28498821 | 1.45 |
AT1G75900.1
|
AT1G75900
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
Chr5_-_21992812 | 1.45 |
AT5G54190.2
AT5G54190.1 |
PORA
|
protochlorophyllide oxidoreductase A |
Chr1_+_22198266 | 1.44 |
AT1G60190.1
|
PUB19
|
ARM repeat superfamily protein |
Chr4_-_9583290 | 1.42 |
AT4G17030.1
|
EXLB1
|
expansin-like B1 |
Chr1_-_7089606 | 1.41 |
AT1G20450.1
AT1G20450.2 |
ERD10
|
Dehydrin family protein |
Chr2_+_7316789 | 1.41 |
AT2G16890.3
AT2G16890.2 AT2G16890.1 AT2G16890.4 |
AT2G16890
|
UDP-Glycosyltransferase superfamily protein |
Chr5_+_17937622 | 1.40 |
AT5G44530.3
AT5G44530.2 AT5G44530.1 |
AT5G44530
|
Subtilase family protein |
Chr3_-_20816035 | 1.40 |
AT3G56090.1
|
FER3
|
ferritin 3 |
Chr1_+_6763765 | 1.40 |
AT1G19530.1
AT1G19530.2 |
AT1G19530
|
DNA polymerase epsilon catalytic subunit A |
Chr5_+_22388782 | 1.39 |
AT5G55180.2
|
AT5G55180
|
O-Glycosyl hydrolases family 17 protein |
Chr3_-_20629295 | 1.38 |
AT3G55610.1
|
P5CS2
|
delta 1-pyrroline-5-carboxylate synthase 2 |
Chr1_+_17766738 | 1.38 |
AT1G48100.1
|
AT1G48100
|
Pectin lyase-like superfamily protein |
Chr2_+_17057388 | 1.38 |
AT2G40880.1
|
CYSA
|
cystatin A |
Chr5_+_2866222 | 1.37 |
AT5G09220.1
|
AAP2
|
amino acid permease 2 |
Chr2_+_13987669 | 1.36 |
AT2G32960.1
|
PFA-DSP2
|
Phosphotyrosine protein phosphatases superfamily protein |
Chr1_-_10164452 | 1.36 |
AT1G29090.1
|
AT1G29090
|
Cysteine proteinases superfamily protein |
Chr5_+_22388521 | 1.36 |
AT5G55180.1
|
AT5G55180
|
O-Glycosyl hydrolases family 17 protein |
Chr1_-_507268 | 1.36 |
AT1G02460.1
|
AT1G02460
|
Pectin lyase-like superfamily protein |
Chr3_+_3923969 | 1.35 |
AT3G12320.3
|
AT3G12320
|
hypothetical protein |
Chr3_-_20629093 | 1.35 |
AT3G55610.2
|
P5CS2
|
delta 1-pyrroline-5-carboxylate synthase 2 |
Chr1_+_23740493 | 1.33 |
AT1G63980.1
AT1G63980.2 |
AT1G63980
|
D111/G-patch domain-containing protein |
Chr3_+_3923515 | 1.33 |
AT3G12320.1
|
AT3G12320
|
hypothetical protein |
Chr3_-_21085245 | 1.33 |
AT3G56970.1
|
bHLH38
|
basic helix-loop-helix (bHLH) DNA-binding superfamily protein |
Chr3_+_5025383 | 1.32 |
AT3G14940.2
|
PPC3
|
phosphoenolpyruvate carboxylase 3 |
Chr2_+_2026162 | 1.32 |
AT2G05520.4
AT2G05520.5 AT2G05520.6 AT2G05520.3 |
GRP-3
|
glycine-rich protein 3 |
Chr5_-_23117403 | 1.32 |
AT5G57110.3
AT5G57110.1 AT5G57110.2 |
ACA8
|
autoinhibited Ca2+ -ATPase, isoform 8 |
Chr1_-_2711000 | 1.31 |
AT1G08560.1
|
SYP111
|
syntaxin of plants 111 |
Chr5_+_21771811 | 1.31 |
AT5G53590.1
|
AT5G53590
|
SAUR-like auxin-responsive protein family |
Chr1_-_23251195 | 1.31 |
AT1G62780.1
|
AT1G62780
|
dimethylallyl, adenosine tRNA methylthiotransferase |
Chr3_+_5025184 | 1.31 |
AT3G14940.1
|
PPC3
|
phosphoenolpyruvate carboxylase 3 |
Chr1_-_598657 | 1.30 |
AT1G02730.1
|
CSLD5
|
cellulose synthase-like D5 |
Chr2_+_6950041 | 1.29 |
AT2G15970.2
|
COR413-PM1
|
cold regulated 413 plasma membrane 1 |
Chr3_+_5720941 | 1.29 |
AT3G16800.5
AT3G16800.4 AT3G16800.2 AT3G16800.6 AT3G16800.1 |
AT3G16800
|
Protein phosphatase 2C family protein |
Chr2_+_6949851 | 1.29 |
AT2G15970.1
|
COR413-PM1
|
cold regulated 413 plasma membrane 1 |
Chr1_+_28829243 | 1.28 |
AT1G76800.1
|
AT1G76800
|
Vacuolar iron transporter (VIT) family protein |
Chr1_-_27755297 | 1.27 |
AT1G73810.1
|
AT1G73810
|
Core-2/I-branching beta-1,6-N-acetylglucosaminyltransferase family protein |
Chr3_+_19825267 | 1.27 |
AT3G53480.1
|
ABCG37
|
pleiotropic drug resistance 9 |
Chr5_-_5759817 | 1.26 |
AT5G17460.3
AT5G17460.2 AT5G17460.1 |
AT5G17460
|
glutamyl-tRNA (Gln) amidotransferase subunit C |
Chr3_+_3923735 | 1.26 |
AT3G12320.2
|
AT3G12320
|
hypothetical protein |
Chr1_-_8189220 | 1.26 |
AT1G23090.4
AT1G23090.1 AT1G23090.3 AT1G23090.2 |
AST91
|
sulfate transporter 91 |
Chr5_+_2657054 | 1.25 |
AT5G08260.1
|
scpl35
|
serine carboxypeptidase-like 35 |
Chr2_-_16664431 | 1.25 |
AT2G39920.4
AT2G39920.1 AT2G39920.3 AT2G39920.2 |
AT2G39920
|
HAD superfamily, subfamily IIIB acid phosphatase |
Chr1_+_29356346 | 1.24 |
AT1G78070.2
AT1G78070.3 |
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
Chr1_+_25508639 | 1.23 |
AT1G68050.1
|
FKF1
|
flavin-binding, kelch repeat, f box 1 |
Chr1_+_24551807 | 1.23 |
AT1G65960.3
AT1G65960.1 |
GAD2
|
glutamate decarboxylase 2 |
Chr1_-_12224000 | 1.23 |
AT1G33720.5
AT1G33720.1 AT1G33720.3 AT1G33720.2 AT1G33720.4 |
CYP76C6
|
cytochrome P450, family 76, subfamily C, polypeptide 6 |
Chr4_+_9865103 | 1.23 |
AT4G17730.2
AT4G17730.1 |
SYP23
|
syntaxin of plants 23 |
Chr1_+_7785708 | 1.23 |
AT1G22065.1
|
AT1G22065
|
hypothetical protein |
Chr4_+_12827856 | 1.23 |
AT4G24960.1
AT4G24960.3 AT4G24960.2 |
HVA22D
|
HVA22 homologue D |
Chr5_-_17022723 | 1.22 |
AT5G42570.1
|
AT5G42570
|
B-cell receptor-associated 31-like protein |
Chr3_+_11810726 | 1.22 |
AT3G30180.1
|
BR6OX2
|
brassinosteroid-6-oxidase 2 |
Chr5_-_1994824 | 1.21 |
AT5G06530.2
AT5G06530.3 AT5G06530.4 AT5G06530.1 |
ABCG22
|
ABC-2 type transporter family protein |
Chr1_+_24554413 | 1.21 |
AT1G65960.4
|
GAD2
|
glutamate decarboxylase 2 |
Chr4_-_433938 | 1.21 |
AT4G01000.2
AT4G01000.1 |
AT4G01000
|
Ubiquitin-like superfamily protein |
Chr3_+_4449259 | 1.20 |
AT3G13610.1
|
AT3G13610
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
Chr1_-_3167924 | 1.20 |
AT1G09780.1
|
iPGAM1
|
Phosphoglycerate mutase, 2,3-bisphosphoglycerate-independent |
Chr1_+_27241696 | 1.20 |
AT1G72360.2
AT1G72360.3 AT1G72360.1 |
ERF73
|
Integrase-type DNA-binding superfamily protein |
Chr1_-_4845847 | 1.20 |
AT1G14170.2
AT1G14170.1 AT1G14170.3 |
AT1G14170
|
RNA-binding KH domain-containing protein |
Chr1_+_27778984 | 1.20 |
AT1G73870.1
|
BBX16
|
B-box type zinc finger protein with CCT domain-containing protein |
Chr2_+_2025991 | 1.20 |
AT2G05520.2
AT2G05520.1 |
GRP-3
|
glycine-rich protein 3 |
Chr3_-_4974521 | 1.20 |
AT3G14810.1
AT3G14810.2 |
MSL5
|
mechanosensitive channel of small conductance-like 5 |
Chr4_-_13864659 | 1.20 |
AT4G27830.1
|
BGLU10
|
beta glucosidase 10 |
Chr4_-_13864327 | 1.19 |
AT4G27830.2
|
BGLU10
|
beta glucosidase 10 |
Chr4_+_8839256 | 1.19 |
AT4G15450.1
AT4G15450.2 |
AT4G15450
|
Senescence/dehydration-associated protein-like protein |
Chr4_+_16542242 | 1.19 |
AT4G34650.1
|
SQS2
|
squalene synthase 2 |
Chr3_+_23211287 | 1.18 |
AT3G62740.2
AT3G62740.1 |
BGLU7
|
beta glucosidase 7 |
Chr3_-_19747114 | 1.18 |
AT3G53260.1
|
PAL2
|
phenylalanine ammonia-lyase 2 |
Chr1_+_7404328 | 1.18 |
AT1G21140.1
|
AT1G21140
|
Vacuolar iron transporter (VIT) family protein |
Chr3_+_5705541 | 1.18 |
AT3G16770.1
|
EBP
|
ethylene-responsive element binding protein |
Chr5_-_8358546 | 1.18 |
AT5G24470.1
|
PRR5
|
two-component response regulator-like protein |
Chr1_+_25701770 | 1.17 |
AT1G68500.1
|
AT1G68500
|
hypothetical protein |
Chr3_-_20142763 | 1.17 |
AT3G54400.1
|
AT3G54400
|
Eukaryotic aspartyl protease family protein |
Chr5_+_2563366 | 1.17 |
AT5G08000.1
AT5G08000.2 |
E13L3
|
glucan endo-1,3-beta-glucosidase-like protein 3 |
Chr3_+_1225919 | 1.17 |
AT3G04550.1
|
AT3G04550
|
rubisco accumulation factor-like protein |
Chr5_+_3536189 | 1.16 |
AT5G11110.1
|
SPS2F
|
sucrose phosphate synthase 2F |
Chr2_+_1966806 | 1.16 |
AT2G05380.1
AT2G05380.2 |
GRP3S
|
glycine-rich protein 3 short isoform |
Chr3_-_6564424 | 1.16 |
AT3G19030.1
|
AT3G19030
|
transcription initiation factor TFIID subunit 1b-like protein |
Chr5_+_20949291 | 1.16 |
AT5G51570.1
|
AT5G51570
|
SPFH/Band 7/PHB domain-containing membrane-associated protein family |
Chr1_-_40945 | 1.16 |
AT1G01070.2
AT1G01070.1 |
UMAMIT28
|
nodulin MtN21 /EamA-like transporter family protein |
Chr2_+_1966610 | 1.15 |
AT2G05380.3
|
GRP3S
|
glycine-rich protein 3 short isoform |
Chr3_-_2699257 | 1.15 |
AT3G08860.2
|
PYD4
|
PYRIMIDINE 4 |
Chr2_-_856725 | 1.14 |
AT2G02950.1
|
PKS1
|
phytochrome kinase substrate 1 |
Chr5_+_8687188 | 1.14 |
AT5G25160.1
|
ZFP3
|
zinc finger protein 3 |
Chr1_+_29354944 | 1.14 |
AT1G78070.1
|
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
Chr1_-_11719988 | 1.14 |
AT1G32450.1
|
NRT1.5
|
nitrate transporter 1.5 |
Chr3_+_8172479 | 1.13 |
AT3G23000.1
|
CIPK7
|
CBL-interacting protein kinase 7 |
Chr2_+_18061716 | 1.13 |
AT2G43500.1
AT2G43500.3 AT2G43500.4 AT2G43500.5 AT2G43500.6 AT2G43500.7 AT2G43500.2 AT2G43500.8 |
AT2G43500
|
Plant regulator RWP-RK family protein |
Chr1_-_698591 | 1.13 |
AT1G03020.1
|
AT1G03020
|
Thioredoxin superfamily protein |
Chr5_+_6718206 | 1.13 |
AT5G19875.1
|
AT5G19875
|
transmembrane protein |
Chr5_-_17755742 | 1.13 |
AT5G44110.2
AT5G44110.4 AT5G44110.3 AT5G44110.1 |
ABCI21
|
P-loop containing nucleoside triphosphate hydrolases superfamily protein |
Chr3_-_5173001 | 1.12 |
AT3G15354.4
AT3G15354.1 AT3G15354.2 AT3G15354.3 |
SPA3
|
SPA1-related 3 |
Chr3_-_19139423 | 1.12 |
AT3G51600.1
|
LTP5
|
lipid transfer protein 5 |
Chr2_-_13392927 | 1.11 |
AT2G31410.1
|
AT2G31410
|
coiled-coil protein |
Chr2_-_827994 | 1.11 |
AT2G02850.1
|
ARPN
|
plantacyanin |
Chr3_+_22635803 | 1.11 |
AT3G61160.3
AT3G61160.6 AT3G61160.5 AT3G61160.4 AT3G61160.2 AT3G61160.1 |
AT3G61160
|
Protein kinase superfamily protein |
Chr4_+_18160903 | 1.11 |
AT4G38960.2
AT4G38960.6 AT4G38960.5 AT4G38960.1 AT4G38960.4 |
BBX19
|
B-box type zinc finger family protein |
Chr1_+_18400003 | 1.11 |
AT1G49720.1
AT1G49720.2 AT1G49720.3 |
ABF1
|
abscisic acid responsive element-binding factor 1 |
Chr3_+_673428 | 1.10 |
AT3G02990.1
|
HSFA1E
|
heat shock transcription factor A1E |
Chr1_+_24552003 | 1.10 |
AT1G65960.2
|
GAD2
|
glutamate decarboxylase 2 |
Chr1_+_18035967 | 1.10 |
AT1G48750.1
|
AT1G48750
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr3_-_2699420 | 1.10 |
AT3G08860.1
|
PYD4
|
PYRIMIDINE 4 |
Chr1_-_156011 | 1.09 |
AT1G01420.1
|
UGT72B3
|
UDP-glucosyl transferase 72B3 |
Chr5_+_6673874 | 1.09 |
AT5G19740.1
|
AT5G19740
|
Peptidase M28 family protein |
Chr2_-_17065813 | 1.09 |
AT2G40900.1
|
UMAMIT11
|
nodulin MtN21 /EamA-like transporter family protein |
Chr2_-_19287590 | 1.08 |
AT2G46940.1
|
AT2G46940
|
fold protein |
Chr2_-_8035412 | 1.08 |
AT2G18520.1
|
AT2G18520
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
Chr2_-_9266393 | 1.08 |
AT2G21660.2
|
GRP7
|
cold, circadian rhythm, and rna binding 2 |
Chr2_+_13814543 | 1.08 |
AT2G32540.1
|
CSLB04
|
cellulose synthase-like B4 |
Chr4_-_9844290 | 1.08 |
AT4G17680.3
AT4G17680.2 AT4G17680.1 |
AT4G17680
|
SBP (S-ribonuclease binding protein) family protein |
Chr5_+_17973775 | 1.08 |
AT5G44575.1
|
AT5G44575
|
hypothetical protein |
Chr3_-_1958304 | 1.08 |
AT3G06430.1
|
PPR2
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
Chr1_-_28094915 | 1.07 |
AT1G74770.2
AT1G74770.1 |
AT1G74770
|
zinc ion binding protein |
Chr3_+_484256 | 1.07 |
AT3G02370.1
AT3G02370.4 AT3G02370.2 AT3G02370.3 |
AT3G02370
|
tRNA-splicing endonuclease subunit |
Chr3_-_19078955 | 1.07 |
AT3G51400.1
|
AT3G51400
|
hypothetical protein (DUF241) |
Chr1_-_8414886 | 1.07 |
AT1G23800.1
AT1G23800.2 |
ALDH2B7
|
aldehyde dehydrogenase 2B7 |
Chr1_-_156178 | 1.07 |
AT1G01420.2
|
UGT72B3
|
UDP-glucosyl transferase 72B3 |
Chr4_+_10103866 | 1.07 |
AT4G18280.1
|
AT4G18280
|
glycine-rich cell wall protein-like protein |
Chr5_-_7385833 | 1.07 |
AT5G22310.1
|
AT5G22310
|
trichohyalin-like protein |
Chr2_-_9056481 | 1.07 |
AT2G21130.1
|
AT2G21130
|
Cyclophilin-like peptidyl-prolyl cis-trans isomerase family protein |
Chr5_+_22515391 | 1.07 |
AT5G55580.1
AT5G55580.3 AT5G55580.2 |
AT5G55580
|
Mitochondrial transcription termination factor family protein |
Chr4_-_17687105 | 1.06 |
AT4G37640.1
|
ACA2
|
calcium ATPase 2 |
Chr3_+_22298549 | 1.06 |
AT3G60330.4
AT3G60330.1 |
HA7
|
H[+]-ATPase 7 |
Chr3_+_22298373 | 1.06 |
AT3G60330.2
AT3G60330.3 |
HA7
|
H[+]-ATPase 7 |
Chr4_-_6479165 | 1.06 |
AT4G10480.2
AT4G10480.1 |
AT4G10480
|
Nascent polypeptide-associated complex (NAC), alpha subunit family protein |
Chr3_+_4403355 | 1.06 |
AT3G13510.1
|
AT3G13510
|
carboxyl-terminal peptidase, putative (DUF239) |
Chr5_+_21020014 | 1.06 |
AT5G51750.1
|
SBT1.3
|
subtilase 1.3 |
Chr2_-_14310608 | 1.06 |
AT2G33830.2
|
AT2G33830
|
Dormancy/auxin associated family protein |
Chr4_+_16543154 | 1.05 |
AT4G34650.2
|
SQS2
|
squalene synthase 2 |
Chr5_+_5268421 | 1.05 |
AT5G16130.1
|
AT5G16130
|
Ribosomal protein S7e family protein |
Chr3_-_5845220 | 1.05 |
AT3G17130.1
|
AT3G17130
|
Plant invertase/pectin methylesterase inhibitor superfamily protein |
Chr1_-_1286619 | 1.05 |
AT1G04620.1
|
HCAR
|
coenzyme F420 hydrogenase family / dehydrogenase, beta subunit family |
Chr1_-_30142697 | 1.05 |
AT1G80130.1
|
AT1G80130
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
Chr1_-_18753941 | 1.05 |
AT1G50630.1
AT1G50630.2 |
AT1G50630
|
extracellular ligand-gated ion channel protein (DUF3537) |
Chr1_-_29869784 | 1.05 |
AT1G79410.1
|
OCT5
|
organic cation/carnitine transporter5 |
Chr5_+_25756272 | 1.05 |
AT5G64420.1
|
AT5G64420
|
DNA polymerase V family |
Chr3_+_3776177 | 1.05 |
AT3G11930.2
AT3G11930.3 AT3G11930.1 AT3G11930.4 |
AT3G11930
|
Adenine nucleotide alpha hydrolases-like superfamily protein |
Chr5_+_23701392 | 1.05 |
AT5G58660.1
AT5G58660.2 |
AT5G58660
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
Chr5_+_3157694 | 1.04 |
AT5G10100.1
AT5G10100.3 AT5G10100.4 |
TPPI
|
Haloacid dehalogenase-like hydrolase (HAD) superfamily protein |
Chr5_+_17951442 | 1.04 |
AT5G44565.2
AT5G44565.1 AT5G44565.3 |
AT5G44565
|
transmembrane protein |
Chr5_+_18444607 | 1.04 |
AT5G45510.2
AT5G45510.1 |
AT5G45510
|
Leucine-rich repeat (LRR) family protein |
Chr2_-_9266557 | 1.03 |
AT2G21660.1
|
GRP7
|
cold, circadian rhythm, and rna binding 2 |
Chr4_-_810574 | 1.03 |
AT4G01870.1
AT4G01870.2 |
AT4G01870
|
tolB protein-like protein |
Chr3_-_21103719 | 1.03 |
AT3G57030.1
|
AT3G57030
|
Calcium-dependent phosphotriesterase superfamily protein |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 8.8 | GO:0009413 | response to flooding(GO:0009413) |
0.7 | 6.7 | GO:0009819 | drought recovery(GO:0009819) |
0.7 | 2.7 | GO:1900409 | positive regulation of cellular response to oxidative stress(GO:1900409) |
0.6 | 1.9 | GO:0015696 | ammonium transport(GO:0015696) |
0.6 | 2.4 | GO:0015675 | nickel cation transport(GO:0015675) |
0.5 | 1.6 | GO:0032490 | detection of molecule of bacterial origin(GO:0032490) |
0.5 | 2.1 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.5 | 2.6 | GO:0034766 | negative regulation of anion channel activity(GO:0010360) regulation of anion channel activity by blue light(GO:0010361) negative regulation of anion channel activity by blue light(GO:0010362) negative regulation of transporter activity(GO:0032410) negative regulation of ion transmembrane transporter activity(GO:0032413) negative regulation of transmembrane transport(GO:0034763) negative regulation of ion transmembrane transport(GO:0034766) negative regulation of anion transport(GO:1903792) negative regulation of anion transmembrane transport(GO:1903960) |
0.5 | 1.5 | GO:0040030 | regulation of molecular function, epigenetic(GO:0040030) negative regulation of molecular function, epigenetic(GO:0045857) |
0.5 | 1.0 | GO:1902884 | positive regulation of response to oxidative stress(GO:1902884) |
0.5 | 1.5 | GO:0009663 | plasmodesma organization(GO:0009663) |
0.5 | 2.5 | GO:0010201 | response to continuous far red light stimulus by the high-irradiance response system(GO:0010201) |
0.5 | 2.5 | GO:0006809 | nitric oxide biosynthetic process(GO:0006809) |
0.5 | 1.4 | GO:0015800 | acidic amino acid transport(GO:0015800) |
0.5 | 2.7 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
0.5 | 1.8 | GO:0010617 | circadian regulation of calcium ion oscillation(GO:0010617) |
0.5 | 6.3 | GO:0010100 | negative regulation of photomorphogenesis(GO:0010100) |
0.4 | 3.1 | GO:0043090 | amino acid import(GO:0043090) |
0.4 | 0.9 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine N-methylation(GO:0035246) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.4 | 1.3 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.4 | 2.2 | GO:0009647 | skotomorphogenesis(GO:0009647) |
0.4 | 1.7 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.4 | 1.3 | GO:0019594 | hexitol metabolic process(GO:0006059) hexitol biosynthetic process(GO:0019406) mannitol biosynthetic process(GO:0019593) mannitol metabolic process(GO:0019594) |
0.4 | 4.1 | GO:0009608 | response to symbiont(GO:0009608) |
0.4 | 1.2 | GO:0009805 | coumarin biosynthetic process(GO:0009805) |
0.4 | 1.6 | GO:0000480 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.4 | 0.4 | GO:0042539 | hypotonic salinity response(GO:0042539) |
0.4 | 1.5 | GO:0046498 | S-adenosylmethionine cycle(GO:0033353) S-adenosylhomocysteine metabolic process(GO:0046498) |
0.4 | 1.1 | GO:0031054 | pre-miRNA processing(GO:0031054) |
0.4 | 1.9 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) DNA double-strand break processing(GO:0000729) |
0.4 | 3.3 | GO:0010188 | response to microbial phytotoxin(GO:0010188) |
0.4 | 1.8 | GO:0071366 | cellular response to indolebutyric acid stimulus(GO:0071366) |
0.4 | 2.5 | GO:0019320 | hexose catabolic process(GO:0019320) |
0.4 | 0.7 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.4 | 1.4 | GO:2000736 | regulation of stem cell population maintenance(GO:2000036) regulation of stem cell differentiation(GO:2000736) |
0.4 | 1.4 | GO:1901333 | positive regulation of lateral root development(GO:1901333) |
0.3 | 2.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.3 | 0.7 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
0.3 | 1.4 | GO:0019322 | pentose biosynthetic process(GO:0019322) arabinose biosynthetic process(GO:0019567) |
0.3 | 8.5 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.3 | 2.4 | GO:0010106 | cellular response to iron ion starvation(GO:0010106) |
0.3 | 1.3 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.3 | 0.3 | GO:0071398 | response to fatty acid(GO:0070542) cellular response to fatty acid(GO:0071398) |
0.3 | 2.9 | GO:2000071 | regulation of defense response by callose deposition(GO:2000071) |
0.3 | 19.0 | GO:0009631 | cold acclimation(GO:0009631) |
0.3 | 1.9 | GO:0031116 | positive regulation of microtubule polymerization or depolymerization(GO:0031112) regulation of microtubule polymerization(GO:0031113) positive regulation of microtubule polymerization(GO:0031116) |
0.3 | 1.2 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
0.3 | 0.3 | GO:2000011 | regulation of adaxial/abaxial pattern formation(GO:2000011) |
0.3 | 5.5 | GO:0010380 | regulation of chlorophyll biosynthetic process(GO:0010380) |
0.3 | 0.9 | GO:0010289 | homogalacturonan biosynthetic process(GO:0010289) |
0.3 | 0.9 | GO:1904215 | regulation of protein import into chloroplast stroma(GO:1904215) |
0.3 | 0.9 | GO:0032196 | transposition(GO:0032196) |
0.3 | 1.8 | GO:0043481 | pigment accumulation in response to UV light(GO:0043478) pigment accumulation in tissues in response to UV light(GO:0043479) pigment accumulation in tissues(GO:0043480) anthocyanin accumulation in tissues in response to UV light(GO:0043481) |
0.3 | 1.5 | GO:0032951 | regulation of beta-glucan metabolic process(GO:0032950) regulation of beta-glucan biosynthetic process(GO:0032951) regulation of cellulose biosynthetic process(GO:2001006) |
0.3 | 0.6 | GO:0072718 | response to cisplatin(GO:0072718) |
0.3 | 9.0 | GO:0055072 | iron ion homeostasis(GO:0055072) |
0.3 | 0.9 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
0.3 | 0.6 | GO:0010376 | stomatal complex formation(GO:0010376) |
0.3 | 0.8 | GO:0071258 | cellular response to gravity(GO:0071258) |
0.3 | 0.8 | GO:0034476 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
0.3 | 1.1 | GO:0015714 | phosphoenolpyruvate transport(GO:0015714) |
0.3 | 0.8 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
0.3 | 0.5 | GO:0016553 | base conversion or substitution editing(GO:0016553) cytidine to uridine editing(GO:0016554) |
0.3 | 1.6 | GO:0010338 | leaf formation(GO:0010338) |
0.3 | 0.8 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
0.3 | 0.8 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
0.3 | 1.3 | GO:0019048 | modulation by virus of host morphology or physiology(GO:0019048) |
0.3 | 4.0 | GO:1901259 | chloroplast rRNA processing(GO:1901259) |
0.3 | 0.5 | GO:0010246 | rhamnogalacturonan I biosynthetic process(GO:0010246) |
0.3 | 0.8 | GO:0080171 | lytic vacuole organization(GO:0080171) |
0.3 | 3.1 | GO:0010044 | response to aluminum ion(GO:0010044) |
0.3 | 1.0 | GO:0000455 | enzyme-directed rRNA pseudouridine synthesis(GO:0000455) |
0.3 | 0.8 | GO:0033967 | box C/D snoRNA 3'-end processing(GO:0000494) peptidyl-glutamine methylation(GO:0018364) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
0.3 | 2.3 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
0.3 | 0.8 | GO:0055047 | generative cell mitosis(GO:0055047) |
0.3 | 1.0 | GO:0006023 | aminoglycan biosynthetic process(GO:0006023) glycosaminoglycan biosynthetic process(GO:0006024) UDP-glucuronate biosynthetic process(GO:0006065) glycosaminoglycan metabolic process(GO:0030203) |
0.3 | 3.3 | GO:0000578 | embryonic axis specification(GO:0000578) |
0.2 | 0.7 | GO:1902446 | regulation of shade avoidance(GO:1902446) positive regulation of shade avoidance(GO:1902448) |
0.2 | 3.4 | GO:0010078 | maintenance of root meristem identity(GO:0010078) |
0.2 | 1.0 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
0.2 | 1.0 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
0.2 | 1.4 | GO:0046683 | response to organophosphorus(GO:0046683) |
0.2 | 0.5 | GO:0048358 | mucilage pectin biosynthetic process(GO:0048358) |
0.2 | 0.9 | GO:0000967 | rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
0.2 | 0.7 | GO:0010254 | nectary development(GO:0010254) |
0.2 | 2.3 | GO:0045962 | positive regulation of development, heterochronic(GO:0045962) |
0.2 | 0.7 | GO:0048838 | release of seed from dormancy(GO:0048838) exit from dormancy(GO:0097438) |
0.2 | 1.6 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.2 | 0.7 | GO:1990884 | rRNA acetylation involved in maturation of SSU-rRNA(GO:1904812) rRNA acetylation(GO:1990882) RNA acetylation(GO:1990884) |
0.2 | 0.5 | GO:0010288 | response to lead ion(GO:0010288) |
0.2 | 3.4 | GO:0005986 | sucrose biosynthetic process(GO:0005986) |
0.2 | 0.7 | GO:0051204 | protein insertion into membrane from inner side(GO:0032978) protein insertion into mitochondrial membrane from inner side(GO:0032979) protein insertion into mitochondrial membrane(GO:0051204) |
0.2 | 1.8 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.2 | 2.7 | GO:0010540 | basipetal auxin transport(GO:0010540) |
0.2 | 0.9 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.2 | 0.9 | GO:0032210 | regulation of telomere maintenance via telomerase(GO:0032210) regulation of telomere maintenance via telomere lengthening(GO:1904356) negative regulation of DNA biosynthetic process(GO:2000279) |
0.2 | 0.7 | GO:0006177 | GMP biosynthetic process(GO:0006177) GMP metabolic process(GO:0046037) |
0.2 | 2.9 | GO:0070076 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) histone demethylation(GO:0016577) histone lysine demethylation(GO:0070076) |
0.2 | 0.9 | GO:0010480 | microsporocyte differentiation(GO:0010480) |
0.2 | 0.7 | GO:0043132 | NAD transport(GO:0043132) |
0.2 | 1.3 | GO:0010019 | chloroplast-nucleus signaling pathway(GO:0010019) |
0.2 | 0.7 | GO:0009093 | cysteine catabolic process(GO:0009093) |
0.2 | 0.7 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) |
0.2 | 0.6 | GO:0010336 | gibberellic acid homeostasis(GO:0010336) |
0.2 | 0.2 | GO:0046717 | acid secretion(GO:0046717) |
0.2 | 1.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.2 | 0.8 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.2 | 1.5 | GO:0015867 | ADP transport(GO:0015866) ATP transport(GO:0015867) |
0.2 | 2.3 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.2 | 0.6 | GO:0002188 | translation reinitiation(GO:0002188) |
0.2 | 0.8 | GO:0010618 | aerenchyma formation(GO:0010618) |
0.2 | 1.9 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.2 | 0.6 | GO:0009915 | phloem sucrose loading(GO:0009915) |
0.2 | 0.6 | GO:0090143 | nucleoid organization(GO:0090143) |
0.2 | 1.2 | GO:0097502 | mannosylation(GO:0097502) |
0.2 | 4.2 | GO:0043572 | chloroplast fission(GO:0010020) plastid fission(GO:0043572) |
0.2 | 2.8 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
0.2 | 0.6 | GO:0042770 | signal transduction in response to DNA damage(GO:0042770) regulation of DNA damage checkpoint(GO:2000001) |
0.2 | 0.4 | GO:0048281 | inflorescence morphogenesis(GO:0048281) |
0.2 | 0.6 | GO:2000039 | regulation of trichome morphogenesis(GO:2000039) |
0.2 | 0.6 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
0.2 | 2.9 | GO:0009638 | phototropism(GO:0009638) |
0.2 | 0.6 | GO:0051512 | positive regulation of unidimensional cell growth(GO:0051512) |
0.2 | 0.6 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.2 | 3.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.2 | 0.8 | GO:1905157 | positive regulation of photosynthesis(GO:1905157) |
0.2 | 0.6 | GO:0001193 | maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
0.2 | 0.6 | GO:0090058 | metaxylem development(GO:0090058) |
0.2 | 0.6 | GO:0032844 | regulation of homeostatic process(GO:0032844) |
0.2 | 0.4 | GO:0010148 | transpiration(GO:0010148) |
0.2 | 0.7 | GO:0051211 | anisotropic cell growth(GO:0051211) |
0.2 | 0.9 | GO:1901535 | regulation of DNA demethylation(GO:1901535) |
0.2 | 0.7 | GO:0019477 | lysine catabolic process(GO:0006554) L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) L-lysine metabolic process(GO:0046440) |
0.2 | 0.4 | GO:0071731 | response to nitric oxide(GO:0071731) |
0.2 | 2.4 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.2 | 0.5 | GO:0080183 | response to photooxidative stress(GO:0080183) |
0.2 | 0.9 | GO:0015846 | polyamine transport(GO:0015846) |
0.2 | 1.3 | GO:0048579 | negative regulation of long-day photoperiodism, flowering(GO:0048579) |
0.2 | 2.4 | GO:0042793 | transcription from plastid promoter(GO:0042793) |
0.2 | 0.5 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.2 | 0.4 | GO:0090547 | response to low humidity(GO:0090547) |
0.2 | 0.5 | GO:1900032 | regulation of trichome patterning(GO:1900032) negative regulation of trichome patterning(GO:1900033) |
0.2 | 0.4 | GO:0033306 | phytol metabolic process(GO:0033306) |
0.2 | 2.1 | GO:0060261 | regulation of transcription initiation from RNA polymerase II promoter(GO:0060260) positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.2 | 0.7 | GO:0033478 | UDP-rhamnose biosynthetic process(GO:0010253) UDP-rhamnose metabolic process(GO:0033478) |
0.2 | 0.7 | GO:0048480 | stigma development(GO:0048480) |
0.2 | 0.5 | GO:0030100 | regulation of endocytosis(GO:0030100) |
0.2 | 0.5 | GO:0002240 | response to molecule of oomycetes origin(GO:0002240) |
0.2 | 0.5 | GO:0090322 | regulation of superoxide metabolic process(GO:0090322) |
0.2 | 0.5 | GO:0015904 | tetracycline transport(GO:0015904) antibiotic transport(GO:0042891) |
0.2 | 0.5 | GO:0070207 | protein homotrimerization(GO:0070207) |
0.2 | 1.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.2 | 0.3 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.2 | 1.7 | GO:0009088 | threonine biosynthetic process(GO:0009088) |
0.2 | 1.8 | GO:0050665 | hydrogen peroxide biosynthetic process(GO:0050665) |
0.2 | 0.7 | GO:0010589 | leaf proximal/distal pattern formation(GO:0010589) |
0.2 | 1.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.2 | 0.7 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
0.2 | 0.7 | GO:0045911 | positive regulation of DNA recombination(GO:0045911) |
0.2 | 0.7 | GO:1902292 | cell cycle DNA replication initiation(GO:1902292) nuclear cell cycle DNA replication initiation(GO:1902315) mitotic DNA replication initiation(GO:1902975) |
0.2 | 1.0 | GO:1901703 | protein localization involved in auxin polar transport(GO:1901703) |
0.2 | 0.8 | GO:0009800 | cinnamic acid biosynthetic process(GO:0009800) |
0.2 | 0.7 | GO:0009727 | detection of ethylene stimulus(GO:0009727) |
0.2 | 1.8 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.2 | 0.5 | GO:0010444 | guard mother cell differentiation(GO:0010444) |
0.2 | 1.3 | GO:0019243 | lactate metabolic process(GO:0006089) methylglyoxal metabolic process(GO:0009438) methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) ketone catabolic process(GO:0042182) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.2 | 3.4 | GO:0045037 | protein import into chloroplast stroma(GO:0045037) |
0.2 | 1.0 | GO:0043100 | pyrimidine nucleobase salvage(GO:0043100) |
0.2 | 0.5 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.2 | 0.5 | GO:0010372 | positive regulation of gibberellin biosynthetic process(GO:0010372) |
0.2 | 2.4 | GO:0048564 | photosystem I assembly(GO:0048564) |
0.2 | 1.3 | GO:0010358 | leaf shaping(GO:0010358) |
0.2 | 3.6 | GO:0072596 | protein targeting to chloroplast(GO:0045036) establishment of protein localization to chloroplast(GO:0072596) |
0.2 | 1.1 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.2 | 0.5 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.2 | 3.0 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
0.2 | 1.4 | GO:0046739 | movement in host(GO:0044000) transport of virus in multicellular host(GO:0046739) movement in other organism involved in symbiotic interaction(GO:0051814) movement in host environment(GO:0052126) movement in environment of other organism involved in symbiotic interaction(GO:0052192) |
0.2 | 0.5 | GO:0006212 | thymine catabolic process(GO:0006210) uracil catabolic process(GO:0006212) beta-alanine metabolic process(GO:0019482) beta-alanine biosynthetic process(GO:0019483) thymine metabolic process(GO:0019859) uracil metabolic process(GO:0019860) |
0.2 | 1.1 | GO:0090059 | protoxylem development(GO:0090059) |
0.2 | 4.9 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.2 | 0.3 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.2 | 0.2 | GO:1900864 | mitochondrial RNA modification(GO:1900864) |
0.2 | 3.2 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
0.2 | 1.2 | GO:0006821 | chloride transport(GO:0006821) |
0.1 | 0.6 | GO:0031000 | response to caffeine(GO:0031000) response to alkaloid(GO:0043279) |
0.1 | 2.1 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.1 | 1.5 | GO:0070370 | cellular heat acclimation(GO:0070370) |
0.1 | 0.7 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) |
0.1 | 0.4 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
0.1 | 1.0 | GO:0010315 | auxin efflux(GO:0010315) |
0.1 | 0.4 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
0.1 | 0.4 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) negative regulation of meiotic cell cycle(GO:0051447) |
0.1 | 5.0 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 2.1 | GO:0071324 | cellular response to disaccharide stimulus(GO:0071324) cellular response to sucrose stimulus(GO:0071329) |
0.1 | 0.7 | GO:0048363 | mucilage pectin metabolic process(GO:0048363) |
0.1 | 0.8 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.1 | 0.6 | GO:0000012 | single strand break repair(GO:0000012) |
0.1 | 0.7 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.1 | 1.4 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.1 | 0.6 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.1 | 1.4 | GO:0016123 | xanthophyll biosynthetic process(GO:0016123) |
0.1 | 0.4 | GO:0071452 | cellular response to singlet oxygen(GO:0071452) |
0.1 | 4.5 | GO:0010143 | cutin biosynthetic process(GO:0010143) |
0.1 | 0.9 | GO:0010065 | primary meristem tissue development(GO:0010065) |
0.1 | 1.2 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.1 | 1.4 | GO:0010031 | circumnutation(GO:0010031) multicellular organismal movement(GO:0050879) |
0.1 | 0.3 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) protein localization to microtubule cytoskeleton(GO:0072698) |
0.1 | 0.4 | GO:0033321 | homomethionine metabolic process(GO:0033321) glucosinolate biosynthetic process from homomethionine(GO:0033506) |
0.1 | 1.2 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
0.1 | 0.4 | GO:0090392 | sepal giant cell differentiation(GO:0090392) |
0.1 | 0.5 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 1.3 | GO:0051446 | positive regulation of meiotic cell cycle(GO:0051446) |
0.1 | 1.5 | GO:0017157 | regulation of exocytosis(GO:0017157) |
0.1 | 1.6 | GO:0010192 | mucilage biosynthetic process(GO:0010192) |
0.1 | 0.4 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
0.1 | 0.3 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.5 | GO:0007041 | lysosomal transport(GO:0007041) endosome to lysosome transport(GO:0008333) |
0.1 | 5.6 | GO:0015995 | chlorophyll biosynthetic process(GO:0015995) |
0.1 | 0.9 | GO:0051127 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) regulation of actin nucleation(GO:0051125) positive regulation of actin nucleation(GO:0051127) positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.6 | GO:0034059 | response to anoxia(GO:0034059) |
0.1 | 0.4 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
0.1 | 0.6 | GO:0019419 | sulfate reduction(GO:0019419) |
0.1 | 0.4 | GO:1901999 | homogentisate metabolic process(GO:1901999) homogentisate catabolic process(GO:1902000) |
0.1 | 0.8 | GO:0010258 | NADH dehydrogenase complex (plastoquinone) assembly(GO:0010258) |
0.1 | 0.8 | GO:0000719 | photoreactive repair(GO:0000719) |
0.1 | 0.3 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.4 | GO:0032365 | intracellular lipid transport(GO:0032365) |
0.1 | 0.4 | GO:1901332 | negative regulation of lateral root development(GO:1901332) |
0.1 | 0.5 | GO:0006678 | glycosylceramide metabolic process(GO:0006677) glucosylceramide metabolic process(GO:0006678) glucosylceramide catabolic process(GO:0006680) glycosphingolipid metabolic process(GO:0006687) glycolipid catabolic process(GO:0019377) glycosylceramide catabolic process(GO:0046477) glycosphingolipid catabolic process(GO:0046479) ceramide catabolic process(GO:0046514) |
0.1 | 0.4 | GO:0036292 | replication fork processing(GO:0031297) DNA rewinding(GO:0036292) replication fork protection(GO:0048478) |
0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 1.0 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.1 | 0.2 | GO:0010395 | rhamnogalacturonan I metabolic process(GO:0010395) |
0.1 | 0.9 | GO:0015909 | long-chain fatty acid transport(GO:0015909) |
0.1 | 0.6 | GO:0015939 | pantothenate metabolic process(GO:0015939) pantothenate biosynthetic process(GO:0015940) |
0.1 | 1.8 | GO:0009098 | leucine biosynthetic process(GO:0009098) |
0.1 | 0.2 | GO:0046048 | UDP biosynthetic process(GO:0006225) ribonucleoside diphosphate biosynthetic process(GO:0009188) pyrimidine ribonucleoside diphosphate metabolic process(GO:0009193) pyrimidine ribonucleoside diphosphate biosynthetic process(GO:0009194) UDP metabolic process(GO:0046048) |
0.1 | 0.5 | GO:0051098 | regulation of binding(GO:0051098) |
0.1 | 0.5 | GO:0010070 | zygote asymmetric cell division(GO:0010070) |
0.1 | 1.3 | GO:0055062 | phosphate ion homeostasis(GO:0055062) trivalent inorganic anion homeostasis(GO:0072506) |
0.1 | 0.1 | GO:0002009 | establishment of planar polarity(GO:0001736) morphogenesis of a polarized epithelium(GO:0001738) morphogenesis of an epithelium(GO:0002009) tissue morphogenesis(GO:0048729) |
0.1 | 1.8 | GO:0009593 | detection of chemical stimulus(GO:0009593) |
0.1 | 1.2 | GO:0010088 | phloem development(GO:0010088) |
0.1 | 0.8 | GO:0016926 | protein desumoylation(GO:0016926) |
0.1 | 0.5 | GO:0001173 | DNA-templated transcriptional start site selection(GO:0001173) |
0.1 | 1.6 | GO:0052546 | cell wall pectin metabolic process(GO:0052546) |
0.1 | 0.8 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 1.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 1.1 | GO:0033320 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
0.1 | 2.0 | GO:0010099 | regulation of photomorphogenesis(GO:0010099) |
0.1 | 1.7 | GO:0031167 | rRNA methylation(GO:0031167) |
0.1 | 0.4 | GO:0015786 | UDP-glucose transport(GO:0015786) |
0.1 | 0.8 | GO:0006206 | pyrimidine nucleobase metabolic process(GO:0006206) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.1 | 0.4 | GO:1901562 | response to paraquat(GO:1901562) |
0.1 | 0.4 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
0.1 | 0.4 | GO:0008645 | hexose transport(GO:0008645) fructose transport(GO:0015755) |
0.1 | 0.3 | GO:0034247 | snoRNA splicing(GO:0034247) |
0.1 | 1.9 | GO:0071483 | cellular response to blue light(GO:0071483) |
0.1 | 0.3 | GO:0009871 | jasmonic acid and ethylene-dependent systemic resistance, ethylene mediated signaling pathway(GO:0009871) |
0.1 | 0.2 | GO:0009855 | determination of bilateral symmetry(GO:0009855) |
0.1 | 3.6 | GO:0010286 | heat acclimation(GO:0010286) |
0.1 | 0.3 | GO:0048656 | anther wall tapetum formation(GO:0048656) anther wall tapetum cell differentiation(GO:0048657) |
0.1 | 1.6 | GO:0000919 | cell plate assembly(GO:0000919) |
0.1 | 0.6 | GO:0010080 | regulation of floral meristem growth(GO:0010080) |
0.1 | 4.2 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) citrate metabolic process(GO:0006101) |
0.1 | 0.2 | GO:0097054 | L-glutamate biosynthetic process(GO:0097054) |
0.1 | 1.1 | GO:0090151 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.1 | 0.5 | GO:2000030 | regulation of response to red or far red light(GO:2000030) |
0.1 | 0.2 | GO:0051291 | protein heterooligomerization(GO:0051291) |
0.1 | 0.1 | GO:0072702 | response to methyl methanesulfonate(GO:0072702) |
0.1 | 3.7 | GO:2000028 | regulation of photoperiodism, flowering(GO:2000028) |
0.1 | 1.2 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
0.1 | 0.6 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.1 | 0.3 | GO:0019695 | choline metabolic process(GO:0019695) |
0.1 | 0.3 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
0.1 | 0.3 | GO:0071569 | protein ufmylation(GO:0071569) |
0.1 | 0.3 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.1 | 2.2 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.1 | 1.1 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 0.5 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.1 | 0.3 | GO:0050996 | positive regulation of fatty acid beta-oxidation(GO:0032000) positive regulation of lipid catabolic process(GO:0050996) |
0.1 | 0.3 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 2.1 | GO:0045338 | farnesyl diphosphate metabolic process(GO:0045338) |
0.1 | 1.5 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
0.1 | 0.4 | GO:0022615 | protein import into peroxisome matrix, docking(GO:0016560) protein to membrane docking(GO:0022615) |
0.1 | 0.3 | GO:2000105 | positive regulation of DNA endoreduplication(GO:0032877) positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.1 | 0.4 | GO:0006788 | heme oxidation(GO:0006788) |
0.1 | 1.8 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.1 | 0.9 | GO:0052324 | plant-type cell wall cellulose biosynthetic process(GO:0052324) |
0.1 | 0.9 | GO:0010190 | cytochrome b6f complex assembly(GO:0010190) |
0.1 | 1.5 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.1 | 0.3 | GO:0009747 | hexokinase-dependent signaling(GO:0009747) |
0.1 | 0.8 | GO:0007004 | RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
0.1 | 0.4 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
0.1 | 1.4 | GO:0048496 | maintenance of organ identity(GO:0048496) maintenance of floral organ identity(GO:0048497) |
0.1 | 0.4 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.1 | 1.2 | GO:0005978 | glycogen biosynthetic process(GO:0005978) |
0.1 | 0.5 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 0.9 | GO:0010205 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) negative regulation of photosynthesis(GO:1905156) |
0.1 | 1.1 | GO:0060321 | acceptance of pollen(GO:0060321) |
0.1 | 1.1 | GO:0010030 | positive regulation of seed germination(GO:0010030) |
0.1 | 0.4 | GO:0006525 | arginine metabolic process(GO:0006525) |
0.1 | 0.1 | GO:0040031 | snRNA modification(GO:0040031) |
0.1 | 1.1 | GO:0010332 | response to gamma radiation(GO:0010332) |
0.1 | 0.3 | GO:0009102 | biotin metabolic process(GO:0006768) biotin biosynthetic process(GO:0009102) |
0.1 | 3.3 | GO:0030641 | regulation of cellular pH(GO:0030641) regulation of intracellular pH(GO:0051453) |
0.1 | 1.8 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 1.2 | GO:0009938 | negative regulation of gibberellic acid mediated signaling pathway(GO:0009938) |
0.1 | 0.7 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.2 | GO:0006063 | uronic acid metabolic process(GO:0006063) galacturonate metabolic process(GO:0019586) |
0.1 | 0.6 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.1 | 0.2 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
0.1 | 0.4 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.1 | 0.2 | GO:1902458 | positive regulation of stomatal opening(GO:1902458) |
0.1 | 3.5 | GO:0051170 | nuclear import(GO:0051170) |
0.1 | 0.1 | GO:0033240 | positive regulation of cellular amine metabolic process(GO:0033240) positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.1 | 0.8 | GO:0015914 | phospholipid transport(GO:0015914) |
0.1 | 0.5 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.4 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) diadenosine tetraphosphate metabolic process(GO:0015965) |
0.1 | 0.3 | GO:0043693 | monoterpene biosynthetic process(GO:0043693) |
0.1 | 0.3 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.5 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
0.1 | 0.3 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
0.1 | 0.3 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
0.1 | 1.3 | GO:0010252 | auxin homeostasis(GO:0010252) |
0.1 | 0.3 | GO:0006425 | glutamyl-tRNA aminoacylation(GO:0006424) glutaminyl-tRNA aminoacylation(GO:0006425) |
0.1 | 1.2 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.3 | GO:0007349 | cellularization(GO:0007349) |
0.1 | 0.5 | GO:0010359 | regulation of anion channel activity(GO:0010359) regulation of anion transmembrane transport(GO:1903959) |
0.1 | 1.5 | GO:0009934 | regulation of meristem structural organization(GO:0009934) |
0.1 | 0.4 | GO:0016598 | protein arginylation(GO:0016598) |
0.1 | 0.3 | GO:0010275 | NAD(P)H dehydrogenase complex assembly(GO:0010275) |
0.1 | 0.3 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.1 | 0.1 | GO:1902457 | negative regulation of stomatal opening(GO:1902457) |
0.1 | 0.3 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
0.1 | 0.9 | GO:0052548 | negative regulation of endopeptidase activity(GO:0010951) regulation of endopeptidase activity(GO:0052548) |
0.1 | 0.9 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.1 | 0.5 | GO:0006567 | threonine catabolic process(GO:0006567) |
0.1 | 0.9 | GO:0010098 | suspensor development(GO:0010098) |
0.1 | 2.7 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 0.5 | GO:0031539 | positive regulation of anthocyanin metabolic process(GO:0031539) |
0.1 | 0.5 | GO:0009880 | embryonic pattern specification(GO:0009880) |
0.1 | 5.3 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.1 | 0.9 | GO:0048317 | seed morphogenesis(GO:0048317) |
0.1 | 0.5 | GO:0071585 | detoxification of cadmium ion(GO:0071585) |
0.1 | 1.3 | GO:0032981 | mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.9 | GO:0048766 | root hair initiation(GO:0048766) |
0.1 | 0.3 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.1 | 0.5 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.3 | GO:0019323 | pentose catabolic process(GO:0019323) |
0.1 | 0.3 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.6 | GO:0010236 | plastoquinone biosynthetic process(GO:0010236) |
0.1 | 0.2 | GO:1901672 | positive regulation of systemic acquired resistance(GO:1901672) |
0.1 | 0.5 | GO:0010438 | cellular response to sulfur starvation(GO:0010438) |
0.1 | 2.3 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.4 | GO:0007142 | male meiosis II(GO:0007142) |
0.1 | 0.3 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 1.6 | GO:0045727 | positive regulation of translation(GO:0045727) |
0.1 | 0.8 | GO:0009641 | shade avoidance(GO:0009641) |
0.1 | 0.3 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.1 | 0.7 | GO:0032544 | plastid translation(GO:0032544) |
0.1 | 0.2 | GO:0080051 | cutin transport(GO:0080051) |
0.1 | 0.9 | GO:0009895 | negative regulation of catabolic process(GO:0009895) |
0.1 | 0.5 | GO:0046482 | para-aminobenzoic acid metabolic process(GO:0046482) |
0.1 | 0.3 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.1 | 0.1 | GO:0050777 | negative regulation of immune response(GO:0050777) |
0.1 | 0.3 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
0.1 | 0.8 | GO:0006826 | iron ion transport(GO:0006826) |
0.1 | 0.6 | GO:0080112 | seed growth(GO:0080112) |
0.1 | 0.4 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
0.1 | 0.2 | GO:0048833 | specification of organ number(GO:0048832) specification of floral organ number(GO:0048833) |
0.1 | 0.3 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.4 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.1 | 2.8 | GO:0006413 | translational initiation(GO:0006413) |
0.1 | 0.5 | GO:0060866 | leaf abscission(GO:0060866) |
0.1 | 1.6 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.1 | 0.4 | GO:0033206 | male meiosis cytokinesis(GO:0007112) meiotic cytokinesis(GO:0033206) |
0.1 | 3.2 | GO:0048278 | membrane docking(GO:0022406) vesicle docking(GO:0048278) |
0.1 | 0.1 | GO:0046398 | UDP-glucuronate metabolic process(GO:0046398) |
0.1 | 0.9 | GO:0010187 | negative regulation of seed germination(GO:0010187) |
0.1 | 1.3 | GO:0006075 | (1->3)-beta-D-glucan metabolic process(GO:0006074) (1->3)-beta-D-glucan biosynthetic process(GO:0006075) |
0.1 | 0.8 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.5 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
0.1 | 0.7 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.1 | 0.3 | GO:0015669 | gas transport(GO:0015669) |
0.1 | 2.1 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.1 | 0.4 | GO:0071586 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
0.1 | 0.7 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
0.1 | 1.0 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.1 | 0.3 | GO:0015739 | sialic acid transport(GO:0015739) |
0.1 | 0.6 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.1 | 2.5 | GO:0009853 | photorespiration(GO:0009853) |
0.1 | 3.1 | GO:0006897 | endocytosis(GO:0006897) |
0.1 | 0.9 | GO:0009231 | riboflavin metabolic process(GO:0006771) riboflavin biosynthetic process(GO:0009231) |
0.1 | 0.1 | GO:0030162 | regulation of proteolysis(GO:0030162) |
0.1 | 0.2 | GO:0016118 | tetraterpenoid catabolic process(GO:0016110) carotenoid catabolic process(GO:0016118) xanthophyll catabolic process(GO:0016124) |
0.1 | 0.2 | GO:0030835 | negative regulation of actin filament depolymerization(GO:0030835) actin filament capping(GO:0051693) |
0.1 | 0.5 | GO:1901527 | abscisic acid-activated signaling pathway involved in stomatal movement(GO:1901527) |
0.1 | 0.3 | GO:0046039 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) GTP metabolic process(GO:0046039) prosthetic group metabolic process(GO:0051189) |
0.1 | 2.0 | GO:0016556 | mRNA modification(GO:0016556) |
0.1 | 0.1 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 1.2 | GO:0009269 | response to desiccation(GO:0009269) |
0.1 | 5.0 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.1 | 0.2 | GO:0090549 | response to carbon starvation(GO:0090549) |
0.1 | 20.8 | GO:0006412 | translation(GO:0006412) |
0.1 | 0.5 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.3 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 0.1 | GO:0006825 | copper ion transport(GO:0006825) |
0.1 | 0.7 | GO:1902074 | response to salt(GO:1902074) |
0.1 | 0.6 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) |
0.1 | 2.4 | GO:0070588 | calcium ion transmembrane transport(GO:0070588) |
0.1 | 2.3 | GO:0009788 | negative regulation of abscisic acid-activated signaling pathway(GO:0009788) |
0.1 | 1.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.1 | 0.6 | GO:0010230 | alternative respiration(GO:0010230) |
0.1 | 0.1 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
0.1 | 3.2 | GO:0006972 | hyperosmotic response(GO:0006972) |
0.1 | 0.4 | GO:0051781 | positive regulation of cell division(GO:0051781) |
0.1 | 0.3 | GO:0009772 | photosynthetic electron transport in photosystem II(GO:0009772) |
0.1 | 2.3 | GO:0051085 | 'de novo' posttranslational protein folding(GO:0051084) chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.1 | 0.3 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 0.3 | GO:1901004 | ubiquinone-6 metabolic process(GO:1901004) ubiquinone-6 biosynthetic process(GO:1901006) |
0.1 | 0.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 3.3 | GO:0006612 | protein targeting to membrane(GO:0006612) |
0.1 | 0.4 | GO:0046113 | purine nucleobase catabolic process(GO:0006145) nucleobase catabolic process(GO:0046113) |
0.1 | 1.2 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) |
0.1 | 0.3 | GO:0010155 | regulation of proton transport(GO:0010155) |
0.1 | 0.2 | GO:0051703 | pollen tube reception(GO:0010483) intraspecies interaction between organisms(GO:0051703) |
0.1 | 0.1 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.1 | 0.1 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 0.2 | GO:0051668 | localization within membrane(GO:0051668) COPII-coated vesicle budding(GO:0090114) |
0.1 | 0.1 | GO:0010450 | inflorescence meristem growth(GO:0010450) |
0.1 | 0.6 | GO:0008361 | regulation of cell size(GO:0008361) |
0.1 | 0.3 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.1 | 1.0 | GO:0010029 | regulation of seed germination(GO:0010029) |
0.1 | 0.1 | GO:0002164 | nematode larval development(GO:0002119) larval development(GO:0002164) regulation of nematode larval development(GO:0061062) |
0.1 | 0.2 | GO:0009769 | photosynthesis, light harvesting in photosystem II(GO:0009769) |
0.1 | 0.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.2 | GO:0060149 | negative regulation of posttranscriptional gene silencing(GO:0060149) |
0.1 | 0.4 | GO:0080142 | regulation of salicylic acid biosynthetic process(GO:0080142) |
0.1 | 1.0 | GO:0015994 | chlorophyll metabolic process(GO:0015994) |
0.1 | 5.1 | GO:0009658 | chloroplast organization(GO:0009658) |
0.1 | 0.5 | GO:0032261 | purine nucleotide salvage(GO:0032261) purine-containing compound salvage(GO:0043101) |
0.1 | 0.2 | GO:0043903 | regulation of symbiosis, encompassing mutualism through parasitism(GO:0043903) |
0.1 | 0.1 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.1 | 0.4 | GO:0048209 | regulation of vesicle targeting, to, from or within Golgi(GO:0048209) |
0.1 | 1.4 | GO:0006284 | base-excision repair(GO:0006284) |
0.1 | 0.1 | GO:0006272 | leading strand elongation(GO:0006272) |
0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.6 | GO:0031365 | N-terminal protein amino acid modification(GO:0031365) |
0.1 | 0.6 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.1 | 0.1 | GO:0046506 | sulfolipid metabolic process(GO:0046505) sulfolipid biosynthetic process(GO:0046506) |
0.1 | 0.4 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.0 | 1.0 | GO:0009958 | positive gravitropism(GO:0009958) |
0.0 | 0.1 | GO:0090213 | regulation of radial pattern formation(GO:0090213) |
0.0 | 0.3 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
0.0 | 0.7 | GO:0046856 | phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
0.0 | 0.2 | GO:0006531 | 2-oxoglutarate metabolic process(GO:0006103) aspartate metabolic process(GO:0006531) |
0.0 | 0.5 | GO:0010158 | abaxial cell fate specification(GO:0010158) |
0.0 | 0.1 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.9 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
0.0 | 0.2 | GO:0042724 | thiamine biosynthetic process(GO:0009228) thiamine-containing compound biosynthetic process(GO:0042724) |
0.0 | 0.7 | GO:0010072 | primary shoot apical meristem specification(GO:0010072) |
0.0 | 0.3 | GO:0019079 | viral genome replication(GO:0019079) |
0.0 | 0.4 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.0 | 0.5 | GO:0009870 | defense response signaling pathway, resistance gene-dependent(GO:0009870) |
0.0 | 1.3 | GO:0090305 | nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
0.0 | 1.2 | GO:0055088 | lipid homeostasis(GO:0055088) |
0.0 | 0.3 | GO:0016559 | peroxisome fission(GO:0016559) regulation of peroxisome size(GO:0044375) |
0.0 | 0.0 | GO:0042391 | regulation of membrane potential(GO:0042391) |
0.0 | 0.4 | GO:0043144 | snoRNA processing(GO:0043144) |
0.0 | 0.4 | GO:0009787 | regulation of abscisic acid-activated signaling pathway(GO:0009787) |
0.0 | 0.2 | GO:0016320 | endoplasmic reticulum membrane fusion(GO:0016320) |
0.0 | 0.9 | GO:0032984 | macromolecular complex disassembly(GO:0032984) |
0.0 | 0.2 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
0.0 | 0.3 | GO:0016925 | protein sumoylation(GO:0016925) |
0.0 | 0.8 | GO:0042631 | cellular response to water deprivation(GO:0042631) cellular response to water stimulus(GO:0071462) |
0.0 | 0.1 | GO:0006666 | 3-keto-sphinganine metabolic process(GO:0006666) |
0.0 | 0.8 | GO:0015850 | organic hydroxy compound transport(GO:0015850) |
0.0 | 1.0 | GO:0009910 | negative regulation of flower development(GO:0009910) |
0.0 | 0.2 | GO:0016444 | somatic cell DNA recombination(GO:0016444) |
0.0 | 0.2 | GO:0071588 | hydrogen peroxide mediated signaling pathway(GO:0071588) |
0.0 | 0.5 | GO:2000033 | regulation of seed dormancy process(GO:2000033) |
0.0 | 0.6 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
0.0 | 0.1 | GO:0048359 | mucilage metabolic process involved in seed coat development(GO:0048359) |
0.0 | 0.1 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
0.0 | 0.2 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 1.7 | GO:0006364 | rRNA processing(GO:0006364) |
0.0 | 0.0 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
0.0 | 1.6 | GO:0042176 | regulation of protein catabolic process(GO:0042176) |
0.0 | 1.0 | GO:0009789 | positive regulation of abscisic acid-activated signaling pathway(GO:0009789) |
0.0 | 0.2 | GO:0010093 | specification of floral organ identity(GO:0010093) |
0.0 | 0.6 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
0.0 | 0.2 | GO:0030308 | negative regulation of cell growth(GO:0030308) |
0.0 | 0.4 | GO:0046337 | phosphatidylethanolamine biosynthetic process(GO:0006646) phosphatidylethanolamine metabolic process(GO:0046337) |
0.0 | 0.4 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.1 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) regulation of spindle organization(GO:0090224) |
0.0 | 0.1 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) negative regulation of nuclear division(GO:0051784) |
0.0 | 0.6 | GO:0006338 | chromatin remodeling(GO:0006338) |
0.0 | 0.2 | GO:0032456 | endocytic recycling(GO:0032456) |
0.0 | 0.1 | GO:0010677 | negative regulation of cellular carbohydrate metabolic process(GO:0010677) |
0.0 | 0.5 | GO:0019375 | galactolipid biosynthetic process(GO:0019375) |
0.0 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.3 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.0 | 0.1 | GO:1900909 | negative regulation of ethylene biosynthetic process(GO:0010366) negative regulation of sulfur amino acid metabolic process(GO:0031336) negative regulation of cellular amine metabolic process(GO:0033239) negative regulation of cellular amino acid metabolic process(GO:0045763) negative regulation of sulfur metabolic process(GO:0051175) negative regulation of olefin metabolic process(GO:1900909) negative regulation of olefin biosynthetic process(GO:1900912) |
0.0 | 0.8 | GO:0009833 | plant-type primary cell wall biogenesis(GO:0009833) |
0.0 | 2.2 | GO:0018209 | peptidyl-serine phosphorylation(GO:0018105) peptidyl-serine modification(GO:0018209) |
0.0 | 0.5 | GO:0010167 | response to nitrate(GO:0010167) |
0.0 | 0.4 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.0 | 0.3 | GO:0033619 | membrane protein proteolysis(GO:0033619) |
0.0 | 1.5 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
0.0 | 0.4 | GO:0051260 | protein homooligomerization(GO:0051260) |
0.0 | 0.2 | GO:0043967 | histone H4 acetylation(GO:0043967) |
0.0 | 0.1 | GO:1900367 | positive regulation of defense response to insect(GO:1900367) |
0.0 | 0.5 | GO:0043622 | cortical microtubule organization(GO:0043622) |
0.0 | 0.6 | GO:1900424 | regulation of defense response to bacterium(GO:1900424) |
0.0 | 0.8 | GO:0035266 | meristem growth(GO:0035266) |
0.0 | 0.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.0 | 0.1 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.0 | 0.1 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.0 | 3.8 | GO:0000398 | mRNA splicing, via spliceosome(GO:0000398) |
0.0 | 0.6 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 0.4 | GO:0060249 | telomere maintenance(GO:0000723) telomere organization(GO:0032200) anatomical structure homeostasis(GO:0060249) |
0.0 | 1.9 | GO:0006457 | protein folding(GO:0006457) |
0.0 | 0.1 | GO:0006513 | protein monoubiquitination(GO:0006513) |
0.0 | 0.1 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.0 | 0.1 | GO:0035606 | protein nitrosylation(GO:0017014) peptidyl-cysteine S-nitrosylation(GO:0018119) peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
0.0 | 0.2 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 2.5 | GO:0007623 | circadian rhythm(GO:0007623) rhythmic process(GO:0048511) |
0.0 | 0.2 | GO:0044070 | regulation of anion transport(GO:0044070) |
0.0 | 0.1 | GO:0034765 | regulation of ion transmembrane transport(GO:0034765) |
0.0 | 0.7 | GO:0006913 | nucleocytoplasmic transport(GO:0006913) nuclear transport(GO:0051169) |
0.0 | 0.4 | GO:0008356 | asymmetric cell division(GO:0008356) |
0.0 | 0.4 | GO:0052803 | histidine biosynthetic process(GO:0000105) histidine metabolic process(GO:0006547) imidazole-containing compound metabolic process(GO:0052803) |
0.0 | 0.1 | GO:0030031 | cell projection organization(GO:0030030) cell projection assembly(GO:0030031) |
0.0 | 0.1 | GO:0042126 | nitrate metabolic process(GO:0042126) nitrate assimilation(GO:0042128) |
0.0 | 0.3 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.1 | GO:0080029 | cellular response to boron-containing substance levels(GO:0080029) |
0.0 | 0.6 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.5 | GO:0046283 | anthocyanin-containing compound metabolic process(GO:0046283) |
0.0 | 0.0 | GO:0072337 | modified amino acid transport(GO:0072337) |
0.0 | 1.0 | GO:0090487 | toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
0.0 | 0.2 | GO:1990748 | cellular detoxification(GO:1990748) |
0.0 | 0.2 | GO:0006401 | RNA catabolic process(GO:0006401) |
0.0 | 0.2 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.0 | 0.1 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.0 | 0.2 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0090356 | negative regulation of auxin metabolic process(GO:0090356) |
0.0 | 0.1 | GO:0006882 | cellular zinc ion homeostasis(GO:0006882) |
0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.1 | GO:0033259 | plastid DNA metabolic process(GO:0033258) plastid DNA replication(GO:0033259) |
0.0 | 0.4 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
0.0 | 0.1 | GO:0015691 | cadmium ion transport(GO:0015691) |
0.0 | 0.6 | GO:0019762 | S-glycoside catabolic process(GO:0016145) glycosinolate catabolic process(GO:0019759) glucosinolate catabolic process(GO:0019762) |
0.0 | 0.2 | GO:0071826 | ribonucleoprotein complex subunit organization(GO:0071826) |
0.0 | 0.0 | GO:0051782 | negative regulation of cell division(GO:0051782) |
0.0 | 0.1 | GO:0031398 | positive regulation of protein ubiquitination(GO:0031398) positive regulation of protein modification by small protein conjugation or removal(GO:1903322) |
0.0 | 0.1 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
0.0 | 0.1 | GO:0019632 | shikimate metabolic process(GO:0019632) |
0.0 | 0.1 | GO:0010371 | regulation of gibberellin biosynthetic process(GO:0010371) |
0.0 | 0.4 | GO:0071804 | cellular potassium ion transport(GO:0071804) potassium ion transmembrane transport(GO:0071805) |
0.0 | 0.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.1 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.0 | 0.1 | GO:0045597 | positive regulation of cell differentiation(GO:0045597) |
0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.1 | GO:0007052 | mitotic spindle organization(GO:0007052) |
0.0 | 0.0 | GO:0032527 | protein exit from endoplasmic reticulum(GO:0032527) |
0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.0 | GO:0009120 | deoxyribonucleoside metabolic process(GO:0009120) thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.0 | 0.3 | GO:0032880 | regulation of protein localization(GO:0032880) |
0.0 | 0.9 | GO:0010608 | posttranscriptional regulation of gene expression(GO:0010608) |
0.0 | 0.1 | GO:0030244 | cellulose biosynthetic process(GO:0030244) |
0.0 | 0.4 | GO:0006397 | mRNA processing(GO:0006397) |
0.0 | 0.2 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
0.0 | 0.1 | GO:0010821 | regulation of mitochondrion organization(GO:0010821) |
0.0 | 0.3 | GO:0009124 | nucleoside monophosphate biosynthetic process(GO:0009124) |
0.0 | 0.0 | GO:0019400 | alditol metabolic process(GO:0019400) |
0.0 | 0.1 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.0 | 0.3 | GO:0070585 | protein targeting to mitochondrion(GO:0006626) protein localization to mitochondrion(GO:0070585) establishment of protein localization to mitochondrion(GO:0072655) |
0.0 | 0.0 | GO:0010364 | regulation of ethylene biosynthetic process(GO:0010364) regulation of sulfur amino acid metabolic process(GO:0031335) regulation of olefin metabolic process(GO:1900908) regulation of olefin biosynthetic process(GO:1900911) |
0.0 | 0.1 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.4 | GO:0016197 | endosomal transport(GO:0016197) |
0.0 | 0.1 | GO:0080117 | secondary growth(GO:0080117) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 4.1 | GO:0031356 | intrinsic component of plastid inner membrane(GO:0031352) integral component of plastid inner membrane(GO:0031353) intrinsic component of chloroplast inner membrane(GO:0031356) integral component of chloroplast inner membrane(GO:0031357) |
0.5 | 1.8 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.5 | 1.8 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.4 | 0.4 | GO:0035061 | interchromatin granule(GO:0035061) |
0.4 | 2.0 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
0.4 | 1.2 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.4 | 1.9 | GO:0010007 | magnesium chelatase complex(GO:0010007) |
0.4 | 1.1 | GO:0070993 | eukaryotic 48S preinitiation complex(GO:0033290) translation preinitiation complex(GO:0070993) |
0.3 | 0.9 | GO:0030689 | Noc complex(GO:0030689) |
0.3 | 0.9 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.3 | 0.3 | GO:0043614 | multi-eIF complex(GO:0043614) |
0.3 | 0.9 | GO:0031897 | Tic complex(GO:0031897) |
0.3 | 0.8 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.3 | 1.0 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.3 | 1.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.2 | 1.7 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.2 | 1.5 | GO:0090395 | plant cell papilla(GO:0090395) |
0.2 | 0.9 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.2 | 1.7 | GO:0009840 | chloroplastic endopeptidase Clp complex(GO:0009840) |
0.2 | 2.3 | GO:0015030 | Cajal body(GO:0015030) |
0.2 | 1.0 | GO:0034515 | proteasome storage granule(GO:0034515) |
0.2 | 4.1 | GO:0031358 | intrinsic component of plastid outer membrane(GO:0031354) integral component of plastid outer membrane(GO:0031355) intrinsic component of chloroplast outer membrane(GO:0031358) integral component of chloroplast outer membrane(GO:0031359) |
0.2 | 0.9 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.2 | 0.6 | GO:1990112 | RQC complex(GO:1990112) |
0.2 | 0.6 | GO:1990298 | bub1-bub3 complex(GO:1990298) |
0.2 | 1.6 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.2 | 0.5 | GO:0000311 | plastid large ribosomal subunit(GO:0000311) |
0.2 | 3.7 | GO:0009508 | plastid chromosome(GO:0009508) |
0.2 | 0.7 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.2 | 0.7 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
0.2 | 5.6 | GO:0032040 | small-subunit processome(GO:0032040) |
0.2 | 0.7 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) multimeric ribonuclease P complex(GO:0030681) |
0.2 | 0.3 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.2 | 0.5 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.2 | 0.6 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
0.2 | 0.5 | GO:0009501 | amyloplast(GO:0009501) |
0.1 | 0.6 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.1 | 3.1 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
0.1 | 0.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 1.6 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 1.6 | GO:0031519 | PcG protein complex(GO:0031519) |
0.1 | 1.1 | GO:0000312 | plastid small ribosomal subunit(GO:0000312) |
0.1 | 2.8 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.1 | 1.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 0.6 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.1 | 0.8 | GO:0032153 | cell division site(GO:0032153) |
0.1 | 0.4 | GO:0042709 | succinate-CoA ligase complex(GO:0042709) |
0.1 | 1.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 0.8 | GO:0016363 | nuclear matrix(GO:0016363) |
0.1 | 1.5 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 1.6 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 1.7 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 17.4 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 0.4 | GO:0016323 | basal plasma membrane(GO:0009925) basolateral plasma membrane(GO:0016323) basal part of cell(GO:0045178) |
0.1 | 7.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.6 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.8 | GO:0009346 | citrate lyase complex(GO:0009346) |
0.1 | 0.7 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.1 | 0.6 | GO:0034518 | RNA cap binding complex(GO:0034518) |
0.1 | 0.9 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 1.0 | GO:0005844 | polysome(GO:0005844) |
0.1 | 1.3 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 2.6 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.1 | GO:0005960 | glycine cleavage complex(GO:0005960) |
0.1 | 0.5 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.1 | 0.3 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 1.1 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 0.3 | GO:0005712 | chiasma(GO:0005712) |
0.1 | 0.9 | GO:0035861 | site of double-strand break(GO:0035861) |
0.1 | 0.6 | GO:0030286 | dynein complex(GO:0030286) |
0.1 | 0.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 1.3 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.1 | 4.2 | GO:0009527 | plastid outer membrane(GO:0009527) |
0.1 | 1.2 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
0.1 | 1.0 | GO:0010168 | ER body(GO:0010168) |
0.1 | 1.7 | GO:0005769 | early endosome(GO:0005769) |
0.1 | 1.0 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.1 | 0.3 | GO:0097361 | CIA complex(GO:0097361) |
0.1 | 0.6 | GO:0000786 | nucleosome(GO:0000786) |
0.1 | 0.9 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 0.4 | GO:0000922 | spindle pole(GO:0000922) |
0.1 | 2.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 8.3 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.7 | GO:0045261 | proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.9 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 1.8 | GO:0000148 | 1,3-beta-D-glucan synthase complex(GO:0000148) |
0.1 | 0.2 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.1 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 3.0 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.1 | 8.6 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 1.5 | GO:0009574 | preprophase band(GO:0009574) |
0.1 | 0.5 | GO:0070552 | BRISC complex(GO:0070552) |
0.1 | 1.7 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.1 | 0.5 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.1 | 0.4 | GO:0001401 | mitochondrial sorting and assembly machinery complex(GO:0001401) |
0.1 | 1.3 | GO:0031970 | organelle envelope lumen(GO:0031970) |
0.1 | 3.4 | GO:0009524 | phragmoplast(GO:0009524) |
0.1 | 0.7 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.4 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 1.3 | GO:0000347 | THO complex(GO:0000347) |
0.1 | 0.2 | GO:0055037 | recycling endosome(GO:0055037) |
0.1 | 23.3 | GO:0005730 | nucleolus(GO:0005730) |
0.1 | 0.5 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.1 | 0.7 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 0.6 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.5 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 1.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.1 | 0.6 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 4.5 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.3 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 0.2 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.1 | 1.5 | GO:0042644 | chloroplast nucleoid(GO:0042644) |
0.1 | 0.3 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.1 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.5 | GO:0016514 | SWI/SNF complex(GO:0016514) BAF-type complex(GO:0090544) |
0.1 | 0.3 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.1 | 0.4 | GO:0043036 | chloroplast starch grain(GO:0009569) starch grain(GO:0043036) |
0.1 | 0.7 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
0.1 | 1.1 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 1.2 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.1 | 1.0 | GO:0045281 | respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) |
0.1 | 43.9 | GO:0009570 | chloroplast stroma(GO:0009570) |
0.1 | 2.6 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.1 | 0.3 | GO:0000322 | storage vacuole(GO:0000322) protein storage vacuole(GO:0000326) |
0.1 | 5.8 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.2 | GO:0034066 | guanyl-nucleotide exchange factor complex(GO:0032045) RIC1-RGP1 guanyl-nucleotide exchange factor complex(GO:0034066) |
0.1 | 2.9 | GO:0031969 | chloroplast membrane(GO:0031969) |
0.1 | 2.7 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 0.9 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.6 | GO:0032806 | holo TFIIH complex(GO:0005675) carboxy-terminal domain protein kinase complex(GO:0032806) |
0.1 | 0.4 | GO:0031082 | BLOC complex(GO:0031082) BLOC-1 complex(GO:0031083) |
0.1 | 0.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 0.7 | GO:0009504 | cell plate(GO:0009504) |
0.1 | 1.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.9 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.5 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 2.3 | GO:0005635 | nuclear envelope(GO:0005635) |
0.1 | 0.4 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 1.3 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.1 | 0.2 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
0.1 | 0.4 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 0.6 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.1 | 0.3 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.2 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.1 | 0.8 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
0.1 | 1.0 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 0.5 | GO:1902554 | serine/threonine protein kinase complex(GO:1902554) |
0.1 | 13.3 | GO:0009579 | thylakoid(GO:0009579) |
0.0 | 0.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) endoplasmic reticulum subcompartment(GO:0098827) |
0.0 | 0.4 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
0.0 | 1.1 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 7.0 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.0 | 0.7 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 2.8 | GO:0016604 | nuclear body(GO:0016604) |
0.0 | 0.3 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 3.8 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
0.0 | 109.2 | GO:0005829 | cytosol(GO:0005829) |
0.0 | 0.7 | GO:0031228 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
0.0 | 3.2 | GO:0016021 | integral component of membrane(GO:0016021) |
0.0 | 1.2 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.7 | GO:0010008 | endosome membrane(GO:0010008) |
0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.6 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 6.5 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
0.0 | 0.4 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.0 | 0.1 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 1.2 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.3 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 2.0 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 3.3 | GO:0000790 | nuclear chromatin(GO:0000790) |
0.0 | 1.1 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.2 | GO:0030897 | HOPS complex(GO:0030897) |
0.0 | 3.7 | GO:0009526 | plastid envelope(GO:0009526) |
0.0 | 11.2 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 0.1 | GO:0048226 | Casparian strip(GO:0048226) |
0.0 | 1.4 | GO:0099503 | secretory vesicle(GO:0099503) |
0.0 | 0.1 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 1.8 | GO:0000325 | plant-type vacuole(GO:0000325) |
0.0 | 0.5 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:0070390 | transcription export complex 2(GO:0070390) |
0.0 | 0.1 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.0 | 0.9 | GO:0044216 | host(GO:0018995) host cell part(GO:0033643) host intracellular part(GO:0033646) host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) host cell nucleus(GO:0042025) intracellular region of host(GO:0043656) host cell(GO:0043657) other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
0.0 | 26.7 | GO:0005886 | plasma membrane(GO:0005886) |
0.0 | 0.2 | GO:0031966 | mitochondrial membrane(GO:0031966) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 8.7 | GO:0047216 | inositol 3-alpha-galactosyltransferase activity(GO:0047216) |
0.8 | 2.4 | GO:0016630 | protochlorophyllide reductase activity(GO:0016630) |
0.8 | 3.8 | GO:0008964 | phosphoenolpyruvate carboxylase activity(GO:0008964) |
0.7 | 2.7 | GO:0004349 | glutamate 5-kinase activity(GO:0004349) glutamate-5-semialdehyde dehydrogenase activity(GO:0004350) |
0.7 | 3.3 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.6 | 1.2 | GO:0080045 | quercetin 3'-O-glucosyltransferase activity(GO:0080045) |
0.6 | 2.8 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.5 | 2.2 | GO:0045548 | phenylalanine ammonia-lyase activity(GO:0045548) |
0.5 | 1.5 | GO:0032947 | MAP-kinase scaffold activity(GO:0005078) protein kinase C binding(GO:0005080) protein complex scaffold(GO:0032947) signaling adaptor activity(GO:0035591) |
0.5 | 0.5 | GO:0052747 | sinapyl alcohol dehydrogenase activity(GO:0052747) |
0.5 | 1.9 | GO:0031516 | far-red light photoreceptor activity(GO:0031516) |
0.5 | 2.7 | GO:0070547 | L-tyrosine:2-oxoglutarate aminotransferase activity(GO:0004838) L-tyrosine aminotransferase activity(GO:0070547) |
0.5 | 1.4 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.4 | 2.2 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
0.4 | 3.6 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.4 | 1.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.4 | 3.9 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.4 | 2.6 | GO:0051996 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
0.4 | 1.3 | GO:0009671 | nitrate:proton symporter activity(GO:0009671) |
0.4 | 4.1 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.4 | 1.6 | GO:0046537 | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase activity(GO:0046537) |
0.4 | 4.5 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
0.4 | 3.7 | GO:0009882 | blue light photoreceptor activity(GO:0009882) |
0.4 | 6.8 | GO:0016157 | sucrose synthase activity(GO:0016157) |
0.4 | 1.2 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.4 | 2.4 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.4 | 1.5 | GO:0003852 | 2-isopropylmalate synthase activity(GO:0003852) |
0.4 | 2.6 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.4 | 1.5 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.4 | 1.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.4 | 1.1 | GO:0052592 | oxidoreductase activity, acting on CH or CH2 groups, with an iron-sulfur protein as acceptor(GO:0052592) |
0.3 | 1.4 | GO:0052595 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
0.3 | 1.4 | GO:0019172 | glyoxalase III activity(GO:0019172) |
0.3 | 2.4 | GO:0008441 | 3'(2'),5'-bisphosphate nucleotidase activity(GO:0008441) |
0.3 | 0.7 | GO:0080146 | L-cysteine desulfhydrase activity(GO:0080146) |
0.3 | 1.0 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.3 | 1.0 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
0.3 | 1.9 | GO:0051003 | magnesium chelatase activity(GO:0016851) ligase activity, forming nitrogen-metal bonds(GO:0051002) ligase activity, forming nitrogen-metal bonds, forming coordination complexes(GO:0051003) |
0.3 | 1.6 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.3 | 1.2 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
0.3 | 0.9 | GO:0016277 | [myelin basic protein]-arginine N-methyltransferase activity(GO:0016277) |
0.3 | 0.6 | GO:0004462 | lactoylglutathione lyase activity(GO:0004462) |
0.3 | 1.2 | GO:0008686 | GTP cyclohydrolase II activity(GO:0003935) 3,4-dihydroxy-2-butanone-4-phosphate synthase activity(GO:0008686) |
0.3 | 1.2 | GO:0035516 | oxidative DNA demethylase activity(GO:0035516) |
0.3 | 0.9 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.3 | 1.7 | GO:0019904 | protein domain specific binding(GO:0019904) |
0.3 | 1.1 | GO:0080103 | 4-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080103) |
0.3 | 1.1 | GO:0016656 | monodehydroascorbate reductase (NADH) activity(GO:0016656) |
0.3 | 1.9 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.3 | 3.5 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
0.3 | 0.8 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.3 | 0.8 | GO:0004528 | phosphodiesterase I activity(GO:0004528) double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
0.3 | 1.8 | GO:0010279 | indole-3-acetic acid amido synthetase activity(GO:0010279) |
0.3 | 0.8 | GO:1990259 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
0.3 | 0.5 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.3 | 1.5 | GO:0050062 | long-chain-fatty-acyl-CoA reductase activity(GO:0050062) |
0.3 | 1.0 | GO:0005093 | Rab GDP-dissociation inhibitor activity(GO:0005093) |
0.3 | 7.8 | GO:0048029 | monosaccharide binding(GO:0048029) |
0.2 | 2.0 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.2 | 3.7 | GO:0015086 | cadmium ion transmembrane transporter activity(GO:0015086) |
0.2 | 0.5 | GO:0004356 | glutamate-ammonia ligase activity(GO:0004356) |
0.2 | 0.2 | GO:0051903 | S-(hydroxymethyl)glutathione dehydrogenase activity(GO:0051903) |
0.2 | 0.7 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.2 | 0.7 | GO:0001130 | bacterial-type RNA polymerase transcription factor activity, sequence-specific DNA binding(GO:0001130) bacterial-type RNA polymerase transcriptional activator activity, sequence-specific DNA binding(GO:0001216) |
0.2 | 1.0 | GO:0042409 | caffeoyl-CoA O-methyltransferase activity(GO:0042409) |
0.2 | 1.0 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
0.2 | 1.9 | GO:0090447 | glycerol-3-phosphate 2-O-acyltransferase activity(GO:0090447) |
0.2 | 0.5 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.2 | 4.3 | GO:0010329 | auxin efflux transmembrane transporter activity(GO:0010329) |
0.2 | 1.0 | GO:0004475 | mannose-1-phosphate guanylyltransferase activity(GO:0004475) |
0.2 | 0.7 | GO:0019003 | GDP binding(GO:0019003) |
0.2 | 1.7 | GO:0016703 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of one atom of oxygen (internal monooxygenases or internal mixed function oxidases)(GO:0016703) |
0.2 | 1.6 | GO:0001872 | (1->3)-beta-D-glucan binding(GO:0001872) |
0.2 | 1.2 | GO:0035197 | siRNA binding(GO:0035197) |
0.2 | 0.7 | GO:1990883 | rRNA cytidine N-acetyltransferase activity(GO:1990883) |
0.2 | 0.7 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.2 | 0.9 | GO:0015367 | oxoglutarate:malate antiporter activity(GO:0015367) |
0.2 | 0.9 | GO:0004831 | tyrosine-tRNA ligase activity(GO:0004831) |
0.2 | 0.7 | GO:0031219 | levanase activity(GO:0031219) fructan beta-fructosidase activity(GO:0051669) |
0.2 | 0.2 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
0.2 | 0.7 | GO:0003864 | 3-methyl-2-oxobutanoate hydroxymethyltransferase activity(GO:0003864) |
0.2 | 0.7 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
0.2 | 1.7 | GO:0050307 | sucrose-phosphate phosphatase activity(GO:0050307) |
0.2 | 1.5 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.2 | 1.7 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.2 | 2.8 | GO:0002020 | protease binding(GO:0002020) |
0.2 | 1.7 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.2 | 1.1 | GO:1902388 | ceramide transporter activity(GO:0035620) sphingolipid transporter activity(GO:0046624) ceramide 1-phosphate binding(GO:1902387) ceramide 1-phosphate transporter activity(GO:1902388) |
0.2 | 0.6 | GO:0052629 | phosphatidylinositol-3-phosphatase activity(GO:0004438) phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.2 | 0.8 | GO:0070140 | ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
0.2 | 1.5 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.2 | 0.8 | GO:0003862 | 3-isopropylmalate dehydrogenase activity(GO:0003862) |
0.2 | 1.0 | GO:0003680 | AT DNA binding(GO:0003680) |
0.2 | 0.8 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.2 | 1.2 | GO:0043878 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (non-phosphorylating) activity(GO:0043878) |
0.2 | 0.4 | GO:0016726 | oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.2 | 1.0 | GO:0080122 | AMP transmembrane transporter activity(GO:0080122) |
0.2 | 1.0 | GO:0003979 | UDP-glucose 6-dehydrogenase activity(GO:0003979) |
0.2 | 2.4 | GO:0000210 | NAD+ diphosphatase activity(GO:0000210) |
0.2 | 0.8 | GO:0033741 | adenylyl-sulfate reductase activity(GO:0009973) adenylyl-sulfate reductase (glutathione) activity(GO:0033741) |
0.2 | 0.6 | GO:0045430 | chalcone isomerase activity(GO:0045430) |
0.2 | 0.6 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.2 | 0.6 | GO:0003844 | 1,4-alpha-glucan branching enzyme activity(GO:0003844) |
0.2 | 0.6 | GO:0016504 | peptidase activator activity(GO:0016504) |
0.2 | 0.7 | GO:0050347 | trans-octaprenyltranstransferase activity(GO:0050347) all-trans-nonaprenyl-diphosphate synthase (geranylgeranyl-diphosphate specific) activity(GO:0052924) |
0.2 | 0.6 | GO:0004034 | aldose 1-epimerase activity(GO:0004034) |
0.2 | 0.7 | GO:0004149 | dihydrolipoyllysine-residue succinyltransferase activity(GO:0004149) succinyltransferase activity(GO:0016748) S-succinyltransferase activity(GO:0016751) |
0.2 | 1.1 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) |
0.2 | 1.1 | GO:0047274 | galactinol-sucrose galactosyltransferase activity(GO:0047274) |
0.2 | 0.4 | GO:0047215 | indole-3-acetate beta-glucosyltransferase activity(GO:0047215) |
0.2 | 2.4 | GO:0042389 | omega-3 fatty acid desaturase activity(GO:0042389) |
0.2 | 0.4 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.2 | 0.5 | GO:0004412 | homoserine dehydrogenase activity(GO:0004412) |
0.2 | 0.9 | GO:0015203 | polyamine transmembrane transporter activity(GO:0015203) |
0.2 | 0.7 | GO:0016034 | maleylacetoacetate isomerase activity(GO:0016034) |
0.2 | 0.5 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.2 | 1.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.2 | 2.0 | GO:0102360 | daphnetin 3-O-glucosyltransferase activity(GO:0102360) |
0.2 | 1.8 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.2 | 0.7 | GO:0080002 | UDP-glucose:4-aminobenzoate acylglucosyltransferase activity(GO:0080002) |
0.2 | 1.9 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.2 | 0.7 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.2 | 0.7 | GO:0008460 | dTDP-glucose 4,6-dehydratase activity(GO:0008460) |
0.2 | 0.7 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.2 | 1.0 | GO:0052691 | UDP-arabinopyranose mutase activity(GO:0052691) |
0.2 | 2.6 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.2 | 1.0 | GO:0031072 | heat shock protein binding(GO:0031072) |
0.2 | 0.5 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.2 | 1.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.2 | 1.0 | GO:0016984 | ribulose-bisphosphate carboxylase activity(GO:0016984) |
0.2 | 1.1 | GO:0005034 | osmosensor activity(GO:0005034) |
0.2 | 0.5 | GO:0046480 | galactolipid galactosyltransferase activity(GO:0046480) |
0.2 | 0.8 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.2 | 0.8 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.2 | 0.9 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.2 | 0.6 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.2 | 2.3 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.2 | 1.1 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
0.2 | 0.5 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 1.0 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.1 | GO:0008835 | diaminohydroxyphosphoribosylaminopyrimidine deaminase activity(GO:0008835) |
0.1 | 1.3 | GO:0015112 | nitrate transmembrane transporter activity(GO:0015112) |
0.1 | 0.9 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.1 | 0.7 | GO:0034432 | bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
0.1 | 0.4 | GO:0008936 | nicotinamidase activity(GO:0008936) |
0.1 | 2.2 | GO:0004743 | pyruvate kinase activity(GO:0004743) potassium ion binding(GO:0030955) alkali metal ion binding(GO:0031420) |
0.1 | 0.7 | GO:0004333 | fumarate hydratase activity(GO:0004333) |
0.1 | 2.6 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.1 | 0.4 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.1 | 2.8 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.1 | 0.4 | GO:0005046 | KDEL sequence binding(GO:0005046) |
0.1 | 1.7 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 4.9 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) mannan synthase activity(GO:0051753) |
0.1 | 1.4 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
0.1 | 5.1 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.1 | 0.4 | GO:0004775 | succinate-CoA ligase activity(GO:0004774) succinate-CoA ligase (ADP-forming) activity(GO:0004775) succinate-CoA ligase (GDP-forming) activity(GO:0004776) |
0.1 | 0.1 | GO:0004567 | beta-mannosidase activity(GO:0004567) |
0.1 | 0.4 | GO:0010291 | carotene beta-ring hydroxylase activity(GO:0010291) |
0.1 | 0.4 | GO:0070678 | preprotein binding(GO:0070678) |
0.1 | 1.9 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 0.4 | GO:0019779 | Atg8 ligase activity(GO:0019776) Atg8 activating enzyme activity(GO:0019779) |
0.1 | 5.8 | GO:0019843 | rRNA binding(GO:0019843) |
0.1 | 0.7 | GO:0004001 | adenosine kinase activity(GO:0004001) |
0.1 | 2.7 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.5 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
0.1 | 0.4 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.1 | 0.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 0.9 | GO:0051018 | protein kinase A regulatory subunit binding(GO:0034237) protein kinase A binding(GO:0051018) Arp2/3 complex binding(GO:0071933) |
0.1 | 0.3 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.1 | 0.4 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
0.1 | 0.8 | GO:0050378 | UDP-glucuronate 4-epimerase activity(GO:0050378) |
0.1 | 0.5 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.1 | 0.9 | GO:0052854 | very-long-chain-(S)-2-hydroxy-acid oxidase activity(GO:0052852) long-chain-(S)-2-hydroxy-long-chain-acid oxidase activity(GO:0052853) medium-chain-(S)-2-hydroxy-acid oxidase activity(GO:0052854) |
0.1 | 1.4 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methyladenine glycosylase activity(GO:0008725) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.1 | 0.8 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
0.1 | 0.2 | GO:0008481 | sphinganine kinase activity(GO:0008481) |
0.1 | 0.6 | GO:0030371 | translation repressor activity(GO:0030371) |
0.1 | 0.5 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
0.1 | 0.4 | GO:0036310 | annealing helicase activity(GO:0036310) annealing activity(GO:0097617) |
0.1 | 0.4 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.1 | 0.5 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.1 | 1.8 | GO:0070717 | poly-purine tract binding(GO:0070717) |
0.1 | 0.4 | GO:0004476 | mannose-6-phosphate isomerase activity(GO:0004476) |
0.1 | 1.5 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.1 | 1.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 0.4 | GO:0050577 | GDP-L-fucose synthase activity(GO:0050577) |
0.1 | 0.6 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.7 | GO:0003913 | DNA photolyase activity(GO:0003913) |
0.1 | 0.7 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 1.2 | GO:0098847 | single-stranded telomeric DNA binding(GO:0043047) sequence-specific single stranded DNA binding(GO:0098847) |
0.1 | 0.3 | GO:0047780 | citrate dehydratase activity(GO:0047780) |
0.1 | 0.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 0.5 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
0.1 | 0.5 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 0.7 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.1 | 0.5 | GO:0004048 | anthranilate phosphoribosyltransferase activity(GO:0004048) |
0.1 | 0.6 | GO:0010295 | (+)-abscisic acid 8'-hydroxylase activity(GO:0010295) |
0.1 | 0.3 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 8.5 | GO:0003724 | RNA helicase activity(GO:0003724) |
0.1 | 25.2 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.6 | GO:0051959 | dynein binding(GO:0045502) dynein intermediate chain binding(GO:0045505) dynein light intermediate chain binding(GO:0051959) |
0.1 | 0.6 | GO:0016985 | mannan endo-1,4-beta-mannosidase activity(GO:0016985) |
0.1 | 0.3 | GO:0000234 | phosphoethanolamine N-methyltransferase activity(GO:0000234) |
0.1 | 0.3 | GO:0018488 | aryl-aldehyde oxidase activity(GO:0018488) indole-3-acetaldehyde oxidase activity(GO:0050302) |
0.1 | 6.8 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.1 | 3.5 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
0.1 | 0.4 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 0.7 | GO:0015288 | porin activity(GO:0015288) wide pore channel activity(GO:0022829) |
0.1 | 6.5 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.1 | 0.5 | GO:0050734 | hydroxycinnamoyltransferase activity(GO:0050734) |
0.1 | 0.4 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.7 | GO:0032977 | membrane insertase activity(GO:0032977) |
0.1 | 1.1 | GO:0017022 | myosin binding(GO:0017022) |
0.1 | 5.4 | GO:0102483 | scopolin beta-glucosidase activity(GO:0102483) |
0.1 | 0.5 | GO:0009678 | hydrogen-translocating pyrophosphatase activity(GO:0009678) |
0.1 | 0.3 | GO:0008661 | 1-deoxy-D-xylulose-5-phosphate synthase activity(GO:0008661) |
0.1 | 2.2 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
0.1 | 1.6 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.1 | 0.4 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.1 | 0.1 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
0.1 | 0.3 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) single-stranded DNA-dependent ATP-dependent 3'-5' DNA helicase activity(GO:1990518) |
0.1 | 0.6 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 1.5 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.1 | 2.1 | GO:0030276 | clathrin binding(GO:0030276) |
0.1 | 0.4 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.1 | 0.4 | GO:0016707 | gibberellin 3-beta-dioxygenase activity(GO:0016707) |
0.1 | 0.2 | GO:0047912 | galacturonokinase activity(GO:0047912) |
0.1 | 0.5 | GO:0046577 | long-chain-alcohol oxidase activity(GO:0046577) |
0.1 | 0.4 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.1 | 0.4 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 9.3 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.1 | 0.3 | GO:0030941 | chloroplast targeting sequence binding(GO:0030941) |
0.1 | 0.5 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 1.8 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.1 | 1.8 | GO:0003843 | 1,3-beta-D-glucan synthase activity(GO:0003843) |
0.1 | 1.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.3 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
0.1 | 2.0 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.7 | GO:0000996 | core DNA-dependent RNA polymerase binding promoter specificity activity(GO:0000996) sigma factor activity(GO:0016987) |
0.1 | 2.7 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.1 | 0.4 | GO:0004057 | arginyltransferase activity(GO:0004057) |
0.1 | 0.3 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.1 | 0.3 | GO:0051752 | phosphoglucan, water dikinase activity(GO:0051752) |
0.1 | 0.3 | GO:0000170 | sphingosine hydroxylase activity(GO:0000170) |
0.1 | 0.4 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
0.1 | 0.4 | GO:0038199 | ethylene receptor activity(GO:0038199) ethylene binding(GO:0051740) alkene binding(GO:0072328) |
0.1 | 1.1 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.1 | 0.3 | GO:0004807 | triose-phosphate isomerase activity(GO:0004807) |
0.1 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 0.9 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 0.9 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.1 | 0.6 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) serine binding(GO:0070905) |
0.1 | 0.6 | GO:0000257 | nitrilase activity(GO:0000257) hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in nitriles(GO:0016815) nitrile hydratase activity(GO:0018822) indole-3-acetonitrile nitrilase activity(GO:0080061) |
0.1 | 1.0 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.1 | 0.8 | GO:0032041 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) NAD-dependent protein deacetylase activity(GO:0034979) |
0.1 | 0.5 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.1 | 0.3 | GO:0004750 | ribulose-phosphate 3-epimerase activity(GO:0004750) |
0.1 | 0.5 | GO:0045156 | electron transporter, transferring electrons within the cyclic electron transport pathway of photosynthesis activity(GO:0045156) |
0.1 | 0.5 | GO:0070122 | isopeptidase activity(GO:0070122) |
0.1 | 1.5 | GO:0051536 | iron-sulfur cluster binding(GO:0051536) metal cluster binding(GO:0051540) |
0.1 | 1.1 | GO:0051117 | ATPase binding(GO:0051117) |
0.1 | 0.5 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.1 | 11.9 | GO:0042626 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) ATPase activity, coupled to transmembrane movement of substances(GO:0042626) ATPase activity, coupled to movement of substances(GO:0043492) |
0.1 | 0.2 | GO:0004484 | mRNA guanylyltransferase activity(GO:0004484) polynucleotide 5'-phosphatase activity(GO:0004651) RNA guanylyltransferase activity(GO:0008192) polynucleotide phosphatase activity(GO:0098518) |
0.1 | 1.9 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.2 | GO:0046409 | p-coumarate 3-hydroxylase activity(GO:0046409) |
0.1 | 0.7 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.3 | GO:0070403 | NAD+ binding(GO:0070403) |
0.1 | 0.3 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.1 | 0.2 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.1 | 0.2 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 0.2 | GO:0017050 | D-erythro-sphingosine kinase activity(GO:0017050) |
0.1 | 1.8 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.1 | 2.9 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.3 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.1 | 0.6 | GO:0009815 | 1-aminocyclopropane-1-carboxylate oxidase activity(GO:0009815) |
0.1 | 0.4 | GO:0004816 | asparagine-tRNA ligase activity(GO:0004816) |
0.1 | 0.9 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
0.1 | 5.2 | GO:0036459 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) |
0.1 | 0.4 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.1 | 0.8 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.7 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 0.1 | GO:0008144 | drug binding(GO:0008144) |
0.1 | 0.2 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
0.1 | 0.7 | GO:0008878 | glucose-1-phosphate adenylyltransferase activity(GO:0008878) |
0.1 | 0.3 | GO:0015136 | sialic acid transmembrane transporter activity(GO:0015136) |
0.1 | 0.6 | GO:0009916 | alternative oxidase activity(GO:0009916) |
0.1 | 2.2 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
0.1 | 0.2 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.1 | 0.2 | GO:0016906 | sterol 3-beta-glucosyltransferase activity(GO:0016906) |
0.1 | 0.4 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 3.0 | GO:0000156 | phosphorelay response regulator activity(GO:0000156) |
0.1 | 1.2 | GO:0060090 | binding, bridging(GO:0060090) |
0.1 | 0.2 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
0.1 | 2.3 | GO:0031625 | ubiquitin protein ligase binding(GO:0031625) |
0.1 | 0.7 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 0.5 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.1 | 1.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.1 | 0.2 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.3 | GO:0019202 | amino acid kinase activity(GO:0019202) |
0.1 | 0.5 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 0.5 | GO:0090079 | translation activator activity(GO:0008494) translation regulator activity(GO:0045182) translation regulator activity, nucleic acid binding(GO:0090079) mitochondrial ribosome binding(GO:0097177) |
0.1 | 0.9 | GO:0070290 | phospholipase D activity(GO:0004630) N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 0.6 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.1 | 0.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.1 | 0.5 | GO:0001653 | peptide receptor activity(GO:0001653) |
0.1 | 0.2 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
0.1 | 0.6 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
0.1 | 0.4 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.1 | 0.1 | GO:0016781 | phosphotransferase activity, paired acceptors(GO:0016781) |
0.1 | 0.6 | GO:0019902 | phosphatase binding(GO:0019902) |
0.1 | 0.4 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.8 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.1 | 0.2 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.3 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.2 | GO:0047209 | coniferyl-alcohol glucosyltransferase activity(GO:0047209) |
0.1 | 0.2 | GO:0033862 | UMP kinase activity(GO:0033862) |
0.1 | 0.9 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.1 | 0.2 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.2 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
0.1 | 0.2 | GO:0005460 | UDP-glucose transmembrane transporter activity(GO:0005460) |
0.1 | 3.3 | GO:0010857 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
0.1 | 0.2 | GO:0019534 | tetracycline transporter activity(GO:0008493) toxin transporter activity(GO:0019534) antibiotic transporter activity(GO:0042895) |
0.1 | 2.5 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
0.1 | 0.6 | GO:0047938 | glucose-6-phosphate 1-epimerase activity(GO:0047938) |
0.1 | 0.2 | GO:0015930 | glutamate synthase activity(GO:0015930) glutamate synthase (NADH) activity(GO:0016040) glutamate synthase activity, NAD(P)H as acceptor(GO:0045181) |
0.1 | 1.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.1 | 0.4 | GO:0009011 | starch synthase activity(GO:0009011) alpha-1,4-glucan synthase activity(GO:0033201) |
0.1 | 0.8 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 0.5 | GO:0052745 | inositol phosphate phosphatase activity(GO:0052745) |
0.1 | 0.4 | GO:0045549 | 9-cis-epoxycarotenoid dioxygenase activity(GO:0045549) |
0.1 | 0.2 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.1 | 0.6 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.4 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.1 | 0.3 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 1.1 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
0.1 | 31.7 | GO:0044822 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
0.1 | 0.3 | GO:0010294 | abscisic acid glucosyltransferase activity(GO:0010294) |
0.1 | 0.3 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.3 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.4 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.5 | GO:1901981 | phosphatidylinositol phosphate binding(GO:1901981) |
0.0 | 0.3 | GO:0046592 | polyamine oxidase activity(GO:0046592) |
0.0 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.6 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
0.0 | 0.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 1.1 | GO:0016620 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, NAD or NADP as acceptor(GO:0016620) |
0.0 | 2.3 | GO:0043621 | protein self-association(GO:0043621) |
0.0 | 0.3 | GO:0004449 | isocitrate dehydrogenase activity(GO:0004448) isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.9 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.2 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.0 | 0.5 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0004452 | isopentenyl-diphosphate delta-isomerase activity(GO:0004452) |
0.0 | 0.3 | GO:0050017 | L-3-cyanoalanine synthase activity(GO:0050017) |
0.0 | 0.6 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.2 | GO:0004617 | phosphoglycerate dehydrogenase activity(GO:0004617) |
0.0 | 2.1 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.3 | GO:0051185 | S-adenosyl-L-methionine transmembrane transporter activity(GO:0000095) coenzyme transporter activity(GO:0051185) |
0.0 | 0.2 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.2 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) core promoter binding(GO:0001047) |
0.0 | 0.7 | GO:0005267 | potassium channel activity(GO:0005267) |
0.0 | 0.1 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.0 | 1.1 | GO:0008170 | N-methyltransferase activity(GO:0008170) |
0.0 | 0.1 | GO:0047560 | 3-dehydrosphinganine reductase activity(GO:0047560) |
0.0 | 0.2 | GO:0050284 | sinapate 1-glucosyltransferase activity(GO:0050284) |
0.0 | 0.2 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.3 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 2.6 | GO:0004650 | polygalacturonase activity(GO:0004650) |
0.0 | 0.2 | GO:0051087 | chaperone binding(GO:0051087) |
0.0 | 0.5 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 1.4 | GO:0005319 | lipid transporter activity(GO:0005319) |
0.0 | 1.8 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.3 | GO:0003999 | adenine phosphoribosyltransferase activity(GO:0003999) |
0.0 | 0.1 | GO:0008963 | phospho-N-acetylmuramoyl-pentapeptide-transferase activity(GO:0008963) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 1.3 | GO:0003713 | transcription coactivator activity(GO:0003713) |
0.0 | 0.2 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.5 | GO:0043424 | protein histidine kinase binding(GO:0043424) |
0.0 | 0.1 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.1 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) chloride channel activity(GO:0005254) |
0.0 | 0.2 | GO:0004148 | dihydrolipoyl dehydrogenase activity(GO:0004148) |
0.0 | 0.1 | GO:0016531 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
0.0 | 1.7 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.3 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.0 | 0.9 | GO:0061733 | histone acetyltransferase activity(GO:0004402) peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.0 | 0.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.1 | GO:0080161 | auxin transmembrane transporter activity(GO:0080161) |
0.0 | 3.1 | GO:0005525 | GTP binding(GO:0005525) guanyl nucleotide binding(GO:0019001) guanyl ribonucleotide binding(GO:0032561) |
0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.1 | GO:0010313 | phytochrome binding(GO:0010313) |
0.0 | 0.3 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
0.0 | 1.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 2.9 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.2 | GO:0070696 | transmembrane receptor protein serine/threonine kinase binding(GO:0070696) |
0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.2 | GO:0008022 | protein C-terminus binding(GO:0008022) |
0.0 | 0.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 1.4 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.7 | GO:0035091 | phosphatidylinositol binding(GO:0035091) |
0.0 | 1.3 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
0.0 | 0.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.2 | GO:0015217 | ADP transmembrane transporter activity(GO:0015217) |
0.0 | 0.1 | GO:0008251 | adenosine deaminase activity(GO:0004000) tRNA-specific adenosine deaminase activity(GO:0008251) |
0.0 | 10.0 | GO:0008270 | zinc ion binding(GO:0008270) |
0.0 | 0.2 | GO:0004124 | cysteine synthase activity(GO:0004124) |
0.0 | 2.2 | GO:0016887 | ATPase activity(GO:0016887) |
0.0 | 0.2 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.2 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.2 | GO:0008083 | growth factor activity(GO:0008083) |
0.0 | 2.5 | GO:0008017 | microtubule binding(GO:0008017) |
0.0 | 0.7 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.6 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:0015369 | calcium:proton antiporter activity(GO:0015369) |
0.0 | 0.1 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0004042 | acetyl-CoA:L-glutamate N-acetyltransferase activity(GO:0004042) |
0.0 | 0.1 | GO:0004765 | shikimate kinase activity(GO:0004765) |
0.0 | 0.1 | GO:0033764 | steroid dehydrogenase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0033764) |
0.0 | 0.2 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.0 | 0.1 | GO:0030267 | glyoxylate reductase (NADP) activity(GO:0030267) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.2 | GO:0005496 | steroid binding(GO:0005496) |
0.0 | 0.2 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.2 | GO:0016161 | beta-amylase activity(GO:0016161) |
0.0 | 0.1 | GO:0003919 | FMN adenylyltransferase activity(GO:0003919) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 1.9 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
0.0 | 0.0 | GO:0004640 | phosphoribosylanthranilate isomerase activity(GO:0004640) |
0.0 | 0.1 | GO:0015391 | nucleobase:cation symporter activity(GO:0015391) |
0.0 | 0.8 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.2 | GO:0005253 | anion channel activity(GO:0005253) |
0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 2.0 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.0 | GO:0004424 | imidazoleglycerol-phosphate dehydratase activity(GO:0004424) |
0.0 | 0.1 | GO:0016688 | L-ascorbate peroxidase activity(GO:0016688) |
0.0 | 0.0 | GO:0004751 | ribose-5-phosphate isomerase activity(GO:0004751) |
0.0 | 0.1 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
0.0 | 0.3 | GO:0016837 | carbon-oxygen lyase activity, acting on polysaccharides(GO:0016837) pectate lyase activity(GO:0030570) |
0.0 | 0.3 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) phosphoprotein binding(GO:0051219) |
0.0 | 0.0 | GO:0004044 | amidophosphoribosyltransferase activity(GO:0004044) |
0.0 | 0.2 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.3 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
0.0 | 0.2 | GO:0016875 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.0 | 0.0 | GO:0033925 | mannosyl-glycoprotein endo-beta-N-acetylglucosaminidase activity(GO:0033925) |
0.0 | 0.8 | GO:0003712 | transcription factor activity, transcription factor binding(GO:0000989) transcription cofactor activity(GO:0003712) |
0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.9 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.3 | 1.0 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.3 | 1.0 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.3 | 0.3 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.2 | 1.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.2 | 1.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.2 | 1.3 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.2 | 0.5 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.2 | 0.8 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.2 | 0.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.2 | 0.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.2 | 0.9 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.1 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.1 | 0.4 | PID MYC PATHWAY | C-MYC pathway |
0.1 | 1.1 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 0.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.1 | 0.4 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.1 | 0.1 | PID P53 REGULATION PATHWAY | p53 pathway |
0.1 | 0.4 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.1 | 0.4 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 0.4 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.4 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.2 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.0 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.5 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.5 | 2.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.5 | 1.4 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.4 | 1.2 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.4 | 1.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.3 | 1.2 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.3 | 2.2 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.3 | 0.8 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.2 | 1.4 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.2 | 0.9 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.2 | 1.1 | REACTOME SLC MEDIATED TRANSMEMBRANE TRANSPORT | Genes involved in SLC-mediated transmembrane transport |
0.2 | 0.7 | REACTOME NEUROTRANSMITTER RECEPTOR BINDING AND DOWNSTREAM TRANSMISSION IN THE POSTSYNAPTIC CELL | Genes involved in Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell |
0.2 | 0.5 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.1 | 0.7 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.1 | 1.1 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.1 | 0.9 | REACTOME INTERFERON SIGNALING | Genes involved in Interferon Signaling |
0.1 | 0.4 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 1.5 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.1 | 0.5 | REACTOME PLATELET ACTIVATION SIGNALING AND AGGREGATION | Genes involved in Platelet activation, signaling and aggregation |
0.1 | 0.4 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.1 | 0.7 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.1 | 0.7 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 0.6 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.1 | 0.2 | REACTOME AXON GUIDANCE | Genes involved in Axon guidance |
0.1 | 0.2 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.1 | 0.1 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.1 | 1.4 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.1 | 0.5 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 0.1 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.2 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
0.1 | 0.3 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.1 | 0.9 | REACTOME HEMOSTASIS | Genes involved in Hemostasis |
0.1 | 0.5 | REACTOME METABOLISM OF CARBOHYDRATES | Genes involved in Metabolism of carbohydrates |
0.1 | 0.4 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
0.0 | 0.6 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.2 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.1 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.2 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.0 | 0.5 | REACTOME TRANSMEMBRANE TRANSPORT OF SMALL MOLECULES | Genes involved in Transmembrane transport of small molecules |
0.0 | 0.1 | REACTOME METABOLISM OF NUCLEOTIDES | Genes involved in Metabolism of nucleotides |