GSE130291:vernalization in Arabidopsis thaliana
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
AT4G00730
|
AT4G00730 | Homeobox-leucine zipper family protein / lipid-binding START domain-containing protein |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| ANL2 | arTal_v1_Chr4_-_304508_304612 | -0.02 | 9.3e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| arTal_v1_Chr1_+_6130025_6130025 | 1.89 |
AT1G17810.1
|
BETA-TIP
|
beta-tonoplast intrinsic protein |
| arTal_v1_Chr2_-_7496292_7496292 | 1.79 |
AT2G17230.1
|
EXL5
|
EXORDIUM like 5 |
| arTal_v1_Chr1_+_1244947_1244947 | 1.68 |
AT1G04560.1
|
AT1G04560
|
AWPM-19-like family protein |
| arTal_v1_Chr5_+_3783930_3783930 | 1.49 |
AT5G11740.1
|
AGP15
|
arabinogalactan protein 15 |
| arTal_v1_Chr5_+_733887_733887 | 1.49 |
AT5G03120.1
AT5G03120.2 |
AT5G03120
|
transmembrane protein |
| arTal_v1_Chr1_-_59215_59215 | 1.37 |
AT1G01120.1
|
KCS1
|
3-ketoacyl-CoA synthase 1 |
| arTal_v1_Chr4_-_2413447_2413447 | 1.34 |
AT4G04745.1
|
AT4G04745
|
hypothetical protein |
| arTal_v1_Chr4_-_7410406_7410406 | 1.31 |
AT4G12490.1
|
AT4G12490
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
| arTal_v1_Chr5_+_1568694_1568694 | 1.30 |
AT5G05290.1
|
EXPA2
|
expansin A2 |
| arTal_v1_Chr4_+_6826587_6826587 | 1.29 |
AT4G11190.1
|
AT4G11190
|
Disease resistance-responsive (dirigent-like protein) family protein |
| arTal_v1_Chr1_-_25580194_25580199 | 1.27 |
AT1G68250.2
AT1G68250.1 |
AT1G68250
|
hypothetical protein |
| arTal_v1_Chr4_+_160643_160643 | 1.26 |
AT4G00360.1
|
CYP86A2
|
cytochrome P450, family 86, subfamily A, polypeptide 2 |
| arTal_v1_Chr5_-_8406132_8406151 | 1.25 |
AT5G24570.1
AT5G24575.1 |
AT5G24570
AT5G24575
|
hypothetical protein hypothetical protein |
| arTal_v1_Chr4_+_13275200_13275200 | 1.25 |
AT4G26200.1
|
ACS7
|
1-amino-cyclopropane-1-carboxylate synthase 7 |
| arTal_v1_Chr4_-_7786161_7786161 | 1.24 |
AT4G13395.1
|
RTFL12
|
ROTUNDIFOLIA like 12 |
| arTal_v1_Chr4_+_17524461_17524461 | 1.22 |
AT4G37240.1
|
AT4G37240
|
HTH-type transcriptional regulator |
| arTal_v1_Chr2_-_15137012_15137012 | 1.22 |
AT2G36050.1
|
OFP15
|
ovate family protein 15 |
| arTal_v1_Chr4_+_15819489_15819489 | 1.21 |
AT4G32800.1
|
AT4G32800
|
Integrase-type DNA-binding superfamily protein |
| arTal_v1_Chr4_+_16596640_16596640 | 1.20 |
AT4G34800.1
|
AT4G34800
|
SAUR-like auxin-responsive protein family |
| arTal_v1_Chr2_+_2763449_2763513 | 1.16 |
AT2G06850.1
AT2G06850.2 |
XTH4
|
xyloglucan endotransglucosylase/hydrolase 4 |
| arTal_v1_Chr4_-_947075_947085 | 1.14 |
AT4G02130.2
AT4G02130.3 |
GATL6
|
galacturonosyltransferase 6 |
| arTal_v1_Chr3_+_8550037_8550037 | 1.14 |
AT3G23730.1
|
XTH16
|
xyloglucan endotransglucosylase/hydrolase 16 |
| arTal_v1_Chr5_-_4299264_4299264 | 1.12 |
AT5G13400.1
|
AT5G13400
|
Major facilitator superfamily protein |
| arTal_v1_Chr2_-_18401339_18401339 | 1.11 |
AT2G44578.1
|
AT2G44578
|
RING/U-box superfamily protein |
| arTal_v1_Chr5_+_16202142_16202142 | 1.09 |
AT5G40460.1
|
AT5G40460
|
cyclin-dependent kinase inhibitor SMR3-like protein |
| arTal_v1_Chr4_+_13812989_13812989 | 1.09 |
AT4G27657.1
|
AT4G27657
|
hypothetical protein |
| arTal_v1_Chr1_+_22767617_22767617 | 1.09 |
AT1G61667.1
|
AT1G61667
|
serine protease, putative (Protein of unknown function, DUF538) |
| arTal_v1_Chr4_-_14883583_14883583 | 1.09 |
AT4G30440.1
|
GAE1
|
UDP-D-glucuronate 4-epimerase 1 |
| arTal_v1_Chr5_+_26772644_26772644 | 1.09 |
AT5G67080.1
|
MAPKKK19
|
mitogen-activated protein kinase kinase kinase 19 |
| arTal_v1_Chr4_-_1046993_1047105 | 1.08 |
AT4G02380.2
AT4G02380.1 AT4G02380.3 |
SAG21
|
senescence-associated gene 21 |
| arTal_v1_Chr3_-_15617149_15617149 | 1.07 |
AT3G43720.2
|
LTPG2
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
| arTal_v1_Chr3_+_1591115_1591115 | 1.05 |
AT3G05490.1
|
RALFL22
|
ralf-like 22 |
| arTal_v1_Chr4_-_947249_947249 | 1.04 |
AT4G02130.1
|
GATL6
|
galacturonosyltransferase 6 |
| arTal_v1_Chr2_-_13609955_13609955 | 1.03 |
AT2G31980.1
|
CYS2
|
PHYTOCYSTATIN 2 |
| arTal_v1_Chr3_-_15617309_15617309 | 1.03 |
AT3G43720.1
|
LTPG2
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
| arTal_v1_Chr3_+_4462841_4462841 | 1.03 |
AT3G13650.1
|
AT3G13650
|
Disease resistance-responsive (dirigent-like protein) family protein |
| arTal_v1_Chr5_-_18506382_18506382 | 1.03 |
AT5G45630.1
|
AT5G45630
|
senescence regulator (Protein of unknown function, DUF584) |
| arTal_v1_Chr3_+_5121303_5121303 | 1.01 |
AT3G15210.1
|
ERF4
|
ethylene responsive element binding factor 4 |
| arTal_v1_Chr1_+_8195776_8195776 | 1.01 |
AT1G23100.1
|
AT1G23100
|
GroES-like family protein |
| arTal_v1_Chr5_+_25721733_25721733 | 1.00 |
AT5G64310.1
|
AGP1
|
arabinogalactan protein 1 |
| arTal_v1_Chr1_+_22767464_22767464 | 0.99 |
AT1G61667.2
|
AT1G61667
|
serine protease, putative (Protein of unknown function, DUF538) |
| arTal_v1_Chr3_-_4834015_4834015 | 0.97 |
AT3G14440.1
|
NCED3
|
nine-cis-epoxycarotenoid dioxygenase 3 |
| arTal_v1_Chr3_+_16892702_16892702 | 0.96 |
AT3G45960.2
AT3G45960.1 |
EXLA3
|
expansin-like A3 |
| arTal_v1_Chr3_-_17008528_17008528 | 0.96 |
AT3G46280.1
|
AT3G46280
|
kinase-like protein |
| arTal_v1_Chr1_+_954290_954290 | 0.95 |
AT1G03790.1
|
SOM
|
Zinc finger C-x8-C-x5-C-x3-H type family protein |
| arTal_v1_Chr2_-_13489679_13489679 | 0.95 |
AT2G31730.1
|
AT2G31730
|
basic helix-loop-helix (bHLH) DNA-binding superfamily protein |
| arTal_v1_Chr4_-_7493080_7493080 | 0.95 |
AT4G12730.1
|
FLA2
|
FASCICLIN-like arabinogalactan 2 |
| arTal_v1_Chr5_-_3728726_3728726 | 0.95 |
AT5G11590.1
|
TINY2
|
Integrase-type DNA-binding superfamily protein |
| arTal_v1_Chr4_-_13022996_13022996 | 0.94 |
AT4G25490.1
|
CBF1
|
C-repeat/DRE binding factor 1 |
| arTal_v1_Chr4_-_16583075_16583075 | 0.93 |
AT4G34760.1
|
AT4G34760
|
SAUR-like auxin-responsive protein family |
| arTal_v1_Chr5_+_14912659_14912659 | 0.93 |
AT5G37540.1
|
AT5G37540
|
Eukaryotic aspartyl protease family protein |
| arTal_v1_Chr2_-_17161293_17161294 | 0.93 |
AT2G41170.2
AT2G41170.1 AT2G41170.3 |
AT2G41170
|
F-box family protein |
| arTal_v1_Chr1_+_22628264_22628409 | 0.92 |
AT1G61340.1
AT1G61340.2 |
FBS1
|
F-box family protein |
| arTal_v1_Chr5_-_27504_27504 | 0.92 |
AT5G01075.1
|
AT5G01075
|
Glycosyl hydrolase family 35 protein |
| arTal_v1_Chr2_-_15474717_15474828 | 0.91 |
AT2G36870.2
AT2G36870.1 |
XTH32
|
xyloglucan endotransglucosylase/hydrolase 32 |
| arTal_v1_Chr3_-_2130451_2130451 | 0.91 |
AT3G06750.1
|
AT3G06750
|
hydroxyproline-rich glycoprotein family protein |
| arTal_v1_Chr3_-_21097481_21097481 | 0.91 |
AT3G57010.1
|
AT3G57010
|
Calcium-dependent phosphotriesterase superfamily protein |
| arTal_v1_Chr3_-_10590685_10590685 | 0.91 |
AT3G28340.1
|
GATL10
|
galacturonosyltransferase-like 10 |
| arTal_v1_Chr4_-_18206684_18206684 | 0.90 |
AT4G39070.1
|
BZS1
|
B-box zinc finger family protein |
| arTal_v1_Chr2_+_11566288_11566288 | 0.89 |
AT2G27080.1
|
AT2G27080
|
Late embryogenesis abundant (LEA) hydroxyproline-rich glycoprotein family |
| arTal_v1_Chr5_-_19977620_19977620 | 0.88 |
AT5G49280.1
|
AT5G49280
|
hydroxyproline-rich glycoprotein family protein |
| arTal_v1_Chr4_-_14439723_14439769 | 0.88 |
AT4G29310.1
AT4G29310.2 |
AT4G29310
|
DUF1005 family protein (DUF1005) |
| arTal_v1_Chr5_+_463073_463073 | 0.87 |
AT5G02260.1
|
EXPA9
|
expansin A9 |
| arTal_v1_Chr1_+_28472357_28472357 | 0.86 |
AT1G75830.1
|
LCR67
|
low-molecular-weight cysteine-rich 67 |
| arTal_v1_Chr4_+_14368877_14368877 | 0.86 |
AT4G29140.1
|
ADS1
|
MATE efflux family protein |
| arTal_v1_Chr2_-_16908152_16908152 | 0.86 |
AT2G40475.1
|
ASG8
|
hypothetical protein |
| arTal_v1_Chr5_-_7084859_7084859 | 0.86 |
AT5G20885.1
|
AT5G20885
|
RING/U-box superfamily protein |
| arTal_v1_Chr4_-_846792_846814 | 0.86 |
AT4G01950.1
AT4G01950.2 |
GPAT3
|
glycerol-3-phosphate acyltransferase 3 |
| arTal_v1_Chr4_+_17752079_17752079 | 0.86 |
AT4G37770.1
|
ACS8
|
1-amino-cyclopropane-1-carboxylate synthase 8 |
| arTal_v1_Chr2_-_13258176_13258176 | 0.85 |
AT2G31100.1
|
AT2G31100
|
alpha/beta-Hydrolases superfamily protein |
| arTal_v1_Chr2_+_9488413_9488542 | 0.85 |
AT2G22330.2
AT2G22330.1 |
CYP79B3
|
cytochrome P450, family 79, subfamily B, polypeptide 3 |
| arTal_v1_Chr4_+_14894073_14894073 | 0.84 |
AT4G30470.1
|
AT4G30470
|
NAD(P)-binding Rossmann-fold superfamily protein |
| arTal_v1_Chr4_+_15382777_15382777 | 0.84 |
AT4G31800.1
|
WRKY18
|
WRKY DNA-binding protein 18 |
| arTal_v1_Chr2_-_18914739_18914739 | 0.84 |
AT2G45970.1
|
CYP86A8
|
cytochrome P450, family 86, subfamily A, polypeptide 8 |
| arTal_v1_Chr1_+_25053673_25053673 | 0.84 |
AT1G67100.1
|
LBD40
|
LOB domain-containing protein 40 |
| arTal_v1_Chr3_-_2137280_2137350 | 0.83 |
AT3G06770.4
AT3G06770.3 |
AT3G06770
|
Pectin lyase-like superfamily protein |
| arTal_v1_Chr5_-_122507_122525 | 0.83 |
AT5G01300.2
AT5G01300.1 AT5G01300.3 |
AT5G01300
|
PEBP (phosphatidylethanolamine-binding protein) family protein |
| arTal_v1_Chr1_+_10375599_10375599 | 0.83 |
AT1G29670.2
|
AT1G29670
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
| arTal_v1_Chr5_-_16995062_16995062 | 0.83 |
AT5G42500.1
|
AT5G42500
|
Disease resistance-responsive (dirigent-like protein) family protein |
| arTal_v1_Chr4_-_14542565_14542565 | 0.83 |
AT4G29690.1
|
AT4G29690
|
Alkaline-phosphatase-like family protein |
| arTal_v1_Chr4_-_14841067_14841147 | 0.82 |
AT4G30340.2
AT4G30340.1 |
DGK7
|
diacylglycerol kinase 7 |
| arTal_v1_Chr1_-_20160864_20160864 | 0.82 |
AT1G54010.1
|
AT1G54010
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
| arTal_v1_Chr1_-_13031375_13031375 | 0.82 |
AT1G35430.1
|
AT1G35430
|
transmembrane protein |
| arTal_v1_Chr3_-_2137012_2137085 | 0.82 |
AT3G06770.1
AT3G06770.5 |
AT3G06770
|
Pectin lyase-like superfamily protein |
| arTal_v1_Chr4_+_15383197_15383197 | 0.82 |
AT4G31800.3
|
WRKY18
|
WRKY DNA-binding protein 18 |
| arTal_v1_Chr5_+_17760865_17760865 | 0.82 |
AT5G44130.1
|
FLA13
|
FASCICLIN-like arabinogalactan protein 13 precursor |
| arTal_v1_Chr2_+_17728479_17728479 | 0.81 |
AT2G42580.1
|
TTL3
|
tetratricopetide-repeat thioredoxin-like 3 |
| arTal_v1_Chr3_-_8865239_8865239 | 0.80 |
AT3G24420.1
|
AT3G24420
|
alpha/beta-Hydrolases superfamily protein |
| arTal_v1_Chr1_+_9740508_9740508 | 0.80 |
AT1G27950.1
|
LTPG1
|
glycosylphosphatidylinositol-anchored lipid protein transfer 1 |
| arTal_v1_Chr3_-_8902835_8902835 | 0.80 |
AT3G24480.1
|
AT3G24480
|
Leucine-rich repeat (LRR) family protein |
| arTal_v1_Chr2_-_12932828_12932828 | 0.79 |
AT2G30340.2
AT2G30340.1 |
LBD13
|
LOB domain-containing protein 13 |
| arTal_v1_Chr1_+_7238693_7238693 | 0.79 |
AT1G20823.1
|
AT1G20823
|
RING/U-box superfamily protein |
| arTal_v1_Chr2_-_13784471_13784483 | 0.79 |
AT2G32460.2
AT2G32460.1 |
MYB101
|
myb domain protein 101 |
| arTal_v1_Chr2_+_11563933_11563933 | 0.79 |
AT2G27080.2
|
AT2G27080
|
Late embryogenesis abundant (LEA) hydroxyproline-rich glycoprotein family |
| arTal_v1_Chr1_+_1425539_1425539 | 0.78 |
AT1G05000.3
AT1G05000.1 AT1G05000.2 |
PFA-DSP1
|
Phosphotyrosine protein phosphatases superfamily protein |
| arTal_v1_Chr5_+_20511642_20511667 | 0.78 |
AT5G50375.3
AT5G50375.1 AT5G50375.2 |
CPI1
|
cyclopropyl isomerase |
| arTal_v1_Chr3_-_15704391_15704391 | 0.78 |
AT3G43850.2
|
AT3G43850
|
hypothetical protein |
| arTal_v1_Chr2_+_1676999_1676999 | 0.77 |
AT2G04780.2
|
FLA7
|
FASCICLIN-like arabinoogalactan 7 |
| arTal_v1_Chr1_+_5638779_5638779 | 0.77 |
AT1G16500.1
|
AT1G16500
|
filamentous hemagglutinin transporter |
| arTal_v1_Chr2_+_1676717_1676717 | 0.77 |
AT2G04780.1
|
FLA7
|
FASCICLIN-like arabinoogalactan 7 |
| arTal_v1_Chr5_-_9792378_9792378 | 0.77 |
AT5G27660.2
|
DEG14
|
Trypsin family protein with PDZ domain-containing protein |
| arTal_v1_Chr3_-_1136397_1136397 | 0.76 |
AT3G04290.1
|
LTL1
|
Li-tolerant lipase 1 |
| arTal_v1_Chr1_+_10375754_10375754 | 0.76 |
AT1G29670.1
|
AT1G29670
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
| arTal_v1_Chr2_-_12149072_12149072 | 0.76 |
AT2G28400.1
|
AT2G28400
|
senescence regulator (Protein of unknown function, DUF584) |
| arTal_v1_Chr2_-_4312103_4312162 | 0.75 |
AT2G10940.2
AT2G10940.1 |
AT2G10940
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
| arTal_v1_Chr1_-_24033600_24033674 | 0.75 |
AT1G64670.1
AT1G64670.3 AT1G64670.2 |
BDG1
|
alpha/beta-Hydrolases superfamily protein |
| arTal_v1_Chr4_-_8307934_8307934 | 0.75 |
AT4G14440.1
|
HCD1
|
3-hydroxyacyl-CoA dehydratase 1 |
| arTal_v1_Chr1_+_28377377_28377377 | 0.75 |
AT1G75580.1
|
AT1G75580
|
SAUR-like auxin-responsive protein family |
| arTal_v1_Chr1_+_2688880_2688880 | 0.75 |
AT1G08500.1
|
ENODL18
|
early nodulin-like protein 18 |
| arTal_v1_Chr5_-_19040456_19040456 | 0.74 |
AT5G46900.1
|
AT5G46900
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
| arTal_v1_Chr1_+_18121434_18121434 | 0.73 |
AT1G48990.1
|
AT1G48990
|
Oleosin family protein |
| arTal_v1_Chr4_-_11519805_11519805 | 0.73 |
AT4G21680.1
|
NRT1.8
|
NITRATE TRANSPORTER 1.8 |
| arTal_v1_Chr4_-_176870_176870 | 0.73 |
AT4G00400.1
|
GPAT8
|
glycerol-3-phosphate acyltransferase 8 |
| arTal_v1_Chr1_+_4934120_4934120 | 0.73 |
AT1G14430.1
|
AT1G14430
|
glyoxal oxidase-related protein |
| arTal_v1_Chr1_-_17015497_17015520 | 0.73 |
AT1G45010.2
AT1G45010.3 AT1G45010.4 AT1G45010.1 |
AT1G45010
|
TRAM, LAG1 and CLN8 (TLC) lipid-sensing domain containing protein |
| arTal_v1_Chr5_+_7676662_7676662 | 0.72 |
AT5G22940.1
|
F8H
|
glucuronoxylan glucuronosyltransferase, putative |
| arTal_v1_Chr2_-_17837618_17837618 | 0.72 |
AT2G42870.1
|
PAR1
|
phy rapidly regulated 1 |
| arTal_v1_Chr1_+_4095246_4095246 | 0.72 |
AT1G12100.1
|
AT1G12100
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
| arTal_v1_Chr1_+_26852406_26852456 | 0.72 |
AT1G71230.1
AT1G71230.2 |
CSN5B
|
COP9-signalosome 5B |
| arTal_v1_Chr4_+_14192569_14192569 | 0.71 |
AT4G28720.1
|
YUC8
|
Flavin-binding monooxygenase family protein |
| arTal_v1_Chr5_+_7676938_7676938 | 0.71 |
AT5G22940.2
|
F8H
|
glucuronoxylan glucuronosyltransferase, putative |
| arTal_v1_Chr4_+_7038437_7038489 | 0.71 |
AT4G11655.1
AT4G11655.2 |
AT4G11655
|
Uncharacterized protein family (UPF0497) |
| arTal_v1_Chr3_-_21523375_21523518 | 0.71 |
AT3G58120.2
AT3G58120.1 |
BZIP61
|
Basic-leucine zipper (bZIP) transcription factor family protein |
| arTal_v1_Chr1_-_25065446_25065446 | 0.71 |
AT1G67110.1
AT1G67110.2 |
CYP735A2
|
cytochrome P450, family 735, subfamily A, polypeptide 2 |
| arTal_v1_Chr5_+_26671273_26671273 | 0.70 |
AT5G66800.1
|
AT5G66800
|
membrane-associated kinase regulator-like protein |
| arTal_v1_Chr1_-_9753952_9753952 | 0.70 |
AT1G27990.1
|
AT1G27990
|
transmembrane protein |
| arTal_v1_Chr4_-_11592425_11592425 | 0.70 |
AT4G21850.1
|
MSRB9
|
methionine sulfoxide reductase B9 |
| arTal_v1_Chr3_-_22811024_22811024 | 0.69 |
AT3G61640.1
|
AGP20
|
arabinogalactan protein 20 |
| arTal_v1_Chr2_+_10072057_10072057 | 0.69 |
AT2G23690.1
|
AT2G23690
|
HTH-type transcriptional regulator |
| arTal_v1_Chr5_-_497372_497372 | 0.69 |
AT5G02350.1
|
AT5G02350
|
Cysteine/Histidine-rich C1 domain family protein |
| arTal_v1_Chr5_-_23289635_23289635 | 0.69 |
AT5G57510.1
|
AT5G57510
|
cotton fiber protein |
| arTal_v1_Chr3_-_8589754_8589754 | 0.69 |
AT3G23810.1
|
SAHH2
|
S-adenosyl-l-homocysteine (SAH) hydrolase 2 |
| arTal_v1_Chr4_+_18185437_18185437 | 0.69 |
AT4G39030.1
|
EDS5
|
MATE efflux family protein |
| arTal_v1_Chr5_+_26767599_26767599 | 0.68 |
AT5G67070.1
|
RALFL34
|
ralf-like 34 |
| arTal_v1_Chr1_+_10244453_10244453 | 0.68 |
AT1G29290.1
|
AT1G29290
|
B-cell lymphoma 6 protein |
| arTal_v1_Chr3_-_18666691_18666691 | 0.68 |
AT3G50340.1
|
AT3G50340
|
hypothetical protein |
| arTal_v1_Chr5_+_19428888_19428888 | 0.68 |
AT5G47980.1
|
AT5G47980
|
HXXXD-type acyl-transferase family protein |
| arTal_v1_Chr2_+_12523276_12523276 | 0.68 |
AT2G29125.1
|
RTFL2
|
ROTUNDIFOLIA like 2 |
| arTal_v1_Chr4_-_11592238_11592238 | 0.68 |
AT4G21850.2
|
MSRB9
|
methionine sulfoxide reductase B9 |
| arTal_v1_Chr4_-_6443554_6443554 | 0.68 |
AT4G10390.1
|
AT4G10390
|
Protein kinase superfamily protein |
| arTal_v1_Chr5_-_17005510_17005510 | 0.68 |
AT5G42530.1
|
AT5G42530
|
hypothetical protein |
| arTal_v1_Chr3_-_2137641_2137641 | 0.68 |
AT3G06770.2
|
AT3G06770
|
Pectin lyase-like superfamily protein |
| arTal_v1_Chr3_-_11138010_11138010 | 0.67 |
AT3G29170.1
|
AT3G29170
|
transmembrane protein (DUF872) |
| arTal_v1_Chr4_+_10521259_10521379 | 0.67 |
AT4G19230.1
AT4G19230.2 |
CYP707A1
|
cytochrome P450, family 707, subfamily A, polypeptide 1 |
| arTal_v1_Chr1_+_7835781_7835781 | 0.67 |
AT1G22190.1
|
AT1G22190
|
Integrase-type DNA-binding superfamily protein |
| arTal_v1_Chr3_-_4079627_4079627 | 0.66 |
AT3G12830.1
|
AT3G12830
|
SAUR-like auxin-responsive protein family |
| arTal_v1_Chr4_-_9368852_9368852 | 0.66 |
AT4G16640.1
|
AT4G16640
|
Matrixin family protein |
| arTal_v1_Chr4_+_16708361_16708361 | 0.66 |
AT4G35100.1
|
PIP3
|
plasma membrane intrinsic protein 3 |
| arTal_v1_Chr4_+_16708552_16708552 | 0.66 |
AT4G35100.2
|
PIP3
|
plasma membrane intrinsic protein 3 |
| arTal_v1_Chr1_-_18390496_18390523 | 0.65 |
AT1G49700.2
AT1G49700.1 AT1G49700.3 AT1G49700.4 |
AT1G49700
|
Plant protein 1589 of unknown function |
| arTal_v1_Chr5_+_22474142_22474142 | 0.65 |
AT5G55480.1
|
SVL1
|
SHV3-like 1 |
| arTal_v1_Chr2_+_18408579_18408579 | 0.65 |
AT2G44600.1
|
AT2G44600
|
hypothetical protein |
| arTal_v1_Chr2_-_13488691_13488691 | 0.65 |
AT2G31730.2
|
AT2G31730
|
basic helix-loop-helix (bHLH) DNA-binding superfamily protein |
| arTal_v1_Chr5_+_26765992_26766082 | 0.65 |
AT5G67060.2
AT5G67060.1 |
HEC1
|
basic helix-loop-helix (bHLH) DNA-binding superfamily protein |
| arTal_v1_Chr3_-_8290164_8290164 | 0.65 |
AT3G23230.1
|
TDR1
|
Integrase-type DNA-binding superfamily protein |
| arTal_v1_Chr5_-_2409259_2409259 | 0.65 |
AT5G07620.1
|
AT5G07620
|
Protein kinase superfamily protein |
| arTal_v1_Chr5_-_4743512_4743539 | 0.64 |
AT5G14700.2
AT5G14700.1 |
AT5G14700
|
NAD(P)-binding Rossmann-fold superfamily protein |
| arTal_v1_Chr1_+_25828890_25828890 | 0.64 |
AT1G68760.1
|
NUDX1
|
nudix hydrolase 1 |
| arTal_v1_Chr3_-_11137604_11137604 | 0.64 |
AT3G29170.2
|
AT3G29170
|
transmembrane protein (DUF872) |
| arTal_v1_Chr5_+_7718118_7718118 | 0.64 |
AT5G23020.1
|
IMS2
|
2-isopropylmalate synthase 2 |
| arTal_v1_Chr1_+_920950_920950 | 0.64 |
AT1G03700.1
|
AT1G03700
|
Uncharacterized protein family (UPF0497) |
| arTal_v1_Chr5_-_16413202_16413202 | 0.64 |
AT5G40960.1
|
AT5G40960
|
transmembrane protein, putative (DUF 3339) |
| arTal_v1_Chr1_+_21017311_21017311 | 0.63 |
AT1G56150.1
|
AT1G56150
|
SAUR-like auxin-responsive protein family |
| arTal_v1_Chr1_+_12346138_12346232 | 0.63 |
AT1G33960.2
AT1G33960.1 |
AIG1
|
P-loop containing nucleoside triphosphate hydrolases superfamily protein |
| arTal_v1_Chr5_-_19224221_19224221 | 0.63 |
AT5G47380.5
|
AT5G47380
|
electron transporter, putative (Protein of unknown function, DUF547) |
| arTal_v1_Chr4_+_8984787_8984787 | 0.63 |
AT4G15800.1
|
RALFL33
|
ralf-like 33 |
| arTal_v1_Chr5_+_5935038_5935157 | 0.63 |
AT5G17920.1
AT5G17920.2 |
ATMS1
|
Cobalamin-independent synthase family protein |
| arTal_v1_Chr3_+_634465_634465 | 0.63 |
AT3G02880.1
|
AT3G02880
|
Leucine-rich repeat protein kinase family protein |
| arTal_v1_Chr4_+_13133402_13133402 | 0.62 |
AT4G25830.1
|
AT4G25830
|
Uncharacterized protein family (UPF0497) |
| arTal_v1_Chr5_-_19224591_19224652 | 0.62 |
AT5G47380.1
AT5G47380.4 AT5G47380.3 AT5G47380.2 |
AT5G47380
|
electron transporter, putative (Protein of unknown function, DUF547) |
| arTal_v1_Chr3_+_10505711_10505711 | 0.62 |
AT3G28180.1
|
CSLC04
|
Cellulose-synthase-like C4 |
| arTal_v1_Chr1_-_8940613_8940613 | 0.62 |
AT1G25450.1
|
KCS5
|
3-ketoacyl-CoA synthase 5 |
| arTal_v1_Chr5_-_17650375_17650375 | 0.62 |
AT5G43890.1
|
YUC5
|
Flavin-binding monooxygenase family protein |
| arTal_v1_Chr4_+_6335919_6335919 | 0.62 |
AT4G10160.1
|
AT4G10160
|
RING/U-box superfamily protein |
| arTal_v1_Chr1_+_28756521_28756521 | 0.61 |
AT1G76620.1
AT1G76620.2 |
AT1G76620
|
Serine/Threonine-kinase, putative (Protein of unknown function, DUF547) |
| arTal_v1_Chr5_-_2622900_2622900 | 0.61 |
AT5G08150.1
|
SOB5
|
suppressor of phytochrome b 5 |
| arTal_v1_Chr2_+_2055519_2055519 | 0.61 |
AT2G05580.1
|
AT2G05580
|
Glycine-rich protein family |
| arTal_v1_Chr1_-_7040231_7040231 | 0.61 |
AT1G20330.1
|
SMT2
|
sterol methyltransferase 2 |
| arTal_v1_Chr1_+_8922416_8922416 | 0.61 |
AT1G25425.1
|
CLE43
|
CLAVATA3/ESR-RELATED 43 |
| arTal_v1_Chr4_-_7343731_7343731 | 0.61 |
AT4G12410.1
|
AT4G12410
|
SAUR-like auxin-responsive protein family |
| arTal_v1_Chr5_+_17585523_17585523 | 0.61 |
AT5G43760.1
|
KCS20
|
3-ketoacyl-CoA synthase 20 |
| arTal_v1_Chr4_-_8464485_8464485 | 0.60 |
AT4G14746.1
AT4G14746.2 |
AT4G14746
|
neurogenic locus notch-like protein |
| arTal_v1_Chr3_+_18514266_18514266 | 0.60 |
AT3G49940.1
|
LBD38
|
LOB domain-containing protein 38 |
| arTal_v1_Chr4_-_16740601_16740601 | 0.60 |
AT4G35180.2
AT4G35180.1 |
LHT7
|
LYS/HIS transporter 7 |
| arTal_v1_Chr2_-_10049413_10049413 | 0.60 |
AT2G23620.1
|
MES1
|
methyl esterase 1 |
| arTal_v1_Chr2_-_10439469_10439469 | 0.60 |
AT2G24570.1
|
WRKY17
|
WRKY DNA-binding protein 17 |
| arTal_v1_Chr2_-_5776289_5776342 | 0.60 |
AT2G13820.2
AT2G13820.1 AT2G13820.3 |
XYP2
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
| arTal_v1_Chr3_+_18046144_18046144 | 0.60 |
AT3G48720.1
|
DCF
|
HXXXD-type acyl-transferase family protein |
| arTal_v1_Chr5_+_24288596_24288664 | 0.60 |
AT5G60390.1
AT5G60390.2 AT5G60390.3 |
AT5G60390
|
GTP binding Elongation factor Tu family protein |
| arTal_v1_Chr3_+_22492811_22492811 | 0.60 |
AT3G60870.1
|
AHL18
|
AT-hook motif nuclear-localized protein 18 |
| arTal_v1_Chr1_-_224351_224351 | 0.60 |
AT1G01610.1
|
GPAT4
|
glycerol-3-phosphate acyltransferase 4 |
| arTal_v1_Chr4_+_11228187_11228187 | 0.60 |
AT4G21020.1
|
AT4G21020
|
Late embryogenesis abundant protein (LEA) family protein |
| arTal_v1_Chr2_-_8880388_8880440 | 0.60 |
AT2G20610.2
AT2G20610.1 |
SUR1
|
Tyrosine transaminase family protein |
| arTal_v1_Chr4_+_15383633_15383633 | 0.60 |
AT4G31800.2
|
WRKY18
|
WRKY DNA-binding protein 18 |
| arTal_v1_Chr5_+_22460550_22460550 | 0.60 |
AT5G55410.2
AT5G55410.1 |
AT5G55410
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
| arTal_v1_Chr1_+_22139170_22139170 | 0.60 |
AT1G60060.1
|
AT1G60060
|
Serine/threonine-protein kinase WNK (With No Lysine)-like protein |
| arTal_v1_Chr2_+_8431363_8431444 | 0.60 |
AT2G19460.2
AT2G19460.1 |
AT2G19460
|
DUF3511 domain protein (DUF3511) |
| arTal_v1_Chr5_+_15997970_15998013 | 0.59 |
AT5G39970.2
AT5G39970.1 AT5G39970.3 |
AT5G39970
|
catalytics |
| arTal_v1_Chr1_-_7804038_7804061 | 0.59 |
AT1G22110.2
AT1G22110.1 |
AT1G22110
|
structural constituent of ribosome |
| arTal_v1_Chr3_+_8768846_8768846 | 0.59 |
AT3G24225.1
|
CLE19
|
CLAVATA3/ESR-RELATED 19 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.4 | GO:0019567 | pentose biosynthetic process(GO:0019322) arabinose biosynthetic process(GO:0019567) |
| 0.3 | 1.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) S-adenosylhomocysteine metabolic process(GO:0046498) |
| 0.3 | 1.3 | GO:0009831 | plant-type cell wall modification involved in multidimensional cell growth(GO:0009831) |
| 0.3 | 1.3 | GO:0006063 | uronic acid metabolic process(GO:0006063) galacturonate metabolic process(GO:0019586) |
| 0.3 | 1.1 | GO:0010500 | transmitting tissue development(GO:0010500) |
| 0.3 | 1.8 | GO:0048830 | adventitious root development(GO:0048830) |
| 0.2 | 0.5 | GO:1902448 | regulation of shade avoidance(GO:1902446) positive regulation of shade avoidance(GO:1902448) |
| 0.2 | 0.7 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
| 0.2 | 2.3 | GO:0050691 | regulation of defense response to virus by host(GO:0050691) |
| 0.2 | 0.7 | GO:2000029 | regulation of proanthocyanidin biosynthetic process(GO:2000029) |
| 0.2 | 0.6 | GO:0009204 | deoxyribonucleoside triphosphate catabolic process(GO:0009204) deoxyribose phosphate catabolic process(GO:0046386) |
| 0.2 | 0.8 | GO:0090603 | sieve element differentiation(GO:0090603) |
| 0.2 | 0.6 | GO:0060967 | negative regulation of gene silencing by RNA(GO:0060967) negative regulation of RNA interference(GO:1900369) |
| 0.2 | 1.8 | GO:0009799 | specification of symmetry(GO:0009799) |
| 0.2 | 0.6 | GO:0044277 | cell wall modification involved in abscission(GO:0009830) cell wall disassembly(GO:0044277) |
| 0.2 | 0.6 | GO:0046203 | spermidine catabolic process(GO:0046203) |
| 0.2 | 0.5 | GO:0033477 | S-methylmethionine metabolic process(GO:0033477) S-methylmethionine cycle(GO:0033528) |
| 0.2 | 1.6 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 0.2 | 6.6 | GO:0042335 | cuticle development(GO:0042335) |
| 0.2 | 0.5 | GO:0015696 | ammonium transport(GO:0015696) |
| 0.2 | 0.7 | GO:1902751 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.2 | 0.9 | GO:0046622 | positive regulation of organ growth(GO:0046622) |
| 0.2 | 0.8 | GO:0006569 | tryptophan catabolic process(GO:0006569) indolalkylamine catabolic process(GO:0046218) |
| 0.2 | 0.6 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.2 | 0.8 | GO:0010226 | response to lithium ion(GO:0010226) |
| 0.1 | 0.7 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.1 | 0.7 | GO:0042218 | 1-aminocyclopropane-1-carboxylate biosynthetic process(GO:0042218) |
| 0.1 | 0.4 | GO:0010254 | nectary development(GO:0010254) |
| 0.1 | 0.8 | GO:1900458 | negative regulation of brassinosteroid mediated signaling pathway(GO:1900458) |
| 0.1 | 1.4 | GO:0010358 | leaf shaping(GO:0010358) |
| 0.1 | 1.2 | GO:0046247 | carotene catabolic process(GO:0016121) terpene catabolic process(GO:0046247) |
| 0.1 | 0.3 | GO:0010432 | bract development(GO:0010432) |
| 0.1 | 0.8 | GO:1990019 | protein storage vacuole organization(GO:1990019) |
| 0.1 | 0.6 | GO:0019742 | pentacyclic triterpenoid metabolic process(GO:0019742) pentacyclic triterpenoid biosynthetic process(GO:0019745) |
| 0.1 | 0.5 | GO:0048464 | sepal development(GO:0048442) flower calyx development(GO:0048464) |
| 0.1 | 0.4 | GO:0010116 | positive regulation of abscisic acid biosynthetic process(GO:0010116) |
| 0.1 | 0.6 | GO:0010376 | stomatal complex formation(GO:0010376) |
| 0.1 | 0.4 | GO:0019406 | hexitol metabolic process(GO:0006059) hexitol biosynthetic process(GO:0019406) mannitol biosynthetic process(GO:0019593) mannitol metabolic process(GO:0019594) |
| 0.1 | 0.4 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 3.4 | GO:0010143 | cutin biosynthetic process(GO:0010143) |
| 0.1 | 0.5 | GO:0010480 | microsporocyte differentiation(GO:0010480) |
| 0.1 | 1.2 | GO:0009961 | response to 1-aminocyclopropane-1-carboxylic acid(GO:0009961) |
| 0.1 | 0.5 | GO:0031023 | microtubule organizing center organization(GO:0031023) |
| 0.1 | 0.4 | GO:0042539 | hypotonic salinity response(GO:0042539) |
| 0.1 | 0.4 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.1 | 1.2 | GO:0010199 | organ boundary specification between lateral organs and the meristem(GO:0010199) |
| 0.1 | 0.7 | GO:0009769 | photosynthesis, light harvesting in photosystem II(GO:0009769) positive regulation of reactive oxygen species biosynthetic process(GO:1903428) |
| 0.1 | 0.3 | GO:1900386 | positive regulation of flavonol biosynthetic process(GO:1900386) |
| 0.1 | 0.7 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.1 | 0.5 | GO:0048656 | anther wall tapetum formation(GO:0048656) anther wall tapetum cell differentiation(GO:0048657) |
| 0.1 | 0.4 | GO:0070509 | calcium ion import(GO:0070509) |
| 0.1 | 1.4 | GO:0010413 | glucuronoxylan metabolic process(GO:0010413) glucuronoxylan biosynthetic process(GO:0010417) |
| 0.1 | 0.4 | GO:0098609 | pollen tube adhesion(GO:0009865) cell-cell adhesion(GO:0098609) multi organism cell adhesion(GO:0098740) |
| 0.1 | 0.3 | GO:0070150 | mitochondrial glycyl-tRNA aminoacylation(GO:0070150) |
| 0.1 | 0.9 | GO:0006168 | adenine salvage(GO:0006168) purine nucleobase salvage(GO:0043096) |
| 0.1 | 0.6 | GO:0042447 | cytokinin catabolic process(GO:0009823) hormone catabolic process(GO:0042447) |
| 0.1 | 1.2 | GO:0080086 | stamen filament development(GO:0080086) |
| 0.1 | 0.2 | GO:0042547 | cell wall modification involved in multidimensional cell growth(GO:0042547) |
| 0.1 | 0.2 | GO:1900151 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) |
| 0.1 | 0.4 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.1 | 0.9 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.1 | 0.3 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.1 | 1.1 | GO:0071585 | detoxification of cadmium ion(GO:0071585) |
| 0.1 | 0.5 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.1 | 0.3 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.1 | 0.3 | GO:0015853 | adenine transport(GO:0015853) guanine transport(GO:0015854) |
| 0.1 | 4.2 | GO:0045489 | pectin biosynthetic process(GO:0045489) |
| 0.1 | 1.1 | GO:0046620 | regulation of organ growth(GO:0046620) |
| 0.1 | 0.4 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 | 0.3 | GO:0042766 | nucleosome mobilization(GO:0042766) |
| 0.1 | 0.6 | GO:0010929 | positive regulation of auxin mediated signaling pathway(GO:0010929) |
| 0.1 | 1.0 | GO:0009864 | induced systemic resistance, jasmonic acid mediated signaling pathway(GO:0009864) |
| 0.1 | 0.6 | GO:0080187 | floral organ senescence(GO:0080187) |
| 0.1 | 0.4 | GO:0080170 | hydrogen peroxide transmembrane transport(GO:0080170) |
| 0.1 | 0.3 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 0.4 | GO:0080094 | response to trehalose-6-phosphate(GO:0080094) |
| 0.1 | 1.4 | GO:0006857 | oligopeptide transport(GO:0006857) peptide transport(GO:0015833) |
| 0.1 | 0.7 | GO:0080165 | callose deposition in phloem sieve plate(GO:0080165) |
| 0.1 | 0.7 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.1 | 0.7 | GO:0010047 | fruit dehiscence(GO:0010047) |
| 0.1 | 0.3 | GO:0010266 | response to vitamin B1(GO:0010266) |
| 0.1 | 0.8 | GO:0071249 | cellular response to nitrate(GO:0071249) |
| 0.1 | 0.3 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.1 | 0.3 | GO:0043693 | monoterpene biosynthetic process(GO:0043693) |
| 0.1 | 0.3 | GO:0046373 | L-arabinose metabolic process(GO:0046373) |
| 0.1 | 0.3 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.1 | 1.1 | GO:2000122 | negative regulation of stomatal complex development(GO:2000122) |
| 0.1 | 5.2 | GO:0007267 | cell-cell signaling(GO:0007267) |
| 0.1 | 1.1 | GO:1901141 | regulation of lignin biosynthetic process(GO:1901141) |
| 0.1 | 0.5 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) positive regulation of DNA repair(GO:0045739) |
| 0.1 | 1.7 | GO:0080155 | regulation of fertilization(GO:0080154) regulation of double fertilization forming a zygote and endosperm(GO:0080155) |
| 0.1 | 0.5 | GO:0009650 | UV protection(GO:0009650) |
| 0.1 | 0.3 | GO:0010185 | regulation of cellular defense response(GO:0010185) |
| 0.1 | 0.2 | GO:0035436 | triose phosphate transport(GO:0015717) triose phosphate transmembrane transport(GO:0035436) |
| 0.1 | 0.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.6 | GO:0010222 | stem vascular tissue pattern formation(GO:0010222) |
| 0.1 | 1.3 | GO:0051762 | sesquiterpene biosynthetic process(GO:0051762) |
| 0.1 | 1.6 | GO:0042044 | water transport(GO:0006833) fluid transport(GO:0042044) |
| 0.1 | 0.3 | GO:0030856 | regulation of epithelial cell differentiation(GO:0030856) regulation of epidermal cell differentiation(GO:0045604) regulation of epidermis development(GO:0045682) |
| 0.1 | 0.7 | GO:0010262 | somatic embryogenesis(GO:0010262) |
| 0.1 | 0.4 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.1 | 0.1 | GO:0051101 | regulation of DNA binding(GO:0051101) |
| 0.1 | 0.2 | GO:0010541 | acropetal auxin transport(GO:0010541) |
| 0.1 | 0.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.1 | 0.3 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 | 0.4 | GO:0006531 | aspartate metabolic process(GO:0006531) |
| 0.1 | 0.4 | GO:0080001 | mucilage extrusion from seed coat(GO:0080001) |
| 0.1 | 0.3 | GO:0002164 | nematode larval development(GO:0002119) larval development(GO:0002164) regulation of nematode larval development(GO:0061062) |
| 0.1 | 0.2 | GO:0001736 | establishment of planar polarity(GO:0001736) morphogenesis of a polarized epithelium(GO:0001738) morphogenesis of an epithelium(GO:0002009) tissue morphogenesis(GO:0048729) |
| 0.1 | 0.6 | GO:0006821 | chloride transport(GO:0006821) |
| 0.1 | 0.3 | GO:0010495 | long-distance posttranscriptional gene silencing(GO:0010495) |
| 0.1 | 0.7 | GO:0048575 | short-day photoperiodism(GO:0048572) short-day photoperiodism, flowering(GO:0048575) |
| 0.1 | 0.3 | GO:0010337 | regulation of salicylic acid metabolic process(GO:0010337) |
| 0.1 | 0.3 | GO:1900034 | regulation of cellular response to heat(GO:1900034) |
| 0.1 | 0.8 | GO:0015749 | monosaccharide transport(GO:0015749) |
| 0.1 | 1.0 | GO:0046348 | aminoglycan catabolic process(GO:0006026) chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) amino sugar catabolic process(GO:0046348) glucosamine-containing compound catabolic process(GO:1901072) |
| 0.1 | 0.2 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.1 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.1 | 0.5 | GO:1902290 | positive regulation of defense response to oomycetes(GO:1902290) |
| 0.1 | 0.3 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
| 0.1 | 0.6 | GO:0033517 | myo-inositol hexakisphosphate biosynthetic process(GO:0010264) myo-inositol hexakisphosphate metabolic process(GO:0033517) |
| 0.1 | 0.2 | GO:0050688 | regulation of immune effector process(GO:0002697) regulation of defense response to virus(GO:0050688) |
| 0.1 | 0.4 | GO:2000014 | regulation of endosperm development(GO:2000014) |
| 0.1 | 2.0 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
| 0.1 | 0.5 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.1 | 0.4 | GO:0033206 | meiotic cytokinesis(GO:0033206) |
| 0.1 | 0.6 | GO:1902533 | positive regulation of intracellular signal transduction(GO:1902533) |
| 0.1 | 0.1 | GO:2000039 | regulation of trichome morphogenesis(GO:2000039) |
| 0.1 | 0.2 | GO:1900459 | positive regulation of brassinosteroid mediated signaling pathway(GO:1900459) |
| 0.1 | 0.3 | GO:0009647 | skotomorphogenesis(GO:0009647) |
| 0.0 | 0.5 | GO:0046337 | phosphatidylethanolamine biosynthetic process(GO:0006646) phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 1.4 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.0 | 0.7 | GO:0048766 | root hair initiation(GO:0048766) |
| 0.0 | 0.2 | GO:0046786 | viral replication complex formation and maintenance(GO:0046786) |
| 0.0 | 0.3 | GO:0045492 | xylan biosynthetic process(GO:0045492) |
| 0.0 | 2.0 | GO:0009690 | cytokinin metabolic process(GO:0009690) |
| 0.0 | 0.4 | GO:0048359 | mucilage metabolic process involved in seed coat development(GO:0048359) |
| 0.0 | 0.2 | GO:1902457 | negative regulation of stomatal opening(GO:1902457) |
| 0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.3 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.0 | 0.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.7 | GO:0048826 | cotyledon morphogenesis(GO:0048826) |
| 0.0 | 0.1 | GO:0080168 | abscisic acid transport(GO:0080168) |
| 0.0 | 0.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.3 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.0 | 0.2 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
| 0.0 | 0.1 | GO:0010198 | synergid death(GO:0010198) pollen tube reception(GO:0010483) intraspecies interaction between organisms(GO:0051703) |
| 0.0 | 0.4 | GO:0009094 | L-phenylalanine biosynthetic process(GO:0009094) erythrose 4-phosphate/phosphoenolpyruvate family amino acid biosynthetic process(GO:1902223) |
| 0.0 | 0.3 | GO:0010581 | regulation of starch biosynthetic process(GO:0010581) |
| 0.0 | 0.5 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
| 0.0 | 0.2 | GO:0034724 | DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 | 0.7 | GO:0052541 | plant-type cell wall cellulose metabolic process(GO:0052541) |
| 0.0 | 0.6 | GO:0005987 | sucrose catabolic process(GO:0005987) |
| 0.0 | 0.3 | GO:0043090 | amino acid import(GO:0043090) |
| 0.0 | 0.7 | GO:0010227 | floral organ abscission(GO:0010227) |
| 0.0 | 0.7 | GO:0009697 | salicylic acid biosynthetic process(GO:0009697) |
| 0.0 | 2.8 | GO:0048545 | response to steroid hormone(GO:0048545) |
| 0.0 | 0.3 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.0 | 1.6 | GO:0009828 | plant-type cell wall loosening(GO:0009828) |
| 0.0 | 1.0 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 3.1 | GO:0009834 | plant-type secondary cell wall biogenesis(GO:0009834) |
| 0.0 | 0.2 | GO:0048838 | release of seed from dormancy(GO:0048838) exit from dormancy(GO:0097438) |
| 0.0 | 0.1 | GO:0080051 | cutin transport(GO:0080051) |
| 0.0 | 0.4 | GO:0046246 | terpene biosynthetic process(GO:0046246) |
| 0.0 | 0.4 | GO:0009554 | megasporogenesis(GO:0009554) |
| 0.0 | 0.2 | GO:0046051 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
| 0.0 | 0.2 | GO:2000762 | regulation of phenylpropanoid metabolic process(GO:2000762) |
| 0.0 | 0.4 | GO:0009423 | chorismate biosynthetic process(GO:0009423) |
| 0.0 | 0.4 | GO:0000304 | response to singlet oxygen(GO:0000304) |
| 0.0 | 0.5 | GO:0010048 | vernalization response(GO:0010048) |
| 0.0 | 0.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.1 | GO:0009759 | indole glucosinolate biosynthetic process(GO:0009759) |
| 0.0 | 0.3 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 | 0.4 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.0 | 0.6 | GO:0080163 | regulation of protein serine/threonine phosphatase activity(GO:0080163) |
| 0.0 | 0.1 | GO:0055047 | generative cell mitosis(GO:0055047) |
| 0.0 | 1.5 | GO:0051084 | 'de novo' posttranslational protein folding(GO:0051084) chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 | 0.4 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.2 | GO:0052546 | cell wall pectin metabolic process(GO:0052546) |
| 0.0 | 1.2 | GO:0048825 | cotyledon development(GO:0048825) |
| 0.0 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.7 | GO:0006826 | iron ion transport(GO:0006826) |
| 0.0 | 0.1 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
| 0.0 | 0.6 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 0.1 | GO:0010372 | positive regulation of gibberellin biosynthetic process(GO:0010372) |
| 0.0 | 0.5 | GO:0010187 | negative regulation of seed germination(GO:0010187) |
| 0.0 | 0.1 | GO:0009945 | radial axis specification(GO:0009945) |
| 0.0 | 0.5 | GO:0006074 | (1->3)-beta-D-glucan metabolic process(GO:0006074) (1->3)-beta-D-glucan biosynthetic process(GO:0006075) |
| 0.0 | 0.0 | GO:1900378 | positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 0.0 | 1.6 | GO:0010411 | xyloglucan metabolic process(GO:0010411) |
| 0.0 | 0.2 | GO:0009827 | plant-type cell wall modification(GO:0009827) |
| 0.0 | 0.4 | GO:0009641 | shade avoidance(GO:0009641) |
| 0.0 | 0.1 | GO:0050993 | dimethylallyl diphosphate biosynthetic process(GO:0050992) dimethylallyl diphosphate metabolic process(GO:0050993) |
| 0.0 | 0.5 | GO:0033356 | UDP-L-arabinose metabolic process(GO:0033356) |
| 0.0 | 0.8 | GO:0019915 | lipid storage(GO:0019915) |
| 0.0 | 0.3 | GO:0008216 | spermidine metabolic process(GO:0008216) |
| 0.0 | 0.1 | GO:0045905 | positive regulation of translational elongation(GO:0045901) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.1 | GO:0006272 | leading strand elongation(GO:0006272) nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.0 | 0.2 | GO:0071733 | establishment of mitotic sister chromatid cohesion(GO:0034087) establishment of protein localization to chromosome(GO:0070199) rDNA condensation(GO:0070550) establishment of protein localization to chromatin(GO:0071169) transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.0 | 1.3 | GO:0008643 | carbohydrate transport(GO:0008643) |
| 0.0 | 0.7 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.1 | GO:0080190 | lateral growth(GO:0080190) |
| 0.0 | 0.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.1 | GO:0035308 | negative regulation of dephosphorylation(GO:0035305) negative regulation of protein dephosphorylation(GO:0035308) |
| 0.0 | 0.2 | GO:2000070 | regulation of response to water deprivation(GO:2000070) |
| 0.0 | 0.1 | GO:0015939 | pantothenate metabolic process(GO:0015939) pantothenate biosynthetic process(GO:0015940) |
| 0.0 | 0.1 | GO:0071049 | nuclear mRNA surveillance of mRNA 3'-end processing(GO:0071031) CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) nuclear retention of pre-mRNA with aberrant 3'-ends at the site of transcription(GO:0071049) |
| 0.0 | 0.1 | GO:0010371 | regulation of gibberellin biosynthetic process(GO:0010371) |
| 0.0 | 0.4 | GO:0015996 | chlorophyll catabolic process(GO:0015996) pigment catabolic process(GO:0046149) |
| 0.0 | 0.4 | GO:0015918 | sterol transport(GO:0015918) |
| 0.0 | 0.4 | GO:0019511 | protein hydroxylation(GO:0018126) peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) 4-hydroxyproline metabolic process(GO:0019471) peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.3 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.0 | 0.1 | GO:0030104 | water homeostasis(GO:0030104) |
| 0.0 | 0.4 | GO:0015743 | malate transport(GO:0015743) |
| 0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.2 | GO:0015689 | molybdate ion transport(GO:0015689) |
| 0.0 | 1.4 | GO:0009627 | systemic acquired resistance(GO:0009627) |
| 0.0 | 0.1 | GO:0032365 | intracellular lipid transport(GO:0032365) |
| 0.0 | 0.1 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) protein localization to microtubule cytoskeleton(GO:0072698) |
| 0.0 | 0.1 | GO:0051320 | mitotic G1 phase(GO:0000080) mitotic S phase(GO:0000084) mitotic G2 phase(GO:0000085) G1 phase(GO:0051318) G2 phase(GO:0051319) S phase(GO:0051320) interphase(GO:0051325) mitotic interphase(GO:0051329) |
| 0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.1 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.0 | 1.3 | GO:0048767 | root hair elongation(GO:0048767) |
| 0.0 | 0.7 | GO:1901800 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) positive regulation of proteasomal protein catabolic process(GO:1901800) |
| 0.0 | 0.1 | GO:0010236 | photosynthetic electron transport in photosystem II(GO:0009772) plastoquinone biosynthetic process(GO:0010236) |
| 0.0 | 0.1 | GO:0006666 | 3-keto-sphinganine metabolic process(GO:0006666) |
| 0.0 | 0.2 | GO:0009901 | anther dehiscence(GO:0009901) |
| 0.0 | 0.3 | GO:0009098 | leucine biosynthetic process(GO:0009098) |
| 0.0 | 0.1 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
| 0.0 | 0.3 | GO:2000377 | regulation of reactive oxygen species metabolic process(GO:2000377) |
| 0.0 | 0.1 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
| 0.0 | 0.3 | GO:0009765 | photosynthesis, light harvesting(GO:0009765) |
| 0.0 | 0.2 | GO:0009556 | microsporogenesis(GO:0009556) |
| 0.0 | 0.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.3 | GO:0006814 | sodium ion transport(GO:0006814) |
| 0.0 | 0.4 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.5 | GO:0009664 | plant-type cell wall organization(GO:0009664) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.2 | GO:0010205 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) |
| 0.0 | 0.7 | GO:0006874 | cellular calcium ion homeostasis(GO:0006874) |
| 0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.1 | GO:0048658 | anther wall tapetum development(GO:0048658) |
| 0.0 | 0.4 | GO:0019722 | calcium-mediated signaling(GO:0019722) |
| 0.0 | 0.3 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.6 | GO:0009911 | positive regulation of flower development(GO:0009911) |
| 0.0 | 1.1 | GO:0010876 | lipid localization(GO:0010876) |
| 0.0 | 0.2 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.0 | 0.2 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.0 | 1.0 | GO:0042545 | cell wall modification(GO:0042545) |
| 0.0 | 0.2 | GO:0010274 | hydrotropism(GO:0010274) |
| 0.0 | 0.2 | GO:0010037 | response to carbon dioxide(GO:0010037) |
| 0.0 | 0.3 | GO:0010091 | trichome branching(GO:0010091) |
| 0.0 | 0.1 | GO:0019408 | dolichol biosynthetic process(GO:0019408) |
| 0.0 | 0.1 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.0 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.5 | GO:0009853 | photorespiration(GO:0009853) |
| 0.0 | 0.4 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
| 0.0 | 0.3 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.0 | 0.1 | GO:0015780 | nucleotide-sugar transport(GO:0015780) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 2.0 | GO:0070505 | pollen coat(GO:0070505) |
| 0.3 | 0.9 | GO:0009925 | basal plasma membrane(GO:0009925) basolateral plasma membrane(GO:0016323) basal part of cell(GO:0045178) |
| 0.2 | 1.2 | GO:0071818 | BAT3 complex(GO:0071818) |
| 0.2 | 0.9 | GO:0090397 | stigma papilla(GO:0090397) |
| 0.1 | 0.5 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 0.4 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 0.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 0.3 | GO:0097196 | Shu complex(GO:0097196) |
| 0.1 | 0.4 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.1 | 0.7 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 12.4 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.1 | 0.7 | GO:0030076 | thylakoid light-harvesting complex(GO:0009503) PSII associated light-harvesting complex II(GO:0009517) light-harvesting complex(GO:0030076) |
| 0.1 | 0.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.1 | 9.3 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.1 | 0.2 | GO:0035101 | FACT complex(GO:0035101) |
| 0.1 | 0.3 | GO:0009317 | acetyl-CoA carboxylase complex(GO:0009317) |
| 0.1 | 0.6 | GO:0035618 | root hair(GO:0035618) |
| 0.1 | 0.2 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.1 | 0.5 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 4.7 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 0.2 | GO:0042709 | succinate-CoA ligase complex(GO:0042709) |
| 0.0 | 0.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.0 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.5 | GO:0098827 | endoplasmic reticulum tubular network(GO:0071782) endoplasmic reticulum subcompartment(GO:0098827) |
| 0.0 | 0.2 | GO:0034515 | proteasome storage granule(GO:0034515) |
| 0.0 | 0.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.7 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.3 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.7 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.0 | 0.5 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.5 | GO:0000148 | 1,3-beta-D-glucan synthase complex(GO:0000148) |
| 0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.2 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.0 | 0.3 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 1.9 | GO:0042995 | cell projection(GO:0042995) |
| 0.0 | 0.1 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.3 | GO:0000418 | DNA-directed RNA polymerase IV complex(GO:0000418) |
| 0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.0 | 0.2 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.0 | 1.1 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.3 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 55.9 | GO:0005576 | extracellular region(GO:0005576) |
| 0.0 | 0.1 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.1 | GO:0030126 | COPI vesicle coat(GO:0030126) COPI-coated vesicle membrane(GO:0030663) |
| 0.0 | 0.6 | GO:0031228 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
| 0.0 | 1.3 | GO:0009505 | plant-type cell wall(GO:0009505) |
| 0.0 | 0.5 | GO:1903293 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.0 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.1 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.0 | 1.5 | GO:0009705 | plant-type vacuole membrane(GO:0009705) |
| 0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 0.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 2.3 | GO:0070330 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) aromatase activity(GO:0070330) |
| 0.4 | 1.3 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.3 | 2.5 | GO:0090447 | glycerol-3-phosphate 2-O-acyltransferase activity(GO:0090447) |
| 0.3 | 2.6 | GO:0009922 | fatty acid elongase activity(GO:0009922) |
| 0.3 | 1.7 | GO:0050378 | UDP-glucuronate 4-epimerase activity(GO:0050378) |
| 0.3 | 0.5 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.2 | 1.0 | GO:0003852 | 2-isopropylmalate synthase activity(GO:0003852) |
| 0.2 | 1.1 | GO:0004473 | malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.2 | 4.2 | GO:0005372 | water transmembrane transporter activity(GO:0005372) water channel activity(GO:0015250) |
| 0.2 | 0.8 | GO:0036218 | dTTP diphosphatase activity(GO:0036218) |
| 0.2 | 0.6 | GO:0052901 | spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.2 | 0.7 | GO:0016856 | racemase and epimerase activity, acting on hydroxy acids and derivatives(GO:0016856) |
| 0.2 | 0.5 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) betaine-homocysteine S-methyltransferase activity(GO:0047150) |
| 0.2 | 1.3 | GO:0047274 | galactinol-sucrose galactosyltransferase activity(GO:0047274) |
| 0.2 | 0.7 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.2 | 0.7 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.2 | 0.5 | GO:0008936 | nicotinamidase activity(GO:0008936) |
| 0.2 | 1.2 | GO:0045549 | 9-cis-epoxycarotenoid dioxygenase activity(GO:0045549) |
| 0.2 | 0.8 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.2 | 4.7 | GO:0047262 | polygalacturonate 4-alpha-galacturonosyltransferase activity(GO:0047262) |
| 0.2 | 0.9 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.2 | 0.8 | GO:0008430 | selenium binding(GO:0008430) |
| 0.2 | 0.5 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) |
| 0.1 | 0.4 | GO:0003849 | 3-deoxy-7-phosphoheptulonate synthase activity(GO:0003849) |
| 0.1 | 1.7 | GO:0016847 | 1-aminocyclopropane-1-carboxylate synthase activity(GO:0016847) |
| 0.1 | 0.4 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) glucose-6-phosphate transmembrane transporter activity(GO:0015152) |
| 0.1 | 1.6 | GO:0103075 | indole-3-pyruvate monooxygenase activity(GO:0103075) |
| 0.1 | 1.2 | GO:0009979 | 16:0 monogalactosyldiacylglycerol desaturase activity(GO:0009979) |
| 0.1 | 2.5 | GO:0005199 | structural constituent of cell wall(GO:0005199) |
| 0.1 | 0.4 | GO:0003962 | cystathionine gamma-synthase activity(GO:0003962) |
| 0.1 | 3.8 | GO:0005179 | hormone activity(GO:0005179) |
| 0.1 | 0.6 | GO:0005354 | galactose transmembrane transporter activity(GO:0005354) |
| 0.1 | 0.6 | GO:0050734 | hydroxycinnamoyltransferase activity(GO:0050734) |
| 0.1 | 0.5 | GO:0004475 | mannose-1-phosphate guanylyltransferase activity(GO:0004475) |
| 0.1 | 0.9 | GO:0003999 | adenine phosphoribosyltransferase activity(GO:0003999) |
| 0.1 | 0.7 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.1 | 0.7 | GO:0052691 | UDP-arabinopyranose mutase activity(GO:0052691) |
| 0.1 | 0.7 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.1 | 0.5 | GO:0004049 | anthranilate synthase activity(GO:0004049) |
| 0.1 | 0.5 | GO:0004325 | ferrochelatase activity(GO:0004325) |
| 0.1 | 0.3 | GO:0015081 | sodium ion transmembrane transporter activity(GO:0015081) |
| 0.1 | 3.6 | GO:0016762 | xyloglucan:xyloglucosyl transferase activity(GO:0016762) |
| 0.1 | 0.4 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.1 | 0.5 | GO:0042085 | 5-methyltetrahydropteroyltriglutamate-homocysteine S-methyltransferase activity(GO:0003871) methionine synthase activity(GO:0008705) 5-methyltetrahydrofolate-dependent methyltransferase activity(GO:0042084) 5-methyltetrahydropteroyltri-L-glutamate-dependent methyltransferase activity(GO:0042085) |
| 0.1 | 0.5 | GO:0045544 | gibberellin 20-oxidase activity(GO:0045544) |
| 0.1 | 0.9 | GO:0004020 | adenylylsulfate kinase activity(GO:0004020) |
| 0.1 | 1.1 | GO:0050373 | UDP-arabinose 4-epimerase activity(GO:0050373) |
| 0.1 | 0.3 | GO:0009374 | biotin binding(GO:0009374) |
| 0.1 | 0.6 | GO:0019139 | cytokinin dehydrogenase activity(GO:0019139) |
| 0.1 | 0.7 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.1 | 0.6 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
| 0.1 | 0.3 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) |
| 0.1 | 1.0 | GO:0047259 | glucomannan 4-beta-mannosyltransferase activity(GO:0047259) |
| 0.1 | 0.6 | GO:0008022 | protein C-terminus binding(GO:0008022) |
| 0.1 | 1.6 | GO:0016844 | strictosidine synthase activity(GO:0016844) |
| 0.1 | 0.6 | GO:0042299 | lupeol synthase activity(GO:0042299) |
| 0.1 | 0.3 | GO:0004820 | glycine-tRNA ligase activity(GO:0004820) |
| 0.1 | 2.3 | GO:0010333 | terpene synthase activity(GO:0010333) |
| 0.1 | 0.2 | GO:0001216 | bacterial-type RNA polymerase transcription factor activity, sequence-specific DNA binding(GO:0001130) bacterial-type RNA polymerase transcriptional activator activity, sequence-specific DNA binding(GO:0001216) |
| 0.1 | 0.5 | GO:0001872 | (1->3)-beta-D-glucan binding(GO:0001872) |
| 0.1 | 0.5 | GO:0050105 | L-gulonolactone oxidase activity(GO:0050105) |
| 0.1 | 0.8 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
| 0.1 | 0.5 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.1 | 0.4 | GO:0016531 | copper chaperone activity(GO:0016531) |
| 0.1 | 0.3 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.1 | 0.4 | GO:0004001 | adenosine kinase activity(GO:0004001) |
| 0.1 | 0.3 | GO:0080116 | glucuronoxylan glucuronosyltransferase activity(GO:0080116) |
| 0.1 | 1.2 | GO:0016157 | sucrose synthase activity(GO:0016157) |
| 0.1 | 4.5 | GO:0004650 | polygalacturonase activity(GO:0004650) |
| 0.1 | 0.5 | GO:0060229 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
| 0.1 | 0.7 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.3 | GO:0047215 | indole-3-acetate beta-glucosyltransferase activity(GO:0047215) |
| 0.1 | 0.3 | GO:0016707 | gibberellin 3-beta-dioxygenase activity(GO:0016707) |
| 0.1 | 0.4 | GO:0043855 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
| 0.1 | 0.6 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
| 0.1 | 0.2 | GO:0046027 | phospholipid:diacylglycerol acyltransferase activity(GO:0046027) |
| 0.1 | 0.4 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
| 0.1 | 0.8 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 0.4 | GO:0004664 | prephenate dehydratase activity(GO:0004664) arogenate dehydratase activity(GO:0047769) |
| 0.1 | 0.3 | GO:0033843 | xyloglucan 6-xylosyltransferase activity(GO:0033843) |
| 0.1 | 0.3 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
| 0.1 | 0.2 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.1 | 0.6 | GO:0047938 | glucose-6-phosphate 1-epimerase activity(GO:0047938) |
| 0.1 | 0.8 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.1 | 0.2 | GO:0052659 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) inositol-1,3,4,5-tetrakisphosphate 5-phosphatase activity(GO:0052659) inositol tetrakisphosphate phosphatase activity(GO:0052743) |
| 0.1 | 0.6 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 0.2 | GO:0080161 | auxin transmembrane transporter activity(GO:0080161) |
| 0.1 | 0.2 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) succinate-CoA ligase (ADP-forming) activity(GO:0004775) succinate-CoA ligase (GDP-forming) activity(GO:0004776) |
| 0.1 | 1.0 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.1 | 0.4 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.1 | 0.3 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.1 | 0.3 | GO:0098599 | palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.1 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.4 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.3 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.6 | GO:0016872 | intramolecular lyase activity(GO:0016872) |
| 0.0 | 1.3 | GO:0008810 | cellulase activity(GO:0008810) |
| 0.0 | 0.7 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
| 0.0 | 0.5 | GO:0016161 | beta-amylase activity(GO:0016161) |
| 0.0 | 0.8 | GO:0102337 | 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.5 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.2 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.0 | 0.2 | GO:0016985 | mannan endo-1,4-beta-mannosidase activity(GO:0016985) |
| 0.0 | 0.4 | GO:0052623 | ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
| 0.0 | 2.7 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.0 | 1.7 | GO:0051119 | sugar transmembrane transporter activity(GO:0051119) |
| 0.0 | 0.6 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 0.0 | 0.9 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 1.0 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.1 | GO:0004452 | isopentenyl-diphosphate delta-isomerase activity(GO:0004452) |
| 0.0 | 0.2 | GO:0042389 | omega-3 fatty acid desaturase activity(GO:0042389) |
| 0.0 | 1.0 | GO:0016168 | chlorophyll binding(GO:0016168) |
| 0.0 | 0.3 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 1.3 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.1 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.0 | 0.2 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 1.4 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.4 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.0 | 0.4 | GO:0000254 | C-4 methylsterol oxidase activity(GO:0000254) |
| 0.0 | 1.6 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.5 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.0 | 0.1 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.0 | 0.3 | GO:0015112 | nitrate transmembrane transporter activity(GO:0015112) |
| 0.0 | 0.6 | GO:0047196 | long-chain-alcohol O-fatty-acyltransferase activity(GO:0047196) |
| 0.0 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 1.4 | GO:0045735 | nutrient reservoir activity(GO:0045735) |
| 0.0 | 0.6 | GO:0008106 | alcohol dehydrogenase (NADP+) activity(GO:0008106) |
| 0.0 | 1.1 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 0.3 | GO:1904680 | oligopeptide transmembrane transporter activity(GO:0035673) peptide transmembrane transporter activity(GO:1904680) |
| 0.0 | 0.2 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
| 0.0 | 0.3 | GO:0010340 | carboxyl-O-methyltransferase activity(GO:0010340) |
| 0.0 | 0.9 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.1 | GO:0004484 | mRNA guanylyltransferase activity(GO:0004484) polynucleotide 5'-phosphatase activity(GO:0004651) RNA guanylyltransferase activity(GO:0008192) |
| 0.0 | 0.1 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.2 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.4 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.4 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.1 | GO:0003978 | UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.0 | 0.4 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.0 | 0.1 | GO:0015665 | myo-inositol transmembrane transporter activity(GO:0005365) myo-inositol:proton symporter activity(GO:0005366) polyol transmembrane transporter activity(GO:0015166) alcohol transmembrane transporter activity(GO:0015665) organic hydroxy compound transmembrane transporter activity(GO:1901618) |
| 0.0 | 0.5 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.0 | 0.6 | GO:0005253 | anion channel activity(GO:0005253) |
| 0.0 | 0.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.4 | GO:0015086 | cadmium ion transmembrane transporter activity(GO:0015086) |
| 0.0 | 0.2 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.0 | 0.2 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 1.2 | GO:0033612 | receptor serine/threonine kinase binding(GO:0033612) |
| 0.0 | 1.1 | GO:0000156 | phosphorelay response regulator activity(GO:0000156) |
| 0.0 | 0.4 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
| 0.0 | 0.5 | GO:0003843 | 1,3-beta-D-glucan synthase activity(GO:0003843) |
| 0.0 | 1.9 | GO:0030599 | pectinesterase activity(GO:0030599) |
| 0.0 | 0.2 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.3 | GO:0033926 | glycopeptide alpha-N-acetylgalactosaminidase activity(GO:0033926) |
| 0.0 | 0.3 | GO:0033293 | monocarboxylic acid binding(GO:0033293) |
| 0.0 | 0.1 | GO:0019534 | tetracycline transporter activity(GO:0008493) toxin transporter activity(GO:0019534) antibiotic transporter activity(GO:0042895) |
| 0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 3.8 | GO:0015297 | antiporter activity(GO:0015297) |
| 0.0 | 0.9 | GO:0016759 | cellulose synthase activity(GO:0016759) |
| 0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) |
| 0.0 | 0.1 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.1 | GO:0008909 | isochorismate synthase activity(GO:0008909) |
| 0.0 | 0.5 | GO:0052716 | hydroquinone:oxygen oxidoreductase activity(GO:0052716) |
| 0.0 | 0.4 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.2 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
| 0.0 | 0.6 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 0.1 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.1 | GO:0047560 | 3-dehydrosphinganine reductase activity(GO:0047560) |
| 0.0 | 0.5 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 1.0 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.0 | 0.1 | GO:0003977 | UDP-N-acetylglucosamine diphosphorylase activity(GO:0003977) |
| 0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.3 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.1 | GO:0016819 | hydrolase activity, acting on acid anhydrides, in sulfonyl-containing anhydrides(GO:0016819) adenylylsulfatase activity(GO:0047627) |
| 0.0 | 0.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 1.8 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.0 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.0 | 0.8 | GO:0031625 | ubiquitin protein ligase binding(GO:0031625) |
| 0.0 | 0.2 | GO:0034979 | NAD-dependent histone deacetylase activity(GO:0017136) histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) NAD-dependent protein deacetylase activity(GO:0034979) |
| 0.0 | 0.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.2 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.4 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.0 | GO:0008661 | 1-deoxy-D-xylulose-5-phosphate synthase activity(GO:0008661) |
| 0.0 | 0.1 | GO:0046592 | polyamine oxidase activity(GO:0046592) |
| 0.0 | 0.4 | GO:0032934 | sterol binding(GO:0032934) |
| 0.0 | 0.9 | GO:0015932 | nucleobase-containing compound transmembrane transporter activity(GO:0015932) |
| 0.0 | 0.2 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.2 | GO:0008146 | sulfotransferase activity(GO:0008146) |
| 0.0 | 0.2 | GO:0016251 | obsolete general RNA polymerase II transcription factor activity(GO:0016251) |
| 0.0 | 0.1 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.0 | 0.1 | GO:0004506 | squalene monooxygenase activity(GO:0004506) |
| 0.0 | 0.2 | GO:0042973 | glucan endo-1,3-beta-D-glucosidase activity(GO:0042973) |
| 0.0 | 0.1 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.0 | 1.1 | GO:0009055 | electron carrier activity(GO:0009055) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.8 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.2 | 0.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 0.6 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.2 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.3 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.0 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.9 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.2 | 0.8 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.1 | 0.3 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.1 | 0.6 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.1 | 0.3 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
| 0.0 | 0.2 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.1 | REACTOME NEUROTRANSMITTER RECEPTOR BINDING AND DOWNSTREAM TRANSMISSION IN THE POSTSYNAPTIC CELL | Genes involved in Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell |
| 0.0 | 0.1 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
| 0.0 | 0.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |