GSE130291:vernalization in Arabidopsis thaliana
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
AT1G65910
|
AT1G65910 | NAC domain containing protein 28 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| NAC028 | arTal_v1_Chr1_-_24524260_24524260 | -0.56 | 3.9e-02 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| arTal_v1_Chr5_-_23308680_23308680 | 2.59 |
AT5G57560.1
|
TCH4
|
Xyloglucan endotransglucosylase/hydrolase family protein |
| arTal_v1_Chr1_-_4835089_4835089 | 2.08 |
AT1G14120.2
AT1G14120.1 AT1G14120.3 |
AT1G14120
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
| arTal_v1_Chr1_-_7388512_7388512 | 2.07 |
AT1G21100.1
|
IGMT1
|
O-methyltransferase family protein |
| arTal_v1_Chr3_-_3993886_3993886 | 1.99 |
AT3G12580.1
|
HSP70
|
heat shock protein 70 |
| arTal_v1_Chr4_+_12137995_12138137 | 1.96 |
AT4G23180.1
AT4G23180.3 AT4G23180.2 |
CRK10
|
cysteine-rich RLK (RECEPTOR-like protein kinase) 10 |
| arTal_v1_Chr2_+_12588191_12588197 | 1.91 |
AT2G29300.2
AT2G29300.1 |
AT2G29300
|
NAD(P)-binding Rossmann-fold superfamily protein |
| arTal_v1_Chr1_-_24558322_24558322 | 1.89 |
AT1G65970.1
|
TPX2
|
thioredoxin-dependent peroxidase 2 |
| arTal_v1_Chr2_-_7919345_7919345 | 1.82 |
AT2G18193.1
|
AT2G18193
|
P-loop containing nucleoside triphosphate hydrolases superfamily protein |
| arTal_v1_Chr3_+_16789780_16789780 | 1.79 |
AT3G45730.1
|
AT3G45730
|
hypothetical protein |
| arTal_v1_Chr4_-_17571743_17571743 | 1.79 |
AT4G37370.1
|
CYP81D8
|
cytochrome P450, family 81, subfamily D, polypeptide 8 |
| arTal_v1_Chr5_+_21352557_21352557 | 1.74 |
AT5G52640.1
|
HSP90.1
|
heat shock-like protein |
| arTal_v1_Chr4_+_11150049_11150049 | 1.73 |
AT4G20820.1
|
AT4G20820
|
FAD-binding Berberine family protein |
| arTal_v1_Chr3_+_10538005_10538105 | 1.72 |
AT3G28270.2
AT3G28270.1 |
AT3G28270
|
transmembrane protein, putative (DUF677) |
| arTal_v1_Chr2_-_8533779_8533779 | 1.71 |
AT2G19800.1
|
MIOX2
|
myo-inositol oxygenase 2 |
| arTal_v1_Chr1_-_23137254_23137254 | 1.71 |
AT1G62510.1
|
AT1G62510
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
| arTal_v1_Chr5_-_15167859_15167864 | 1.71 |
AT5G38020.2
AT5G38020.1 |
AT5G38020
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
| arTal_v1_Chr2_+_16108235_16108235 | 1.70 |
AT2G38470.1
|
WRKY33
|
WRKY DNA-binding protein 33 |
| arTal_v1_Chr3_+_17879542_17879542 | 1.67 |
AT3G48280.1
|
CYP71A25
|
cytochrome P450, family 71, subfamily A, polypeptide 25 |
| arTal_v1_Chr1_-_10720843_10720843 | 1.66 |
AT1G30370.1
|
DLAH
|
alpha/beta-Hydrolases superfamily protein |
| arTal_v1_Chr4_+_13128394_13128394 | 1.63 |
AT4G25810.1
|
XTR6
|
xyloglucan endotransglycosylase 6 |
| arTal_v1_Chr2_-_15421866_15421866 | 1.58 |
AT2G36790.1
|
UGT73C6
|
UDP-glucosyl transferase 73C6 |
| arTal_v1_Chr5_-_216773_216773 | 1.56 |
AT5G01550.1
|
LECRKA4.2
|
lectin receptor kinase a4.1 |
| arTal_v1_Chr4_+_418327_418391 | 1.56 |
AT4G00970.1
AT4G00970.2 |
CRK41
|
cysteine-rich RLK (RECEPTOR-like protein kinase) 41 |
| arTal_v1_Chr1_+_11928757_11928757 | 1.54 |
AT1G32920.1
|
AT1G32920
|
hypothetical protein |
| arTal_v1_Chr4_-_7494234_7494234 | 1.52 |
AT4G12735.1
|
AT4G12735
|
hypothetical protein |
| arTal_v1_Chr1_+_5204312_5204433 | 1.50 |
AT1G15125.1
AT1G15125.2 |
AT1G15125
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
| arTal_v1_Chr2_-_14541617_14541617 | 1.49 |
AT2G34500.1
|
CYP710A1
|
cytochrome P450, family 710, subfamily A, polypeptide 1 |
| arTal_v1_Chr1_-_1702749_1702749 | 1.46 |
AT1G05675.1
|
AT1G05675
|
UDP-Glycosyltransferase superfamily protein |
| arTal_v1_Chr1_-_2747936_2747967 | 1.46 |
AT1G08630.6
AT1G08630.7 AT1G08630.5 AT1G08630.2 |
THA1
|
threonine aldolase 1 |
| arTal_v1_Chr1_-_9143336_9143336 | 1.43 |
AT1G26420.1
|
AT1G26420
|
FAD-binding Berberine family protein |
| arTal_v1_Chr3_+_7906521_7906521 | 1.43 |
AT3G22370.1
|
AOX1A
|
alternative oxidase 1A |
| arTal_v1_Chr2_-_1339468_1339468 | 1.43 |
AT2G04050.1
|
AT2G04050
|
MATE efflux family protein |
| arTal_v1_Chr1_+_3664187_3664187 | 1.42 |
AT1G10960.1
|
FD1
|
ferredoxin 1 |
| arTal_v1_Chr2_+_15706285_15706285 | 1.40 |
AT2G37430.1
|
ZAT11
|
C2H2 and C2HC zinc fingers superfamily protein |
| arTal_v1_Chr5_+_9050660_9050660 | 1.39 |
AT5G25930.1
|
AT5G25930
|
kinase family with leucine-rich repeat domain-containing protein |
| arTal_v1_Chr2_-_8913747_8913747 | 1.38 |
AT2G20670.1
|
AT2G20670
|
sugar phosphate exchanger, putative (DUF506) |
| arTal_v1_Chr2_+_17854557_17854557 | 1.37 |
AT2G42900.1
|
AT2G42900
|
Plant basic secretory protein (BSP) family protein |
| arTal_v1_Chr2_-_8370675_8370675 | 1.37 |
AT2G19310.1
|
AT2G19310
|
HSP20-like chaperones superfamily protein |
| arTal_v1_Chr4_-_14820595_14820595 | 1.36 |
AT4G30270.1
|
XTH24
|
xyloglucan endotransglucosylase/hydrolase 24 |
| arTal_v1_Chr4_+_16354857_16354857 | 1.35 |
AT4G34150.1
|
AT4G34150
|
Calcium-dependent lipid-binding (CaLB domain) family protein |
| arTal_v1_Chr3_-_15953346_15953346 | 1.33 |
AT3G44260.1
|
CAF1a
|
Polynucleotidyl transferase, ribonuclease H-like superfamily protein |
| arTal_v1_Chr3_+_8703220_8703220 | 1.31 |
AT3G24100.1
|
AT3G24100
|
Uncharacterized protein family SERF |
| arTal_v1_Chr1_-_27265806_27265806 | 1.28 |
AT1G72430.1
|
AT1G72430
|
SAUR-like auxin-responsive protein family |
| arTal_v1_Chr1_+_27308513_27308513 | 1.28 |
AT1G72520.1
|
LOX4
|
PLAT/LH2 domain-containing lipoxygenase family protein |
| arTal_v1_Chr1_-_26295609_26295922 | 1.26 |
AT1G69840.6
AT1G69840.3 AT1G69840.2 AT1G69840.5 AT1G69840.7 AT1G69840.1 AT1G69840.4 |
AT1G69840
|
SPFH/Band 7/PHB domain-containing membrane-associated protein family |
| arTal_v1_Chr3_+_20776220_20776265 | 1.26 |
AT3G55980.2
AT3G55980.1 |
SZF1
|
salt-inducible zinc finger 1 |
| arTal_v1_Chr3_+_16896166_16896166 | 1.24 |
AT3G45970.2
AT3G45970.1 |
EXLA1
|
expansin-like A1 |
| arTal_v1_Chr4_-_8273903_8273903 | 1.24 |
AT4G14365.1
|
XBAT34
|
hypothetical protein |
| arTal_v1_Chr5_-_14999619_14999619 | 1.24 |
AT5G37770.1
AT5G37770.2 |
TCH2
|
EF hand calcium-binding protein family |
| arTal_v1_Chr4_-_14827211_14827211 | 1.23 |
AT4G30280.1
|
XTH18
|
xyloglucan endotransglucosylase/hydrolase 18 |
| arTal_v1_Chr3_+_20354351_20354351 | 1.21 |
AT3G54940.3
AT3G54940.2 |
AT3G54940
|
Papain family cysteine protease |
| arTal_v1_Chr3_+_8918679_8918679 | 1.20 |
AT3G24500.2
|
MBF1C
|
multiprotein bridging factor 1C |
| arTal_v1_Chr1_+_6568002_6568002 | 1.20 |
AT1G19020.1
|
AT1G19020
|
CDP-diacylglycerol-glycerol-3-phosphate 3-phosphatidyltransferase |
| arTal_v1_Chr1_+_24824356_24824496 | 1.19 |
AT1G66540.1
AT1G66540.2 |
AT1G66540
|
Cytochrome P450 superfamily protein |
| arTal_v1_Chr1_-_20706893_20706893 | 1.19 |
AT1G55450.2
|
AT1G55450
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
| arTal_v1_Chr3_+_9827682_9827682 | 1.19 |
AT3G26740.1
|
CCL
|
CCR-like protein |
| arTal_v1_Chr2_-_10737800_10737800 | 1.18 |
AT2G25200.1
|
AT2G25200
|
hypothetical protein (DUF868) |
| arTal_v1_Chr2_+_14577083_14577083 | 1.17 |
AT2G34620.1
|
AT2G34620
|
Mitochondrial transcription termination factor family protein |
| arTal_v1_Chr1_+_26705420_26705428 | 1.17 |
AT1G70820.1
AT1G70820.2 |
AT1G70820
|
phosphoglucomutase, putative / glucose phosphomutase |
| arTal_v1_Chr1_-_8399836_8399836 | 1.17 |
AT1G23740.1
|
AOR
|
Oxidoreductase, zinc-binding dehydrogenase family protein |
| arTal_v1_Chr1_-_20707071_20707071 | 1.16 |
AT1G55450.1
|
AT1G55450
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
| arTal_v1_Chr4_+_13297695_13297803 | 1.16 |
AT4G26260.1
AT4G26260.2 |
MIOX4
|
myo-inositol oxygenase 4 |
| arTal_v1_Chr3_+_8918267_8918267 | 1.15 |
AT3G24500.1
|
MBF1C
|
multiprotein bridging factor 1C |
| arTal_v1_Chr3_-_21008064_21008068 | 1.15 |
AT3G56710.1
AT3G56710.2 |
SIB1
|
sigma factor binding protein 1 |
| arTal_v1_Chr2_-_11284211_11284272 | 1.15 |
AT2G26530.2
AT2G26530.1 |
AR781
|
AR781, pheromone receptor-like protein (DUF1645) |
| arTal_v1_Chr1_+_1164910_1164910 | 1.15 |
AT1G04350.1
|
AT1G04350
|
2-oxoglutarate (2OG) and Fe(II)-dependent oxygenase superfamily protein |
| arTal_v1_Chr5_-_19693845_19693845 | 1.14 |
AT5G48570.1
|
AT5G48570
|
FKBP-type peptidyl-prolyl cis-trans isomerase family protein |
| arTal_v1_Chr2_+_12326808_12326808 | 1.14 |
AT2G28720.1
|
AT2G28720
|
Histone superfamily protein |
| arTal_v1_Chr4_-_12170055_12170080 | 1.14 |
AT4G23260.1
AT4G23260.2 |
CRK18
|
cysteine-rich RLK (RECEPTOR-like protein kinase) 18 |
| arTal_v1_Chr2_+_9792166_9792212 | 1.14 |
AT2G23000.2
AT2G23000.1 |
scpl10
|
serine carboxypeptidase-like 10 |
| arTal_v1_Chr3_+_18929526_18929526 | 1.13 |
AT3G50930.1
|
BCS1
|
cytochrome BC1 synthesi |
| arTal_v1_Chr5_+_7168106_7168106 | 1.12 |
AT5G21100.1
|
AT5G21100
|
Plant L-ascorbate oxidase |
| arTal_v1_Chr4_+_10481619_10481619 | 1.11 |
AT4G19170.1
|
NCED4
|
nine-cis-epoxycarotenoid dioxygenase 4 |
| arTal_v1_Chr1_+_27736546_27736546 | 1.11 |
AT1G73750.2
AT1G73750.1 |
AT1G73750
|
alpha/beta hydrolase family protein |
| arTal_v1_Chr1_+_5977323_5977323 | 1.11 |
AT1G17420.1
|
LOX3
|
lipoxygenase 3 |
| arTal_v1_Chr2_+_3618058_3618058 | 1.10 |
AT2G08986.1
|
AT2G08986
|
hypothetical protein |
| arTal_v1_Chr2_+_9254378_9254378 | 1.09 |
AT2G21640.1
|
AT2G21640
|
marker for oxidative stress response protein |
| arTal_v1_Chr2_+_13036814_13036925 | 1.09 |
AT2G30600.4
AT2G30600.5 AT2G30600.1 AT2G30600.3 |
AT2G30600
|
BTB/POZ domain-containing protein |
| arTal_v1_Chr3_-_18649521_18649521 | 1.09 |
AT3G50310.1
|
MAPKKK20
|
mitogen-activated protein kinase kinase kinase 20 |
| arTal_v1_Chr1_+_4084162_4084162 | 1.09 |
AT1G12080.1
AT1G12080.2 |
AT1G12080
|
Vacuolar calcium-binding protein-like protein |
| arTal_v1_Chr5_-_17099595_17099595 | 1.09 |
AT5G42650.1
|
AOS
|
allene oxide synthase |
| arTal_v1_Chr2_+_14573030_14573030 | 1.09 |
AT2G34600.1
|
JAZ7
|
jasmonate-zim-domain protein 7 |
| arTal_v1_Chr5_-_26906517_26906524 | 1.08 |
AT5G67420.1
AT5G67420.2 |
LBD37
|
LOB domain-containing protein 37 |
| arTal_v1_Chr2_+_13037238_13037238 | 1.08 |
AT2G30600.6
AT2G30600.2 |
AT2G30600
|
BTB/POZ domain-containing protein |
| arTal_v1_Chr5_+_26710302_26710302 | 1.07 |
AT5G66880.1
|
SNRK2.3
|
sucrose nonfermenting 1(SNF1)-related protein kinase 2.3 |
| arTal_v1_Chr5_+_26710469_26710469 | 1.06 |
AT5G66880.2
|
SNRK2.3
|
sucrose nonfermenting 1(SNF1)-related protein kinase 2.3 |
| arTal_v1_Chr5_+_23734273_23734273 | 1.06 |
AT5G58770.1
|
cPT4
|
Undecaprenyl pyrophosphate synthetase family protein |
| arTal_v1_Chr2_+_13820909_13820909 | 1.06 |
AT2G32550.3
AT2G32550.1 |
AT2G32550
|
Cell differentiation, Rcd1-like protein |
| arTal_v1_Chr5_-_23230749_23230749 | 1.06 |
AT5G57345.1
|
AT5G57345
|
transmembrane protein |
| arTal_v1_Chr4_+_12134973_12134973 | 1.06 |
AT4G23170.1
|
EP1
|
receptor-like protein kinase-related family protein |
| arTal_v1_Chr2_+_10066117_10066117 | 1.06 |
AT2G23680.2
AT2G23680.1 |
AT2G23680
|
Cold acclimation protein WCOR413 family |
| arTal_v1_Chr3_+_5249112_5249112 | 1.05 |
AT3G15518.1
|
AT3G15518
|
hypothetical protein |
| arTal_v1_Chr1_-_9140439_9140439 | 1.05 |
AT1G26410.1
|
AT1G26410
|
FAD-binding Berberine family protein |
| arTal_v1_Chr3_+_1172687_1172687 | 1.05 |
AT3G04420.2
AT3G04420.1 |
NAC048
|
NAC domain containing protein 48 |
| arTal_v1_Chr5_+_430858_430877 | 1.04 |
AT5G02180.1
AT5G02180.2 |
AT5G02180
|
Transmembrane amino acid transporter family protein |
| arTal_v1_Chr5_+_427642_427757 | 1.04 |
AT5G02170.1
AT5G02170.2 |
AT5G02170
|
Transmembrane amino acid transporter family protein |
| arTal_v1_Chr5_+_3267635_3267635 | 1.04 |
AT5G10380.1
|
RING1
|
RING/U-box superfamily protein |
| arTal_v1_Chr1_+_8395466_8395509 | 1.03 |
AT1G23730.2
AT1G23730.1 |
BCA3
|
beta carbonic anhydrase 3 |
| arTal_v1_Chr5_+_3377652_3377663 | 1.02 |
AT5G10695.1
AT5G10695.2 |
AT5G10695
|
methionyl-tRNA synthetase |
| arTal_v1_Chr1_+_24637196_24637196 | 1.02 |
AT1G66160.2
AT1G66160.1 |
CMPG1
|
CYS, MET, PRO, and GLY protein 1 |
| arTal_v1_Chr5_+_3206140_3206140 | 1.02 |
AT5G10210.1
|
AT5G10210
|
nitric oxide synthase-interacting protein |
| arTal_v1_Chr4_-_10591546_10591633 | 1.02 |
AT4G19420.3
AT4G19420.2 AT4G19420.1 |
AT4G19420
|
Pectinacetylesterase family protein |
| arTal_v1_Chr4_+_17752079_17752079 | 1.01 |
AT4G37770.1
|
ACS8
|
1-amino-cyclopropane-1-carboxylate synthase 8 |
| arTal_v1_Chr2_+_9903215_9903215 | 1.01 |
AT2G23270.1
|
AT2G23270
|
transmembrane protein |
| arTal_v1_Chr1_+_5602786_5602786 | 1.01 |
AT1G16390.1
|
OCT3
|
organic cation/carnitine transporter 3 |
| arTal_v1_Chr2_-_108803_108829 | 1.00 |
AT2G01180.7
AT2G01180.2 AT2G01180.5 AT2G01180.1 AT2G01180.8 AT2G01180.4 AT2G01180.3 |
PAP1
|
phosphatidic acid phosphatase 1 |
| arTal_v1_Chr5_+_4488476_4488476 | 0.99 |
AT5G13930.1
|
TT4
|
Chalcone and stilbene synthase family protein |
| arTal_v1_Chr5_-_21938396_21938396 | 0.98 |
AT5G54060.1
|
UF3GT
|
UDP-glucose:flavonoid 3-o-glucosyltransferase |
| arTal_v1_Chr1_+_20525654_20525654 | 0.98 |
AT1G55020.1
|
LOX1
|
lipoxygenase 1 |
| arTal_v1_Chr3_+_6876043_6876079 | 0.97 |
AT3G19800.1
AT3G19800.2 |
AT3G19800
|
E3 ubiquitin-protein ligase, putative (DUF177) |
| arTal_v1_Chr1_-_10308163_10308246 | 0.97 |
AT1G29460.1
AT1G29460.2 |
AT1G29460
|
SAUR-like auxin-responsive protein family |
| arTal_v1_Chr5_-_8856758_8856809 | 0.96 |
AT5G25440.1
AT5G25440.2 |
AT5G25440
|
Protein kinase superfamily protein |
| arTal_v1_Chr3_+_10255906_10255941 | 0.96 |
AT3G27690.2
AT3G27690.1 |
LHCB2.3
|
photosystem II light harvesting complex protein 2.3 |
| arTal_v1_Chr1_-_4633299_4633299 | 0.95 |
AT1G13520.1
|
AT1G13520
|
hypothetical protein (DUF1262) |
| arTal_v1_Chr5_+_23003909_23003909 | 0.95 |
AT5G56870.1
|
BGAL4
|
beta-galactosidase 4 |
| arTal_v1_Chr3_+_8309209_8309210 | 0.95 |
AT3G23250.1
AT3G23250.2 |
MYB15
|
myb domain protein 15 |
| arTal_v1_Chr5_-_18954692_18954692 | 0.95 |
AT5G46710.1
AT5G46710.2 AT5G46710.3 |
AT5G46710
|
PLATZ transcription factor family protein |
| arTal_v1_Chr4_-_18459257_18459257 | 0.94 |
AT4G39780.1
|
AT4G39780
|
Integrase-type DNA-binding superfamily protein |
| arTal_v1_Chr3_+_9758797_9758797 | 0.94 |
AT3G26580.1
|
AT3G26580
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
| arTal_v1_Chr3_-_1832190_1832190 | 0.93 |
AT3G06070.1
|
AT3G06070
|
hypothetical protein |
| arTal_v1_Chr5_-_13903218_13903218 | 0.92 |
AT5G35735.1
|
AT5G35735
|
Auxin-responsive family protein |
| arTal_v1_Chr5_+_5658416_5658416 | 0.92 |
AT5G17220.1
|
GSTF12
|
glutathione S-transferase phi 12 |
| arTal_v1_Chr1_+_7043628_7043628 | 0.91 |
AT1G20350.1
|
TIM17-1
|
translocase inner membrane subunit 17-1 |
| arTal_v1_Chr4_+_8010967_8010967 | 0.91 |
AT4G13830.2
AT4G13830.3 |
J20
|
DNAJ-like 20 |
| arTal_v1_Chr5_+_16151772_16151772 | 0.91 |
AT5G40380.3
AT5G40380.2 |
CRK42
|
cysteine-rich RLK (RECEPTOR-like protein kinase) 42 |
| arTal_v1_Chr3_+_3249513_3249526 | 0.90 |
AT3G10450.3
AT3G10450.2 AT3G10450.1 AT3G10450.4 |
SCPL7
|
serine carboxypeptidase-like 7 |
| arTal_v1_Chr4_+_14215473_14215473 | 0.90 |
AT4G28780.1
|
AT4G28780
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
| arTal_v1_Chr1_+_5596633_5596633 | 0.90 |
AT1G16370.1
|
OCT6
|
organic cation/carnitine transporter 6 |
| arTal_v1_Chr3_-_18863397_18863397 | 0.90 |
AT3G50750.1
|
BEH1
|
BES1/BZR1 homolog 1 |
| arTal_v1_Chr3_-_20718866_20718866 | 0.90 |
AT3G55840.1
|
AT3G55840
|
Hs1pro-1 protein |
| arTal_v1_Chr3_-_826585_826585 | 0.89 |
AT3G03470.1
|
CYP89A9
|
cytochrome P450, family 87, subfamily A, polypeptide 9 |
| arTal_v1_Chr2_-_1355883_1355883 | 0.89 |
AT2G04070.1
|
AT2G04070
|
MATE efflux family protein |
| arTal_v1_Chr3_+_17228642_17228642 | 0.89 |
AT3G46780.1
|
PTAC16
|
plastid transcriptionally active 16 |
| arTal_v1_Chr4_+_7480556_7480641 | 0.89 |
AT4G12690.2
AT4G12690.1 |
AT4G12690
|
DUF868 family protein (DUF868) |
| arTal_v1_Chr2_+_17886101_17886101 | 0.89 |
AT2G43010.1
AT2G43010.3 AT2G43010.4 |
PIF4
|
phytochrome interacting factor 4 |
| arTal_v1_Chr2_+_7406911_7406911 | 0.89 |
AT2G17040.1
|
NAC036
|
NAC domain containing protein 36 |
| arTal_v1_Chr4_-_468294_468294 | 0.89 |
AT4G01080.1
|
TBL26
|
TRICHOME BIREFRINGENCE-LIKE 26 |
| arTal_v1_Chr4_+_334573_334573 | 0.88 |
AT4G00780.1
|
AT4G00780
|
TRAF-like family protein |
| arTal_v1_Chr2_+_18253610_18253610 | 0.88 |
AT2G44130.1
|
AT2G44130
|
Galactose oxidase/kelch repeat superfamily protein |
| arTal_v1_Chr1_-_10382153_10382153 | 0.88 |
AT1G29690.1
|
CAD1
|
MAC/Perforin domain-containing protein |
| arTal_v1_Chr2_-_10975916_10975916 | 0.87 |
AT2G25735.1
|
AT2G25735
|
hypothetical protein |
| arTal_v1_Chr4_+_8011183_8011183 | 0.87 |
AT4G13830.1
|
J20
|
DNAJ-like 20 |
| arTal_v1_Chr5_+_3193017_3193017 | 0.87 |
AT5G10180.1
|
SULTR2%3B1
|
slufate transporter 2;1 |
| arTal_v1_Chr1_+_23650840_23650848 | 0.86 |
AT1G63750.3
AT1G63750.2 AT1G63750.1 |
AT1G63750
|
Disease resistance protein (TIR-NBS-LRR class) family |
| arTal_v1_Chr1_-_10055881_10055881 | 0.86 |
AT1G28610.2
AT1G28610.1 |
AT1G28610
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
| arTal_v1_Chr5_+_16688626_16688626 | 0.86 |
AT5G41740.1
AT5G41740.3 AT5G41740.2 |
AT5G41740
|
Disease resistance protein (TIR-NBS-LRR class) family |
| arTal_v1_Chr5_-_24767732_24767732 | 0.86 |
AT5G61600.1
|
ERF104
|
ethylene response factor 104 |
| arTal_v1_Chr1_+_3288087_3288087 | 0.85 |
AT1G10070.3
AT1G10070.2 AT1G10070.1 |
BCAT-2
|
branched-chain amino acid transaminase 2 |
| arTal_v1_Chr4_+_7148124_7148386 | 0.85 |
AT4G11890.3
AT4G11890.1 AT4G11890.4 |
ARCK1
|
Protein kinase superfamily protein |
| arTal_v1_Chr1_-_8310916_8310916 | 0.85 |
AT1G23390.1
|
AT1G23390
|
Kelch repeat-containing F-box family protein |
| arTal_v1_Chr4_+_6967709_6967729 | 0.85 |
AT4G11470.2
AT4G11470.1 |
CRK31
|
cysteine-rich RLK (RECEPTOR-like protein kinase) 31 |
| arTal_v1_Chr3_-_11400332_11400332 | 0.85 |
AT3G29590.1
|
AT5MAT
|
HXXXD-type acyl-transferase family protein |
| arTal_v1_Chr5_+_3545211_3545211 | 0.84 |
AT5G11140.1
|
AT5G11140
|
phospholipase-like protein (PEARLI 4) family protein |
| arTal_v1_Chr4_-_10590700_10590700 | 0.84 |
AT4G19420.4
|
AT4G19420
|
Pectinacetylesterase family protein |
| arTal_v1_Chr4_-_17139777_17139777 | 0.83 |
AT4G36220.1
|
FAH1
|
ferulic acid 5-hydroxylase 1 |
| arTal_v1_Chr4_+_16502747_16502747 | 0.83 |
AT4G34550.2
|
AT4G34550
|
F-box protein |
| arTal_v1_Chr5_+_5718498_5718498 | 0.83 |
AT5G17350.1
|
AT5G17350
|
hypothetical protein |
| arTal_v1_Chr3_+_11728024_11728024 | 0.83 |
AT3G29810.1
|
COBL2
|
COBRA-like protein 2 precursor |
| arTal_v1_Chr4_+_4886962_4886962 | 0.83 |
AT4G08040.1
|
ACS11
|
1-aminocyclopropane-1-carboxylate synthase 11 |
| arTal_v1_Chr5_-_19172956_19172956 | 0.82 |
AT5G47220.1
|
ERF2
|
ethylene responsive element binding factor 2 |
| arTal_v1_Chr3_-_1763348_1763348 | 0.82 |
AT3G05900.2
|
AT3G05900
|
neurofilament protein-like protein |
| arTal_v1_Chr5_-_16195751_16195888 | 0.82 |
AT5G40450.2
AT5G40450.1 |
AT5G40450
|
A-kinase anchor-like protein |
| arTal_v1_Chr3_-_8890927_8890927 | 0.82 |
AT3G24460.1
|
AT3G24460
|
Serinc-domain containing serine and sphingolipid biosynthesis protein |
| arTal_v1_Chr3_+_17520958_17521029 | 0.82 |
AT3G47540.1
AT3G47540.2 |
AT3G47540
|
Chitinase family protein |
| arTal_v1_Chr1_+_25041833_25041844 | 0.81 |
AT1G67070.1
AT1G67070.2 |
DIN9
|
Mannose-6-phosphate isomerase, type I |
| arTal_v1_Chr1_-_12984640_12984740 | 0.81 |
AT1G35350.2
AT1G35350.1 |
AT1G35350
|
EXS (ERD1/XPR1/SYG1) family protein |
| arTal_v1_Chr4_-_18084630_18084630 | 0.81 |
AT4G38740.1
|
ROC1
|
rotamase CYP 1 |
| arTal_v1_Chr5_-_26899736_26899736 | 0.81 |
AT5G67411.1
|
AT5G67411
|
GRAS family transcription factor |
| arTal_v1_Chr1_+_852151_852151 | 0.81 |
AT1G03440.1
|
AT1G03440
|
Leucine-rich repeat (LRR) family protein |
| arTal_v1_Chr5_-_17025361_17025361 | 0.81 |
AT5G42580.1
|
CYP705A12
|
cytochrome P450, family 705, subfamily A, polypeptide 12 |
| arTal_v1_Chr2_-_17882636_17882636 | 0.81 |
AT2G43000.1
AT2G43000.2 |
NAC042
|
NAC domain containing protein 42 |
| arTal_v1_Chr5_-_23873691_23873849 | 0.80 |
AT5G59130.1
AT5G59130.2 AT5G59130.3 AT5G59130.4 |
AT5G59130
|
Subtilase family protein |
| arTal_v1_Chr5_+_14887429_14887429 | 0.80 |
AT5G37490.1
|
AT5G37490
|
ARM repeat superfamily protein |
| arTal_v1_Chr5_+_2083964_2084088 | 0.80 |
AT5G06740.2
AT5G06740.1 |
AT5G06740
|
Concanavalin A-like lectin protein kinase family protein |
| arTal_v1_Chr4_+_16502532_16502532 | 0.79 |
AT4G34550.1
|
AT4G34550
|
F-box protein |
| arTal_v1_Chr5_-_21453980_21453980 | 0.79 |
AT5G52900.1
|
MAKR6
|
membrane-associated kinase regulator |
| arTal_v1_Chr3_-_9634470_9634470 | 0.79 |
AT3G26290.1
|
CYP71B26
|
cytochrome P450, family 71, subfamily B, polypeptide 26 |
| arTal_v1_Chr3_+_18733021_18733042 | 0.79 |
AT3G50480.2
AT3G50480.1 |
HR4
|
homolog of RPW8 4 |
| arTal_v1_Chr3_-_9634822_9634822 | 0.79 |
AT3G26290.2
|
CYP71B26
|
cytochrome P450, family 71, subfamily B, polypeptide 26 |
| arTal_v1_Chr5_-_753657_753657 | 0.78 |
AT5G03170.1
|
FLA11
|
FASCICLIN-like arabinogalactan-protein 11 |
| arTal_v1_Chr5_-_37999_37999 | 0.78 |
AT5G01100.1
|
FRB1
|
O-fucosyltransferase family protein |
| arTal_v1_Chr1_-_20160864_20160864 | 0.78 |
AT1G54010.1
|
AT1G54010
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
| arTal_v1_Chr1_+_29135904_29135904 | 0.78 |
AT1G77530.1
AT1G77530.2 |
AT1G77530
|
O-methyltransferase family protein |
| arTal_v1_Chr3_-_21931570_21931570 | 0.78 |
AT3G59340.1
AT3G59340.3 AT3G59340.4 |
AT3G59340
|
solute carrier family 35 protein (DUF914) |
| arTal_v1_Chr1_+_20151016_20151016 | 0.78 |
AT1G53990.1
|
GLIP3
|
GDSL-motif lipase 3 |
| arTal_v1_Chr3_-_1763984_1763984 | 0.78 |
AT3G05900.1
|
AT3G05900
|
neurofilament protein-like protein |
| arTal_v1_Chr1_+_28327698_28327698 | 0.78 |
AT1G75460.1
|
AT1G75460
|
ATP-dependent protease La (LON) domain protein |
| arTal_v1_Chr5_+_5968352_5968352 | 0.77 |
AT5G18030.1
|
AT5G18030
|
SAUR-like auxin-responsive protein family |
| arTal_v1_Chr4_-_437591_437605 | 0.77 |
AT4G01010.1
AT4G01010.2 |
CNGC13
|
cyclic nucleotide-gated channel 13 |
| arTal_v1_Chr3_-_18611262_18611263 | 0.77 |
AT3G50190.2
AT3G50190.1 AT3G50190.3 AT3G50190.4 |
AT3G50190
|
transmembrane protein, putative (DUF247) |
| arTal_v1_Chr1_+_28253890_28253890 | 0.77 |
AT1G75290.1
|
AT1G75290
|
NAD(P)-binding Rossmann-fold superfamily protein |
| arTal_v1_Chr1_+_5489145_5489145 | 0.77 |
AT1G15980.1
|
PnsB1
|
NDH-dependent cyclic electron flow 1 |
| arTal_v1_Chr2_+_10899348_10899348 | 0.77 |
AT2G25605.1
|
AT2G25605
|
DNA-directed RNA polymerase subunit beta |
| arTal_v1_Chr2_+_17886798_17886798 | 0.77 |
AT2G43010.5
|
PIF4
|
phytochrome interacting factor 4 |
| arTal_v1_Chr2_+_6313883_6313883 | 0.76 |
AT2G14750.1
|
APK
|
APS kinase |
| arTal_v1_Chr1_-_19458069_19458069 | 0.76 |
AT1G52240.1
|
ROPGEF11
|
rop guanine nucleotide exchange factor-like protein |
| arTal_v1_Chr1_-_26770175_26770177 | 0.76 |
AT1G71000.1
AT1G71000.2 |
AT1G71000
|
Chaperone DnaJ-domain superfamily protein |
| arTal_v1_Chr1_+_25464712_25464726 | 0.76 |
AT1G67900.4
AT1G67900.3 AT1G67900.5 |
AT1G67900
|
Phototropic-responsive NPH3 family protein |
| arTal_v1_Chr2_+_17886427_17886427 | 0.76 |
AT2G43010.2
|
PIF4
|
phytochrome interacting factor 4 |
| arTal_v1_Chr2_-_9454270_9454300 | 0.76 |
AT2G22240.3
AT2G22240.1 |
MIPS2
|
myo-inositol-1-phosphate synthase 2 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.9 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) regulation of spindle organization(GO:0090224) |
| 0.6 | 3.7 | GO:0006567 | threonine catabolic process(GO:0006567) |
| 0.6 | 3.0 | GO:0019310 | inositol catabolic process(GO:0019310) |
| 0.5 | 1.4 | GO:0010045 | response to nickel cation(GO:0010045) |
| 0.5 | 1.4 | GO:0006057 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) |
| 0.4 | 1.8 | GO:0010322 | regulation of isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway(GO:0010322) |
| 0.4 | 1.1 | GO:0050687 | negative regulation of immune effector process(GO:0002698) negative regulation of defense response to virus(GO:0050687) |
| 0.4 | 1.1 | GO:0060776 | simple leaf morphogenesis(GO:0060776) |
| 0.3 | 1.3 | GO:0080170 | hydrogen peroxide transmembrane transport(GO:0080170) |
| 0.3 | 1.5 | GO:0006690 | icosanoid metabolic process(GO:0006690) fatty acid derivative metabolic process(GO:1901568) |
| 0.3 | 1.5 | GO:0045730 | respiratory burst involved in defense response(GO:0002679) respiratory burst(GO:0045730) |
| 0.3 | 0.9 | GO:0010124 | phenylacetate catabolic process(GO:0010124) |
| 0.3 | 0.9 | GO:0048281 | inflorescence morphogenesis(GO:0048281) |
| 0.3 | 1.5 | GO:0015700 | arsenite transport(GO:0015700) phytochelatin metabolic process(GO:0046937) phytochelatin biosynthetic process(GO:0046938) cellular response to cadmium ion(GO:0071276) cellular detoxification of cadmium ion(GO:0098849) |
| 0.3 | 0.9 | GO:0042766 | nucleosome mobilization(GO:0042766) |
| 0.3 | 2.0 | GO:0043066 | apoptotic process(GO:0006915) regulation of apoptotic process(GO:0042981) negative regulation of apoptotic process(GO:0043066) |
| 0.3 | 1.6 | GO:0009745 | sucrose mediated signaling(GO:0009745) |
| 0.3 | 2.8 | GO:0070370 | cellular heat acclimation(GO:0070370) |
| 0.2 | 3.4 | GO:0010244 | response to low fluence blue light stimulus by blue low-fluence system(GO:0010244) |
| 0.2 | 2.6 | GO:0080086 | stamen filament development(GO:0080086) |
| 0.2 | 1.5 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.2 | 0.4 | GO:0032260 | response to jasmonic acid stimulus involved in jasmonic acid and ethylene-dependent systemic resistance(GO:0032260) |
| 0.2 | 0.6 | GO:0045905 | positive regulation of translational elongation(GO:0045901) positive regulation of translational termination(GO:0045905) |
| 0.2 | 0.2 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.2 | 0.6 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.2 | 1.0 | GO:0016137 | glycoside metabolic process(GO:0016137) |
| 0.2 | 1.7 | GO:0010230 | alternative respiration(GO:0010230) |
| 0.2 | 0.9 | GO:0097036 | regulation of plasma membrane sterol distribution(GO:0097036) |
| 0.2 | 0.9 | GO:0010226 | response to lithium ion(GO:0010226) |
| 0.2 | 0.7 | GO:0016320 | endoplasmic reticulum membrane fusion(GO:0016320) |
| 0.2 | 0.9 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.2 | 0.9 | GO:0046218 | tryptophan catabolic process(GO:0006569) indolalkylamine catabolic process(GO:0046218) |
| 0.2 | 0.4 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.2 | 0.5 | GO:0010184 | cytokinin transport(GO:0010184) |
| 0.2 | 0.9 | GO:1904589 | regulation of protein import(GO:1904589) |
| 0.2 | 0.3 | GO:1990937 | xylan acetylation(GO:1990937) |
| 0.2 | 0.5 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.2 | 0.6 | GO:0060860 | regulation of floral organ abscission(GO:0060860) negative regulation of floral organ abscission(GO:0060862) |
| 0.2 | 1.0 | GO:0009769 | photosynthesis, light harvesting in photosystem II(GO:0009769) |
| 0.2 | 2.1 | GO:0001676 | long-chain fatty acid metabolic process(GO:0001676) |
| 0.2 | 1.6 | GO:0010196 | nonphotochemical quenching(GO:0010196) energy quenching(GO:1990066) |
| 0.2 | 0.8 | GO:0042549 | photosystem II stabilization(GO:0042549) |
| 0.2 | 0.2 | GO:0097468 | cell death in response to oxidative stress(GO:0036473) programmed cell death in response to reactive oxygen species(GO:0097468) |
| 0.2 | 2.9 | GO:0042343 | indole glucosinolate metabolic process(GO:0042343) |
| 0.1 | 1.2 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.1 | 0.7 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.1 | 1.6 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.1 | 2.3 | GO:0015976 | carbon utilization(GO:0015976) |
| 0.1 | 2.7 | GO:1901071 | glucosamine-containing compound metabolic process(GO:1901071) |
| 0.1 | 0.1 | GO:2000068 | regulation of defense response to insect(GO:2000068) |
| 0.1 | 0.4 | GO:1900378 | positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 0.1 | 0.9 | GO:0080151 | positive regulation of salicylic acid mediated signaling pathway(GO:0080151) |
| 0.1 | 3.5 | GO:0009612 | response to mechanical stimulus(GO:0009612) |
| 0.1 | 0.6 | GO:1900384 | regulation of flavonol biosynthetic process(GO:1900384) |
| 0.1 | 0.6 | GO:1900367 | positive regulation of defense response to insect(GO:1900367) |
| 0.1 | 0.8 | GO:0046087 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.1 | 0.5 | GO:0099636 | cytoplasmic streaming(GO:0099636) |
| 0.1 | 1.5 | GO:0010021 | amylopectin biosynthetic process(GO:0010021) amylopectin metabolic process(GO:2000896) |
| 0.1 | 0.9 | GO:0009099 | valine biosynthetic process(GO:0009099) |
| 0.1 | 0.5 | GO:0097054 | L-glutamate biosynthetic process(GO:0097054) |
| 0.1 | 1.2 | GO:0010439 | regulation of glucosinolate biosynthetic process(GO:0010439) |
| 0.1 | 0.5 | GO:0036065 | fucosylation(GO:0036065) |
| 0.1 | 0.6 | GO:0042218 | 1-aminocyclopropane-1-carboxylate biosynthetic process(GO:0042218) |
| 0.1 | 1.4 | GO:0048354 | mucilage biosynthetic process involved in seed coat development(GO:0048354) |
| 0.1 | 0.3 | GO:0009945 | radial axis specification(GO:0009945) |
| 0.1 | 0.3 | GO:0010929 | positive regulation of auxin mediated signaling pathway(GO:0010929) |
| 0.1 | 0.3 | GO:0010069 | zygote asymmetric cytokinesis in embryo sac(GO:0010069) |
| 0.1 | 1.4 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.1 | 0.3 | GO:0032490 | detection of molecule of bacterial origin(GO:0032490) |
| 0.1 | 0.3 | GO:0010055 | atrichoblast differentiation(GO:0010055) |
| 0.1 | 0.3 | GO:0010213 | non-photoreactive DNA repair(GO:0010213) |
| 0.1 | 1.5 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
| 0.1 | 1.0 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.1 | 0.3 | GO:0043953 | protein transport by the Tat complex(GO:0043953) |
| 0.1 | 0.7 | GO:0016121 | carotene catabolic process(GO:0016121) terpene catabolic process(GO:0046247) |
| 0.1 | 0.3 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.3 | GO:0036292 | DNA rewinding(GO:0036292) |
| 0.1 | 0.2 | GO:0046373 | L-arabinose metabolic process(GO:0046373) |
| 0.1 | 0.3 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.1 | 0.4 | GO:0015669 | gas transport(GO:0015669) |
| 0.1 | 0.3 | GO:0072388 | FAD biosynthetic process(GO:0006747) flavin adenine dinucleotide biosynthetic process(GO:0072388) |
| 0.1 | 0.6 | GO:0043617 | cellular response to sucrose starvation(GO:0043617) |
| 0.1 | 0.8 | GO:0051513 | regulation of monopolar cell growth(GO:0051513) |
| 0.1 | 0.8 | GO:0009799 | specification of symmetry(GO:0009799) |
| 0.1 | 0.8 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.1 | 0.9 | GO:0000304 | response to singlet oxygen(GO:0000304) |
| 0.1 | 0.4 | GO:0007231 | osmosensory signaling pathway(GO:0007231) |
| 0.1 | 0.3 | GO:0070509 | calcium ion import(GO:0070509) |
| 0.1 | 1.0 | GO:0030307 | positive regulation of cell growth(GO:0030307) |
| 0.1 | 1.1 | GO:0010115 | regulation of abscisic acid biosynthetic process(GO:0010115) |
| 0.1 | 0.2 | GO:0090227 | regulation of red or far-red light signaling pathway(GO:0090227) |
| 0.1 | 0.6 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.1 | 0.4 | GO:0019742 | pentacyclic triterpenoid metabolic process(GO:0019742) pentacyclic triterpenoid biosynthetic process(GO:0019745) |
| 0.1 | 0.7 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
| 0.1 | 0.3 | GO:0001578 | microtubule bundle formation(GO:0001578) |
| 0.1 | 1.0 | GO:0009704 | de-etiolation(GO:0009704) |
| 0.1 | 10.0 | GO:0010200 | response to chitin(GO:0010200) |
| 0.1 | 0.8 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.1 | 0.7 | GO:0007155 | cell adhesion(GO:0007155) biological adhesion(GO:0022610) |
| 0.1 | 0.3 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.1 | 0.3 | GO:1901336 | lactone metabolic process(GO:1901334) lactone biosynthetic process(GO:1901336) strigolactone metabolic process(GO:1901600) strigolactone biosynthetic process(GO:1901601) |
| 0.1 | 1.0 | GO:0048645 | organ formation(GO:0048645) |
| 0.1 | 0.9 | GO:0016104 | triterpenoid biosynthetic process(GO:0016104) |
| 0.1 | 0.4 | GO:0009807 | lignan metabolic process(GO:0009806) lignan biosynthetic process(GO:0009807) |
| 0.1 | 0.2 | GO:0072526 | pyridoxal metabolic process(GO:0042817) pyridine-containing compound catabolic process(GO:0072526) |
| 0.1 | 0.5 | GO:0019464 | glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 | 0.5 | GO:2000122 | negative regulation of stomatal complex development(GO:2000122) |
| 0.1 | 0.3 | GO:0035308 | negative regulation of dephosphorylation(GO:0035305) negative regulation of protein dephosphorylation(GO:0035308) |
| 0.1 | 1.3 | GO:0009969 | xyloglucan biosynthetic process(GO:0009969) |
| 0.1 | 0.3 | GO:1900370 | positive regulation of RNA interference(GO:1900370) |
| 0.1 | 0.3 | GO:0034329 | cell-cell junction assembly(GO:0007043) cell junction assembly(GO:0034329) |
| 0.1 | 0.7 | GO:0015749 | monosaccharide transport(GO:0015749) |
| 0.1 | 0.8 | GO:0010077 | maintenance of inflorescence meristem identity(GO:0010077) |
| 0.1 | 0.5 | GO:1901465 | positive regulation of tetrapyrrole biosynthetic process(GO:1901465) |
| 0.1 | 0.4 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
| 0.1 | 0.9 | GO:0031408 | oxylipin metabolic process(GO:0031407) oxylipin biosynthetic process(GO:0031408) |
| 0.1 | 0.2 | GO:0046949 | fatty-acyl-CoA biosynthetic process(GO:0046949) |
| 0.1 | 0.2 | GO:1900459 | positive regulation of brassinosteroid mediated signaling pathway(GO:1900459) |
| 0.1 | 1.5 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.1 | 1.3 | GO:0010214 | seed coat development(GO:0010214) |
| 0.1 | 1.3 | GO:0045493 | xylan catabolic process(GO:0045493) |
| 0.1 | 1.2 | GO:0009773 | photosynthetic electron transport in photosystem I(GO:0009773) |
| 0.1 | 0.2 | GO:0080175 | phragmoplast microtubule organization(GO:0080175) |
| 0.1 | 0.5 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.1 | 0.3 | GO:1901001 | negative regulation of response to salt stress(GO:1901001) |
| 0.1 | 0.6 | GO:0010262 | somatic embryogenesis(GO:0010262) |
| 0.1 | 0.8 | GO:0007050 | cell cycle arrest(GO:0007050) |
| 0.1 | 0.4 | GO:0045487 | diterpenoid catabolic process(GO:0016103) gibberellin catabolic process(GO:0045487) |
| 0.1 | 0.4 | GO:0009645 | response to low light intensity stimulus(GO:0009645) |
| 0.1 | 0.3 | GO:0042391 | regulation of membrane potential(GO:0042391) |
| 0.1 | 0.3 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.1 | 0.4 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 1.1 | GO:1900426 | positive regulation of defense response to bacterium(GO:1900426) |
| 0.1 | 0.2 | GO:0019343 | cysteine biosynthetic process via cystathionine(GO:0019343) protein homotetramerization(GO:0051289) |
| 0.1 | 0.2 | GO:2000082 | regulation of vitamin metabolic process(GO:0030656) regulation of L-ascorbic acid biosynthetic process(GO:2000082) |
| 0.1 | 0.3 | GO:0015824 | proline transport(GO:0015824) |
| 0.1 | 0.6 | GO:0051553 | flavone biosynthetic process(GO:0051553) flavonol biosynthetic process(GO:0051555) |
| 0.0 | 0.1 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.0 | 0.6 | GO:0010413 | glucuronoxylan metabolic process(GO:0010413) glucuronoxylan biosynthetic process(GO:0010417) |
| 0.0 | 0.4 | GO:1902025 | nitrate import(GO:1902025) |
| 0.0 | 0.3 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.0 | 0.2 | GO:0071836 | nectar secretion(GO:0071836) |
| 0.0 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.1 | GO:0033528 | S-methylmethionine metabolic process(GO:0033477) S-methylmethionine cycle(GO:0033528) |
| 0.0 | 0.1 | GO:0080051 | cutin transport(GO:0080051) |
| 0.0 | 0.4 | GO:0034471 | rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.0 | 0.4 | GO:0010304 | PSII associated light-harvesting complex II catabolic process(GO:0010304) |
| 0.0 | 2.3 | GO:0051510 | regulation of unidimensional cell growth(GO:0051510) |
| 0.0 | 0.5 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 3.0 | GO:0009875 | pollen-pistil interaction(GO:0009875) |
| 0.0 | 0.4 | GO:0033619 | membrane protein proteolysis(GO:0033619) |
| 0.0 | 0.3 | GO:0052482 | defense response by cell wall thickening(GO:0052482) |
| 0.0 | 0.3 | GO:0010023 | proanthocyanidin biosynthetic process(GO:0010023) |
| 0.0 | 0.2 | GO:0016115 | isoprenoid catabolic process(GO:0008300) sesquiterpenoid catabolic process(GO:0016107) terpenoid catabolic process(GO:0016115) apocarotenoid catabolic process(GO:0043290) abscisic acid catabolic process(GO:0046345) |
| 0.0 | 2.2 | GO:0006906 | vesicle fusion(GO:0006906) |
| 0.0 | 0.4 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 1.6 | GO:0010411 | xyloglucan metabolic process(GO:0010411) |
| 0.0 | 4.3 | GO:0009860 | pollen tube growth(GO:0009860) |
| 0.0 | 0.2 | GO:0007112 | male meiosis cytokinesis(GO:0007112) |
| 0.0 | 0.8 | GO:0005983 | starch catabolic process(GO:0005983) |
| 0.0 | 0.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.0 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.0 | 0.2 | GO:0000187 | activation of MAPK activity(GO:0000187) positive regulation of MAP kinase activity(GO:0043406) |
| 0.0 | 0.6 | GO:0009299 | mRNA transcription(GO:0009299) |
| 0.0 | 0.2 | GO:1902767 | farnesyl diphosphate biosynthetic process, mevalonate pathway(GO:0010142) isoprenoid biosynthetic process via mevalonate(GO:1902767) |
| 0.0 | 0.8 | GO:0050826 | response to freezing(GO:0050826) |
| 0.0 | 1.3 | GO:0051607 | defense response to virus(GO:0051607) |
| 0.0 | 0.3 | GO:0009610 | response to symbiotic fungus(GO:0009610) |
| 0.0 | 0.6 | GO:0009697 | salicylic acid biosynthetic process(GO:0009697) |
| 0.0 | 0.0 | GO:0043954 | cellular component maintenance(GO:0043954) chromatin maintenance(GO:0070827) heterochromatin maintenance(GO:0070829) |
| 0.0 | 1.5 | GO:0009816 | defense response to bacterium, incompatible interaction(GO:0009816) |
| 0.0 | 0.3 | GO:0070919 | production of siRNA involved in chromatin silencing by small RNA(GO:0070919) |
| 0.0 | 1.2 | GO:1901800 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) positive regulation of proteasomal protein catabolic process(GO:1901800) |
| 0.0 | 0.2 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) aspartate metabolic process(GO:0006531) |
| 0.0 | 0.4 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.5 | GO:0010093 | specification of floral organ identity(GO:0010093) |
| 0.0 | 0.2 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
| 0.0 | 0.4 | GO:0009970 | cellular response to sulfate starvation(GO:0009970) |
| 0.0 | 1.9 | GO:0009627 | systemic acquired resistance(GO:0009627) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.3 | GO:0010239 | chloroplast mRNA processing(GO:0010239) |
| 0.0 | 0.4 | GO:0008216 | spermidine metabolic process(GO:0008216) |
| 0.0 | 0.8 | GO:0009718 | anthocyanin-containing compound biosynthetic process(GO:0009718) |
| 0.0 | 1.0 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.1 | GO:0060145 | viral gene silencing in virus induced gene silencing(GO:0060145) |
| 0.0 | 0.3 | GO:0010358 | leaf shaping(GO:0010358) |
| 0.0 | 0.1 | GO:0010337 | regulation of salicylic acid metabolic process(GO:0010337) |
| 0.0 | 0.5 | GO:0080163 | regulation of protein serine/threonine phosphatase activity(GO:0080163) |
| 0.0 | 0.2 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.0 | 0.1 | GO:2000692 | negative regulation of seed maturation(GO:2000692) |
| 0.0 | 0.1 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
| 0.0 | 0.9 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.0 | 0.1 | GO:0030856 | regulation of epithelial cell differentiation(GO:0030856) regulation of epidermal cell differentiation(GO:0045604) regulation of epidermis development(GO:0045682) |
| 0.0 | 0.6 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.0 | 0.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.3 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.0 | 0.1 | GO:0046741 | transport of virus in host, tissue to tissue(GO:0046741) |
| 0.0 | 0.6 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.1 | GO:0008333 | lysosomal transport(GO:0007041) endosome to lysosome transport(GO:0008333) |
| 0.0 | 0.1 | GO:0080088 | spermidine hydroxycinnamate conjugate biosynthetic process(GO:0080088) |
| 0.0 | 0.5 | GO:0010440 | stomatal lineage progression(GO:0010440) |
| 0.0 | 0.4 | GO:0080027 | response to herbivore(GO:0080027) |
| 0.0 | 0.4 | GO:0045492 | xylan biosynthetic process(GO:0045492) |
| 0.0 | 0.6 | GO:0010207 | photosystem II assembly(GO:0010207) |
| 0.0 | 0.1 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.0 | 0.2 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.0 | 0.1 | GO:0017145 | stem cell division(GO:0017145) |
| 0.0 | 0.4 | GO:0043069 | negative regulation of programmed cell death(GO:0043069) |
| 0.0 | 0.4 | GO:0019471 | protein hydroxylation(GO:0018126) peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) 4-hydroxyproline metabolic process(GO:0019471) peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.7 | GO:1900673 | ethylene metabolic process(GO:0009692) ethylene biosynthetic process(GO:0009693) cellular alkene metabolic process(GO:0043449) alkene biosynthetic process(GO:0043450) olefin metabolic process(GO:1900673) olefin biosynthetic process(GO:1900674) |
| 0.0 | 0.5 | GO:1900150 | regulation of defense response to fungus(GO:1900150) |
| 0.0 | 0.4 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 0.5 | GO:0060688 | regulation of morphogenesis of a branching structure(GO:0060688) regulation of secondary shoot formation(GO:2000032) |
| 0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 4.7 | GO:0071456 | cellular response to hypoxia(GO:0071456) |
| 0.0 | 0.5 | GO:0046470 | phosphatidylcholine metabolic process(GO:0046470) |
| 0.0 | 0.1 | GO:0006426 | glycyl-tRNA aminoacylation(GO:0006426) |
| 0.0 | 0.4 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
| 0.0 | 0.4 | GO:0031056 | regulation of histone modification(GO:0031056) |
| 0.0 | 0.6 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.4 | GO:0046855 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) inositol phosphate catabolic process(GO:0071545) |
| 0.0 | 0.8 | GO:1901421 | positive regulation of abscisic acid-activated signaling pathway(GO:0009789) positive regulation of response to alcohol(GO:1901421) |
| 0.0 | 1.1 | GO:0018393 | internal protein amino acid acetylation(GO:0006475) histone acetylation(GO:0016573) internal peptidyl-lysine acetylation(GO:0018393) peptidyl-lysine acetylation(GO:0018394) |
| 0.0 | 0.7 | GO:0010584 | pollen exine formation(GO:0010584) |
| 0.0 | 0.1 | GO:0019427 | acetyl-CoA biosynthetic process from acetate(GO:0019427) |
| 0.0 | 1.0 | GO:0006101 | tricarboxylic acid cycle(GO:0006099) citrate metabolic process(GO:0006101) |
| 0.0 | 0.1 | GO:0043903 | regulation of symbiosis, encompassing mutualism through parasitism(GO:0043903) regulation of viral process(GO:0050792) |
| 0.0 | 0.3 | GO:0010229 | inflorescence development(GO:0010229) |
| 0.0 | 0.1 | GO:0044236 | collagen metabolic process(GO:0032963) multicellular organism metabolic process(GO:0044236) multicellular organismal macromolecule metabolic process(GO:0044259) |
| 0.0 | 0.1 | GO:0060866 | leaf abscission(GO:0060866) |
| 0.0 | 0.1 | GO:0043409 | negative regulation of MAP kinase activity(GO:0043407) negative regulation of MAPK cascade(GO:0043409) |
| 0.0 | 0.1 | GO:0006893 | Golgi to plasma membrane transport(GO:0006893) |
| 0.0 | 1.8 | GO:0045490 | pectin catabolic process(GO:0045490) |
| 0.0 | 0.1 | GO:0033967 | box C/D snoRNA 3'-end processing(GO:0000494) peptidyl-glutamine methylation(GO:0018364) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.0 | 0.6 | GO:0016575 | histone deacetylation(GO:0016575) |
| 0.0 | 0.2 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.0 | 0.1 | GO:0050667 | transsulfuration(GO:0019346) homocysteine metabolic process(GO:0050667) |
| 0.0 | 0.1 | GO:0010019 | chloroplast-nucleus signaling pathway(GO:0010019) |
| 0.0 | 0.6 | GO:0046246 | terpene biosynthetic process(GO:0046246) |
| 0.0 | 0.2 | GO:0051214 | RNA virus induced gene silencing(GO:0051214) |
| 0.0 | 0.6 | GO:0009863 | salicylic acid mediated signaling pathway(GO:0009863) |
| 0.0 | 0.2 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
| 0.0 | 0.3 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 | 0.1 | GO:0030308 | negative regulation of cell growth(GO:0030308) |
| 0.0 | 0.2 | GO:0070413 | trehalose metabolism in response to stress(GO:0070413) |
| 0.0 | 0.1 | GO:0009268 | response to pH(GO:0009268) |
| 0.0 | 0.3 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.3 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.0 | 0.1 | GO:0071457 | cellular response to ozone(GO:0071457) |
| 0.0 | 0.2 | GO:0042753 | entrainment of circadian clock(GO:0009649) positive regulation of circadian rhythm(GO:0042753) |
| 0.0 | 0.5 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.2 | GO:1902532 | negative regulation of intracellular signal transduction(GO:1902532) |
| 0.0 | 0.7 | GO:0072596 | protein targeting to chloroplast(GO:0045036) establishment of protein localization to chloroplast(GO:0072596) |
| 0.0 | 0.4 | GO:0043572 | chloroplast fission(GO:0010020) plastid fission(GO:0043572) |
| 0.0 | 1.2 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.0 | 0.2 | GO:0015691 | cadmium ion transport(GO:0015691) |
| 0.0 | 0.9 | GO:0009787 | regulation of abscisic acid-activated signaling pathway(GO:0009787) |
| 0.0 | 0.2 | GO:0006857 | oligopeptide transport(GO:0006857) peptide transport(GO:0015833) |
| 0.0 | 0.1 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.0 | 0.6 | GO:0043269 | regulation of ion transport(GO:0043269) |
| 0.0 | 0.3 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.0 | 0.1 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.1 | GO:2000014 | regulation of endosperm development(GO:2000014) |
| 0.0 | 0.1 | GO:0080117 | secondary growth(GO:0080117) |
| 0.0 | 0.1 | GO:0090057 | root radial pattern formation(GO:0090057) |
| 0.0 | 0.6 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
| 0.0 | 0.2 | GO:0030026 | cellular manganese ion homeostasis(GO:0030026) |
| 0.0 | 0.1 | GO:0019320 | hexose catabolic process(GO:0019320) |
| 0.0 | 0.0 | GO:0006386 | termination of RNA polymerase III transcription(GO:0006386) |
| 0.0 | 0.8 | GO:0006897 | endocytosis(GO:0006897) |
| 0.0 | 0.4 | GO:0009903 | chloroplast avoidance movement(GO:0009903) |
| 0.0 | 0.3 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.0 | 0.1 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.0 | GO:0006768 | biotin metabolic process(GO:0006768) biotin biosynthetic process(GO:0009102) |
| 0.0 | 0.2 | GO:0005987 | sucrose catabolic process(GO:0005987) |
| 0.0 | 0.1 | GO:0019632 | shikimate metabolic process(GO:0019632) |
| 0.0 | 0.1 | GO:0046464 | diacylglycerol metabolic process(GO:0046339) neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
| 0.0 | 0.3 | GO:0009960 | endosperm development(GO:0009960) |
| 0.0 | 0.2 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.0 | 0.1 | GO:0045851 | pH reduction(GO:0045851) |
| 0.0 | 0.1 | GO:0043155 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) negative regulation of photosynthesis(GO:1905156) |
| 0.0 | 0.8 | GO:0007267 | cell-cell signaling(GO:0007267) |
| 0.0 | 0.0 | GO:0000256 | allantoin catabolic process(GO:0000256) |
| 0.0 | 0.4 | GO:0009142 | nucleoside triphosphate biosynthetic process(GO:0009142) |
| 0.0 | 0.2 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.7 | GO:0022900 | electron transport chain(GO:0022900) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.2 | GO:0046460 | triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 0.0 | 0.3 | GO:0016101 | gibberellin metabolic process(GO:0009685) gibberellin biosynthetic process(GO:0009686) diterpenoid metabolic process(GO:0016101) diterpenoid biosynthetic process(GO:0016102) |
| 0.0 | 0.2 | GO:0019915 | lipid storage(GO:0019915) |
| 0.0 | 0.5 | GO:0009834 | plant-type secondary cell wall biogenesis(GO:0009834) |
| 0.0 | 0.2 | GO:0048598 | embryonic morphogenesis(GO:0048598) |
| 0.0 | 1.3 | GO:0006310 | DNA recombination(GO:0006310) |
| 0.0 | 2.0 | GO:0042742 | defense response to bacterium(GO:0042742) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.9 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.4 | 1.3 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.2 | 2.2 | GO:0009517 | thylakoid light-harvesting complex(GO:0009503) PSII associated light-harvesting complex II(GO:0009517) light-harvesting complex(GO:0030076) |
| 0.2 | 0.7 | GO:0043668 | pollen wall(GO:0043667) exine(GO:0043668) sexine(GO:0043673) columella(GO:0043674) |
| 0.2 | 1.4 | GO:0009538 | photosystem I reaction center(GO:0009538) |
| 0.1 | 2.1 | GO:0005880 | nuclear microtubule(GO:0005880) |
| 0.1 | 1.6 | GO:0000322 | storage vacuole(GO:0000322) protein storage vacuole(GO:0000326) |
| 0.1 | 1.0 | GO:0071012 | U2-type catalytic step 1 spliceosome(GO:0071006) catalytic step 1 spliceosome(GO:0071012) |
| 0.1 | 0.9 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 1.2 | GO:0010168 | ER body(GO:0010168) |
| 0.1 | 0.7 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.1 | 0.6 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.1 | 0.3 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 1.1 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.1 | 0.3 | GO:0033281 | TAT protein transport complex(GO:0033281) |
| 0.1 | 0.3 | GO:0030093 | chloroplast photosystem I(GO:0030093) |
| 0.1 | 0.8 | GO:0005784 | Sec61 translocon complex(GO:0005784) |
| 0.1 | 0.5 | GO:0000796 | condensin complex(GO:0000796) |
| 0.1 | 1.3 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.1 | 0.9 | GO:0098807 | chloroplast thylakoid membrane protein complex(GO:0098807) |
| 0.1 | 0.4 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.8 | GO:0048226 | Casparian strip(GO:0048226) |
| 0.1 | 0.3 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.1 | 1.8 | GO:0009654 | photosystem II oxygen evolving complex(GO:0009654) |
| 0.1 | 1.2 | GO:0010598 | NAD(P)H dehydrogenase complex (plastoquinone)(GO:0010598) |
| 0.1 | 0.3 | GO:0009509 | chromoplast(GO:0009509) |
| 0.1 | 1.5 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.1 | 0.9 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 0.2 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.1 | 0.6 | GO:0090576 | transcription factor TFIIIC complex(GO:0000127) RNA polymerase III transcription factor complex(GO:0090576) |
| 0.1 | 0.3 | GO:0009360 | DNA polymerase III complex(GO:0009360) |
| 0.1 | 0.9 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
| 0.1 | 0.8 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.1 | 0.9 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.1 | 1.9 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.1 | 0.2 | GO:0070505 | pollen coat(GO:0070505) |
| 0.1 | 0.4 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.3 | GO:0031380 | RNA-directed RNA polymerase complex(GO:0031379) nuclear RNA-directed RNA polymerase complex(GO:0031380) |
| 0.0 | 0.2 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.0 | 0.4 | GO:0098553 | integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) lumenal side of membrane(GO:0098576) |
| 0.0 | 0.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.3 | GO:0032153 | cell division site(GO:0032153) |
| 0.0 | 0.6 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.5 | GO:0043230 | extracellular organelle(GO:0043230) extracellular exosome(GO:0070062) extracellular vesicle(GO:1903561) |
| 0.0 | 2.1 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.6 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.0 | 0.5 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
| 0.0 | 5.6 | GO:0099503 | secretory vesicle(GO:0099503) |
| 0.0 | 0.6 | GO:0009986 | cell surface(GO:0009986) |
| 0.0 | 0.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.1 | GO:0009523 | photosystem II(GO:0009523) |
| 0.0 | 1.7 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.4 | GO:0051286 | growing cell tip(GO:0035838) cell tip(GO:0051286) pollen tube tip(GO:0090404) |
| 0.0 | 1.2 | GO:0010319 | stromule(GO:0010319) |
| 0.0 | 0.0 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.0 | 0.3 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 1.1 | GO:0010287 | plastoglobule(GO:0010287) |
| 0.0 | 0.3 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 5.3 | GO:0048046 | apoplast(GO:0048046) |
| 0.0 | 0.1 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.0 | 5.8 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.4 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.1 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.3 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.0 | 0.8 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.1 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
| 0.0 | 0.2 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.3 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.2 | GO:0010005 | cortical microtubule, transverse to long axis(GO:0010005) |
| 0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.5 | GO:0009707 | chloroplast outer membrane(GO:0009707) |
| 0.0 | 0.2 | GO:0009508 | plastid chromosome(GO:0009508) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 3.7 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.7 | 2.1 | GO:0000249 | C-22 sterol desaturase activity(GO:0000249) |
| 0.6 | 3.0 | GO:0050113 | inositol oxygenase activity(GO:0050113) |
| 0.6 | 0.6 | GO:0003994 | aconitate hydratase activity(GO:0003994) |
| 0.5 | 2.1 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.5 | 1.4 | GO:0004476 | mannose-6-phosphate isomerase activity(GO:0004476) |
| 0.4 | 1.3 | GO:0051738 | xanthophyll binding(GO:0051738) |
| 0.4 | 1.3 | GO:0050736 | O-malonyltransferase activity(GO:0050736) |
| 0.3 | 1.0 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
| 0.3 | 0.9 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.3 | 0.9 | GO:0046027 | phospholipid:diacylglycerol acyltransferase activity(GO:0046027) |
| 0.3 | 1.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.3 | 1.5 | GO:0046870 | arsenite secondary active transmembrane transporter activity(GO:0008490) arsenite-transmembrane transporting ATPase activity(GO:0015446) anion transmembrane-transporting ATPase activity(GO:0043225) cadmium ion binding(GO:0046870) |
| 0.3 | 0.9 | GO:0050412 | cinnamate beta-D-glucosyltransferase activity(GO:0050412) |
| 0.3 | 0.8 | GO:0080132 | fatty acid alpha-hydroxylase activity(GO:0080132) |
| 0.3 | 1.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.3 | 0.8 | GO:0010242 | oxygen evolving activity(GO:0010242) |
| 0.3 | 0.8 | GO:0051752 | phosphoglucan, water dikinase activity(GO:0051752) |
| 0.2 | 1.2 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.2 | 1.9 | GO:0033946 | xyloglucan-specific endo-beta-1,4-glucanase activity(GO:0033946) |
| 0.2 | 0.9 | GO:0047782 | coniferin beta-glucosidase activity(GO:0047782) |
| 0.2 | 1.7 | GO:0009916 | alternative oxidase activity(GO:0009916) |
| 0.2 | 0.6 | GO:0052635 | C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.2 | 1.5 | GO:0019825 | oxygen binding(GO:0019825) |
| 0.2 | 2.0 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) peroxiredoxin activity(GO:0051920) |
| 0.2 | 0.6 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.2 | 0.6 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) |
| 0.2 | 0.9 | GO:0004333 | fumarate hydratase activity(GO:0004333) |
| 0.2 | 0.5 | GO:0003844 | 1,4-alpha-glucan branching enzyme activity(GO:0003844) |
| 0.2 | 2.1 | GO:0009815 | 1-aminocyclopropane-1-carboxylate oxidase activity(GO:0009815) |
| 0.2 | 1.8 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.2 | 0.5 | GO:0010283 | pinoresinol reductase activity(GO:0010283) |
| 0.2 | 0.5 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.2 | 0.5 | GO:0016041 | glutamate synthase (ferredoxin) activity(GO:0016041) oxidoreductase activity, acting on the CH-NH2 group of donors, iron-sulfur protein as acceptor(GO:0016643) |
| 0.1 | 0.7 | GO:0003863 | 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.1 | 1.1 | GO:0080046 | quercetin 4'-O-glucosyltransferase activity(GO:0080046) |
| 0.1 | 0.4 | GO:0047364 | desulfoglucosinolate sulfotransferase activity(GO:0047364) |
| 0.1 | 1.6 | GO:0031176 | endo-1,4-beta-xylanase activity(GO:0031176) |
| 0.1 | 0.7 | GO:0002020 | protease binding(GO:0002020) |
| 0.1 | 0.3 | GO:0080116 | glucuronoxylan glucuronosyltransferase activity(GO:0080116) |
| 0.1 | 0.4 | GO:0045140 | inositol phosphoceramide synthase activity(GO:0045140) |
| 0.1 | 1.4 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.1 | 1.4 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.1 | 0.8 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.1 | 1.4 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.1 | 0.2 | GO:0030619 | U1 snRNA binding(GO:0030619) |
| 0.1 | 0.4 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.1 | 0.4 | GO:0004044 | amidophosphoribosyltransferase activity(GO:0004044) |
| 0.1 | 1.8 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.4 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.1 | 1.4 | GO:0016847 | 1-aminocyclopropane-1-carboxylate synthase activity(GO:0016847) |
| 0.1 | 0.9 | GO:0033201 | starch synthase activity(GO:0009011) alpha-1,4-glucan synthase activity(GO:0033201) |
| 0.1 | 0.9 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.1 | 0.5 | GO:0015089 | high-affinity copper ion transmembrane transporter activity(GO:0015089) |
| 0.1 | 1.0 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.1 | 0.4 | GO:0070405 | ammonium ion binding(GO:0070405) |
| 0.1 | 2.2 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.1 | 0.5 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.1 | 1.0 | GO:0009922 | fatty acid elongase activity(GO:0009922) |
| 0.1 | 0.5 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.1 | 0.9 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.1 | 0.3 | GO:0000992 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 3 promoter sequence-specific DNA binding(GO:0001006) RNA polymerase III regulatory region DNA binding(GO:0001016) RNA polymerase III type 3 promoter DNA binding(GO:0001032) |
| 0.1 | 0.3 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) alanine transmembrane transporter activity(GO:0022858) |
| 0.1 | 0.5 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) L-methionine:thioredoxin-disulfide S-oxidoreductase activity(GO:0033744) L-methionine-(S)-S-oxide reductase activity(GO:0036456) |
| 0.1 | 1.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.9 | GO:0016688 | L-ascorbate peroxidase activity(GO:0016688) |
| 0.1 | 2.3 | GO:0016762 | xyloglucan:xyloglucosyl transferase activity(GO:0016762) |
| 0.1 | 0.7 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.1 | 0.3 | GO:0080002 | UDP-glucose:4-aminobenzoate acylglucosyltransferase activity(GO:0080002) |
| 0.1 | 2.2 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.1 | 1.5 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
| 0.1 | 2.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.1 | 0.5 | GO:0042171 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.1 | 0.3 | GO:0047517 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) 1,4-beta-D-xylan synthase activity(GO:0047517) |
| 0.1 | 0.5 | GO:0052654 | L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 0.3 | GO:0033836 | flavonol 7-O-beta-glucosyltransferase activity(GO:0033836) |
| 0.1 | 3.5 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.1 | 0.6 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.1 | 0.8 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.1 | 0.2 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.1 | 2.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.4 | GO:0045543 | gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) |
| 0.1 | 0.8 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) |
| 0.1 | 0.3 | GO:0046593 | mandelonitrile lyase activity(GO:0046593) |
| 0.1 | 0.2 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 0.1 | 0.4 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.1 | 0.9 | GO:0103075 | indole-3-pyruvate monooxygenase activity(GO:0103075) |
| 0.1 | 0.4 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 0.6 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.1 | 2.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 0.6 | GO:0004506 | squalene monooxygenase activity(GO:0004506) |
| 0.1 | 0.8 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
| 0.1 | 0.3 | GO:0003919 | FMN adenylyltransferase activity(GO:0003919) |
| 0.1 | 2.1 | GO:0005179 | hormone activity(GO:0005179) |
| 0.1 | 1.3 | GO:0042300 | beta-amyrin synthase activity(GO:0042300) |
| 0.1 | 0.2 | GO:0032131 | alkylated DNA binding(GO:0032131) |
| 0.1 | 1.0 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.1 | 0.4 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.1 | 0.2 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 0.4 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 0.1 | GO:0004484 | mRNA guanylyltransferase activity(GO:0004484) polynucleotide 5'-phosphatase activity(GO:0004651) RNA guanylyltransferase activity(GO:0008192) polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.6 | GO:0031078 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) NAD-dependent protein deacetylase activity(GO:0034979) |
| 0.1 | 0.6 | GO:0016161 | beta-amylase activity(GO:0016161) |
| 0.1 | 0.5 | GO:0004020 | adenylylsulfate kinase activity(GO:0004020) |
| 0.1 | 2.0 | GO:0051119 | sugar transmembrane transporter activity(GO:0051119) |
| 0.1 | 1.0 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.1 | 0.3 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.1 | 0.2 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.1 | 0.4 | GO:1990538 | xylan O-acetyltransferase activity(GO:1990538) |
| 0.1 | 0.3 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.1 | 1.2 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.1 | 0.2 | GO:0003848 | 2-amino-4-hydroxy-6-hydroxymethyldihydropteridine diphosphokinase activity(GO:0003848) dihydropteroate synthase activity(GO:0004156) |
| 0.1 | 0.5 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.1 | 0.3 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 0.1 | 2.1 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.1 | 0.5 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.3 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.0 | 0.2 | GO:0010295 | (+)-abscisic acid 8'-hydroxylase activity(GO:0010295) |
| 0.0 | 0.2 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 1.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.2 | GO:0031956 | medium-chain fatty acid-CoA ligase activity(GO:0031956) |
| 0.0 | 0.4 | GO:0016987 | core DNA-dependent RNA polymerase binding promoter specificity activity(GO:0000996) sigma factor activity(GO:0016987) |
| 0.0 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.1 | GO:0047150 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) betaine-homocysteine S-methyltransferase activity(GO:0047150) |
| 0.0 | 0.3 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.0 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 1.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.8 | GO:0102336 | 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 2.0 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.0 | 0.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 2.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.7 | GO:0005372 | water transmembrane transporter activity(GO:0005372) water channel activity(GO:0015250) |
| 0.0 | 0.2 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.0 | 0.3 | GO:0070696 | transmembrane receptor protein serine/threonine kinase binding(GO:0070696) |
| 0.0 | 0.2 | GO:0004108 | citrate (Si)-synthase activity(GO:0004108) citrate synthase activity(GO:0036440) |
| 0.0 | 0.8 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 1.2 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.6 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.4 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.5 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 1.0 | GO:0047262 | polygalacturonate 4-alpha-galacturonosyltransferase activity(GO:0047262) |
| 0.0 | 0.1 | GO:0003962 | cystathionine gamma-synthase activity(GO:0003962) |
| 0.0 | 0.3 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) |
| 0.0 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.4 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 0.0 | 0.1 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 1.8 | GO:0022884 | protein transmembrane transporter activity(GO:0008320) macromolecule transmembrane transporter activity(GO:0022884) |
| 0.0 | 0.6 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.2 | GO:0008964 | phosphoenolpyruvate carboxylase activity(GO:0008964) |
| 0.0 | 0.4 | GO:0015038 | peptide disulfide oxidoreductase activity(GO:0015037) glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.4 | GO:0004575 | sucrose alpha-glucosidase activity(GO:0004575) |
| 0.0 | 0.2 | GO:0004123 | cystathionine gamma-lyase activity(GO:0004123) |
| 0.0 | 0.5 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.9 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.1 | GO:0070704 | sterol desaturase activity(GO:0070704) |
| 0.0 | 1.0 | GO:0005262 | calcium channel activity(GO:0005262) |
| 0.0 | 0.2 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
| 0.0 | 0.4 | GO:0031543 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) peptidyl-proline dioxygenase activity(GO:0031543) peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 1.5 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.6 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 0.6 | GO:0016837 | carbon-oxygen lyase activity, acting on polysaccharides(GO:0016837) pectate lyase activity(GO:0030570) |
| 0.0 | 0.1 | GO:0043765 | T/G mismatch-specific endonuclease activity(GO:0043765) |
| 0.0 | 0.3 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.6 | GO:0005345 | purine nucleobase transmembrane transporter activity(GO:0005345) |
| 0.0 | 1.4 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.4 | GO:0048029 | monosaccharide binding(GO:0048029) |
| 0.0 | 0.2 | GO:0050105 | L-gulonolactone oxidase activity(GO:0050105) |
| 0.0 | 0.6 | GO:0016682 | oxidoreductase activity, acting on diphenols and related substances as donors, oxygen as acceptor(GO:0016682) |
| 0.0 | 0.2 | GO:0009979 | 16:0 monogalactosyldiacylglycerol desaturase activity(GO:0009979) |
| 0.0 | 0.1 | GO:0004820 | glycine-tRNA ligase activity(GO:0004820) |
| 0.0 | 0.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.5 | GO:0080031 | methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
| 0.0 | 1.6 | GO:0046910 | pectinesterase inhibitor activity(GO:0046910) |
| 0.0 | 0.1 | GO:0036374 | peptidyltransferase activity(GO:0000048) glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.4 | GO:0004630 | phospholipase D activity(GO:0004630) N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.4 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) alcohol dehydrogenase (NADP+) activity(GO:0008106) |
| 0.0 | 0.1 | GO:0004148 | dihydrolipoyl dehydrogenase activity(GO:0004148) |
| 0.0 | 0.2 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.0 | 0.1 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.0 | 0.2 | GO:0015198 | peptide transporter activity(GO:0015197) oligopeptide transporter activity(GO:0015198) |
| 0.0 | 0.3 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.2 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.0 | 2.3 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 2.3 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.2 | GO:0003825 | alpha,alpha-trehalose-phosphate synthase (UDP-forming) activity(GO:0003825) |
| 0.0 | 0.1 | GO:0060229 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
| 0.0 | 0.2 | GO:0016207 | 4-coumarate-CoA ligase activity(GO:0016207) |
| 0.0 | 0.5 | GO:0010333 | terpene synthase activity(GO:0010333) |
| 0.0 | 0.7 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.7 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.1 | GO:0050664 | NAD(P)H oxidase activity(GO:0016174) oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.0 | 0.1 | GO:0015434 | cadmium-transporting ATPase activity(GO:0015434) zinc-exporting ATPase activity(GO:0016463) |
| 0.0 | 0.2 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.0 | 0.7 | GO:0045735 | nutrient reservoir activity(GO:0045735) |
| 0.0 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.1 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.0 | 0.1 | GO:0052691 | UDP-arabinopyranose mutase activity(GO:0052691) |
| 0.0 | 0.1 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
| 0.0 | 0.4 | GO:0008810 | cellulase activity(GO:0008810) |
| 0.0 | 2.6 | GO:0043531 | ADP binding(GO:0043531) |
| 0.0 | 0.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.0 | GO:0003852 | 2-isopropylmalate synthase activity(GO:0003852) |
| 0.0 | 0.6 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.0 | 0.0 | GO:0051723 | prenylcysteine methylesterase activity(GO:0010296) protein methylesterase activity(GO:0051723) |
| 0.0 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.0 | GO:0016160 | amylase activity(GO:0016160) |
| 0.0 | 0.4 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.1 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.0 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.0 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.9 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 0.5 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 0.6 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 0.2 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.1 | 0.3 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
| 0.0 | 0.1 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.1 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.1 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 1.2 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 0.4 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 0.3 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
| 0.1 | 0.3 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
| 0.1 | 0.5 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 0.4 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
| 0.1 | 0.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.1 | 0.2 | REACTOME NUCLEOTIDE BINDING DOMAIN LEUCINE RICH REPEAT CONTAINING RECEPTOR NLR SIGNALING PATHWAYS | Genes involved in Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways |
| 0.1 | 0.3 | REACTOME INNATE IMMUNE SYSTEM | Genes involved in Innate Immune System |
| 0.0 | 0.2 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |