GSE130291:vernalization in Arabidopsis thaliana
Gene Symbol | Gene ID | Gene Info |
---|---|---|
AT1G31140
|
AT1G31140 | GORDITA |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
GOA | arTal_v1_Chr1_+_11117941_11117993 | -0.03 | 9.2e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
Chr1_+_28975255 | 2.67 |
AT1G77120.1
|
ADH1
|
alcohol dehydrogenase 1 |
Chr2_-_17710433 | 2.54 |
AT2G42530.1
|
COR15B
|
cold regulated 15b |
Chr2_+_538250 | 2.14 |
AT2G02120.1
|
PDF2.1
|
Scorpion toxin-like knottin superfamily protein |
Chr5_-_14753088 | 1.98 |
AT5G37260.1
|
RVE2
|
Homeodomain-like superfamily protein |
Chr5_+_5206156 | 1.97 |
AT5G15950.2
|
AT5G15950
|
Adenosylmethionine decarboxylase family protein |
Chr5_+_5205869 | 1.96 |
AT5G15950.1
|
AT5G15950
|
Adenosylmethionine decarboxylase family protein |
Chr4_-_7401951 | 1.90 |
AT4G12470.1
|
AZI1
|
azelaic acid induced 1 |
Chr5_-_22712441 | 1.88 |
AT5G56080.1
|
NAS2
|
nicotianamine synthase 2 |
Chr5_-_5692920 | 1.70 |
AT5G17300.2
AT5G17300.1 |
RVE1
|
Homeodomain-like superfamily protein |
Chr5_+_5211719 | 1.65 |
AT5G15970.1
|
KIN2
|
stress-responsive protein (KIN2) / stress-induced protein (KIN2) / cold-responsive protein (COR6.6) / cold-regulated protein (COR6.6) |
Chr2_+_19245591 | 1.63 |
AT2G46830.1
AT2G46830.2 |
CCA1
|
circadian clock associated 1 |
Chr4_-_15954803 | 1.60 |
AT4G33070.1
|
AT4G33070
|
Thiamine pyrophosphate dependent pyruvate decarboxylase family protein |
Chr4_+_8827600 | 1.52 |
AT4G15430.2
AT4G15430.1 |
AT4G15430
|
ERD (early-responsive to dehydration stress) family protein |
Chr2_+_19246681 | 1.49 |
AT2G46830.3
|
CCA1
|
circadian clock associated 1 |
Chr3_-_82182 | 1.48 |
AT3G01260.1
|
AT3G01260
|
Galactose mutarotase-like superfamily protein |
Chr3_-_7796310 | 1.47 |
AT3G22120.1
AT3G22120.2 |
CWLP
|
cell wall-plasma membrane linker protein |
Chr1_+_5872024 | 1.47 |
AT1G17180.1
|
GSTU25
|
glutathione S-transferase TAU 25 |
Chr1_-_37757 | 1.47 |
AT1G01060.3
AT1G01060.2 AT1G01060.4 AT1G01060.1 AT1G01060.6 AT1G01060.7 AT1G01060.5 |
LHY
|
Homeodomain-like superfamily protein |
Chr5_+_20151163 | 1.40 |
AT5G49640.1
|
AT5G49640
|
hypothetical protein |
Chr2_-_19370478 | 1.37 |
AT2G47180.1
|
GolS1
|
galactinol synthase 1 |
Chr3_-_20576249 | 1.35 |
AT3G55500.1
|
EXPA16
|
expansin A16 |
Chr1_-_22280593 | 1.34 |
AT1G60470.1
|
GolS4
|
galactinol synthase 4 |
Chr3_-_8085669 | 1.34 |
AT3G22840.1
|
ELIP1
|
Chlorophyll A-B binding family protein |
Chr3_+_1693548 | 1.33 |
AT3G05727.1
|
AT3G05727
|
S locus-related glycoprotein 1 (SLR1) binding pollen coat protein family |
Chr1_-_19762560 | 1.29 |
AT1G53035.2
AT1G53035.1 |
AT1G53035
|
transmembrane protein |
Chr2_+_6893949 | 1.28 |
AT2G15830.1
|
AT2G15830
|
hypothetical protein |
Chr1_-_10164452 | 1.25 |
AT1G29090.1
|
AT1G29090
|
Cysteine proteinases superfamily protein |
Chr5_-_7054281 | 1.20 |
AT5G20830.3
|
SUS1
|
sucrose synthase 1 |
Chr3_+_19845097 | 1.20 |
AT3G53530.2
AT3G53530.1 |
NAKR3
|
Chloroplast-targeted copper chaperone protein |
Chr5_+_17526660 | 1.20 |
AT5G43630.2
AT5G43630.1 AT5G43630.3 AT5G43630.4 |
TZP
|
zinc knuckle (CCHC-type) family protein |
Chr5_-_7054713 | 1.18 |
AT5G20830.1
|
SUS1
|
sucrose synthase 1 |
Chr1_-_18238497 | 1.15 |
AT1G49310.1
|
AT1G49310
|
transmembrane protein |
Chr5_-_7055398 | 1.15 |
AT5G20830.2
|
SUS1
|
sucrose synthase 1 |
Chr4_-_7406994 | 1.14 |
AT4G12480.1
|
EARLI1
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr5_-_18189523 | 1.14 |
AT5G45070.1
|
PP2-A8
|
phloem protein 2-A8 |
Chr3_+_10547441 | 1.14 |
AT3G28290.1
|
AT14A
|
transmembrane protein, putative (DUF677) |
Chr5_-_6976036 | 1.13 |
AT5G20630.1
|
GER3
|
germin 3 |
Chr3_+_2441565 | 1.10 |
AT3G07650.4
AT3G07650.1 AT3G07650.3 AT3G07650.2 |
COL9
|
CONSTANS-like 9 |
Chr5_+_4768263 | 1.09 |
AT5G14760.1
|
AO
|
L-aspartate oxidase |
Chr2_-_6493512 | 1.09 |
AT2G15020.1
|
AT2G15020
|
hypothetical protein |
Chr2_-_12343443 | 1.09 |
AT2G28780.1
|
AT2G28780
|
P-hydroxybenzoic acid efflux pump subunit |
Chr1_-_17266724 | 1.08 |
AT1G46768.3
AT1G46768.2 AT1G46768.1 |
RAP2.1
|
related to AP2 1 |
Chr3_-_21085245 | 1.08 |
AT3G56970.1
|
bHLH38
|
basic helix-loop-helix (bHLH) DNA-binding superfamily protein |
Chr3_-_21650347 | 1.07 |
AT3G58550.1
|
AT3G58550
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr4_-_13001948 | 1.07 |
AT4G25433.1
|
AT4G25433
|
peptidoglycan-binding LysM domain-containing protein |
Chr3_-_10790553 | 1.06 |
AT3G28740.1
|
CYP81D11
|
Cytochrome P450 superfamily protein |
Chr3_+_4449259 | 1.06 |
AT3G13610.1
|
AT3G13610
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
Chr5_+_22388782 | 1.06 |
AT5G55180.2
|
AT5G55180
|
O-Glycosyl hydrolases family 17 protein |
Chr1_-_3756998 | 1.05 |
AT1G11210.1
|
AT1G11210
|
cotton fiber protein, putative (DUF761) |
Chr3_-_23195917 | 1.05 |
AT3G62700.1
|
ABCC14
|
multidrug resistance-associated protein 10 |
Chr2_+_13987669 | 1.04 |
AT2G32960.1
|
PFA-DSP2
|
Phosphotyrosine protein phosphatases superfamily protein |
Chr5_+_22388521 | 1.04 |
AT5G55180.1
|
AT5G55180
|
O-Glycosyl hydrolases family 17 protein |
Chr2_+_9248525 | 1.04 |
AT2G21620.1
AT2G21620.2 |
RD2
|
Adenine nucleotide alpha hydrolases-like superfamily protein |
Chr1_+_16263805 | 1.04 |
AT1G43160.1
|
RAP2.6
|
related to AP2 6 |
Chr4_+_9028262 | 1.03 |
AT4G15910.1
|
DI21
|
drought-induced 21 |
Chr3_-_10599042 | 1.01 |
AT3G28345.1
|
ABCB15
|
ABC transporter family protein |
Chr3_-_19747114 | 1.01 |
AT3G53260.1
|
PAL2
|
phenylalanine ammonia-lyase 2 |
Chr3_+_5720941 | 1.01 |
AT3G16800.5
AT3G16800.4 AT3G16800.2 AT3G16800.6 AT3G16800.1 |
AT3G16800
|
Protein phosphatase 2C family protein |
Chr5_-_19062814 | 1.01 |
AT5G46960.1
|
AT5G46960
|
Plant invertase/pectin methylesterase inhibitor superfamily protein |
Chr5_+_3347381 | 1.00 |
AT5G10580.3
AT5G10580.4 AT5G10580.1 AT5G10580.2 |
AT5G10580
|
plant/protein (Protein of unknown function, DUF599) |
Chr4_-_12345652 | 0.99 |
AT4G23700.2
|
CHX17
|
cation/H+ exchanger 17 |
Chr1_-_23246949 | 0.98 |
AT1G62770.1
|
AT1G62770
|
Plant invertase/pectin methylesterase inhibitor superfamily protein |
Chr5_+_2866222 | 0.97 |
AT5G09220.1
|
AAP2
|
amino acid permease 2 |
Chr4_-_12346051 | 0.97 |
AT4G23700.1
|
CHX17
|
cation/H+ exchanger 17 |
Chr4_+_8804070 | 0.97 |
AT4G15393.2
AT4G15393.3 AT4G15393.1 |
CYP702A5
|
cytochrome P450, family 702, subfamily A, polypeptide 5 |
Chr5_-_17337884 | 0.96 |
AT5G43180.1
|
AT5G43180
|
transmembrane protein, putative (Protein of unknown function, DUF599) |
Chr5_+_21688763 | 0.96 |
AT5G53450.2
AT5G53450.3 AT5G53450.1 |
ORG1
|
OBP3-responsive protein 1 |
Chr5_-_4620551 | 0.95 |
AT5G14330.1
|
AT5G14330
|
transmembrane protein |
Chr3_+_8941066 | 0.95 |
AT3G24520.1
|
HSFC1
|
heat shock transcription factor C1 |
Chr1_+_28829243 | 0.94 |
AT1G76800.1
|
AT1G76800
|
Vacuolar iron transporter (VIT) family protein |
Chr5_-_23117403 | 0.93 |
AT5G57110.3
AT5G57110.1 AT5G57110.2 |
ACA8
|
autoinhibited Ca2+ -ATPase, isoform 8 |
Chr3_-_4974521 | 0.93 |
AT3G14810.1
AT3G14810.2 |
MSL5
|
mechanosensitive channel of small conductance-like 5 |
Chr1_+_25701770 | 0.93 |
AT1G68500.1
|
AT1G68500
|
hypothetical protein |
Chr4_-_13016235 | 0.93 |
AT4G25470.1
|
CBF2
|
C-repeat/DRE binding factor 2 |
Chr5_-_19563832 | 0.93 |
AT5G48250.1
|
BBX8
|
B-box type zinc finger protein with CCT domain-containing protein |
Chr5_+_17937622 | 0.92 |
AT5G44530.3
AT5G44530.2 AT5G44530.1 |
AT5G44530
|
Subtilase family protein |
Chr1_+_18198227 | 0.92 |
AT1G49200.1
|
AT1G49200
|
RING/U-box superfamily protein |
Chr4_-_9583290 | 0.92 |
AT4G17030.1
|
EXLB1
|
expansin-like B1 |
Chr1_-_507268 | 0.91 |
AT1G02460.1
|
AT1G02460
|
Pectin lyase-like superfamily protein |
Chr2_+_2026162 | 0.91 |
AT2G05520.4
AT2G05520.5 AT2G05520.6 AT2G05520.3 |
GRP-3
|
glycine-rich protein 3 |
Chr1_+_7404328 | 0.91 |
AT1G21140.1
|
AT1G21140
|
Vacuolar iron transporter (VIT) family protein |
Chr3_+_8172479 | 0.89 |
AT3G23000.1
|
CIPK7
|
CBL-interacting protein kinase 7 |
Chr1_-_10664570 | 0.89 |
AT1G30280.2
AT1G30280.3 AT1G30280.1 |
AT1G30280
|
Chaperone DnaJ-domain superfamily protein |
Chr4_+_11182092 | 0.88 |
AT4G20890.1
|
TUB9
|
tubulin beta-9 chain |
Chr1_-_6074525 | 0.88 |
AT1G17665.1
|
AT1G17665
|
CA-responsive protein |
Chr1_-_24703041 | 0.88 |
AT1G66270.2
AT1G66270.1 |
BGLU21
|
Glycosyl hydrolase superfamily protein |
Chr1_-_4651549 | 0.87 |
AT1G13600.1
|
bZIP58
|
basic leucine-zipper 58 |
Chr3_+_2946239 | 0.87 |
AT3G09600.1
AT3G09600.2 AT3G09600.4 AT3G09600.3 AT3G09600.7 AT3G09600.6 AT3G09600.5 AT3G09600.8 AT3G09600.9 |
RVE8
|
Homeodomain-like superfamily protein |
Chr4_-_433938 | 0.87 |
AT4G01000.2
AT4G01000.1 |
AT4G01000
|
Ubiquitin-like superfamily protein |
Chr3_+_9475350 | 0.87 |
AT3G25890.2
AT3G25890.1 |
CRF11
|
Integrase-type DNA-binding superfamily protein |
Chr3_+_7959753 | 0.86 |
AT3G22440.1
|
AT3G22440
|
FRIGIDA-like protein |
Chr4_+_12827856 | 0.85 |
AT4G24960.1
AT4G24960.3 AT4G24960.2 |
HVA22D
|
HVA22 homologue D |
Chr5_+_18627950 | 0.83 |
AT5G45930.1
|
CHLI2
|
magnesium chelatase i2 |
Chr2_-_9266393 | 0.83 |
AT2G21660.2
|
GRP7
|
cold, circadian rhythm, and rna binding 2 |
Chr3_+_23211287 | 0.82 |
AT3G62740.2
AT3G62740.1 |
BGLU7
|
beta glucosidase 7 |
Chr1_-_3167924 | 0.82 |
AT1G09780.1
|
iPGAM1
|
Phosphoglycerate mutase, 2,3-bisphosphoglycerate-independent |
Chr5_+_3536189 | 0.82 |
AT5G11110.1
|
SPS2F
|
sucrose phosphate synthase 2F |
Chr2_+_2025991 | 0.82 |
AT2G05520.2
AT2G05520.1 |
GRP-3
|
glycine-rich protein 3 |
Chr3_-_19078955 | 0.81 |
AT3G51400.1
|
AT3G51400
|
hypothetical protein (DUF241) |
Chr1_+_6763765 | 0.81 |
AT1G19530.1
AT1G19530.2 |
AT1G19530
|
DNA polymerase epsilon catalytic subunit A |
Chr3_+_23135630 | 0.81 |
AT3G62550.1
|
AT3G62550
|
Adenine nucleotide alpha hydrolases-like superfamily protein |
Chr3_-_20142763 | 0.81 |
AT3G54400.1
|
AT3G54400
|
Eukaryotic aspartyl protease family protein |
Chr2_-_856725 | 0.80 |
AT2G02950.1
|
PKS1
|
phytochrome kinase substrate 1 |
Chr2_-_9266557 | 0.80 |
AT2G21660.1
|
GRP7
|
cold, circadian rhythm, and rna binding 2 |
Chr1_+_29356346 | 0.80 |
AT1G78070.2
AT1G78070.3 |
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
Chr5_-_7385833 | 0.79 |
AT5G22310.1
|
AT5G22310
|
trichohyalin-like protein |
Chr5_+_9033204 | 0.79 |
AT5G25890.1
|
IAA28
|
indole-3-acetic acid inducible 28 |
Chr2_-_7153430 | 0.79 |
AT2G16500.1
|
ADC1
|
arginine decarboxylase 1 |
Chr3_+_5585872 | 0.79 |
AT3G16440.2
AT3G16440.1 |
MLP-300B
|
myrosinase-binding protein-like protein-300B |
Chr1_-_23610653 | 0.79 |
AT1G63670.5
AT1G63670.3 AT1G63670.2 |
TRM12
|
hypothetical protein (DUF3741) |
Chr1_-_12745748 | 0.78 |
AT1G34760.1
AT1G34760.2 |
GRF11
|
general regulatory factor 11 |
Chr1_+_7785708 | 0.78 |
AT1G22065.1
|
AT1G22065
|
hypothetical protein |
Chr3_-_17506124 | 0.78 |
AT3G47500.1
|
CDF3
|
cycling DOF factor 3 |
Chr3_-_23046153 | 0.78 |
AT3G62270.1
|
AT3G62270
|
HCO3- transporter family |
Chr1_-_11719988 | 0.77 |
AT1G32450.1
|
NRT1.5
|
nitrate transporter 1.5 |
Chr5_+_20949291 | 0.77 |
AT5G51570.1
|
AT5G51570
|
SPFH/Band 7/PHB domain-containing membrane-associated protein family |
Chr2_-_8035412 | 0.77 |
AT2G18520.1
|
AT2G18520
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
Chr5_-_22500564 | 0.77 |
AT5G55540.2
AT5G55540.1 |
TRN1
|
tornado 1 |
Chr5_+_8687188 | 0.77 |
AT5G25160.1
|
ZFP3
|
zinc finger protein 3 |
Chr3_+_7673276 | 0.77 |
AT3G21770.1
|
AT3G21770
|
Peroxidase superfamily protein |
Chr3_+_16138375 | 0.77 |
AT3G44550.2
|
FAR5
|
fatty acid reductase 5 |
Chr4_+_1151611 | 0.77 |
AT4G02630.1
|
AT4G02630
|
Protein kinase superfamily protein |
Chr1_+_29354944 | 0.77 |
AT1G78070.1
|
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
Chr5_+_18398832 | 0.76 |
AT5G45400.1
|
RPA70C
|
Replication factor-A protein 1-like protein |
Chr1_-_22317070 | 0.76 |
AT1G60590.1
|
AT1G60590
|
Pectin lyase-like superfamily protein |
Chr1_-_23716170 | 0.76 |
AT1G63880.2
AT1G63880.1 |
AT1G63880
|
Disease resistance protein (TIR-NBS-LRR class) family |
Chr2_+_18061716 | 0.76 |
AT2G43500.1
AT2G43500.3 AT2G43500.4 AT2G43500.5 AT2G43500.6 AT2G43500.7 AT2G43500.2 AT2G43500.8 |
AT2G43500
|
Plant regulator RWP-RK family protein |
Chr1_-_29034822 | 0.76 |
AT1G77280.2
AT1G77280.1 |
AT1G77280
|
kinase with adenine nucleotide alpha hydrolases-like domain-containing protein |
Chr4_+_16542242 | 0.76 |
AT4G34650.1
|
SQS2
|
squalene synthase 2 |
Chr5_-_7654835 | 0.76 |
AT5G22890.1
|
AT5G22890
|
C2H2 and C2HC zinc fingers superfamily protein |
Chr5_-_7255944 | 0.75 |
AT5G21950.7
AT5G21950.2 AT5G21950.3 AT5G21950.1 AT5G21950.4 AT5G21950.6 AT5G21950.5 |
AT5G21950
|
alpha/beta-Hydrolases superfamily protein |
Chr2_-_19287590 | 0.75 |
AT2G46940.1
|
AT2G46940
|
fold protein |
Chr5_-_24559879 | 0.75 |
AT5G61020.2
AT5G61020.1 |
ECT3
|
evolutionarily conserved C-terminal region 3 |
Chr1_-_12224000 | 0.75 |
AT1G33720.5
AT1G33720.1 AT1G33720.3 AT1G33720.2 AT1G33720.4 |
CYP76C6
|
cytochrome P450, family 76, subfamily C, polypeptide 6 |
Chr4_+_5244865 | 0.75 |
AT4G08300.1
|
UMAMIT17
|
nodulin MtN21 /EamA-like transporter family protein |
Chr5_-_2697724 | 0.75 |
AT5G08380.2
AT5G08380.1 |
AGAL1
|
alpha-galactosidase 1 |
Chr1_-_18753941 | 0.74 |
AT1G50630.1
AT1G50630.2 |
AT1G50630
|
extracellular ligand-gated ion channel protein (DUF3537) |
Chr5_-_900298 | 0.74 |
AT5G03555.1
|
NCS1
|
permease, cytosine/purines, uracil, thiamine, allantoin family protein |
Chr1_-_11079240 | 0.74 |
AT1G31050.8
AT1G31050.7 AT1G31050.4 AT1G31050.6 AT1G31050.5 AT1G31050.3 AT1G31050.2 AT1G31050.1 |
AT1G31050
|
basic helix-loop-helix (bHLH) DNA-binding superfamily protein |
Chr3_+_5721225 | 0.73 |
AT3G16800.3
|
AT3G16800
|
Protein phosphatase 2C family protein |
Chr1_+_19711179 | 0.73 |
AT1G52930.1
|
AT1G52930
|
Ribosomal RNA processing Brix domain protein |
Chr5_-_7090169 | 0.73 |
AT5G20890.1
|
AT5G20890
|
TCP-1/cpn60 chaperonin family protein |
Chr5_-_25898171 | 0.73 |
AT5G64770.1
|
RGF9
|
root meristem growth factor |
Chr5_-_13868362 | 0.73 |
AT5G35690.1
|
AT5G35690
|
zinc metalloproteinase-like protein |
Chr3_+_8480025 | 0.73 |
AT3G23620.1
|
AT3G23620
|
Ribosomal RNA processing Brix domain protein |
Chr5_+_25328119 | 0.73 |
AT5G63140.1
|
PAP29
|
purple acid phosphatase 29 |
Chr4_+_8392825 | 0.72 |
AT4G14630.1
|
GLP9
|
germin-like protein 9 |
Chr2_+_16076289 | 0.72 |
AT2G38380.1
|
AT2G38380
|
Peroxidase superfamily protein |
Chr4_-_12533924 | 0.72 |
AT4G24140.1
|
AT4G24140
|
alpha/beta-Hydrolases superfamily protein |
Chr5_-_20111806 | 0.72 |
AT5G49560.1
|
AT5G49560
|
Putative methyltransferase family protein |
Chr1_-_23610327 | 0.72 |
AT1G63670.4
AT1G63670.1 |
TRM12
|
hypothetical protein (DUF3741) |
Chr3_+_11810726 | 0.72 |
AT3G30180.1
|
BR6OX2
|
brassinosteroid-6-oxidase 2 |
Chr4_+_18034363 | 0.72 |
AT4G38580.2
|
FP6
|
farnesylated protein 6 |
Chr4_+_17739514 | 0.72 |
AT4G37750.1
|
ANT
|
Integrase-type DNA-binding superfamily protein |
Chr5_+_23701392 | 0.72 |
AT5G58660.1
AT5G58660.2 |
AT5G58660
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
Chr1_-_156178 | 0.71 |
AT1G01420.2
|
UGT72B3
|
UDP-glucosyl transferase 72B3 |
Chr4_-_9935685 | 0.71 |
AT4G17880.1
|
MYC4
|
Basic helix-loop-helix (bHLH) DNA-binding family protein |
Chr1_-_29064637 | 0.71 |
AT1G77330.1
|
AT1G77330
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
Chr5_+_2657054 | 0.71 |
AT5G08260.1
|
scpl35
|
serine carboxypeptidase-like 35 |
Chr1_-_28117405 | 0.71 |
AT1G74840.2
AT1G74840.1 |
AT1G74840
|
Homeodomain-like superfamily protein |
Chr3_-_1652149 | 0.71 |
AT3G05660.1
|
RLP33
|
receptor like protein 33 |
Chr4_-_16631339 | 0.71 |
AT4G34900.3
AT4G34900.2 AT4G34900.1 |
XDH2
|
xanthine dehydrogenase 2 |
Chr4_+_18034131 | 0.71 |
AT4G38580.1
|
FP6
|
farnesylated protein 6 |
Chr5_-_1994824 | 0.71 |
AT5G06530.2
AT5G06530.3 AT5G06530.4 AT5G06530.1 |
ABCG22
|
ABC-2 type transporter family protein |
Chr3_-_2722624 | 0.71 |
AT3G08943.1
|
AT3G08943
|
ARM repeat superfamily protein |
Chr1_-_156011 | 0.71 |
AT1G01420.1
|
UGT72B3
|
UDP-glucosyl transferase 72B3 |
Chr3_+_20578922 | 0.71 |
AT3G55510.1
AT3G55510.2 |
RBL
|
Noc2p family |
Chr4_+_17512254 | 0.71 |
AT4G37210.1
AT4G37210.2 |
AT4G37210
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
Chr3_+_673428 | 0.71 |
AT3G02990.1
|
HSFA1E
|
heat shock transcription factor A1E |
Chr5_+_21910471 | 0.70 |
AT5G53970.1
|
TAT7
|
Tyrosine transaminase family protein |
Chr3_+_4729399 | 0.70 |
AT3G14210.1
AT3G14210.2 |
ESM1
|
GDSL-like lipase/acylhydrolase superfamily protein |
Chr3_-_6564424 | 0.70 |
AT3G19030.1
|
AT3G19030
|
transcription initiation factor TFIID subunit 1b-like protein |
Chr2_-_968048 | 0.70 |
AT2G03200.1
|
AT2G03200
|
Eukaryotic aspartyl protease family protein |
Chr5_-_24984044 | 0.70 |
AT5G62190.1
|
PRH75
|
DEAD box RNA helicase (PRH75) |
Chr1_-_22417244 | 0.70 |
AT1G60890.2
AT1G60890.1 |
AT1G60890
|
Phosphatidylinositol-4-phosphate 5-kinase family protein |
Chr1_+_10996870 | 0.70 |
AT1G30900.1
|
VSR6
|
VACUOLAR SORTING RECEPTOR 6 |
Chr5_+_17148808 | 0.70 |
AT5G42760.2
AT5G42760.1 |
AT5G42760
|
Leucine carboxyl methyltransferase |
Chr3_-_21199319 | 0.70 |
AT3G57290.1
|
EIF3E
|
eukaryotic translation initiation factor 3E |
Chr5_+_22671113 | 0.70 |
AT5G55990.1
AT5G55990.2 |
CBL2
|
calcineurin B-like protein 2 |
Chr5_-_19648362 | 0.70 |
AT5G48490.1
|
AT5G48490
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr2_-_9056481 | 0.69 |
AT2G21130.1
|
AT2G21130
|
Cyclophilin-like peptidyl-prolyl cis-trans isomerase family protein |
Chr5_-_1742161 | 0.69 |
AT5G05790.2
AT5G05790.1 |
AT5G05790
|
Duplicated homeodomain-like superfamily protein |
Chr1_-_1286619 | 0.69 |
AT1G04620.1
|
HCAR
|
coenzyme F420 hydrogenase family / dehydrogenase, beta subunit family |
Chr1_-_6538145 | 0.69 |
AT1G18910.1
|
AT1G18910
|
zinc ion binding protein |
Chr1_-_20385380 | 0.69 |
AT1G54570.1
|
PES1
|
Esterase/lipase/thioesterase family protein |
Chr2_-_394184 | 0.69 |
AT2G01880.1
|
PAP7
|
purple acid phosphatase 7 |
Chr3_-_22102164 | 0.69 |
AT3G59820.4
AT3G59820.2 AT3G59820.1 AT3G59820.3 |
LETM1
|
LETM1-like protein |
Chr4_+_596397 | 0.69 |
AT4G01440.3
AT4G01440.2 AT4G01440.1 AT4G01440.4 |
UMAMIT31
|
nodulin MtN21 /EamA-like transporter family protein |
Chr3_+_17427950 | 0.68 |
AT3G47295.1
|
AT3G47295
|
hypothetical protein |
Chr4_+_1321758 | 0.68 |
AT4G02990.1
AT4G02990.2 |
BSM
|
Mitochondrial transcription termination factor family protein |
Chr1_+_18400003 | 0.68 |
AT1G49720.1
AT1G49720.2 AT1G49720.3 |
ABF1
|
abscisic acid responsive element-binding factor 1 |
Chr3_+_3776177 | 0.68 |
AT3G11930.2
AT3G11930.3 AT3G11930.1 AT3G11930.4 |
AT3G11930
|
Adenine nucleotide alpha hydrolases-like superfamily protein |
Chr1_+_4056165 | 0.68 |
AT1G12010.1
|
AT1G12010
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
Chr2_-_8495892 | 0.67 |
AT2G19650.1
|
AT2G19650
|
Cysteine/Histidine-rich C1 domain family protein |
Chr5_+_18791575 | 0.67 |
AT5G46330.1
AT5G46330.2 |
FLS2
|
Leucine-rich receptor-like protein kinase family protein |
Chr4_-_13019400 | 0.67 |
AT4G25480.1
|
DREB1A
|
dehydration response element B1A |
Chr3_+_16137576 | 0.67 |
AT3G44550.1
|
FAR5
|
fatty acid reductase 5 |
Chr1_-_37230 | 0.67 |
AT1G01060.8
|
LHY
|
Homeodomain-like superfamily protein |
Chr5_-_23301689 | 0.67 |
AT5G57530.1
|
XTH12
|
xyloglucan endotransglucosylase/hydrolase 12 |
Chr3_-_4739136 | 0.67 |
AT3G14230.1
AT3G14230.3 |
RAP2.2
|
related to AP2 2 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 6.1 | GO:0009413 | response to flooding(GO:0009413) |
0.9 | 5.3 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.6 | 2.5 | GO:0072351 | nicotianamine metabolic process(GO:0030417) nicotianamine biosynthetic process(GO:0030418) tricarboxylic acid biosynthetic process(GO:0072351) |
0.5 | 0.5 | GO:0031113 | regulation of microtubule polymerization(GO:0031113) |
0.5 | 1.9 | GO:0033499 | galactose catabolic process(GO:0019388) galactose catabolic process via UDP-galactose(GO:0033499) |
0.4 | 1.2 | GO:0019320 | hexose catabolic process(GO:0019320) |
0.4 | 1.2 | GO:1990882 | rRNA acetylation involved in maturation of SSU-rRNA(GO:1904812) rRNA acetylation(GO:1990882) RNA acetylation(GO:1990884) |
0.4 | 1.2 | GO:0019406 | hexitol metabolic process(GO:0006059) hexitol biosynthetic process(GO:0019406) mannitol biosynthetic process(GO:0019593) mannitol metabolic process(GO:0019594) |
0.4 | 1.8 | GO:0010201 | response to continuous far red light stimulus by the high-irradiance response system(GO:0010201) |
0.4 | 1.1 | GO:1902347 | response to strigolactone(GO:1902347) |
0.4 | 1.1 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.3 | 1.7 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) regulation of anion channel activity by blue light(GO:0010361) negative regulation of anion channel activity by blue light(GO:0010362) negative regulation of transporter activity(GO:0032410) negative regulation of ion transmembrane transporter activity(GO:0032413) negative regulation of transmembrane transport(GO:0034763) negative regulation of ion transmembrane transport(GO:0034766) negative regulation of anion transport(GO:1903792) negative regulation of anion transmembrane transport(GO:1903960) |
0.3 | 1.4 | GO:0046498 | S-adenosylmethionine cycle(GO:0033353) S-adenosylhomocysteine metabolic process(GO:0046498) |
0.3 | 1.0 | GO:0070922 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) small RNA loading onto RISC(GO:0070922) |
0.3 | 1.3 | GO:0001173 | DNA-templated transcriptional start site selection(GO:0001173) |
0.3 | 1.2 | GO:0071836 | nectar secretion(GO:0071836) |
0.3 | 0.3 | GO:0048656 | stamen formation(GO:0048455) anther wall tapetum formation(GO:0048656) anther wall tapetum cell differentiation(GO:0048657) |
0.3 | 0.9 | GO:0046898 | response to cycloheximide(GO:0046898) cellular response to external biotic stimulus(GO:0071217) |
0.3 | 0.9 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
0.3 | 0.9 | GO:0051341 | regulation of oxidoreductase activity(GO:0051341) |
0.3 | 0.8 | GO:0045857 | regulation of molecular function, epigenetic(GO:0040030) negative regulation of molecular function, epigenetic(GO:0045857) |
0.3 | 0.8 | GO:0031054 | pre-miRNA processing(GO:0031054) |
0.3 | 1.0 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.3 | 0.8 | GO:0090547 | response to low humidity(GO:0090547) |
0.3 | 1.0 | GO:1902326 | positive regulation of chlorophyll biosynthetic process(GO:1902326) |
0.3 | 1.0 | GO:0006023 | aminoglycan biosynthetic process(GO:0006023) glycosaminoglycan biosynthetic process(GO:0006024) UDP-glucuronate biosynthetic process(GO:0006065) glycosaminoglycan metabolic process(GO:0030203) |
0.3 | 1.3 | GO:0006809 | nitric oxide biosynthetic process(GO:0006809) |
0.2 | 0.7 | GO:1990116 | ribosome-associated ubiquitin-dependent protein catabolic process(GO:1990116) |
0.2 | 2.4 | GO:0010106 | cellular response to iron ion starvation(GO:0010106) |
0.2 | 1.5 | GO:0009800 | cinnamic acid biosynthetic process(GO:0009800) |
0.2 | 0.5 | GO:0002009 | establishment of planar polarity(GO:0001736) morphogenesis of a polarized epithelium(GO:0001738) morphogenesis of an epithelium(GO:0002009) tissue morphogenesis(GO:0048729) |
0.2 | 0.2 | GO:0051639 | actin filament network formation(GO:0051639) |
0.2 | 3.1 | GO:2000071 | regulation of defense response by callose deposition(GO:2000071) |
0.2 | 1.4 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.2 | 1.2 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.2 | 0.7 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) single-organism membrane invagination(GO:1902534) |
0.2 | 0.9 | GO:0042144 | regulation of vacuole fusion, non-autophagic(GO:0032889) vacuole fusion, non-autophagic(GO:0042144) |
0.2 | 0.9 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.2 | 0.6 | GO:0009747 | hexokinase-dependent signaling(GO:0009747) |
0.2 | 0.9 | GO:0033306 | phytol metabolic process(GO:0033306) |
0.2 | 0.4 | GO:1901031 | regulation of response to reactive oxygen species(GO:1901031) |
0.2 | 0.4 | GO:0072718 | response to cisplatin(GO:0072718) |
0.2 | 0.6 | GO:1900111 | positive regulation of histone H3-K9 dimethylation(GO:1900111) |
0.2 | 0.6 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.2 | 0.8 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.2 | 1.2 | GO:0010338 | leaf formation(GO:0010338) |
0.2 | 1.2 | GO:1900367 | positive regulation of defense response to insect(GO:1900367) |
0.2 | 0.6 | GO:0071461 | cellular response to redox state(GO:0071461) |
0.2 | 0.6 | GO:0060919 | auxin influx(GO:0060919) |
0.2 | 1.2 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
0.2 | 0.6 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.2 | 0.8 | GO:1905157 | positive regulation of photosynthesis(GO:1905157) |
0.2 | 0.2 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
0.2 | 1.1 | GO:0009303 | rRNA transcription(GO:0009303) |
0.2 | 0.6 | GO:0010246 | rhamnogalacturonan I biosynthetic process(GO:0010246) |
0.2 | 1.8 | GO:0010031 | circumnutation(GO:0010031) multicellular organismal movement(GO:0050879) |
0.2 | 0.5 | GO:0090213 | regulation of radial pattern formation(GO:0090213) |
0.2 | 0.7 | GO:0010480 | microsporocyte differentiation(GO:0010480) |
0.2 | 1.2 | GO:0010019 | chloroplast-nucleus signaling pathway(GO:0010019) |
0.2 | 1.0 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.2 | 1.0 | GO:0002230 | positive regulation of defense response to virus by host(GO:0002230) |
0.2 | 0.5 | GO:0043132 | NAD transport(GO:0043132) |
0.2 | 1.2 | GO:0009610 | response to symbiotic fungus(GO:0009610) |
0.2 | 0.7 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
0.2 | 0.7 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
0.2 | 0.3 | GO:0071158 | regulation of cell cycle arrest(GO:0071156) positive regulation of cell cycle arrest(GO:0071158) |
0.2 | 0.8 | GO:0080119 | ER body organization(GO:0080119) |
0.2 | 1.5 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.2 | 0.7 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.2 | 2.0 | GO:0010044 | response to aluminum ion(GO:0010044) |
0.2 | 0.3 | GO:0010343 | singlet oxygen-mediated programmed cell death(GO:0010343) |
0.2 | 0.5 | GO:2000082 | regulation of vitamin metabolic process(GO:0030656) regulation of L-ascorbic acid biosynthetic process(GO:2000082) |
0.2 | 1.5 | GO:0009942 | longitudinal axis specification(GO:0009942) |
0.2 | 0.7 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
0.2 | 0.5 | GO:0010233 | vascular transport(GO:0010232) phloem transport(GO:0010233) |
0.2 | 2.6 | GO:0010540 | basipetal auxin transport(GO:0010540) |
0.2 | 0.8 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.2 | 0.5 | GO:0009830 | cell wall modification involved in abscission(GO:0009830) cell wall disassembly(GO:0044277) |
0.2 | 0.3 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
0.2 | 0.8 | GO:0031929 | TOR signaling(GO:0031929) |
0.2 | 1.6 | GO:0045962 | positive regulation of development, heterochronic(GO:0045962) |
0.2 | 0.6 | GO:1902916 | regulation of protein polyubiquitination(GO:1902914) positive regulation of protein polyubiquitination(GO:1902916) |
0.2 | 1.4 | GO:0071490 | cellular response to far red light(GO:0071490) |
0.2 | 0.8 | GO:0010086 | embryonic root morphogenesis(GO:0010086) |
0.2 | 1.1 | GO:0048579 | negative regulation of long-day photoperiodism, flowering(GO:0048579) |
0.2 | 0.5 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.2 | 0.5 | GO:0009915 | phloem sucrose loading(GO:0009915) |
0.2 | 0.5 | GO:0002188 | translation reinitiation(GO:0002188) |
0.1 | 1.3 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
0.1 | 0.9 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
0.1 | 2.3 | GO:0010039 | response to iron ion(GO:0010039) |
0.1 | 0.9 | GO:0070982 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
0.1 | 0.4 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
0.1 | 1.3 | GO:0010188 | response to microbial phytotoxin(GO:0010188) |
0.1 | 0.4 | GO:1900364 | negative regulation of mRNA 3'-end processing(GO:0031441) negative regulation of mRNA processing(GO:0050686) negative regulation of mRNA polyadenylation(GO:1900364) negative regulation of mRNA metabolic process(GO:1903312) |
0.1 | 1.2 | GO:0009819 | drought recovery(GO:0009819) |
0.1 | 0.7 | GO:0042550 | photosystem I stabilization(GO:0042550) |
0.1 | 0.4 | GO:0019365 | pyridine nucleotide salvage(GO:0019365) |
0.1 | 0.6 | GO:0031538 | negative regulation of anthocyanin metabolic process(GO:0031538) |
0.1 | 0.9 | GO:0071398 | response to fatty acid(GO:0070542) cellular response to fatty acid(GO:0071398) |
0.1 | 0.7 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.1 | 0.7 | GO:0080121 | AMP transport(GO:0080121) |
0.1 | 0.7 | GO:0010148 | transpiration(GO:0010148) |
0.1 | 0.4 | GO:0048872 | tissue homeostasis(GO:0001894) homeostasis of number of meristem cells(GO:0007639) homeostasis of number of cells(GO:0048872) homeostasis of number of cells within a tissue(GO:0048873) |
0.1 | 0.6 | GO:1902315 | cell cycle DNA replication initiation(GO:1902292) nuclear cell cycle DNA replication initiation(GO:1902315) mitotic DNA replication initiation(GO:1902975) |
0.1 | 0.4 | GO:2000693 | positive regulation of seed maturation(GO:2000693) |
0.1 | 0.1 | GO:0032414 | positive regulation of transporter activity(GO:0032411) positive regulation of ion transmembrane transporter activity(GO:0032414) positive regulation of anion channel activity(GO:1901529) positive regulation of anion transport(GO:1903793) positive regulation of anion transmembrane transport(GO:1903961) |
0.1 | 0.3 | GO:0090322 | regulation of superoxide metabolic process(GO:0090322) |
0.1 | 0.4 | GO:0010433 | bract morphogenesis(GO:0010433) bract formation(GO:0010434) |
0.1 | 0.5 | GO:0045046 | protein import into peroxisome membrane(GO:0045046) |
0.1 | 0.8 | GO:1904961 | quiescent center organization(GO:1904961) |
0.1 | 1.5 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
0.1 | 0.3 | GO:0010395 | rhamnogalacturonan I metabolic process(GO:0010395) |
0.1 | 0.5 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA transport(GO:0051031) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
0.1 | 1.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.4 | GO:0007032 | endosome organization(GO:0007032) |
0.1 | 0.7 | GO:0051091 | positive regulation of sequence-specific DNA binding transcription factor activity(GO:0051091) |
0.1 | 0.7 | GO:0043489 | RNA stabilization(GO:0043489) |
0.1 | 2.5 | GO:0031425 | chloroplast RNA processing(GO:0031425) |
0.1 | 0.4 | GO:0090058 | metaxylem development(GO:0090058) |
0.1 | 0.4 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.1 | 0.4 | GO:1900386 | positive regulation of flavonol biosynthetic process(GO:1900386) |
0.1 | 1.7 | GO:0009638 | phototropism(GO:0009638) |
0.1 | 0.4 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.1 | 3.2 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.1 | 2.4 | GO:0000373 | Group II intron splicing(GO:0000373) |
0.1 | 0.3 | GO:0045764 | positive regulation of cellular amine metabolic process(GO:0033240) positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.1 | 0.1 | GO:1900369 | negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by RNA(GO:0060967) negative regulation of RNA interference(GO:1900369) |
0.1 | 0.6 | GO:0010236 | plastoquinone biosynthetic process(GO:0010236) |
0.1 | 0.9 | GO:0007187 | G-protein coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger(GO:0007187) adenylate cyclase-modulating G-protein coupled receptor signaling pathway(GO:0007188) |
0.1 | 0.2 | GO:0090239 | regulation of histone H4 acetylation(GO:0090239) |
0.1 | 3.9 | GO:0010143 | cutin biosynthetic process(GO:0010143) |
0.1 | 0.4 | GO:0090143 | nucleoid organization(GO:0090143) |
0.1 | 0.2 | GO:0090207 | regulation of triglyceride metabolic process(GO:0090207) |
0.1 | 0.7 | GO:0043100 | pyrimidine nucleobase salvage(GO:0043100) |
0.1 | 0.5 | GO:0031000 | response to caffeine(GO:0031000) response to alkaloid(GO:0043279) |
0.1 | 0.2 | GO:0009616 | virus induced gene silencing(GO:0009616) modulation by symbiont of RNA levels in host(GO:0052018) modulation of RNA levels in other organism involved in symbiotic interaction(GO:0052249) |
0.1 | 0.5 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.1 | 0.7 | GO:1900458 | negative regulation of brassinosteroid mediated signaling pathway(GO:1900458) |
0.1 | 0.7 | GO:1901141 | regulation of lignin biosynthetic process(GO:1901141) |
0.1 | 0.5 | GO:0006063 | uronic acid metabolic process(GO:0006063) galacturonate metabolic process(GO:0019586) |
0.1 | 0.6 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 0.6 | GO:1990641 | response to iron ion starvation(GO:1990641) |
0.1 | 0.4 | GO:0015786 | GDP-fucose transport(GO:0015783) UDP-glucose transport(GO:0015786) |
0.1 | 0.1 | GO:0098586 | cellular response to virus(GO:0098586) |
0.1 | 0.6 | GO:0046713 | borate transport(GO:0046713) |
0.1 | 0.2 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.1 | 0.6 | GO:0007041 | lysosomal transport(GO:0007041) endosome to lysosome transport(GO:0008333) |
0.1 | 1.5 | GO:0010100 | negative regulation of photomorphogenesis(GO:0010100) |
0.1 | 0.7 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.1 | 0.5 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
0.1 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.1 | 0.8 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.7 | GO:0071588 | hydrogen peroxide mediated signaling pathway(GO:0071588) |
0.1 | 1.7 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.7 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.1 | 1.0 | GO:0016123 | xanthophyll biosynthetic process(GO:0016123) |
0.1 | 0.7 | GO:0048578 | positive regulation of long-day photoperiodism, flowering(GO:0048578) |
0.1 | 0.4 | GO:0048205 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
0.1 | 0.8 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.1 | 1.1 | GO:1901259 | chloroplast rRNA processing(GO:1901259) |
0.1 | 0.2 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.1 | 0.4 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.1 | 0.4 | GO:0051455 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) attachment of spindle microtubules to kinetochore involved in homologous chromosome segregation(GO:0051455) microtubule cytoskeleton organization involved in homologous chromosome segregation(GO:0090172) |
0.1 | 0.2 | GO:2001009 | regulation of cell wall macromolecule metabolic process(GO:0010981) regulation of plant-type cell wall cellulose biosynthetic process(GO:2001009) |
0.1 | 0.3 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.4 | GO:0097438 | release of seed from dormancy(GO:0048838) exit from dormancy(GO:0097438) |
0.1 | 2.1 | GO:0006074 | (1->3)-beta-D-glucan metabolic process(GO:0006074) (1->3)-beta-D-glucan biosynthetic process(GO:0006075) |
0.1 | 1.0 | GO:0031221 | arabinan metabolic process(GO:0031221) |
0.1 | 0.4 | GO:0016598 | protein arginylation(GO:0016598) |
0.1 | 2.3 | GO:0052546 | cell wall pectin metabolic process(GO:0052546) |
0.1 | 0.5 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.1 | GO:1900109 | histone H3-K9 dimethylation(GO:0036123) regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.4 | GO:0080117 | secondary growth(GO:0080117) |
0.1 | 0.6 | GO:0010189 | vitamin E biosynthetic process(GO:0010189) vitamin E metabolic process(GO:0042360) |
0.1 | 1.0 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
0.1 | 0.4 | GO:1900056 | negative regulation of leaf senescence(GO:1900056) |
0.1 | 0.3 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.1 | 0.1 | GO:0055122 | response to very low light intensity stimulus(GO:0055122) |
0.1 | 0.6 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.5 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.1 | 0.3 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.1 | 0.8 | GO:0010315 | auxin efflux(GO:0010315) |
0.1 | 0.6 | GO:1900036 | positive regulation of cellular response to heat(GO:1900036) |
0.1 | 0.9 | GO:0009920 | cell plate formation involved in plant-type cell wall biogenesis(GO:0009920) |
0.1 | 1.1 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.1 | 0.2 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.1 | 1.0 | GO:0010088 | phloem development(GO:0010088) |
0.1 | 0.3 | GO:0010288 | response to lead ion(GO:0010288) |
0.1 | 5.4 | GO:0009631 | cold acclimation(GO:0009631) |
0.1 | 1.9 | GO:0080156 | mitochondrial mRNA modification(GO:0080156) |
0.1 | 1.2 | GO:0060321 | acceptance of pollen(GO:0060321) |
0.1 | 0.9 | GO:0032388 | positive regulation of intracellular transport(GO:0032388) |
0.1 | 0.8 | GO:0015804 | neutral amino acid transport(GO:0015804) |
0.1 | 1.2 | GO:0010497 | plasmodesmata-mediated intercellular transport(GO:0010497) |
0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 1.4 | GO:0048497 | maintenance of organ identity(GO:0048496) maintenance of floral organ identity(GO:0048497) |
0.1 | 1.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 1.4 | GO:0010030 | positive regulation of seed germination(GO:0010030) |
0.1 | 0.5 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.1 | 0.3 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
0.1 | 2.8 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 2.6 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.1 | 0.4 | GO:0010336 | gibberellic acid homeostasis(GO:0010336) |
0.1 | 0.6 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.1 | 0.4 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.1 | 1.3 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
0.1 | 2.3 | GO:0010252 | auxin homeostasis(GO:0010252) |
0.1 | 0.4 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) regulation of methylation-dependent chromatin silencing(GO:0090308) positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.1 | 0.4 | GO:0022615 | protein import into peroxisome matrix, docking(GO:0016560) protein to membrane docking(GO:0022615) |
0.1 | 0.3 | GO:0090392 | sepal giant cell differentiation(GO:0090392) |
0.1 | 0.7 | GO:0080183 | response to photooxidative stress(GO:0080183) |
0.1 | 0.3 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.1 | 0.3 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
0.1 | 0.3 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
0.1 | 1.2 | GO:0019375 | galactolipid biosynthetic process(GO:0019375) |
0.1 | 1.0 | GO:0000959 | mitochondrial RNA metabolic process(GO:0000959) |
0.1 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
0.1 | 0.8 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.1 | 1.5 | GO:0010286 | heat acclimation(GO:0010286) |
0.1 | 0.5 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
0.1 | 0.5 | GO:0009650 | UV protection(GO:0009650) |
0.1 | 0.3 | GO:0010070 | zygote asymmetric cell division(GO:0010070) |
0.1 | 0.7 | GO:0010065 | primary meristem tissue development(GO:0010065) |
0.1 | 0.3 | GO:1904580 | regulation of intracellular mRNA localization(GO:1904580) |
0.1 | 0.2 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.1 | 3.6 | GO:0006413 | translational initiation(GO:0006413) |
0.1 | 0.1 | GO:1903335 | regulation of vacuolar transport(GO:1903335) |
0.1 | 0.2 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.1 | 0.3 | GO:0019740 | nitrogen utilization(GO:0019740) |
0.1 | 0.5 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.1 | 1.0 | GO:0060261 | regulation of transcription initiation from RNA polymerase II promoter(GO:0060260) positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.1 | 0.3 | GO:0010380 | regulation of chlorophyll biosynthetic process(GO:0010380) |
0.1 | 0.2 | GO:0048577 | negative regulation of short-day photoperiodism, flowering(GO:0048577) |
0.1 | 3.1 | GO:0072665 | protein targeting to vacuole(GO:0006623) protein localization to vacuole(GO:0072665) establishment of protein localization to vacuole(GO:0072666) |
0.1 | 0.3 | GO:0050993 | dimethylallyl diphosphate biosynthetic process(GO:0050992) dimethylallyl diphosphate metabolic process(GO:0050993) |
0.1 | 0.5 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
0.1 | 0.2 | GO:0006425 | glutamyl-tRNA aminoacylation(GO:0006424) glutaminyl-tRNA aminoacylation(GO:0006425) |
0.1 | 0.7 | GO:0018107 | peptidyl-threonine phosphorylation(GO:0018107) peptidyl-threonine modification(GO:0018210) |
0.1 | 0.7 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
0.1 | 0.5 | GO:0019632 | shikimate metabolic process(GO:0019632) |
0.1 | 1.0 | GO:0030104 | water homeostasis(GO:0030104) |
0.1 | 0.6 | GO:0010190 | cytochrome b6f complex assembly(GO:0010190) |
0.1 | 0.5 | GO:0006565 | L-serine catabolic process(GO:0006565) glycine biosynthetic process from serine(GO:0019264) response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
0.1 | 0.2 | GO:0080040 | positive regulation of cellular response to phosphate starvation(GO:0080040) |
0.1 | 1.7 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.2 | GO:0048832 | specification of organ number(GO:0048832) specification of floral organ number(GO:0048833) |
0.1 | 0.5 | GO:0051646 | mitochondrion localization(GO:0051646) |
0.1 | 1.1 | GO:0009098 | leucine biosynthetic process(GO:0009098) |
0.1 | 3.3 | GO:0072596 | protein targeting to chloroplast(GO:0045036) establishment of protein localization to chloroplast(GO:0072596) |
0.1 | 1.9 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.1 | 0.4 | GO:0034308 | primary alcohol metabolic process(GO:0034308) |
0.1 | 0.3 | GO:0010271 | regulation of chlorophyll catabolic process(GO:0010271) regulation of tetrapyrrole catabolic process(GO:1901404) |
0.1 | 0.2 | GO:0034969 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) histone arginine methylation(GO:0034969) peptidyl-arginine N-methylation(GO:0035246) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.1 | 0.7 | GO:0009088 | threonine biosynthetic process(GO:0009088) |
0.1 | 0.4 | GO:0034051 | negative regulation of plant-type hypersensitive response(GO:0034051) |
0.1 | 0.3 | GO:0080168 | abscisic acid transport(GO:0080168) |
0.1 | 0.3 | GO:1901562 | response to paraquat(GO:1901562) |
0.1 | 0.2 | GO:0010599 | production of lsiRNA involved in RNA interference(GO:0010599) |
0.1 | 0.2 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.1 | 0.2 | GO:0010113 | negative regulation of systemic acquired resistance(GO:0010113) |
0.1 | 0.2 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) rRNA (guanine-N7)-methylation(GO:0070476) |
0.1 | 3.4 | GO:0006897 | endocytosis(GO:0006897) |
0.1 | 0.7 | GO:0080036 | regulation of cytokinin-activated signaling pathway(GO:0080036) |
0.1 | 0.5 | GO:0007097 | nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) nucleus localization(GO:0051647) |
0.1 | 0.6 | GO:0033319 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
0.1 | 0.2 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.1 | 1.7 | GO:0046834 | lipid phosphorylation(GO:0046834) phosphatidylinositol phosphorylation(GO:0046854) |
0.1 | 2.5 | GO:0042255 | ribosome assembly(GO:0042255) |
0.1 | 0.6 | GO:0007292 | female gamete generation(GO:0007292) |
0.1 | 0.5 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.1 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.2 | GO:0006212 | uracil catabolic process(GO:0006212) beta-alanine biosynthetic process(GO:0019483) uracil metabolic process(GO:0019860) |
0.1 | 2.6 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.1 | 0.4 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 1.3 | GO:0045338 | farnesyl diphosphate metabolic process(GO:0045338) |
0.1 | 0.2 | GO:0080051 | cutin transport(GO:0080051) |
0.1 | 0.3 | GO:0051211 | anisotropic cell growth(GO:0051211) |
0.1 | 1.7 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.1 | 0.7 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 0.7 | GO:0045040 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.3 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.1 | GO:0009635 | response to herbicide(GO:0009635) |
0.1 | 0.2 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.4 | GO:0055075 | potassium ion homeostasis(GO:0055075) |
0.1 | 0.2 | GO:0071266 | L-methionine biosynthetic process from L-homoserine via cystathionine(GO:0019279) 'de novo' L-methionine biosynthetic process(GO:0071266) |
0.1 | 0.3 | GO:0045763 | negative regulation of ethylene biosynthetic process(GO:0010366) negative regulation of sulfur amino acid metabolic process(GO:0031336) negative regulation of cellular amine metabolic process(GO:0033239) negative regulation of cellular amino acid metabolic process(GO:0045763) negative regulation of sulfur metabolic process(GO:0051175) negative regulation of olefin metabolic process(GO:1900909) negative regulation of olefin biosynthetic process(GO:1900912) |
0.1 | 1.4 | GO:0010345 | suberin biosynthetic process(GO:0010345) |
0.1 | 0.6 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.1 | 0.2 | GO:0009590 | detection of gravity(GO:0009590) amyloplast organization(GO:0009660) |
0.1 | 0.2 | GO:0048587 | regulation of short-day photoperiodism, flowering(GO:0048587) |
0.1 | 0.9 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.1 | 1.9 | GO:0042026 | protein refolding(GO:0042026) |
0.1 | 0.2 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.6 | GO:0033753 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
0.1 | 0.4 | GO:0016444 | somatic cell DNA recombination(GO:0016444) |
0.1 | 0.2 | GO:0010045 | response to nickel cation(GO:0010045) |
0.1 | 1.6 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.1 | 0.2 | GO:1901703 | protein localization involved in auxin polar transport(GO:1901703) |
0.1 | 0.3 | GO:0080009 | mRNA methylation(GO:0080009) |
0.1 | 0.3 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 0.2 | GO:0019474 | lysine catabolic process(GO:0006554) L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) L-lysine metabolic process(GO:0046440) |
0.1 | 0.1 | GO:0006273 | lagging strand elongation(GO:0006273) |
0.1 | 0.9 | GO:0009641 | shade avoidance(GO:0009641) |
0.1 | 0.7 | GO:0048015 | phosphatidylinositol-mediated signaling(GO:0048015) |
0.1 | 1.0 | GO:0005983 | starch catabolic process(GO:0005983) |
0.1 | 0.3 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.1 | 0.2 | GO:0032950 | regulation of beta-glucan metabolic process(GO:0032950) regulation of beta-glucan biosynthetic process(GO:0032951) regulation of cellulose biosynthetic process(GO:2001006) |
0.1 | 0.6 | GO:0010050 | vegetative phase change(GO:0010050) |
0.1 | 3.4 | GO:0015994 | chlorophyll metabolic process(GO:0015994) |
0.1 | 0.2 | GO:0033206 | male meiosis cytokinesis(GO:0007112) meiotic cytokinesis(GO:0033206) |
0.1 | 0.4 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.1 | 0.8 | GO:1902074 | response to salt(GO:1902074) |
0.1 | 0.2 | GO:0009305 | protein biotinylation(GO:0009305) |
0.1 | 0.3 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 0.2 | GO:0071480 | cellular response to gamma radiation(GO:0071480) cellular response to X-ray(GO:0071481) |
0.1 | 0.2 | GO:0033260 | nuclear DNA replication(GO:0033260) |
0.1 | 0.3 | GO:0015837 | amine transport(GO:0015837) regulation of organic acid transport(GO:0032890) regulation of amine transport(GO:0051952) regulation of amino acid transport(GO:0051955) regulation of amino acid export(GO:0080143) |
0.1 | 0.4 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
0.1 | 4.1 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.1 | 0.7 | GO:0005978 | glycogen biosynthetic process(GO:0005978) |
0.1 | 0.4 | GO:0042350 | GDP-L-fucose biosynthetic process(GO:0042350) GDP-L-fucose metabolic process(GO:0046368) |
0.1 | 0.9 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.1 | 0.2 | GO:1901600 | lactone metabolic process(GO:1901334) lactone biosynthetic process(GO:1901336) strigolactone metabolic process(GO:1901600) strigolactone biosynthetic process(GO:1901601) |
0.1 | 0.2 | GO:0019377 | glycosylceramide metabolic process(GO:0006677) glucosylceramide metabolic process(GO:0006678) glucosylceramide catabolic process(GO:0006680) glycosphingolipid metabolic process(GO:0006687) glycolipid catabolic process(GO:0019377) glycosylceramide catabolic process(GO:0046477) glycosphingolipid catabolic process(GO:0046479) ceramide catabolic process(GO:0046514) |
0.1 | 1.7 | GO:0006606 | protein import into nucleus(GO:0006606) protein targeting to nucleus(GO:0044744) |
0.1 | 0.1 | GO:0006825 | copper ion transport(GO:0006825) |
0.1 | 0.2 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.1 | 0.5 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.1 | 0.4 | GO:0072663 | protein targeting to peroxisome(GO:0006625) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.1 | 1.6 | GO:0010268 | brassinosteroid homeostasis(GO:0010268) |
0.1 | 0.2 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
0.1 | 4.2 | GO:0018209 | peptidyl-serine phosphorylation(GO:0018105) peptidyl-serine modification(GO:0018209) |
0.1 | 5.1 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.1 | 0.5 | GO:1902408 | preprophase band assembly(GO:0000913) cytokinesis, site selection(GO:0007105) mitotic cytokinesis, site selection(GO:1902408) |
0.1 | 0.1 | GO:0009558 | embryo sac cellularization(GO:0009558) |
0.1 | 0.4 | GO:0016925 | protein sumoylation(GO:0016925) |
0.1 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 5.0 | GO:0007623 | circadian rhythm(GO:0007623) rhythmic process(GO:0048511) |
0.1 | 0.6 | GO:0010205 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) |
0.1 | 0.8 | GO:0006188 | IMP biosynthetic process(GO:0006188) |
0.1 | 0.3 | GO:0010390 | histone monoubiquitination(GO:0010390) |
0.1 | 0.8 | GO:0009269 | response to desiccation(GO:0009269) |
0.1 | 0.7 | GO:0010274 | hydrotropism(GO:0010274) |
0.1 | 0.4 | GO:0060866 | leaf abscission(GO:0060866) |
0.1 | 0.3 | GO:0046482 | para-aminobenzoic acid metabolic process(GO:0046482) |
0.1 | 0.3 | GO:0051014 | actin filament severing(GO:0051014) |
0.1 | 0.2 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 0.1 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
0.1 | 0.1 | GO:1901002 | positive regulation of response to salt stress(GO:1901002) |
0.1 | 0.6 | GO:1901371 | regulation of leaf morphogenesis(GO:1901371) |
0.1 | 0.5 | GO:1904030 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.1 | 0.9 | GO:0009306 | protein secretion(GO:0009306) |
0.1 | 0.2 | GO:0046156 | siroheme biosynthetic process(GO:0019354) siroheme metabolic process(GO:0046156) |
0.1 | 0.7 | GO:2000034 | regulation of seed maturation(GO:2000034) |
0.1 | 0.4 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
0.0 | 0.5 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.0 | 0.1 | GO:0080148 | negative regulation of response to water deprivation(GO:0080148) |
0.0 | 0.4 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.0 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.1 | GO:0010235 | guard mother cell cytokinesis(GO:0010235) |
0.0 | 0.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.0 | 0.5 | GO:0000422 | mitophagy(GO:0000422) mitochondrion disassembly(GO:0061726) |
0.0 | 0.8 | GO:0097031 | mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.3 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.8 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 2.1 | GO:1901420 | negative regulation of abscisic acid-activated signaling pathway(GO:0009788) negative regulation of response to alcohol(GO:1901420) |
0.0 | 0.7 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.9 | GO:0035195 | gene silencing by miRNA(GO:0035195) |
0.0 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.2 | GO:1902457 | negative regulation of stomatal opening(GO:1902457) |
0.0 | 1.1 | GO:0046939 | nucleotide phosphorylation(GO:0046939) |
0.0 | 0.4 | GO:0045851 | pH reduction(GO:0045851) |
0.0 | 0.6 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.2 | GO:0044843 | G1/S transition of mitotic cell cycle(GO:0000082) cell cycle G1/S phase transition(GO:0044843) |
0.0 | 15.6 | GO:0006412 | translation(GO:0006412) |
0.0 | 0.2 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.0 | 0.1 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) phragmoplast assembly(GO:0000914) assembly of actomyosin apparatus involved in mitotic cytokinesis(GO:1902407) |
0.0 | 0.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.5 | GO:0006826 | iron ion transport(GO:0006826) |
0.0 | 0.3 | GO:1902222 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.0 | 0.3 | GO:0046051 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
0.0 | 0.4 | GO:2000896 | amylopectin biosynthetic process(GO:0010021) amylopectin metabolic process(GO:2000896) |
0.0 | 1.3 | GO:0016575 | histone deacetylation(GO:0016575) |
0.0 | 0.1 | GO:0017196 | N-terminal protein amino acid acetylation(GO:0006474) N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.6 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.3 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.2 | GO:1901006 | ubiquinone-6 metabolic process(GO:1901004) ubiquinone-6 biosynthetic process(GO:1901006) |
0.0 | 0.1 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
0.0 | 0.9 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.1 | GO:0018196 | peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
0.0 | 0.2 | GO:0010364 | regulation of ethylene biosynthetic process(GO:0010364) regulation of sulfur amino acid metabolic process(GO:0031335) regulation of olefin metabolic process(GO:1900908) regulation of olefin biosynthetic process(GO:1900911) |
0.0 | 0.5 | GO:0009231 | riboflavin metabolic process(GO:0006771) riboflavin biosynthetic process(GO:0009231) |
0.0 | 3.1 | GO:0080147 | root hair cell development(GO:0080147) |
0.0 | 0.1 | GO:0002119 | nematode larval development(GO:0002119) larval development(GO:0002164) regulation of nematode larval development(GO:0061062) |
0.0 | 0.1 | GO:0071731 | response to nitric oxide(GO:0071731) |
0.0 | 0.2 | GO:0007142 | male meiosis II(GO:0007142) |
0.0 | 0.2 | GO:0048317 | seed morphogenesis(GO:0048317) |
0.0 | 1.2 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.1 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.1 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.0 | 0.1 | GO:2000014 | regulation of endosperm development(GO:2000014) |
0.0 | 0.2 | GO:0015669 | gas transport(GO:0015669) |
0.0 | 0.1 | GO:0043693 | monoterpene biosynthetic process(GO:0043693) |
0.0 | 0.4 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.1 | GO:0016120 | carotene biosynthetic process(GO:0016120) |
0.0 | 0.1 | GO:0009855 | determination of bilateral symmetry(GO:0009855) |
0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.0 | GO:0048358 | mucilage pectin biosynthetic process(GO:0048358) |
0.0 | 0.1 | GO:0048863 | stem cell differentiation(GO:0048863) |
0.0 | 1.5 | GO:0006006 | glucose metabolic process(GO:0006006) |
0.0 | 0.6 | GO:0034030 | coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
0.0 | 0.4 | GO:1902183 | regulation of shoot apical meristem development(GO:1902183) |
0.0 | 0.6 | GO:0006090 | pyruvate metabolic process(GO:0006090) |
0.0 | 0.5 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.0 | 1.2 | GO:0006401 | RNA catabolic process(GO:0006401) |
0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.1 | GO:2001022 | positive regulation of DNA repair(GO:0045739) positive regulation of response to DNA damage stimulus(GO:2001022) |
0.0 | 0.8 | GO:0015986 | ATP biosynthetic process(GO:0006754) energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.1 | GO:0048530 | fruit morphogenesis(GO:0048530) |
0.0 | 0.3 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.0 | 0.2 | GO:0051513 | monopolar cell growth(GO:0042814) regulation of monopolar cell growth(GO:0051513) |
0.0 | 0.2 | GO:0010098 | suspensor development(GO:0010098) |
0.0 | 0.1 | GO:0048209 | vesicle targeting(GO:0006903) regulation of vesicle targeting, to, from or within Golgi(GO:0048209) |
0.0 | 0.3 | GO:0042593 | glucose homeostasis(GO:0042593) cellular response to glucose stimulus(GO:0071333) |
0.0 | 1.2 | GO:0006354 | DNA-templated transcription, elongation(GO:0006354) |
0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.3 | GO:0043650 | dicarboxylic acid biosynthetic process(GO:0043650) |
0.0 | 0.1 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
0.0 | 0.1 | GO:0000719 | photoreactive repair(GO:0000719) |
0.0 | 3.3 | GO:0006457 | protein folding(GO:0006457) |
0.0 | 0.8 | GO:0009395 | phospholipid catabolic process(GO:0009395) |
0.0 | 0.9 | GO:0030641 | regulation of cellular pH(GO:0030641) regulation of intracellular pH(GO:0051453) |
0.0 | 0.2 | GO:0000919 | cell plate assembly(GO:0000919) |
0.0 | 0.5 | GO:0009773 | photosynthetic electron transport in photosystem I(GO:0009773) |
0.0 | 0.4 | GO:0022611 | seed dormancy process(GO:0010162) dormancy process(GO:0022611) |
0.0 | 0.1 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.3 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.0 | 0.6 | GO:2000031 | regulation of salicylic acid mediated signaling pathway(GO:2000031) |
0.0 | 0.2 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.3 | GO:0010206 | photosystem II repair(GO:0010206) |
0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.6 | GO:0090630 | activation of GTPase activity(GO:0090630) |
0.0 | 1.0 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
0.0 | 0.5 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) |
0.0 | 0.5 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 2.1 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:0006734 | NADH metabolic process(GO:0006734) |
0.0 | 0.6 | GO:0051260 | protein homooligomerization(GO:0051260) |
0.0 | 0.3 | GO:0034311 | sphingosine metabolic process(GO:0006670) diol metabolic process(GO:0034311) diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.0 | 0.3 | GO:0016117 | tetraterpenoid biosynthetic process(GO:0016109) carotenoid biosynthetic process(GO:0016117) |
0.0 | 0.5 | GO:0071472 | cellular response to salt stress(GO:0071472) |
0.0 | 0.3 | GO:0042631 | cellular response to water deprivation(GO:0042631) cellular response to water stimulus(GO:0071462) |
0.0 | 0.7 | GO:0010043 | response to zinc ion(GO:0010043) |
0.0 | 0.5 | GO:0009959 | negative gravitropism(GO:0009959) |
0.0 | 1.2 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.2 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.2 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
0.0 | 0.1 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.0 | 0.3 | GO:1900150 | regulation of defense response to fungus(GO:1900150) |
0.0 | 0.1 | GO:0009099 | valine biosynthetic process(GO:0009099) |
0.0 | 0.1 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
0.0 | 0.1 | GO:0051098 | regulation of binding(GO:0051098) |
0.0 | 0.5 | GO:0009612 | response to mechanical stimulus(GO:0009612) |
0.0 | 0.3 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
0.0 | 1.0 | GO:0048825 | cotyledon development(GO:0048825) |
0.0 | 0.1 | GO:0030974 | thiamine pyrophosphate transport(GO:0030974) vitamin transmembrane transport(GO:0035461) azole transport(GO:0045117) |
0.0 | 0.2 | GO:0033619 | membrane protein proteolysis(GO:0033619) |
0.0 | 0.2 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:0019685 | photosynthesis, dark reaction(GO:0019685) |
0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) positive regulation of gene expression, epigenetic(GO:0045815) |
0.0 | 0.4 | GO:0010207 | photosystem II assembly(GO:0010207) |
0.0 | 0.1 | GO:0048281 | inflorescence morphogenesis(GO:0048281) |
0.0 | 0.5 | GO:0008356 | asymmetric cell division(GO:0008356) |
0.0 | 1.4 | GO:0042176 | regulation of protein catabolic process(GO:0042176) |
0.0 | 0.2 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.1 | GO:0005977 | glycogen metabolic process(GO:0005977) energy reserve metabolic process(GO:0006112) |
0.0 | 0.1 | GO:0016121 | carotene catabolic process(GO:0016121) terpene catabolic process(GO:0046247) |
0.0 | 0.1 | GO:0048363 | mucilage pectin metabolic process(GO:0048363) |
0.0 | 1.0 | GO:0006338 | chromatin remodeling(GO:0006338) |
0.0 | 0.2 | GO:0048359 | mucilage metabolic process involved in seed coat development(GO:0048359) |
0.0 | 0.1 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
0.0 | 0.3 | GO:0042793 | transcription from plastid promoter(GO:0042793) |
0.0 | 0.1 | GO:0050667 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) homocysteine metabolic process(GO:0050667) |
0.0 | 0.0 | GO:0043605 | cellular amide catabolic process(GO:0043605) |
0.0 | 0.4 | GO:0090305 | nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
0.0 | 0.1 | GO:1903310 | positive regulation of chromatin modification(GO:1903310) |
0.0 | 0.1 | GO:0080120 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
0.0 | 0.1 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.0 | 0.2 | GO:0030522 | blue light signaling pathway(GO:0009785) intracellular receptor signaling pathway(GO:0030522) |
0.0 | 0.0 | GO:0015867 | ADP transport(GO:0015866) ATP transport(GO:0015867) |
0.0 | 0.2 | GO:0050665 | hydrogen peroxide biosynthetic process(GO:0050665) |
0.0 | 0.1 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.0 | 0.2 | GO:0042762 | regulation of sulfur metabolic process(GO:0042762) |
0.0 | 0.4 | GO:1900424 | regulation of defense response to bacterium(GO:1900424) |
0.0 | 0.1 | GO:2000067 | regulation of root morphogenesis(GO:2000067) |
0.0 | 0.2 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.2 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.7 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
0.0 | 0.2 | GO:0019344 | cysteine biosynthetic process from serine(GO:0006535) cysteine biosynthetic process(GO:0019344) |
0.0 | 2.6 | GO:0006470 | protein dephosphorylation(GO:0006470) |
0.0 | 0.1 | GO:0006531 | aspartate metabolic process(GO:0006531) |
0.0 | 0.0 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
0.0 | 0.3 | GO:0045493 | xylan catabolic process(GO:0045493) |
0.0 | 0.3 | GO:0009958 | positive gravitropism(GO:0009958) |
0.0 | 0.2 | GO:0048759 | xylem vessel member cell differentiation(GO:0048759) |
0.0 | 0.1 | GO:2000582 | positive regulation of ATPase activity(GO:0032781) regulation of microtubule motor activity(GO:2000574) positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.0 | 0.1 | GO:0072337 | modified amino acid transport(GO:0072337) |
0.0 | 0.3 | GO:0009960 | endosperm development(GO:0009960) |
0.0 | 0.7 | GO:0009828 | plant-type cell wall loosening(GO:0009828) |
0.0 | 2.8 | GO:0016071 | mRNA metabolic process(GO:0016071) |
0.0 | 2.1 | GO:0009451 | RNA modification(GO:0009451) |
0.0 | 0.1 | GO:0018904 | glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
0.0 | 0.6 | GO:0090487 | toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
0.0 | 0.3 | GO:2000652 | regulation of secondary cell wall biogenesis(GO:2000652) |
0.0 | 0.1 | GO:0052324 | plant-type cell wall cellulose biosynthetic process(GO:0052324) |
0.0 | 0.2 | GO:0010072 | primary shoot apical meristem specification(GO:0010072) |
0.0 | 0.0 | GO:0030307 | positive regulation of cell growth(GO:0030307) |
0.0 | 0.5 | GO:0070592 | cell wall polysaccharide biosynthetic process(GO:0070592) |
0.0 | 0.3 | GO:0009910 | negative regulation of flower development(GO:0009910) |
0.0 | 0.1 | GO:0045332 | lipid translocation(GO:0034204) phospholipid translocation(GO:0045332) |
0.0 | 0.0 | GO:0006666 | 3-keto-sphinganine metabolic process(GO:0006666) |
0.0 | 0.1 | GO:0048442 | sepal development(GO:0048442) flower calyx development(GO:0048464) |
0.0 | 0.1 | GO:0031365 | N-terminal protein amino acid modification(GO:0031365) |
0.0 | 0.1 | GO:0051127 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) regulation of actin nucleation(GO:0051125) positive regulation of actin nucleation(GO:0051127) positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.5 | GO:0000209 | protein polyubiquitination(GO:0000209) |
0.0 | 0.2 | GO:0009630 | gravitropism(GO:0009630) |
0.0 | 0.1 | GO:0032456 | endocytic recycling(GO:0032456) |
0.0 | 0.6 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
0.0 | 0.3 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.0 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.0 | 0.0 | GO:0031110 | regulation of microtubule polymerization or depolymerization(GO:0031110) |
0.0 | 0.7 | GO:0009741 | response to brassinosteroid(GO:0009741) |
0.0 | 0.6 | GO:0048544 | recognition of pollen(GO:0048544) |
0.0 | 0.4 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 0.1 | GO:0043547 | positive regulation of GTPase activity(GO:0043547) |
0.0 | 0.1 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
0.0 | 0.0 | GO:0006517 | protein deglycosylation(GO:0006517) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.1 | GO:0030689 | Noc complex(GO:0030689) |
0.4 | 1.8 | GO:0010007 | magnesium chelatase complex(GO:0010007) |
0.3 | 1.0 | GO:0043235 | receptor complex(GO:0043235) |
0.3 | 1.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.3 | 0.8 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.2 | 0.7 | GO:1990112 | RQC complex(GO:1990112) |
0.2 | 0.9 | GO:0043614 | multi-eIF complex(GO:0043614) |
0.2 | 0.4 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.2 | 2.0 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.2 | 0.6 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.2 | 0.4 | GO:0031351 | intrinsic component of plastid membrane(GO:0031350) integral component of plastid membrane(GO:0031351) |
0.2 | 1.0 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.2 | 1.8 | GO:0031519 | PcG protein complex(GO:0031519) |
0.2 | 1.1 | GO:0031372 | ubiquitin conjugating enzyme complex(GO:0031371) UBC13-MMS2 complex(GO:0031372) |
0.2 | 2.0 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 1.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.2 | 0.9 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.2 | 1.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 1.7 | GO:0005763 | mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 1.3 | GO:0010445 | nuclear dicing body(GO:0010445) |
0.1 | 0.6 | GO:0010330 | cellulose synthase complex(GO:0010330) |
0.1 | 0.6 | GO:0030897 | HOPS complex(GO:0030897) |
0.1 | 0.7 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 0.5 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.9 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.4 | GO:0009925 | basal plasma membrane(GO:0009925) basolateral plasma membrane(GO:0016323) basal part of cell(GO:0045178) |
0.1 | 0.5 | GO:0031353 | intrinsic component of plastid inner membrane(GO:0031352) integral component of plastid inner membrane(GO:0031353) intrinsic component of chloroplast inner membrane(GO:0031356) integral component of chloroplast inner membrane(GO:0031357) |
0.1 | 7.5 | GO:0009707 | chloroplast outer membrane(GO:0009707) |
0.1 | 0.9 | GO:0016363 | nuclear matrix(GO:0016363) |
0.1 | 1.3 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 1.1 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.1 | 0.5 | GO:0010316 | pyrophosphate-dependent phosphofructokinase complex(GO:0010316) |
0.1 | 0.6 | GO:0033597 | mitotic checkpoint complex(GO:0033597) |
0.1 | 0.8 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 0.9 | GO:0035861 | site of double-strand break(GO:0035861) |
0.1 | 0.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 0.3 | GO:0031897 | Tic complex(GO:0031897) |
0.1 | 2.1 | GO:0000148 | 1,3-beta-D-glucan synthase complex(GO:0000148) |
0.1 | 0.8 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.6 | GO:0009360 | DNA polymerase III complex(GO:0009360) |
0.1 | 1.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 2.6 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.6 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 0.4 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.1 | 2.0 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
0.1 | 1.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 1.4 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.1 | 0.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 0.8 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 1.0 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.1 | 1.1 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.1 | 1.0 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 0.6 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.1 | 0.2 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
0.1 | 0.5 | GO:0034657 | GID complex(GO:0034657) |
0.1 | 0.6 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.1 | 0.4 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 1.0 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
0.1 | 0.4 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.5 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 1.1 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.1 | 10.9 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 0.7 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 0.2 | GO:0045495 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.1 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 0.2 | GO:0097361 | CIA complex(GO:0097361) |
0.1 | 0.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.8 | GO:0042555 | MCM complex(GO:0042555) |
0.1 | 0.5 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
0.1 | 1.3 | GO:0005839 | proteasome core complex(GO:0005839) |
0.1 | 0.7 | GO:0015030 | Cajal body(GO:0015030) |
0.1 | 1.7 | GO:0005761 | mitochondrial ribosome(GO:0005761) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 0.4 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.1 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
0.1 | 0.7 | GO:0010168 | ER body(GO:0010168) |
0.1 | 1.1 | GO:0070461 | SAGA-type complex(GO:0070461) |
0.1 | 0.7 | GO:0016514 | SWI/SNF complex(GO:0016514) BAF-type complex(GO:0090544) |
0.1 | 0.8 | GO:0005688 | U6 snRNP(GO:0005688) |
0.1 | 0.5 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.1 | GO:0044462 | cell wall part(GO:0044426) external encapsulating structure part(GO:0044462) |
0.1 | 0.8 | GO:0000974 | Prp19 complex(GO:0000974) |
0.1 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.4 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.7 | GO:0032806 | holo TFIIH complex(GO:0005675) carboxy-terminal domain protein kinase complex(GO:0032806) |
0.1 | 0.2 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.1 | 0.3 | GO:0030141 | secretory granule(GO:0030141) |
0.1 | 0.7 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.1 | 0.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 1.5 | GO:0009574 | preprophase band(GO:0009574) |
0.1 | 6.1 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 2.5 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 0.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.1 | 0.5 | GO:0009840 | chloroplastic endopeptidase Clp complex(GO:0009840) |
0.1 | 0.6 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 0.2 | GO:0005844 | polysome(GO:0005844) |
0.1 | 0.5 | GO:0000346 | transcription export complex(GO:0000346) THO complex part of transcription export complex(GO:0000445) |
0.1 | 0.7 | GO:0070062 | extracellular organelle(GO:0043230) extracellular exosome(GO:0070062) extracellular vesicle(GO:1903561) |
0.1 | 0.5 | GO:0035619 | root hair tip(GO:0035619) |
0.1 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 0.3 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 0.8 | GO:0005769 | early endosome(GO:0005769) |
0.1 | 1.0 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.1 | 1.6 | GO:0032040 | small-subunit processome(GO:0032040) |
0.1 | 2.9 | GO:0005770 | late endosome(GO:0005770) |
0.1 | 0.4 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.3 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.7 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.0 | 0.4 | GO:0000419 | DNA-directed RNA polymerase V complex(GO:0000419) |
0.0 | 1.5 | GO:0009504 | cell plate(GO:0009504) |
0.0 | 0.3 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 3.5 | GO:0016604 | nuclear body(GO:0016604) |
0.0 | 0.8 | GO:0009531 | secondary cell wall(GO:0009531) |
0.0 | 1.0 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.2 | GO:0043036 | chloroplast starch grain(GO:0009569) starch grain(GO:0043036) |
0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) NatC complex(GO:0031417) |
0.0 | 0.2 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.8 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 2.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.2 | GO:0031083 | BLOC complex(GO:0031082) BLOC-1 complex(GO:0031083) |
0.0 | 0.4 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 31.3 | GO:0009506 | cell-cell junction(GO:0005911) plasmodesma(GO:0009506) cell junction(GO:0030054) symplast(GO:0055044) |
0.0 | 0.5 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.6 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.9 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.6 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.1 | GO:0009509 | chromoplast(GO:0009509) |
0.0 | 0.1 | GO:0009527 | plastid outer membrane(GO:0009527) |
0.0 | 8.4 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 3.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.0 | 0.5 | GO:0045273 | respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) |
0.0 | 0.2 | GO:0009654 | photosystem II oxygen evolving complex(GO:0009654) |
0.0 | 0.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.9 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 1.3 | GO:0031977 | thylakoid lumen(GO:0031977) |
0.0 | 21.6 | GO:0009532 | plastid stroma(GO:0009532) |
0.0 | 0.6 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.0 | 0.8 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.2 | GO:0000786 | nucleosome(GO:0000786) DNA packaging complex(GO:0044815) |
0.0 | 0.1 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 1.5 | GO:0000428 | DNA-directed RNA polymerase complex(GO:0000428) |
0.0 | 1.1 | GO:0044440 | endosomal part(GO:0044440) |
0.0 | 0.6 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.5 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 3.0 | GO:0005768 | endosome(GO:0005768) |
0.0 | 0.4 | GO:0010598 | NAD(P)H dehydrogenase complex (plastoquinone)(GO:0010598) |
0.0 | 0.4 | GO:1902493 | histone acetyltransferase complex(GO:0000123) protein acetyltransferase complex(GO:0031248) acetyltransferase complex(GO:1902493) |
0.0 | 0.1 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.7 | GO:1902554 | serine/threonine protein kinase complex(GO:1902554) |
0.0 | 0.4 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 55.1 | GO:0005829 | cytosol(GO:0005829) |
0.0 | 0.1 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
0.0 | 0.1 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.1 | GO:0030286 | dynein complex(GO:0030286) |
0.0 | 0.1 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.7 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.2 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.2 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.0 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.0 | 0.1 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 3.0 | GO:0009579 | thylakoid(GO:0009579) |
0.0 | 0.6 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.2 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 1.1 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.1 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.0 | GO:1990429 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
0.0 | 1.9 | GO:0030312 | cell wall(GO:0005618) external encapsulating structure(GO:0030312) |
0.0 | 0.1 | GO:0031965 | nuclear membrane(GO:0031965) |
0.0 | 0.1 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 22.7 | GO:0005886 | plasma membrane(GO:0005886) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 2.5 | GO:0030410 | nicotianamine synthase activity(GO:0030410) |
0.6 | 1.9 | GO:0004034 | aldose 1-epimerase activity(GO:0004034) |
0.6 | 0.6 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.5 | 3.1 | GO:0019904 | protein domain specific binding(GO:0019904) |
0.4 | 1.7 | GO:0032791 | lead ion binding(GO:0032791) |
0.4 | 2.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.4 | 1.2 | GO:0046524 | sucrose-phosphate synthase activity(GO:0046524) |
0.4 | 1.2 | GO:1990883 | rRNA cytidine N-acetyltransferase activity(GO:1990883) |
0.4 | 3.1 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.4 | 0.7 | GO:0004557 | alpha-galactosidase activity(GO:0004557) raffinose alpha-galactosidase activity(GO:0052692) |
0.4 | 1.5 | GO:0045548 | phenylalanine ammonia-lyase activity(GO:0045548) |
0.4 | 0.7 | GO:0016726 | oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.4 | 1.1 | GO:0046480 | galactolipid galactosyltransferase activity(GO:0046480) |
0.3 | 2.0 | GO:0004838 | L-tyrosine:2-oxoglutarate aminotransferase activity(GO:0004838) L-tyrosine aminotransferase activity(GO:0070547) |
0.3 | 1.3 | GO:0046537 | 2,3-bisphosphoglycerate-independent phosphoglycerate mutase activity(GO:0046537) |
0.3 | 2.8 | GO:0009882 | blue light photoreceptor activity(GO:0009882) |
0.3 | 0.9 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.3 | 2.7 | GO:0047216 | inositol 3-alpha-galactosyltransferase activity(GO:0047216) |
0.3 | 0.6 | GO:0046481 | digalactosyldiacylglycerol synthase activity(GO:0046481) |
0.3 | 0.9 | GO:0000403 | Y-form DNA binding(GO:0000403) flap-structured DNA binding(GO:0070336) |
0.3 | 1.8 | GO:0051003 | magnesium chelatase activity(GO:0016851) ligase activity, forming nitrogen-metal bonds(GO:0051002) ligase activity, forming nitrogen-metal bonds, forming coordination complexes(GO:0051003) |
0.3 | 0.9 | GO:0004071 | aspartate-ammonia ligase activity(GO:0004071) |
0.3 | 1.1 | GO:0050162 | oxalate oxidase activity(GO:0050162) |
0.3 | 1.9 | GO:0010279 | indole-3-acetic acid amido synthetase activity(GO:0010279) |
0.3 | 0.8 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
0.3 | 0.8 | GO:0051777 | ent-kaurenoate oxidase activity(GO:0051777) |
0.3 | 1.0 | GO:0031516 | far-red light photoreceptor activity(GO:0031516) |
0.3 | 0.8 | GO:0052592 | oxidoreductase activity, acting on CH or CH2 groups, with an iron-sulfur protein as acceptor(GO:0052592) |
0.2 | 1.0 | GO:0003852 | 2-isopropylmalate synthase activity(GO:0003852) |
0.2 | 1.0 | GO:1990269 | phosphoserine binding(GO:0050815) RNA polymerase II C-terminal domain phosphoserine binding(GO:1990269) |
0.2 | 0.7 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.2 | 0.7 | GO:0052640 | salicylic acid glucosyltransferase (glucoside-forming) activity(GO:0052640) |
0.2 | 1.4 | GO:0004310 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
0.2 | 0.7 | GO:0000823 | inositol-1,4,5-trisphosphate 6-kinase activity(GO:0000823) inositol tetrakisphosphate 3-kinase activity(GO:0000824) inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) inositol tetrakisphosphate 5-kinase activity(GO:0047326) |
0.2 | 0.7 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
0.2 | 0.9 | GO:0004349 | glutamate 5-kinase activity(GO:0004349) glutamate-5-semialdehyde dehydrogenase activity(GO:0004350) |
0.2 | 1.6 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.2 | 0.7 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.2 | 0.9 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.2 | 1.3 | GO:0047274 | galactinol-sucrose galactosyltransferase activity(GO:0047274) |
0.2 | 1.7 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.2 | 3.2 | GO:0016157 | sucrose synthase activity(GO:0016157) |
0.2 | 1.0 | GO:0030371 | translation repressor activity(GO:0030371) |
0.2 | 1.4 | GO:0016781 | phosphotransferase activity, paired acceptors(GO:0016781) |
0.2 | 1.0 | GO:0003979 | UDP-glucose 6-dehydrogenase activity(GO:0003979) |
0.2 | 1.6 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) |
0.2 | 0.6 | GO:0008839 | 4-hydroxy-tetrahydrodipicolinate reductase(GO:0008839) |
0.2 | 1.0 | GO:0033897 | ribonuclease T2 activity(GO:0033897) |
0.2 | 0.6 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.2 | 1.0 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.2 | 1.3 | GO:0005034 | osmosensor activity(GO:0005034) |
0.2 | 0.6 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.2 | 0.6 | GO:0001056 | RNA polymerase I activity(GO:0001054) RNA polymerase III activity(GO:0001056) |
0.2 | 0.6 | GO:0031210 | phosphatidylcholine binding(GO:0031210) quaternary ammonium group binding(GO:0050997) |
0.2 | 0.9 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
0.2 | 0.5 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.2 | 0.5 | GO:0016504 | peptidase activator activity(GO:0016504) |
0.2 | 0.7 | GO:0004831 | tyrosine-tRNA ligase activity(GO:0004831) |
0.2 | 0.2 | GO:0051903 | S-(hydroxymethyl)glutathione dehydrogenase activity(GO:0051903) |
0.2 | 1.1 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.2 | 0.5 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.2 | 0.6 | GO:0047215 | indole-3-acetate beta-glucosyltransferase activity(GO:0047215) |
0.2 | 5.6 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
0.2 | 1.3 | GO:0090447 | glycerol-3-phosphate 2-O-acyltransferase activity(GO:0090447) |
0.2 | 0.6 | GO:0004617 | phosphoglycerate dehydrogenase activity(GO:0004617) |
0.2 | 0.5 | GO:0003935 | GTP cyclohydrolase II activity(GO:0003935) 3,4-dihydroxy-2-butanone-4-phosphate synthase activity(GO:0008686) |
0.1 | 0.4 | GO:0010291 | carotene beta-ring hydroxylase activity(GO:0010291) |
0.1 | 2.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 0.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.1 | 0.7 | GO:0080122 | AMP transmembrane transporter activity(GO:0080122) |
0.1 | 1.0 | GO:0016703 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of one atom of oxygen (internal monooxygenases or internal mixed function oxidases)(GO:0016703) |
0.1 | 0.4 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.4 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.5 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.5 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.1 | 1.2 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
0.1 | 1.6 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.6 | GO:0001664 | G-protein coupled receptor binding(GO:0001664) G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.1 | 0.6 | GO:0050734 | hydroxycinnamoyltransferase activity(GO:0050734) |
0.1 | 0.5 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
0.1 | 1.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.4 | GO:0045430 | chalcone isomerase activity(GO:0045430) |
0.1 | 1.4 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methyladenine glycosylase activity(GO:0008725) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.1 | 0.5 | GO:0016707 | gibberellin 3-beta-dioxygenase activity(GO:0016707) |
0.1 | 2.1 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 0.6 | GO:0015434 | cadmium-transporting ATPase activity(GO:0015434) zinc-exporting ATPase activity(GO:0016463) |
0.1 | 0.5 | GO:0050284 | sinapate 1-glucosyltransferase activity(GO:0050284) |
0.1 | 1.0 | GO:0043142 | ATP-dependent DNA helicase activity(GO:0004003) ATP-dependent helicase activity(GO:0008026) single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) single-stranded DNA-dependent ATPase activity(GO:0043142) purine NTP-dependent helicase activity(GO:0070035) |
0.1 | 0.4 | GO:0047209 | coniferyl-alcohol glucosyltransferase activity(GO:0047209) |
0.1 | 0.6 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 0.6 | GO:0043225 | arsenite secondary active transmembrane transporter activity(GO:0008490) arsenite-transmembrane transporting ATPase activity(GO:0015446) anion transmembrane-transporting ATPase activity(GO:0043225) |
0.1 | 0.4 | GO:0009671 | nitrate:proton symporter activity(GO:0009671) |
0.1 | 0.8 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.6 | GO:0046715 | borate transmembrane transporter activity(GO:0046715) borate efflux transmembrane transporter activity(GO:0080139) |
0.1 | 0.4 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
0.1 | 0.5 | GO:0047334 | diphosphate-fructose-6-phosphate 1-phosphotransferase activity(GO:0047334) |
0.1 | 0.3 | GO:0001216 | bacterial-type RNA polymerase transcription factor activity, sequence-specific DNA binding(GO:0001130) bacterial-type RNA polymerase transcriptional activator activity, sequence-specific DNA binding(GO:0001216) |
0.1 | 1.3 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.1 | 0.3 | GO:0050377 | UDP-L-rhamnose synthase activity(GO:0010280) UDP-glucose 4,6-dehydratase activity(GO:0050377) |
0.1 | 0.2 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
0.1 | 2.8 | GO:0051219 | protein phosphorylated amino acid binding(GO:0045309) phosphoprotein binding(GO:0051219) |
0.1 | 1.3 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.1 | 2.2 | GO:0022839 | calcium activated cation channel activity(GO:0005227) ion gated channel activity(GO:0022839) |
0.1 | 0.6 | GO:0047780 | citrate dehydratase activity(GO:0047780) |
0.1 | 0.1 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.1 | 0.3 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) |
0.1 | 0.6 | GO:0043682 | copper-transporting ATPase activity(GO:0043682) |
0.1 | 0.4 | GO:0016420 | malonyltransferase activity(GO:0016420) |
0.1 | 0.8 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
0.1 | 0.5 | GO:0051740 | ethylene receptor activity(GO:0038199) ethylene binding(GO:0051740) alkene binding(GO:0072328) |
0.1 | 2.1 | GO:0003843 | 1,3-beta-D-glucan synthase activity(GO:0003843) |
0.1 | 0.4 | GO:0004057 | arginyltransferase activity(GO:0004057) |
0.1 | 0.9 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.7 | GO:0032977 | membrane insertase activity(GO:0032977) |
0.1 | 0.3 | GO:0004452 | isopentenyl-diphosphate delta-isomerase activity(GO:0004452) |
0.1 | 0.6 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.4 | GO:0016531 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
0.1 | 0.5 | GO:0004333 | fumarate hydratase activity(GO:0004333) |
0.1 | 0.3 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
0.1 | 0.6 | GO:0045547 | dehydrodolichyl diphosphate synthase activity(GO:0045547) |
0.1 | 0.6 | GO:0010294 | abscisic acid glucosyltransferase activity(GO:0010294) |
0.1 | 0.4 | GO:0000035 | acyl binding(GO:0000035) |
0.1 | 0.7 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.1 | 0.3 | GO:0061608 | nuclear import signal receptor activity(GO:0061608) |
0.1 | 0.4 | GO:0015603 | iron chelate transmembrane transporter activity(GO:0015603) iron-nicotianamine transmembrane transporter activity(GO:0051980) |
0.1 | 0.9 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.1 | 1.3 | GO:0042389 | omega-3 fatty acid desaturase activity(GO:0042389) |
0.1 | 8.1 | GO:0003724 | RNA helicase activity(GO:0003724) |
0.1 | 0.8 | GO:0000996 | core DNA-dependent RNA polymerase binding promoter specificity activity(GO:0000996) sigma factor activity(GO:0016987) |
0.1 | 1.1 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 1.0 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 0.3 | GO:0046409 | p-coumarate 3-hydroxylase activity(GO:0046409) |
0.1 | 0.4 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
0.1 | 0.4 | GO:0050347 | trans-octaprenyltranstransferase activity(GO:0050347) all-trans-nonaprenyl-diphosphate synthase (geranylgeranyl-diphosphate specific) activity(GO:0052924) |
0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.5 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 1.7 | GO:0010329 | auxin efflux transmembrane transporter activity(GO:0010329) |
0.1 | 1.2 | GO:0009927 | histidine phosphotransfer kinase activity(GO:0009927) |
0.1 | 0.5 | GO:0017050 | D-erythro-sphingosine kinase activity(GO:0017050) |
0.1 | 0.7 | GO:0001872 | (1->3)-beta-D-glucan binding(GO:0001872) |
0.1 | 0.5 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.1 | GO:0008460 | dTDP-glucose 4,6-dehydratase activity(GO:0008460) |
0.1 | 0.5 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) |
0.1 | 0.4 | GO:0004640 | phosphoribosylanthranilate isomerase activity(GO:0004640) |
0.1 | 2.3 | GO:0070717 | poly-purine tract binding(GO:0070717) |
0.1 | 2.6 | GO:0048029 | monosaccharide binding(GO:0048029) |
0.1 | 0.4 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.4 | GO:0004335 | galactokinase activity(GO:0004335) |
0.1 | 0.4 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.1 | 0.4 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.1 | 0.6 | GO:0005487 | nuclear export signal receptor activity(GO:0005049) nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 1.2 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.1 | 0.5 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 1.5 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) |
0.1 | 0.3 | GO:0019779 | Atg8 activating enzyme activity(GO:0019779) |
0.1 | 0.8 | GO:0008878 | glucose-1-phosphate adenylyltransferase activity(GO:0008878) |
0.1 | 2.2 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.1 | 0.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.1 | 0.2 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.1 | 0.1 | GO:0010429 | methyl-CpNpG binding(GO:0010428) methyl-CpNpN binding(GO:0010429) |
0.1 | 2.3 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.1 | 0.3 | GO:0003862 | 3-isopropylmalate dehydrogenase activity(GO:0003862) |
0.1 | 0.4 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.8 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
0.1 | 0.7 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 1.1 | GO:0002020 | protease binding(GO:0002020) |
0.1 | 0.8 | GO:0015086 | cadmium ion transmembrane transporter activity(GO:0015086) |
0.1 | 2.0 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 2.7 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.1 | 0.5 | GO:0050062 | long-chain-fatty-acyl-CoA reductase activity(GO:0050062) |
0.1 | 0.2 | GO:0072349 | modified amino acid transmembrane transporter activity(GO:0072349) |
0.1 | 1.4 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.1 | 1.0 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.1 | 0.8 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) sequence-specific single stranded DNA binding(GO:0098847) |
0.1 | 0.3 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.1 | 0.2 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
0.1 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.2 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.1 | 0.3 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 1.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.1 | 0.5 | GO:0047627 | hydrolase activity, acting on acid anhydrides, in sulfonyl-containing anhydrides(GO:0016819) adenylylsulfatase activity(GO:0047627) |
0.1 | 0.6 | GO:0019903 | protein phosphatase binding(GO:0019903) |
0.1 | 0.5 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) serine binding(GO:0070905) |
0.1 | 0.2 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.1 | 0.4 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
0.1 | 0.6 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.1 | 0.2 | GO:0016277 | [myelin basic protein]-arginine N-methyltransferase activity(GO:0016277) |
0.1 | 0.5 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.6 | GO:0009011 | starch synthase activity(GO:0009011) alpha-1,4-glucan synthase activity(GO:0033201) |
0.1 | 1.0 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.1 | 0.2 | GO:0004488 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 2.1 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.1 | 0.2 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
0.1 | 2.7 | GO:0043022 | ribosome binding(GO:0043022) |
0.1 | 4.4 | GO:0043621 | protein self-association(GO:0043621) |
0.1 | 3.1 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
0.1 | 0.5 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 0.2 | GO:0030941 | chloroplast targeting sequence binding(GO:0030941) |
0.1 | 4.7 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) |
0.1 | 0.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.1 | 0.5 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
0.1 | 0.3 | GO:0047517 | 1,4-beta-D-xylan synthase activity(GO:0047517) |
0.1 | 0.3 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.7 | GO:0043424 | protein histidine kinase binding(GO:0043424) |
0.1 | 0.4 | GO:0003913 | DNA photolyase activity(GO:0003913) |
0.1 | 2.7 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
0.1 | 0.4 | GO:0050378 | UDP-glucuronate 4-epimerase activity(GO:0050378) |
0.1 | 0.3 | GO:0016034 | maleylacetoacetate isomerase activity(GO:0016034) |
0.1 | 0.7 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
0.1 | 0.5 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.1 | 16.9 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.5 | GO:0008022 | protein C-terminus binding(GO:0008022) |
0.1 | 0.5 | GO:0045431 | flavonol synthase activity(GO:0045431) |
0.1 | 0.2 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.1 | 0.8 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.8 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.1 | 0.3 | GO:0034432 | bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
0.1 | 1.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.2 | GO:0047804 | cysteine-S-conjugate beta-lyase activity(GO:0047804) |
0.1 | 0.6 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.1 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.2 | GO:0031219 | levanase activity(GO:0031219) fructan beta-fructosidase activity(GO:0051669) |
0.1 | 0.3 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.1 | 0.9 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.1 | 0.4 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.1 | 0.8 | GO:0046556 | alpha-L-arabinofuranosidase activity(GO:0046556) |
0.1 | 0.3 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.4 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 0.4 | GO:0030527 | structural constituent of chromatin(GO:0030527) |
0.1 | 0.2 | GO:0015930 | glutamate synthase activity(GO:0015930) glutamate synthase (NADH) activity(GO:0016040) glutamate synthase activity, NAD(P)H as acceptor(GO:0045181) |
0.1 | 1.4 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
0.1 | 1.3 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.1 | 0.4 | GO:0030515 | snoRNA binding(GO:0030515) |
0.1 | 0.2 | GO:0004149 | dihydrolipoyllysine-residue succinyltransferase activity(GO:0004149) succinyltransferase activity(GO:0016748) S-succinyltransferase activity(GO:0016751) |
0.1 | 0.2 | GO:0016906 | sterol 3-beta-glucosyltransferase activity(GO:0016906) |
0.1 | 0.5 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.1 | 0.9 | GO:0008144 | drug binding(GO:0008144) |
0.1 | 0.5 | GO:0008083 | growth factor activity(GO:0008083) |
0.1 | 0.5 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 0.6 | GO:0052747 | sinapyl alcohol dehydrogenase activity(GO:0052747) |
0.1 | 0.4 | GO:0016880 | ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
0.1 | 0.4 | GO:0032029 | myosin tail binding(GO:0032029) myosin heavy chain binding(GO:0032036) myosin XI tail binding(GO:0080115) |
0.1 | 0.4 | GO:0019843 | rRNA binding(GO:0019843) |
0.1 | 0.3 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.1 | 2.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.2 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.1 | 0.2 | GO:0004077 | biotin-[acetyl-CoA-carboxylase] ligase activity(GO:0004077) biotin-protein ligase activity(GO:0018271) |
0.1 | 2.9 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.1 | 0.2 | GO:0080118 | brassinosteroid sulfotransferase activity(GO:0080118) |
0.1 | 0.1 | GO:0004619 | phosphoglycerate mutase activity(GO:0004619) |
0.1 | 0.5 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) |
0.1 | 0.3 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.1 | 0.3 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.1 | 0.7 | GO:0019905 | syntaxin binding(GO:0019905) |
0.1 | 0.8 | GO:1901981 | phosphatidylinositol phosphate binding(GO:1901981) |
0.1 | 0.2 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
0.1 | 0.6 | GO:0043878 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (non-phosphorylating) activity(GO:0043878) |
0.1 | 0.2 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
0.1 | 0.8 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.1 | 0.8 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 0.5 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 0.2 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
0.1 | 0.3 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.1 | 0.3 | GO:0004325 | ferrochelatase activity(GO:0004325) |
0.1 | 4.2 | GO:0005198 | structural molecule activity(GO:0005198) |
0.1 | 2.4 | GO:0003713 | transcription coactivator activity(GO:0003713) |
0.1 | 0.2 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.1 | 0.4 | GO:0016688 | L-ascorbate peroxidase activity(GO:0016688) |
0.1 | 1.0 | GO:0004564 | beta-fructofuranosidase activity(GO:0004564) |
0.1 | 0.2 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
0.1 | 0.2 | GO:0030267 | glyoxylate reductase (NADP) activity(GO:0030267) |
0.1 | 0.6 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.4 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.0 | 2.7 | GO:0009931 | calmodulin-dependent protein kinase activity(GO:0004683) calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
0.0 | 0.3 | GO:0015923 | mannosidase activity(GO:0015923) |
0.0 | 0.3 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.0 | 0.6 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.0 | 0.1 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.0 | 0.1 | GO:0004412 | homoserine dehydrogenase activity(GO:0004412) |
0.0 | 0.2 | GO:0008493 | tetracycline transporter activity(GO:0008493) toxin transporter activity(GO:0019534) antibiotic transporter activity(GO:0042895) |
0.0 | 0.7 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.7 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.6 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.5 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.0 | 0.2 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.2 | GO:0010328 | auxin influx transmembrane transporter activity(GO:0010328) |
0.0 | 0.5 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.0 | 0.4 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.0 | 0.1 | GO:0022835 | ionotropic glutamate receptor activity(GO:0004970) extracellular ligand-gated ion channel activity(GO:0005230) transmitter-gated ion channel activity(GO:0022824) transmitter-gated channel activity(GO:0022835) neurotransmitter receptor activity(GO:0030594) |
0.0 | 2.4 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.0 | 0.2 | GO:0019156 | isoamylase activity(GO:0019156) |
0.0 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.8 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
0.0 | 0.7 | GO:0005048 | signal sequence binding(GO:0005048) |
0.0 | 0.6 | GO:0031420 | pyruvate kinase activity(GO:0004743) potassium ion binding(GO:0030955) alkali metal ion binding(GO:0031420) |
0.0 | 0.0 | GO:0004373 | glycogen (starch) synthase activity(GO:0004373) |
0.0 | 0.5 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 0.7 | GO:0060090 | binding, bridging(GO:0060090) |
0.0 | 3.9 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.4 | GO:1990757 | ubiquitin ligase activator activity(GO:1990757) |
0.0 | 0.4 | GO:0102360 | daphnetin 3-O-glucosyltransferase activity(GO:0102360) |
0.0 | 0.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) chloride channel activity(GO:0005254) |
0.0 | 0.8 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.3 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.5 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
0.0 | 0.2 | GO:0004820 | glycine-tRNA ligase activity(GO:0004820) |
0.0 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.1 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.0 | 0.1 | GO:0003962 | cystathionine gamma-synthase activity(GO:0003962) |
0.0 | 0.3 | GO:0045549 | 9-cis-epoxycarotenoid dioxygenase activity(GO:0045549) |
0.0 | 0.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.3 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.5 | GO:0016844 | strictosidine synthase activity(GO:0016844) |
0.0 | 0.3 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
0.0 | 0.6 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 4.5 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) ATPase activity, coupled to transmembrane movement of substances(GO:0042626) ATPase activity, coupled to movement of substances(GO:0043492) |
0.0 | 0.4 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 21.7 | GO:0044822 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
0.0 | 0.2 | GO:0016768 | spermine synthase activity(GO:0016768) |
0.0 | 0.4 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.5 | GO:0051184 | cofactor transporter activity(GO:0051184) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.3 | GO:0016161 | beta-amylase activity(GO:0016161) |
0.0 | 0.2 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.0 | 1.2 | GO:0004407 | histone deacetylase activity(GO:0004407) protein deacetylase activity(GO:0033558) |
0.0 | 0.2 | GO:0010179 | IAA-Ala conjugate hydrolase activity(GO:0010179) |
0.0 | 0.2 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.2 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.2 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.1 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
0.0 | 1.2 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.2 | GO:0046625 | sphingolipid binding(GO:0046625) ceramide binding(GO:0097001) |
0.0 | 1.5 | GO:0102483 | scopolin beta-glucosidase activity(GO:0102483) |
0.0 | 0.2 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
0.0 | 0.1 | GO:0015367 | oxoglutarate:malate antiporter activity(GO:0015367) |
0.0 | 0.1 | GO:0005354 | galactose transmembrane transporter activity(GO:0005354) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.4 | GO:0001098 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
0.0 | 0.4 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
0.0 | 0.4 | GO:0004124 | cysteine synthase activity(GO:0004124) |
0.0 | 0.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.0 | 0.2 | GO:0001653 | peptide receptor activity(GO:0001653) |
0.0 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0050664 | NAD(P)H oxidase activity(GO:0016174) oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.0 | 0.1 | GO:0008893 | acetyl-CoA hydrolase activity(GO:0003986) guanosine-3',5'-bis(diphosphate) 3'-diphosphatase activity(GO:0008893) diphosphoric monoester hydrolase activity(GO:0016794) |
0.0 | 0.3 | GO:0004930 | G-protein coupled receptor activity(GO:0004930) |
0.0 | 0.8 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:1901474 | thiamine pyrophosphate transporter activity(GO:0090422) azole transmembrane transporter activity(GO:1901474) |
0.0 | 0.2 | GO:0003955 | NAD(P)H dehydrogenase (quinone) activity(GO:0003955) |
0.0 | 0.8 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 1.1 | GO:0003678 | DNA helicase activity(GO:0003678) |
0.0 | 0.1 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.2 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.2 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.0 | 1.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.3 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
0.0 | 0.2 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) |
0.0 | 0.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.8 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.1 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) |
0.0 | 0.8 | GO:0030145 | manganese ion binding(GO:0030145) |
0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.0 | GO:0015105 | arsenite transmembrane transporter activity(GO:0015105) |
0.0 | 0.2 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) |
0.0 | 3.2 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 1.1 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.3 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.2 | GO:0047259 | glucomannan 4-beta-mannosyltransferase activity(GO:0047259) |
0.0 | 0.2 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.5 | GO:0016782 | transferase activity, transferring sulfur-containing groups(GO:0016782) |
0.0 | 1.1 | GO:0003712 | transcription factor activity, transcription factor binding(GO:0000989) transcription cofactor activity(GO:0003712) |
0.0 | 0.5 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.2 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.0 | 0.3 | GO:0016207 | 4-coumarate-CoA ligase activity(GO:0016207) |
0.0 | 0.3 | GO:0004630 | phospholipase D activity(GO:0004630) N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.0 | 0.1 | GO:0003861 | 3-isopropylmalate dehydratase activity(GO:0003861) |
0.0 | 0.2 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.0 | 0.0 | GO:0080045 | quercetin 3'-O-glucosyltransferase activity(GO:0080045) |
0.0 | 0.1 | GO:0051959 | dynein binding(GO:0045502) dynein intermediate chain binding(GO:0045505) dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.3 | GO:0004659 | prenyltransferase activity(GO:0004659) |
0.0 | 0.1 | GO:0019172 | glyoxalase III activity(GO:0019172) |
0.0 | 0.2 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.1 | GO:0008883 | glutamyl-tRNA reductase activity(GO:0008883) |
0.0 | 0.1 | GO:0004765 | shikimate kinase activity(GO:0004765) |
0.0 | 0.1 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.2 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.0 | 0.1 | GO:0015112 | nitrate transmembrane transporter activity(GO:0015112) |
0.0 | 0.2 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
0.0 | 0.6 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 4.4 | GO:0003723 | RNA binding(GO:0003723) |
0.0 | 1.7 | GO:0046982 | protein heterodimerization activity(GO:0046982) |
0.0 | 0.0 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.1 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0009916 | alternative oxidase activity(GO:0009916) |
0.0 | 0.0 | GO:0047560 | 3-dehydrosphinganine reductase activity(GO:0047560) |
0.0 | 0.1 | GO:0036440 | citrate (Si)-synthase activity(GO:0004108) citrate synthase activity(GO:0036440) |
0.0 | 0.1 | GO:0015203 | polyamine transmembrane transporter activity(GO:0015203) |
0.0 | 0.3 | GO:0080032 | methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.0 | 0.3 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.0 | 0.1 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) protein kinase A binding(GO:0051018) Arp2/3 complex binding(GO:0071933) |
0.0 | 0.4 | GO:0015079 | potassium ion transmembrane transporter activity(GO:0015079) |
0.0 | 8.6 | GO:0004672 | protein kinase activity(GO:0004672) |
0.0 | 0.2 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.2 | GO:0016597 | amino acid binding(GO:0016597) |
0.0 | 0.2 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.1 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.3 | 0.9 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.2 | 0.5 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.2 | 0.7 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.2 | 0.8 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.2 | 0.7 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.2 | 0.5 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.2 | 0.6 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 0.1 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.1 | 0.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.1 | 0.5 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.1 | 0.3 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 0.3 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 0.2 | PID P53 REGULATION PATHWAY | p53 pathway |
0.1 | 0.4 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.3 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.1 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.2 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.0 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.2 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.2 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.1 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.1 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.9 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.3 | 1.0 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.3 | 0.9 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.3 | 1.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.2 | 1.1 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.2 | 0.8 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.2 | 0.4 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.2 | 0.6 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.2 | 0.2 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.2 | 0.7 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.2 | 0.5 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.2 | 0.5 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.2 | 0.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.2 | 0.8 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.1 | 0.4 | REACTOME NEUROTRANSMITTER RECEPTOR BINDING AND DOWNSTREAM TRANSMISSION IN THE POSTSYNAPTIC CELL | Genes involved in Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell |
0.1 | 0.4 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.1 | 0.8 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 0.8 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.1 | 0.9 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 0.5 | REACTOME METABOLISM OF NUCLEOTIDES | Genes involved in Metabolism of nucleotides |
0.1 | 0.3 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.1 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 1.9 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.1 | 0.3 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.1 | 0.3 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 0.4 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.1 | 0.9 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.1 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
0.0 | 0.1 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.0 | 0.4 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.1 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.0 | 0.1 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.1 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.1 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.0 | 0.1 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.0 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |