GSE130291:vernalization in Arabidopsis thaliana
Gene Symbol | Gene ID | Gene Info |
---|---|---|
AT1G06850
|
AT1G06850 | basic leucine-zipper 52 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
bZIP52 | arTal_v1_Chr1_+_2105048_2105055 | 0.55 | 4.0e-02 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
Chr4_-_7401951 | 2.05 |
AT4G12470.1
|
AZI1
|
azelaic acid induced 1 |
Chr5_+_21240717 | 1.65 |
AT5G52310.1
|
LTI78
|
low-temperature-responsive protein 78 (LTI78) / desiccation-responsive protein 29A (RD29A) |
Chr2_-_12343443 | 1.60 |
AT2G28780.1
|
AT2G28780
|
P-hydroxybenzoic acid efflux pump subunit |
Chr1_+_28498821 | 1.58 |
AT1G75900.1
|
AT1G75900
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
Chr1_-_9275193 | 1.56 |
AT1G26790.1
|
AT1G26790
|
Dof-type zinc finger DNA-binding family protein |
Chr4_+_9028262 | 1.51 |
AT4G15910.1
|
DI21
|
drought-induced 21 |
Chr5_-_19648362 | 1.38 |
AT5G48490.1
|
AT5G48490
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr5_-_18189523 | 1.28 |
AT5G45070.1
|
PP2-A8
|
phloem protein 2-A8 |
Chr1_-_28442429 | 1.26 |
AT1G75750.2
AT1G75750.1 |
GASA1
|
GAST1 protein homolog 1 |
Chr3_+_18940643 | 1.22 |
AT3G50970.1
|
LTI30
|
dehydrin family protein |
Chr1_-_698591 | 1.19 |
AT1G03020.1
|
AT1G03020
|
Thioredoxin superfamily protein |
Chr2_+_7964326 | 1.16 |
AT2G18328.1
|
RL4
|
RAD-like 4 |
Chr1_-_37757 | 1.15 |
AT1G01060.3
AT1G01060.2 AT1G01060.4 AT1G01060.1 AT1G01060.6 AT1G01060.7 AT1G01060.5 |
LHY
|
Homeodomain-like superfamily protein |
Chr3_-_20816035 | 1.15 |
AT3G56090.1
|
FER3
|
ferritin 3 |
Chr1_+_3093644 | 1.14 |
AT1G09560.1
|
GLP5
|
germin-like protein 5 |
Chr5_-_6976036 | 1.14 |
AT5G20630.1
|
GER3
|
germin 3 |
Chr5_+_22721373 | 1.14 |
AT5G56120.1
|
AT5G56120
|
RNA polymerase II elongation factor |
Chr5_-_8406132 | 1.10 |
AT5G24570.1
AT5G24575.1 |
AT5G24570
AT5G24575
|
hypothetical protein hypothetical protein |
Chr3_-_23046153 | 1.09 |
AT3G62270.1
|
AT3G62270
|
HCO3- transporter family |
Chr5_+_18791575 | 1.05 |
AT5G46330.1
AT5G46330.2 |
FLS2
|
Leucine-rich receptor-like protein kinase family protein |
Chr5_-_20489727 | 1.03 |
AT5G50335.1
|
AT5G50335
|
hypothetical protein |
Chr2_-_827994 | 1.02 |
AT2G02850.1
|
ARPN
|
plantacyanin |
Chr2_-_5675995 | 1.02 |
AT2G13610.1
|
ABCG5
|
ABC-2 type transporter family protein |
Chr3_+_2441565 | 1.00 |
AT3G07650.4
AT3G07650.1 AT3G07650.3 AT3G07650.2 |
COL9
|
CONSTANS-like 9 |
Chr1_+_16263805 | 0.97 |
AT1G43160.1
|
RAP2.6
|
related to AP2 6 |
Chr3_+_20991280 | 0.97 |
AT3G56680.1
|
AT3G56680
|
Single-stranded nucleic acid binding R3H protein |
Chr3_-_565801 | 0.97 |
AT3G02640.1
|
AT3G02640
|
transmembrane protein |
Chr5_-_4620551 | 0.93 |
AT5G14330.1
|
AT5G14330
|
transmembrane protein |
Chr3_-_2825114 | 0.93 |
AT3G09200.2
AT3G09200.1 |
AT3G09200
|
Ribosomal protein L10 family protein |
Chr5_-_15201168 | 0.92 |
AT5G38100.4
AT5G38100.1 AT5G38100.2 |
AT5G38100
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
Chr5_+_2563366 | 0.91 |
AT5G08000.1
AT5G08000.2 |
E13L3
|
glucan endo-1,3-beta-glucosidase-like protein 3 |
Chr5_+_17951442 | 0.91 |
AT5G44565.2
AT5G44565.1 AT5G44565.3 |
AT5G44565
|
transmembrane protein |
Chr5_+_23701392 | 0.90 |
AT5G58660.1
AT5G58660.2 |
AT5G58660
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
Chr4_-_12400231 | 0.90 |
AT4G23820.1
|
AT4G23820
|
Pectin lyase-like superfamily protein |
Chr2_+_2763449 | 0.90 |
AT2G06850.1
AT2G06850.2 |
XTH4
|
xyloglucan endotransglucosylase/hydrolase 4 |
Chr1_-_2392500 | 0.89 |
AT1G07720.1
AT1G07720.2 |
KCS3
|
3-ketoacyl-CoA synthase 3 |
Chr1_+_7785708 | 0.88 |
AT1G22065.1
|
AT1G22065
|
hypothetical protein |
Chr1_-_11719988 | 0.88 |
AT1G32450.1
|
NRT1.5
|
nitrate transporter 1.5 |
Chr1_-_4398193 | 0.88 |
AT1G12920.1
|
ERF1-2
|
eukaryotic release factor 1-2 |
Chr5_+_6687030 | 0.86 |
AT5G19780.1
|
TUA5
|
tubulin alpha-5 |
Chr5_-_26816761 | 0.85 |
AT5G67200.1
|
AT5G67200
|
Leucine-rich repeat protein kinase family protein |
Chr4_+_9257869 | 0.84 |
AT4G16390.1
|
SVR7
|
pentatricopeptide (PPR) repeat-containing protein |
Chr1_-_10473502 | 0.83 |
AT1G29910.1
|
CAB3
|
chlorophyll A/B binding protein 3 |
Chr4_-_7414955 | 0.83 |
AT4G12500.1
|
AT4G12500
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr1_-_22417244 | 0.82 |
AT1G60890.2
AT1G60890.1 |
AT1G60890
|
Phosphatidylinositol-4-phosphate 5-kinase family protein |
Chr5_+_3157694 | 0.82 |
AT5G10100.1
AT5G10100.3 AT5G10100.4 |
TPPI
|
Haloacid dehalogenase-like hydrolase (HAD) superfamily protein |
Chr5_-_14868758 | 0.82 |
AT5G37475.2
AT5G37475.1 AT5G37475.3 |
AT5G37475
|
Translation initiation factor eIF3 subunit |
Chr4_+_1249971 | 0.82 |
AT4G02800.1
|
AT4G02800
|
GRIP/coiled-coil protein |
Chr3_+_8550037 | 0.81 |
AT3G23730.1
|
XTH16
|
xyloglucan endotransglucosylase/hydrolase 16 |
Chr3_-_1970946 | 0.81 |
AT3G06435.2
|
AT3G06435
|
Expressed protein |
Chr1_-_10399873 | 0.81 |
AT1G29720.1
|
AT1G29720
|
Leucine-rich repeat transmembrane protein kinase |
Chr5_-_5137707 | 0.80 |
AT5G15740.1
|
AT5G15740
|
O-fucosyltransferase family protein |
Chr1_-_5789312 | 0.80 |
AT1G16920.1
|
RABA1b
|
RAB GTPase homolog A1B |
Chr5_+_14273535 | 0.80 |
AT5G36230.2
|
AT5G36230
|
ARM repeat superfamily protein |
Chr3_+_18249663 | 0.80 |
AT3G49220.2
AT3G49220.3 AT3G49220.1 |
AT3G49220
|
Plant invertase/pectin methylesterase inhibitor superfamily |
Chr2_+_10759724 | 0.79 |
AT2G25270.1
|
AT2G25270
|
transmembrane protein |
Chr5_+_22388782 | 0.78 |
AT5G55180.2
|
AT5G55180
|
O-Glycosyl hydrolases family 17 protein |
Chr3_-_6212551 | 0.78 |
AT3G18130.1
|
RACK1C_AT
|
receptor for activated C kinase 1C |
Chr5_+_14273345 | 0.78 |
AT5G36230.1
|
AT5G36230
|
ARM repeat superfamily protein |
Chr1_-_28094915 | 0.78 |
AT1G74770.2
AT1G74770.1 |
AT1G74770
|
zinc ion binding protein |
Chr4_+_11663186 | 0.77 |
AT4G22010.1
|
sks4
|
SKU5 similar 4 |
Chr3_+_4403355 | 0.77 |
AT3G13510.1
|
AT3G13510
|
carboxyl-terminal peptidase, putative (DUF239) |
Chr5_+_15878698 | 0.77 |
AT5G39660.1
AT5G39660.3 AT5G39660.2 |
CDF2
|
cycling DOF factor 2 |
Chr3_-_1970784 | 0.77 |
AT3G06435.1
|
AT3G06435
|
Expressed protein |
Chr3_+_17512816 | 0.77 |
AT3G47520.1
|
MDH
|
malate dehydrogenase |
Chr5_+_4768263 | 0.77 |
AT5G14760.1
|
AO
|
L-aspartate oxidase |
Chr5_+_3111945 | 0.76 |
AT5G09970.1
|
CYP78A7
|
cytochrome P450, family 78, subfamily A, polypeptide 7 |
Chr2_+_6950041 | 0.75 |
AT2G15970.2
|
COR413-PM1
|
cold regulated 413 plasma membrane 1 |
Chr2_+_6949851 | 0.75 |
AT2G15970.1
|
COR413-PM1
|
cold regulated 413 plasma membrane 1 |
Chr1_+_18416474 | 0.75 |
AT1G49760.2
AT1G49760.1 |
PAB8
|
poly(A) binding protein 8 |
Chr1_-_6940832 | 0.75 |
AT1G20010.1
|
TUB5
|
tubulin beta-5 chain |
Chr5_+_7014662 | 0.75 |
AT5G20720.1
AT5G20720.4 AT5G20720.2 AT5G20720.3 |
CPN20
|
chaperonin 20 |
Chr5_-_14623093 | 0.75 |
AT5G37010.1
|
AT5G37010
|
rho GTPase-activating protein |
Chr5_+_22388521 | 0.75 |
AT5G55180.1
|
AT5G55180
|
O-Glycosyl hydrolases family 17 protein |
Chr5_-_25813620 | 0.75 |
AT5G64570.3
AT5G64570.2 AT5G64570.1 |
XYL4
|
beta-D-xylosidase 4 |
Chr5_-_22944970 | 0.74 |
AT5G56710.2
AT5G56710.1 |
AT5G56710
|
Ribosomal protein L31e family protein |
Chr3_-_20629295 | 0.74 |
AT3G55610.1
|
P5CS2
|
delta 1-pyrroline-5-carboxylate synthase 2 |
Chr5_+_18444607 | 0.74 |
AT5G45510.2
AT5G45510.1 |
AT5G45510
|
Leucine-rich repeat (LRR) family protein |
Chr2_-_7496292 | 0.74 |
AT2G17230.1
|
EXL5
|
EXORDIUM like 5 |
Chr1_+_29354944 | 0.74 |
AT1G78070.1
|
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
Chr2_-_784880 | 0.73 |
AT2G02780.3
AT2G02780.1 AT2G02780.2 |
AT2G02780
|
Leucine-rich repeat protein kinase family protein |
Chr1_+_28756521 | 0.73 |
AT1G76620.1
AT1G76620.2 |
AT1G76620
|
Serine/Threonine-kinase, putative (Protein of unknown function, DUF547) |
Chr2_-_17827648 | 0.73 |
AT2G42840.1
|
PDF1
|
protodermal factor 1 |
Chr5_-_24559879 | 0.73 |
AT5G61020.2
AT5G61020.1 |
ECT3
|
evolutionarily conserved C-terminal region 3 |
Chr5_+_26671273 | 0.73 |
AT5G66800.1
|
AT5G66800
|
membrane-associated kinase regulator-like protein |
Chr2_-_19361328 | 0.72 |
AT2G47160.1
|
BOR1
|
HCO3- transporter family |
Chr3_+_19825267 | 0.72 |
AT3G53480.1
|
ABCG37
|
pleiotropic drug resistance 9 |
Chr2_-_19361162 | 0.72 |
AT2G47160.2
|
BOR1
|
HCO3- transporter family |
Chr5_+_1536057 | 0.72 |
AT5G05180.2
AT5G05180.1 AT5G05180.3 |
AT5G05180
|
myosin heavy chain, striated protein |
Chr3_-_20629093 | 0.72 |
AT3G55610.2
|
P5CS2
|
delta 1-pyrroline-5-carboxylate synthase 2 |
Chr4_-_17123855 | 0.72 |
AT4G36180.1
|
AT4G36180
|
Leucine-rich receptor-like protein kinase family protein |
Chr3_+_9848628 | 0.71 |
AT3G26780.1
|
MEF14
|
Phosphoglycerate mutase family protein |
Chr4_-_2992618 | 0.71 |
AT4G05631.1
|
AT4G05631
|
hypothetical protein |
Chr3_+_2167730 | 0.70 |
AT3G06868.1
|
AT3G06868
|
vitellogenin-like protein |
Chr5_-_6684744 | 0.70 |
AT5G19770.1
|
TUA3
|
tubulin alpha-3 |
Chr5_+_18945543 | 0.70 |
AT5G46690.2
AT5G46690.1 |
bHLH071
|
beta HLH protein 71 |
Chr1_+_23527570 | 0.70 |
AT1G63440.1
|
HMA5
|
heavy metal atpase 5 |
Chr1_-_1375742 | 0.70 |
AT1G04870.1
AT1G04870.2 |
PRMT10
|
protein arginine methyltransferase 10 |
Chr5_+_19736540 | 0.69 |
AT5G48660.1
AT5G48660.2 |
AT5G48660
|
B-cell receptor-associated protein 31-like protein |
Chr3_+_18534450 | 0.69 |
AT3G50000.1
|
CKA2
|
casein kinase II, alpha chain 2 |
Chr3_-_4974521 | 0.69 |
AT3G14810.1
AT3G14810.2 |
MSL5
|
mechanosensitive channel of small conductance-like 5 |
Chr4_-_8095749 | 0.69 |
AT4G14020.1
|
AT4G14020
|
Rapid alkalinization factor (RALF) family protein |
Chr1_+_116784 | 0.69 |
AT1G01300.1
|
AT1G01300
|
Eukaryotic aspartyl protease family protein |
Chr5_+_23693259 | 0.68 |
AT5G58620.1
|
AT5G58620
|
zinc finger (CCCH-type) family protein |
Chr5_-_4639835 | 0.68 |
AT5G14390.1
|
AT5G14390
|
alpha/beta-Hydrolases superfamily protein |
Chr1_-_29005281 | 0.68 |
AT1G77200.1
|
AT1G77200
|
Integrase-type DNA-binding superfamily protein |
Chr3_+_6154363 | 0.68 |
AT3G18000.1
|
XPL1
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
Chr5_+_15208358 | 0.67 |
AT5G38110.1
|
ASF1B
|
anti- silencing function 1b |
Chr4_+_1292483 | 0.66 |
AT4G02920.1
AT4G02920.2 |
AT4G02920
|
hypothetical protein |
Chr3_+_10911132 | 0.66 |
AT3G28910.1
AT3G28910.2 |
MYB30
|
myb domain protein 30 |
Chr2_-_12646057 | 0.66 |
AT2G29550.1
|
TUB7
|
tubulin beta-7 chain |
Chr1_+_29356346 | 0.66 |
AT1G78070.2
AT1G78070.3 |
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
Chr5_+_22492892 | 0.66 |
AT5G55530.2
AT5G55530.1 |
AT5G55530
|
Calcium-dependent lipid-binding (CaLB domain) family protein |
Chr5_-_22906764 | 0.66 |
AT5G56580.1
|
MKK6
|
MAP kinase kinase 6 |
Chr5_-_19328940 | 0.66 |
AT5G47700.2
AT5G47700.1 |
AT5G47700
|
60S acidic ribosomal protein family |
Chr1_+_338241 | 0.66 |
AT1G01970.1
|
AT1G01970
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
Chr3_+_4408925 | 0.65 |
AT3G13520.1
|
AGP12
|
arabinogalactan protein 12 |
Chr4_+_12660687 | 0.65 |
AT4G24510.1
|
CER2
|
HXXXD-type acyl-transferase family protein |
Chr5_-_17755742 | 0.65 |
AT5G44110.2
AT5G44110.4 AT5G44110.3 AT5G44110.1 |
ABCI21
|
P-loop containing nucleoside triphosphate hydrolases superfamily protein |
Chr2_-_8088302 | 0.65 |
AT2G18650.1
|
MEE16
|
RING/U-box superfamily protein |
Chr5_-_2665826 | 0.64 |
AT5G08280.1
|
HEMC
|
hydroxymethylbilane synthase |
Chr1_+_22444307 | 0.64 |
AT1G60950.1
|
FED A
|
2Fe-2S ferredoxin-like superfamily protein |
Chr4_+_4886962 | 0.64 |
AT4G08040.1
|
ACS11
|
1-aminocyclopropane-1-carboxylate synthase 11 |
Chr5_+_18530834 | 0.64 |
AT5G45680.1
|
FKBP13
|
FK506-binding protein 13 |
Chr1_-_1307973 | 0.63 |
AT1G04680.1
|
AT1G04680
|
Pectin lyase-like superfamily protein |
Chr4_+_8571816 | 0.63 |
AT4G15000.1
AT4G15000.2 |
AT4G15000
|
Ribosomal L27e protein family |
Chr4_+_15819489 | 0.63 |
AT4G32800.1
|
AT4G32800
|
Integrase-type DNA-binding superfamily protein |
Chr3_+_5116021 | 0.63 |
AT3G15190.1
|
PRPS20
|
chloroplast 30S ribosomal protein S20 |
Chr4_-_15394626 | 0.63 |
AT4G31820.1
AT4G31820.2 |
ENP
|
Phototropic-responsive NPH3 family protein |
Chr5_-_7111352 | 0.63 |
AT5G20950.2
AT5G20950.1 AT5G20950.3 |
AT5G20950
|
Glycosyl hydrolase family protein |
Chr3_+_5720941 | 0.63 |
AT3G16800.5
AT3G16800.4 AT3G16800.2 AT3G16800.6 AT3G16800.1 |
AT3G16800
|
Protein phosphatase 2C family protein |
Chr2_-_13012043 | 0.63 |
AT2G30540.1
|
AT2G30540
|
Thioredoxin superfamily protein |
Chr3_+_21944170 | 0.63 |
AT3G59380.1
|
FTA
|
farnesyltransferase A |
Chr1_-_28407182 | 0.62 |
AT1G75640.1
|
AT1G75640
|
Leucine-rich receptor-like protein kinase family protein |
Chr2_-_13081418 | 0.62 |
AT2G30695.3
AT2G30695.2 AT2G30695.4 AT2G30695.1 |
AT2G30695
|
bacterial trigger factor |
Chr3_+_22973564 | 0.61 |
AT3G62030.3
AT3G62030.1 |
ROC4
|
rotamase CYP 4 |
Chr3_-_11269228 | 0.61 |
AT3G29360.2
AT3G29360.1 |
UGD2
|
UDP-glucose 6-dehydrogenase family protein |
Chr5_+_22493103 | 0.60 |
AT5G55530.3
|
AT5G55530
|
Calcium-dependent lipid-binding (CaLB domain) family protein |
Chr2_-_14390317 | 0.60 |
AT2G34070.1
AT2G34070.2 |
TBL37
|
TRICHOME BIREFRINGENCE-LIKE 37 |
Chr1_+_23730106 | 0.60 |
AT1G63940.4
AT1G63940.3 |
MDAR6
|
monodehydroascorbate reductase 6 |
Chr1_+_20614573 | 0.60 |
AT1G55260.1
AT1G55260.2 |
AT1G55260
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
Chr3_+_8436436 | 0.60 |
AT3G23530.1
|
AT3G23530
|
Cyclopropane-fatty-acyl-phospholipid synthase |
Chr1_+_23729875 | 0.60 |
AT1G63940.2
AT1G63940.1 |
MDAR6
|
monodehydroascorbate reductase 6 |
Chr3_+_22973004 | 0.60 |
AT3G62030.2
|
ROC4
|
rotamase CYP 4 |
Chr1_-_6904155 | 0.59 |
AT1G19880.1
|
AT1G19880
|
Regulator of chromosome condensation (RCC1) family protein |
Chr3_-_19063538 | 0.59 |
AT3G51350.1
|
AT3G51350
|
Eukaryotic aspartyl protease family protein |
Chr3_-_4231408 | 0.59 |
AT3G13160.1
|
AT3G13160
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
Chr3_+_247192 | 0.59 |
AT3G01670.2
AT3G01670.1 |
SEOa
|
sieve element occlusion protein |
Chr3_-_1526166 | 0.59 |
AT3G05340.1
|
AT3G05340
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
Chr1_+_5648636 | 0.59 |
AT1G16520.1
|
AT1G16520
|
interactor of constitutive active ROPs protein |
Chr1_-_6754073 | 0.59 |
AT1G19490.1
|
AT1G19490
|
Basic-leucine zipper (bZIP) transcription factor family protein |
Chr1_-_23716170 | 0.59 |
AT1G63880.2
AT1G63880.1 |
AT1G63880
|
Disease resistance protein (TIR-NBS-LRR class) family |
Chr2_+_17513008 | 0.59 |
AT2G41950.1
|
AT2G41950
|
DNA-directed RNA polymerase subunit beta |
Chr3_+_415389 | 0.58 |
AT3G02230.1
|
RGP1
|
reversibly glycosylated polypeptide 1 |
Chr4_+_16881336 | 0.58 |
AT4G35560.1
AT4G35560.2 |
DAW1
|
Transducin/WD40 repeat-like superfamily protein |
Chr5_-_18021508 | 0.58 |
AT5G44670.1
|
GALS2
|
glycosyltransferase family protein (DUF23) |
Chr5_-_18899646 | 0.58 |
AT5G46580.1
|
AT5G46580
|
pentatricopeptide (PPR) repeat-containing protein |
Chr5_+_5223934 | 0.58 |
AT5G16000.1
|
NIK1
|
NSP-interacting kinase 1 |
Chr4_-_433938 | 0.58 |
AT4G01000.2
AT4G01000.1 |
AT4G01000
|
Ubiquitin-like superfamily protein |
Chr1_+_18724190 | 0.58 |
AT1G50560.1
|
CYP705A25
|
cytochrome P450, family 705, subfamily A, polypeptide 25 |
Chr5_-_9259028 | 0.58 |
AT5G26360.1
|
AT5G26360
|
TCP-1/cpn60 chaperonin family protein |
Chr5_-_556623 | 0.57 |
AT5G02500.1
|
HSC70-1
|
heat shock cognate protein 70-1 |
Chr5_-_556442 | 0.57 |
AT5G02500.2
|
HSC70-1
|
heat shock cognate protein 70-1 |
Chr3_+_3034477 | 0.57 |
AT3G09900.1
|
RABE1e
|
RAB GTPase homolog E1E |
Chr1_-_29239484 | 0.57 |
AT1G77760.1
|
NIA1
|
nitrate reductase 1 |
Chr1_-_8414886 | 0.57 |
AT1G23800.1
AT1G23800.2 |
ALDH2B7
|
aldehyde dehydrogenase 2B7 |
Chr4_-_17899491 | 0.56 |
AT4G38130.2
AT4G38130.1 |
HD1
|
histone deacetylase 1 |
Chr3_-_1238616 | 0.56 |
AT3G04580.1
AT3G04580.2 |
EIN4
|
Signal transduction histidine kinase, hybrid-type, ethylene sensor |
Chr1_+_23833485 | 0.56 |
AT1G64230.1
AT1G64230.3 AT1G64230.5 AT1G64230.4 AT1G64230.2 |
UBC28
|
ubiquitin-conjugating enzyme 28 |
Chr3_-_21402899 | 0.56 |
AT3G57780.5
AT3G57780.4 AT3G57780.3 |
AT3G57780
|
nucleolar-like protein |
Chr1_-_6008501 | 0.56 |
AT1G17480.1
|
IQD7
|
IQ-domain 7 |
Chr3_+_8519136 | 0.56 |
AT3G23670.1
AT3G23670.2 |
KINESIN-12B
|
phragmoplast-associated kinesin-related protein |
Chr3_-_4221647 | 0.56 |
AT3G13120.1
AT3G13120.3 AT3G13120.2 |
AT3G13120
|
Ribosomal protein S10p/S20e family protein |
Chr1_+_23192146 | 0.56 |
AT1G62640.2
AT1G62640.1 |
KAS III
|
3-ketoacyl-acyl carrier protein synthase III |
Chr4_-_7195214 | 0.56 |
AT4G12000.3
AT4G12000.2 AT4G12000.1 |
AT4G12000
|
SNARE associated Golgi protein family |
Chr1_-_21580766 | 0.56 |
AT1G58235.1
|
AT1G58235
|
hypothetical protein |
Chr5_-_7955622 | 0.56 |
AT5G23590.2
|
AT5G23590
|
DNAJ heat shock N-terminal domain-containing protein |
Chr5_+_7912652 | 0.56 |
AT5G23460.1
|
AT5G23460
|
hypothetical protein |
Chr4_-_17104576 | 0.56 |
AT4G36140.2
AT4G36140.1 |
AT4G36140
|
disease resistance protein (TIR-NBS-LRR class) |
Chr2_-_13051773 | 0.56 |
AT2G30640.1
|
MUG2
|
|
Chr2_+_9151940 | 0.56 |
AT2G21390.1
|
AT2G21390
|
Coatomer, alpha subunit |
Chr5_-_25656067 | 0.55 |
AT5G64110.1
|
AT5G64110
|
Peroxidase superfamily protein |
Chr1_+_3449567 | 0.55 |
AT1G10480.1
|
ZFP5
|
zinc finger protein 5 |
Chr3_-_7002435 | 0.55 |
AT3G20050.1
|
TCP-1
|
T-complex protein 1 alpha subunit |
Chr3_+_19648711 | 0.55 |
AT3G52990.1
|
AT3G52990
|
Pyruvate kinase family protein |
Chr3_+_19648880 | 0.55 |
AT3G52990.2
|
AT3G52990
|
Pyruvate kinase family protein |
Chr3_-_7457393 | 0.55 |
AT3G21240.2
AT3G21240.1 AT3G21240.3 |
4CL2
|
4-coumarate:CoA ligase 2 |
Chr4_+_7196364 | 0.55 |
AT4G12005.1
AT4G12005.2 |
AT4G12005
|
hypothetical protein |
Chr5_+_2046785 | 0.55 |
AT5G06660.1
|
AT5G06660
|
transmembrane/coiled-coil protein (Protein of unknown function DUF106, transmembrane) |
Chr1_-_21581165 | 0.55 |
AT1G58235.2
|
AT1G58235
|
hypothetical protein |
Chr4_+_6818058 | 0.55 |
AT4G11175.1
|
AT4G11175
|
Nucleic acid-binding, OB-fold-like protein |
Chr1_+_5705897 | 0.55 |
AT1G16690.1
|
AT1G16690
|
Enhancer of polycomb-like transcription factor protein |
Chr3_+_9295175 | 0.54 |
AT3G25585.5
AT3G25585.1 AT3G25585.3 AT3G25585.4 AT3G25585.2 |
AAPT2
|
aminoalcoholphosphotransferase |
Chr3_-_8456708 | 0.54 |
AT3G23560.1
AT3G23560.2 |
ALF5
|
MATE efflux family protein |
Chr2_+_13381767 | 0.54 |
AT2G31380.1
|
STH
|
salt tolerance homologue |
Chr5_-_24984044 | 0.54 |
AT5G62190.1
|
PRH75
|
DEAD box RNA helicase (PRH75) |
Chr5_+_26664842 | 0.54 |
AT5G66790.1
|
AT5G66790
|
Protein kinase superfamily protein |
Chr1_+_4788463 | 0.54 |
AT1G13980.2
AT1G13980.1 |
GN
|
sec7 domain-containing protein |
Chr5_+_20945676 | 0.54 |
AT5G51560.1
|
AT5G51560
|
Leucine-rich repeat protein kinase family protein |
Chr1_-_20574348 | 0.54 |
AT1G55140.2
AT1G55140.1 |
AT1G55140
|
Ribonuclease III family protein |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 2.5 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
0.4 | 1.7 | GO:0043433 | negative regulation of sequence-specific DNA binding transcription factor activity(GO:0043433) |
0.3 | 1.4 | GO:0046713 | borate transport(GO:0046713) |
0.3 | 0.9 | GO:0051341 | regulation of oxidoreductase activity(GO:0051341) |
0.3 | 0.9 | GO:1990532 | stress response to nickel ion(GO:1990532) |
0.3 | 0.8 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
0.3 | 0.8 | GO:0055047 | generative cell mitosis(GO:0055047) |
0.2 | 0.7 | GO:0071258 | cellular response to gravity(GO:0071258) |
0.2 | 0.7 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine N-methylation(GO:0035246) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.2 | 0.7 | GO:0071461 | cellular response to redox state(GO:0071461) |
0.2 | 0.7 | GO:0019695 | choline metabolic process(GO:0019695) |
0.2 | 1.1 | GO:1902407 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) phragmoplast assembly(GO:0000914) assembly of actomyosin apparatus involved in mitotic cytokinesis(GO:1902407) |
0.2 | 0.7 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.2 | 0.7 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
0.2 | 0.9 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
0.2 | 1.3 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.2 | 0.6 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.2 | 1.1 | GO:0010376 | stomatal complex formation(GO:0010376) |
0.2 | 1.0 | GO:0070861 | regulation of protein exit from endoplasmic reticulum(GO:0070861) positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.2 | 0.6 | GO:0033321 | homomethionine metabolic process(GO:0033321) glucosinolate biosynthetic process from homomethionine(GO:0033506) |
0.2 | 0.8 | GO:0071312 | cellular response to alkaloid(GO:0071312) cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) negative regulation of cellular response to caffeine(GO:1901181) |
0.2 | 0.6 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
0.2 | 0.6 | GO:0019184 | glutathione biosynthetic process(GO:0006750) nonribosomal peptide biosynthetic process(GO:0019184) |
0.2 | 0.7 | GO:0045604 | regulation of epithelial cell differentiation(GO:0030856) regulation of epidermal cell differentiation(GO:0045604) regulation of epidermis development(GO:0045682) |
0.2 | 0.5 | GO:0002009 | establishment of planar polarity(GO:0001736) morphogenesis of a polarized epithelium(GO:0001738) morphogenesis of an epithelium(GO:0002009) tissue morphogenesis(GO:0048729) |
0.2 | 0.2 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.2 | 0.5 | GO:0010372 | positive regulation of gibberellin biosynthetic process(GO:0010372) |
0.2 | 0.2 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.2 | 2.0 | GO:0017157 | regulation of exocytosis(GO:0017157) |
0.2 | 0.5 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.2 | 0.5 | GO:0031506 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) response to cobalt ion(GO:0032025) |
0.2 | 0.7 | GO:0019586 | uronic acid metabolic process(GO:0006063) galacturonate metabolic process(GO:0019586) |
0.2 | 0.7 | GO:0007112 | male meiosis cytokinesis(GO:0007112) |
0.2 | 0.5 | GO:0015755 | hexose transport(GO:0008645) fructose transport(GO:0015755) |
0.2 | 0.5 | GO:0060776 | simple leaf morphogenesis(GO:0060776) |
0.2 | 0.6 | GO:0019322 | pentose biosynthetic process(GO:0019322) arabinose biosynthetic process(GO:0019567) |
0.2 | 1.5 | GO:0048579 | negative regulation of long-day photoperiodism, flowering(GO:0048579) |
0.2 | 2.6 | GO:0006074 | (1->3)-beta-D-glucan metabolic process(GO:0006074) (1->3)-beta-D-glucan biosynthetic process(GO:0006075) |
0.2 | 0.6 | GO:0006023 | aminoglycan biosynthetic process(GO:0006023) glycosaminoglycan biosynthetic process(GO:0006024) UDP-glucuronate biosynthetic process(GO:0006065) glycosaminoglycan metabolic process(GO:0030203) |
0.2 | 2.9 | GO:0010555 | response to mannitol(GO:0010555) |
0.2 | 1.4 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
0.1 | 0.4 | GO:0090213 | regulation of radial pattern formation(GO:0090213) |
0.1 | 0.7 | GO:0071366 | cellular response to indolebutyric acid stimulus(GO:0071366) |
0.1 | 0.4 | GO:1904215 | regulation of protein import into chloroplast stroma(GO:1904215) |
0.1 | 0.1 | GO:0034969 | histone arginine methylation(GO:0034969) |
0.1 | 0.7 | GO:0010589 | leaf proximal/distal pattern formation(GO:0010589) |
0.1 | 0.6 | GO:2000736 | regulation of stem cell population maintenance(GO:2000036) regulation of stem cell differentiation(GO:2000736) |
0.1 | 0.3 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) attachment of spindle microtubules to kinetochore involved in homologous chromosome segregation(GO:0051455) microtubule cytoskeleton organization involved in homologous chromosome segregation(GO:0090172) |
0.1 | 0.4 | GO:0035017 | cuticle pattern formation(GO:0035017) |
0.1 | 0.4 | GO:0070922 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) small RNA loading onto RISC(GO:0070922) |
0.1 | 0.7 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 0.7 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
0.1 | 1.1 | GO:0016045 | detection of bacterium(GO:0016045) |
0.1 | 1.0 | GO:0080142 | regulation of salicylic acid biosynthetic process(GO:0080142) |
0.1 | 0.7 | GO:0042550 | photosystem I stabilization(GO:0042550) |
0.1 | 0.7 | GO:0015824 | proline transport(GO:0015824) |
0.1 | 0.4 | GO:0009558 | embryo sac cellularization(GO:0009558) |
0.1 | 0.5 | GO:0010070 | zygote asymmetric cell division(GO:0010070) |
0.1 | 0.8 | GO:1900367 | positive regulation of defense response to insect(GO:1900367) |
0.1 | 0.6 | GO:0006809 | nitric oxide biosynthetic process(GO:0006809) |
0.1 | 0.4 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.1 | 0.8 | GO:0009769 | photosynthesis, light harvesting in photosystem II(GO:0009769) |
0.1 | 0.5 | GO:0010480 | microsporocyte differentiation(GO:0010480) |
0.1 | 0.4 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 1.8 | GO:0010497 | plasmodesmata-mediated intercellular transport(GO:0010497) |
0.1 | 0.4 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
0.1 | 0.7 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.1 | 0.2 | GO:0051046 | regulation of secretion(GO:0051046) regulation of secretion by cell(GO:1903530) |
0.1 | 0.2 | GO:1901672 | positive regulation of systemic acquired resistance(GO:1901672) |
0.1 | 1.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.6 | GO:0045911 | positive regulation of DNA recombination(GO:0045911) |
0.1 | 0.3 | GO:0019279 | L-methionine biosynthetic process from L-homoserine via cystathionine(GO:0019279) 'de novo' L-methionine biosynthetic process(GO:0071266) |
0.1 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 0.3 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.1 | 0.4 | GO:0009660 | amyloplast organization(GO:0009660) |
0.1 | 0.6 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.1 | 0.6 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) |
0.1 | 0.3 | GO:1902066 | regulation of cell wall pectin metabolic process(GO:1902066) |
0.1 | 0.3 | GO:0080051 | cutin transport(GO:0080051) |
0.1 | 0.3 | GO:0000472 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.1 | 1.7 | GO:0010039 | response to iron ion(GO:0010039) |
0.1 | 0.5 | GO:0048464 | sepal development(GO:0048442) flower calyx development(GO:0048464) |
0.1 | 0.3 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.1 | 1.0 | GO:0080110 | sporopollenin biosynthetic process(GO:0080110) |
0.1 | 0.2 | GO:0080171 | lytic vacuole organization(GO:0080171) |
0.1 | 0.5 | GO:0048455 | stamen formation(GO:0048455) |
0.1 | 1.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.5 | GO:0007035 | vacuolar acidification(GO:0007035) intracellular pH reduction(GO:0051452) |
0.1 | 0.5 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
0.1 | 0.3 | GO:0010541 | acropetal auxin transport(GO:0010541) |
0.1 | 0.2 | GO:0010045 | response to nickel cation(GO:0010045) |
0.1 | 0.4 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.1 | 0.3 | GO:0010434 | nectary development(GO:0010254) bract morphogenesis(GO:0010433) bract formation(GO:0010434) |
0.1 | 0.7 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
0.1 | 3.0 | GO:0070417 | cellular response to cold(GO:0070417) |
0.1 | 0.4 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.1 | 0.3 | GO:0033259 | plastid DNA metabolic process(GO:0033258) plastid DNA replication(GO:0033259) |
0.1 | 0.3 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) regulation of defense response to fungus, incompatible interaction(GO:2000072) |
0.1 | 0.3 | GO:0080141 | regulation of jasmonic acid metabolic process(GO:0080140) regulation of jasmonic acid biosynthetic process(GO:0080141) |
0.1 | 0.4 | GO:0015739 | sialic acid transport(GO:0015739) |
0.1 | 0.3 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.1 | 0.4 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.3 | GO:0010483 | pollen tube reception(GO:0010483) intraspecies interaction between organisms(GO:0051703) |
0.1 | 0.8 | GO:0043096 | adenine salvage(GO:0006168) purine nucleobase salvage(GO:0043096) |
0.1 | 0.9 | GO:0045040 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.3 | GO:0015804 | neutral amino acid transport(GO:0015804) |
0.1 | 1.1 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.1 | 0.3 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) protein to membrane docking(GO:0022615) |
0.1 | 0.3 | GO:0034982 | mitochondrial protein processing(GO:0034982) cristae formation(GO:0042407) |
0.1 | 0.3 | GO:0033306 | phytol metabolic process(GO:0033306) |
0.1 | 0.3 | GO:0033240 | positive regulation of cellular amine metabolic process(GO:0033240) positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.1 | 0.4 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.9 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) phosphatidylethanolamine metabolic process(GO:0046337) |
0.1 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.5 | GO:1900036 | positive regulation of cellular response to heat(GO:1900036) |
0.1 | 0.3 | GO:1902446 | regulation of shade avoidance(GO:1902446) positive regulation of shade avoidance(GO:1902448) |
0.1 | 0.3 | GO:0097054 | L-glutamate biosynthetic process(GO:0097054) |
0.1 | 0.6 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.1 | 0.3 | GO:0019474 | lysine catabolic process(GO:0006554) L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) L-lysine metabolic process(GO:0046440) |
0.1 | 0.6 | GO:0009643 | photosynthetic acclimation(GO:0009643) |
0.1 | 0.4 | GO:0010080 | regulation of floral meristem growth(GO:0010080) inflorescence meristem growth(GO:0010450) |
0.1 | 0.6 | GO:0010065 | primary meristem tissue development(GO:0010065) |
0.1 | 0.7 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.1 | 1.5 | GO:0010072 | primary shoot apical meristem specification(GO:0010072) |
0.1 | 0.2 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) single-organism membrane invagination(GO:1902534) |
0.1 | 0.4 | GO:0060919 | auxin influx(GO:0060919) |
0.1 | 0.7 | GO:0018107 | peptidyl-threonine phosphorylation(GO:0018107) peptidyl-threonine modification(GO:0018210) |
0.1 | 0.2 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
0.1 | 0.2 | GO:0090549 | response to carbon starvation(GO:0090549) |
0.1 | 0.5 | GO:0043100 | pyrimidine nucleobase salvage(GO:0043100) |
0.1 | 0.4 | GO:0005980 | glycogen catabolic process(GO:0005980) |
0.1 | 0.4 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 0.6 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
0.1 | 0.2 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.1 | 0.5 | GO:0045038 | protein import into chloroplast thylakoid membrane(GO:0045038) |
0.1 | 1.5 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
0.1 | 1.0 | GO:0010417 | glucuronoxylan metabolic process(GO:0010413) glucuronoxylan biosynthetic process(GO:0010417) |
0.1 | 0.2 | GO:0042353 | fucose biosynthetic process(GO:0042353) |
0.1 | 1.4 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.1 | 0.2 | GO:0080175 | phragmoplast microtubule organization(GO:0080175) |
0.1 | 1.1 | GO:0005986 | sucrose biosynthetic process(GO:0005986) |
0.1 | 0.7 | GO:0071249 | cellular response to nitrate(GO:0071249) |
0.1 | 0.9 | GO:0060627 | regulation of vesicle-mediated transport(GO:0060627) |
0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.4 | GO:1900370 | positive regulation of RNA interference(GO:1900370) |
0.1 | 2.4 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.1 | 0.3 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.1 | 0.6 | GO:0031222 | arabinan catabolic process(GO:0031222) |
0.1 | 0.3 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
0.1 | 0.5 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.1 | 0.3 | GO:0070509 | calcium ion import(GO:0070509) |
0.1 | 0.6 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) |
0.1 | 1.6 | GO:0007264 | small GTPase mediated signal transduction(GO:0007264) |
0.1 | 0.3 | GO:0052546 | cell wall pectin metabolic process(GO:0052546) |
0.1 | 0.6 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 1.5 | GO:0045037 | protein import into chloroplast stroma(GO:0045037) |
0.1 | 0.2 | GO:0009945 | radial axis specification(GO:0009945) |
0.1 | 0.3 | GO:0048281 | inflorescence morphogenesis(GO:0048281) |
0.1 | 0.6 | GO:0010540 | basipetal auxin transport(GO:0010540) |
0.1 | 0.5 | GO:0032456 | endocytic recycling(GO:0032456) |
0.1 | 0.8 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.2 | GO:0090392 | regulation of multicellular organism growth(GO:0040014) sepal giant cell differentiation(GO:0090392) regulation of adaxial/abaxial pattern formation(GO:2000011) |
0.1 | 0.8 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.1 | 0.2 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) positive regulation of lipid catabolic process(GO:0050996) |
0.1 | 0.3 | GO:0006901 | vesicle coating(GO:0006901) |
0.1 | 0.2 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
0.1 | 0.9 | GO:0010105 | negative regulation of ethylene-activated signaling pathway(GO:0010105) negative regulation of phosphorelay signal transduction system(GO:0070298) |
0.1 | 0.3 | GO:0051601 | exocyst localization(GO:0051601) |
0.1 | 0.1 | GO:0031542 | positive regulation of anthocyanin biosynthetic process(GO:0031542) |
0.1 | 0.2 | GO:1990882 | rRNA acetylation involved in maturation of SSU-rRNA(GO:1904812) rRNA acetylation(GO:1990882) RNA acetylation(GO:1990884) |
0.1 | 0.2 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.1 | 0.3 | GO:0009647 | skotomorphogenesis(GO:0009647) |
0.1 | 2.5 | GO:0045489 | pectin biosynthetic process(GO:0045489) |
0.1 | 0.6 | GO:0010088 | phloem development(GO:0010088) |
0.1 | 0.2 | GO:1903513 | retrograde protein transport, ER to cytosol(GO:0030970) endoplasmic reticulum to cytosol transport(GO:1903513) |
0.1 | 0.2 | GO:1900369 | negative regulation of gene silencing by RNA(GO:0060967) negative regulation of RNA interference(GO:1900369) |
0.1 | 1.3 | GO:0009913 | epidermis development(GO:0008544) epidermal cell differentiation(GO:0009913) epithelial cell differentiation(GO:0030855) |
0.1 | 0.6 | GO:0009768 | photosynthesis, light harvesting in photosystem I(GO:0009768) |
0.1 | 1.7 | GO:0042026 | protein refolding(GO:0042026) |
0.1 | 0.2 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 0.4 | GO:0090506 | axillary shoot meristem initiation(GO:0090506) |
0.1 | 0.1 | GO:0070827 | cellular component maintenance(GO:0043954) chromatin maintenance(GO:0070827) |
0.1 | 0.4 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.1 | 0.4 | GO:0033617 | respiratory chain complex IV assembly(GO:0008535) mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 0.8 | GO:0048766 | root hair initiation(GO:0048766) |
0.1 | 0.2 | GO:0042817 | pyridoxal metabolic process(GO:0042817) |
0.1 | 0.7 | GO:0046785 | microtubule polymerization(GO:0046785) |
0.1 | 0.2 | GO:0009088 | threonine biosynthetic process(GO:0009088) |
0.1 | 0.2 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.1 | 1.2 | GO:0009638 | phototropism(GO:0009638) |
0.1 | 0.2 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.1 | 0.3 | GO:0051320 | mitotic G1 phase(GO:0000080) mitotic S phase(GO:0000084) mitotic G2 phase(GO:0000085) G1 phase(GO:0051318) G2 phase(GO:0051319) S phase(GO:0051320) interphase(GO:0051325) mitotic interphase(GO:0051329) |
0.1 | 0.5 | GO:0007105 | preprophase band assembly(GO:0000913) cytokinesis, site selection(GO:0007105) mitotic cytokinesis, site selection(GO:1902408) |
0.1 | 0.3 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.1 | 0.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.2 | GO:0048530 | fruit morphogenesis(GO:0048530) |
0.1 | 0.3 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.1 | 0.3 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) respiratory burst(GO:0045730) |
0.1 | 0.5 | GO:0060321 | acceptance of pollen(GO:0060321) |
0.0 | 0.3 | GO:0048871 | multicellular organismal homeostasis(GO:0048871) |
0.0 | 0.2 | GO:0034471 | rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
0.0 | 0.4 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.1 | GO:1903312 | negative regulation of mRNA 3'-end processing(GO:0031441) negative regulation of mRNA processing(GO:0050686) negative regulation of mRNA polyadenylation(GO:1900364) negative regulation of mRNA metabolic process(GO:1903312) |
0.0 | 0.6 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.5 | GO:0016925 | protein sumoylation(GO:0016925) |
0.0 | 0.1 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
0.0 | 2.6 | GO:0009631 | cold acclimation(GO:0009631) |
0.0 | 0.5 | GO:0010232 | vascular transport(GO:0010232) phloem transport(GO:0010233) |
0.0 | 0.7 | GO:0006547 | histidine biosynthetic process(GO:0000105) histidine metabolic process(GO:0006547) imidazole-containing compound metabolic process(GO:0052803) |
0.0 | 0.2 | GO:0080001 | mucilage extrusion from seed coat(GO:0080001) |
0.0 | 1.0 | GO:1902099 | regulation of mitotic metaphase/anaphase transition(GO:0030071) regulation of metaphase/anaphase transition of cell cycle(GO:1902099) |
0.0 | 0.4 | GO:0090355 | positive regulation of auxin metabolic process(GO:0090355) |
0.0 | 0.4 | GO:0034312 | sphingosine metabolic process(GO:0006670) diol metabolic process(GO:0034311) diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.0 | 0.2 | GO:0080121 | AMP transport(GO:0080121) |
0.0 | 0.4 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.0 | 0.2 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.0 | 0.5 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.4 | GO:0032922 | circadian regulation of gene expression(GO:0032922) |
0.0 | 0.9 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.6 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.8 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.1 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
0.0 | 0.4 | GO:0033750 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
0.0 | 0.2 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
0.0 | 0.2 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.2 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.4 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
0.0 | 0.8 | GO:0045927 | positive regulation of growth(GO:0045927) |
0.0 | 0.3 | GO:2000306 | positive regulation of photomorphogenesis(GO:2000306) |
0.0 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.1 | GO:0010235 | guard mother cell cytokinesis(GO:0010235) |
0.0 | 0.4 | GO:0071329 | cellular response to disaccharide stimulus(GO:0071324) cellular response to sucrose stimulus(GO:0071329) |
0.0 | 0.7 | GO:0009645 | response to low light intensity stimulus(GO:0009645) |
0.0 | 0.7 | GO:2000012 | regulation of auxin polar transport(GO:2000012) |
0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.2 | GO:0009969 | xyloglucan biosynthetic process(GO:0009969) |
0.0 | 0.5 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.0 | 0.1 | GO:0009584 | detection of visible light(GO:0009584) |
0.0 | 0.3 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
0.0 | 0.3 | GO:0006565 | L-serine catabolic process(GO:0006565) glycine biosynthetic process from serine(GO:0019264) response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
0.0 | 0.0 | GO:0032388 | positive regulation of intracellular transport(GO:0032388) |
0.0 | 0.6 | GO:0009089 | lysine biosynthetic process via diaminopimelate(GO:0009089) diaminopimelate metabolic process(GO:0046451) |
0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.1 | GO:0090114 | COPII-coated vesicle budding(GO:0090114) |
0.0 | 0.1 | GO:0060860 | regulation of floral organ abscission(GO:0060860) negative regulation of floral organ abscission(GO:0060862) |
0.0 | 0.8 | GO:0009294 | genetic transfer(GO:0009292) DNA mediated transformation(GO:0009294) |
0.0 | 0.7 | GO:0031425 | chloroplast RNA processing(GO:0031425) |
0.0 | 0.1 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.0 | 0.4 | GO:0031647 | regulation of protein stability(GO:0031647) |
0.0 | 0.8 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.2 | GO:0009720 | detection of hormone stimulus(GO:0009720) detection of endogenous stimulus(GO:0009726) |
0.0 | 0.2 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.3 | GO:0050879 | circumnutation(GO:0010031) multicellular organismal movement(GO:0050879) |
0.0 | 0.1 | GO:0071219 | cellular response to molecule of bacterial origin(GO:0071219) |
0.0 | 0.5 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.1 | GO:0048451 | petal formation(GO:0048451) |
0.0 | 0.3 | GO:0010506 | regulation of autophagy(GO:0010506) |
0.0 | 0.2 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.0 | 1.6 | GO:0009817 | defense response to fungus, incompatible interaction(GO:0009817) |
0.0 | 0.3 | GO:1902290 | positive regulation of defense response to oomycetes(GO:1902290) |
0.0 | 0.3 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.0 | 0.2 | GO:1900911 | regulation of ethylene biosynthetic process(GO:0010364) regulation of sulfur amino acid metabolic process(GO:0031335) regulation of olefin metabolic process(GO:1900908) regulation of olefin biosynthetic process(GO:1900911) |
0.0 | 0.1 | GO:0032527 | protein exit from endoplasmic reticulum(GO:0032527) |
0.0 | 1.4 | GO:0006897 | endocytosis(GO:0006897) |
0.0 | 0.2 | GO:0051214 | RNA virus induced gene silencing(GO:0051214) |
0.0 | 0.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.6 | GO:1900674 | ethylene metabolic process(GO:0009692) ethylene biosynthetic process(GO:0009693) cellular alkene metabolic process(GO:0043449) alkene biosynthetic process(GO:0043450) olefin metabolic process(GO:1900673) olefin biosynthetic process(GO:1900674) |
0.0 | 0.7 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
0.0 | 1.2 | GO:0000122 | negative regulation of transcription from RNA polymerase II promoter(GO:0000122) |
0.0 | 0.5 | GO:0050779 | RNA destabilization(GO:0050779) mRNA destabilization(GO:0061157) |
0.0 | 0.1 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
0.0 | 1.3 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.1 | GO:1902464 | histone H3-K27 trimethylation(GO:0098532) regulation of histone H3-K27 trimethylation(GO:1902464) |
0.0 | 0.2 | GO:0010337 | regulation of salicylic acid metabolic process(GO:0010337) |
0.0 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.2 | GO:0010358 | leaf shaping(GO:0010358) |
0.0 | 0.1 | GO:0097576 | regulation of vacuole fusion, non-autophagic(GO:0032889) vacuole fusion, non-autophagic(GO:0042144) regulation of vacuole organization(GO:0044088) vacuole fusion(GO:0097576) |
0.0 | 0.2 | GO:0010189 | vitamin E biosynthetic process(GO:0010189) vitamin E metabolic process(GO:0042360) |
0.0 | 0.2 | GO:0009942 | longitudinal axis specification(GO:0009942) |
0.0 | 0.1 | GO:0019048 | modulation by virus of host morphology or physiology(GO:0019048) |
0.0 | 3.6 | GO:0006457 | protein folding(GO:0006457) |
0.0 | 0.1 | GO:0010321 | regulation of vegetative phase change(GO:0010321) |
0.0 | 0.2 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.1 | GO:0048479 | style development(GO:0048479) |
0.0 | 0.7 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.2 | GO:0006821 | chloride transport(GO:0006821) |
0.0 | 0.1 | GO:0072387 | FAD metabolic process(GO:0046443) flavin adenine dinucleotide metabolic process(GO:0072387) |
0.0 | 0.3 | GO:0044070 | regulation of anion transport(GO:0044070) |
0.0 | 0.1 | GO:0019627 | urea metabolic process(GO:0019627) |
0.0 | 0.3 | GO:1902223 | L-phenylalanine biosynthetic process(GO:0009094) erythrose 4-phosphate/phosphoenolpyruvate family amino acid biosynthetic process(GO:1902223) |
0.0 | 0.3 | GO:0051567 | histone H3-K9 methylation(GO:0051567) |
0.0 | 0.1 | GO:0080186 | developmental vegetative growth(GO:0080186) |
0.0 | 4.6 | GO:0046777 | protein autophosphorylation(GO:0046777) |
0.0 | 0.2 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.5 | GO:1900150 | regulation of defense response to fungus(GO:1900150) |
0.0 | 1.4 | GO:0046488 | phosphatidylinositol metabolic process(GO:0046488) |
0.0 | 0.1 | GO:0048255 | mRNA stabilization(GO:0048255) |
0.0 | 0.1 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
0.0 | 0.1 | GO:0034308 | primary alcohol metabolic process(GO:0034308) |
0.0 | 0.4 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.3 | GO:0010100 | negative regulation of photomorphogenesis(GO:0010100) |
0.0 | 0.1 | GO:0051513 | regulation of monopolar cell growth(GO:0051513) |
0.0 | 0.3 | GO:1902074 | response to salt(GO:1902074) |
0.0 | 0.6 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.5 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.2 | GO:0006828 | manganese ion transport(GO:0006828) |
0.0 | 0.4 | GO:0031167 | rRNA methylation(GO:0031167) |
0.0 | 0.0 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.0 | 0.1 | GO:0046506 | sulfolipid metabolic process(GO:0046505) sulfolipid biosynthetic process(GO:0046506) |
0.0 | 0.3 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
0.0 | 0.1 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
0.0 | 0.8 | GO:0009846 | pollen germination(GO:0009846) |
0.0 | 3.6 | GO:0007017 | microtubule-based process(GO:0007017) |
0.0 | 0.3 | GO:0010305 | leaf vascular tissue pattern formation(GO:0010305) |
0.0 | 0.2 | GO:0031540 | regulation of anthocyanin biosynthetic process(GO:0031540) |
0.0 | 0.3 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.3 | GO:0046341 | CDP-diacylglycerol biosynthetic process(GO:0016024) CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.2 | GO:1905156 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) negative regulation of photosynthesis(GO:1905156) |
0.0 | 0.4 | GO:0010143 | cutin biosynthetic process(GO:0010143) |
0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.3 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
0.0 | 0.0 | GO:0017006 | protein-tetrapyrrole linkage(GO:0017006) |
0.0 | 0.1 | GO:0010019 | chloroplast-nucleus signaling pathway(GO:0010019) |
0.0 | 0.1 | GO:0010161 | red light signaling pathway(GO:0010161) |
0.0 | 0.6 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 0.1 | GO:0090342 | cell aging(GO:0007569) regulation of cell aging(GO:0090342) |
0.0 | 0.1 | GO:0031930 | mitochondria-nucleus signaling pathway(GO:0031930) |
0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.0 | 0.1 | GO:0030522 | blue light signaling pathway(GO:0009785) intracellular receptor signaling pathway(GO:0030522) |
0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.3 | GO:0010821 | regulation of mitochondrion organization(GO:0010821) |
0.0 | 2.4 | GO:0043413 | protein glycosylation(GO:0006486) glycoprotein biosynthetic process(GO:0009101) macromolecule glycosylation(GO:0043413) |
0.0 | 0.7 | GO:0042752 | regulation of circadian rhythm(GO:0042752) |
0.0 | 0.0 | GO:0046398 | UDP-glucuronate metabolic process(GO:0046398) |
0.0 | 0.1 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
0.0 | 1.4 | GO:0046939 | nucleotide phosphorylation(GO:0046939) |
0.0 | 0.2 | GO:0016575 | histone deacetylation(GO:0016575) |
0.0 | 0.1 | GO:0042493 | response to drug(GO:0042493) |
0.0 | 0.1 | GO:0090207 | regulation of triglyceride metabolic process(GO:0090207) mitochondrial mRNA processing(GO:0090615) |
0.0 | 0.2 | GO:0032273 | positive regulation of actin filament polymerization(GO:0030838) positive regulation of protein polymerization(GO:0032273) actin nucleation(GO:0045010) |
0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.0 | GO:1902583 | multi-organism intracellular transport(GO:1902583) |
0.0 | 0.1 | GO:0033619 | membrane protein proteolysis(GO:0033619) |
0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 0.1 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
0.0 | 0.4 | GO:0010043 | response to zinc ion(GO:0010043) |
0.0 | 0.2 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.0 | 0.3 | GO:0048574 | long-day photoperiodism, flowering(GO:0048574) |
0.0 | 0.4 | GO:0010075 | regulation of meristem growth(GO:0010075) |
0.0 | 0.4 | GO:1902645 | abscisic acid biosynthetic process(GO:0009688) apocarotenoid biosynthetic process(GO:0043289) tertiary alcohol biosynthetic process(GO:1902645) |
0.0 | 0.2 | GO:0043967 | histone H4 acetylation(GO:0043967) |
0.0 | 0.2 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
0.0 | 0.0 | GO:1902457 | negative regulation of stomatal opening(GO:1902457) |
0.0 | 0.1 | GO:0080183 | response to photooxidative stress(GO:0080183) |
0.0 | 0.4 | GO:0006743 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) |
0.0 | 0.1 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.0 | 0.1 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.1 | GO:0010098 | suspensor development(GO:0010098) |
0.0 | 0.3 | GO:0015985 | ATP biosynthetic process(GO:0006754) energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.1 | GO:0006513 | protein monoubiquitination(GO:0006513) |
0.0 | 0.2 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.2 | GO:0071484 | cellular response to light intensity(GO:0071484) |
0.0 | 0.4 | GO:0070585 | protein targeting to mitochondrion(GO:0006626) protein localization to mitochondrion(GO:0070585) establishment of protein localization to mitochondrion(GO:0072655) |
0.0 | 0.6 | GO:0042176 | regulation of protein catabolic process(GO:0042176) |
0.0 | 0.2 | GO:0042793 | transcription from plastid promoter(GO:0042793) |
0.0 | 0.4 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) maintenance of floral organ identity(GO:0048497) |
0.0 | 0.2 | GO:0005987 | sucrose catabolic process(GO:0005987) |
0.0 | 0.2 | GO:0016104 | triterpenoid biosynthetic process(GO:0016104) |
0.0 | 0.8 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.0 | 0.2 | GO:0035196 | production of miRNAs involved in gene silencing by miRNA(GO:0035196) |
0.0 | 0.0 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
0.0 | 0.1 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
0.0 | 1.9 | GO:0009451 | RNA modification(GO:0009451) |
0.0 | 0.1 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.0 | 0.0 | GO:0045851 | pH reduction(GO:0045851) |
0.0 | 1.8 | GO:0009657 | plastid organization(GO:0009657) |
0.0 | 0.1 | GO:0009854 | oxidative photosynthetic carbon pathway(GO:0009854) |
0.0 | 0.0 | GO:0051668 | localization within membrane(GO:0051668) |
0.0 | 0.4 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.4 | GO:0043673 | lateral plasma membrane(GO:0016328) pollen wall(GO:0043667) exine(GO:0043668) sexine(GO:0043673) columella(GO:0043674) |
0.3 | 1.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.2 | 3.0 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 0.7 | GO:0042709 | succinate-CoA ligase complex(GO:0042709) |
0.2 | 0.9 | GO:0018444 | translation release factor complex(GO:0018444) |
0.2 | 1.9 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.2 | 0.5 | GO:1990112 | RQC complex(GO:1990112) |
0.2 | 3.2 | GO:0000148 | 1,3-beta-D-glucan synthase complex(GO:0000148) |
0.2 | 0.8 | GO:0034425 | etioplast envelope(GO:0034425) etioplast membrane(GO:0034426) |
0.2 | 1.1 | GO:0090395 | plant cell papilla(GO:0090395) |
0.1 | 1.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 0.7 | GO:0034515 | proteasome storage granule(GO:0034515) |
0.1 | 0.5 | GO:0030870 | Mre11 complex(GO:0030870) |
0.1 | 0.3 | GO:0044426 | cell wall part(GO:0044426) external encapsulating structure part(GO:0044462) |
0.1 | 0.1 | GO:0043230 | extracellular organelle(GO:0043230) extracellular exosome(GO:0070062) extracellular vesicle(GO:1903561) |
0.1 | 0.3 | GO:1990298 | bub1-bub3 complex(GO:1990298) |
0.1 | 0.6 | GO:0030126 | COPI vesicle coat(GO:0030126) COPI-coated vesicle membrane(GO:0030663) |
0.1 | 1.1 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 0.6 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 1.0 | GO:0001401 | mitochondrial sorting and assembly machinery complex(GO:0001401) |
0.1 | 0.4 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
0.1 | 0.5 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 0.4 | GO:0070505 | pollen coat(GO:0070505) |
0.1 | 0.4 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.5 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 2.1 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.3 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.1 | 0.5 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
0.1 | 0.6 | GO:0009840 | chloroplastic endopeptidase Clp complex(GO:0009840) |
0.1 | 0.5 | GO:0031372 | ubiquitin conjugating enzyme complex(GO:0031371) UBC13-MMS2 complex(GO:0031372) |
0.1 | 0.5 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.1 | 2.2 | GO:0055028 | cortical microtubule(GO:0055028) |
0.1 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.8 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
0.1 | 0.8 | GO:0000974 | Prp19 complex(GO:0000974) |
0.1 | 0.6 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 0.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 1.0 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.1 | 0.3 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 0.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.5 | GO:0030118 | clathrin coat(GO:0030118) |
0.1 | 0.6 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.1 | 0.2 | GO:0034272 | phosphatidylinositol 3-kinase complex(GO:0005942) phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 0.2 | GO:0032153 | cell division site(GO:0032153) |
0.1 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 2.6 | GO:0009707 | chloroplast outer membrane(GO:0009707) |
0.1 | 0.8 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 0.4 | GO:0030897 | HOPS complex(GO:0030897) |
0.1 | 1.2 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.1 | 0.8 | GO:0031902 | late endosome membrane(GO:0031902) |
0.1 | 0.3 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.1 | 0.5 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 1.2 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.2 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.0 | 0.5 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.0 | 0.3 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 6.3 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 4.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.0 | 0.4 | GO:0009986 | cell surface(GO:0009986) |
0.0 | 0.2 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.1 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.0 | 0.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.6 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 1.0 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 1.3 | GO:0009504 | cell plate(GO:0009504) |
0.0 | 1.0 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 1.2 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.3 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 1.5 | GO:0010319 | stromule(GO:0010319) |
0.0 | 0.3 | GO:0009503 | thylakoid light-harvesting complex(GO:0009503) PSII associated light-harvesting complex II(GO:0009517) light-harvesting complex(GO:0030076) |
0.0 | 0.5 | GO:0005769 | early endosome(GO:0005769) |
0.0 | 0.4 | GO:0005763 | mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.3 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.0 | 0.5 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.8 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.3 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 3.2 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.2 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.2 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.9 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 5.1 | GO:0009505 | plant-type cell wall(GO:0009505) |
0.0 | 0.2 | GO:0005685 | U1 snRNP(GO:0005685) |
0.0 | 0.2 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 1.2 | GO:0009543 | chloroplast thylakoid lumen(GO:0009543) plastid thylakoid lumen(GO:0031978) |
0.0 | 0.4 | GO:0031977 | thylakoid lumen(GO:0031977) |
0.0 | 0.1 | GO:0071818 | BAT3 complex(GO:0071818) |
0.0 | 0.2 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.5 | GO:0030427 | site of polarized growth(GO:0030427) |
0.0 | 1.4 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.0 | 0.1 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.0 | 0.3 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.4 | GO:0031228 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
0.0 | 2.2 | GO:0015935 | small ribosomal subunit(GO:0015935) |
0.0 | 4.6 | GO:0005768 | endosome(GO:0005768) |
0.0 | 0.2 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
0.0 | 0.1 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.1 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
0.0 | 0.5 | GO:0005938 | cell cortex(GO:0005938) cytoplasmic region(GO:0099568) |
0.0 | 0.1 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.6 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.3 | GO:0000347 | THO complex(GO:0000347) |
0.0 | 0.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.2 | GO:0048500 | signal recognition particle(GO:0048500) |
0.0 | 0.3 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.3 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
0.0 | 0.6 | GO:0009524 | phragmoplast(GO:0009524) |
0.0 | 1.0 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 2.5 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 9.8 | GO:0009570 | chloroplast stroma(GO:0009570) |
0.0 | 10.0 | GO:0055044 | cell-cell junction(GO:0005911) plasmodesma(GO:0009506) cell junction(GO:0030054) symplast(GO:0055044) |
0.0 | 0.2 | GO:0009574 | preprophase band(GO:0009574) |
0.0 | 0.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.2 | GO:0045261 | proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.6 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.2 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.1 | GO:0004350 | glutamate 5-kinase activity(GO:0004349) glutamate-5-semialdehyde dehydrogenase activity(GO:0004350) |
0.3 | 0.3 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.3 | 0.9 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.3 | 1.4 | GO:0080139 | borate transmembrane transporter activity(GO:0046715) borate efflux transmembrane transporter activity(GO:0080139) |
0.3 | 1.1 | GO:0050162 | oxalate oxidase activity(GO:0050162) |
0.3 | 0.8 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) protein kinase C binding(GO:0005080) protein complex scaffold(GO:0032947) signaling adaptor activity(GO:0035591) |
0.2 | 0.7 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
0.2 | 0.9 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
0.2 | 0.7 | GO:0016277 | [myelin basic protein]-arginine N-methyltransferase activity(GO:0016277) |
0.2 | 0.7 | GO:0000234 | phosphoethanolamine N-methyltransferase activity(GO:0000234) |
0.2 | 0.7 | GO:0004775 | succinate-CoA ligase activity(GO:0004774) succinate-CoA ligase (ADP-forming) activity(GO:0004775) succinate-CoA ligase (GDP-forming) activity(GO:0004776) |
0.2 | 0.9 | GO:0016656 | monodehydroascorbate reductase (NADH) activity(GO:0016656) |
0.2 | 0.6 | GO:0070336 | Y-form DNA binding(GO:0000403) flap-structured DNA binding(GO:0070336) |
0.2 | 1.4 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.2 | 0.6 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.2 | 0.9 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.2 | 0.9 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.2 | 0.9 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.2 | 0.5 | GO:0019003 | GDP binding(GO:0019003) |
0.2 | 0.9 | GO:0072328 | ethylene receptor activity(GO:0038199) ethylene binding(GO:0051740) alkene binding(GO:0072328) |
0.2 | 0.5 | GO:0004476 | mannose-6-phosphate isomerase activity(GO:0004476) |
0.2 | 3.2 | GO:0003843 | 1,3-beta-D-glucan synthase activity(GO:0003843) |
0.2 | 0.7 | GO:0005093 | Rab GDP-dissociation inhibitor activity(GO:0005093) |
0.2 | 1.4 | GO:0016464 | chloroplast protein-transporting ATPase activity(GO:0016464) |
0.2 | 0.6 | GO:0004400 | histidinol-phosphate transaminase activity(GO:0004400) |
0.2 | 0.9 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.1 | 1.7 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.4 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
0.1 | 0.4 | GO:0052592 | oxidoreductase activity, acting on CH or CH2 groups, with an iron-sulfur protein as acceptor(GO:0052592) |
0.1 | 0.1 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) |
0.1 | 0.9 | GO:0045431 | flavonol synthase activity(GO:0045431) |
0.1 | 0.7 | GO:0004473 | malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
0.1 | 0.7 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.1 | 0.9 | GO:0001872 | (1->3)-beta-D-glucan binding(GO:0001872) |
0.1 | 0.8 | GO:0015288 | porin activity(GO:0015288) wide pore channel activity(GO:0022829) |
0.1 | 0.4 | GO:0009671 | nitrate:proton symporter activity(GO:0009671) |
0.1 | 0.6 | GO:0003979 | UDP-glucose 6-dehydrogenase activity(GO:0003979) |
0.1 | 1.0 | GO:0050307 | sucrose-phosphate phosphatase activity(GO:0050307) |
0.1 | 1.0 | GO:0008026 | ATP-dependent DNA helicase activity(GO:0004003) ATP-dependent helicase activity(GO:0008026) single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) single-stranded DNA-dependent ATPase activity(GO:0043142) purine NTP-dependent helicase activity(GO:0070035) |
0.1 | 1.5 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.1 | 0.3 | GO:0047804 | cysteine-S-conjugate beta-lyase activity(GO:0047804) |
0.1 | 0.7 | GO:0050378 | UDP-glucuronate 4-epimerase activity(GO:0050378) |
0.1 | 0.4 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
0.1 | 0.5 | GO:0017050 | D-erythro-sphingosine kinase activity(GO:0017050) |
0.1 | 0.3 | GO:0008265 | Mo-molybdopterin cofactor sulfurase activity(GO:0008265) |
0.1 | 0.4 | GO:0050347 | trans-octaprenyltranstransferase activity(GO:0050347) all-trans-nonaprenyl-diphosphate synthase (geranylgeranyl-diphosphate specific) activity(GO:0052924) |
0.1 | 0.6 | GO:0080109 | indole-3-acetonitrile nitrile hydratase activity(GO:0080109) |
0.1 | 1.3 | GO:0002020 | protease binding(GO:0002020) |
0.1 | 0.5 | GO:0008490 | arsenite secondary active transmembrane transporter activity(GO:0008490) arsenite-transmembrane transporting ATPase activity(GO:0015446) anion transmembrane-transporting ATPase activity(GO:0043225) |
0.1 | 1.0 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
0.1 | 0.8 | GO:0003999 | adenine phosphoribosyltransferase activity(GO:0003999) |
0.1 | 0.3 | GO:0046480 | galactolipid galactosyltransferase activity(GO:0046480) |
0.1 | 0.6 | GO:0052691 | UDP-arabinopyranose mutase activity(GO:0052691) |
0.1 | 0.3 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
0.1 | 0.3 | GO:0016504 | peptidase activator activity(GO:0016504) |
0.1 | 0.4 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.1 | 1.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.4 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
0.1 | 0.4 | GO:0008703 | 5-amino-6-(5-phosphoribosylamino)uracil reductase activity(GO:0008703) |
0.1 | 0.5 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.1 | 3.2 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
0.1 | 0.5 | GO:0019904 | protein domain specific binding(GO:0019904) |
0.1 | 0.4 | GO:0015136 | sialic acid transmembrane transporter activity(GO:0015136) |
0.1 | 0.9 | GO:0032041 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) NAD-dependent protein deacetylase activity(GO:0034979) |
0.1 | 0.4 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 0.4 | GO:0070330 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) aromatase activity(GO:0070330) |
0.1 | 1.3 | GO:0031420 | pyruvate kinase activity(GO:0004743) potassium ion binding(GO:0030955) alkali metal ion binding(GO:0031420) |
0.1 | 2.9 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.1 | 0.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 0.7 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 1.3 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.1 | 0.3 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.1 | 1.3 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.1 | 0.7 | GO:0090447 | glycerol-3-phosphate 2-O-acyltransferase activity(GO:0090447) |
0.1 | 0.2 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
0.1 | 1.0 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.2 | GO:0051777 | ent-kaurenoate oxidase activity(GO:0051777) |
0.1 | 0.3 | GO:0016040 | glutamate synthase activity(GO:0015930) glutamate synthase (NADH) activity(GO:0016040) glutamate synthase activity, NAD(P)H as acceptor(GO:0045181) |
0.1 | 0.3 | GO:0016748 | dihydrolipoyllysine-residue succinyltransferase activity(GO:0004149) succinyltransferase activity(GO:0016748) S-succinyltransferase activity(GO:0016751) |
0.1 | 0.5 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.9 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.1 | 0.6 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 0.4 | GO:0009678 | hydrogen-translocating pyrophosphatase activity(GO:0009678) |
0.1 | 0.3 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.1 | 0.2 | GO:0019779 | Atg8 activating enzyme activity(GO:0019779) |
0.1 | 0.3 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 1.4 | GO:0010329 | auxin efflux transmembrane transporter activity(GO:0010329) |
0.1 | 0.2 | GO:0008661 | 1-deoxy-D-xylulose-5-phosphate synthase activity(GO:0008661) |
0.1 | 0.3 | GO:0035516 | oxidative DNA demethylase activity(GO:0035516) |
0.1 | 0.4 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.1 | 0.1 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
0.1 | 1.1 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.1 | 0.8 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
0.1 | 2.1 | GO:0047262 | polygalacturonate 4-alpha-galacturonosyltransferase activity(GO:0047262) |
0.1 | 0.7 | GO:0015112 | nitrate transmembrane transporter activity(GO:0015112) |
0.1 | 0.9 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.8 | GO:0043878 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (non-phosphorylating) activity(GO:0043878) |
0.1 | 0.3 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.1 | 0.4 | GO:0009884 | cytokinin receptor activity(GO:0009884) |
0.1 | 0.5 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.4 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.1 | 0.5 | GO:0016987 | core DNA-dependent RNA polymerase binding promoter specificity activity(GO:0000996) sigma factor activity(GO:0016987) |
0.1 | 0.4 | GO:0004619 | phosphoglycerate mutase activity(GO:0004619) |
0.1 | 0.3 | GO:0035175 | histone serine kinase activity(GO:0035174) histone kinase activity (H3-S10 specific)(GO:0035175) |
0.1 | 0.3 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.3 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 0.3 | GO:0080103 | 4-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080103) |
0.1 | 0.4 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.9 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
0.1 | 0.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.2 | GO:1990883 | rRNA cytidine N-acetyltransferase activity(GO:1990883) |
0.1 | 0.4 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.2 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.1 | 0.6 | GO:0017022 | myosin binding(GO:0017022) |
0.1 | 0.4 | GO:0003830 | beta-1,4-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0003830) |
0.1 | 0.6 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.1 | GO:0008144 | drug binding(GO:0008144) |
0.1 | 0.1 | GO:0015462 | protein-transmembrane transporting ATPase activity(GO:0015462) |
0.1 | 0.2 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.1 | 0.9 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 0.5 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 3.4 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.1 | 1.5 | GO:0033558 | histone deacetylase activity(GO:0004407) protein deacetylase activity(GO:0033558) |
0.1 | 0.4 | GO:0047714 | galactolipase activity(GO:0047714) |
0.1 | 0.3 | GO:0009883 | red or far-red light photoreceptor activity(GO:0009883) |
0.1 | 0.5 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.6 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.1 | 0.3 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.1 | 0.6 | GO:0102391 | acyl-CoA ligase activity(GO:0003996) decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.3 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.4 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
0.0 | 0.5 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.0 | 0.5 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.0 | 1.2 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.0 | 0.1 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.0 | 0.8 | GO:0102338 | 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.2 | GO:0030371 | translation repressor activity(GO:0030371) |
0.0 | 0.4 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 3.3 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.2 | GO:0080122 | AMP transmembrane transporter activity(GO:0080122) |
0.0 | 0.4 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 1.0 | GO:0080031 | methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.0 | 0.6 | GO:0009044 | xylan 1,4-beta-xylosidase activity(GO:0009044) alpha-L-arabinofuranosidase activity(GO:0046556) |
0.0 | 0.9 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.0 | 0.1 | GO:0046524 | sucrose-phosphate synthase activity(GO:0046524) |
0.0 | 0.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.5 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.7 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.6 | GO:0019199 | transmembrane receptor protein kinase activity(GO:0019199) |
0.0 | 0.4 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 1.6 | GO:0030145 | manganese ion binding(GO:0030145) |
0.0 | 0.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.2 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.2 | GO:0033843 | xyloglucan 6-xylosyltransferase activity(GO:0033843) |
0.0 | 0.3 | GO:0070905 | glycine hydroxymethyltransferase activity(GO:0004372) serine binding(GO:0070905) |
0.0 | 0.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.4 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.0 | 0.2 | GO:0004324 | ferredoxin-NADP+ reductase activity(GO:0004324) |
0.0 | 0.2 | GO:0045549 | 9-cis-epoxycarotenoid dioxygenase activity(GO:0045549) |
0.0 | 2.0 | GO:0009931 | calmodulin-dependent protein kinase activity(GO:0004683) calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
0.0 | 0.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.1 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.0 | 0.2 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.0 | 0.3 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.6 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
0.0 | 0.4 | GO:0051117 | ATPase binding(GO:0051117) |
0.0 | 0.4 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.1 | GO:0019172 | glyoxalase III activity(GO:0019172) |
0.0 | 0.8 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 2.1 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 0.2 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.1 | GO:0098518 | mRNA guanylyltransferase activity(GO:0004484) polynucleotide 5'-phosphatase activity(GO:0004651) RNA guanylyltransferase activity(GO:0008192) polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.1 | GO:0001216 | bacterial-type RNA polymerase transcription factor activity, sequence-specific DNA binding(GO:0001130) bacterial-type RNA polymerase transcriptional activator activity, sequence-specific DNA binding(GO:0001216) |
0.0 | 0.8 | GO:0016168 | chlorophyll binding(GO:0016168) |
0.0 | 0.9 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.0 | 0.1 | GO:0004049 | anthranilate synthase activity(GO:0004049) |
0.0 | 0.1 | GO:0008839 | 4-hydroxy-tetrahydrodipicolinate reductase(GO:0008839) NADPH binding(GO:0070402) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.2 | GO:0004838 | L-tyrosine:2-oxoglutarate aminotransferase activity(GO:0004838) L-tyrosine aminotransferase activity(GO:0070547) |
0.0 | 0.1 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.3 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.4 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 1.6 | GO:0043621 | protein self-association(GO:0043621) |
0.0 | 0.8 | GO:0004402 | histone acetyltransferase activity(GO:0004402) peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.0 | 0.4 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.2 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 0.2 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.5 | GO:0070290 | phospholipase D activity(GO:0004630) N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 3.6 | GO:0005525 | GTP binding(GO:0005525) guanyl nucleotide binding(GO:0019001) guanyl ribonucleotide binding(GO:0032561) |
0.0 | 0.2 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 7.2 | GO:0005198 | structural molecule activity(GO:0005198) |
0.0 | 0.1 | GO:0016819 | hydrolase activity, acting on acid anhydrides, in sulfonyl-containing anhydrides(GO:0016819) adenylylsulfatase activity(GO:0047627) |
0.0 | 0.2 | GO:0042285 | xylosyltransferase activity(GO:0042285) |
0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.2 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.3 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.3 | GO:0016847 | 1-aminocyclopropane-1-carboxylate synthase activity(GO:0016847) |
0.0 | 1.9 | GO:0003724 | RNA helicase activity(GO:0003724) |
0.0 | 0.6 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.0 | 0.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.1 | GO:0010313 | phytochrome binding(GO:0010313) |
0.0 | 1.6 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) |
0.0 | 0.4 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.5 | GO:0004564 | beta-fructofuranosidase activity(GO:0004564) |
0.0 | 0.2 | GO:0009979 | 16:0 monogalactosyldiacylglycerol desaturase activity(GO:0009979) |
0.0 | 1.5 | GO:0004650 | polygalacturonase activity(GO:0004650) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 1.1 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.2 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.0 | 3.0 | GO:0008017 | microtubule binding(GO:0008017) |
0.0 | 0.2 | GO:0051920 | thioredoxin peroxidase activity(GO:0008379) peroxiredoxin activity(GO:0051920) |
0.0 | 0.4 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.3 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
0.0 | 0.1 | GO:0004831 | tyrosine-tRNA ligase activity(GO:0004831) |
0.0 | 0.2 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
0.0 | 0.2 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
0.0 | 0.7 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.1 | GO:0003919 | FMN adenylyltransferase activity(GO:0003919) |
0.0 | 0.1 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.0 | 1.0 | GO:0044389 | ubiquitin-like protein ligase binding(GO:0044389) |
0.0 | 1.2 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
0.0 | 0.1 | GO:0003977 | UDP-N-acetylglucosamine diphosphorylase activity(GO:0003977) |
0.0 | 0.1 | GO:0004072 | aspartate kinase activity(GO:0004072) |
0.0 | 1.3 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.1 | GO:0032977 | membrane insertase activity(GO:0032977) |
0.0 | 0.6 | GO:0019887 | protein kinase regulator activity(GO:0019887) |
0.0 | 1.7 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.8 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
0.0 | 0.1 | GO:0016151 | nickel cation binding(GO:0016151) |
0.0 | 0.2 | GO:0060090 | binding, bridging(GO:0060090) |
0.0 | 0.5 | GO:0004713 | protein tyrosine kinase activity(GO:0004713) |
0.0 | 0.8 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 1.8 | GO:0009055 | electron carrier activity(GO:0009055) |
0.0 | 0.1 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) |
0.0 | 0.2 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.0 | 0.6 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.2 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 0.1 | GO:0004567 | beta-mannosidase activity(GO:0004567) |
0.0 | 0.2 | GO:0015631 | tubulin binding(GO:0015631) |
0.0 | 0.1 | GO:0003913 | DNA photolyase activity(GO:0003913) |
0.0 | 0.1 | GO:0031956 | medium-chain fatty acid-CoA ligase activity(GO:0031956) |
0.0 | 0.1 | GO:0008022 | protein C-terminus binding(GO:0008022) |
0.0 | 0.3 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) phosphoprotein binding(GO:0051219) |
0.0 | 0.2 | GO:0042300 | beta-amyrin synthase activity(GO:0042300) |
0.0 | 0.1 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
0.0 | 0.3 | GO:0016597 | amino acid binding(GO:0016597) |
0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.1 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.2 | GO:0016207 | 4-coumarate-CoA ligase activity(GO:0016207) |
0.0 | 0.6 | GO:0102483 | scopolin beta-glucosidase activity(GO:0102483) |
0.0 | 0.3 | GO:0030570 | carbon-oxygen lyase activity, acting on polysaccharides(GO:0016837) pectate lyase activity(GO:0030570) |
0.0 | 0.2 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.3 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.1 | GO:0008143 | poly(A) binding(GO:0008143) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.0 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.2 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.2 | 0.7 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.2 | 0.2 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.2 | 0.5 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.2 | 0.5 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.2 | 0.6 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.1 | 0.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 0.3 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 0.5 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.1 | 0.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 0.5 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 0.5 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.1 | 0.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.5 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.1 | 0.4 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 0.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.0 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.1 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.1 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.1 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 2.3 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.3 | 1.0 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.3 | 1.5 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.2 | 0.7 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.2 | 1.5 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.2 | 0.6 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.1 | 0.4 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.1 | 0.3 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.1 | 0.2 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.1 | 0.3 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.4 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.1 | 0.1 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.1 | 0.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.2 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
0.0 | 0.8 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.3 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.2 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.0 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.0 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.0 | 0.0 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.1 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |