GSE130291:vernalization in Arabidopsis thaliana
Gene Symbol | Gene ID | Gene Info |
---|---|---|
AT1G71450
|
AT1G71450 | Integrase-type DNA-binding superfamily protein |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
AT1G71450 | arTal_v1_Chr1_+_26927012_26927012 | -0.09 | 7.5e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
Chr2_-_17712290 | 3.42 |
AT2G42540.2
AT2G42540.4 AT2G42540.1 AT2G42540.3 |
COR15A
|
cold-regulated 15a |
Chr5_+_5209717 | 3.21 |
AT5G15960.1
|
KIN1
|
stress-responsive protein (KIN1) / stress-induced protein (KIN1) |
Chr2_-_17710433 | 2.55 |
AT2G42530.1
|
COR15B
|
cold regulated 15b |
Chr5_+_21240717 | 2.16 |
AT5G52310.1
|
LTI78
|
low-temperature-responsive protein 78 (LTI78) / desiccation-responsive protein 29A (RD29A) |
Chr5_+_20151163 | 2.13 |
AT5G49640.1
|
AT5G49640
|
hypothetical protein |
Chr1_+_3019639 | 1.87 |
AT1G09350.1
|
GolS3
|
galactinol synthase 3 |
Chr3_+_20612693 | 1.84 |
AT3G55580.1
|
AT3G55580
|
Regulator of chromosome condensation (RCC1) family protein |
Chr3_+_4104463 | 1.81 |
AT3G12900.1
|
AT3G12900
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
Chr1_+_3020221 | 1.69 |
AT1G09350.2
|
GolS3
|
galactinol synthase 3 |
Chr3_-_23334034 | 1.63 |
AT3G63160.1
|
OEP6
|
outer envelope membrane protein |
Chr3_-_7796310 | 1.62 |
AT3G22120.1
AT3G22120.2 |
CWLP
|
cell wall-plasma membrane linker protein |
Chr4_+_14954204 | 1.54 |
AT4G30650.1
|
AT4G30650
|
Low temperature and salt responsive protein family |
Chr2_+_1966806 | 1.52 |
AT2G05380.1
AT2G05380.2 |
GRP3S
|
glycine-rich protein 3 short isoform |
Chr1_+_209208 | 1.52 |
AT1G01580.1
|
FRO2
|
ferric reduction oxidase 2 |
Chr1_+_208995 | 1.52 |
AT1G01580.2
|
FRO2
|
ferric reduction oxidase 2 |
Chr2_+_1966610 | 1.50 |
AT2G05380.3
|
GRP3S
|
glycine-rich protein 3 short isoform |
Chr2_+_2026162 | 1.48 |
AT2G05520.4
AT2G05520.5 AT2G05520.6 AT2G05520.3 |
GRP-3
|
glycine-rich protein 3 |
Chr1_-_5765798 | 1.42 |
AT1G16850.1
|
AT1G16850
|
transmembrane protein |
Chr2_-_19370478 | 1.40 |
AT2G47180.1
|
GolS1
|
galactinol synthase 1 |
Chr2_+_2025991 | 1.37 |
AT2G05520.2
AT2G05520.1 |
GRP-3
|
glycine-rich protein 3 |
Chr5_+_5211719 | 1.34 |
AT5G15970.1
|
KIN2
|
stress-responsive protein (KIN2) / stress-induced protein (KIN2) / cold-responsive protein (COR6.6) / cold-regulated protein (COR6.6) |
Chr1_+_27778984 | 1.31 |
AT1G73870.1
|
BBX16
|
B-box type zinc finger protein with CCT domain-containing protein |
Chr3_+_19845097 | 1.30 |
AT3G53530.2
AT3G53530.1 |
NAKR3
|
Chloroplast-targeted copper chaperone protein |
Chr3_+_15983199 | 1.30 |
AT3G44300.1
|
NIT2
|
nitrilase 2 |
Chr4_+_9028262 | 1.29 |
AT4G15910.1
|
DI21
|
drought-induced 21 |
Chr2_-_12343443 | 1.29 |
AT2G28780.1
|
AT2G28780
|
P-hydroxybenzoic acid efflux pump subunit |
Chr2_+_1993038 | 1.22 |
AT2G05440.2
AT2G05440.9 AT2G05440.5 AT2G05440.1 AT2G05440.6 AT2G05440.3 AT2G05440.4 AT2G05440.8 AT2G05440.7 |
GRP9
|
GLYCINE RICH PROTEIN 9 |
Chr3_+_6023844 | 1.22 |
AT3G17609.2
AT3G17609.3 AT3G17609.4 AT3G17609.1 |
HYH
|
HY5-homolog |
Chr5_-_1994824 | 1.18 |
AT5G06530.2
AT5G06530.3 AT5G06530.4 AT5G06530.1 |
ABCG22
|
ABC-2 type transporter family protein |
Chr2_+_15106940 | 1.17 |
AT2G35960.1
|
NHL12
|
NDR1/HIN1-like 12 |
Chr2_+_6893949 | 1.16 |
AT2G15830.1
|
AT2G15830
|
hypothetical protein |
Chr4_+_17639 | 1.16 |
AT4G00050.1
AT4G00050.3 AT4G00050.2 |
UNE10
|
basic helix-loop-helix (bHLH) DNA-binding superfamily protein |
Chr3_-_2699257 | 1.12 |
AT3G08860.2
|
PYD4
|
PYRIMIDINE 4 |
Chr3_+_7959753 | 1.12 |
AT3G22440.1
|
AT3G22440
|
FRIGIDA-like protein |
Chr2_+_13381767 | 1.11 |
AT2G31380.1
|
STH
|
salt tolerance homologue |
Chr2_+_9126263 | 1.11 |
AT2G21320.1
|
BBX18
|
B-box zinc finger family protein |
Chr1_+_8139114 | 1.10 |
AT1G22990.1
AT1G22990.2 |
HIPP22
|
Heavy metal transport/detoxification superfamily protein |
Chr1_+_23740493 | 1.08 |
AT1G63980.1
AT1G63980.2 |
AT1G63980
|
D111/G-patch domain-containing protein |
Chr3_-_2699420 | 1.07 |
AT3G08860.1
|
PYD4
|
PYRIMIDINE 4 |
Chr1_-_8189220 | 1.06 |
AT1G23090.4
AT1G23090.1 AT1G23090.3 AT1G23090.2 |
AST91
|
sulfate transporter 91 |
Chr1_-_450426 | 1.05 |
AT1G02280.1
AT1G02280.2 |
TOC33
|
translocon at the outer envelope membrane of chloroplasts 33 |
Chr3_-_18718396 | 1.05 |
AT3G50440.1
|
MES10
|
methylesterase |
Chr1_-_30142697 | 1.04 |
AT1G80130.1
|
AT1G80130
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
Chr5_+_8541713 | 1.03 |
AT5G24860.3
AT5G24860.1 |
FPF1
|
flowering promoting factor 1 |
Chr1_+_7785708 | 1.03 |
AT1G22065.1
|
AT1G22065
|
hypothetical protein |
Chr2_-_16603059 | 1.03 |
AT2G39800.2
AT2G39800.4 AT2G39800.3 |
P5CS1
|
delta1-pyrroline-5-carboxylate synthase 1 |
Chr5_+_4776733 | 1.02 |
AT5G14780.1
AT5G14780.3 AT5G14780.2 |
FDH
|
formate dehydrogenase |
Chr2_-_12415661 | 1.02 |
AT2G28900.1
|
OEP16-1
|
outer plastid envelope protein 16-1 |
Chr3_-_23195917 | 1.01 |
AT3G62700.1
|
ABCC14
|
multidrug resistance-associated protein 10 |
Chr4_+_13725546 | 1.01 |
AT4G27440.2
AT4G27440.1 |
PORB
|
protochlorophyllide oxidoreductase B |
Chr3_+_5705541 | 1.00 |
AT3G16770.1
|
EBP
|
ethylene-responsive element binding protein |
Chr3_+_3776177 | 1.00 |
AT3G11930.2
AT3G11930.3 AT3G11930.1 AT3G11930.4 |
AT3G11930
|
Adenine nucleotide alpha hydrolases-like superfamily protein |
Chr1_-_29459493 | 0.99 |
AT1G78290.2
AT1G78290.3 |
SNRK2-8
|
Protein kinase superfamily protein |
Chr2_+_7316789 | 0.99 |
AT2G16890.3
AT2G16890.2 AT2G16890.1 AT2G16890.4 |
AT2G16890
|
UDP-Glycosyltransferase superfamily protein |
Chr1_-_3756998 | 0.98 |
AT1G11210.1
|
AT1G11210
|
cotton fiber protein, putative (DUF761) |
Chr3_-_3963984 | 0.98 |
AT3G12500.1
|
HCHIB
|
basic chitinase |
Chr4_+_10103866 | 0.98 |
AT4G18280.1
|
AT4G18280
|
glycine-rich cell wall protein-like protein |
Chr3_+_5243432 | 0.97 |
AT3G15510.1
|
NAC2
|
NAC domain containing protein 2 |
Chr2_+_13814543 | 0.97 |
AT2G32540.1
|
CSLB04
|
cellulose synthase-like B4 |
Chr2_-_827994 | 0.97 |
AT2G02850.1
|
ARPN
|
plantacyanin |
Chr3_+_5720941 | 0.97 |
AT3G16800.5
AT3G16800.4 AT3G16800.2 AT3G16800.6 AT3G16800.1 |
AT3G16800
|
Protein phosphatase 2C family protein |
Chr2_+_528179 | 0.96 |
AT2G02100.1
|
LCR69
|
low-molecular-weight cysteine-rich 69 |
Chr1_-_10664570 | 0.96 |
AT1G30280.2
AT1G30280.3 AT1G30280.1 |
AT1G30280
|
Chaperone DnaJ-domain superfamily protein |
Chr3_-_4974521 | 0.96 |
AT3G14810.1
AT3G14810.2 |
MSL5
|
mechanosensitive channel of small conductance-like 5 |
Chr2_+_9248525 | 0.95 |
AT2G21620.1
AT2G21620.2 |
RD2
|
Adenine nucleotide alpha hydrolases-like superfamily protein |
Chr5_+_21771811 | 0.95 |
AT5G53590.1
|
AT5G53590
|
SAUR-like auxin-responsive protein family |
Chr4_+_8839256 | 0.95 |
AT4G15450.1
AT4G15450.2 |
AT4G15450
|
Senescence/dehydration-associated protein-like protein |
Chr2_-_4007044 | 0.95 |
AT2G10410.1
|
SADHU1-1
|
|
Chr4_-_15954803 | 0.94 |
AT4G33070.1
|
AT4G33070
|
Thiamine pyrophosphate dependent pyruvate decarboxylase family protein |
Chr3_-_20576249 | 0.94 |
AT3G55500.1
|
EXPA16
|
expansin A16 |
Chr2_-_14310608 | 0.94 |
AT2G33830.2
|
AT2G33830
|
Dormancy/auxin associated family protein |
Chr4_-_433938 | 0.94 |
AT4G01000.2
AT4G01000.1 |
AT4G01000
|
Ubiquitin-like superfamily protein |
Chr5_+_2866222 | 0.94 |
AT5G09220.1
|
AAP2
|
amino acid permease 2 |
Chr5_+_17171807 | 0.94 |
AT5G42825.1
|
AT5G42825
|
hypothetical protein |
Chr1_+_25701770 | 0.93 |
AT1G68500.1
|
AT1G68500
|
hypothetical protein |
Chr1_+_23953099 | 0.92 |
AT1G64500.1
|
AT1G64500
|
Glutaredoxin family protein |
Chr1_+_29759030 | 0.92 |
AT1G79110.2
AT1G79110.3 AT1G79110.1 |
BRG2
|
zinc ion binding protein |
Chr2_-_14310339 | 0.91 |
AT2G33830.1
|
AT2G33830
|
Dormancy/auxin associated family protein |
Chr2_-_9866562 | 0.90 |
AT2G23170.1
|
GH3.3
|
Auxin-responsive GH3 family protein |
Chr2_-_17065813 | 0.90 |
AT2G40900.1
|
UMAMIT11
|
nodulin MtN21 /EamA-like transporter family protein |
Chr1_-_17266724 | 0.90 |
AT1G46768.3
AT1G46768.2 AT1G46768.1 |
RAP2.1
|
related to AP2 1 |
Chr5_+_2657054 | 0.90 |
AT5G08260.1
|
scpl35
|
serine carboxypeptidase-like 35 |
Chr4_-_9935685 | 0.90 |
AT4G17880.1
|
MYC4
|
Basic helix-loop-helix (bHLH) DNA-binding family protein |
Chr2_-_521707 | 0.89 |
AT2G02080.4
AT2G02080.2 AT2G02080.5 AT2G02080.6 AT2G02080.3 AT2G02080.1 |
IDD4
|
indeterminate(ID)-domain 4 |
Chr2_+_10244745 | 0.88 |
AT2G24100.1
|
ASG1
|
ATP-dependent DNA helicase |
Chr5_-_7054281 | 0.88 |
AT5G20830.3
|
SUS1
|
sucrose synthase 1 |
Chr5_-_24741304 | 0.88 |
AT5G61520.2
AT5G61520.1 |
AT5G61520
|
Major facilitator superfamily protein |
Chr1_+_28498821 | 0.88 |
AT1G75900.1
|
AT1G75900
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
Chr1_+_3157501 | 0.88 |
AT1G09750.1
|
AT1G09750
|
Eukaryotic aspartyl protease family protein |
Chr1_+_16263805 | 0.87 |
AT1G43160.1
|
RAP2.6
|
related to AP2 6 |
Chr1_+_27338034 | 0.87 |
AT1G72600.2
AT1G72600.1 |
AT1G72600
|
hydroxyproline-rich glycoprotein family protein |
Chr1_-_4679594 | 0.87 |
AT1G13640.2
|
AT1G13640
|
Phosphatidylinositol 3- and 4-kinase family protein |
Chr3_+_3034477 | 0.86 |
AT3G09900.1
|
RABE1e
|
RAB GTPase homolog E1E |
Chr4_+_994726 | 0.86 |
AT4G02280.1
|
SUS3
|
sucrose synthase 3 |
Chr5_-_7054713 | 0.86 |
AT5G20830.1
|
SUS1
|
sucrose synthase 1 |
Chr1_-_4679862 | 0.86 |
AT1G13640.1
|
AT1G13640
|
Phosphatidylinositol 3- and 4-kinase family protein |
Chr5_+_451406 | 0.86 |
AT5G02240.1
|
AT5G02240
|
NAD(P)-binding Rossmann-fold superfamily protein |
Chr2_-_16603319 | 0.86 |
AT2G39800.1
|
P5CS1
|
delta1-pyrroline-5-carboxylate synthase 1 |
Chr1_+_11181504 | 0.85 |
AT1G31280.1
|
AGO2
|
Argonaute family protein |
Chr4_+_12310619 | 0.84 |
AT4G23600.3
|
CORI3
|
Tyrosine transaminase family protein |
Chr4_-_1046993 | 0.84 |
AT4G02380.2
AT4G02380.1 AT4G02380.3 |
SAG21
|
senescence-associated gene 21 |
Chr1_-_4845847 | 0.84 |
AT1G14170.2
AT1G14170.1 AT1G14170.3 |
AT1G14170
|
RNA-binding KH domain-containing protein |
Chr1_+_17847042 | 0.83 |
AT1G48300.1
|
DGAT3
|
diacylglycerol acyltransferase |
Chr5_+_22515391 | 0.83 |
AT5G55580.1
AT5G55580.3 AT5G55580.2 |
AT5G55580
|
Mitochondrial transcription termination factor family protein |
Chr4_+_12310885 | 0.83 |
AT4G23600.2
|
CORI3
|
Tyrosine transaminase family protein |
Chr5_-_7055398 | 0.83 |
AT5G20830.2
|
SUS1
|
sucrose synthase 1 |
Chr3_+_5852049 | 0.83 |
AT3G17160.1
|
AT3G17160
|
hypothetical protein |
Chr1_-_28466971 | 0.83 |
AT1G75820.1
|
CLV1
|
Leucine-rich receptor-like protein kinase family protein |
Chr2_-_5675995 | 0.83 |
AT2G13610.1
|
ABCG5
|
ABC-2 type transporter family protein |
Chr1_+_29356346 | 0.83 |
AT1G78070.2
AT1G78070.3 |
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
Chr1_+_10918267 | 0.83 |
AT1G30760.2
AT1G30760.1 |
AT1G30760
|
FAD-binding Berberine family protein |
Chr3_-_21103719 | 0.83 |
AT3G57030.1
|
AT3G57030
|
Calcium-dependent phosphotriesterase superfamily protein |
Chr4_+_12310379 | 0.82 |
AT4G23600.1
|
CORI3
|
Tyrosine transaminase family protein |
Chr4_-_1500100 | 0.82 |
AT4G03400.2
|
DFL2
|
Auxin-responsive GH3 family protein |
Chr5_+_17973775 | 0.82 |
AT5G44575.1
|
AT5G44575
|
hypothetical protein |
Chr3_-_20816035 | 0.82 |
AT3G56090.1
|
FER3
|
ferritin 3 |
Chr3_-_1958304 | 0.82 |
AT3G06430.1
|
PPR2
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
Chr5_+_2563366 | 0.80 |
AT5G08000.1
AT5G08000.2 |
E13L3
|
glucan endo-1,3-beta-glucosidase-like protein 3 |
Chr2_-_19287590 | 0.80 |
AT2G46940.1
|
AT2G46940
|
fold protein |
Chr1_+_29354944 | 0.79 |
AT1G78070.1
|
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
Chr3_+_673428 | 0.79 |
AT3G02990.1
|
HSFA1E
|
heat shock transcription factor A1E |
Chr2_+_12004658 | 0.79 |
AT2G28160.1
AT2G28160.2 |
FRU
|
FER-like regulator of iron uptake |
Chr3_+_4403355 | 0.79 |
AT3G13510.1
|
AT3G13510
|
carboxyl-terminal peptidase, putative (DUF239) |
Chr5_-_3595003 | 0.78 |
AT5G11260.2
AT5G11260.1 |
HY5
|
Basic-leucine zipper (bZIP) transcription factor family protein |
Chr3_+_1225919 | 0.78 |
AT3G04550.1
|
AT3G04550
|
rubisco accumulation factor-like protein |
Chr3_-_7808046 | 0.77 |
AT3G22142.1
|
AT3G22142
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr1_+_18701882 | 0.77 |
AT1G50480.1
|
THFS
|
10-formyltetrahydrofolate synthetase |
Chr5_-_19135414 | 0.77 |
AT5G47110.1
|
LIL3:2
|
Chlorophyll A-B binding family protein |
Chr3_-_19139423 | 0.77 |
AT3G51600.1
|
LTP5
|
lipid transfer protein 5 |
Chr5_+_25248690 | 0.77 |
AT5G62900.1
|
AT5G62900
|
basic-leucine zipper transcription factor K |
Chr4_+_15544800 | 0.77 |
AT4G32190.1
|
AT4G32190
|
Myosin heavy chain-related protein |
Chr5_-_7973995 | 0.77 |
AT5G23660.1
|
SWEET12
|
bidirectional sugar transporter SWEET12-like protein |
Chr1_-_156178 | 0.77 |
AT1G01420.2
|
UGT72B3
|
UDP-glucosyl transferase 72B3 |
Chr1_+_4351019 | 0.77 |
AT1G12770.1
AT1G12770.2 |
EMB1586
|
P-loop containing nucleoside triphosphate hydrolases superfamily protein |
Chr2_+_15053483 | 0.76 |
AT2G35840.4
AT2G35840.2 AT2G35840.1 |
AT2G35840
|
Sucrose-6F-phosphate phosphohydrolase family protein |
Chr2_-_17379059 | 0.76 |
AT2G41680.1
|
NTRC
|
NADPH-dependent thioredoxin reductase C |
Chr1_-_156011 | 0.76 |
AT1G01420.1
|
UGT72B3
|
UDP-glucosyl transferase 72B3 |
Chr2_-_8495892 | 0.76 |
AT2G19650.1
|
AT2G19650
|
Cysteine/Histidine-rich C1 domain family protein |
Chr4_+_14004401 | 0.76 |
AT4G28260.1
AT4G28260.2 |
AT4G28260
|
acyl-UDP-N-acetylglucosamine O-acyltransferase |
Chr4_-_843531 | 0.75 |
AT4G01940.1
|
NFU1
|
NFU domain protein 1 |
Chr4_-_1501599 | 0.75 |
AT4G03400.1
|
DFL2
|
Auxin-responsive GH3 family protein |
Chr5_-_19297424 | 0.75 |
AT5G47580.1
|
ASG7
|
transmembrane protein |
Chr1_+_846664 | 0.75 |
AT1G03420.1
|
Sadhu4-2
|
|
Chr4_+_18160903 | 0.75 |
AT4G38960.2
AT4G38960.6 AT4G38960.5 AT4G38960.1 AT4G38960.4 |
BBX19
|
B-box type zinc finger family protein |
Chr3_-_4235814 | 0.74 |
AT3G13175.1
|
AT3G13175
|
transmembrane protein |
Chr1_+_28829243 | 0.74 |
AT1G76800.1
|
AT1G76800
|
Vacuolar iron transporter (VIT) family protein |
Chr5_-_7652714 | 0.74 |
AT5G22880.1
|
HTB2
|
histone B2 |
Chr3_-_3961911 | 0.74 |
AT3G12490.1
AT3G12490.2 |
CYSB
|
cystatin B |
Chr3_-_1652149 | 0.74 |
AT3G05660.1
|
RLP33
|
receptor like protein 33 |
Chr5_+_17951442 | 0.74 |
AT5G44565.2
AT5G44565.1 AT5G44565.3 |
AT5G44565
|
transmembrane protein |
Chr1_-_4243201 | 0.74 |
AT1G12440.1
AT1G12440.3 |
AT1G12440
|
A20/AN1-like zinc finger family protein |
Chr3_+_5721225 | 0.73 |
AT3G16800.3
|
AT3G16800
|
Protein phosphatase 2C family protein |
Chr1_-_29869784 | 0.73 |
AT1G79410.1
|
OCT5
|
organic cation/carnitine transporter5 |
Chr5_+_8541558 | 0.73 |
AT5G24860.2
|
FPF1
|
flowering promoting factor 1 |
Chr4_+_4643747 | 0.73 |
AT4G07825.1
|
AT4G07825
|
transmembrane protein |
Chr3_+_22285138 | 0.73 |
AT3G60300.1
AT3G60300.2 |
AT3G60300
|
RWD domain-containing protein |
Chr4_-_17899491 | 0.73 |
AT4G38130.2
AT4G38130.1 |
HD1
|
histone deacetylase 1 |
Chr1_-_10399873 | 0.73 |
AT1G29720.1
|
AT1G29720
|
Leucine-rich repeat transmembrane protein kinase |
Chr5_-_17022723 | 0.72 |
AT5G42570.1
|
AT5G42570
|
B-cell receptor-associated 31-like protein |
Chr1_+_15976805 | 0.72 |
AT1G42550.1
|
PMI1
|
plastid movement impaired1 |
Chr1_-_4242963 | 0.72 |
AT1G12440.2
|
AT1G12440
|
A20/AN1-like zinc finger family protein |
Chr5_+_8687188 | 0.72 |
AT5G25160.1
|
ZFP3
|
zinc finger protein 3 |
Chr2_-_15623104 | 0.72 |
AT2G37200.1
AT2G37200.2 |
AT2G37200
|
Uncharacterized protein family (UPF0497) |
Chr1_-_507268 | 0.72 |
AT1G02460.1
|
AT1G02460
|
Pectin lyase-like superfamily protein |
Chr4_+_2554997 | 0.72 |
AT4G04990.1
|
AT4G04990
|
serine/arginine repetitive matrix-like protein (DUF761) |
Chr4_-_14117367 | 0.72 |
AT4G28560.1
|
RIC7
|
ROP-interactive CRIB motif-containing protein 7 |
Chr5_-_8444101 | 0.71 |
AT5G24660.1
|
LSU2
|
response to low sulfur 2 |
Chr1_-_23786800 | 0.71 |
AT1G64080.1
|
MAKR2
|
membrane-associated kinase regulator |
Chr5_+_21020014 | 0.71 |
AT5G51750.1
|
SBT1.3
|
subtilase 1.3 |
Chr1_-_21580766 | 0.71 |
AT1G58235.1
|
AT1G58235
|
hypothetical protein |
Chr1_-_756303 | 0.71 |
AT1G03140.1
|
AT1G03140
|
splicing factor Prp18 family protein |
Chr5_+_26884203 | 0.71 |
AT5G67385.3
AT5G67385.1 AT5G67385.5 AT5G67385.4 |
AT5G67385
|
Phototropic-responsive NPH3 family protein |
Chr1_-_21581165 | 0.71 |
AT1G58235.2
|
AT1G58235
|
hypothetical protein |
Chr2_+_13940187 | 0.71 |
AT2G32860.2
AT2G32860.1 |
BGLU33
|
beta glucosidase 33 |
Chr1_-_149806 | 0.71 |
AT1G01390.1
AT1G01390.2 |
AT1G01390
|
UDP-Glycosyltransferase superfamily protein |
Chr5_-_900298 | 0.71 |
AT5G03555.1
|
NCS1
|
permease, cytosine/purines, uracil, thiamine, allantoin family protein |
Chr1_-_3518035 | 0.71 |
AT1G10640.1
|
AT1G10640
|
Pectin lyase-like superfamily protein |
Chr3_+_22757761 | 0.70 |
AT3G61490.1
AT3G61490.4 AT3G61490.2 |
AT3G61490
|
Pectin lyase-like superfamily protein |
Chr1_-_1286619 | 0.70 |
AT1G04620.1
|
HCAR
|
coenzyme F420 hydrogenase family / dehydrogenase, beta subunit family |
Chr1_-_9451768 | 0.70 |
AT1G27200.1
|
AT1G27200
|
glycosyltransferase family protein (DUF23) |
Chr5_-_19358125 | 0.70 |
AT5G47810.1
|
PFK2
|
phosphofructokinase 2 |
Chr1_+_23527570 | 0.69 |
AT1G63440.1
|
HMA5
|
heavy metal atpase 5 |
Chr1_+_18305445 | 0.69 |
AT1G49450.1
|
AT1G49450
|
Transducin/WD40 repeat-like superfamily protein |
Chr1_+_7404328 | 0.69 |
AT1G21140.1
|
AT1G21140
|
Vacuolar iron transporter (VIT) family protein |
Chr4_-_17830465 | 0.69 |
AT4G37920.1
|
AT4G37920
|
endoribonuclease E-like protein |
Chr2_-_14746124 | 0.69 |
AT2G34960.1
|
CAT5
|
cationic amino acid transporter 5 |
Chr2_-_9266393 | 0.69 |
AT2G21660.2
|
GRP7
|
cold, circadian rhythm, and rna binding 2 |
Chr5_+_1727368 | 0.69 |
AT5G05750.1
|
AT5G05750
|
DNAJ heat shock N-terminal domain-containing protein |
Chr1_-_8414886 | 0.68 |
AT1G23800.1
AT1G23800.2 |
ALDH2B7
|
aldehyde dehydrogenase 2B7 |
Chr2_+_7198127 | 0.68 |
AT2G16595.1
|
AT2G16595
|
Translocon-associated protein (TRAP), alpha subunit |
Chr1_+_17766738 | 0.68 |
AT1G48100.1
|
AT1G48100
|
Pectin lyase-like superfamily protein |
Chr5_+_26664842 | 0.68 |
AT5G66790.1
|
AT5G66790
|
Protein kinase superfamily protein |
Chr1_+_6886669 | 0.68 |
AT1G19850.1
|
MP
|
Transcriptional factor B3 family protein / auxin-responsive factor AUX/IAA-like protein |
Chr2_-_12785037 | 0.68 |
AT2G29980.2
|
FAD3
|
fatty acid desaturase 3 |
Chr3_+_20344785 | 0.68 |
AT3G54920.1
|
PMR6
|
Pectin lyase-like superfamily protein |
Chr1_+_21030787 | 0.68 |
AT1G56200.1
AT1G56200.2 |
EMB1303
|
embryo defective 1303 |
Chr2_+_8125128 | 0.68 |
AT2G18750.1
AT2G18750.3 AT2G18750.2 |
AT2G18750
|
Calmodulin-binding protein |
Chr4_+_16548600 | 0.68 |
AT4G34670.1
|
AT4G34670
|
Ribosomal protein S3Ae |
Chr1_-_11595982 | 0.68 |
AT1G32190.2
AT1G32190.1 |
AT1G32190
|
alpha/beta-Hydrolases superfamily protein |
Chr1_+_19685747 | 0.67 |
AT1G52870.1
|
AT1G52870
|
Peroxisomal membrane 22 kDa (Mpv17/PMP22) family protein |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.6 | GO:0010203 | response to very low fluence red light stimulus(GO:0010203) |
0.5 | 2.7 | GO:0032413 | negative regulation of anion channel activity(GO:0010360) regulation of anion channel activity by blue light(GO:0010361) negative regulation of anion channel activity by blue light(GO:0010362) negative regulation of transporter activity(GO:0032410) negative regulation of ion transmembrane transporter activity(GO:0032413) negative regulation of transmembrane transport(GO:0034763) negative regulation of ion transmembrane transport(GO:0034766) negative regulation of anion transport(GO:1903792) negative regulation of anion transmembrane transport(GO:1903960) |
0.5 | 0.5 | GO:0019322 | pentose biosynthetic process(GO:0019322) arabinose biosynthetic process(GO:0019567) |
0.5 | 2.6 | GO:0072708 | response to sorbitol(GO:0072708) |
0.5 | 4.2 | GO:0009819 | drought recovery(GO:0009819) |
0.4 | 1.7 | GO:1900409 | positive regulation of cellular response to oxidative stress(GO:1900409) |
0.4 | 0.4 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.3 | 1.3 | GO:0033306 | phytol metabolic process(GO:0033306) |
0.3 | 1.0 | GO:0009663 | plasmodesma organization(GO:0009663) |
0.3 | 1.9 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
0.3 | 1.5 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
0.3 | 1.4 | GO:0006809 | nitric oxide biosynthetic process(GO:0006809) |
0.3 | 1.1 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.3 | 3.9 | GO:0010100 | negative regulation of photomorphogenesis(GO:0010100) |
0.3 | 3.3 | GO:0010044 | response to aluminum ion(GO:0010044) |
0.3 | 1.1 | GO:0055073 | cadmium ion homeostasis(GO:0055073) |
0.3 | 2.5 | GO:0010188 | response to microbial phytotoxin(GO:0010188) |
0.3 | 1.3 | GO:0010599 | production of lsiRNA involved in RNA interference(GO:0010599) |
0.3 | 1.9 | GO:0015800 | acidic amino acid transport(GO:0015800) |
0.3 | 0.3 | GO:0046717 | acid secretion(GO:0046717) |
0.2 | 1.0 | GO:0009871 | jasmonic acid and ethylene-dependent systemic resistance, ethylene mediated signaling pathway(GO:0009871) |
0.2 | 1.2 | GO:0015939 | pantothenate metabolic process(GO:0015939) pantothenate biosynthetic process(GO:0015940) |
0.2 | 1.1 | GO:0019048 | modulation by virus of host morphology or physiology(GO:0019048) |
0.2 | 0.7 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
0.2 | 0.7 | GO:0010024 | phytochromobilin biosynthetic process(GO:0010024) phytochromobilin metabolic process(GO:0051202) |
0.2 | 0.7 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
0.2 | 0.4 | GO:0019856 | pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.2 | 1.3 | GO:0043478 | pigment accumulation in response to UV light(GO:0043478) pigment accumulation in tissues in response to UV light(GO:0043479) pigment accumulation in tissues(GO:0043480) anthocyanin accumulation in tissues in response to UV light(GO:0043481) |
0.2 | 1.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.2 | 1.5 | GO:0010148 | transpiration(GO:0010148) |
0.2 | 0.7 | GO:0046037 | GMP biosynthetic process(GO:0006177) GMP metabolic process(GO:0046037) |
0.2 | 0.9 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
0.2 | 1.1 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) DNA double-strand break processing(GO:0000729) |
0.2 | 0.2 | GO:0010822 | positive regulation of mitochondrion organization(GO:0010822) |
0.2 | 1.3 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.2 | 3.3 | GO:0010380 | regulation of chlorophyll biosynthetic process(GO:0010380) |
0.2 | 0.6 | GO:0090322 | regulation of superoxide metabolic process(GO:0090322) |
0.2 | 0.4 | GO:0010376 | stomatal complex formation(GO:0010376) |
0.2 | 0.8 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.2 | 3.4 | GO:1901259 | chloroplast rRNA processing(GO:1901259) |
0.2 | 0.6 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine N-methylation(GO:0035246) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.2 | 0.6 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.2 | 0.8 | GO:0071452 | cellular response to singlet oxygen(GO:0071452) |
0.2 | 0.8 | GO:0048480 | stigma development(GO:0048480) |
0.2 | 2.3 | GO:0009608 | response to symbiont(GO:0009608) |
0.2 | 1.9 | GO:0009942 | longitudinal axis specification(GO:0009942) |
0.2 | 0.9 | GO:0010239 | chloroplast mRNA processing(GO:0010239) |
0.2 | 0.6 | GO:0017014 | protein nitrosylation(GO:0017014) peptidyl-cysteine S-nitrosylation(GO:0018119) peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
0.2 | 3.4 | GO:0009861 | jasmonic acid and ethylene-dependent systemic resistance(GO:0009861) |
0.2 | 1.6 | GO:0048363 | mucilage pectin metabolic process(GO:0048363) |
0.2 | 0.5 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.2 | 1.2 | GO:1901401 | regulation of tetrapyrrole metabolic process(GO:1901401) |
0.2 | 0.4 | GO:0040023 | nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) nucleus localization(GO:0051647) |
0.2 | 1.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.2 | 0.5 | GO:0048255 | mRNA stabilization(GO:0048255) |
0.2 | 0.5 | GO:0034247 | snoRNA splicing(GO:0034247) |
0.2 | 0.5 | GO:0032979 | protein insertion into membrane from inner side(GO:0032978) protein insertion into mitochondrial membrane from inner side(GO:0032979) protein insertion into mitochondrial membrane(GO:0051204) |
0.2 | 0.2 | GO:2000011 | regulation of adaxial/abaxial pattern formation(GO:2000011) |
0.2 | 0.6 | GO:1901333 | positive regulation of lateral root development(GO:1901333) |
0.2 | 0.5 | GO:1900111 | positive regulation of histone H3-K9 dimethylation(GO:1900111) |
0.2 | 0.5 | GO:0010254 | nectary development(GO:0010254) bract morphogenesis(GO:0010433) bract formation(GO:0010434) |
0.2 | 0.5 | GO:0090392 | sepal giant cell differentiation(GO:0090392) |
0.2 | 0.3 | GO:0010395 | rhamnogalacturonan I metabolic process(GO:0010395) |
0.2 | 0.5 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
0.2 | 0.5 | GO:1900032 | regulation of trichome patterning(GO:1900032) negative regulation of trichome patterning(GO:1900033) |
0.2 | 0.6 | GO:0033499 | galactose catabolic process(GO:0019388) galactose catabolic process via UDP-galactose(GO:0033499) |
0.2 | 2.9 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
0.2 | 0.3 | GO:0051099 | positive regulation of binding(GO:0051099) |
0.2 | 4.2 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.2 | 8.7 | GO:0009631 | cold acclimation(GO:0009631) |
0.1 | 0.4 | GO:0009915 | phloem sucrose loading(GO:0009915) |
0.1 | 1.3 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) |
0.1 | 0.7 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.1 | 0.4 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
0.1 | 1.3 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
0.1 | 0.6 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 0.6 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.1 | 0.4 | GO:0090143 | nucleoid organization(GO:0090143) |
0.1 | 0.1 | GO:0002009 | establishment of planar polarity(GO:0001736) morphogenesis of a polarized epithelium(GO:0001738) morphogenesis of an epithelium(GO:0002009) tissue morphogenesis(GO:0048729) |
0.1 | 0.7 | GO:1901535 | regulation of DNA demethylation(GO:1901535) |
0.1 | 1.0 | GO:0032844 | regulation of homeostatic process(GO:0032844) |
0.1 | 0.4 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.1 | 0.4 | GO:1990258 | box C/D snoRNA 3'-end processing(GO:0000494) peptidyl-glutamine methylation(GO:0018364) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
0.1 | 0.4 | GO:0043090 | amino acid import(GO:0043090) |
0.1 | 0.4 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
0.1 | 2.6 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) inositol phosphate catabolic process(GO:0071545) |
0.1 | 5.3 | GO:0055072 | iron ion homeostasis(GO:0055072) |
0.1 | 0.4 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
0.1 | 0.5 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 0.3 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) |
0.1 | 0.7 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
0.1 | 0.4 | GO:0043132 | NAD transport(GO:0043132) |
0.1 | 0.7 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.1 | 0.3 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
0.1 | 0.7 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 0.3 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.1 | 0.4 | GO:0016124 | tetraterpenoid catabolic process(GO:0016110) carotenoid catabolic process(GO:0016118) xanthophyll catabolic process(GO:0016124) |
0.1 | 1.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.3 | GO:0015802 | basic amino acid transport(GO:0015802) |
0.1 | 1.9 | GO:0005986 | sucrose biosynthetic process(GO:0005986) |
0.1 | 1.0 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.1 | 0.9 | GO:0010098 | suspensor development(GO:0010098) |
0.1 | 0.5 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.1 | 0.4 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.7 | GO:0034724 | DNA replication-independent nucleosome organization(GO:0034724) |
0.1 | 0.2 | GO:1901672 | positive regulation of systemic acquired resistance(GO:1901672) |
0.1 | 0.2 | GO:0010541 | acropetal auxin transport(GO:0010541) |
0.1 | 1.7 | GO:0009641 | shade avoidance(GO:0009641) |
0.1 | 0.4 | GO:0010289 | homogalacturonan biosynthetic process(GO:0010289) |
0.1 | 0.4 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
0.1 | 0.7 | GO:0043100 | pyrimidine nucleobase salvage(GO:0043100) |
0.1 | 0.5 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.1 | 0.2 | GO:0051291 | protein heterooligomerization(GO:0051291) |
0.1 | 0.4 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) |
0.1 | 0.8 | GO:0042362 | fat-soluble vitamin metabolic process(GO:0006775) fat-soluble vitamin biosynthetic process(GO:0042362) |
0.1 | 2.9 | GO:0045037 | protein import into chloroplast stroma(GO:0045037) |
0.1 | 0.7 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.1 | 1.4 | GO:0017157 | regulation of exocytosis(GO:0017157) |
0.1 | 1.3 | GO:0048317 | seed morphogenesis(GO:0048317) |
0.1 | 0.3 | GO:2000693 | positive regulation of seed maturation(GO:2000693) |
0.1 | 1.5 | GO:0070076 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) histone demethylation(GO:0016577) histone lysine demethylation(GO:0070076) |
0.1 | 0.6 | GO:0042547 | cell wall modification involved in multidimensional cell growth(GO:0042547) |
0.1 | 0.2 | GO:0042817 | pyridoxal metabolic process(GO:0042817) |
0.1 | 0.4 | GO:0051211 | anisotropic cell growth(GO:0051211) |
0.1 | 0.4 | GO:0009193 | UDP biosynthetic process(GO:0006225) ribonucleoside diphosphate biosynthetic process(GO:0009188) pyrimidine ribonucleoside diphosphate metabolic process(GO:0009193) pyrimidine ribonucleoside diphosphate biosynthetic process(GO:0009194) UDP metabolic process(GO:0046048) |
0.1 | 0.3 | GO:0015755 | hexose transport(GO:0008645) fructose transport(GO:0015755) |
0.1 | 1.3 | GO:0052192 | movement in host(GO:0044000) transport of virus in multicellular host(GO:0046739) movement in other organism involved in symbiotic interaction(GO:0051814) movement in host environment(GO:0052126) movement in environment of other organism involved in symbiotic interaction(GO:0052192) |
0.1 | 0.8 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.1 | 0.7 | GO:0010338 | leaf formation(GO:0010338) |
0.1 | 0.2 | GO:2000072 | regulation of defense response to fungus, incompatible interaction(GO:2000072) |
0.1 | 1.4 | GO:0009938 | negative regulation of gibberellic acid mediated signaling pathway(GO:0009938) |
0.1 | 0.9 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
0.1 | 1.4 | GO:0010078 | maintenance of root meristem identity(GO:0010078) |
0.1 | 0.8 | GO:0015909 | long-chain fatty acid transport(GO:0015909) |
0.1 | 0.9 | GO:0006278 | RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
0.1 | 0.4 | GO:0010019 | chloroplast-nucleus signaling pathway(GO:0010019) |
0.1 | 0.6 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.1 | 0.3 | GO:0019859 | thymine catabolic process(GO:0006210) uracil catabolic process(GO:0006212) beta-alanine biosynthetic process(GO:0019483) thymine metabolic process(GO:0019859) uracil metabolic process(GO:0019860) |
0.1 | 0.3 | GO:0009747 | hexokinase-dependent signaling(GO:0009747) |
0.1 | 1.1 | GO:0050879 | circumnutation(GO:0010031) multicellular organismal movement(GO:0050879) |
0.1 | 0.4 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) protein to membrane docking(GO:0022615) |
0.1 | 0.3 | GO:0009584 | detection of visible light(GO:0009584) |
0.1 | 0.3 | GO:0015904 | tetracycline transport(GO:0015904) antibiotic transport(GO:0042891) |
0.1 | 0.7 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 0.4 | GO:0032527 | protein exit from endoplasmic reticulum(GO:0032527) |
0.1 | 0.6 | GO:0010258 | NADH dehydrogenase complex (plastoquinone) assembly(GO:0010258) |
0.1 | 0.5 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.1 | 1.2 | GO:0060321 | acceptance of pollen(GO:0060321) |
0.1 | 0.3 | GO:0048281 | inflorescence morphogenesis(GO:0048281) |
0.1 | 3.2 | GO:0010143 | cutin biosynthetic process(GO:0010143) |
0.1 | 0.3 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.1 | 0.3 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
0.1 | 0.4 | GO:0008333 | lysosomal transport(GO:0007041) endosome to lysosome transport(GO:0008333) |
0.1 | 0.7 | GO:0010065 | primary meristem tissue development(GO:0010065) |
0.1 | 0.7 | GO:0070370 | cellular heat acclimation(GO:0070370) |
0.1 | 1.2 | GO:0009880 | embryonic pattern specification(GO:0009880) |
0.1 | 0.5 | GO:0015846 | polyamine transport(GO:0015846) |
0.1 | 0.3 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.1 | 2.0 | GO:0010099 | regulation of photomorphogenesis(GO:0010099) |
0.1 | 0.7 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.1 | 0.7 | GO:0015866 | ADP transport(GO:0015866) ATP transport(GO:0015867) |
0.1 | 0.5 | GO:0042724 | thiamine biosynthetic process(GO:0009228) thiamine-containing compound biosynthetic process(GO:0042724) |
0.1 | 2.2 | GO:0072596 | protein targeting to chloroplast(GO:0045036) establishment of protein localization to chloroplast(GO:0072596) |
0.1 | 3.7 | GO:0015995 | chlorophyll biosynthetic process(GO:0015995) |
0.1 | 0.3 | GO:1904812 | rRNA acetylation involved in maturation of SSU-rRNA(GO:1904812) rRNA acetylation(GO:1990882) RNA acetylation(GO:1990884) |
0.1 | 0.4 | GO:0016099 | monoterpenoid metabolic process(GO:0016098) monoterpenoid biosynthetic process(GO:0016099) |
0.1 | 0.6 | GO:0015919 | peroxisomal membrane transport(GO:0015919) |
0.1 | 1.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.3 | GO:0090342 | regulation of cell aging(GO:0090342) |
0.1 | 0.1 | GO:0051512 | positive regulation of unidimensional cell growth(GO:0051512) |
0.1 | 0.1 | GO:0051051 | negative regulation of transport(GO:0051051) |
0.1 | 0.3 | GO:0009727 | detection of ethylene stimulus(GO:0009727) |
0.1 | 0.7 | GO:0048209 | regulation of vesicle targeting, to, from or within Golgi(GO:0048209) |
0.1 | 0.7 | GO:1901703 | protein localization involved in auxin polar transport(GO:1901703) |
0.1 | 0.3 | GO:0033240 | positive regulation of cellular amine metabolic process(GO:0033240) positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.1 | 0.8 | GO:0045962 | positive regulation of development, heterochronic(GO:0045962) |
0.1 | 0.7 | GO:0016926 | protein desumoylation(GO:0016926) |
0.1 | 0.4 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.1 | 0.2 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.1 | 0.8 | GO:0042814 | monopolar cell growth(GO:0042814) |
0.1 | 0.2 | GO:0009726 | detection of hormone stimulus(GO:0009720) detection of endogenous stimulus(GO:0009726) |
0.1 | 0.3 | GO:0000012 | single strand break repair(GO:0000012) |
0.1 | 2.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 0.2 | GO:0015696 | ammonium transport(GO:0015696) |
0.1 | 0.9 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 1.6 | GO:0043572 | chloroplast fission(GO:0010020) plastid fission(GO:0043572) |
0.1 | 0.6 | GO:0043486 | histone exchange(GO:0043486) |
0.1 | 1.2 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.1 | 0.2 | GO:0046459 | short-chain fatty acid metabolic process(GO:0046459) |
0.1 | 0.2 | GO:0032196 | transposition(GO:0032196) |
0.1 | 0.3 | GO:0015965 | diadenosine polyphosphate metabolic process(GO:0015959) diadenosine tetraphosphate metabolic process(GO:0015965) |
0.1 | 1.3 | GO:0010187 | negative regulation of seed germination(GO:0010187) |
0.1 | 1.4 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.3 | GO:1901562 | response to paraquat(GO:1901562) |
0.1 | 0.2 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
0.1 | 0.4 | GO:0007112 | male meiosis cytokinesis(GO:0007112) |
0.1 | 0.2 | GO:0040030 | regulation of molecular function, epigenetic(GO:0040030) negative regulation of molecular function, epigenetic(GO:0045857) |
0.1 | 0.9 | GO:0010315 | auxin efflux(GO:0010315) |
0.1 | 0.2 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.1 | 1.2 | GO:0030522 | blue light signaling pathway(GO:0009785) intracellular receptor signaling pathway(GO:0030522) |
0.1 | 1.0 | GO:0048496 | maintenance of organ identity(GO:0048496) maintenance of floral organ identity(GO:0048497) |
0.1 | 2.5 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 0.1 | GO:0010447 | response to acidic pH(GO:0010447) |
0.1 | 0.4 | GO:0097502 | mannosylation(GO:0097502) |
0.1 | 0.3 | GO:0048578 | positive regulation of long-day photoperiodism, flowering(GO:0048578) |
0.1 | 0.5 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.3 | GO:0048657 | anther wall tapetum formation(GO:0048656) anther wall tapetum cell differentiation(GO:0048657) |
0.1 | 0.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.3 | GO:0001173 | DNA-templated transcriptional start site selection(GO:0001173) |
0.1 | 0.4 | GO:0051325 | mitotic G1 phase(GO:0000080) mitotic S phase(GO:0000084) mitotic G2 phase(GO:0000085) G1 phase(GO:0051318) G2 phase(GO:0051319) S phase(GO:0051320) interphase(GO:0051325) mitotic interphase(GO:0051329) |
0.1 | 1.8 | GO:0009395 | phospholipid catabolic process(GO:0009395) |
0.1 | 0.4 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
0.1 | 0.7 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.2 | GO:2000029 | regulation of proanthocyanidin biosynthetic process(GO:2000029) |
0.1 | 0.7 | GO:0031425 | chloroplast RNA processing(GO:0031425) |
0.1 | 0.2 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.3 | GO:0015714 | phosphoenolpyruvate transport(GO:0015714) |
0.1 | 0.1 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.1 | 0.3 | GO:0060860 | regulation of floral organ abscission(GO:0060860) negative regulation of floral organ abscission(GO:0060862) |
0.1 | 0.8 | GO:0060261 | regulation of transcription initiation from RNA polymerase II promoter(GO:0060260) positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.1 | 0.3 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 1.0 | GO:0009870 | defense response signaling pathway, resistance gene-dependent(GO:0009870) |
0.1 | 0.8 | GO:0010332 | response to gamma radiation(GO:0010332) |
0.1 | 0.7 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.1 | 0.7 | GO:0010205 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) |
0.1 | 0.9 | GO:0031167 | rRNA methylation(GO:0031167) |
0.1 | 0.2 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 0.2 | GO:0071569 | protein ufmylation(GO:0071569) |
0.1 | 2.3 | GO:0009911 | positive regulation of flower development(GO:0009911) |
0.1 | 1.0 | GO:0009913 | epidermis development(GO:0008544) epidermal cell differentiation(GO:0009913) epithelial cell differentiation(GO:0030855) epithelium development(GO:0060429) |
0.1 | 1.8 | GO:0006284 | base-excision repair(GO:0006284) |
0.1 | 0.2 | GO:0010372 | positive regulation of gibberellin biosynthetic process(GO:0010372) |
0.1 | 0.2 | GO:0080051 | cutin transport(GO:0080051) |
0.1 | 0.3 | GO:0016120 | carotene biosynthetic process(GO:0016120) |
0.1 | 0.2 | GO:0097298 | regulation of nucleus size(GO:0097298) |
0.1 | 0.2 | GO:0045596 | negative regulation of cell differentiation(GO:0045596) |
0.1 | 0.5 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.2 | GO:0010070 | zygote asymmetric cell division(GO:0010070) |
0.1 | 0.8 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.1 | 0.3 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.1 | 0.5 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.1 | 0.8 | GO:1902074 | response to salt(GO:1902074) |
0.1 | 1.2 | GO:0061572 | actin filament bundle assembly(GO:0051017) actin filament bundle organization(GO:0061572) |
0.1 | 0.1 | GO:0043953 | protein transport by the Tat complex(GO:0043953) |
0.1 | 0.5 | GO:0080142 | regulation of salicylic acid biosynthetic process(GO:0080142) |
0.1 | 0.6 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.1 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.1 | 1.7 | GO:0010286 | heat acclimation(GO:0010286) |
0.1 | 0.8 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.1 | 0.3 | GO:0000719 | photoreactive repair(GO:0000719) |
0.1 | 0.2 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
0.1 | 0.2 | GO:0051567 | histone H3-K9 methylation(GO:0051567) |
0.1 | 0.2 | GO:0006687 | glycosylceramide metabolic process(GO:0006677) glucosylceramide metabolic process(GO:0006678) glucosylceramide catabolic process(GO:0006680) glycosphingolipid metabolic process(GO:0006687) glycolipid catabolic process(GO:0019377) glycosylceramide catabolic process(GO:0046477) glycosphingolipid catabolic process(GO:0046479) ceramide catabolic process(GO:0046514) |
0.1 | 0.2 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
0.1 | 0.4 | GO:0080112 | seed growth(GO:0080112) |
0.1 | 0.2 | GO:1902457 | negative regulation of stomatal opening(GO:1902457) |
0.1 | 0.5 | GO:0032922 | circadian regulation of gene expression(GO:0032922) |
0.1 | 0.2 | GO:0080094 | response to trehalose-6-phosphate(GO:0080094) |
0.0 | 0.1 | GO:0009590 | detection of gravity(GO:0009590) |
0.0 | 0.1 | GO:2000105 | positive regulation of DNA endoreduplication(GO:0032877) positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.0 | 0.4 | GO:0006089 | lactate metabolic process(GO:0006089) methylglyoxal metabolic process(GO:0009438) methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) ketone catabolic process(GO:0042182) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.2 | GO:1900384 | regulation of flavonol biosynthetic process(GO:1900384) |
0.0 | 0.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.3 | GO:0046482 | para-aminobenzoic acid metabolic process(GO:0046482) |
0.0 | 0.3 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.7 | GO:0071329 | cellular response to disaccharide stimulus(GO:0071324) cellular response to sucrose stimulus(GO:0071329) |
0.0 | 0.2 | GO:0051016 | negative regulation of actin filament depolymerization(GO:0030835) barbed-end actin filament capping(GO:0051016) actin filament capping(GO:0051693) |
0.0 | 0.3 | GO:0046113 | purine nucleobase catabolic process(GO:0006145) nucleobase catabolic process(GO:0046113) |
0.0 | 0.1 | GO:0010677 | negative regulation of cellular carbohydrate metabolic process(GO:0010677) |
0.0 | 1.4 | GO:2000031 | regulation of salicylic acid mediated signaling pathway(GO:2000031) |
0.0 | 0.3 | GO:0046621 | negative regulation of organ growth(GO:0046621) |
0.0 | 0.5 | GO:0010192 | mucilage biosynthetic process(GO:0010192) |
0.0 | 0.5 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
0.0 | 0.5 | GO:0008361 | regulation of cell size(GO:0008361) |
0.0 | 1.7 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.1 | GO:0048442 | sepal development(GO:0048442) flower calyx development(GO:0048464) |
0.0 | 0.4 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.2 | GO:0016598 | protein arginylation(GO:0016598) |
0.0 | 0.4 | GO:0051782 | negative regulation of cell division(GO:0051782) |
0.0 | 1.0 | GO:0010109 | regulation of photosynthesis(GO:0010109) |
0.0 | 0.4 | GO:0009088 | threonine biosynthetic process(GO:0009088) |
0.0 | 0.2 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.0 | 1.3 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.1 | GO:1903321 | negative regulation of protein modification by small protein conjugation or removal(GO:1903321) |
0.0 | 0.7 | GO:0010072 | primary shoot apical meristem specification(GO:0010072) |
0.0 | 0.6 | GO:0009593 | detection of chemical stimulus(GO:0009593) |
0.0 | 0.3 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.4 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
0.0 | 0.3 | GO:0006814 | sodium ion transport(GO:0006814) |
0.0 | 0.7 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
0.0 | 0.3 | GO:0071586 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
0.0 | 0.3 | GO:0045910 | negative regulation of DNA recombination(GO:0045910) |
0.0 | 0.8 | GO:0000373 | Group II intron splicing(GO:0000373) |
0.0 | 0.8 | GO:0001510 | RNA methylation(GO:0001510) |
0.0 | 0.7 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.8 | GO:0008356 | asymmetric cell division(GO:0008356) |
0.0 | 0.1 | GO:0097056 | seryl-tRNA aminoacylation(GO:0006434) selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
0.0 | 1.3 | GO:0034728 | nucleosome organization(GO:0034728) |
0.0 | 0.2 | GO:0042816 | vitamin B6 metabolic process(GO:0042816) |
0.0 | 0.2 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.0 | 1.2 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.1 | GO:0006424 | glutamyl-tRNA aminoacylation(GO:0006424) |
0.0 | 0.2 | GO:0006567 | threonine catabolic process(GO:0006567) |
0.0 | 0.8 | GO:0009934 | regulation of meristem structural organization(GO:0009934) |
0.0 | 0.2 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.0 | 0.1 | GO:0072337 | modified amino acid transport(GO:0072337) |
0.0 | 1.8 | GO:0009247 | glycolipid biosynthetic process(GO:0009247) |
0.0 | 0.6 | GO:0015994 | chlorophyll metabolic process(GO:0015994) |
0.0 | 0.2 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.2 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
0.0 | 0.9 | GO:0006338 | chromatin remodeling(GO:0006338) |
0.0 | 0.6 | GO:0018198 | peptidyl-cysteine modification(GO:0018198) |
0.0 | 0.4 | GO:0010088 | phloem development(GO:0010088) |
0.0 | 0.1 | GO:0009647 | skotomorphogenesis(GO:0009647) |
0.0 | 0.3 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
0.0 | 0.1 | GO:1901001 | negative regulation of response to salt stress(GO:1901001) |
0.0 | 0.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.2 | GO:0080190 | secondary growth(GO:0080117) lateral growth(GO:0080190) |
0.0 | 0.3 | GO:0006415 | translational termination(GO:0006415) |
0.0 | 0.4 | GO:0009895 | negative regulation of catabolic process(GO:0009895) |
0.0 | 0.2 | GO:1904961 | quiescent center organization(GO:1904961) |
0.0 | 0.3 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.6 | GO:0046352 | disaccharide catabolic process(GO:0046352) |
0.0 | 0.3 | GO:0010359 | regulation of anion channel activity(GO:0010359) |
0.0 | 1.6 | GO:0042176 | regulation of protein catabolic process(GO:0042176) |
0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.1 | GO:0009769 | photosynthesis, light harvesting in photosystem II(GO:0009769) |
0.0 | 0.1 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.5 | GO:0009098 | leucine biosynthetic process(GO:0009098) |
0.0 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.0 | 0.4 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.0 | 0.1 | GO:0033259 | plastid DNA metabolic process(GO:0033258) plastid DNA replication(GO:0033259) |
0.0 | 0.9 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 1.0 | GO:0042023 | DNA endoreduplication(GO:0042023) |
0.0 | 0.3 | GO:2000034 | regulation of seed maturation(GO:2000034) |
0.0 | 0.1 | GO:0097054 | L-glutamate biosynthetic process(GO:0097054) |
0.0 | 0.9 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 2.4 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
0.0 | 0.1 | GO:0010233 | vascular transport(GO:0010232) phloem transport(GO:0010233) |
0.0 | 0.2 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.0 | 0.4 | GO:0070298 | negative regulation of ethylene-activated signaling pathway(GO:0010105) negative regulation of phosphorelay signal transduction system(GO:0070298) |
0.0 | 0.4 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.4 | GO:1902099 | metaphase/anaphase transition of mitotic cell cycle(GO:0007091) regulation of mitotic sister chromatid separation(GO:0010965) regulation of mitotic metaphase/anaphase transition(GO:0030071) regulation of mitotic sister chromatid segregation(GO:0033047) metaphase/anaphase transition of cell cycle(GO:0044784) regulation of metaphase/anaphase transition of cell cycle(GO:1902099) |
0.0 | 0.2 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.1 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) small RNA loading onto RISC(GO:0070922) |
0.0 | 0.1 | GO:0050665 | hydrogen peroxide biosynthetic process(GO:0050665) |
0.0 | 0.4 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 3.3 | GO:0009658 | chloroplast organization(GO:0009658) |
0.0 | 0.5 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.1 | GO:0051098 | regulation of binding(GO:0051098) |
0.0 | 1.6 | GO:0072350 | tricarboxylic acid metabolic process(GO:0072350) |
0.0 | 0.2 | GO:0019288 | isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway(GO:0019288) |
0.0 | 0.1 | GO:1900367 | positive regulation of defense response to insect(GO:1900367) |
0.0 | 0.0 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
0.0 | 0.3 | GO:0006513 | protein monoubiquitination(GO:0006513) |
0.0 | 0.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.4 | GO:0006574 | valine catabolic process(GO:0006574) |
0.0 | 0.5 | GO:0009862 | systemic acquired resistance, salicylic acid mediated signaling pathway(GO:0009862) |
0.0 | 0.1 | GO:0010581 | regulation of starch biosynthetic process(GO:0010581) |
0.0 | 1.0 | GO:0048506 | regulation of timing of meristematic phase transition(GO:0048506) regulation of timing of transition from vegetative to reproductive phase(GO:0048510) |
0.0 | 0.1 | GO:0048530 | fruit morphogenesis(GO:0048530) |
0.0 | 0.1 | GO:0007349 | cellularization(GO:0007349) |
0.0 | 0.5 | GO:0043289 | abscisic acid biosynthetic process(GO:0009688) apocarotenoid biosynthetic process(GO:0043289) tertiary alcohol biosynthetic process(GO:1902645) |
0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.1 | GO:0015854 | adenine transport(GO:0015853) guanine transport(GO:0015854) |
0.0 | 0.2 | GO:0009061 | anaerobic respiration(GO:0009061) |
0.0 | 1.3 | GO:0006897 | endocytosis(GO:0006897) |
0.0 | 0.5 | GO:0051260 | protein homooligomerization(GO:0051260) |
0.0 | 0.2 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.0 | 0.2 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.0 | 1.5 | GO:0006413 | translational initiation(GO:0006413) |
0.0 | 0.4 | GO:0006074 | (1->3)-beta-D-glucan metabolic process(GO:0006074) (1->3)-beta-D-glucan biosynthetic process(GO:0006075) |
0.0 | 0.5 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
0.0 | 0.1 | GO:0097438 | release of seed from dormancy(GO:0048838) exit from dormancy(GO:0097438) |
0.0 | 0.2 | GO:0033356 | UDP-L-arabinose metabolic process(GO:0033356) |
0.0 | 0.7 | GO:0016575 | histone deacetylation(GO:0016575) |
0.0 | 0.5 | GO:0042631 | cellular response to water deprivation(GO:0042631) cellular response to water stimulus(GO:0071462) |
0.0 | 0.1 | GO:0030026 | cellular manganese ion homeostasis(GO:0030026) |
0.0 | 0.1 | GO:0042353 | fucose biosynthetic process(GO:0042353) |
0.0 | 0.6 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
0.0 | 0.2 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.0 | GO:0098740 | pollen tube adhesion(GO:0009865) cell-cell adhesion(GO:0098609) multi organism cell adhesion(GO:0098740) |
0.0 | 0.3 | GO:0010252 | auxin homeostasis(GO:0010252) |
0.0 | 0.6 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
0.0 | 0.2 | GO:0051127 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) regulation of actin nucleation(GO:0051125) positive regulation of actin nucleation(GO:0051127) positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.3 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.3 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
0.0 | 0.2 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
0.0 | 0.4 | GO:0048571 | long-day photoperiodism(GO:0048571) |
0.0 | 0.0 | GO:1903313 | positive regulation of mRNA processing(GO:0050685) positive regulation of mRNA metabolic process(GO:1903313) |
0.0 | 0.1 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.0 | 0.7 | GO:0090305 | nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
0.0 | 0.4 | GO:0009269 | response to desiccation(GO:0009269) |
0.0 | 0.3 | GO:0055069 | zinc ion homeostasis(GO:0055069) |
0.0 | 0.5 | GO:0001708 | cell fate specification(GO:0001708) |
0.0 | 0.1 | GO:0051592 | response to calcium ion(GO:0051592) |
0.0 | 0.1 | GO:0009855 | determination of bilateral symmetry(GO:0009855) |
0.0 | 0.2 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.0 | 0.5 | GO:0030641 | regulation of cellular pH(GO:0030641) regulation of intracellular pH(GO:0051453) |
0.0 | 0.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.1 | GO:0010358 | leaf shaping(GO:0010358) |
0.0 | 0.2 | GO:0000919 | cell plate assembly(GO:0000919) |
0.0 | 7.4 | GO:0006412 | translation(GO:0006412) |
0.0 | 0.1 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.2 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 0.3 | GO:0050777 | negative regulation of immune response(GO:0050777) |
0.0 | 0.1 | GO:0006525 | arginine metabolic process(GO:0006525) |
0.0 | 0.2 | GO:0051446 | positive regulation of meiotic cell cycle(GO:0051446) |
0.0 | 0.7 | GO:0000911 | cytokinesis by cell plate formation(GO:0000911) cytokinetic process(GO:0032506) mitotic cytokinetic process(GO:1902410) |
0.0 | 0.2 | GO:0043967 | histone H4 acetylation(GO:0043967) |
0.0 | 0.7 | GO:0010043 | response to zinc ion(GO:0010043) |
0.0 | 0.3 | GO:0031124 | mRNA 3'-end processing(GO:0031124) |
0.0 | 1.5 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.0 | 0.0 | GO:0010191 | mucilage metabolic process(GO:0010191) |
0.0 | 0.2 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
0.0 | 0.4 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) |
0.0 | 0.4 | GO:0007030 | Golgi organization(GO:0007030) |
0.0 | 0.2 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.2 | GO:0010540 | basipetal auxin transport(GO:0010540) |
0.0 | 2.6 | GO:0010498 | proteasomal protein catabolic process(GO:0010498) |
0.0 | 0.8 | GO:0071805 | cellular potassium ion transport(GO:0071804) potassium ion transmembrane transport(GO:0071805) |
0.0 | 0.3 | GO:0010207 | photosystem II assembly(GO:0010207) |
0.0 | 0.5 | GO:0051170 | nuclear import(GO:0051170) |
0.0 | 0.0 | GO:0042148 | somatic cell DNA recombination(GO:0016444) strand invasion(GO:0042148) |
0.0 | 0.6 | GO:0006906 | vesicle fusion(GO:0006906) |
0.0 | 0.1 | GO:1900458 | negative regulation of brassinosteroid mediated signaling pathway(GO:1900458) |
0.0 | 0.3 | GO:0080188 | RNA-directed DNA methylation(GO:0080188) |
0.0 | 0.2 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.0 | 0.5 | GO:0009833 | plant-type primary cell wall biogenesis(GO:0009833) |
0.0 | 0.1 | GO:0046865 | isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) abscisic acid transport(GO:0080168) |
0.0 | 0.1 | GO:0030308 | negative regulation of cell growth(GO:0030308) |
0.0 | 2.8 | GO:0008380 | RNA splicing(GO:0008380) |
0.0 | 0.2 | GO:0046470 | phosphatidylcholine metabolic process(GO:0046470) |
0.0 | 0.1 | GO:0010262 | somatic embryogenesis(GO:0010262) |
0.0 | 0.1 | GO:0010080 | regulation of floral meristem growth(GO:0010080) |
0.0 | 0.1 | GO:0010222 | stem vascular tissue pattern formation(GO:0010222) |
0.0 | 0.3 | GO:0006949 | syncytium formation(GO:0006949) |
0.0 | 0.1 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.0 | 0.1 | GO:0051555 | flavone biosynthetic process(GO:0051553) flavonol biosynthetic process(GO:0051555) |
0.0 | 0.2 | GO:0010413 | glucuronoxylan metabolic process(GO:0010413) glucuronoxylan biosynthetic process(GO:0010417) |
0.0 | 0.2 | GO:0032365 | intracellular lipid transport(GO:0032365) |
0.0 | 0.1 | GO:0051781 | positive regulation of cell division(GO:0051781) |
0.0 | 0.2 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.2 | GO:0046653 | tetrahydrofolate metabolic process(GO:0046653) |
0.0 | 0.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.0 | 0.1 | GO:0010190 | cytochrome b6f complex assembly(GO:0010190) |
0.0 | 0.0 | GO:0044259 | collagen metabolic process(GO:0032963) multicellular organism metabolic process(GO:0044236) multicellular organismal macromolecule metabolic process(GO:0044259) |
0.0 | 0.2 | GO:0010076 | maintenance of floral meristem identity(GO:0010076) |
0.0 | 0.1 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.1 | GO:0009583 | detection of light stimulus(GO:0009583) |
0.0 | 0.4 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 0.2 | GO:2000028 | regulation of photoperiodism, flowering(GO:2000028) |
0.0 | 0.1 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.0 | 0.0 | GO:0006968 | cellular defense response(GO:0006968) |
0.0 | 0.0 | GO:0007098 | centrosome cycle(GO:0007098) centriole replication(GO:0007099) microtubule organizing center organization(GO:0031023) centrosome organization(GO:0051297) centrosome duplication(GO:0051298) centriole assembly(GO:0098534) |
0.0 | 0.2 | GO:0009612 | response to mechanical stimulus(GO:0009612) |
0.0 | 0.1 | GO:0045740 | positive regulation of DNA replication(GO:0045740) |
0.0 | 0.1 | GO:0055062 | phosphate ion homeostasis(GO:0055062) trivalent inorganic anion homeostasis(GO:0072506) |
0.0 | 0.4 | GO:0009788 | negative regulation of abscisic acid-activated signaling pathway(GO:0009788) |
0.0 | 0.1 | GO:0009638 | phototropism(GO:0009638) |
0.0 | 0.3 | GO:0009828 | plant-type cell wall loosening(GO:0009828) |
0.0 | 0.1 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.0 | 0.1 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.0 | 0.4 | GO:0009853 | photorespiration(GO:0009853) |
0.0 | 0.2 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.1 | GO:0015865 | purine nucleotide transport(GO:0015865) |
0.0 | 0.7 | GO:0009909 | regulation of flower development(GO:0009909) |
0.0 | 0.1 | GO:0033619 | membrane protein proteolysis(GO:0033619) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.2 | GO:0080022 | primary root development(GO:0080022) |
0.0 | 0.9 | GO:0009451 | RNA modification(GO:0009451) |
0.0 | 0.2 | GO:0090630 | activation of GTPase activity(GO:0090630) |
0.0 | 0.0 | GO:0010198 | synergid death(GO:0010198) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.3 | 0.9 | GO:0031897 | Tic complex(GO:0031897) |
0.2 | 1.1 | GO:0030286 | dynein complex(GO:0030286) |
0.2 | 0.9 | GO:0031352 | intrinsic component of plastid inner membrane(GO:0031352) integral component of plastid inner membrane(GO:0031353) intrinsic component of chloroplast inner membrane(GO:0031356) integral component of chloroplast inner membrane(GO:0031357) |
0.2 | 0.6 | GO:0033290 | eukaryotic 48S preinitiation complex(GO:0033290) |
0.2 | 0.6 | GO:0009501 | amyloplast(GO:0009501) |
0.2 | 0.6 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.2 | 0.6 | GO:1990112 | RQC complex(GO:1990112) |
0.2 | 0.8 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.2 | 1.0 | GO:0000311 | plastid large ribosomal subunit(GO:0000311) |
0.2 | 0.8 | GO:0000812 | Swr1 complex(GO:0000812) |
0.2 | 0.8 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
0.1 | 0.9 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.1 | 1.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 1.0 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 1.3 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.1 | 1.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 1.1 | GO:0016514 | SWI/SNF complex(GO:0016514) BAF-type complex(GO:0090544) |
0.1 | 0.6 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 0.4 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 2.7 | GO:0031358 | intrinsic component of plastid outer membrane(GO:0031354) integral component of plastid outer membrane(GO:0031355) intrinsic component of chloroplast outer membrane(GO:0031358) integral component of chloroplast outer membrane(GO:0031359) |
0.1 | 0.4 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.1 | 0.6 | GO:0010007 | magnesium chelatase complex(GO:0010007) |
0.1 | 0.4 | GO:0035101 | FACT complex(GO:0035101) |
0.1 | 0.5 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
0.1 | 1.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 0.9 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 1.1 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 2.3 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
0.1 | 0.4 | GO:0000791 | euchromatin(GO:0000791) |
0.1 | 0.5 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.3 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
0.1 | 1.1 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.1 | 0.8 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 1.0 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 0.6 | GO:0005884 | actin filament(GO:0005884) |
0.1 | 0.5 | GO:0034518 | RNA cap binding complex(GO:0034518) |
0.1 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 3.5 | GO:0009707 | chloroplast outer membrane(GO:0009707) |
0.1 | 0.6 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 0.6 | GO:0030897 | HOPS complex(GO:0030897) |
0.1 | 1.1 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 1.4 | GO:0005769 | early endosome(GO:0005769) |
0.1 | 0.4 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.1 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 0.8 | GO:0000427 | plastid-encoded plastid RNA polymerase complex(GO:0000427) |
0.1 | 0.6 | GO:0000445 | transcription export complex(GO:0000346) THO complex part of transcription export complex(GO:0000445) |
0.1 | 0.3 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
0.1 | 0.5 | GO:0090395 | plant cell papilla(GO:0090395) |
0.1 | 1.0 | GO:0042644 | chloroplast nucleoid(GO:0042644) |
0.1 | 0.6 | GO:0035861 | site of double-strand break(GO:0035861) |
0.1 | 0.4 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 0.6 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 0.3 | GO:0032044 | DSIF complex(GO:0032044) |
0.1 | 0.3 | GO:0070505 | pollen coat(GO:0070505) |
0.1 | 8.8 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 0.1 | GO:0042646 | plastid nucleoid(GO:0042646) |
0.1 | 0.3 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.1 | 0.2 | GO:0005712 | chiasma(GO:0005712) |
0.1 | 1.1 | GO:0031965 | nuclear membrane(GO:0031965) |
0.1 | 0.5 | GO:0000312 | plastid small ribosomal subunit(GO:0000312) |
0.1 | 0.7 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.1 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.1 | 0.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 0.3 | GO:0034271 | phosphatidylinositol 3-kinase complex(GO:0005942) phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 3.5 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.2 | GO:0034066 | RIC1-RGP1 guanyl-nucleotide exchange factor complex(GO:0034066) |
0.1 | 0.3 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 1.0 | GO:0072686 | mitotic spindle(GO:0072686) |
0.1 | 0.5 | GO:0070390 | transcription export complex 2(GO:0070390) |
0.1 | 0.4 | GO:0015030 | Cajal body(GO:0015030) |
0.1 | 0.6 | GO:0032806 | holo TFIIH complex(GO:0005675) carboxy-terminal domain protein kinase complex(GO:0032806) |
0.1 | 0.8 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
0.1 | 0.2 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) multimeric ribonuclease P complex(GO:0030681) |
0.1 | 0.4 | GO:0010445 | nuclear dicing body(GO:0010445) |
0.1 | 0.4 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.1 | GO:0038201 | TORC1 complex(GO:0031931) TOR complex(GO:0038201) |
0.1 | 0.5 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.2 | GO:0042709 | succinate-CoA ligase complex(GO:0042709) |
0.1 | 1.1 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 3.0 | GO:0031969 | chloroplast membrane(GO:0031969) |
0.1 | 2.6 | GO:0031977 | thylakoid lumen(GO:0031977) |
0.0 | 1.8 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.3 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 0.3 | GO:0009346 | citrate lyase complex(GO:0009346) |
0.0 | 0.2 | GO:0005838 | proteasome regulatory particle(GO:0005838) proteasome accessory complex(GO:0022624) |
0.0 | 0.3 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 1.1 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 1.0 | GO:0031307 | intrinsic component of mitochondrial outer membrane(GO:0031306) integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.3 | GO:0031083 | BLOC complex(GO:0031082) BLOC-1 complex(GO:0031083) |
0.0 | 0.1 | GO:1990298 | bub1-bub3 complex(GO:1990298) |
0.0 | 0.5 | GO:1902554 | serine/threonine protein kinase complex(GO:1902554) |
0.0 | 0.7 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
0.0 | 0.9 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
0.0 | 0.4 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
0.0 | 0.4 | GO:0009533 | chloroplast stromal thylakoid(GO:0009533) |
0.0 | 1.5 | GO:0009524 | phragmoplast(GO:0009524) |
0.0 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.6 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.1 | GO:0032153 | cell division site(GO:0032153) |
0.0 | 0.6 | GO:0009508 | plastid chromosome(GO:0009508) |
0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.4 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.8 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.9 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 4.5 | GO:0000790 | nuclear chromatin(GO:0000790) |
0.0 | 0.2 | GO:0046695 | SLIK (SAGA-like) complex(GO:0046695) |
0.0 | 0.2 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.7 | GO:0000148 | 1,3-beta-D-glucan synthase complex(GO:0000148) |
0.0 | 0.2 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.1 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 3.7 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.7 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 1.0 | GO:0055028 | cortical microtubule(GO:0055028) |
0.0 | 0.1 | GO:0043235 | TAT protein transport complex(GO:0033281) receptor complex(GO:0043235) |
0.0 | 0.5 | GO:0009574 | preprophase band(GO:0009574) |
0.0 | 0.6 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.2 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
0.0 | 11.4 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.7 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.0 | 0.3 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 2.4 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 1.8 | GO:0005635 | nuclear envelope(GO:0005635) |
0.0 | 1.7 | GO:0016604 | nuclear body(GO:0016604) |
0.0 | 3.8 | GO:0031461 | cullin-RING ubiquitin ligase complex(GO:0031461) |
0.0 | 0.5 | GO:0048500 | signal recognition particle(GO:0048500) |
0.0 | 0.6 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.8 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.2 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.0 | 0.3 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0000347 | THO complex(GO:0000347) |
0.0 | 0.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) NatC complex(GO:0031417) |
0.0 | 0.3 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 12.2 | GO:0009526 | plastid envelope(GO:0009526) |
0.0 | 64.8 | GO:0005829 | cytosol(GO:0005829) |
0.0 | 0.1 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.1 | GO:0034399 | nuclear periphery(GO:0034399) |
0.0 | 0.5 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.5 | GO:0010287 | plastoglobule(GO:0010287) |
0.0 | 0.3 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 3.9 | GO:0009532 | plastid stroma(GO:0009532) |
0.0 | 0.2 | GO:1902495 | transmembrane transporter complex(GO:1902495) |
0.0 | 1.6 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
0.0 | 1.1 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.2 | GO:0000418 | DNA-directed RNA polymerase IV complex(GO:0000418) |
0.0 | 1.3 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.0 | 0.6 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
0.0 | 0.1 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 1.5 | GO:0055035 | plastid thylakoid membrane(GO:0055035) |
0.0 | 0.3 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.1 | GO:0098576 | integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) lumenal side of membrane(GO:0098576) |
0.0 | 1.7 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.0 | 0.2 | GO:0031012 | extracellular matrix(GO:0031012) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 4.8 | GO:0047216 | inositol 3-alpha-galactosyltransferase activity(GO:0047216) |
0.5 | 2.1 | GO:0031516 | far-red light photoreceptor activity(GO:0031516) |
0.5 | 1.5 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.5 | 1.9 | GO:0004349 | glutamate 5-kinase activity(GO:0004349) glutamate-5-semialdehyde dehydrogenase activity(GO:0004350) |
0.4 | 2.7 | GO:0070547 | L-tyrosine:2-oxoglutarate aminotransferase activity(GO:0004838) L-tyrosine aminotransferase activity(GO:0070547) |
0.4 | 1.9 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.3 | 2.9 | GO:0009882 | blue light photoreceptor activity(GO:0009882) |
0.3 | 0.9 | GO:0016630 | protochlorophyllide reductase activity(GO:0016630) |
0.3 | 0.3 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.3 | 0.9 | GO:0003864 | 3-methyl-2-oxobutanoate hydroxymethyltransferase activity(GO:0003864) |
0.3 | 0.9 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
0.3 | 1.5 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
0.3 | 1.8 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.3 | 1.2 | GO:0003852 | 2-isopropylmalate synthase activity(GO:0003852) |
0.3 | 1.4 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.3 | 1.3 | GO:0030371 | translation repressor activity(GO:0030371) |
0.3 | 1.3 | GO:0046577 | long-chain-alcohol oxidase activity(GO:0046577) |
0.2 | 1.0 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.2 | 1.7 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.2 | 0.7 | GO:0031219 | levanase activity(GO:0031219) fructan beta-fructosidase activity(GO:0051669) |
0.2 | 1.2 | GO:0008964 | phosphoenolpyruvate carboxylase activity(GO:0008964) |
0.2 | 0.7 | GO:0035591 | MAP-kinase scaffold activity(GO:0005078) protein kinase C binding(GO:0005080) protein complex scaffold(GO:0032947) signaling adaptor activity(GO:0035591) |
0.2 | 0.7 | GO:0052592 | oxidoreductase activity, acting on CH or CH2 groups, with an iron-sulfur protein as acceptor(GO:0052592) |
0.2 | 2.5 | GO:0016723 | ferric-chelate reductase activity(GO:0000293) oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
0.2 | 3.9 | GO:0016157 | sucrose synthase activity(GO:0016157) |
0.2 | 1.8 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.2 | 1.1 | GO:0015367 | oxoglutarate:malate antiporter activity(GO:0015367) |
0.2 | 0.7 | GO:0070678 | preprotein binding(GO:0070678) |
0.2 | 1.1 | GO:0045505 | dynein binding(GO:0045502) dynein intermediate chain binding(GO:0045505) dynein light intermediate chain binding(GO:0051959) |
0.2 | 0.9 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
0.2 | 1.5 | GO:0001872 | (1->3)-beta-D-glucan binding(GO:0001872) |
0.2 | 1.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.2 | 1.5 | GO:0008441 | 3'(2'),5'-bisphosphate nucleotidase activity(GO:0008441) |
0.2 | 1.3 | GO:0080109 | indole-3-acetonitrile nitrile hydratase activity(GO:0080109) |
0.2 | 6.6 | GO:0048029 | monosaccharide binding(GO:0048029) |
0.2 | 0.6 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.2 | 0.8 | GO:0019172 | glyoxalase III activity(GO:0019172) |
0.2 | 1.0 | GO:0038199 | ethylene receptor activity(GO:0038199) ethylene binding(GO:0051740) alkene binding(GO:0072328) |
0.2 | 0.6 | GO:0016277 | [myelin basic protein]-arginine N-methyltransferase activity(GO:0016277) |
0.2 | 0.6 | GO:0052629 | phosphatidylinositol-3-phosphatase activity(GO:0004438) phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.2 | 0.6 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.2 | 2.5 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.2 | 0.6 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
0.2 | 1.3 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.2 | 1.1 | GO:0019904 | protein domain specific binding(GO:0019904) |
0.2 | 0.4 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.2 | 1.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.2 | 0.7 | GO:0070140 | ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
0.2 | 1.9 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.2 | 0.7 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.2 | 0.7 | GO:0008686 | GTP cyclohydrolase II activity(GO:0003935) 3,4-dihydroxy-2-butanone-4-phosphate synthase activity(GO:0008686) |
0.2 | 0.9 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.2 | 0.7 | GO:0004048 | anthranilate phosphoribosyltransferase activity(GO:0004048) |
0.2 | 1.4 | GO:0050307 | sucrose-phosphate phosphatase activity(GO:0050307) |
0.2 | 0.8 | GO:0035197 | siRNA binding(GO:0035197) |
0.2 | 0.5 | GO:0008442 | 3-hydroxyisobutyrate dehydrogenase activity(GO:0008442) |
0.2 | 0.8 | GO:0034432 | bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
0.2 | 0.7 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.2 | 1.5 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.2 | 0.6 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.2 | 1.1 | GO:0016703 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of one atom of oxygen (internal monooxygenases or internal mixed function oxidases)(GO:0016703) |
0.2 | 1.1 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 1.2 | GO:0010328 | auxin influx transmembrane transporter activity(GO:0010328) |
0.1 | 1.3 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 0.6 | GO:0045548 | phenylalanine ammonia-lyase activity(GO:0045548) |
0.1 | 0.9 | GO:0018708 | thiol S-methyltransferase activity(GO:0018708) |
0.1 | 0.6 | GO:0035516 | oxidative DNA demethylase activity(GO:0035516) |
0.1 | 0.9 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) |
0.1 | 0.6 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
0.1 | 0.6 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.1 | 0.4 | GO:1990259 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
0.1 | 0.8 | GO:0052691 | UDP-arabinopyranose mutase activity(GO:0052691) |
0.1 | 0.4 | GO:0046480 | galactolipid galactosyltransferase activity(GO:0046480) |
0.1 | 1.1 | GO:0090447 | glycerol-3-phosphate 2-O-acyltransferase activity(GO:0090447) |
0.1 | 0.8 | GO:0050062 | long-chain-fatty-acyl-CoA reductase activity(GO:0050062) |
0.1 | 1.5 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methyladenine glycosylase activity(GO:0008725) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.1 | 0.5 | GO:0046537 | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase activity(GO:0046537) |
0.1 | 0.5 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
0.1 | 0.5 | GO:0016656 | monodehydroascorbate reductase (NADH) activity(GO:0016656) |
0.1 | 1.3 | GO:0034979 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) NAD-dependent protein deacetylase activity(GO:0034979) |
0.1 | 0.3 | GO:0016726 | oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.1 | 0.4 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
0.1 | 0.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.5 | GO:1990269 | phosphoserine binding(GO:0050815) RNA polymerase II C-terminal domain phosphoserine binding(GO:1990269) |
0.1 | 1.9 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.1 | 0.4 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.1 | 0.8 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.1 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.5 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.1 | 1.2 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 1.0 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 0.8 | GO:0010279 | indole-3-acetic acid amido synthetase activity(GO:0010279) |
0.1 | 0.4 | GO:0004034 | aldose 1-epimerase activity(GO:0004034) |
0.1 | 4.2 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
0.1 | 0.4 | GO:0016504 | peptidase activator activity(GO:0016504) |
0.1 | 0.5 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 0.4 | GO:0033862 | UMP kinase activity(GO:0033862) |
0.1 | 1.3 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.1 | 0.7 | GO:0080046 | quercetin 4'-O-glucosyltransferase activity(GO:0080046) |
0.1 | 0.6 | GO:0016851 | magnesium chelatase activity(GO:0016851) ligase activity, forming nitrogen-metal bonds(GO:0051002) ligase activity, forming nitrogen-metal bonds, forming coordination complexes(GO:0051003) |
0.1 | 0.3 | GO:0008265 | Mo-molybdopterin cofactor sulfurase activity(GO:0008265) |
0.1 | 0.3 | GO:0080002 | UDP-glucose:4-aminobenzoate acylglucosyltransferase activity(GO:0080002) |
0.1 | 0.5 | GO:0015203 | polyamine transmembrane transporter activity(GO:0015203) |
0.1 | 0.3 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.1 | 0.5 | GO:0009678 | hydrogen-translocating pyrophosphatase activity(GO:0009678) |
0.1 | 0.2 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.3 | GO:1990883 | rRNA cytidine N-acetyltransferase activity(GO:1990883) |
0.1 | 0.9 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.4 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.5 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 1.2 | GO:0042389 | omega-3 fatty acid desaturase activity(GO:0042389) |
0.1 | 0.1 | GO:0008835 | diaminohydroxyphosphoribosylaminopyrimidine deaminase activity(GO:0008835) |
0.1 | 0.2 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
0.1 | 0.4 | GO:0017050 | D-erythro-sphingosine kinase activity(GO:0017050) |
0.1 | 0.3 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.1 | 0.3 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.3 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.1 | 0.9 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) sequence-specific single stranded DNA binding(GO:0098847) |
0.1 | 0.3 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.1 | 0.5 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.1 | 0.3 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.1 | 0.5 | GO:0016819 | hydrolase activity, acting on acid anhydrides, in sulfonyl-containing anhydrides(GO:0016819) adenylylsulfatase activity(GO:0047627) |
0.1 | 0.3 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
0.1 | 0.2 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 0.9 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 1.1 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.1 | 0.5 | GO:0018488 | aryl-aldehyde oxidase activity(GO:0018488) indole-3-acetaldehyde oxidase activity(GO:0050302) |
0.1 | 0.2 | GO:0004042 | acetyl-CoA:L-glutamate N-acetyltransferase activity(GO:0004042) |
0.1 | 0.2 | GO:0004412 | homoserine dehydrogenase activity(GO:0004412) |
0.1 | 0.6 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.2 | GO:0052745 | inositol phosphate phosphatase activity(GO:0052745) |
0.1 | 1.6 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 1.5 | GO:0031491 | nucleosome binding(GO:0031491) |
0.1 | 0.8 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.1 | 0.8 | GO:0034647 | histone demethylase activity (H3-K4 specific)(GO:0032453) histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
0.1 | 0.6 | GO:0010294 | abscisic acid glucosyltransferase activity(GO:0010294) |
0.1 | 0.5 | GO:0032977 | membrane insertase activity(GO:0032977) |
0.1 | 4.0 | GO:0019843 | rRNA binding(GO:0019843) |
0.1 | 0.3 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 0.2 | GO:0001130 | bacterial-type RNA polymerase transcription factor activity, sequence-specific DNA binding(GO:0001130) bacterial-type RNA polymerase transcriptional activator activity, sequence-specific DNA binding(GO:0001216) |
0.1 | 0.4 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 1.0 | GO:0070403 | NAD+ binding(GO:0070403) |
0.1 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) Atg8 activating enzyme activity(GO:0019779) |
0.1 | 2.1 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.1 | 0.5 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.5 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.1 | 0.5 | GO:0016781 | phosphotransferase activity, paired acceptors(GO:0016781) |
0.1 | 1.5 | GO:0030276 | clathrin binding(GO:0030276) |
0.1 | 0.6 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 1.1 | GO:0060090 | binding, bridging(GO:0060090) |
0.1 | 0.5 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.3 | GO:0010313 | phytochrome binding(GO:0010313) |
0.1 | 0.2 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.1 | 2.2 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) mannan synthase activity(GO:0051753) |
0.1 | 1.1 | GO:0015217 | ADP transmembrane transporter activity(GO:0015217) |
0.1 | 0.9 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.1 | 0.7 | GO:0043878 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (non-phosphorylating) activity(GO:0043878) |
0.1 | 0.4 | GO:0003913 | DNA photolyase activity(GO:0003913) |
0.1 | 0.5 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 4.1 | GO:0004650 | polygalacturonase activity(GO:0004650) |
0.1 | 0.3 | GO:0046509 | 1,2-diacylglycerol 3-beta-galactosyltransferase activity(GO:0046509) |
0.1 | 0.2 | GO:0008661 | 1-deoxy-D-xylulose-5-phosphate synthase activity(GO:0008661) |
0.1 | 0.2 | GO:0080102 | 3-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080102) 5-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080104) 7-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080106) |
0.1 | 1.1 | GO:0015086 | cadmium ion transmembrane transporter activity(GO:0015086) |
0.1 | 0.2 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.2 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 0.2 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.2 | GO:0070818 | oxygen-dependent protoporphyrinogen oxidase activity(GO:0004729) protoporphyrinogen oxidase activity(GO:0070818) |
0.1 | 1.9 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
0.1 | 0.4 | GO:0045549 | 9-cis-epoxycarotenoid dioxygenase activity(GO:0045549) |
0.1 | 2.7 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.1 | 0.8 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.1 | 0.7 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
0.1 | 0.4 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.1 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.4 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.1 | 0.4 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.1 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.3 | GO:0015120 | phosphoglycerate transmembrane transporter activity(GO:0015120) aldonate transmembrane transporter activity(GO:0042879) |
0.1 | 0.2 | GO:0004776 | succinate-CoA ligase activity(GO:0004774) succinate-CoA ligase (ADP-forming) activity(GO:0004775) succinate-CoA ligase (GDP-forming) activity(GO:0004776) |
0.1 | 0.7 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.1 | 3.1 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.1 | 0.3 | GO:0004333 | fumarate hydratase activity(GO:0004333) |
0.1 | 0.2 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
0.1 | 0.8 | GO:0070717 | poly-purine tract binding(GO:0070717) |
0.1 | 0.8 | GO:0004124 | cysteine synthase activity(GO:0004124) |
0.1 | 11.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 1.2 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 4.0 | GO:0003724 | RNA helicase activity(GO:0003724) |
0.0 | 0.4 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
0.0 | 0.2 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.0 | 0.1 | GO:0047912 | galacturonokinase activity(GO:0047912) |
0.0 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.5 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.3 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
0.0 | 0.4 | GO:0001653 | peptide receptor activity(GO:0001653) |
0.0 | 0.3 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.8 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 0.3 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.6 | GO:0004930 | G-protein coupled receptor activity(GO:0004930) |
0.0 | 0.2 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
0.0 | 0.1 | GO:0004476 | mannose-6-phosphate isomerase activity(GO:0004476) |
0.0 | 0.3 | GO:0097001 | sphingolipid binding(GO:0046625) ceramide binding(GO:0097001) |
0.0 | 0.2 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 2.5 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.7 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.0 | 0.1 | GO:0004044 | amidophosphoribosyltransferase activity(GO:0004044) |
0.0 | 0.9 | GO:0008266 | poly-pyrimidine tract binding(GO:0008187) poly(U) RNA binding(GO:0008266) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.2 | GO:0004057 | arginyltransferase activity(GO:0004057) |
0.0 | 0.4 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.3 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
0.0 | 0.4 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.5 | GO:1901981 | phosphatidylinositol phosphate binding(GO:1901981) |
0.0 | 0.5 | GO:0005267 | potassium channel activity(GO:0005267) |
0.0 | 0.1 | GO:0008963 | phospho-N-acetylmuramoyl-pentapeptide-transferase activity(GO:0008963) |
0.0 | 0.6 | GO:0004630 | phospholipase D activity(GO:0004630) N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.0 | 0.2 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.0 | 0.5 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.1 | GO:0008460 | dTDP-glucose 4,6-dehydratase activity(GO:0008460) UDP-L-rhamnose synthase activity(GO:0010280) UDP-glucose 4,6-dehydratase activity(GO:0050377) |
0.0 | 0.2 | GO:0009884 | cytokinin receptor activity(GO:0009884) |
0.0 | 1.0 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
0.0 | 0.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.3 | GO:0004567 | beta-mannosidase activity(GO:0004567) mannosidase activity(GO:0015923) |
0.0 | 0.1 | GO:0047780 | citrate dehydratase activity(GO:0047780) |
0.0 | 0.2 | GO:0004001 | adenosine kinase activity(GO:0004001) |
0.0 | 0.0 | GO:0016815 | nitrilase activity(GO:0000257) hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in nitriles(GO:0016815) nitrile hydratase activity(GO:0018822) indole-3-acetonitrile nitrilase activity(GO:0080061) |
0.0 | 0.2 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
0.0 | 0.2 | GO:0031683 | G-protein coupled receptor binding(GO:0001664) G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.7 | GO:0003843 | 1,3-beta-D-glucan synthase activity(GO:0003843) |
0.0 | 0.3 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
0.0 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.1 | GO:0004619 | phosphoglycerate mutase activity(GO:0004619) |
0.0 | 0.1 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.7 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
0.0 | 2.1 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 1.0 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
0.0 | 0.4 | GO:0080161 | auxin transmembrane transporter activity(GO:0080161) |
0.0 | 1.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.4 | GO:0002020 | protease binding(GO:0002020) |
0.0 | 1.7 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.1 | GO:0045181 | glutamate synthase activity(GO:0015930) glutamate synthase (NADH) activity(GO:0016040) glutamate synthase activity, NAD(P)H as acceptor(GO:0045181) |
0.0 | 0.4 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
0.0 | 0.4 | GO:0004743 | pyruvate kinase activity(GO:0004743) potassium ion binding(GO:0030955) alkali metal ion binding(GO:0031420) |
0.0 | 0.1 | GO:0045156 | electron transporter, transferring electrons within the cyclic electron transport pathway of photosynthesis activity(GO:0045156) |
0.0 | 0.0 | GO:0080103 | 4-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080103) |
0.0 | 3.9 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
0.0 | 0.5 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.4 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
0.0 | 1.1 | GO:0016278 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
0.0 | 3.7 | GO:0003712 | transcription factor activity, transcription factor binding(GO:0000989) transcription cofactor activity(GO:0003712) |
0.0 | 0.8 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.7 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.1 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.2 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 4.2 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.0 | 0.4 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.1 | GO:0052742 | phosphatidylinositol kinase activity(GO:0052742) |
0.0 | 0.1 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
0.0 | 0.2 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.0 | 0.4 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.2 | GO:0015391 | nucleobase:cation symporter activity(GO:0015391) |
0.0 | 4.9 | GO:0015405 | P-P-bond-hydrolysis-driven transmembrane transporter activity(GO:0015405) |
0.0 | 0.3 | GO:0043566 | structure-specific DNA binding(GO:0043566) |
0.0 | 16.5 | GO:0003729 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.5 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.6 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.7 | GO:0035091 | phosphatidylinositol binding(GO:0035091) |
0.0 | 0.5 | GO:0004564 | beta-fructofuranosidase activity(GO:0004564) |
0.0 | 0.1 | GO:0010296 | prenylcysteine methylesterase activity(GO:0010296) |
0.0 | 0.2 | GO:0051018 | protein kinase A regulatory subunit binding(GO:0034237) protein kinase A binding(GO:0051018) Arp2/3 complex binding(GO:0071933) |
0.0 | 0.6 | GO:0015205 | nucleobase transmembrane transporter activity(GO:0015205) |
0.0 | 0.1 | GO:0061608 | nucleocytoplasmic transporter activity(GO:0005487) nuclear import signal receptor activity(GO:0061608) |
0.0 | 0.3 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 1.0 | GO:0000156 | phosphorelay response regulator activity(GO:0000156) |
0.0 | 0.3 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.0 | 0.1 | GO:0004123 | cystathionine gamma-lyase activity(GO:0004123) |
0.0 | 0.3 | GO:0004084 | branched-chain-amino-acid transaminase activity(GO:0004084) |
0.0 | 0.1 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
0.0 | 0.1 | GO:0019202 | amino acid kinase activity(GO:0019202) |
0.0 | 0.1 | GO:0016906 | sterol 3-beta-glucosyltransferase activity(GO:0016906) |
0.0 | 0.4 | GO:0003825 | alpha,alpha-trehalose-phosphate synthase (UDP-forming) activity(GO:0003825) |
0.0 | 0.4 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.9 | GO:0080043 | quercetin 3-O-glucosyltransferase activity(GO:0080043) |
0.0 | 1.4 | GO:0036459 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) |
0.0 | 0.3 | GO:0016408 | C-acyltransferase activity(GO:0016408) |
0.0 | 0.1 | GO:0047560 | 3-dehydrosphinganine reductase activity(GO:0047560) |
0.0 | 0.3 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.6 | GO:0047262 | polygalacturonate 4-alpha-galacturonosyltransferase activity(GO:0047262) |
0.0 | 0.1 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 1.8 | GO:0004519 | endonuclease activity(GO:0004519) |
0.0 | 0.3 | GO:0008515 | sucrose transmembrane transporter activity(GO:0008515) |
0.0 | 0.2 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.4 | GO:0016597 | amino acid binding(GO:0016597) |
0.0 | 0.2 | GO:0016688 | L-ascorbate peroxidase activity(GO:0016688) |
0.0 | 0.1 | GO:0019206 | uridine kinase activity(GO:0004849) nucleoside kinase activity(GO:0019206) |
0.0 | 0.9 | GO:0010857 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
0.0 | 0.3 | GO:0008146 | sulfotransferase activity(GO:0008146) |
0.0 | 0.1 | GO:0008251 | adenosine deaminase activity(GO:0004000) tRNA-specific adenosine deaminase activity(GO:0008251) |
0.0 | 0.1 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.1 | GO:0051184 | cofactor transporter activity(GO:0051184) |
0.0 | 0.1 | GO:0019902 | phosphatase binding(GO:0019902) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.5 | GO:0051540 | iron-sulfur cluster binding(GO:0051536) metal cluster binding(GO:0051540) |
0.0 | 0.3 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.8 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.1 | GO:0070696 | transmembrane receptor protein serine/threonine kinase binding(GO:0070696) |
0.0 | 0.2 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
0.0 | 0.6 | GO:0043621 | protein self-association(GO:0043621) |
0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.4 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
0.0 | 0.4 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.1 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
0.0 | 0.3 | GO:0051087 | chaperone binding(GO:0051087) |
0.0 | 0.1 | GO:0003830 | beta-1,4-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0003830) |
0.0 | 0.1 | GO:0010011 | auxin binding(GO:0010011) |
0.0 | 1.6 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.1 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 1.0 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.4 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
0.0 | 0.4 | GO:0032561 | GTP binding(GO:0005525) guanyl nucleotide binding(GO:0019001) guanyl ribonucleotide binding(GO:0032561) |
0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.4 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.2 | GO:0080032 | methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.0 | 0.1 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.1 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.2 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.3 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.3 | 0.8 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.2 | 0.2 | PID RAS PATHWAY | Regulation of Ras family activation |
0.2 | 0.9 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.2 | 0.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.2 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.1 | 0.1 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.1 | 0.2 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 0.8 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.1 | 0.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 0.3 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.1 | 0.3 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 0.4 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.1 | 0.4 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.1 | 0.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.4 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.1 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.2 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.0 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.3 | 0.9 | REACTOME DOWNSTREAM SIGNALING OF ACTIVATED FGFR | Genes involved in Downstream signaling of activated FGFR |
0.3 | 0.9 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.2 | 1.0 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.2 | 0.8 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.1 | 0.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 1.0 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 0.1 | REACTOME AXON GUIDANCE | Genes involved in Axon guidance |
0.1 | 0.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 0.4 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 0.3 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.1 | 0.3 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.1 | 0.2 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.1 | 0.4 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.1 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 0.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 0.4 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.0 | 0.2 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.0 | 0.3 | REACTOME INTERFERON SIGNALING | Genes involved in Interferon Signaling |
0.0 | 1.3 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
0.0 | 0.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.0 | 0.1 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.1 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.3 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.7 | REACTOME METABOLISM OF LIPIDS AND LIPOPROTEINS | Genes involved in Metabolism of lipids and lipoproteins |
0.0 | 0.1 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |