GSE130291:vernalization in Arabidopsis thaliana
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
AT5G02320
|
AT5G02320 | myb domain protein 3r-5 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| MYB3R-5 | arTal_v1_Chr5_-_485664_485664 | -0.08 | 8.0e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| arTal_v1_Chr5_-_19040456_19040456 | 1.44 |
AT5G46900.1
|
AT5G46900
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
| arTal_v1_Chr3_+_4408925_4408925 | 1.43 |
AT3G13520.1
|
AGP12
|
arabinogalactan protein 12 |
| arTal_v1_Chr5_+_22721373_22721373 | 1.41 |
AT5G56120.1
|
AT5G56120
|
RNA polymerase II elongation factor |
| arTal_v1_Chr5_+_8033665_8033738 | 1.35 |
AT5G23830.1
AT5G23830.2 |
AT5G23830
|
MD-2-related lipid recognition domain-containing protein |
| arTal_v1_Chr3_+_9409160_9409160 | 1.34 |
AT3G25780.1
|
AOC3
|
allene oxide cyclase 3 |
| arTal_v1_Chr3_-_565801_565801 | 1.32 |
AT3G02640.1
|
AT3G02640
|
transmembrane protein |
| arTal_v1_Chr5_-_8647817_8647817 | 1.32 |
AT5G25090.1
|
ENODL13
|
early nodulin-like protein 13 |
| arTal_v1_Chr5_-_5310951_5310951 | 1.26 |
AT5G16250.1
|
AT5G16250
|
transmembrane protein |
| arTal_v1_Chr5_+_19434758_19434758 | 1.25 |
AT5G47990.1
|
CYP705A5
|
cytochrome P450, family 705, subfamily A, polypeptide 5 |
| arTal_v1_Chr3_-_10590685_10590685 | 1.25 |
AT3G28340.1
|
GATL10
|
galacturonosyltransferase-like 10 |
| arTal_v1_Chr1_-_20160864_20160864 | 1.22 |
AT1G54010.1
|
AT1G54010
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
| arTal_v1_Chr5_+_25721733_25721733 | 1.17 |
AT5G64310.1
|
AGP1
|
arabinogalactan protein 1 |
| arTal_v1_Chr1_+_6728747_6728747 | 1.17 |
AT1G19440.1
|
KCS4
|
3-ketoacyl-CoA synthase 4 |
| arTal_v1_Chr4_+_18525246_18525246 | 1.16 |
AT4G39950.1
|
CYP79B2
|
cytochrome P450, family 79, subfamily B, polypeptide 2 |
| arTal_v1_Chr4_+_18525042_18525042 | 1.15 |
AT4G39950.2
|
CYP79B2
|
cytochrome P450, family 79, subfamily B, polypeptide 2 |
| arTal_v1_Chr2_+_10662190_10662190 | 1.13 |
AT2G25060.1
|
ENODL14
|
early nodulin-like protein 14 |
| arTal_v1_Chr3_+_9503056_9503056 | 1.13 |
AT3G25980.4
AT3G25980.3 AT3G25980.1 AT3G25980.2 |
MAD2
|
DNA-binding HORMA family protein |
| arTal_v1_Chr4_+_15401640_15401640 | 1.11 |
AT4G31840.1
|
ENODL15
|
early nodulin-like protein 15 |
| arTal_v1_Chr4_-_16043457_16043549 | 1.10 |
AT4G33260.2
AT4G33260.1 |
CDC20.2
|
Transducin family protein / WD-40 repeat family protein |
| arTal_v1_Chr1_-_1527360_1527360 | 1.04 |
AT1G05250.1
|
AT1G05250
|
Peroxidase superfamily protein |
| arTal_v1_Chr1_-_6278150_6278258 | 1.03 |
AT1G18250.2
AT1G18250.1 |
ATLP-1
|
Pathogenesis-related thaumatin superfamily protein |
| arTal_v1_Chr2_-_17992047_17992047 | 1.02 |
AT2G43290.1
|
MSS3
|
Calcium-binding EF-hand family protein |
| arTal_v1_Chr1_-_1307973_1307973 | 1.01 |
AT1G04680.1
|
AT1G04680
|
Pectin lyase-like superfamily protein |
| arTal_v1_Chr3_-_7656053_7656053 | 1.01 |
AT3G21720.1
|
ICL
|
isocitrate lyase |
| arTal_v1_Chr5_+_18537239_18537239 | 0.99 |
AT5G45700.1
|
AT5G45700
|
Haloacid dehalogenase-like hydrolase (HAD) superfamily protein |
| arTal_v1_Chr3_-_790693_790693 | 0.97 |
AT3G03341.1
|
AT3G03341
|
cold-regulated protein |
| arTal_v1_Chr2_+_15445294_15445294 | 0.96 |
AT2G36830.1
|
GAMMA-TIP
|
gamma tonoplast intrinsic protein |
| arTal_v1_Chr3_+_1982659_1982659 | 0.95 |
AT3G06460.1
|
AT3G06460
|
GNS1/SUR4 membrane protein family |
| arTal_v1_Chr4_-_11134075_11134075 | 0.95 |
AT4G20780.1
|
CML42
|
calmodulin like 42 |
| arTal_v1_Chr5_+_3783930_3783930 | 0.95 |
AT5G11740.1
|
AGP15
|
arabinogalactan protein 15 |
| arTal_v1_Chr1_+_1520278_1520278 | 0.94 |
AT1G05240.1
|
AT1G05240
|
Peroxidase superfamily protein |
| arTal_v1_Chr1_+_22628264_22628409 | 0.93 |
AT1G61340.1
AT1G61340.2 |
FBS1
|
F-box family protein |
| arTal_v1_Chr1_+_618061_618061 | 0.93 |
AT1G02810.1
|
AT1G02810
|
Plant invertase/pectin methylesterase inhibitor superfamily |
| arTal_v1_Chr5_+_4335595_4335595 | 0.93 |
AT5G13490.2
|
AAC2
|
ADP/ATP carrier 2 |
| arTal_v1_Chr4_+_8688250_8688289 | 0.93 |
AT4G15233.1
AT4G15233.7 AT4G15233.8 AT4G15233.2 |
ABCG42
|
ABC-2 and Plant PDR ABC-type transporter family protein |
| arTal_v1_Chr1_+_27681358_27681358 | 0.92 |
AT1G73620.1
|
AT1G73620
|
Pathogenesis-related thaumatin superfamily protein |
| arTal_v1_Chr3_+_4710483_4710483 | 0.91 |
AT3G14190.2
AT3G14190.1 |
AT3G14190
|
hypothetical protein |
| arTal_v1_Chr5_+_4335272_4335272 | 0.90 |
AT5G13490.1
|
AAC2
|
ADP/ATP carrier 2 |
| arTal_v1_Chr2_+_7666548_7666548 | 0.90 |
AT2G17630.1
|
AT2G17630
|
Pyridoxal phosphate (PLP)-dependent transferases superfamily protein |
| arTal_v1_Chr2_+_11566288_11566288 | 0.90 |
AT2G27080.1
|
AT2G27080
|
Late embryogenesis abundant (LEA) hydroxyproline-rich glycoprotein family |
| arTal_v1_Chr3_-_11194897_11194993 | 0.90 |
AT3G29250.2
AT3G29250.1 |
SDR4
|
NAD(P)-binding Rossmann-fold superfamily protein |
| arTal_v1_Chr3_-_723784_723784 | 0.89 |
AT3G03130.1
|
AT3G03130
|
lisH domain-like protein |
| arTal_v1_Chr5_-_25843555_25843555 | 0.89 |
AT5G64660.1
|
CMPG2
|
CYS, MET, PRO, and GLY protein 2 |
| arTal_v1_Chr4_+_1415953_1415953 | 0.89 |
AT4G03210.2
|
XTH9
|
xyloglucan endotransglucosylase/hydrolase 9 |
| arTal_v1_Chr2_-_14740146_14740146 | 0.88 |
AT2G34930.1
|
AT2G34930
|
disease resistance family protein / LRR family protein |
| arTal_v1_Chr1_+_29135904_29135904 | 0.87 |
AT1G77530.1
AT1G77530.2 |
AT1G77530
|
O-methyltransferase family protein |
| arTal_v1_Chr3_-_3627273_3627273 | 0.86 |
AT3G11520.2
AT3G11520.1 |
CYCB1%3B3
|
CYCLIN B1;3 |
| arTal_v1_Chr1_-_598657_598657 | 0.86 |
AT1G02730.1
|
CSLD5
|
cellulose synthase-like D5 |
| arTal_v1_Chr4_+_1415617_1415617 | 0.86 |
AT4G03210.1
|
XTH9
|
xyloglucan endotransglucosylase/hydrolase 9 |
| arTal_v1_Chr4_-_12393982_12393982 | 0.86 |
AT4G23810.1
|
WRKY53
|
WRKY family transcription factor |
| arTal_v1_Chr4_-_16046937_16046937 | 0.85 |
AT4G33270.1
|
CDC20.1
|
Transducin family protein / WD-40 repeat family protein |
| arTal_v1_Chr3_+_7518784_7518784 | 0.85 |
AT3G21351.1
|
AT3G21351
|
transmembrane protein |
| arTal_v1_Chr2_-_17562947_17562947 | 0.84 |
AT2G42110.1
|
AT2G42110
|
hypothetical protein |
| arTal_v1_Chr1_-_6908805_6908805 | 0.83 |
AT1G19900.1
|
AT1G19900
|
glyoxal oxidase-related protein |
| arTal_v1_Chr1_-_8940613_8940613 | 0.83 |
AT1G25450.1
|
KCS5
|
3-ketoacyl-CoA synthase 5 |
| arTal_v1_Chr2_-_8851035_8851035 | 0.82 |
AT2G20562.1
|
AT2G20562
|
taximin |
| arTal_v1_Chr2_+_11401118_11401118 | 0.81 |
AT2G26760.1
|
CYCB1%3B4
|
Cyclin B1;4 |
| arTal_v1_Chr3_-_4095112_4095112 | 0.81 |
AT3G12870.1
|
AT3G12870
|
transmembrane protein |
| arTal_v1_Chr1_-_5684909_5684909 | 0.81 |
AT1G16630.1
|
AT1G16630
|
transmembrane protein |
| arTal_v1_Chr4_-_15954803_15954803 | 0.81 |
AT4G33070.1
|
AT4G33070
|
Thiamine pyrophosphate dependent pyruvate decarboxylase family protein |
| arTal_v1_Chr5_-_26129547_26129547 | 0.80 |
AT5G65390.1
|
AGP7
|
arabinogalactan protein 7 |
| arTal_v1_Chr2_+_723565_723565 | 0.80 |
AT2G02630.1
|
AT2G02630
|
Cysteine/Histidine-rich C1 domain family protein |
| arTal_v1_Chr1_+_29373803_29373889 | 0.80 |
AT1G78090.1
AT1G78090.2 |
TPPB
|
trehalose-6-phosphate phosphatase |
| arTal_v1_Chr2_+_19508929_19508929 | 0.80 |
AT2G47550.1
|
AT2G47550
|
Plant invertase/pectin methylesterase inhibitor superfamily |
| arTal_v1_Chr3_+_9480746_9480839 | 0.80 |
AT3G25900.1
AT3G25900.3 AT3G25900.2 |
HMT-1
|
Homocysteine S-methyltransferase family protein |
| arTal_v1_Chr5_+_22474142_22474142 | 0.80 |
AT5G55480.1
|
SVL1
|
SHV3-like 1 |
| arTal_v1_Chr1_-_8961183_8961183 | 0.80 |
AT1G25510.1
|
AT1G25510
|
Eukaryotic aspartyl protease family protein |
| arTal_v1_Chr5_-_1861656_1861703 | 0.79 |
AT5G06150.2
AT5G06150.1 |
CYC1BAT
|
Cyclin family protein |
| arTal_v1_Chr4_-_682601_682601 | 0.79 |
AT4G01575.1
|
AT4G01575
|
serine protease inhibitor, Kazal-type family protein |
| arTal_v1_Chr2_+_6313883_6313883 | 0.79 |
AT2G14750.1
|
APK
|
APS kinase |
| arTal_v1_Chr5_-_26906517_26906524 | 0.79 |
AT5G67420.1
AT5G67420.2 |
LBD37
|
LOB domain-containing protein 37 |
| arTal_v1_Chr5_-_19404147_19404147 | 0.79 |
AT5G47920.1
|
AT5G47920
|
transcription elongation factor |
| arTal_v1_Chr1_+_789820_789820 | 0.79 |
AT1G03230.1
|
AT1G03230
|
Eukaryotic aspartyl protease family protein |
| arTal_v1_Chr1_-_7391603_7391603 | 0.78 |
AT1G21110.1
|
IGMT3
|
O-methyltransferase family protein |
| arTal_v1_Chr1_-_1063809_1063809 | 0.77 |
AT1G04110.1
|
SDD1
|
Subtilase family protein |
| arTal_v1_Chr4_-_14002069_14002124 | 0.77 |
AT4G28250.2
AT4G28250.3 AT4G28250.4 AT4G28250.1 |
EXPB3
|
expansin B3 |
| arTal_v1_Chr5_+_25322975_25322975 | 0.77 |
AT5G63130.2
AT5G63130.1 |
AT5G63130
|
Octicosapeptide/Phox/Bem1p family protein |
| arTal_v1_Chr4_+_1249971_1249971 | 0.76 |
AT4G02800.1
|
AT4G02800
|
GRIP/coiled-coil protein |
| arTal_v1_Chr2_-_16499524_16499524 | 0.75 |
AT2G39530.1
|
AT2G39530
|
Uncharacterized protein family (UPF0497) |
| arTal_v1_Chr3_+_1143694_1143773 | 0.75 |
AT3G04320.2
AT3G04320.1 |
AT3G04320
|
Kunitz family trypsin and protease inhibitor protein |
| arTal_v1_Chr3_+_1591115_1591115 | 0.75 |
AT3G05490.1
|
RALFL22
|
ralf-like 22 |
| arTal_v1_Chr3_+_19037140_19037140 | 0.75 |
AT3G51280.1
|
AT3G51280
|
Tetratricopeptide repeat (TPR)-like superfamily protein |
| arTal_v1_Chr5_-_8406132_8406151 | 0.74 |
AT5G24570.1
AT5G24575.1 |
AT5G24570
AT5G24575
|
hypothetical protein hypothetical protein |
| arTal_v1_Chr5_-_15167859_15167864 | 0.74 |
AT5G38020.2
AT5G38020.1 |
AT5G38020
|
S-adenosyl-L-methionine-dependent methyltransferases superfamily protein |
| arTal_v1_Chr1_+_3008910_3008910 | 0.74 |
AT1G09310.1
|
AT1G09310
|
plant/protein (Protein of unknown function, DUF538) |
| arTal_v1_Chr2_+_14436589_14436589 | 0.74 |
AT2G34190.1
|
AT2G34190
|
Xanthine/uracil permease family protein |
| arTal_v1_Chr1_+_28291698_28291698 | 0.73 |
AT1G75390.1
AT1G75390.2 |
bZIP44
|
basic leucine-zipper 44 |
| arTal_v1_Chr1_+_10375599_10375599 | 0.73 |
AT1G29670.2
|
AT1G29670
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
| arTal_v1_Chr5_+_22686473_22686473 | 0.72 |
AT5G56030.1
|
HSP81-2
|
heat shock protein 81-2 |
| arTal_v1_Chr4_-_17300367_17300367 | 0.72 |
AT4G36700.1
|
AT4G36700
|
RmlC-like cupins superfamily protein |
| arTal_v1_Chr1_+_1425539_1425539 | 0.72 |
AT1G05000.3
AT1G05000.1 AT1G05000.2 |
PFA-DSP1
|
Phosphotyrosine protein phosphatases superfamily protein |
| arTal_v1_Chr5_+_22686832_22686832 | 0.72 |
AT5G56030.2
|
HSP81-2
|
heat shock protein 81-2 |
| arTal_v1_Chr1_-_24056328_24056328 | 0.72 |
AT1G64760.2
|
AT1G64760
|
O-Glycosyl hydrolases family 17 protein |
| arTal_v1_Chr3_+_3189918_3190001 | 0.72 |
AT3G10310.2
AT3G10310.1 |
AT3G10310
|
P-loop nucleoside triphosphate hydrolases superfamily protein with CH (Calponin Homology) domain-containing protein |
| arTal_v1_Chr2_+_19437648_19437648 | 0.71 |
AT2G47360.1
|
AT2G47360
|
transmembrane protein |
| arTal_v1_Chr2_-_15481377_15481412 | 0.71 |
AT2G36880.2
AT2G36880.1 |
MAT3
|
methionine adenosyltransferase 3 |
| arTal_v1_Chr3_+_5556710_5556710 | 0.71 |
AT3G16370.1
|
AT3G16370
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
| arTal_v1_Chr5_-_14213293_14213293 | 0.71 |
AT5G36140.1
|
CYP716A2
|
cytochrome P450, family 716, subfamily A, polypeptide 2 |
| arTal_v1_Chr5_-_23992908_23992908 | 0.71 |
AT5G59520.1
|
ZIP2
|
ZRT/IRT-like protein 2 |
| arTal_v1_Chr2_+_11563933_11563933 | 0.71 |
AT2G27080.2
|
AT2G27080
|
Late embryogenesis abundant (LEA) hydroxyproline-rich glycoprotein family |
| arTal_v1_Chr5_+_22594617_22594617 | 0.70 |
AT5G55830.1
|
AT5G55830
|
Concanavalin A-like lectin protein kinase family protein |
| arTal_v1_Chr4_-_17376279_17376279 | 0.70 |
AT4G36880.1
|
CP1
|
cysteine proteinase1 |
| arTal_v1_Chr5_-_4069094_4069094 | 0.70 |
AT5G12880.1
|
AT5G12880
|
proline-rich family protein |
| arTal_v1_Chr4_+_8687354_8687380 | 0.69 |
AT4G15233.3
AT4G15233.4 |
ABCG42
|
ABC-2 and Plant PDR ABC-type transporter family protein |
| arTal_v1_Chr1_-_2711000_2711000 | 0.69 |
AT1G08560.1
|
SYP111
|
syntaxin of plants 111 |
| arTal_v1_Chr4_+_749307_749307 | 0.69 |
AT4G01730.1
|
AT4G01730
|
DHHC-type zinc finger family protein |
| arTal_v1_Chr1_-_1161982_1161982 | 0.69 |
AT1G04330.1
|
AT1G04330
|
hypothetical protein |
| arTal_v1_Chr3_-_11195171_11195171 | 0.69 |
AT3G29250.3
|
SDR4
|
NAD(P)-binding Rossmann-fold superfamily protein |
| arTal_v1_Chr1_+_10375754_10375754 | 0.69 |
AT1G29670.1
|
AT1G29670
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
| arTal_v1_Chr1_+_25018077_25018173 | 0.69 |
AT1G67035.2
AT1G67035.1 |
AT1G67035
|
homeobox Hox-B3-like protein |
| arTal_v1_Chr1_-_24056491_24056491 | 0.69 |
AT1G64760.1
|
AT1G64760
|
O-Glycosyl hydrolases family 17 protein |
| arTal_v1_Chr2_-_18401339_18401339 | 0.69 |
AT2G44578.1
|
AT2G44578
|
RING/U-box superfamily protein |
| arTal_v1_Chr5_-_18579241_18579241 | 0.68 |
AT5G45800.2
AT5G45800.1 |
MEE62
|
Leucine-rich repeat protein kinase family protein |
| arTal_v1_Chr1_+_17123785_17123821 | 0.68 |
AT1G45201.3
AT1G45201.1 AT1G45201.2 |
TLL1
|
triacylglycerol lipase-like 1 |
| arTal_v1_Chr1_-_11377885_11377885 | 0.68 |
AT1G31770.1
|
ABCG14
|
ATP-binding cassette 14 |
| arTal_v1_Chr5_+_16202142_16202142 | 0.68 |
AT5G40460.1
|
AT5G40460
|
cyclin-dependent kinase inhibitor SMR3-like protein |
| arTal_v1_Chr5_-_17650375_17650375 | 0.66 |
AT5G43890.1
|
YUC5
|
Flavin-binding monooxygenase family protein |
| arTal_v1_Chr3_+_8678678_8678678 | 0.66 |
AT3G24020.1
|
AT3G24020
|
Disease resistance-responsive (dirigent-like protein) family protein |
| arTal_v1_Chr2_-_14216054_14216054 | 0.66 |
AT2G33560.1
AT2G33560.2 |
BUBR1
|
BUB1-related (BUB1: budding uninhibited by benzymidazol 1) |
| arTal_v1_Chr1_-_28630546_28630789 | 0.65 |
AT1G76310.3
AT1G76310.4 AT1G76310.2 AT1G76310.1 |
CYCB2%3B4
|
CYCLIN B2;4 |
| arTal_v1_Chr5_-_20552670_20552670 | 0.65 |
AT5G50460.1
|
AT5G50460
|
secE/sec61-gamma protein transport protein |
| arTal_v1_Chr1_-_7294746_7294746 | 0.65 |
AT1G20930.1
|
CDKB2%3B2
|
cyclin-dependent kinase B2;2 |
| arTal_v1_Chr4_-_17624308_17624308 | 0.64 |
AT4G37490.1
|
CYCB1%3B1
|
CYCLIN B1;1 |
| arTal_v1_Chr4_-_11585542_11585542 | 0.64 |
AT4G21830.1
|
MSRB7
|
methionine sulfoxide reductase B7 |
| arTal_v1_Chr4_+_10375244_10375340 | 0.64 |
AT4G18950.1
AT4G18950.2 |
AT4G18950
|
Integrin-linked protein kinase family |
| arTal_v1_Chr1_+_4276505_4276505 | 0.64 |
AT1G12560.1
|
EXPA7
|
expansin A7 |
| arTal_v1_Chr3_-_202754_202754 | 0.63 |
AT3G01513.1
|
AT3G01513
|
hypothetical protein |
| arTal_v1_Chr2_+_7301334_7301334 | 0.63 |
AT2G16850.1
|
PIP2%3B8
|
plasma membrane intrinsic protein 2;8 |
| arTal_v1_Chr5_+_22388782_22388782 | 0.62 |
AT5G55180.2
|
AT5G55180
|
O-Glycosyl hydrolases family 17 protein |
| arTal_v1_Chr4_-_11585391_11585391 | 0.62 |
AT4G21830.2
|
MSRB7
|
methionine sulfoxide reductase B7 |
| arTal_v1_Chr3_+_18704764_18704764 | 0.62 |
AT3G50400.1
|
AT3G50400
|
GDSL-like Lipase/Acylhydrolase superfamily protein |
| arTal_v1_Chr1_+_1855910_1855910 | 0.62 |
AT1G06120.1
|
AT1G06120
|
Fatty acid desaturase family protein |
| arTal_v1_Chr3_+_23420145_23420145 | 0.62 |
AT3G63430.2
AT3G63430.1 |
TRM5
|
zinc finger CCCH domain protein |
| arTal_v1_Chr5_-_22491266_22491300 | 0.62 |
AT5G55520.1
AT5G55520.2 |
AT5G55520
|
kinesin-like protein |
| arTal_v1_Chr2_+_15758601_15758634 | 0.60 |
AT2G37560.2
AT2G37560.1 |
ORC2
|
origin recognition complex second largest subunit 2 |
| arTal_v1_Chr5_+_19179881_19179881 | 0.60 |
AT5G47230.1
|
ERF5
|
ethylene responsive element binding factor 5 |
| arTal_v1_Chr1_+_1843463_1843568 | 0.60 |
AT1G06080.1
AT1G06080.2 |
ADS1
|
delta 9 desaturase 1 |
| arTal_v1_Chr1_-_26765285_26765285 | 0.60 |
AT1G70985.1
|
AT1G70985
|
hydroxyproline-rich glycoprotein family protein |
| arTal_v1_Chr1_-_30186716_30186716 | 0.60 |
AT1G80280.1
|
AT1G80280
|
alpha/beta-Hydrolases superfamily protein |
| arTal_v1_Chr5_-_23127724_23127724 | 0.59 |
AT5G57123.1
|
AT5G57123
|
hypothetical protein |
| arTal_v1_Chr5_-_19447149_19447380 | 0.59 |
AT5G48000.7
AT5G48000.4 AT5G48000.2 AT5G48000.3 AT5G48000.5 AT5G48000.6 |
CYP708A2
|
cytochrome P450, family 708, subfamily A, polypeptide 2 |
| arTal_v1_Chr5_+_6760094_6760094 | 0.59 |
AT5G20010.1
|
RAN-1
|
RAS-related nuclear protein-1 |
| arTal_v1_Chr4_+_16901596_16901596 | 0.59 |
AT4G35620.2
AT4G35620.1 |
CYCB2%3B2
|
Cyclin B2;2 |
| arTal_v1_Chr1_+_1040375_1040383 | 0.59 |
AT1G04030.1
AT1G04030.2 |
AT1G04030
|
eisosome protein |
| arTal_v1_Chr5_+_22388521_22388521 | 0.59 |
AT5G55180.1
|
AT5G55180
|
O-Glycosyl hydrolases family 17 protein |
| arTal_v1_Chr3_-_20651443_20651484 | 0.59 |
AT3G55660.2
AT3G55660.1 |
ROPGEF6
|
ROP (rho of plants) guanine nucleotide exchange factor 6 |
| arTal_v1_Chr3_-_20903080_20903080 | 0.59 |
AT3G56370.1
|
AT3G56370
|
Leucine-rich repeat protein kinase family protein |
| arTal_v1_Chr5_+_1563286_1563308 | 0.59 |
AT5G05270.1
AT5G05270.2 |
CHIL
|
Chalcone-flavanone isomerase family protein |
| arTal_v1_Chr1_+_1529767_1529767 | 0.59 |
AT1G05260.1
|
RCI3
|
Peroxidase superfamily protein |
| arTal_v1_Chr3_+_19271347_19271347 | 0.59 |
AT3G51930.1
|
AT3G51930
|
Transducin/WD40 repeat-like superfamily protein |
| arTal_v1_Chr4_+_17254290_17254290 | 0.59 |
AT4G36570.1
|
RL3
|
RAD-like 3 |
| arTal_v1_Chr4_+_596397_596399 | 0.58 |
AT4G01440.3
AT4G01440.2 AT4G01440.1 AT4G01440.4 |
UMAMIT31
|
nodulin MtN21 /EamA-like transporter family protein |
| arTal_v1_Chr1_-_22589789_22589789 | 0.58 |
AT1G61255.1
|
AT1G61255
|
hypothetical protein |
| arTal_v1_Chr5_-_3270957_3270957 | 0.58 |
AT5G10400.1
|
AT5G10400
|
Histone superfamily protein |
| arTal_v1_Chr2_-_16301245_16301245 | 0.58 |
AT2G39040.1
|
AT2G39040
|
Peroxidase superfamily protein |
| arTal_v1_Chr1_+_23168767_23168767 | 0.58 |
AT1G62570.1
|
FMO GS-OX4
|
flavin-monooxygenase glucosinolate S-oxygenase 4 |
| arTal_v1_Chr2_-_6032502_6032502 | 0.58 |
AT2G14245.1
|
AT2G14245
|
|
| arTal_v1_Chr3_-_21216836_21216836 | 0.58 |
AT3G57330.1
|
ACA11
|
autoinhibited Ca2+-ATPase 11 |
| arTal_v1_Chr5_-_26920179_26920179 | 0.58 |
AT5G67450.1
|
ZF1
|
zinc-finger protein 1 |
| arTal_v1_Chr5_+_7328870_7328870 | 0.58 |
AT5G22100.1
|
AT5G22100
|
RNA cyclase family protein |
| arTal_v1_Chr1_-_16777352_16777352 | 0.58 |
AT1G44110.1
|
CYCA1%3B1
|
Cyclin A1;1 |
| arTal_v1_Chr5_+_15305847_15305847 | 0.58 |
AT5G38300.1
|
AT5G38300
|
homeobox Hox-B3-like protein |
| arTal_v1_Chr2_+_12814271_12814271 | 0.58 |
AT2G30020.1
|
AT2G30020
|
Protein phosphatase 2C family protein |
| arTal_v1_Chr5_-_3044546_3044546 | 0.58 |
AT5G09800.1
|
AT5G09800
|
ARM repeat superfamily protein |
| arTal_v1_Chr4_-_14902144_14902144 | 0.57 |
AT4G30490.1
|
AT4G30490
|
AFG1-like ATPase family protein |
| arTal_v1_Chr4_+_7210807_7210807 | 0.57 |
AT4G12030.4
AT4G12030.3 AT4G12030.2 AT4G12030.1 |
BAT5
|
bile acid transporter 5 |
| arTal_v1_Chr3_-_8001238_8001263 | 0.57 |
AT3G22570.1
AT3G22570.2 |
AT3G22570
|
Bifunctional inhibitor/lipid-transfer protein/seed storage 2S albumin superfamily protein |
| arTal_v1_Chr4_+_15842443_15842443 | 0.57 |
AT4G32830.1
|
AUR1
|
ataurora1 |
| arTal_v1_Chr4_-_16740601_16740601 | 0.56 |
AT4G35180.2
AT4G35180.1 |
LHT7
|
LYS/HIS transporter 7 |
| arTal_v1_Chr2_-_12646057_12646057 | 0.56 |
AT2G29550.1
|
TUB7
|
tubulin beta-7 chain |
| arTal_v1_Chr4_+_16708552_16708552 | 0.56 |
AT4G35100.2
|
PIP3
|
plasma membrane intrinsic protein 3 |
| arTal_v1_Chr1_-_2152541_2152541 | 0.56 |
AT1G07000.1
|
EXO70B2
|
exocyst subunit exo70 family protein B2 |
| arTal_v1_Chr4_+_16708361_16708361 | 0.56 |
AT4G35100.1
|
PIP3
|
plasma membrane intrinsic protein 3 |
| arTal_v1_Chr2_-_12277417_12277417 | 0.56 |
AT2G28630.2
|
KCS12
|
3-ketoacyl-CoA synthase 12 |
| arTal_v1_Chr5_-_14976229_14976229 | 0.56 |
AT5G37690.2
AT5G37690.1 |
AT5G37690
|
SGNH hydrolase-type esterase superfamily protein |
| arTal_v1_Chr4_+_18409846_18409846 | 0.55 |
AT4G39670.1
|
AT4G39670
|
Glycolipid transfer protein (GLTP) family protein |
| arTal_v1_Chr4_-_7780366_7780366 | 0.55 |
AT4G13370.1
|
AT4G13370
|
serine/arginine repetitive matrix protein, putative (DUF936) |
| arTal_v1_Chr3_-_2334185_2334185 | 0.55 |
AT3G07320.1
|
AT3G07320
|
O-Glycosyl hydrolases family 17 protein |
| arTal_v1_Chr3_+_5121303_5121303 | 0.55 |
AT3G15210.1
|
ERF4
|
ethylene responsive element binding factor 4 |
| arTal_v1_Chr3_-_20756690_20756690 | 0.54 |
AT3G55950.1
|
CCR3
|
CRINKLY4 related 3 |
| arTal_v1_Chr3_-_2607573_2607573 | 0.54 |
AT3G08580.1
|
AAC1
|
ADP/ATP carrier 1 |
| arTal_v1_Chr1_-_10845242_10845242 | 0.54 |
AT1G30600.1
|
AT1G30600
|
Subtilase family protein |
| arTal_v1_Chr5_-_3005587_3005587 | 0.54 |
AT5G09700.1
|
AT5G09700
|
Glycosyl hydrolase family protein |
| arTal_v1_Chr3_-_2607895_2607895 | 0.54 |
AT3G08580.2
|
AAC1
|
ADP/ATP carrier 1 |
| arTal_v1_Chr1_+_4247218_4247249 | 0.53 |
AT1G12460.1
AT1G12460.2 |
AT1G12460
|
Leucine-rich repeat protein kinase family protein |
| arTal_v1_Chr1_-_26515188_26515255 | 0.53 |
AT1G70370.2
AT1G70370.1 |
PG2
|
polygalacturonase 2 |
| arTal_v1_Chr1_-_7137828_7137828 | 0.53 |
AT1G20610.1
|
CYCB2%3B3
|
Cyclin B2;3 |
| arTal_v1_Chr4_-_18084630_18084630 | 0.53 |
AT4G38740.1
|
ROC1
|
rotamase CYP 1 |
| arTal_v1_Chr5_+_84474_84474 | 0.53 |
AT5G01210.1
|
AT5G01210
|
HXXXD-type acyl-transferase family protein |
| arTal_v1_Chr3_-_21215428_21215428 | 0.53 |
AT3G57330.2
|
ACA11
|
autoinhibited Ca2+-ATPase 11 |
| arTal_v1_Chr3_-_1822858_1822858 | 0.53 |
AT3G06030.1
|
NP3
|
NPK1-related protein kinase 3 |
| arTal_v1_Chr1_-_11909049_11909049 | 0.53 |
AT1G32860.1
|
AT1G32860
|
Glycosyl hydrolase superfamily protein |
| arTal_v1_Chr3_-_1113859_1113859 | 0.53 |
AT3G04230.1
|
AT3G04230
|
Ribosomal protein S5 domain 2-like superfamily protein |
| arTal_v1_Chr4_-_12062757_12062858 | 0.53 |
AT4G23010.2
AT4G23010.1 AT4G23010.3 |
UTR2
|
UDP-galactose transporter 2 |
| arTal_v1_Chr2_-_10277266_10277266 | 0.53 |
AT2G24170.1
AT2G24170.2 |
AT2G24170
|
Endomembrane protein 70 protein family |
| arTal_v1_Chr4_+_8687981_8687981 | 0.52 |
AT4G15233.6
|
ABCG42
|
ABC-2 and Plant PDR ABC-type transporter family protein |
| arTal_v1_Chr1_-_30244949_30244949 | 0.52 |
AT1G80450.1
|
AT1G80450
|
VQ motif-containing protein |
| arTal_v1_Chr2_-_12277245_12277245 | 0.52 |
AT2G28630.1
|
KCS12
|
3-ketoacyl-CoA synthase 12 |
| arTal_v1_Chr1_+_729830_729830 | 0.52 |
AT1G03070.1
AT1G03070.3 AT1G03070.2 |
AT1G03070
|
Bax inhibitor-1 family protein |
| arTal_v1_Chr2_-_17263017_17263017 | 0.52 |
AT2G41410.1
|
AT2G41410
|
Calcium-binding EF-hand family protein |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 2.8 | GO:0046218 | tryptophan catabolic process(GO:0006569) indolalkylamine catabolic process(GO:0046218) |
| 0.5 | 2.2 | GO:0080003 | thalianol metabolic process(GO:0080003) |
| 0.5 | 1.9 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.3 | 1.0 | GO:0015840 | urea transport(GO:0015840) |
| 0.3 | 0.9 | GO:0043987 | histone-serine phosphorylation(GO:0035404) histone H3-S10 phosphorylation(GO:0043987) |
| 0.3 | 0.8 | GO:0033528 | S-methylmethionine metabolic process(GO:0033477) S-methylmethionine cycle(GO:0033528) |
| 0.3 | 0.8 | GO:0033506 | homomethionine metabolic process(GO:0033321) glucosinolate biosynthetic process from homomethionine(GO:0033506) |
| 0.3 | 0.8 | GO:0060776 | simple leaf morphogenesis(GO:0060776) |
| 0.2 | 0.7 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.2 | 0.7 | GO:0010184 | cytokinin transport(GO:0010184) |
| 0.2 | 0.7 | GO:0016572 | histone phosphorylation(GO:0016572) |
| 0.2 | 0.4 | GO:0010597 | green leaf volatile biosynthetic process(GO:0010597) |
| 0.2 | 2.0 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.2 | 2.9 | GO:0015865 | purine nucleotide transport(GO:0015865) |
| 0.2 | 0.8 | GO:0071313 | cellular response to alkaloid(GO:0071312) cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) negative regulation of cellular response to caffeine(GO:1901181) |
| 0.2 | 0.9 | GO:0007142 | male meiosis II(GO:0007142) |
| 0.2 | 1.8 | GO:0071174 | mitotic spindle assembly checkpoint(GO:0007094) spindle checkpoint(GO:0031577) negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) negative regulation of sister chromatid segregation(GO:0033046) negative regulation of mitotic sister chromatid segregation(GO:0033048) negative regulation of mitotic metaphase/anaphase transition(GO:0045841) negative regulation of chromosome segregation(GO:0051985) spindle assembly checkpoint(GO:0071173) mitotic spindle checkpoint(GO:0071174) negative regulation of proteasomal protein catabolic process(GO:1901799) negative regulation of metaphase/anaphase transition of cell cycle(GO:1902100) negative regulation of proteolysis involved in cellular protein catabolic process(GO:1903051) negative regulation of cellular protein catabolic process(GO:1903363) negative regulation of mitotic sister chromatid separation(GO:2000816) |
| 0.2 | 1.8 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 | 0.3 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) regulation of spindle organization(GO:0090224) |
| 0.1 | 0.7 | GO:0050810 | regulation of brassinosteroid biosynthetic process(GO:0010422) regulation of steroid metabolic process(GO:0019218) regulation of steroid biosynthetic process(GO:0050810) regulation of steroid hormone biosynthetic process(GO:0090030) |
| 0.1 | 0.8 | GO:0015785 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.1 | 0.4 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.5 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
| 0.1 | 0.8 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) regulation of actin nucleation(GO:0051125) positive regulation of actin nucleation(GO:0051127) positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 1.3 | GO:0000304 | response to singlet oxygen(GO:0000304) |
| 0.1 | 0.6 | GO:0080175 | phragmoplast microtubule organization(GO:0080175) |
| 0.1 | 0.7 | GO:0007349 | cellularization(GO:0007349) |
| 0.1 | 0.3 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.1 | 0.4 | GO:0048205 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.1 | 0.5 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.1 | 0.2 | GO:0036473 | cell death in response to oxidative stress(GO:0036473) programmed cell death in response to reactive oxygen species(GO:0097468) |
| 0.1 | 1.2 | GO:0010439 | regulation of glucosinolate biosynthetic process(GO:0010439) |
| 0.1 | 0.4 | GO:0080029 | cellular response to boron-containing substance levels(GO:0080029) |
| 0.1 | 0.9 | GO:0009961 | response to 1-aminocyclopropane-1-carboxylic acid(GO:0009961) |
| 0.1 | 0.3 | GO:0006750 | glutathione biosynthetic process(GO:0006750) nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.1 | 0.8 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
| 0.1 | 1.0 | GO:0032366 | intracellular sterol transport(GO:0032366) |
| 0.1 | 0.4 | GO:0050482 | icosanoid secretion(GO:0032309) arachidonic acid secretion(GO:0050482) icosanoid transport(GO:0071715) fatty acid derivative transport(GO:1901571) arachidonate transport(GO:1903963) |
| 0.1 | 0.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.1 | 0.2 | GO:0051352 | negative regulation of protein ubiquitination(GO:0031397) negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.1 | 0.5 | GO:0070199 | establishment of mitotic sister chromatid cohesion(GO:0034087) establishment of protein localization to chromosome(GO:0070199) rDNA condensation(GO:0070550) establishment of protein localization to chromatin(GO:0071169) transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.1 | 1.2 | GO:0000919 | cell plate assembly(GO:0000919) |
| 0.1 | 1.2 | GO:0052541 | plant-type cell wall cellulose metabolic process(GO:0052541) |
| 0.1 | 1.0 | GO:0010274 | hydrotropism(GO:0010274) |
| 0.1 | 0.2 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 1.5 | GO:0006833 | water transport(GO:0006833) fluid transport(GO:0042044) |
| 0.1 | 0.2 | GO:0009805 | coumarin biosynthetic process(GO:0009805) |
| 0.1 | 0.2 | GO:0018279 | peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.1 | 0.5 | GO:0009061 | anaerobic respiration(GO:0009061) |
| 0.1 | 0.3 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 2.3 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
| 0.1 | 1.6 | GO:0043069 | negative regulation of programmed cell death(GO:0043069) |
| 0.1 | 0.6 | GO:1902290 | positive regulation of defense response to oomycetes(GO:1902290) |
| 0.1 | 0.3 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.1 | 0.4 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.1 | 0.2 | GO:0010116 | positive regulation of abscisic acid biosynthetic process(GO:0010116) |
| 0.1 | 4.6 | GO:0045490 | pectin catabolic process(GO:0045490) |
| 0.1 | 0.2 | GO:0044236 | collagen metabolic process(GO:0032963) multicellular organism metabolic process(GO:0044236) multicellular organismal macromolecule metabolic process(GO:0044259) |
| 0.0 | 0.9 | GO:0033753 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
| 0.0 | 0.2 | GO:0048656 | anther wall tapetum formation(GO:0048656) anther wall tapetum cell differentiation(GO:0048657) |
| 0.0 | 0.9 | GO:0006949 | syncytium formation(GO:0006949) |
| 0.0 | 0.5 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.3 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.0 | 0.3 | GO:0009759 | indole glucosinolate biosynthetic process(GO:0009759) |
| 0.0 | 0.1 | GO:0010069 | zygote asymmetric cytokinesis in embryo sac(GO:0010069) |
| 0.0 | 0.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.5 | GO:0030071 | regulation of mitotic metaphase/anaphase transition(GO:0030071) regulation of metaphase/anaphase transition of cell cycle(GO:1902099) |
| 0.0 | 0.1 | GO:0071422 | thiosulfate transport(GO:0015709) succinate transport(GO:0015744) succinate transmembrane transport(GO:0071422) |
| 0.0 | 0.5 | GO:0090114 | COPII-coated vesicle budding(GO:0090114) |
| 0.0 | 0.2 | GO:0070981 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.0 | 0.4 | GO:0009097 | isoleucine metabolic process(GO:0006549) isoleucine biosynthetic process(GO:0009097) |
| 0.0 | 0.5 | GO:0009864 | induced systemic resistance, jasmonic acid mediated signaling pathway(GO:0009864) |
| 0.0 | 0.5 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 1.7 | GO:2000022 | regulation of jasmonic acid mediated signaling pathway(GO:2000022) |
| 0.0 | 0.4 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.0 | 0.5 | GO:0030104 | water homeostasis(GO:0030104) |
| 0.0 | 0.1 | GO:0006659 | phosphatidylserine metabolic process(GO:0006658) phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 | 0.7 | GO:0006521 | regulation of cellular amino acid metabolic process(GO:0006521) regulation of cellular amine metabolic process(GO:0033238) |
| 0.0 | 0.0 | GO:0010447 | response to acidic pH(GO:0010447) |
| 0.0 | 0.2 | GO:0009807 | lignan metabolic process(GO:0009806) lignan biosynthetic process(GO:0009807) |
| 0.0 | 0.9 | GO:0019761 | S-glycoside biosynthetic process(GO:0016144) glycosinolate biosynthetic process(GO:0019758) glucosinolate biosynthetic process(GO:0019761) |
| 0.0 | 0.3 | GO:0030026 | cellular manganese ion homeostasis(GO:0030026) |
| 0.0 | 0.9 | GO:0010091 | trichome branching(GO:0010091) |
| 0.0 | 0.4 | GO:1902223 | L-phenylalanine biosynthetic process(GO:0009094) erythrose 4-phosphate/phosphoenolpyruvate family amino acid biosynthetic process(GO:1902223) |
| 0.0 | 0.1 | GO:1902407 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) phragmoplast assembly(GO:0000914) assembly of actomyosin apparatus involved in mitotic cytokinesis(GO:1902407) |
| 0.0 | 0.7 | GO:0010103 | stomatal complex morphogenesis(GO:0010103) |
| 0.0 | 0.5 | GO:0010332 | response to gamma radiation(GO:0010332) |
| 0.0 | 0.1 | GO:0032978 | protein insertion into membrane from inner side(GO:0032978) protein insertion into mitochondrial membrane from inner side(GO:0032979) protein insertion into mitochondrial membrane(GO:0051204) |
| 0.0 | 0.1 | GO:0090646 | mitochondrial tRNA processing(GO:0090646) |
| 0.0 | 0.2 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 0.1 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.0 | 1.3 | GO:0045489 | pectin biosynthetic process(GO:0045489) |
| 0.0 | 0.4 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) purine nucleobase biosynthetic process(GO:0009113) |
| 0.0 | 0.8 | GO:0010143 | cutin biosynthetic process(GO:0010143) |
| 0.0 | 0.8 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.0 | 0.6 | GO:0048768 | root hair cell tip growth(GO:0048768) |
| 0.0 | 0.1 | GO:0080187 | floral organ senescence(GO:0080187) |
| 0.0 | 1.4 | GO:0007267 | cell-cell signaling(GO:0007267) |
| 0.0 | 0.4 | GO:0046785 | microtubule polymerization(GO:0046785) |
| 0.0 | 1.5 | GO:0007018 | microtubule-based movement(GO:0007018) |
| 0.0 | 1.1 | GO:0048767 | root hair elongation(GO:0048767) |
| 0.0 | 1.2 | GO:0010075 | regulation of meristem growth(GO:0010075) |
| 0.0 | 0.2 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
| 0.0 | 0.7 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.7 | GO:0005992 | trehalose biosynthetic process(GO:0005992) |
| 0.0 | 0.5 | GO:0009768 | photosynthesis, light harvesting in photosystem I(GO:0009768) |
| 0.0 | 0.2 | GO:0042343 | indole glucosinolate metabolic process(GO:0042343) |
| 0.0 | 0.2 | GO:0071585 | detoxification of cadmium ion(GO:0071585) |
| 0.0 | 0.1 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.0 | 0.4 | GO:0010268 | brassinosteroid homeostasis(GO:0010268) |
| 0.0 | 0.2 | GO:0070193 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
| 0.0 | 0.4 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
| 0.0 | 0.2 | GO:0071249 | cellular response to nitrate(GO:0071249) |
| 0.0 | 0.3 | GO:0015833 | oligopeptide transport(GO:0006857) peptide transport(GO:0015833) |
| 0.0 | 0.4 | GO:0009612 | response to mechanical stimulus(GO:0009612) |
| 0.0 | 0.5 | GO:0009833 | plant-type primary cell wall biogenesis(GO:0009833) |
| 0.0 | 0.1 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.0 | 0.2 | GO:0080086 | stamen filament development(GO:0080086) |
| 0.0 | 0.3 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 0.0 | 0.3 | GO:0043068 | positive regulation of programmed cell death(GO:0043068) |
| 0.0 | 0.0 | GO:0080051 | cutin transport(GO:0080051) |
| 0.0 | 0.2 | GO:0045740 | positive regulation of DNA replication(GO:0045740) |
| 0.0 | 0.3 | GO:0006722 | triterpenoid metabolic process(GO:0006722) |
| 0.0 | 0.4 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.1 | GO:0052548 | negative regulation of endopeptidase activity(GO:0010951) regulation of endopeptidase activity(GO:0052548) |
| 0.0 | 0.4 | GO:0009695 | jasmonic acid biosynthetic process(GO:0009695) |
| 0.0 | 0.4 | GO:0043622 | cortical microtubule organization(GO:0043622) |
| 0.0 | 0.5 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 2.0 | GO:0010200 | response to chitin(GO:0010200) |
| 0.0 | 1.2 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
| 0.0 | 0.1 | GO:0009727 | detection of ethylene stimulus(GO:0009727) |
| 0.0 | 0.1 | GO:0042447 | cytokinin catabolic process(GO:0009823) hormone catabolic process(GO:0042447) |
| 0.0 | 0.8 | GO:0010411 | xyloglucan metabolic process(GO:0010411) |
| 0.0 | 0.1 | GO:0010199 | organ boundary specification between lateral organs and the meristem(GO:0010199) |
| 0.0 | 0.2 | GO:0070828 | heterochromatin organization(GO:0070828) |
| 0.0 | 0.3 | GO:0009904 | chloroplast accumulation movement(GO:0009904) |
| 0.0 | 0.1 | GO:0043155 | photoinhibition(GO:0010205) negative regulation of photosynthesis, light reaction(GO:0043155) |
| 0.0 | 0.5 | GO:0002239 | response to oomycetes(GO:0002239) |
| 0.0 | 0.9 | GO:0007017 | microtubule-based process(GO:0007017) |
| 0.0 | 0.5 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
| 0.0 | 0.4 | GO:0009789 | positive regulation of abscisic acid-activated signaling pathway(GO:0009789) |
| 0.0 | 0.0 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.0 | 0.0 | GO:0090506 | axillary shoot meristem initiation(GO:0090506) |
| 0.0 | 0.9 | GO:0006633 | fatty acid biosynthetic process(GO:0006633) |
| 0.0 | 0.1 | GO:0010232 | vascular transport(GO:0010232) phloem transport(GO:0010233) |
| 0.0 | 0.4 | GO:0000911 | cytokinesis by cell plate formation(GO:0000911) |
| 0.0 | 0.3 | GO:0010928 | regulation of auxin mediated signaling pathway(GO:0010928) |
| 0.0 | 0.1 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
| 0.0 | 0.2 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 2.0 | GO:0033597 | mitotic checkpoint complex(GO:0033597) |
| 0.4 | 1.5 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.3 | 1.0 | GO:0009514 | glyoxysome(GO:0009514) |
| 0.3 | 1.8 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.2 | 1.2 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.2 | 0.5 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.5 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 0.4 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.1 | 1.0 | GO:0000322 | storage vacuole(GO:0000322) protein storage vacuole(GO:0000326) |
| 0.1 | 0.3 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.1 | 0.8 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 1.5 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 0.8 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 8.1 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 6.0 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.5 | GO:0010168 | ER body(GO:0010168) |
| 0.0 | 0.6 | GO:1903561 | extracellular organelle(GO:0043230) extracellular exosome(GO:0070062) extracellular vesicle(GO:1903561) |
| 0.0 | 0.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.6 | GO:0005880 | nuclear microtubule(GO:0005880) |
| 0.0 | 0.5 | GO:0048226 | Casparian strip(GO:0048226) |
| 0.0 | 0.2 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.1 | GO:0045495 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.0 | 0.2 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.0 | 0.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.4 | GO:0098827 | endoplasmic reticulum tubular network(GO:0071782) endoplasmic reticulum subcompartment(GO:0098827) |
| 0.0 | 0.5 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.3 | GO:0035618 | endocytic vesicle(GO:0030139) root hair(GO:0035618) |
| 0.0 | 0.2 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.5 | GO:0010319 | stromule(GO:0010319) |
| 0.0 | 1.6 | GO:0009524 | phragmoplast(GO:0009524) |
| 0.0 | 0.2 | GO:0009538 | photosystem I reaction center(GO:0009538) |
| 0.0 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.3 | GO:0071007 | U2-type catalytic step 2 spliceosome(GO:0071007) |
| 0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.2 | GO:0009517 | thylakoid light-harvesting complex(GO:0009503) PSII associated light-harvesting complex II(GO:0009517) light-harvesting complex(GO:0030076) |
| 0.0 | 0.3 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.2 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
| 0.0 | 0.1 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.4 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.2 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
| 0.0 | 0.5 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.2 | GO:0005763 | mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 1.7 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 7.1 | GO:0030312 | cell wall(GO:0005618) external encapsulating structure(GO:0030312) |
| 0.0 | 0.5 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 1.6 | GO:0009705 | plant-type vacuole membrane(GO:0009705) |
| 0.0 | 0.2 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.0 | 3.1 | GO:0048046 | apoplast(GO:0048046) |
| 0.0 | 0.4 | GO:0031228 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
| 0.0 | 0.1 | GO:0009574 | preprophase band(GO:0009574) |
| 0.0 | 0.6 | GO:0090406 | pollen tube(GO:0090406) |
| 0.0 | 1.0 | GO:0016604 | nuclear body(GO:0016604) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.5 | GO:0035175 | histone serine kinase activity(GO:0035174) histone kinase activity (H3-S10 specific)(GO:0035175) |
| 0.4 | 1.1 | GO:0045430 | chalcone isomerase activity(GO:0045430) |
| 0.3 | 1.0 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.3 | 2.9 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) |
| 0.3 | 0.8 | GO:0047150 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) betaine-homocysteine S-methyltransferase activity(GO:0047150) |
| 0.2 | 1.0 | GO:0046423 | allene-oxide cyclase activity(GO:0046423) |
| 0.2 | 2.0 | GO:1990757 | ubiquitin ligase activator activity(GO:1990757) |
| 0.1 | 0.6 | GO:0080103 | 4-methylthiopropyl glucosinolate S-oxygenase activity(GO:0080103) |
| 0.1 | 0.7 | GO:0015367 | oxoglutarate:malate antiporter activity(GO:0015367) |
| 0.1 | 0.8 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.1 | 0.4 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) alanine transmembrane transporter activity(GO:0022858) |
| 0.1 | 0.5 | GO:0046593 | mandelonitrile lyase activity(GO:0046593) |
| 0.1 | 1.3 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.1 | 0.4 | GO:0004044 | amidophosphoribosyltransferase activity(GO:0004044) |
| 0.1 | 0.5 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.1 | 2.8 | GO:0102336 | 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.8 | GO:0071933 | protein kinase A regulatory subunit binding(GO:0034237) protein kinase A binding(GO:0051018) Arp2/3 complex binding(GO:0071933) |
| 0.1 | 0.4 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.5 | GO:1902388 | ceramide transporter activity(GO:0035620) sphingolipid transporter activity(GO:0046624) ceramide 1-phosphate binding(GO:1902387) ceramide 1-phosphate transporter activity(GO:1902388) |
| 0.1 | 0.8 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.1 | 0.5 | GO:0050664 | NAD(P)H oxidase activity(GO:0016174) oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.1 | 0.5 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 0.8 | GO:0004020 | adenylylsulfate kinase activity(GO:0004020) |
| 0.1 | 1.5 | GO:0005372 | water transmembrane transporter activity(GO:0005372) water channel activity(GO:0015250) |
| 0.1 | 0.4 | GO:0004108 | citrate (Si)-synthase activity(GO:0004108) citrate synthase activity(GO:0036440) |
| 0.1 | 0.2 | GO:0004071 | aspartate-ammonia ligase activity(GO:0004071) |
| 0.1 | 0.6 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 0.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 0.8 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
| 0.1 | 0.6 | GO:0009979 | 16:0 monogalactosyldiacylglycerol desaturase activity(GO:0009979) |
| 0.1 | 1.9 | GO:0032934 | sterol binding(GO:0032934) |
| 0.1 | 0.9 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.2 | GO:0005496 | steroid binding(GO:0005496) |
| 0.1 | 0.2 | GO:0046409 | p-coumarate 3-hydroxylase activity(GO:0046409) |
| 0.1 | 0.4 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.1 | 1.0 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.3 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 0.3 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
| 0.1 | 0.2 | GO:0010283 | pinoresinol reductase activity(GO:0010283) |
| 0.1 | 0.3 | GO:0015369 | calcium:proton antiporter activity(GO:0015369) |
| 0.1 | 1.6 | GO:0047262 | polygalacturonate 4-alpha-galacturonosyltransferase activity(GO:0047262) |
| 0.1 | 0.4 | GO:0016211 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.1 | 0.3 | GO:0047769 | prephenate dehydratase activity(GO:0004664) arogenate dehydratase activity(GO:0047769) |
| 0.1 | 1.3 | GO:0030570 | carbon-oxygen lyase activity, acting on polysaccharides(GO:0016837) pectate lyase activity(GO:0030570) |
| 0.0 | 2.3 | GO:0016759 | cellulose synthase activity(GO:0016759) |
| 0.0 | 0.4 | GO:0070696 | transmembrane receptor protein serine/threonine kinase binding(GO:0070696) |
| 0.0 | 0.3 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 1.1 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 3.1 | GO:0046910 | pectinesterase inhibitor activity(GO:0046910) |
| 0.0 | 0.4 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) peptide transmembrane transporter activity(GO:1904680) |
| 0.0 | 0.4 | GO:0047216 | inositol 3-alpha-galactosyltransferase activity(GO:0047216) |
| 0.0 | 0.1 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 0.0 | 0.8 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.3 | GO:0090447 | glycerol-3-phosphate 2-O-acyltransferase activity(GO:0090447) |
| 0.0 | 0.3 | GO:0003955 | NAD(P)H dehydrogenase (quinone) activity(GO:0003955) |
| 0.0 | 1.6 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.0 | 0.3 | GO:0050105 | L-gulonolactone oxidase activity(GO:0050105) |
| 0.0 | 0.3 | GO:0030623 | U5 snRNA binding(GO:0030623) |
| 0.0 | 0.3 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 4.5 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.5 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.5 | GO:0030295 | kinase activator activity(GO:0019209) protein kinase activator activity(GO:0030295) |
| 0.0 | 0.5 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 2.4 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.4 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methyladenine glycosylase activity(GO:0008725) DNA-3-methylbase glycosylase activity(GO:0043733) |
| 0.0 | 0.5 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.3 | GO:0010011 | auxin binding(GO:0010011) |
| 0.0 | 0.4 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.5 | GO:0004675 | transmembrane receptor protein serine/threonine kinase activity(GO:0004675) |
| 0.0 | 0.2 | GO:0016621 | cinnamoyl-CoA reductase activity(GO:0016621) |
| 0.0 | 0.4 | GO:0052747 | sinapyl alcohol dehydrogenase activity(GO:0052747) |
| 0.0 | 1.0 | GO:0016762 | xyloglucan:xyloglucosyl transferase activity(GO:0016762) |
| 0.0 | 0.2 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.7 | GO:0004805 | trehalose-phosphatase activity(GO:0004805) |
| 0.0 | 0.1 | GO:0004512 | inositol-3-phosphate synthase activity(GO:0004512) |
| 0.0 | 0.4 | GO:0003978 | UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.0 | 0.8 | GO:0005179 | hormone activity(GO:0005179) |
| 0.0 | 0.1 | GO:0003856 | 3-dehydroquinate synthase activity(GO:0003856) |
| 0.0 | 0.1 | GO:0000249 | C-22 sterol desaturase activity(GO:0000249) |
| 0.0 | 0.4 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:0032977 | membrane insertase activity(GO:0032977) |
| 0.0 | 0.6 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.2 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.2 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.0 | 2.2 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.7 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.6 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 3.8 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.3 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
| 0.0 | 0.3 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.0 | 1.1 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.0 | 0.5 | GO:0016168 | chlorophyll binding(GO:0016168) |
| 0.0 | 0.7 | GO:0045735 | nutrient reservoir activity(GO:0045735) |
| 0.0 | 0.3 | GO:0004124 | cysteine synthase activity(GO:0004124) |
| 0.0 | 0.2 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.0 | 3.9 | GO:0005509 | calcium ion binding(GO:0005509) |
| 0.0 | 0.3 | GO:0030599 | pectinesterase activity(GO:0030599) |
| 0.0 | 0.1 | GO:0045549 | 9-cis-epoxycarotenoid dioxygenase activity(GO:0045549) |
| 0.0 | 0.4 | GO:0008810 | cellulase activity(GO:0008810) |
| 0.0 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.1 | GO:0016688 | L-ascorbate peroxidase activity(GO:0016688) |
| 0.0 | 0.4 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
| 0.0 | 0.2 | GO:0015112 | nitrate transmembrane transporter activity(GO:0015112) |
| 0.0 | 1.7 | GO:0009055 | electron carrier activity(GO:0009055) |
| 0.0 | 0.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.4 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 1.4 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.1 | GO:0019139 | cytokinin dehydrogenase activity(GO:0019139) |
| 0.0 | 0.1 | GO:0047780 | citrate dehydratase activity(GO:0047780) |
| 0.0 | 1.1 | GO:0004601 | peroxidase activity(GO:0004601) oxidoreductase activity, acting on peroxide as acceptor(GO:0016684) |
| 0.0 | 1.2 | GO:0046982 | protein heterodimerization activity(GO:0046982) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.7 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
| 0.1 | 0.3 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.4 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.2 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.2 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 0.4 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.1 | 0.2 | REACTOME SEMAPHORIN INTERACTIONS | Genes involved in Semaphorin interactions |
| 0.0 | 0.2 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.0 | 0.1 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |