A549 cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
KLF16
|
ENSG00000129911.4 | Kruppel like factor 16 |
|
SP2
|
ENSG00000167182.11 | Sp2 transcription factor |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| KLF16 | hg19_v2_chr19_-_1863567_1863586 | 0.81 | 5.1e-02 | Click! |
| SP2 | hg19_v2_chr17_+_45973516_45973618 | 0.02 | 9.6e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr1_+_228362251 | 0.85 |
ENST00000546123.1
|
IBA57
|
IBA57, iron-sulfur cluster assembly homolog (S. cerevisiae) |
| chr16_+_77246337 | 0.79 |
ENST00000563157.1
|
SYCE1L
|
synaptonemal complex central element protein 1-like |
| chr1_-_1850697 | 0.53 |
ENST00000378598.4
ENST00000416272.1 ENST00000310991.3 |
TMEM52
|
transmembrane protein 52 |
| chr19_+_50433476 | 0.52 |
ENST00000596658.1
|
ATF5
|
activating transcription factor 5 |
| chr19_+_11457232 | 0.45 |
ENST00000587531.1
|
CCDC159
|
coiled-coil domain containing 159 |
| chr2_+_20866424 | 0.44 |
ENST00000272224.3
|
GDF7
|
growth differentiation factor 7 |
| chr21_+_42792442 | 0.42 |
ENST00000398600.2
|
MX1
|
myxovirus (influenza virus) resistance 1, interferon-inducible protein p78 (mouse) |
| chr6_-_168397757 | 0.38 |
ENST00000456585.1
ENST00000414364.1 |
KIF25-AS1
|
KIF25 antisense RNA 1 |
| chrX_-_16888276 | 0.37 |
ENST00000493145.1
|
RBBP7
|
retinoblastoma binding protein 7 |
| chr7_+_97910962 | 0.37 |
ENST00000539286.1
|
BRI3
|
brain protein I3 |
| chr17_+_19091325 | 0.36 |
ENST00000584923.1
|
SNORD3A
|
small nucleolar RNA, C/D box 3A |
| chr19_+_17581253 | 0.35 |
ENST00000252595.7
ENST00000598424.1 |
SLC27A1
|
solute carrier family 27 (fatty acid transporter), member 1 |
| chr22_-_39548443 | 0.35 |
ENST00000401405.3
|
CBX7
|
chromobox homolog 7 |
| chr21_-_43916433 | 0.33 |
ENST00000291536.3
|
RSPH1
|
radial spoke head 1 homolog (Chlamydomonas) |
| chr12_+_112451222 | 0.31 |
ENST00000552052.1
|
ERP29
|
endoplasmic reticulum protein 29 |
| chr17_-_72968837 | 0.30 |
ENST00000581676.1
|
HID1
|
HID1 domain containing |
| chr11_-_64512469 | 0.28 |
ENST00000377485.1
|
RASGRP2
|
RAS guanyl releasing protein 2 (calcium and DAG-regulated) |
| chr17_+_41177220 | 0.28 |
ENST00000587250.2
ENST00000544533.1 |
RND2
|
Rho family GTPase 2 |
| chr2_-_241500168 | 0.27 |
ENST00000443318.1
ENST00000411765.1 |
ANKMY1
|
ankyrin repeat and MYND domain containing 1 |
| chr19_+_3224700 | 0.27 |
ENST00000292672.2
ENST00000541430.2 |
CELF5
|
CUGBP, Elav-like family member 5 |
| chr12_-_113658826 | 0.27 |
ENST00000546692.1
|
IQCD
|
IQ motif containing D |
| chr19_-_1863567 | 0.27 |
ENST00000250916.4
|
KLF16
|
Kruppel-like factor 16 |
| chr1_-_9189144 | 0.27 |
ENST00000414642.2
|
GPR157
|
G protein-coupled receptor 157 |
| chr8_-_142318398 | 0.27 |
ENST00000520137.1
|
SLC45A4
|
solute carrier family 45, member 4 |
| chr21_+_44394742 | 0.26 |
ENST00000432907.2
|
PKNOX1
|
PBX/knotted 1 homeobox 1 |
| chr3_-_135915146 | 0.26 |
ENST00000473093.1
|
MSL2
|
male-specific lethal 2 homolog (Drosophila) |
| chr19_-_44258770 | 0.26 |
ENST00000601925.1
ENST00000602222.1 ENST00000599804.1 |
SMG9
|
SMG9 nonsense mediated mRNA decay factor |
| chr6_+_99282570 | 0.26 |
ENST00000328345.5
|
POU3F2
|
POU class 3 homeobox 2 |
| chr19_-_10047219 | 0.26 |
ENST00000264833.4
|
OLFM2
|
olfactomedin 2 |
| chr16_-_89268070 | 0.26 |
ENST00000562855.2
|
SLC22A31
|
solute carrier family 22, member 31 |
| chr19_-_44258733 | 0.25 |
ENST00000597586.1
ENST00000596714.1 |
SMG9
|
SMG9 nonsense mediated mRNA decay factor |
| chr1_-_15850676 | 0.25 |
ENST00000440484.1
ENST00000333868.5 |
CASP9
|
caspase 9, apoptosis-related cysteine peptidase |
| chr17_-_19281203 | 0.24 |
ENST00000487415.2
|
B9D1
|
B9 protein domain 1 |
| chr19_-_3869012 | 0.24 |
ENST00000592398.1
ENST00000262961.4 ENST00000439086.2 |
ZFR2
|
zinc finger RNA binding protein 2 |
| chr19_-_55669093 | 0.24 |
ENST00000344887.5
|
TNNI3
|
troponin I type 3 (cardiac) |
| chr3_-_50649192 | 0.24 |
ENST00000443053.2
ENST00000348721.3 |
CISH
|
cytokine inducible SH2-containing protein |
| chr10_-_7708918 | 0.24 |
ENST00000256861.6
ENST00000397146.2 ENST00000446830.2 ENST00000397145.2 |
ITIH5
|
inter-alpha-trypsin inhibitor heavy chain family, member 5 |
| chrX_-_1331527 | 0.23 |
ENST00000381567.3
ENST00000381566.1 ENST00000400841.2 |
CRLF2
|
cytokine receptor-like factor 2 |
| chr16_-_11350036 | 0.23 |
ENST00000332029.2
|
SOCS1
|
suppressor of cytokine signaling 1 |
| chr16_+_67465016 | 0.23 |
ENST00000326152.5
|
HSD11B2
|
hydroxysteroid (11-beta) dehydrogenase 2 |
| chr11_+_134201911 | 0.23 |
ENST00000389881.3
|
GLB1L2
|
galactosidase, beta 1-like 2 |
| chr9_+_140500087 | 0.23 |
ENST00000371421.4
|
ARRDC1
|
arrestin domain containing 1 |
| chr3_+_186648507 | 0.23 |
ENST00000458216.1
|
ST6GAL1
|
ST6 beta-galactosamide alpha-2,6-sialyltranferase 1 |
| chr19_-_55668093 | 0.23 |
ENST00000588882.1
ENST00000586858.1 |
TNNI3
|
troponin I type 3 (cardiac) |
| chr22_+_51112800 | 0.23 |
ENST00000414786.2
|
SHANK3
|
SH3 and multiple ankyrin repeat domains 3 |
| chr11_+_134201768 | 0.22 |
ENST00000535456.2
ENST00000339772.7 |
GLB1L2
|
galactosidase, beta 1-like 2 |
| chr4_-_1107306 | 0.22 |
ENST00000433731.2
ENST00000333673.5 ENST00000382968.5 |
RNF212
|
ring finger protein 212 |
| chrX_-_48814810 | 0.22 |
ENST00000376488.3
ENST00000396743.3 ENST00000156084.4 |
OTUD5
|
OTU domain containing 5 |
| chr1_+_44457441 | 0.22 |
ENST00000466180.1
|
CCDC24
|
coiled-coil domain containing 24 |
| chr9_+_129986734 | 0.22 |
ENST00000444677.1
|
GARNL3
|
GTPase activating Rap/RanGAP domain-like 3 |
| chr5_-_138739739 | 0.22 |
ENST00000514983.1
ENST00000507779.2 ENST00000451821.2 ENST00000450845.2 ENST00000509959.1 ENST00000302091.5 |
SPATA24
|
spermatogenesis associated 24 |
| chr1_+_43424698 | 0.22 |
ENST00000431759.1
|
SLC2A1-AS1
|
SLC2A1 antisense RNA 1 |
| chr8_-_145060593 | 0.22 |
ENST00000313059.5
ENST00000524918.1 ENST00000313028.7 ENST00000525773.1 |
PARP10
|
poly (ADP-ribose) polymerase family, member 10 |
| chr19_+_45349630 | 0.22 |
ENST00000252483.5
|
PVRL2
|
poliovirus receptor-related 2 (herpesvirus entry mediator B) |
| chr21_-_45660723 | 0.21 |
ENST00000344330.4
ENST00000407780.3 ENST00000400379.3 |
ICOSLG
|
inducible T-cell co-stimulator ligand |
| chr17_+_81037473 | 0.21 |
ENST00000320095.7
|
METRNL
|
meteorin, glial cell differentiation regulator-like |
| chr9_-_35658007 | 0.21 |
ENST00000602361.1
|
RMRP
|
RNA component of mitochondrial RNA processing endoribonuclease |
| chr11_+_369804 | 0.21 |
ENST00000329962.6
|
B4GALNT4
|
beta-1,4-N-acetyl-galactosaminyl transferase 4 |
| chrX_+_53449805 | 0.21 |
ENST00000414955.2
|
RIBC1
|
RIB43A domain with coiled-coils 1 |
| chr17_-_19015945 | 0.21 |
ENST00000573866.2
|
SNORD3D
|
small nucleolar RNA, C/D box 3D |
| chr1_-_200992827 | 0.21 |
ENST00000332129.2
ENST00000422435.2 |
KIF21B
|
kinesin family member 21B |
| chr2_+_232575168 | 0.21 |
ENST00000440384.1
|
PTMA
|
prothymosin, alpha |
| chr22_-_39548627 | 0.21 |
ENST00000216133.5
|
CBX7
|
chromobox homolog 7 |
| chr2_+_74212073 | 0.21 |
ENST00000441217.1
|
AC073046.25
|
AC073046.25 |
| chr9_+_139873264 | 0.21 |
ENST00000446677.1
|
PTGDS
|
prostaglandin D2 synthase 21kDa (brain) |
| chr4_+_1714548 | 0.21 |
ENST00000605571.1
|
RP11-572O17.1
|
RP11-572O17.1 |
| chrX_+_53449839 | 0.21 |
ENST00000457095.1
|
RIBC1
|
RIB43A domain with coiled-coils 1 |
| chr15_+_80445232 | 0.20 |
ENST00000561421.1
|
FAH
|
fumarylacetoacetate hydrolase (fumarylacetoacetase) |
| chr16_+_88519669 | 0.20 |
ENST00000319555.3
|
ZFPM1
|
zinc finger protein, FOG family member 1 |
| chr19_+_49866851 | 0.20 |
ENST00000221498.2
ENST00000596402.1 |
DKKL1
|
dickkopf-like 1 |
| chr16_+_68279256 | 0.20 |
ENST00000564827.2
ENST00000566188.1 ENST00000444212.2 ENST00000568082.1 |
PLA2G15
|
phospholipase A2, group XV |
| chr6_+_11537910 | 0.20 |
ENST00000543875.1
|
TMEM170B
|
transmembrane protein 170B |
| chr10_-_18948208 | 0.20 |
ENST00000607346.1
|
ARL5B-AS1
|
ARL5B antisense RNA 1 |
| chr1_+_10057274 | 0.20 |
ENST00000294435.7
|
RBP7
|
retinol binding protein 7, cellular |
| chr11_+_64008525 | 0.20 |
ENST00000449942.2
|
FKBP2
|
FK506 binding protein 2, 13kDa |
| chr11_-_615570 | 0.20 |
ENST00000525445.1
ENST00000348655.6 ENST00000397566.1 |
IRF7
|
interferon regulatory factor 7 |
| chr4_+_17578815 | 0.20 |
ENST00000226299.4
|
LAP3
|
leucine aminopeptidase 3 |
| chr16_-_4303767 | 0.20 |
ENST00000573268.1
ENST00000573042.1 |
RP11-95P2.1
|
RP11-95P2.1 |
| chr7_+_5322561 | 0.19 |
ENST00000396872.3
ENST00000444741.1 ENST00000297195.4 ENST00000406453.3 |
SLC29A4
|
solute carrier family 29 (equilibrative nucleoside transporter), member 4 |
| chr11_-_615942 | 0.19 |
ENST00000397562.3
ENST00000330243.5 ENST00000397570.1 ENST00000397574.2 |
IRF7
|
interferon regulatory factor 7 |
| chr19_-_2096478 | 0.19 |
ENST00000591236.1
ENST00000589902.1 |
MOB3A
|
MOB kinase activator 3A |
| chr4_+_17579110 | 0.19 |
ENST00000606142.1
|
LAP3
|
leucine aminopeptidase 3 |
| chr4_-_187112626 | 0.19 |
ENST00000596414.1
|
AC110771.1
|
Uncharacterized protein |
| chr20_+_48599506 | 0.19 |
ENST00000244050.2
|
SNAI1
|
snail family zinc finger 1 |
| chr16_+_30934376 | 0.19 |
ENST00000562798.1
ENST00000471231.2 |
FBXL19
|
F-box and leucine-rich repeat protein 19 |
| chr19_-_11456935 | 0.19 |
ENST00000590788.1
ENST00000586590.1 ENST00000589555.1 ENST00000586956.1 ENST00000593256.2 ENST00000447337.1 ENST00000591677.1 ENST00000586701.1 ENST00000589655.1 |
TMEM205
RAB3D
|
transmembrane protein 205 RAB3D, member RAS oncogene family |
| chr19_-_14168391 | 0.19 |
ENST00000589048.1
|
PALM3
|
paralemmin 3 |
| chr4_-_152329987 | 0.19 |
ENST00000508847.1
|
RP11-610P16.1
|
RP11-610P16.1 |
| chr11_+_46402482 | 0.19 |
ENST00000441869.1
|
MDK
|
midkine (neurite growth-promoting factor 2) |
| chr3_+_50606577 | 0.19 |
ENST00000434410.1
ENST00000232854.4 |
HEMK1
|
HemK methyltransferase family member 1 |
| chr9_+_2621950 | 0.19 |
ENST00000382096.1
|
VLDLR
|
very low density lipoprotein receptor |
| chr19_-_50836762 | 0.19 |
ENST00000474951.1
ENST00000391818.2 |
KCNC3
|
potassium voltage-gated channel, Shaw-related subfamily, member 3 |
| chr11_+_66234216 | 0.19 |
ENST00000349459.6
ENST00000320740.7 ENST00000524466.1 ENST00000526296.1 |
PELI3
|
pellino E3 ubiquitin protein ligase family member 3 |
| chr12_-_49581152 | 0.18 |
ENST00000550811.1
|
TUBA1A
|
tubulin, alpha 1a |
| chr19_+_41869894 | 0.18 |
ENST00000413014.2
|
TMEM91
|
transmembrane protein 91 |
| chr3_+_50606901 | 0.18 |
ENST00000455834.1
|
HEMK1
|
HemK methyltransferase family member 1 |
| chrX_-_134232630 | 0.18 |
ENST00000535837.1
ENST00000433425.2 |
LINC00087
|
long intergenic non-protein coding RNA 87 |
| chr12_-_110318130 | 0.18 |
ENST00000540772.1
|
GLTP
|
glycolipid transfer protein |
| chr15_+_80445113 | 0.18 |
ENST00000407106.1
ENST00000261755.5 |
FAH
|
fumarylacetoacetate hydrolase (fumarylacetoacetase) |
| chr16_+_777739 | 0.18 |
ENST00000563792.1
|
HAGHL
|
hydroxyacylglutathione hydrolase-like |
| chr8_-_119634141 | 0.18 |
ENST00000409003.4
ENST00000526328.1 ENST00000314727.4 ENST00000526765.1 |
SAMD12
|
sterile alpha motif domain containing 12 |
| chr19_+_13229126 | 0.18 |
ENST00000292431.4
|
NACC1
|
nucleus accumbens associated 1, BEN and BTB (POZ) domain containing |
| chr19_+_47778119 | 0.18 |
ENST00000552360.2
|
PRR24
|
proline rich 24 |
| chr19_-_50979981 | 0.18 |
ENST00000595790.1
ENST00000600100.1 |
FAM71E1
|
family with sequence similarity 71, member E1 |
| chr10_+_91152303 | 0.18 |
ENST00000371804.3
|
IFIT1
|
interferon-induced protein with tetratricopeptide repeats 1 |
| chr1_-_228401338 | 0.17 |
ENST00000295012.5
|
C1orf145
|
chromosome 1 open reading frame 145 |
| chr14_+_105266933 | 0.17 |
ENST00000555360.1
|
ZBTB42
|
zinc finger and BTB domain containing 42 |
| chr11_-_118927880 | 0.17 |
ENST00000527038.2
|
HYOU1
|
hypoxia up-regulated 1 |
| chr5_+_177540444 | 0.17 |
ENST00000274605.5
|
N4BP3
|
NEDD4 binding protein 3 |
| chr22_-_38966172 | 0.17 |
ENST00000216024.2
|
DMC1
|
DNA meiotic recombinase 1 |
| chr2_+_105471969 | 0.17 |
ENST00000361360.2
|
POU3F3
|
POU class 3 homeobox 3 |
| chr12_-_6982442 | 0.17 |
ENST00000523102.1
ENST00000524270.1 ENST00000519357.1 |
SPSB2
|
splA/ryanodine receptor domain and SOCS box containing 2 |
| chrX_+_153237740 | 0.17 |
ENST00000369982.4
|
TMEM187
|
transmembrane protein 187 |
| chr19_-_15236173 | 0.17 |
ENST00000527093.1
|
ILVBL
|
ilvB (bacterial acetolactate synthase)-like |
| chr17_-_74449252 | 0.17 |
ENST00000319380.7
|
UBE2O
|
ubiquitin-conjugating enzyme E2O |
| chr8_+_58907104 | 0.17 |
ENST00000361488.3
|
FAM110B
|
family with sequence similarity 110, member B |
| chr16_+_30969055 | 0.17 |
ENST00000452917.1
|
SETD1A
|
SET domain containing 1A |
| chr16_+_730379 | 0.17 |
ENST00000567173.1
|
STUB1
|
STIP1 homology and U-box containing protein 1, E3 ubiquitin protein ligase |
| chr6_-_33285505 | 0.17 |
ENST00000431845.2
|
ZBTB22
|
zinc finger and BTB domain containing 22 |
| chr4_+_129732419 | 0.17 |
ENST00000510308.1
|
PHF17
|
jade family PHD finger 1 |
| chr16_+_730063 | 0.17 |
ENST00000565677.1
ENST00000219548.4 |
STUB1
|
STIP1 homology and U-box containing protein 1, E3 ubiquitin protein ligase |
| chr17_-_79196799 | 0.16 |
ENST00000269392.4
|
AZI1
|
5-azacytidine induced 1 |
| chr6_+_31515337 | 0.16 |
ENST00000376148.4
ENST00000376145.4 |
NFKBIL1
|
nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor-like 1 |
| chr1_+_33546714 | 0.16 |
ENST00000294517.6
ENST00000358680.3 ENST00000373443.3 ENST00000398167.1 |
ADC
|
arginine decarboxylase |
| chr19_-_7936344 | 0.16 |
ENST00000599142.1
|
CTD-3193O13.9
|
Protein FLJ22184 |
| chr13_+_52158610 | 0.16 |
ENST00000298125.5
|
WDFY2
|
WD repeat and FYVE domain containing 2 |
| chr17_+_29815013 | 0.16 |
ENST00000394744.2
|
RAB11FIP4
|
RAB11 family interacting protein 4 (class II) |
| chr19_-_18314836 | 0.16 |
ENST00000464076.3
ENST00000222256.4 |
RAB3A
|
RAB3A, member RAS oncogene family |
| chr19_+_7571968 | 0.16 |
ENST00000599312.1
|
CTD-2207O23.12
|
Uncharacterized protein |
| chr11_+_64008443 | 0.16 |
ENST00000309366.4
|
FKBP2
|
FK506 binding protein 2, 13kDa |
| chr19_+_56653064 | 0.16 |
ENST00000593100.1
|
ZNF444
|
zinc finger protein 444 |
| chr2_-_178129551 | 0.16 |
ENST00000430047.1
|
NFE2L2
|
nuclear factor, erythroid 2-like 2 |
| chr10_-_135122603 | 0.16 |
ENST00000368563.2
|
TUBGCP2
|
tubulin, gamma complex associated protein 2 |
| chr19_+_19516561 | 0.16 |
ENST00000457895.2
|
GATAD2A
|
GATA zinc finger domain containing 2A |
| chr19_-_54567035 | 0.16 |
ENST00000366170.2
ENST00000425006.2 |
VSTM1
|
V-set and transmembrane domain containing 1 |
| chr11_+_71498552 | 0.16 |
ENST00000346333.6
ENST00000359244.4 ENST00000426628.2 |
FAM86C1
|
family with sequence similarity 86, member C1 |
| chr15_+_31619013 | 0.16 |
ENST00000307145.3
|
KLF13
|
Kruppel-like factor 13 |
| chr1_-_38471156 | 0.16 |
ENST00000373016.3
|
FHL3
|
four and a half LIM domains 3 |
| chr11_-_17410629 | 0.16 |
ENST00000526912.1
|
KCNJ11
|
potassium inwardly-rectifying channel, subfamily J, member 11 |
| chr19_+_41083064 | 0.16 |
ENST00000595631.1
|
SHKBP1
|
SH3KBP1 binding protein 1 |
| chr1_+_151253991 | 0.16 |
ENST00000443959.1
|
ZNF687
|
zinc finger protein 687 |
| chr16_-_1993124 | 0.16 |
ENST00000473663.1
ENST00000399753.2 ENST00000564908.1 |
MSRB1
|
methionine sulfoxide reductase B1 |
| chr4_+_76439649 | 0.16 |
ENST00000507557.1
|
THAP6
|
THAP domain containing 6 |
| chr22_+_45148432 | 0.16 |
ENST00000389774.2
ENST00000396119.2 ENST00000336963.4 ENST00000356099.6 ENST00000412433.1 |
ARHGAP8
|
Rho GTPase activating protein 8 |
| chr3_-_128840604 | 0.15 |
ENST00000476465.1
ENST00000315150.5 ENST00000393304.1 ENST00000393308.1 ENST00000393307.1 ENST00000393305.1 |
RAB43
|
RAB43, member RAS oncogene family |
| chr6_+_14117872 | 0.15 |
ENST00000379153.3
|
CD83
|
CD83 molecule |
| chr19_+_17326141 | 0.15 |
ENST00000445667.2
ENST00000263897.5 |
USE1
|
unconventional SNARE in the ER 1 homolog (S. cerevisiae) |
| chr2_+_24272543 | 0.15 |
ENST00000380991.4
|
FKBP1B
|
FK506 binding protein 1B, 12.6 kDa |
| chr7_+_1084206 | 0.15 |
ENST00000444847.1
|
GPR146
|
G protein-coupled receptor 146 |
| chrX_+_47092791 | 0.15 |
ENST00000377080.3
|
USP11
|
ubiquitin specific peptidase 11 |
| chr11_-_67188642 | 0.15 |
ENST00000546202.1
ENST00000542876.1 |
PPP1CA
|
protein phosphatase 1, catalytic subunit, alpha isozyme |
| chr22_-_50746027 | 0.15 |
ENST00000425954.1
ENST00000449103.1 |
PLXNB2
|
plexin B2 |
| chr17_-_80291818 | 0.15 |
ENST00000269389.3
ENST00000581691.1 |
SECTM1
|
secreted and transmembrane 1 |
| chr1_+_65886244 | 0.15 |
ENST00000344610.8
|
LEPR
|
leptin receptor |
| chr17_-_55162360 | 0.15 |
ENST00000576871.1
ENST00000576313.1 |
RP11-166P13.3
|
RP11-166P13.3 |
| chrX_-_49056635 | 0.15 |
ENST00000472598.1
ENST00000538567.1 ENST00000479808.1 ENST00000263233.4 |
SYP
|
synaptophysin |
| chr19_+_917287 | 0.15 |
ENST00000592648.1
ENST00000234371.5 |
KISS1R
|
KISS1 receptor |
| chr17_+_27055798 | 0.15 |
ENST00000268766.6
|
NEK8
|
NIMA-related kinase 8 |
| chr19_-_54693521 | 0.15 |
ENST00000391754.1
ENST00000245615.1 ENST00000431666.2 |
MBOAT7
|
membrane bound O-acyltransferase domain containing 7 |
| chr1_+_154975110 | 0.15 |
ENST00000535420.1
ENST00000368426.3 |
ZBTB7B
|
zinc finger and BTB domain containing 7B |
| chr16_+_2273645 | 0.15 |
ENST00000565413.1
|
E4F1
|
E4F transcription factor 1 |
| chr1_-_15850839 | 0.15 |
ENST00000348549.5
ENST00000546424.1 |
CASP9
|
caspase 9, apoptosis-related cysteine peptidase |
| chr10_+_131265443 | 0.15 |
ENST00000306010.7
|
MGMT
|
O-6-methylguanine-DNA methyltransferase |
| chr19_+_29704142 | 0.15 |
ENST00000587859.1
ENST00000590607.1 |
CTB-32O4.2
|
CTB-32O4.2 |
| chr22_+_38035623 | 0.15 |
ENST00000336738.5
ENST00000442465.2 |
SH3BP1
|
SH3-domain binding protein 1 |
| chr20_+_10199566 | 0.15 |
ENST00000430336.1
|
SNAP25
|
synaptosomal-associated protein, 25kDa |
| chr8_-_144651024 | 0.15 |
ENST00000524906.1
ENST00000532862.1 ENST00000534459.1 |
MROH6
|
maestro heat-like repeat family member 6 |
| chr11_-_118927735 | 0.15 |
ENST00000526656.1
|
HYOU1
|
hypoxia up-regulated 1 |
| chr17_-_72772425 | 0.15 |
ENST00000578822.1
|
NAT9
|
N-acetyltransferase 9 (GCN5-related, putative) |
| chr3_-_183979251 | 0.15 |
ENST00000296238.3
|
CAMK2N2
|
calcium/calmodulin-dependent protein kinase II inhibitor 2 |
| chr19_-_11456722 | 0.15 |
ENST00000354882.5
|
TMEM205
|
transmembrane protein 205 |
| chr2_+_85811525 | 0.15 |
ENST00000306384.4
|
VAMP5
|
vesicle-associated membrane protein 5 |
| chr6_+_36165133 | 0.15 |
ENST00000446974.1
ENST00000454960.1 |
BRPF3
|
bromodomain and PHD finger containing, 3 |
| chrX_-_153775426 | 0.15 |
ENST00000393562.2
|
G6PD
|
glucose-6-phosphate dehydrogenase |
| chr3_-_53080047 | 0.15 |
ENST00000482396.1
ENST00000358080.2 ENST00000296295.6 ENST00000394752.3 |
SFMBT1
|
Scm-like with four mbt domains 1 |
| chr1_-_11741155 | 0.15 |
ENST00000445656.1
ENST00000376669.5 ENST00000456915.1 ENST00000376692.4 |
MAD2L2
|
MAD2 mitotic arrest deficient-like 2 (yeast) |
| chr21_-_45682099 | 0.15 |
ENST00000270172.3
ENST00000418993.1 |
DNMT3L
|
DNA (cytosine-5-)-methyltransferase 3-like |
| chr7_-_20826504 | 0.15 |
ENST00000418710.2
ENST00000361443.4 |
SP8
|
Sp8 transcription factor |
| chr22_-_30685596 | 0.15 |
ENST00000404953.3
ENST00000407689.3 |
GATSL3
|
GATS protein-like 3 |
| chr16_+_2933209 | 0.14 |
ENST00000293981.6
|
FLYWCH2
|
FLYWCH family member 2 |
| chr17_-_56591978 | 0.14 |
ENST00000583656.1
|
MTMR4
|
myotubularin related protein 4 |
| chr19_-_17559376 | 0.14 |
ENST00000341130.5
|
TMEM221
|
transmembrane protein 221 |
| chr16_+_87636474 | 0.14 |
ENST00000284262.2
|
JPH3
|
junctophilin 3 |
| chr2_+_235860690 | 0.14 |
ENST00000416021.1
|
SH3BP4
|
SH3-domain binding protein 4 |
| chr19_-_409134 | 0.14 |
ENST00000332235.6
|
C2CD4C
|
C2 calcium-dependent domain containing 4C |
| chr21_+_44073860 | 0.14 |
ENST00000335512.4
ENST00000539837.1 ENST00000291539.6 ENST00000380328.2 ENST00000398232.3 ENST00000398234.3 ENST00000398236.3 ENST00000328862.6 ENST00000335440.6 ENST00000398225.3 ENST00000398229.3 ENST00000398227.3 |
PDE9A
|
phosphodiesterase 9A |
| chr19_-_663171 | 0.14 |
ENST00000606896.1
ENST00000589762.2 |
RNF126
|
ring finger protein 126 |
| chr1_+_164528616 | 0.14 |
ENST00000340699.3
|
PBX1
|
pre-B-cell leukemia homeobox 1 |
| chr3_+_49840685 | 0.14 |
ENST00000333323.4
|
FAM212A
|
family with sequence similarity 212, member A |
| chr20_-_61493115 | 0.14 |
ENST00000335351.3
ENST00000217162.5 |
TCFL5
|
transcription factor-like 5 (basic helix-loop-helix) |
| chr5_+_176853669 | 0.14 |
ENST00000355472.5
|
GRK6
|
G protein-coupled receptor kinase 6 |
| chr6_+_31514622 | 0.14 |
ENST00000376146.4
|
NFKBIL1
|
nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor-like 1 |
| chr17_+_16945820 | 0.14 |
ENST00000577514.1
|
MPRIP
|
myosin phosphatase Rho interacting protein |
| chr21_+_45875354 | 0.14 |
ENST00000291592.4
|
LRRC3
|
leucine rich repeat containing 3 |
| chr1_+_11333546 | 0.14 |
ENST00000376804.2
|
UBIAD1
|
UbiA prenyltransferase domain containing 1 |
| chr14_-_92414294 | 0.14 |
ENST00000554468.1
|
FBLN5
|
fibulin 5 |
| chr9_+_139685782 | 0.14 |
ENST00000290079.8
ENST00000456614.2 |
TMEM141
RP11-216L13.17
|
transmembrane protein 141 RP11-216L13.17 |
| chr22_-_38794490 | 0.14 |
ENST00000400206.2
|
CSNK1E
|
casein kinase 1, epsilon |
| chr19_+_827823 | 0.14 |
ENST00000233997.2
|
AZU1
|
azurocidin 1 |
| chr9_-_139891165 | 0.14 |
ENST00000494426.1
|
CLIC3
|
chloride intracellular channel 3 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.5 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.1 | 0.4 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.1 | 0.5 | GO:1903381 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.1 | 0.1 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
| 0.1 | 0.3 | GO:0003192 | mitral valve formation(GO:0003192) |
| 0.1 | 0.3 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.1 | 0.6 | GO:0090034 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.1 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.1 | 0.3 | GO:0070429 | regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) tolerance induction to lipopolysaccharide(GO:0072573) negative regulation of CD40 signaling pathway(GO:2000349) |
| 0.1 | 0.5 | GO:0015887 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 0.1 | 0.2 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
| 0.1 | 0.2 | GO:0070377 | regulation of ERK5 cascade(GO:0070376) negative regulation of ERK5 cascade(GO:0070377) |
| 0.1 | 0.5 | GO:0010286 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.1 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.1 | 0.2 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 0.1 | 0.2 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.1 | 0.2 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 0.1 | 0.1 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.1 | 0.3 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.4 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.1 | 0.3 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.1 | 0.2 | GO:1990926 | short-term synaptic potentiation(GO:1990926) |
| 0.1 | 0.1 | GO:0035900 | response to isolation stress(GO:0035900) |
| 0.1 | 0.4 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 0.2 | GO:0043311 | regulation of eosinophil degranulation(GO:0043309) positive regulation of eosinophil degranulation(GO:0043311) regulation of eosinophil activation(GO:1902566) positive regulation of eosinophil activation(GO:1902568) |
| 0.1 | 0.2 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.1 | 0.3 | GO:0015862 | uridine transport(GO:0015862) pyrimidine nucleoside transport(GO:0015864) |
| 0.1 | 0.1 | GO:0060629 | regulation of homologous chromosome segregation(GO:0060629) |
| 0.1 | 0.2 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 | 0.1 | GO:0051492 | regulation of stress fiber assembly(GO:0051492) |
| 0.1 | 0.3 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.1 | 0.3 | GO:0030421 | defecation(GO:0030421) |
| 0.1 | 0.2 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.1 | 0.2 | GO:1903450 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
| 0.1 | 0.1 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.1 | 0.3 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.1 | 0.4 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.2 | GO:0019516 | lactate oxidation(GO:0019516) |
| 0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 0.1 | GO:0051604 | protein maturation(GO:0051604) |
| 0.1 | 0.1 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 0.0 | 0.1 | GO:0045362 | interleukin-1 biosynthetic process(GO:0042222) regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
| 0.0 | 0.2 | GO:0043474 | eye pigment biosynthetic process(GO:0006726) eye pigment metabolic process(GO:0042441) pigment metabolic process involved in developmental pigmentation(GO:0043324) pigment metabolic process involved in pigmentation(GO:0043474) |
| 0.0 | 0.0 | GO:0007588 | excretion(GO:0007588) |
| 0.0 | 0.2 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.0 | 0.2 | GO:0006311 | meiotic gene conversion(GO:0006311) |
| 0.0 | 0.1 | GO:1902356 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
| 0.0 | 0.2 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.0 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.2 | GO:0051097 | negative regulation of helicase activity(GO:0051097) |
| 0.0 | 0.0 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.0 | 0.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.0 | 0.2 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.1 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.0 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.0 | 0.4 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.2 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
| 0.0 | 0.1 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.0 | 0.3 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.1 | GO:1904617 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.0 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.0 | 0.1 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
| 0.0 | 0.1 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
| 0.0 | 0.4 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.0 | 0.1 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.0 | 0.1 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.0 | 0.3 | GO:2000782 | regulation of unidimensional cell growth(GO:0051510) negative regulation of unidimensional cell growth(GO:0051511) establishment of cell polarity regulating cell shape(GO:0071964) regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000769) positive regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000771) regulation of establishment of cell polarity regulating cell shape(GO:2000782) positive regulation of establishment of cell polarity regulating cell shape(GO:2000784) positive regulation of barbed-end actin filament capping(GO:2000814) |
| 0.0 | 0.2 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.0 | 0.2 | GO:0099640 | axo-dendritic protein transport(GO:0099640) |
| 0.0 | 0.1 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.0 | 0.1 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.0 | 0.2 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 0.0 | 0.0 | GO:0032707 | negative regulation of interleukin-23 production(GO:0032707) |
| 0.0 | 0.2 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.0 | 0.2 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.0 | 0.1 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.0 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 | 0.1 | GO:0090274 | regulation of somatostatin secretion(GO:0090273) positive regulation of somatostatin secretion(GO:0090274) |
| 0.0 | 0.3 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.0 | 0.0 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
| 0.0 | 0.5 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.2 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.0 | 0.0 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.1 | GO:2000625 | regulation of miRNA catabolic process(GO:2000625) positive regulation of miRNA catabolic process(GO:2000627) |
| 0.0 | 0.1 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.0 | 0.0 | GO:0022009 | establishment of endothelial blood-brain barrier(GO:0014045) central nervous system vasculogenesis(GO:0022009) |
| 0.0 | 0.1 | GO:0035568 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.0 | 0.1 | GO:2000656 | regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
| 0.0 | 0.2 | GO:0016333 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.0 | 0.1 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.0 | 0.1 | GO:1902811 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.0 | 0.2 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.0 | 0.2 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.0 | 0.1 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.0 | 0.1 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
| 0.0 | 0.1 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.0 | 0.1 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.0 | 0.2 | GO:1901536 | negative regulation of DNA demethylation(GO:1901536) |
| 0.0 | 0.6 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.3 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.1 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.0 | 0.1 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.0 | 0.1 | GO:1902661 | positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.0 | 0.1 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 0.4 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.0 | 0.1 | GO:0035419 | activation of MAPK activity involved in innate immune response(GO:0035419) |
| 0.0 | 0.0 | GO:0090102 | cochlea development(GO:0090102) |
| 0.0 | 0.1 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.0 | 0.2 | GO:0032479 | regulation of type I interferon production(GO:0032479) |
| 0.0 | 0.1 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.0 | 0.1 | GO:0048627 | myoblast development(GO:0048627) |
| 0.0 | 0.1 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 0.0 | 0.1 | GO:0021888 | hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
| 0.0 | 0.9 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.1 | GO:0061145 | bronchus cartilage development(GO:0060532) lung smooth muscle development(GO:0061145) |
| 0.0 | 0.1 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 0.0 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.1 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.0 | 0.1 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.0 | 0.0 | GO:1904783 | positive regulation of NMDA glutamate receptor activity(GO:1904783) |
| 0.0 | 0.3 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.1 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
| 0.0 | 0.1 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 0.0 | 0.1 | GO:1901291 | negative regulation of double-strand break repair via single-strand annealing(GO:1901291) |
| 0.0 | 0.1 | GO:0060380 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
| 0.0 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.1 | GO:0090096 | regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 0.0 | 0.2 | GO:2001151 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
| 0.0 | 0.2 | GO:1901093 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.0 | 0.0 | GO:1901420 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) negative regulation of response to alcohol(GO:1901420) |
| 0.0 | 0.2 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.0 | 0.8 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.3 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.0 | 0.1 | GO:0002065 | columnar/cuboidal epithelial cell differentiation(GO:0002065) |
| 0.0 | 0.2 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.4 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.0 | 0.0 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.0 | 0.1 | GO:1904482 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 0.0 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.0 | 0.2 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.0 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) positive regulation of telomeric DNA binding(GO:1904744) |
| 0.0 | 0.2 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.0 | 0.5 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.0 | 0.0 | GO:0071874 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.0 | 0.0 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
| 0.0 | 0.1 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.0 | 0.1 | GO:0060129 | thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 0.0 | 0.0 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.0 | 0.3 | GO:0032776 | DNA methylation on cytosine(GO:0032776) |
| 0.0 | 0.1 | GO:0061015 | snRNA import into nucleus(GO:0061015) |
| 0.0 | 0.1 | GO:0003275 | apoptotic process involved in outflow tract morphogenesis(GO:0003275) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) |
| 0.0 | 0.4 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.0 | 0.1 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.0 | 0.1 | GO:1905053 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.0 | 0.4 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.0 | GO:0010921 | regulation of phosphatase activity(GO:0010921) |
| 0.0 | 0.1 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.0 | 0.4 | GO:1901642 | nucleoside transmembrane transport(GO:1901642) |
| 0.0 | 0.0 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.0 | 0.1 | GO:0046439 | cysteine biosynthetic process from serine(GO:0006535) cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.0 | 0.0 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.0 | 0.1 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.0 | 0.0 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.0 | 0.1 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.0 | 0.2 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.0 | 0.1 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.0 | 0.1 | GO:1904875 | regulation of DNA ligase activity(GO:1904875) |
| 0.0 | 0.1 | GO:0060032 | notochord regression(GO:0060032) |
| 0.0 | 0.2 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.1 | GO:1902563 | regulation of neutrophil degranulation(GO:0043313) regulation of neutrophil activation(GO:1902563) |
| 0.0 | 0.1 | GO:1904586 | response to putrescine(GO:1904585) cellular response to putrescine(GO:1904586) hepatocyte dedifferentiation(GO:1990828) |
| 0.0 | 0.1 | GO:0072287 | metanephric distal tubule morphogenesis(GO:0072287) |
| 0.0 | 0.4 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.0 | 0.1 | GO:0003285 | septum secundum development(GO:0003285) |
| 0.0 | 0.0 | GO:0043000 | Golgi to plasma membrane CFTR protein transport(GO:0043000) |
| 0.0 | 0.2 | GO:2000538 | regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.0 | 0.1 | GO:1902995 | positive regulation of engulfment of apoptotic cell(GO:1901076) regulation of phospholipid efflux(GO:1902994) positive regulation of phospholipid efflux(GO:1902995) |
| 0.0 | 0.2 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.0 | 0.3 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
| 0.0 | 0.1 | GO:0060730 | regulation of intestinal epithelial structure maintenance(GO:0060730) |
| 0.0 | 0.2 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.0 | 0.1 | GO:0043602 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.0 | 0.0 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.1 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.0 | 0.1 | GO:1904117 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.0 | 0.1 | GO:2000340 | interleukin-15 production(GO:0032618) chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) positive regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000340) |
| 0.0 | 0.1 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.1 | GO:0045007 | depurination(GO:0045007) |
| 0.0 | 0.1 | GO:0045082 | positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.0 | 0.0 | GO:0090303 | positive regulation of wound healing(GO:0090303) |
| 0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.2 | GO:0035898 | parathyroid hormone secretion(GO:0035898) post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.0 | 0.0 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.0 | 0.0 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.0 | 0.0 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.0 | 0.1 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.0 | 0.1 | GO:1904578 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.0 | 0.1 | GO:1901538 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.0 | 0.1 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.0 | 0.0 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.0 | 0.1 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.0 | 0.1 | GO:0032700 | negative regulation of interleukin-17 production(GO:0032700) |
| 0.0 | 0.1 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.0 | 0.1 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) |
| 0.0 | 0.0 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.0 | 0.1 | GO:0052553 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.0 | 0.4 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.2 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
| 0.0 | 0.1 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.0 | 0.1 | GO:0002276 | basophil activation involved in immune response(GO:0002276) |
| 0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 | 0.1 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.0 | 0.1 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.0 | 0.1 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.0 | 0.1 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.0 | 0.0 | GO:0060922 | atrioventricular node development(GO:0003162) cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
| 0.0 | 0.2 | GO:0003322 | pancreatic A cell development(GO:0003322) |
| 0.0 | 0.0 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.0 | 0.1 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.0 | 0.1 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.0 | 0.1 | GO:1902598 | creatine transport(GO:0015881) creatine transmembrane transport(GO:1902598) |
| 0.0 | 0.2 | GO:1903786 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.0 | 0.1 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.0 | 0.3 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.0 | 0.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.0 | 0.2 | GO:1905232 | cellular response to L-glutamate(GO:1905232) |
| 0.0 | 0.2 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.1 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.0 | 0.1 | GO:0061536 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.0 | 0.2 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.0 | 0.1 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.0 | 0.1 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.1 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.0 | 0.0 | GO:1904376 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.0 | 0.1 | GO:0031456 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.0 | 0.1 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.0 | 0.0 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.0 | 0.0 | GO:0002663 | B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.0 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.1 | GO:0031938 | regulation of chromatin silencing at telomere(GO:0031938) |
| 0.0 | 0.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.0 | 0.0 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.0 | 0.0 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
| 0.0 | 0.0 | GO:0060374 | mast cell differentiation(GO:0060374) |
| 0.0 | 0.2 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 | 0.1 | GO:1903526 | negative regulation of membrane tubulation(GO:1903526) |
| 0.0 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.0 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.0 | 0.4 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.0 | 0.5 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.0 | 0.2 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 | 0.0 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
| 0.0 | 0.6 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.0 | 0.1 | GO:0021557 | oculomotor nerve development(GO:0021557) |
| 0.0 | 0.1 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
| 0.0 | 0.3 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.2 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.0 | 0.1 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.0 | 0.3 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.0 | GO:0042323 | negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 0.0 | 0.0 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.0 | 0.0 | GO:1904862 | inhibitory synapse assembly(GO:1904862) |
| 0.0 | 0.1 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 | 0.0 | GO:0061074 | regulation of neural retina development(GO:0061074) |
| 0.0 | 0.1 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.0 | 0.2 | GO:0060313 | negative regulation of blood vessel remodeling(GO:0060313) |
| 0.0 | 0.0 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.0 | 0.0 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.0 | 0.0 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.0 | 0.1 | GO:0044501 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.0 | 0.1 | GO:0097502 | mannosylation(GO:0097502) |
| 0.0 | 0.0 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 | 0.2 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.0 | 0.0 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.0 | 0.1 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.0 | 0.2 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.0 | 0.3 | GO:1902287 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.0 | 0.0 | GO:0046688 | response to copper ion(GO:0046688) |
| 0.0 | 0.0 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.0 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.0 | 0.2 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.0 | 0.1 | GO:0032796 | uropod organization(GO:0032796) |
| 0.0 | 0.0 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.0 | 0.1 | GO:1902616 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.0 | 0.0 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.0 | 0.0 | GO:0045575 | basophil activation(GO:0045575) |
| 0.0 | 0.0 | GO:0071863 | regulation of cell proliferation in bone marrow(GO:0071863) positive regulation of cell proliferation in bone marrow(GO:0071864) |
| 0.0 | 0.3 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 | 0.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.0 | 0.3 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.0 | GO:0089709 | histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) |
| 0.0 | 0.1 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.0 | 0.0 | GO:0006433 | prolyl-tRNA aminoacylation(GO:0006433) |
| 0.0 | 0.3 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.0 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.0 | 0.1 | GO:0046073 | dTMP biosynthetic process(GO:0006231) dTMP metabolic process(GO:0046073) |
| 0.0 | 0.5 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.0 | 0.0 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.0 | 0.0 | GO:0090343 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
| 0.0 | 0.1 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.0 | 0.1 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.0 | 0.0 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.0 | 0.0 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
| 0.0 | 0.2 | GO:0048293 | isotype switching to IgE isotypes(GO:0048289) regulation of isotype switching to IgE isotypes(GO:0048293) positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.0 | 0.0 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.0 | 0.2 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.0 | 0.1 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 0.0 | 0.0 | GO:1903401 | lysine transport(GO:0015819) L-lysine transport(GO:1902022) L-lysine transmembrane transport(GO:1903401) |
| 0.0 | 0.0 | GO:0035482 | gastric motility(GO:0035482) gastric emptying(GO:0035483) positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.1 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.0 | 0.3 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.0 | 0.2 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.0 | 0.0 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.0 | 0.1 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.0 | 0.0 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.0 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.0 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
| 0.0 | 0.1 | GO:0046725 | negative regulation by virus of viral protein levels in host cell(GO:0046725) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) |
| 0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.1 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.0 | 0.1 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
| 0.0 | 0.1 | GO:0018277 | protein deamination(GO:0018277) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.1 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 | 0.1 | GO:1903519 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.0 | 0.1 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.0 | 0.1 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.0 | 0.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.0 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.0 | 0.0 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 0.1 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 0.0 | 0.2 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.0 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.0 | 0.1 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.0 | 0.1 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.0 | 0.0 | GO:2000506 | negative regulation of energy homeostasis(GO:2000506) |
| 0.0 | 0.0 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.0 | 0.1 | GO:1904844 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.0 | 0.2 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.0 | 0.2 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.0 | 0.1 | GO:0009407 | toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
| 0.0 | 0.1 | GO:0034444 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 0.0 | 0.0 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.0 | 0.0 | GO:2000742 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.0 | 0.0 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.0 | 0.1 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.0 | 0.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 0.1 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.0 | 0.6 | GO:0006735 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.0 | 0.2 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.0 | 0.0 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 0.0 | GO:0043507 | positive regulation of JUN kinase activity(GO:0043507) |
| 0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.1 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.0 | GO:0042088 | T-helper 1 type immune response(GO:0042088) |
| 0.0 | 0.1 | GO:0042144 | vacuole fusion, non-autophagic(GO:0042144) |
| 0.0 | 0.0 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.0 | 0.0 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.0 | 0.2 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.0 | 0.1 | GO:0018262 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
| 0.0 | 0.1 | GO:0019075 | virus maturation(GO:0019075) |
| 0.0 | 0.0 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.0 | 0.1 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.0 | 0.0 | GO:0072684 | mitochondrial tRNA 3'-trailer cleavage, endonucleolytic(GO:0072684) |
| 0.0 | 0.0 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.0 | 0.0 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.1 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.1 | GO:0003207 | cardiac chamber formation(GO:0003207) |
| 0.0 | 0.1 | GO:0002316 | follicular B cell differentiation(GO:0002316) |
| 0.0 | 0.0 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.0 | 0.0 | GO:1902824 | positive regulation of late endosome to lysosome transport(GO:1902824) |
| 0.0 | 0.1 | GO:0070627 | ferrous iron import(GO:0070627) ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.0 | 0.0 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.0 | 0.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.1 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.0 | 0.2 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.0 | 0.0 | GO:0060489 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 0.0 | 0.0 | GO:0090107 | regulation of high-density lipoprotein particle assembly(GO:0090107) |
| 0.0 | 0.0 | GO:0097012 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 | 0.0 | GO:0005985 | sucrose metabolic process(GO:0005985) vacuolar sequestering(GO:0043181) |
| 0.0 | 0.0 | GO:0000494 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.0 | 0.1 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
| 0.0 | 0.1 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.0 | 0.0 | GO:0036034 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.0 | 0.0 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.0 | 0.1 | GO:0007320 | insemination(GO:0007320) |
| 0.0 | 0.0 | GO:0060278 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.0 | 0.0 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.0 | 0.1 | GO:0031272 | pseudopodium assembly(GO:0031269) regulation of pseudopodium assembly(GO:0031272) positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.0 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.0 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 | 0.2 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 0.0 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.0 | 0.0 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.0 | GO:0071400 | cellular response to oleic acid(GO:0071400) |
| 0.0 | 0.0 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
| 0.0 | 0.1 | GO:0018022 | peptidyl-lysine methylation(GO:0018022) |
| 0.0 | 0.0 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 0.0 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.0 | 0.0 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.0 | 0.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 | 0.1 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
| 0.0 | 0.1 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.0 | 0.1 | GO:0010816 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 | 0.1 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.0 | 0.1 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.0 | 0.1 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.0 | 0.1 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 | 0.1 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
| 0.0 | 0.0 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.2 | GO:0010224 | response to UV-B(GO:0010224) |
| 0.0 | 0.5 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.0 | 0.1 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.0 | 0.0 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.0 | 0.0 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.0 | 0.0 | GO:0046110 | xanthine metabolic process(GO:0046110) |
| 0.0 | 0.0 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.0 | 0.1 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 | 0.1 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.0 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.0 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.0 | 0.2 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.0 | 0.0 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.0 | GO:1903393 | positive regulation of adherens junction organization(GO:1903393) |
| 0.0 | 0.0 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.0 | 0.1 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.0 | 0.0 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.0 | 0.0 | GO:0035026 | leading edge cell differentiation(GO:0035026) |
| 0.0 | 0.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 0.0 | GO:1903008 | organelle disassembly(GO:1903008) |
| 0.0 | 0.1 | GO:0006218 | uridine catabolic process(GO:0006218) |
| 0.0 | 0.1 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
| 0.0 | 0.0 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
| 0.0 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.0 | 0.0 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.0 | 0.1 | GO:0019056 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.0 | 0.0 | GO:0050807 | regulation of synapse organization(GO:0050807) |
| 0.0 | 0.0 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
| 0.0 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.0 | 0.2 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 | 0.0 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.0 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.0 | 0.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.0 | GO:0071450 | cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
| 0.0 | 0.0 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.0 | 0.1 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.0 | 0.1 | GO:0006051 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.1 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.0 | GO:1900180 | regulation of protein localization to nucleus(GO:1900180) |
| 0.0 | 0.1 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.1 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.0 | 0.1 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.0 | 0.0 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.0 | 0.1 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
| 0.0 | 0.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.3 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.1 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.0 | 0.0 | GO:0036114 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) medium-chain fatty acid biosynthetic process(GO:0051792) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.0 | 0.0 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.0 | 0.0 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.0 | 0.1 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
| 0.0 | 0.0 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.0 | 0.0 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
| 0.0 | 0.1 | GO:0048243 | norepinephrine secretion(GO:0048243) |
| 0.0 | 0.1 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.0 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.0 | 0.1 | GO:0045341 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.0 | 0.1 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.0 | 0.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 0.1 | GO:0055057 | neuronal stem cell division(GO:0036445) neuroblast division(GO:0055057) |
| 0.0 | 0.1 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.0 | 0.1 | GO:0036343 | psychomotor behavior(GO:0036343) |
| 0.0 | 0.0 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.0 | 0.0 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.0 | 0.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.1 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.0 | 0.0 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.0 | 0.0 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.0 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.0 | GO:0021940 | positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
| 0.0 | 0.1 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.0 | 0.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.0 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.0 | 0.1 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.0 | 0.2 | GO:1901070 | UTP biosynthetic process(GO:0006228) guanosine-containing compound biosynthetic process(GO:1901070) |
| 0.0 | 0.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.1 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 | 0.0 | GO:0046543 | development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 0.0 | 0.2 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.0 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.0 | 0.2 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 0.0 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.0 | 0.1 | GO:0016128 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.0 | 0.0 | GO:0002476 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
| 0.0 | 0.0 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
| 0.0 | 0.1 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 | 0.0 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.1 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
| 0.0 | 0.0 | GO:1903094 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.0 | 0.0 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.0 | 0.0 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.0 | 0.0 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
| 0.0 | 0.0 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
| 0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.1 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.0 | 0.0 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
| 0.0 | 0.0 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.3 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.0 | 0.0 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.0 | 0.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.0 | 0.2 | GO:0046697 | decidualization(GO:0046697) |
| 0.0 | 0.1 | GO:0046465 | dolichyl diphosphate biosynthetic process(GO:0006489) dolichyl diphosphate metabolic process(GO:0046465) |
| 0.0 | 0.0 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 | 0.0 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.0 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.0 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.0 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 0.0 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.0 | GO:0070099 | regulation of chemokine-mediated signaling pathway(GO:0070099) negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.1 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.0 | GO:0021539 | subthalamus development(GO:0021539) |
| 0.0 | 0.2 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.0 | 0.1 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.0 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
| 0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 | 0.1 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.0 | 0.1 | GO:0060068 | vagina development(GO:0060068) |
| 0.0 | 0.0 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.0 | 0.0 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.0 | 0.0 | GO:0045670 | regulation of osteoclast differentiation(GO:0045670) |
| 0.0 | 0.0 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.0 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.0 | 0.1 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.0 | GO:0032904 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.0 | 0.0 | GO:0010044 | response to aluminum ion(GO:0010044) |
| 0.0 | 0.5 | GO:0035082 | axoneme assembly(GO:0035082) |
| 0.0 | 0.0 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.0 | 0.1 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.2 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.0 | 0.0 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.0 | 0.0 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.5 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.1 | 0.5 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.1 | 0.1 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 0.4 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 0.1 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 0.4 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.0 | 0.1 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.0 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.0 | 0.3 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.0 | 0.2 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.1 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
| 0.0 | 0.5 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.2 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.8 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.0 | 0.0 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.0 | GO:0060187 | cell pole(GO:0060187) |
| 0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.3 | GO:0097361 | CIA complex(GO:0097361) |
| 0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.4 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.2 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.2 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.0 | 0.1 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.0 | 0.1 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.0 | 0.1 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.0 | 0.2 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.0 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.0 | 0.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.2 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.0 | 0.1 | GO:0071065 | alpha9-beta1 integrin-vascular cell adhesion molecule-1 complex(GO:0071065) |
| 0.0 | 0.3 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.2 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.0 | 0.2 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.2 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.0 | 0.0 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 0.1 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
| 0.0 | 0.1 | GO:0032449 | CBM complex(GO:0032449) |
| 0.0 | 0.2 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.0 | 0.1 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.0 | 0.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.0 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 0.2 | GO:0060199 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.0 | 0.0 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 0.1 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.0 | 0.0 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.0 | 0.1 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.0 | 0.5 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 0.2 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.0 | 0.1 | GO:0044218 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
| 0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.1 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.1 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.0 | 0.1 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
| 0.0 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.1 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.0 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.0 | 0.0 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.0 | 0.2 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.1 | GO:0000806 | Y chromosome(GO:0000806) |
| 0.0 | 0.1 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.0 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.2 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.0 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.7 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.1 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.0 | 0.3 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.1 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
| 0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.0 | 0.1 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.1 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.1 | GO:0090568 | nuclear transcriptional repressor complex(GO:0090568) |
| 0.0 | 0.0 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.1 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 0.1 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.0 | 0.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.0 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.0 | 0.4 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.4 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.1 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.0 | 0.7 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.1 | GO:1990876 | cytoplasmic side of nuclear pore(GO:1990876) |
| 0.0 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
| 0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.2 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.0 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.2 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.1 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.0 | GO:0036477 | somatodendritic compartment(GO:0036477) |
| 0.0 | 0.5 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 0.3 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.0 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.0 | 0.1 | GO:0061200 | clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
| 0.0 | 0.4 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.1 | GO:0000836 | Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 0.0 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 0.1 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.0 | 0.3 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.0 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.1 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.0 | 0.0 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.0 | 0.1 | GO:0098647 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.1 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.0 | 0.0 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.0 | 0.0 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 0.0 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.0 | 0.1 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.0 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 0.0 | 0.1 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.0 | GO:0070470 | plasma membrane respiratory chain(GO:0070470) |
| 0.0 | 0.2 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.1 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.0 | 0.1 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.5 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.1 | 0.3 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.1 | 0.2 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.1 | 0.1 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.1 | 0.3 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.1 | 0.3 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.4 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.5 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.1 | 0.3 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.1 | 0.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.2 | GO:0016250 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
| 0.1 | 0.1 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 0.2 | GO:0004458 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
| 0.1 | 0.3 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.0 | 0.1 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.0 | 0.6 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.2 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) |
| 0.0 | 0.1 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
| 0.0 | 0.1 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
| 0.0 | 0.2 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 0.1 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.0 | 0.1 | GO:0070364 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.0 | 0.1 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
| 0.0 | 0.1 | GO:0072591 | citrate-L-glutamate ligase activity(GO:0072591) |
| 0.0 | 0.2 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.0 | 0.0 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.0 | 0.1 | GO:0042356 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
| 0.0 | 0.4 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.2 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 0.1 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.0 | 0.4 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.0 | 0.2 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.0 | 0.1 | GO:0047325 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
| 0.0 | 0.3 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.0 | 0.1 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.0 | 0.2 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 0.0 | 0.1 | GO:0019207 | kinase regulator activity(GO:0019207) |
| 0.0 | 0.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.0 | 0.1 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.0 | 0.1 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.2 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.3 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.0 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.0 | 0.2 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.1 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.0 | 0.2 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.0 | 0.2 | GO:0010736 | serum response element binding(GO:0010736) |
| 0.0 | 0.1 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
| 0.0 | 0.3 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.0 | 0.1 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 0.0 | 0.1 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 0.0 | 0.1 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.3 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.0 | 0.1 | GO:0071633 | dihydroceramidase activity(GO:0071633) |
| 0.0 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.1 | GO:0034039 | 8-oxo-7,8-dihydroguanine DNA N-glycosylase activity(GO:0034039) |
| 0.0 | 0.1 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.0 | 0.1 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.0 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.4 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.1 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.0 | 0.1 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.0 | 0.1 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.0 | 0.1 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.0 | 0.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.0 | 0.1 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.0 | 0.3 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.0 | 0.1 | GO:0032408 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.0 | 0.0 | GO:1904680 | peptide transmembrane transporter activity(GO:1904680) |
| 0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.2 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.0 | 0.2 | GO:0016213 | linoleoyl-CoA desaturase activity(GO:0016213) |
| 0.0 | 0.3 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.0 | 0.0 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.0 | 0.1 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.3 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.0 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.1 | GO:0016662 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
| 0.0 | 0.1 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.0 | 0.2 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.2 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.0 | 0.1 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
| 0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.9 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.0 | 0.1 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 0.0 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.1 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.0 | 0.1 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.0 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.0 | 0.1 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.0 | 0.0 | GO:0051500 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.0 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 0.1 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.0 | 0.3 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.0 | 0.0 | GO:0047017 | prostaglandin-F synthase activity(GO:0047017) |
| 0.0 | 0.1 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
| 0.0 | 0.0 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
| 0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 0.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.2 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.0 | 0.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.0 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.0 | 0.1 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
| 0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.0 | 0.1 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.0 | 0.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.0 | 0.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.1 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.0 | 0.1 | GO:0030375 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.0 | 0.0 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 0.1 | GO:0001002 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
| 0.0 | 0.1 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.0 | 0.1 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.0 | 0.1 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
| 0.0 | 0.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.0 | 0.1 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.0 | 0.4 | GO:0019841 | retinol binding(GO:0019841) |
| 0.0 | 0.4 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.1 | GO:0015039 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.0 | 0.2 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.0 | 0.1 | GO:0043849 | Ras palmitoyltransferase activity(GO:0043849) |
| 0.0 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.6 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.0 | 0.2 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.0 | 0.1 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.1 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.0 | 0.1 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.0 | 0.3 | GO:0031628 | opioid receptor binding(GO:0031628) mu-type opioid receptor binding(GO:0031852) |
| 0.0 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.0 | 0.3 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.1 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.0 | 0.0 | GO:0004827 | proline-tRNA ligase activity(GO:0004827) |
| 0.0 | 0.1 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
| 0.0 | 0.0 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.0 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.0 | 0.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.1 | GO:0004608 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.0 | 0.1 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 0.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.2 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.0 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.0 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.0 | 0.2 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 0.1 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.0 | 0.1 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.1 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.0 | 0.1 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.0 | 0.1 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.0 | 0.0 | GO:0046977 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) |
| 0.0 | 0.4 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.1 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.0 | 0.1 | GO:0035539 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 0.0 | 0.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.1 | GO:0050610 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.0 | 0.1 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.0 | 0.0 | GO:0016768 | spermine synthase activity(GO:0016768) |
| 0.0 | 0.1 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.4 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.1 | GO:1903135 | cupric ion binding(GO:1903135) |
| 0.0 | 0.0 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.0 | 0.1 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.0 | 0.0 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.0 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.0 | 0.3 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.0 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.0 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) |
| 0.0 | 0.1 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.1 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.0 | 0.2 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.0 | 0.1 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.0 | 0.5 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.2 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.1 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.0 | 0.0 | GO:0070026 | nitric oxide binding(GO:0070026) |
| 0.0 | 0.0 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.0 | 0.0 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.0 | 0.0 | GO:1990259 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.0 | 0.0 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.0 | 0.1 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.0 | 0.1 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.0 | 0.2 | GO:0001163 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 0.0 | GO:0050333 | thiamin-triphosphatase activity(GO:0050333) |
| 0.0 | 0.3 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.0 | GO:0015368 | calcium:cation antiporter activity(GO:0015368) |
| 0.0 | 0.1 | GO:0034188 | apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 0.0 | 0.0 | GO:0004459 | lactate dehydrogenase activity(GO:0004457) L-lactate dehydrogenase activity(GO:0004459) |
| 0.0 | 0.0 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.2 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 0.0 | GO:0004513 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.1 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.0 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.0 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.0 | 0.0 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.0 | 0.1 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.0 | 0.1 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.0 | 0.0 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.0 | 0.1 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.0 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
| 0.0 | 0.0 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.0 | 0.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.0 | GO:0032089 | NACHT domain binding(GO:0032089) |
| 0.0 | 0.0 | GO:0030617 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) |
| 0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.0 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.0 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.0 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.0 | 0.0 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.0 | 0.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.1 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.0 | 0.3 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 0.0 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
| 0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.1 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.0 | 0.2 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.0 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.0 | 0.2 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.0 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.0 | 0.1 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
| 0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.0 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
| 0.0 | 0.0 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.0 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.0 | 0.1 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.0 | 0.0 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.0 | 0.0 | GO:1904854 | proteasome core complex binding(GO:1904854) |
| 0.0 | 0.1 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.0 | 0.0 | GO:0045142 | triplex DNA binding(GO:0045142) |
| 0.0 | 0.1 | GO:0016416 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
| 0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.0 | GO:0052856 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 0.0 | 0.1 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 0.0 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
| 0.0 | 0.1 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.0 | 0.0 | GO:0004040 | amidase activity(GO:0004040) |
| 0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.0 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 0.2 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.1 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.0 | 0.0 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.0 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.0 | 0.1 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
| 0.0 | 0.0 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
| 0.0 | 0.2 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.0 | 0.0 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
| 0.0 | 0.0 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.0 | 0.5 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.1 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
| 0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.0 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.0 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 0.0 | GO:0052894 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.0 | 0.1 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.1 | GO:0005319 | lipid transporter activity(GO:0005319) |
| 0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.0 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) platelet-derived growth factor beta-receptor activity(GO:0005019) |
| 0.0 | 0.0 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.0 | 0.0 | GO:0004515 | nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.0 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.0 | GO:0001098 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
| 0.0 | 0.0 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.0 | 0.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.1 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.0 | 0.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.1 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 0.1 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.0 | 0.0 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 0.2 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.0 | GO:0090554 | phosphatidylcholine-translocating ATPase activity(GO:0090554) |
| 0.0 | 0.0 | GO:0005055 | laminin receptor activity(GO:0005055) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.4 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 1.2 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.0 | 0.6 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.0 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.8 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 1.9 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.3 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 1.0 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.0 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.1 | REACTOME NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Neurotransmitter Release Cycle |
| 0.0 | 0.7 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.0 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.7 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.3 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 1.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.4 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 1.0 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 1.5 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.4 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.0 | 1.1 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.0 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 0.1 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.0 | 0.6 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.0 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.8 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.0 | 0.7 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.1 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 1.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.3 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.0 | 0.3 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.3 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.4 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.0 | 0.3 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |