GSE130291:vernalization in Arabidopsis thaliana
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
AT2G35530
|
AT2G35530 | basic region/leucine zipper transcription factor 16 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| bZIP16 | arTal_v1_Chr2_-_14926609_14926609 | 0.46 | 9.8e-02 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| arTal_v1_Chr1_+_28975255_28975255 | 3.74 |
AT1G77120.1
|
ADH1
|
alcohol dehydrogenase 1 |
| arTal_v1_Chr1_-_10289666_10289666 | 3.50 |
AT1G29395.1
|
COR413IM1
|
COLD REGULATED 314 INNER MEMBRANE 1 |
| arTal_v1_Chr5_-_17199793_17199910 | 3.28 |
AT5G42900.1
AT5G42900.3 AT5G42900.2 |
COR27
|
cold regulated protein 27 |
| arTal_v1_Chr1_+_3019639_3019639 | 3.26 |
AT1G09350.1
|
GolS3
|
galactinol synthase 3 |
| arTal_v1_Chr1_+_3020221_3020221 | 3.10 |
AT1G09350.2
|
GolS3
|
galactinol synthase 3 |
| arTal_v1_Chr5_+_5206156_5206156 | 2.93 |
AT5G15950.2
|
AT5G15950
|
Adenosylmethionine decarboxylase family protein |
| arTal_v1_Chr5_+_5205869_5205869 | 2.90 |
AT5G15950.1
|
AT5G15950
|
Adenosylmethionine decarboxylase family protein |
| arTal_v1_Chr5_-_14753088_14753088 | 2.59 |
AT5G37260.1
|
RVE2
|
Homeodomain-like superfamily protein |
| arTal_v1_Chr5_+_5211719_5211719 | 2.56 |
AT5G15970.1
|
KIN2
|
stress-responsive protein (KIN2) / stress-induced protein (KIN2) / cold-responsive protein (COR6.6) / cold-regulated protein (COR6.6) |
| arTal_v1_Chr4_-_18472048_18472048 | 2.29 |
AT4G39800.1
|
MIPS1
|
myo-inositol-1-phosphate synthase 1 |
| arTal_v1_Chr3_+_18940643_18940643 | 2.28 |
AT3G50970.1
|
LTI30
|
dehydrin family protein |
| arTal_v1_Chr5_-_5692920_5692992 | 2.06 |
AT5G17300.2
AT5G17300.1 |
RVE1
|
Homeodomain-like superfamily protein |
| arTal_v1_Chr1_-_10475969_10475969 | 2.00 |
AT1G29920.1
|
CAB2
|
chlorophyll A/B-binding protein 2 |
| arTal_v1_Chr2_-_12343443_12343443 | 1.87 |
AT2G28780.1
|
AT2G28780
|
P-hydroxybenzoic acid efflux pump subunit |
| arTal_v1_Chr5_+_15878698_15878726 | 1.68 |
AT5G39660.1
AT5G39660.3 AT5G39660.2 |
CDF2
|
cycling DOF factor 2 |
| arTal_v1_Chr1_-_26163715_26163715 | 1.67 |
AT1G69570.1
|
AT1G69570
|
Dof-type zinc finger DNA-binding family protein |
| arTal_v1_Chr3_+_22635803_22635816 | 1.62 |
AT3G61160.3
AT3G61160.6 AT3G61160.5 AT3G61160.4 AT3G61160.2 AT3G61160.1 |
AT3G61160
|
Protein kinase superfamily protein |
| arTal_v1_Chr1_-_3481041_3481041 | 1.61 |
AT1G10550.1
|
XTH33
|
xyloglucan:xyloglucosyl transferase 33 |
| arTal_v1_Chr2_+_19232607_19232649 | 1.52 |
AT2G46790.3
AT2G46790.4 AT2G46790.1 AT2G46790.2 AT2G46790.5 |
PRR9
|
pseudo-response regulator 9 |
| arTal_v1_Chr4_-_12345652_12345652 | 1.51 |
AT4G23700.2
|
CHX17
|
cation/H+ exchanger 17 |
| arTal_v1_Chr1_+_29354944_29354944 | 1.51 |
AT1G78070.1
|
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
| arTal_v1_Chr4_-_12346051_12346051 | 1.50 |
AT4G23700.1
|
CHX17
|
cation/H+ exchanger 17 |
| arTal_v1_Chr1_+_29356346_29356382 | 1.50 |
AT1G78070.2
AT1G78070.3 |
AT1G78070
|
Transducin/WD40 repeat-like superfamily protein |
| arTal_v1_Chr2_-_6493512_6493512 | 1.46 |
AT2G15020.1
|
AT2G15020
|
hypothetical protein |
| arTal_v1_Chr3_+_22935510_22935510 | 1.46 |
AT3G61930.1
|
AT3G61930
|
hypothetical protein |
| arTal_v1_Chr1_-_40945_41017 | 1.43 |
AT1G01070.2
AT1G01070.1 |
UMAMIT28
|
nodulin MtN21 /EamA-like transporter family protein |
| arTal_v1_Chr5_-_22115539_22115539 | 1.42 |
AT5G54470.1
|
BBX29
|
B-box type zinc finger family protein |
| arTal_v1_Chr1_+_17766738_17766738 | 1.41 |
AT1G48100.1
|
AT1G48100
|
Pectin lyase-like superfamily protein |
| arTal_v1_Chr1_+_29759030_29759158 | 1.40 |
AT1G79110.2
AT1G79110.3 AT1G79110.1 |
BRG2
|
zinc ion binding protein |
| arTal_v1_Chr2_+_12666935_12666979 | 1.39 |
AT2G29630.3
AT2G29630.2 AT2G29630.1 |
THIC
|
thiaminC |
| arTal_v1_Chr5_+_17526660_17526729 | 1.39 |
AT5G43630.2
AT5G43630.1 AT5G43630.3 AT5G43630.4 |
TZP
|
zinc knuckle (CCHC-type) family protein |
| arTal_v1_Chr5_+_4776733_4776733 | 1.32 |
AT5G14780.1
AT5G14780.3 AT5G14780.2 |
FDH
|
formate dehydrogenase |
| arTal_v1_Chr3_-_17976774_17976774 | 1.31 |
AT3G48520.1
|
CYP94B3
|
cytochrome P450, family 94, subfamily B, polypeptide 3 |
| arTal_v1_Chr5_+_2563366_2563366 | 1.29 |
AT5G08000.1
AT5G08000.2 |
E13L3
|
glucan endo-1,3-beta-glucosidase-like protein 3 |
| arTal_v1_Chr2_+_10244745_10244745 | 1.29 |
AT2G24100.1
|
ASG1
|
ATP-dependent DNA helicase |
| arTal_v1_Chr2_+_12667901_12667901 | 1.28 |
AT2G29630.4
|
THIC
|
thiaminC |
| arTal_v1_Chr2_+_6950041_6950041 | 1.27 |
AT2G15970.2
|
COR413-PM1
|
cold regulated 413 plasma membrane 1 |
| arTal_v1_Chr2_+_6949851_6949851 | 1.26 |
AT2G15970.1
|
COR413-PM1
|
cold regulated 413 plasma membrane 1 |
| arTal_v1_Chr3_+_5243432_5243432 | 1.26 |
AT3G15510.1
|
NAC2
|
NAC domain containing protein 2 |
| arTal_v1_Chr2_-_17065813_17065813 | 1.24 |
AT2G40900.1
|
UMAMIT11
|
nodulin MtN21 /EamA-like transporter family protein |
| arTal_v1_Chr1_-_7089606_7089606 | 1.22 |
AT1G20450.1
AT1G20450.2 |
ERD10
|
Dehydrin family protein |
| arTal_v1_Chr1_-_29716255_29716255 | 1.20 |
AT1G78995.1
|
AT1G78995
|
hypothetical protein |
| arTal_v1_Chr5_-_25071111_25071111 | 1.19 |
AT5G62430.1
|
CDF1
|
cycling DOF factor 1 |
| arTal_v1_Chr2_+_17057388_17057388 | 1.18 |
AT2G40880.1
|
CYSA
|
cystatin A |
| arTal_v1_Chr3_-_3238267_3238267 | 1.17 |
AT3G10410.1
|
SCPL49
|
SERINE CARBOXYPEPTIDASE-LIKE 49 |
| arTal_v1_Chr1_-_16851224_16851271 | 1.17 |
AT1G44446.3
AT1G44446.2 AT1G44446.1 |
CH1
|
Pheophorbide a oxygenase family protein with Rieske 2Fe-2S domain-containing protein |
| arTal_v1_Chr1_-_16851010_16851010 | 1.17 |
AT1G44446.4
|
CH1
|
Pheophorbide a oxygenase family protein with Rieske 2Fe-2S domain-containing protein |
| arTal_v1_Chr1_-_27498062_27498062 | 1.15 |
AT1G73120.1
|
AT1G73120
|
F-box/RNI superfamily protein |
| arTal_v1_Chr3_+_22757761_22757761 | 1.14 |
AT3G61490.1
AT3G61490.4 AT3G61490.2 |
AT3G61490
|
Pectin lyase-like superfamily protein |
| arTal_v1_Chr1_+_25016402_25016402 | 1.13 |
AT1G67030.1
|
ZFP6
|
zinc finger protein 6 |
| arTal_v1_Chr5_+_18444607_18444607 | 1.13 |
AT5G45510.2
AT5G45510.1 |
AT5G45510
|
Leucine-rich repeat (LRR) family protein |
| arTal_v1_Chr1_+_26038905_26038905 | 1.13 |
AT1G69260.1
|
AFP1
|
ABI five binding protein |
| arTal_v1_Chr1_+_2274926_2274926 | 1.13 |
AT1G07400.1
|
AT1G07400
|
HSP20-like chaperones superfamily protein |
| arTal_v1_Chr1_-_4855287_4855287 | 1.11 |
AT1G14200.1
|
AT1G14200
|
RING/U-box superfamily protein |
| arTal_v1_Chr5_+_332330_332330 | 1.11 |
AT5G01850.2
AT5G01850.1 |
AT5G01850
|
Protein kinase superfamily protein |
| arTal_v1_Chr1_+_25701770_25701770 | 1.10 |
AT1G68500.1
|
AT1G68500
|
hypothetical protein |
| arTal_v1_Chr3_+_4403355_4403355 | 1.07 |
AT3G13510.1
|
AT3G13510
|
carboxyl-terminal peptidase, putative (DUF239) |
| arTal_v1_Chr1_-_4679594_4679594 | 1.06 |
AT1G13640.2
|
AT1G13640
|
Phosphatidylinositol 3- and 4-kinase family protein |
| arTal_v1_Chr3_-_9464676_9464676 | 1.06 |
AT3G25870.1
|
AT3G25870
|
hypothetical protein |
| arTal_v1_Chr1_+_20617313_20617313 | 1.06 |
AT1G55265.1
|
AT1G55265
|
DUF538 family protein, putative (Protein of unknown function, DUF538) |
| arTal_v1_Chr3_+_22758039_22758063 | 1.04 |
AT3G61490.5
AT3G61490.3 |
AT3G61490
|
Pectin lyase-like superfamily protein |
| arTal_v1_Chr1_-_4679862_4679862 | 1.03 |
AT1G13640.1
|
AT1G13640
|
Phosphatidylinositol 3- and 4-kinase family protein |
| arTal_v1_Chr5_-_17022723_17022723 | 1.02 |
AT5G42570.1
|
AT5G42570
|
B-cell receptor-associated 31-like protein |
| arTal_v1_Chr4_+_13812989_13812989 | 1.02 |
AT4G27657.1
|
AT4G27657
|
hypothetical protein |
| arTal_v1_Chr1_-_17706460_17706460 | 1.02 |
AT1G48000.1
|
MYB112
|
myb domain protein 112 |
| arTal_v1_Chr1_+_20273567_20273597 | 1.01 |
AT1G54310.2
AT1G54310.1 |
AT1G54310
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
| arTal_v1_Chr5_-_18021508_18021508 | 0.99 |
AT5G44670.1
|
GALS2
|
glycosyltransferase family protein (DUF23) |
| arTal_v1_Chr5_+_3111945_3111945 | 0.98 |
AT5G09970.1
|
CYP78A7
|
cytochrome P450, family 78, subfamily A, polypeptide 7 |
| arTal_v1_Chr3_-_4174934_4174934 | 0.97 |
AT3G13040.2
|
AT3G13040
|
myb-like HTH transcriptional regulator family protein |
| arTal_v1_Chr1_+_23515680_23515680 | 0.97 |
AT1G63420.1
AT1G63420.2 |
AT1G63420
|
O-glucosyltransferase-like protein (DUF821) |
| arTal_v1_Chr5_-_3709403_3709403 | 0.97 |
AT5G11550.1
|
AT5G11550
|
ARM repeat superfamily protein |
| arTal_v1_Chr1_+_9214072_9214174 | 0.97 |
AT1G26665.1
AT1G26665.2 |
AT1G26665
|
Mediator complex, subunit Med10 |
| arTal_v1_Chr4_-_7553332_7553375 | 0.96 |
AT4G12910.2
AT4G12910.1 |
scpl20
|
serine carboxypeptidase-like 20 |
| arTal_v1_Chr2_-_16563441_16563441 | 0.96 |
AT2G39710.1
|
AT2G39710
|
Eukaryotic aspartyl protease family protein |
| arTal_v1_Chr3_-_4175248_4175248 | 0.96 |
AT3G13040.3
|
AT3G13040
|
myb-like HTH transcriptional regulator family protein |
| arTal_v1_Chr5_+_579744_579852 | 0.95 |
AT5G02580.1
AT5G02580.3 AT5G02580.2 |
AT5G02580
|
argininosuccinate lyase |
| arTal_v1_Chr3_-_4175457_4175457 | 0.94 |
AT3G13040.1
|
AT3G13040
|
myb-like HTH transcriptional regulator family protein |
| arTal_v1_Chr2_+_19000180_19000191 | 0.93 |
AT2G46270.2
AT2G46270.1 AT2G46270.4 AT2G46270.3 |
GBF3
|
G-box binding factor 3 |
| arTal_v1_Chr1_-_29034822_29034822 | 0.92 |
AT1G77280.2
AT1G77280.1 |
AT1G77280
|
kinase with adenine nucleotide alpha hydrolases-like domain-containing protein |
| arTal_v1_Chr5_+_16410782_16410782 | 0.92 |
AT5G40950.1
|
RPL27
|
ribosomal protein large subunit 27 |
| arTal_v1_Chr3_+_2167730_2167730 | 0.92 |
AT3G06868.1
|
AT3G06868
|
vitellogenin-like protein |
| arTal_v1_Chr5_-_7242857_7242880 | 0.91 |
AT5G21920.2
AT5G21920.1 |
YLMG2
|
YGGT family protein |
| arTal_v1_Chr5_+_25948954_25948954 | 0.91 |
AT5G64940.1
AT5G64940.2 |
ATH13
|
ABC2 homolog 13 |
| arTal_v1_Chr5_+_22388782_22388782 | 0.89 |
AT5G55180.2
|
AT5G55180
|
O-Glycosyl hydrolases family 17 protein |
| arTal_v1_Chr3_-_20651443_20651484 | 0.89 |
AT3G55660.2
AT3G55660.1 |
ROPGEF6
|
ROP (rho of plants) guanine nucleotide exchange factor 6 |
| arTal_v1_Chr5_-_9174598_9174598 | 0.88 |
AT5G26230.1
|
MAKR1
|
membrane-associated kinase regulator |
| arTal_v1_Chr2_+_15669131_15669131 | 0.88 |
AT2G37330.1
|
ALS3
|
aluminum sensitive 3 |
| arTal_v1_Chr1_-_20812915_20813061 | 0.88 |
AT1G55690.1
AT1G55690.3 AT1G55690.4 AT1G55690.5 AT1G55690.2 |
AT1G55690
|
Sec14p-like phosphatidylinositol transfer family protein |
| arTal_v1_Chr1_+_22051133_22051133 | 0.88 |
AT1G59900.1
|
E1 ALPHA
|
pyruvate dehydrogenase complex E1 alpha subunit |
| arTal_v1_Chr3_-_17506124_17506124 | 0.88 |
AT3G47500.1
|
CDF3
|
cycling DOF factor 3 |
| arTal_v1_Chr5_-_23501416_23501416 | 0.87 |
AT5G58070.1
|
TIL
|
temperature-induced lipocalin |
| arTal_v1_Chr5_+_22388521_22388521 | 0.86 |
AT5G55180.1
|
AT5G55180
|
O-Glycosyl hydrolases family 17 protein |
| arTal_v1_Chr1_+_22051295_22051295 | 0.85 |
AT1G59900.2
|
E1 ALPHA
|
pyruvate dehydrogenase complex E1 alpha subunit |
| arTal_v1_Chr2_-_16757599_16757599 | 0.84 |
AT2G40120.1
|
AT2G40120
|
Protein kinase superfamily protein |
| arTal_v1_Chr3_+_10330547_10330591 | 0.84 |
AT3G27870.1
AT3G27870.2 AT3G27870.3 |
AT3G27870
|
ATPase E1-E2 type family protein / haloacid dehalogenase-like hydrolase family protein |
| arTal_v1_Chr4_+_222289_222289 | 0.83 |
AT4G00490.1
|
BAM2
|
beta-amylase 2 |
| arTal_v1_Chr1_-_5645443_5645443 | 0.83 |
AT1G16510.1
|
AT1G16510
|
SAUR-like auxin-responsive protein family |
| arTal_v1_Chr4_-_8524217_8524217 | 0.83 |
AT4G14900.1
|
AT4G14900
|
FRIGIDA-like protein |
| arTal_v1_Chr1_+_6805430_6805430 | 0.81 |
AT1G19680.1
|
AT1G19680
|
RING/U-box superfamily protein |
| arTal_v1_Chr3_-_20178982_20179070 | 0.81 |
AT3G54500.1
AT3G54500.4 AT3G54500.3 AT3G54500.8 AT3G54500.2 AT3G54500.5 AT3G54500.7 AT3G54500.6 |
AT3G54500
|
agglutinin-like protein |
| arTal_v1_Chr2_+_12706627_12706627 | 0.81 |
AT2G29740.1
|
UGT71C2
|
UDP-glucosyl transferase 71C2 |
| arTal_v1_Chr1_+_18513624_18513624 | 0.80 |
AT1G49990.1
|
AT1G49990
|
F-box family protein |
| arTal_v1_Chr4_-_15016977_15016977 | 0.80 |
AT4G30830.2
|
AT4G30830
|
myosin-like protein (Protein of unknown function, DUF593) |
| arTal_v1_Chr3_+_17567126_17567126 | 0.80 |
AT3G47640.2
AT3G47640.3 |
PYE
|
basic helix-loop-helix (bHLH) DNA-binding superfamily protein |
| arTal_v1_Chr5_-_26845294_26845294 | 0.79 |
AT5G67280.1
|
RLK
|
receptor-like kinase |
| arTal_v1_Chr5_-_25920254_25920254 | 0.79 |
AT5G64840.1
|
ABCF5
|
general control non-repressible 5 |
| arTal_v1_Chr3_+_16818347_16818347 | 0.79 |
AT3G45780.2
|
PHOT1
|
phototropin 1 |
| arTal_v1_Chr4_+_13527_13527 | 0.79 |
AT4G00030.1
|
AT4G00030
|
Plastid-lipid associated protein PAP / fibrillin family protein |
| arTal_v1_Chr4_-_15017365_15017365 | 0.78 |
AT4G30830.1
|
AT4G30830
|
myosin-like protein (Protein of unknown function, DUF593) |
| arTal_v1_Chr5_-_4933620_4933620 | 0.78 |
AT5G15190.2
AT5G15190.1 |
AT5G15190
|
hypothetical protein |
| arTal_v1_Chr5_-_21483722_21483797 | 0.78 |
AT5G52980.2
AT5G52980.1 |
AT5G52980
|
ER-based factor for assembly of V-ATPase |
| arTal_v1_Chr4_+_12514899_12514982 | 0.77 |
AT4G24100.2
AT4G24100.1 AT4G24100.3 AT4G24100.4 |
AT4G24100
|
Protein kinase superfamily protein |
| arTal_v1_Chr3_+_16816721_16816721 | 0.77 |
AT3G45780.1
|
PHOT1
|
phototropin 1 |
| arTal_v1_Chr4_-_17564763_17564763 | 0.77 |
AT4G37330.1
|
CYP81D4
|
cytochrome P450, family 81, subfamily D, polypeptide 4 |
| arTal_v1_Chr4_-_13016235_13016235 | 0.77 |
AT4G25470.1
|
CBF2
|
C-repeat/DRE binding factor 2 |
| arTal_v1_Chr1_+_17847042_17847042 | 0.76 |
AT1G48300.1
|
DGAT3
|
diacylglycerol acyltransferase |
| arTal_v1_Chr4_+_16881336_16881362 | 0.76 |
AT4G35560.1
AT4G35560.2 |
DAW1
|
Transducin/WD40 repeat-like superfamily protein |
| arTal_v1_Chr5_+_18398832_18398832 | 0.75 |
AT5G45400.1
|
RPA70C
|
Replication factor-A protein 1-like protein |
| arTal_v1_Chr1_+_8692630_8692630 | 0.74 |
AT1G24530.1
|
AT1G24530
|
Transducin/WD40 repeat-like superfamily protein |
| arTal_v1_Chr2_-_1167115_1167115 | 0.74 |
AT2G03820.1
|
NMD3
|
nonsense-mediated mRNA decay NMD3 family protein |
| arTal_v1_Chr2_-_15355330_15355330 | 0.74 |
AT2G36630.1
|
AT2G36630
|
Sulfite exporter TauE/SafE family protein |
| arTal_v1_Chr4_+_585598_585610 | 0.74 |
AT4G01430.1
AT4G01430.2 AT4G01430.3 |
UMAMIT29
|
nodulin MtN21 /EamA-like transporter family protein |
| arTal_v1_Chr4_+_285876_285876 | 0.74 |
AT4G00700.2
AT4G00700.1 |
AT4G00700
|
C2 calcium/lipid-binding plant phosphoribosyltransferase family protein |
| arTal_v1_Chr4_-_10291058_10291058 | 0.73 |
AT4G18700.1
|
CIPK12
|
CBL-interacting protein kinase 12 |
| arTal_v1_Chr1_+_29404648_29404880 | 0.73 |
AT1G78150.2
AT1G78150.1 AT1G78150.3 |
AT1G78150
|
N-lysine methyltransferase |
| arTal_v1_Chr5_+_24674963_24674963 | 0.73 |
AT5G61380.1
|
TOC1
|
CCT motif -containing response regulator protein |
| arTal_v1_Chr2_+_9530365_9530365 | 0.73 |
AT2G22450.1
|
RIBA2
|
riboflavin biosynthesis protein |
| arTal_v1_Chr1_+_190408_190478 | 0.73 |
AT1G01520.4
AT1G01520.2 AT1G01520.3 AT1G01520.1 AT1G01520.5 |
ASG4
|
Homeodomain-like superfamily protein |
| arTal_v1_Chr1_-_26891284_26891284 | 0.72 |
AT1G71350.1
|
AT1G71350
|
eukaryotic translation initiation factor SUI1 family protein |
| arTal_v1_Chr1_-_25049424_25049424 | 0.72 |
AT1G67090.2
|
RBCS1A
|
ribulose bisphosphate carboxylase small chain 1A |
| arTal_v1_Chr1_-_25049667_25049667 | 0.72 |
AT1G67090.1
|
RBCS1A
|
ribulose bisphosphate carboxylase small chain 1A |
| arTal_v1_Chr5_+_2202364_2202397 | 0.72 |
AT5G07090.1
AT5G07090.3 AT5G07090.2 |
AT5G07090
|
Ribosomal protein S4 (RPS4A) family protein |
| arTal_v1_Chr5_-_19287179_19287179 | 0.72 |
AT5G47550.1
|
AT5G47550
|
Cystatin/monellin superfamily protein |
| arTal_v1_Chr3_-_7704958_7704958 | 0.71 |
AT3G21870.1
|
CYCP2%3B1
|
cyclin p2;1 |
| arTal_v1_Chr4_-_8435105_8435105 | 0.70 |
AT4G14720.1
AT4G14720.2 |
AT4G14720
|
TIFY domain/Divergent CCT motif family protein |
| arTal_v1_Chr3_+_17549111_17549111 | 0.70 |
AT3G47610.1
|
AT3G47610
|
transcription regulator/ zinc ion binding protein |
| arTal_v1_Chr3_+_1086516_1086516 | 0.69 |
AT3G04140.1
|
AT3G04140
|
Ankyrin repeat family protein |
| arTal_v1_Chr5_-_16570275_16570275 | 0.69 |
AT5G41400.1
|
AT5G41400
|
RING/U-box superfamily protein |
| arTal_v1_Chr3_-_2264721_2264721 | 0.69 |
AT3G07150.1
|
AT3G07150
|
amino acid-ligase |
| arTal_v1_Chr1_+_2882491_2882543 | 0.69 |
AT1G08970.2
AT1G08970.1 AT1G08970.3 AT1G08970.4 |
NF-YC9
|
nuclear factor Y, subunit C9 |
| arTal_v1_Chr1_+_23899994_23900035 | 0.69 |
AT1G64385.1
AT1G64385.2 |
AT1G64385
|
transmembrane protein |
| arTal_v1_Chr5_-_19163918_19163980 | 0.68 |
AT5G47180.2
AT5G47180.1 |
AT5G47180
|
Plant VAMP (vesicle-associated membrane protein) family protein |
| arTal_v1_Chr3_+_5748497_5748497 | 0.68 |
AT3G16850.1
|
AT3G16850
|
Pectin lyase-like superfamily protein |
| arTal_v1_Chr3_+_17567476_17567476 | 0.68 |
AT3G47640.1
|
PYE
|
basic helix-loop-helix (bHLH) DNA-binding superfamily protein |
| arTal_v1_Chr2_+_18558885_18558938 | 0.68 |
AT2G44990.2
AT2G44990.3 AT2G44990.1 |
CCD7
|
carotenoid cleavage dioxygenase 7 |
| arTal_v1_Chr5_+_18816585_18816604 | 0.68 |
AT5G46390.2
AT5G46390.1 |
AT5G46390
|
Peptidase S41 family protein |
| arTal_v1_Chr5_-_17755742_17755768 | 0.67 |
AT5G44110.2
AT5G44110.4 AT5G44110.3 AT5G44110.1 |
ABCI21
|
P-loop containing nucleoside triphosphate hydrolases superfamily protein |
| arTal_v1_Chr1_-_19590281_19590281 | 0.67 |
AT1G52590.1
|
AT1G52590
|
Putative thiol-disulfide oxidoreductase DCC |
| arTal_v1_Chr5_-_25429255_25429255 | 0.67 |
AT5G63520.1
|
AT5G63520
|
F-box/LRR protein |
| arTal_v1_Chr3_+_10061009_10061043 | 0.67 |
AT3G27250.1
AT3G27250.2 |
AT3G27250
|
hypothetical protein |
| arTal_v1_Chr1_+_11119827_11119865 | 0.67 |
AT1G31150.1
AT1G31150.2 |
AT1G31150
|
K-box region protein (DUF1985) |
| arTal_v1_Chr5_-_8358546_8358546 | 0.66 |
AT5G24470.1
|
PRR5
|
two-component response regulator-like protein |
| arTal_v1_Chr1_-_8935544_8935544 | 0.66 |
AT1G25440.1
|
BBX15
|
B-box type zinc finger protein with CCT domain-containing protein |
| arTal_v1_Chr1_-_22871298_22871358 | 0.66 |
AT1G61890.3
AT1G61890.1 AT1G61890.2 |
AT1G61890
|
MATE efflux family protein |
| arTal_v1_Chr5_-_14238026_14238072 | 0.66 |
AT5G36170.4
AT5G36170.2 AT5G36170.3 AT5G36170.1 |
HCF109
|
high chlorophyll fluorescent 109 |
| arTal_v1_Chr1_-_7830275_7830424 | 0.66 |
AT1G22180.1
AT1G22180.3 AT1G22180.2 AT1G22180.4 |
AT1G22180
|
Sec14p-like phosphatidylinositol transfer family protein |
| arTal_v1_Chr4_-_13808003_13808031 | 0.65 |
AT4G27650.2
AT4G27650.3 AT4G27650.1 |
PEL1
|
Eukaryotic release factor 1 (eRF1) family protein |
| arTal_v1_Chr5_+_16161449_16161449 | 0.65 |
AT5G40390.1
|
SIP1
|
Raffinose synthase family protein |
| arTal_v1_Chr1_+_19484221_19484465 | 0.65 |
AT1G52320.5
AT1G52320.2 AT1G52320.1 |
AT1G52320
|
kinesin-like protein |
| arTal_v1_Chr5_+_105268_105282 | 0.64 |
AT5G01260.3
AT5G01260.2 AT5G01260.1 |
AT5G01260
|
Carbohydrate-binding-like fold |
| arTal_v1_Chr1_-_1659079_1659079 | 0.63 |
AT1G05570.3
|
CALS1
|
callose synthase 1 |
| arTal_v1_Chr1_-_1658806_1658806 | 0.63 |
AT1G05570.4
|
CALS1
|
callose synthase 1 |
| arTal_v1_Chr5_-_15828035_15828035 | 0.63 |
AT5G39530.1
AT5G39530.2 |
AT5G39530
|
hypothetical protein (DUF1997) |
| arTal_v1_Chr1_+_99865_99872 | 0.63 |
AT1G01240.4
AT1G01240.2 AT1G01240.1 AT1G01240.3 AT1G01240.5 |
AT1G01240
|
transmembrane protein |
| arTal_v1_Chr4_-_18232011_18232202 | 0.63 |
AT4G39140.5
AT4G39140.1 AT4G39140.2 AT4G39140.4 AT4G39140.3 |
AT4G39140
|
RING/U-box superfamily protein |
| arTal_v1_Chr5_-_24456115_24456115 | 0.62 |
AT5G60790.1
|
ABCF1
|
ABC transporter family protein |
| arTal_v1_Chr1_-_1659437_1659437 | 0.62 |
AT1G05570.2
|
CALS1
|
callose synthase 1 |
| arTal_v1_Chr5_+_3199533_3199533 | 0.62 |
AT5G10190.3
|
AT5G10190
|
Major facilitator superfamily protein |
| arTal_v1_Chr5_+_26926551_26926551 | 0.62 |
AT5G67470.1
|
FH6
|
formin homolog 6 |
| arTal_v1_Chr3_-_4782452_4782452 | 0.62 |
AT3G14330.1
|
AT3G14330
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
| arTal_v1_Chr4_+_15799077_15799138 | 0.62 |
AT4G32760.3
AT4G32760.2 AT4G32760.1 |
AT4G32760
|
ENTH/VHS/GAT family protein |
| arTal_v1_Chr5_-_26795369_26795369 | 0.62 |
AT5G67140.1
|
AT5G67140
|
F-box/RNI-like superfamily protein |
| arTal_v1_Chr1_-_1659611_1659611 | 0.62 |
AT1G05570.1
|
CALS1
|
callose synthase 1 |
| arTal_v1_Chr5_-_26080209_26080209 | 0.61 |
AT5G65250.1
|
AT5G65250
|
transmembrane protein |
| arTal_v1_Chr1_-_8033156_8033156 | 0.61 |
AT1G22710.1
|
SUC2
|
sucrose-proton symporter 2 |
| arTal_v1_Chr4_+_12649985_12649987 | 0.61 |
AT4G24480.2
AT4G24480.1 AT4G24480.3 |
AT4G24480
|
Protein kinase superfamily protein |
| arTal_v1_Chr1_-_29715017_29715017 | 0.61 |
AT1G78990.1
|
AT1G78990
|
HXXXD-type acyl-transferase family protein |
| arTal_v1_Chr2_+_12712879_12712879 | 0.61 |
AT2G29760.1
|
OTP81
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
| arTal_v1_Chr2_+_18834011_18834149 | 0.60 |
AT2G45720.3
AT2G45720.2 AT2G45720.4 AT2G45720.5 |
AT2G45720
|
ARM repeat superfamily protein |
| arTal_v1_Chr3_+_15430660_15430660 | 0.60 |
AT3G43540.1
AT3G43540.2 |
AT3G43540
|
initiation factor 4F subunit (DUF1350) |
| arTal_v1_Chr2_-_19556126_19556126 | 0.60 |
AT2G47710.1
|
AT2G47710
|
Adenine nucleotide alpha hydrolases-like superfamily protein |
| arTal_v1_Chr3_+_23444203_23444203 | 0.60 |
AT3G63490.1
AT3G63490.2 |
EMB3126
|
Ribosomal protein L1p/L10e family |
| arTal_v1_Chr3_+_20961543_20961589 | 0.59 |
AT3G56580.1
AT3G56580.2 AT3G56580.3 |
AT3G56580
|
RING/U-box superfamily protein |
| arTal_v1_Chr1_+_20235465_20235465 | 0.59 |
AT1G54200.1
|
AT1G54200
|
DNA mismatch repair Msh6-like protein |
| arTal_v1_Chr1_+_26450166_26450166 | 0.59 |
AT1G70230.1
|
TBL27
|
TRICHOME BIREFRINGENCE-LIKE 27 |
| arTal_v1_Chr1_+_20713499_20713499 | 0.59 |
AT1G55480.1
|
ZKT
|
protein containing PDZ domain, a K-box domain, and a TPR region |
| arTal_v1_Chr1_-_29965758_29965795 | 0.59 |
AT1G79630.2
AT1G79630.1 AT1G79630.7 AT1G79630.5 AT1G79630.4 AT1G79630.8 AT1G79630.3 AT1G79630.6 |
AT1G79630
|
Protein phosphatase 2C family protein |
| arTal_v1_Chr1_+_28940486_28940486 | 0.59 |
AT1G77000.4
AT1G77000.1 |
SKP2B
|
RNI-like superfamily protein |
| arTal_v1_Chr4_+_16410791_16410791 | 0.59 |
AT4G34290.1
|
AT4G34290
|
SWIB/MDM2 domain superfamily protein |
| arTal_v1_Chr2_-_15371033_15371033 | 0.59 |
AT2G36680.1
AT2G36680.3 |
AT2G36680
|
Modifier of rudimentary (Mod(r)) protein |
| arTal_v1_Chr2_-_15370829_15370846 | 0.58 |
AT2G36680.4
AT2G36680.2 |
AT2G36680
|
Modifier of rudimentary (Mod(r)) protein |
| arTal_v1_Chr5_+_3199102_3199102 | 0.58 |
AT5G10190.2
|
AT5G10190
|
Major facilitator superfamily protein |
| arTal_v1_Chr3_-_3684871_3684871 | 0.58 |
AT3G11670.1
|
DGD1
|
UDP-Glycosyltransferase superfamily protein |
| arTal_v1_Chr5_+_20282111_20282111 | 0.58 |
AT5G49880.1
|
MAD1
|
mitotic checkpoint family protein |
| arTal_v1_Chr3_-_2931289_2931362 | 0.58 |
AT3G09540.2
AT3G09540.3 AT3G09540.1 |
AT3G09540
|
Pectin lyase-like superfamily protein |
| arTal_v1_Chr5_-_15825566_15825566 | 0.58 |
AT5G39520.1
|
AT5G39520
|
hypothetical protein (DUF1997) |
| arTal_v1_Chr1_+_28940147_28940272 | 0.58 |
AT1G77000.2
AT1G77000.3 |
SKP2B
|
RNI-like superfamily protein |
| arTal_v1_Chr5_+_3198898_3198898 | 0.57 |
AT5G10190.1
|
AT5G10190
|
Major facilitator superfamily protein |
| arTal_v1_Chr5_+_22779614_22779614 | 0.57 |
AT5G56270.1
|
WRKY2
|
WRKY DNA-binding protein 2 |
| arTal_v1_Chr3_+_6191461_6191461 | 0.57 |
AT3G18080.1
|
BGLU44
|
B-S glucosidase 44 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 2.7 | GO:0010266 | response to vitamin B1(GO:0010266) |
| 0.8 | 2.3 | GO:0006659 | phosphatidylserine metabolic process(GO:0006658) phosphatidylserine biosynthetic process(GO:0006659) |
| 0.7 | 3.7 | GO:0043279 | response to caffeine(GO:0031000) response to alkaloid(GO:0043279) |
| 0.5 | 1.5 | GO:1904215 | regulation of protein import into chloroplast stroma(GO:1904215) |
| 0.3 | 1.4 | GO:0001173 | DNA-templated transcriptional start site selection(GO:0001173) |
| 0.3 | 1.3 | GO:0048480 | stigma development(GO:0048480) |
| 0.3 | 1.6 | GO:1903960 | negative regulation of anion channel activity(GO:0010360) regulation of anion channel activity by blue light(GO:0010361) negative regulation of anion channel activity by blue light(GO:0010362) negative regulation of transporter activity(GO:0032410) negative regulation of ion transmembrane transporter activity(GO:0032413) negative regulation of transmembrane transport(GO:0034763) negative regulation of ion transmembrane transport(GO:0034766) negative regulation of anion transport(GO:1903792) negative regulation of anion transmembrane transport(GO:1903960) |
| 0.3 | 0.9 | GO:0090143 | nucleoid organization(GO:0090143) |
| 0.3 | 0.9 | GO:1901031 | regulation of response to reactive oxygen species(GO:1901031) |
| 0.3 | 0.9 | GO:0055064 | cellular sodium ion homeostasis(GO:0006883) chloride ion homeostasis(GO:0055064) |
| 0.2 | 0.5 | GO:0090322 | regulation of superoxide metabolic process(GO:0090322) |
| 0.2 | 0.7 | GO:0016118 | tetraterpenoid catabolic process(GO:0016110) carotenoid catabolic process(GO:0016118) xanthophyll catabolic process(GO:0016124) |
| 0.2 | 1.1 | GO:0042550 | photosystem I stabilization(GO:0042550) |
| 0.2 | 0.7 | GO:0019406 | hexitol metabolic process(GO:0006059) hexitol biosynthetic process(GO:0019406) mannitol biosynthetic process(GO:0019593) mannitol metabolic process(GO:0019594) |
| 0.2 | 0.8 | GO:0010480 | microsporocyte differentiation(GO:0010480) |
| 0.2 | 0.6 | GO:0009915 | phloem sucrose loading(GO:0009915) |
| 0.2 | 1.7 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
| 0.2 | 6.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.2 | 0.2 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.2 | 1.2 | GO:1901332 | negative regulation of lateral root development(GO:1901332) |
| 0.2 | 0.7 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.2 | 10.3 | GO:0009631 | cold acclimation(GO:0009631) |
| 0.2 | 2.1 | GO:0048317 | seed morphogenesis(GO:0048317) |
| 0.1 | 2.8 | GO:0006074 | (1->3)-beta-D-glucan metabolic process(GO:0006074) (1->3)-beta-D-glucan biosynthetic process(GO:0006075) |
| 0.1 | 1.5 | GO:0010106 | cellular response to iron ion starvation(GO:0010106) |
| 0.1 | 0.5 | GO:0009831 | plant-type cell wall modification involved in multidimensional cell growth(GO:0009831) |
| 0.1 | 2.0 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.4 | GO:0010395 | rhamnogalacturonan I metabolic process(GO:0010395) |
| 0.1 | 0.4 | GO:1901881 | positive regulation of protein depolymerization(GO:1901881) |
| 0.1 | 1.6 | GO:0010417 | glucuronoxylan metabolic process(GO:0010413) glucuronoxylan biosynthetic process(GO:0010417) |
| 0.1 | 0.7 | GO:0009772 | photosynthetic electron transport in photosystem II(GO:0009772) |
| 0.1 | 0.6 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.1 | 0.8 | GO:0045038 | protein import into chloroplast thylakoid membrane(GO:0045038) |
| 0.1 | 0.7 | GO:2000306 | positive regulation of photomorphogenesis(GO:2000306) |
| 0.1 | 0.8 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.6 | GO:0032951 | negative regulation of cellular carbohydrate metabolic process(GO:0010677) regulation of beta-glucan metabolic process(GO:0032950) regulation of beta-glucan biosynthetic process(GO:0032951) regulation of cellulose biosynthetic process(GO:2001006) |
| 0.1 | 0.3 | GO:0048833 | specification of organ number(GO:0048832) specification of floral organ number(GO:0048833) |
| 0.1 | 0.5 | GO:1901004 | ubiquinone-6 metabolic process(GO:1901004) ubiquinone-6 biosynthetic process(GO:1901006) |
| 0.1 | 0.5 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.1 | 1.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 | 0.7 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 | 0.5 | GO:0080175 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) phragmoplast assembly(GO:0000914) phragmoplast microtubule organization(GO:0080175) assembly of actomyosin apparatus involved in mitotic cytokinesis(GO:1902407) |
| 0.1 | 1.3 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.1 | 0.4 | GO:0060145 | viral gene silencing in virus induced gene silencing(GO:0060145) |
| 0.1 | 0.3 | GO:0006056 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) response to cobalt ion(GO:0032025) |
| 0.1 | 1.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.5 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) |
| 0.1 | 0.5 | GO:0006000 | fructose metabolic process(GO:0006000) |
| 0.1 | 0.3 | GO:0015965 | diadenosine polyphosphate metabolic process(GO:0015959) diadenosine tetraphosphate metabolic process(GO:0015965) |
| 0.1 | 0.5 | GO:0051098 | regulation of binding(GO:0051098) |
| 0.1 | 0.4 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 0.1 | 0.7 | GO:0045962 | positive regulation of development, heterochronic(GO:0045962) |
| 0.1 | 12.2 | GO:0048511 | circadian rhythm(GO:0007623) rhythmic process(GO:0048511) |
| 0.1 | 0.3 | GO:0000455 | enzyme-directed rRNA pseudouridine synthesis(GO:0000455) |
| 0.1 | 0.3 | GO:0022615 | protein import into peroxisome matrix, docking(GO:0016560) protein to membrane docking(GO:0022615) |
| 0.1 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.2 | GO:0080140 | regulation of jasmonic acid metabolic process(GO:0080140) regulation of jasmonic acid biosynthetic process(GO:0080141) |
| 0.1 | 0.1 | GO:0010343 | singlet oxygen-mediated programmed cell death(GO:0010343) |
| 0.1 | 0.6 | GO:0030308 | negative regulation of cell growth(GO:0030308) |
| 0.1 | 2.9 | GO:0048510 | regulation of timing of meristematic phase transition(GO:0048506) regulation of timing of transition from vegetative to reproductive phase(GO:0048510) |
| 0.1 | 3.1 | GO:0072666 | protein targeting to vacuole(GO:0006623) protein localization to vacuole(GO:0072665) establishment of protein localization to vacuole(GO:0072666) |
| 0.1 | 0.4 | GO:0006809 | nitric oxide biosynthetic process(GO:0006809) |
| 0.1 | 0.2 | GO:0080153 | regulation of photosynthesis, dark reaction(GO:0010110) cellular response to anoxia(GO:0071454) regulation of reductive pentose-phosphate cycle(GO:0080152) negative regulation of reductive pentose-phosphate cycle(GO:0080153) |
| 0.1 | 0.7 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.1 | 0.9 | GO:0010044 | response to aluminum ion(GO:0010044) |
| 0.1 | 1.1 | GO:0009750 | response to fructose(GO:0009750) |
| 0.1 | 0.8 | GO:0017157 | regulation of exocytosis(GO:0017157) regulation of secretion(GO:0051046) regulation of secretion by cell(GO:1903530) |
| 0.1 | 0.7 | GO:0007004 | RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
| 0.1 | 0.2 | GO:1902446 | regulation of shade avoidance(GO:1902446) positive regulation of shade avoidance(GO:1902448) |
| 0.1 | 0.6 | GO:0009942 | longitudinal axis specification(GO:0009942) |
| 0.1 | 0.4 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.1 | 0.4 | GO:0048363 | mucilage pectin metabolic process(GO:0048363) |
| 0.1 | 0.3 | GO:0042549 | photosystem II stabilization(GO:0042549) |
| 0.1 | 0.6 | GO:0010206 | photosystem II repair(GO:0010206) |
| 0.1 | 3.4 | GO:0015995 | chlorophyll biosynthetic process(GO:0015995) |
| 0.1 | 0.4 | GO:0040001 | establishment of mitotic spindle orientation(GO:0000132) establishment of mitotic spindle localization(GO:0040001) establishment of spindle localization(GO:0051293) establishment of spindle orientation(GO:0051294) spindle localization(GO:0051653) |
| 0.0 | 0.1 | GO:1901537 | positive regulation of DNA demethylation(GO:1901537) |
| 0.0 | 0.2 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
| 0.0 | 0.2 | GO:0046477 | glycosylceramide metabolic process(GO:0006677) glucosylceramide metabolic process(GO:0006678) glucosylceramide catabolic process(GO:0006680) glycosphingolipid metabolic process(GO:0006687) glycolipid catabolic process(GO:0019377) glycosylceramide catabolic process(GO:0046477) glycosphingolipid catabolic process(GO:0046479) ceramide catabolic process(GO:0046514) |
| 0.0 | 0.4 | GO:0034311 | sphingosine metabolic process(GO:0006670) diol metabolic process(GO:0034311) diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.0 | 0.1 | GO:0080051 | cutin transport(GO:0080051) |
| 0.0 | 0.3 | GO:0010929 | positive regulation of auxin mediated signaling pathway(GO:0010929) |
| 0.0 | 0.2 | GO:0080168 | abscisic acid transport(GO:0080168) |
| 0.0 | 0.5 | GO:0010100 | negative regulation of photomorphogenesis(GO:0010100) |
| 0.0 | 0.7 | GO:0071329 | cellular response to sucrose stimulus(GO:0071329) |
| 0.0 | 0.3 | GO:0034035 | guanosine tetraphosphate metabolic process(GO:0015969) purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.2 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.0 | 0.5 | GO:0005978 | glycogen biosynthetic process(GO:0005978) |
| 0.0 | 0.3 | GO:0010258 | NADH dehydrogenase complex (plastoquinone) assembly(GO:0010258) |
| 0.0 | 0.8 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
| 0.0 | 0.6 | GO:0010315 | auxin efflux(GO:0010315) |
| 0.0 | 0.2 | GO:0031023 | microtubule organizing center organization(GO:0031023) |
| 0.0 | 0.3 | GO:0090506 | axillary shoot meristem initiation(GO:0090506) |
| 0.0 | 0.4 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.0 | 0.3 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.3 | GO:0043155 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) |
| 0.0 | 0.2 | GO:0010067 | procambium histogenesis(GO:0010067) |
| 0.0 | 0.5 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.5 | GO:0048497 | maintenance of organ identity(GO:0048496) maintenance of floral organ identity(GO:0048497) |
| 0.0 | 0.4 | GO:0009641 | shade avoidance(GO:0009641) |
| 0.0 | 0.3 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 | 0.2 | GO:0019405 | alditol catabolic process(GO:0019405) glycerol catabolic process(GO:0019563) |
| 0.0 | 1.3 | GO:0048235 | pollen sperm cell differentiation(GO:0048235) |
| 0.0 | 0.2 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.0 | 0.7 | GO:0006415 | translational termination(GO:0006415) |
| 0.0 | 0.3 | GO:0030835 | negative regulation of actin filament depolymerization(GO:0030835) actin filament capping(GO:0051693) |
| 0.0 | 1.5 | GO:0009740 | gibberellic acid mediated signaling pathway(GO:0009740) |
| 0.0 | 0.8 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.0 | 0.3 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.0 | 0.6 | GO:0031425 | chloroplast RNA processing(GO:0031425) |
| 0.0 | 0.5 | GO:0009089 | lysine biosynthetic process via diaminopimelate(GO:0009089) diaminopimelate metabolic process(GO:0046451) |
| 0.0 | 0.1 | GO:0015739 | sialic acid transport(GO:0015739) |
| 0.0 | 0.4 | GO:0009231 | riboflavin metabolic process(GO:0006771) riboflavin biosynthetic process(GO:0009231) |
| 0.0 | 0.5 | GO:0006814 | sodium ion transport(GO:0006814) |
| 0.0 | 0.3 | GO:1901371 | regulation of leaf morphogenesis(GO:1901371) |
| 0.0 | 2.0 | GO:0043067 | regulation of programmed cell death(GO:0043067) |
| 0.0 | 0.2 | GO:1901703 | protein localization involved in auxin polar transport(GO:1901703) |
| 0.0 | 0.5 | GO:0009645 | response to low light intensity stimulus(GO:0009645) |
| 0.0 | 0.3 | GO:1901141 | regulation of lignin biosynthetic process(GO:1901141) |
| 0.0 | 0.3 | GO:0010048 | vernalization response(GO:0010048) |
| 0.0 | 0.3 | GO:0009773 | photosynthetic electron transport in photosystem I(GO:0009773) |
| 0.0 | 1.6 | GO:0007018 | microtubule-based movement(GO:0007018) |
| 0.0 | 0.1 | GO:0048255 | mRNA stabilization(GO:0048255) |
| 0.0 | 0.6 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.1 | GO:0006723 | cuticle hydrocarbon biosynthetic process(GO:0006723) |
| 0.0 | 0.3 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 0.0 | 1.4 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.5 | GO:0046834 | lipid phosphorylation(GO:0046834) phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.3 | GO:0050821 | protein stabilization(GO:0050821) |
| 0.0 | 0.4 | GO:0009269 | response to desiccation(GO:0009269) |
| 0.0 | 0.5 | GO:0051453 | regulation of cellular pH(GO:0030641) regulation of intracellular pH(GO:0051453) |
| 0.0 | 0.3 | GO:2000030 | regulation of response to red or far red light(GO:2000030) |
| 0.0 | 0.8 | GO:0010075 | regulation of meristem growth(GO:0010075) |
| 0.0 | 0.4 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.2 | GO:0048359 | mucilage metabolic process involved in seed coat development(GO:0048359) |
| 0.0 | 0.6 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.5 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.3 | GO:0010305 | leaf vascular tissue pattern formation(GO:0010305) |
| 0.0 | 0.2 | GO:0010928 | regulation of auxin mediated signaling pathway(GO:0010928) |
| 0.0 | 0.2 | GO:2000071 | pattern recognition receptor signaling pathway(GO:0002221) regulation of defense response by callose deposition(GO:2000071) |
| 0.0 | 0.0 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.0 | 0.3 | GO:0030042 | actin filament depolymerization(GO:0030042) |
| 0.0 | 0.2 | GO:0010093 | specification of floral organ identity(GO:0010093) |
| 0.0 | 0.1 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.0 | 0.5 | GO:0045036 | protein targeting to chloroplast(GO:0045036) establishment of protein localization to chloroplast(GO:0072596) |
| 0.0 | 0.6 | GO:2000280 | regulation of root development(GO:2000280) |
| 0.0 | 0.2 | GO:0009767 | photosynthetic electron transport chain(GO:0009767) |
| 0.0 | 0.3 | GO:0007030 | Golgi organization(GO:0007030) |
| 0.0 | 0.4 | GO:0009851 | auxin biosynthetic process(GO:0009851) |
| 0.0 | 0.1 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.0 | 0.4 | GO:0000122 | negative regulation of transcription from RNA polymerase II promoter(GO:0000122) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 4.4 | GO:0031353 | intrinsic component of plastid inner membrane(GO:0031352) integral component of plastid inner membrane(GO:0031353) intrinsic component of chloroplast inner membrane(GO:0031356) integral component of chloroplast inner membrane(GO:0031357) |
| 0.4 | 1.7 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.2 | 1.4 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 2.8 | GO:0000148 | 1,3-beta-D-glucan synthase complex(GO:0000148) |
| 0.1 | 0.6 | GO:0009509 | chromoplast(GO:0009509) |
| 0.1 | 1.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 2.4 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
| 0.1 | 0.4 | GO:0031515 | tRNA (m1A) methyltransferase complex(GO:0031515) |
| 0.1 | 0.7 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.1 | 0.3 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 1.0 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.1 | 0.2 | GO:0030093 | chloroplast photosystem I(GO:0030093) |
| 0.1 | 3.6 | GO:0009528 | plastid inner membrane(GO:0009528) |
| 0.1 | 0.3 | GO:0046695 | SLIK (SAGA-like) complex(GO:0046695) |
| 0.1 | 3.1 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.4 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 1.2 | GO:0009654 | photosystem II oxygen evolving complex(GO:0009654) |
| 0.0 | 0.5 | GO:0009522 | photosystem I(GO:0009522) |
| 0.0 | 0.7 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.7 | GO:0098807 | chloroplast thylakoid membrane protein complex(GO:0098807) |
| 0.0 | 2.2 | GO:0010287 | plastoglobule(GO:0010287) |
| 0.0 | 0.7 | GO:0010598 | NAD(P)H dehydrogenase complex (plastoquinone)(GO:0010598) |
| 0.0 | 1.9 | GO:0031977 | thylakoid lumen(GO:0031977) |
| 0.0 | 0.6 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 2.7 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.2 | GO:0043036 | chloroplast starch grain(GO:0009569) starch grain(GO:0043036) |
| 0.0 | 0.5 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 4.0 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 1.8 | GO:0009707 | chloroplast outer membrane(GO:0009707) |
| 0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 1.6 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.1 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.4 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.8 | GO:0031228 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
| 0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.5 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.4 | GO:0048500 | signal recognition particle(GO:0048500) |
| 0.0 | 1.5 | GO:0009524 | phragmoplast(GO:0009524) |
| 0.0 | 1.0 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.3 | GO:0098552 | side of membrane(GO:0098552) |
| 0.0 | 1.3 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
| 0.0 | 0.5 | GO:0005875 | microtubule associated complex(GO:0005875) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 6.5 | GO:0047216 | inositol 3-alpha-galactosyltransferase activity(GO:0047216) |
| 0.7 | 3.4 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.5 | 2.2 | GO:0004512 | inositol-3-phosphate synthase activity(GO:0004512) |
| 0.5 | 2.4 | GO:0010277 | chlorophyllide a oxygenase [overall] activity(GO:0010277) |
| 0.5 | 3.7 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.4 | 2.7 | GO:0080041 | ADP-sugar diphosphatase activity(GO:0019144) ADP-ribose pyrophosphohydrolase activity(GO:0080041) |
| 0.4 | 1.1 | GO:0046480 | galactolipid galactosyltransferase activity(GO:0046480) |
| 0.3 | 1.4 | GO:1990269 | phosphoserine binding(GO:0050815) RNA polymerase II C-terminal domain phosphoserine binding(GO:1990269) |
| 0.3 | 1.2 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.3 | 0.9 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.3 | 0.8 | GO:0080045 | quercetin 3'-O-glucosyltransferase activity(GO:0080045) |
| 0.2 | 1.7 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.2 | 2.6 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.2 | 1.3 | GO:0001872 | (1->3)-beta-D-glucan binding(GO:0001872) |
| 0.2 | 0.7 | GO:0003935 | GTP cyclohydrolase II activity(GO:0003935) 3,4-dihydroxy-2-butanone-4-phosphate synthase activity(GO:0008686) |
| 0.2 | 0.5 | GO:0003844 | 1,4-alpha-glucan branching enzyme activity(GO:0003844) |
| 0.2 | 1.6 | GO:0009882 | blue light photoreceptor activity(GO:0009882) |
| 0.1 | 2.8 | GO:0003843 | 1,3-beta-D-glucan synthase activity(GO:0003843) |
| 0.1 | 0.4 | GO:0008481 | sphinganine kinase activity(GO:0008481) |
| 0.1 | 0.4 | GO:0004750 | ribulose-phosphate 3-epimerase activity(GO:0004750) |
| 0.1 | 0.5 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.1 | 1.2 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.1 | 2.0 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.1 | 0.4 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.1 | 0.3 | GO:0008963 | phospho-N-acetylmuramoyl-pentapeptide-transferase activity(GO:0008963) |
| 0.1 | 0.4 | GO:0080103 | 4-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080103) |
| 0.1 | 0.4 | GO:0016429 | tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.1 | 0.3 | GO:0001216 | bacterial-type RNA polymerase transcription factor activity, sequence-specific DNA binding(GO:0001130) bacterial-type RNA polymerase transcriptional activator activity, sequence-specific DNA binding(GO:0001216) |
| 0.1 | 0.3 | GO:0004476 | mannose-6-phosphate isomerase activity(GO:0004476) |
| 0.1 | 0.7 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.1 | 0.3 | GO:0010242 | oxygen evolving activity(GO:0010242) |
| 0.1 | 0.3 | GO:0031409 | pigment binding(GO:0031409) |
| 0.1 | 0.7 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.1 | 3.2 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) |
| 0.1 | 3.4 | GO:0000156 | phosphorelay response regulator activity(GO:0000156) |
| 0.1 | 0.4 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 0.4 | GO:0031956 | medium-chain fatty acid-CoA ligase activity(GO:0031956) |
| 0.1 | 0.4 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 0.8 | GO:0017022 | myosin binding(GO:0017022) |
| 0.1 | 0.7 | GO:0098847 | single-stranded telomeric DNA binding(GO:0043047) sequence-specific single stranded DNA binding(GO:0098847) |
| 0.1 | 0.5 | GO:0045549 | 9-cis-epoxycarotenoid dioxygenase activity(GO:0045549) |
| 0.1 | 0.4 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 0.8 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 1.0 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
| 0.1 | 0.3 | GO:0034432 | bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
| 0.1 | 0.3 | GO:0047517 | 1,4-beta-D-xylan synthase activity(GO:0047517) |
| 0.1 | 0.5 | GO:0004567 | beta-mannosidase activity(GO:0004567) |
| 0.1 | 0.3 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.1 | 1.5 | GO:0016168 | chlorophyll binding(GO:0016168) |
| 0.1 | 0.7 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
| 0.1 | 0.2 | GO:0004412 | homoserine dehydrogenase activity(GO:0004412) |
| 0.1 | 0.4 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.1 | 0.8 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.1 | 0.9 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 0.1 | 0.8 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.1 | 1.0 | GO:0005199 | structural constituent of cell wall(GO:0005199) |
| 0.0 | 0.2 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 3.3 | GO:0004650 | polygalacturonase activity(GO:0004650) |
| 0.0 | 0.5 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.3 | GO:0008728 | GTP diphosphokinase activity(GO:0008728) |
| 0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.9 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.4 | GO:0016872 | intramolecular lyase activity(GO:0016872) |
| 0.0 | 2.5 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.0 | 2.1 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.5 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.1 | GO:0033764 | steroid dehydrogenase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0033764) |
| 0.0 | 0.1 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.2 | GO:0046592 | polyamine oxidase activity(GO:0046592) |
| 0.0 | 2.2 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.6 | GO:0010329 | auxin efflux transmembrane transporter activity(GO:0010329) |
| 0.0 | 0.2 | GO:0045156 | electron transporter, transferring electrons within the cyclic electron transport pathway of photosynthesis activity(GO:0045156) |
| 0.0 | 0.1 | GO:0015136 | sialic acid transmembrane transporter activity(GO:0015136) |
| 0.0 | 0.5 | GO:0004124 | cysteine synthase activity(GO:0004124) |
| 0.0 | 0.2 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.0 | 0.1 | GO:0004737 | pyruvate decarboxylase activity(GO:0004737) |
| 0.0 | 0.2 | GO:0003955 | NAD(P)H dehydrogenase (quinone) activity(GO:0003955) |
| 0.0 | 0.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 1.6 | GO:0016620 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, NAD or NADP as acceptor(GO:0016620) |
| 0.0 | 1.6 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 1.0 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.0 | 0.5 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 0.1 | GO:0004148 | dihydrolipoyl dehydrogenase activity(GO:0004148) |
| 0.0 | 0.3 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 0.7 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.2 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.1 | GO:0001653 | peptide receptor activity(GO:0001653) |
| 0.0 | 0.3 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.0 | 1.9 | GO:0003779 | actin binding(GO:0003779) |
| 0.0 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.1 | GO:0008022 | protein C-terminus binding(GO:0008022) |
| 0.0 | 0.3 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.0 | 0.3 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.0 | 0.2 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.0 | 0.6 | GO:0033612 | receptor serine/threonine kinase binding(GO:0033612) |
| 0.0 | 0.1 | GO:0047938 | glucose-6-phosphate 1-epimerase activity(GO:0047938) |
| 0.0 | 0.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.1 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 0.0 | 0.0 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.2 | GO:0022843 | voltage-gated cation channel activity(GO:0022843) |
| 0.0 | 0.9 | GO:0003712 | transcription factor activity, transcription factor binding(GO:0000989) transcription cofactor activity(GO:0003712) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.6 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.1 | 0.7 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.0 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.3 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.1 | PID PLK1 PATHWAY | PLK1 signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.9 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.0 | 0.1 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
| 0.0 | 0.2 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.2 | REACTOME METABOLISM OF CARBOHYDRATES | Genes involved in Metabolism of carbohydrates |