A549 cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
GTF2I
|
ENSG00000077809.8 | general transcription factor IIi |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| GTF2I | hg19_v2_chr7_+_74072288_74072357 | -0.49 | 3.3e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr19_+_50094866 | 1.40 |
ENST00000418929.2
|
PRR12
|
proline rich 12 |
| chr14_-_61191049 | 0.96 |
ENST00000556952.3
|
SIX4
|
SIX homeobox 4 |
| chr6_-_10412600 | 0.78 |
ENST00000379608.3
|
TFAP2A
|
transcription factor AP-2 alpha (activating enhancer binding protein 2 alpha) |
| chr2_+_128175997 | 0.78 |
ENST00000234071.3
ENST00000429925.1 ENST00000442644.1 ENST00000453608.2 |
PROC
|
protein C (inactivator of coagulation factors Va and VIIIa) |
| chr16_+_29819372 | 0.77 |
ENST00000568544.1
ENST00000569978.1 |
MAZ
|
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr17_+_46131912 | 0.73 |
ENST00000584634.1
ENST00000580050.1 |
NFE2L1
|
nuclear factor, erythroid 2-like 1 |
| chr19_-_31840438 | 0.69 |
ENST00000240587.4
|
TSHZ3
|
teashirt zinc finger homeobox 3 |
| chr1_-_27930102 | 0.68 |
ENST00000247087.5
ENST00000374011.2 |
AHDC1
|
AT hook, DNA binding motif, containing 1 |
| chr2_+_219264466 | 0.68 |
ENST00000273062.2
|
CTDSP1
|
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase 1 |
| chr1_+_27022839 | 0.67 |
ENST00000457599.2
|
ARID1A
|
AT rich interactive domain 1A (SWI-like) |
| chr12_+_122018697 | 0.65 |
ENST00000541574.1
|
RP13-941N14.1
|
RP13-941N14.1 |
| chr19_+_51815102 | 0.65 |
ENST00000270642.8
|
IGLON5
|
IgLON family member 5 |
| chr1_+_27022485 | 0.64 |
ENST00000324856.7
|
ARID1A
|
AT rich interactive domain 1A (SWI-like) |
| chr12_-_50222187 | 0.62 |
ENST00000335999.6
|
NCKAP5L
|
NCK-associated protein 5-like |
| chr16_+_29819446 | 0.62 |
ENST00000568282.1
|
MAZ
|
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr9_+_109625378 | 0.61 |
ENST00000277225.5
ENST00000457913.1 ENST00000472574.1 |
ZNF462
|
zinc finger protein 462 |
| chr16_+_29817399 | 0.59 |
ENST00000545521.1
|
MAZ
|
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr2_+_219264762 | 0.59 |
ENST00000452977.1
|
CTDSP1
|
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase 1 |
| chr18_+_46065570 | 0.59 |
ENST00000591412.1
|
CTIF
|
CBP80/20-dependent translation initiation factor |
| chr17_-_935036 | 0.58 |
ENST00000572441.1
ENST00000543210.2 |
ABR
|
active BCR-related |
| chr7_+_100770328 | 0.55 |
ENST00000223095.4
ENST00000445463.2 |
SERPINE1
|
serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1 |
| chr13_-_45151259 | 0.54 |
ENST00000493016.1
|
TSC22D1
|
TSC22 domain family, member 1 |
| chr5_+_149865838 | 0.53 |
ENST00000519157.1
|
NDST1
|
N-deacetylase/N-sulfotransferase (heparan glucosaminyl) 1 |
| chr16_+_29819096 | 0.53 |
ENST00000568411.1
ENST00000563012.1 ENST00000562557.1 |
MAZ
|
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr18_+_46065393 | 0.52 |
ENST00000256413.3
|
CTIF
|
CBP80/20-dependent translation initiation factor |
| chr11_-_118305921 | 0.50 |
ENST00000532619.1
|
RP11-770J1.4
|
RP11-770J1.4 |
| chr15_-_88799948 | 0.50 |
ENST00000394480.2
|
NTRK3
|
neurotrophic tyrosine kinase, receptor, type 3 |
| chr6_-_34664612 | 0.49 |
ENST00000374023.3
ENST00000374026.3 |
C6orf106
|
chromosome 6 open reading frame 106 |
| chr5_+_139027877 | 0.49 |
ENST00000302517.3
|
CXXC5
|
CXXC finger protein 5 |
| chr19_-_39303576 | 0.48 |
ENST00000594209.1
|
LGALS4
|
lectin, galactoside-binding, soluble, 4 |
| chr14_-_61190754 | 0.48 |
ENST00000216513.4
|
SIX4
|
SIX homeobox 4 |
| chr12_-_124873357 | 0.48 |
ENST00000448614.1
|
NCOR2
|
nuclear receptor corepressor 2 |
| chr2_+_45168875 | 0.48 |
ENST00000260653.3
|
SIX3
|
SIX homeobox 3 |
| chr17_+_7155343 | 0.48 |
ENST00000573513.1
ENST00000354429.2 ENST00000574255.1 ENST00000396627.2 ENST00000356683.2 |
ELP5
|
elongator acetyltransferase complex subunit 5 |
| chr2_-_145277882 | 0.47 |
ENST00000465070.1
ENST00000444559.1 |
ZEB2
|
zinc finger E-box binding homeobox 2 |
| chr7_-_27153454 | 0.47 |
ENST00000522456.1
|
HOXA3
|
homeobox A3 |
| chr18_+_46065483 | 0.47 |
ENST00000382998.4
|
CTIF
|
CBP80/20-dependent translation initiation factor |
| chr22_-_36236265 | 0.46 |
ENST00000414461.2
ENST00000416721.2 ENST00000449924.2 ENST00000262829.7 ENST00000397305.3 |
RBFOX2
|
RNA binding protein, fox-1 homolog (C. elegans) 2 |
| chr20_+_36531544 | 0.45 |
ENST00000448944.1
|
VSTM2L
|
V-set and transmembrane domain containing 2 like |
| chr1_+_154229547 | 0.44 |
ENST00000428595.1
|
UBAP2L
|
ubiquitin associated protein 2-like |
| chr12_+_58120044 | 0.43 |
ENST00000542466.2
|
AGAP2-AS1
|
AGAP2 antisense RNA 1 |
| chr14_+_23775971 | 0.43 |
ENST00000250405.5
|
BCL2L2
|
BCL2-like 2 |
| chrX_+_109245863 | 0.43 |
ENST00000372072.3
|
TMEM164
|
transmembrane protein 164 |
| chr11_+_61595572 | 0.42 |
ENST00000517312.1
|
FADS2
|
fatty acid desaturase 2 |
| chr1_+_12538594 | 0.42 |
ENST00000543710.1
|
VPS13D
|
vacuolar protein sorting 13 homolog D (S. cerevisiae) |
| chr6_+_41514078 | 0.42 |
ENST00000373063.3
ENST00000373060.1 |
FOXP4
|
forkhead box P4 |
| chr6_-_42419649 | 0.41 |
ENST00000372922.4
ENST00000541110.1 ENST00000372917.4 |
TRERF1
|
transcriptional regulating factor 1 |
| chr19_-_39340563 | 0.41 |
ENST00000601813.1
|
HNRNPL
|
heterogeneous nuclear ribonucleoprotein L |
| chr17_-_42188598 | 0.41 |
ENST00000591714.1
|
HDAC5
|
histone deacetylase 5 |
| chr17_-_46692287 | 0.41 |
ENST00000239144.4
|
HOXB8
|
homeobox B8 |
| chr7_+_69064300 | 0.41 |
ENST00000342771.4
|
AUTS2
|
autism susceptibility candidate 2 |
| chr15_-_82338460 | 0.40 |
ENST00000558133.1
ENST00000329713.4 |
MEX3B
|
mex-3 RNA binding family member B |
| chr19_-_46272106 | 0.40 |
ENST00000560168.1
|
SIX5
|
SIX homeobox 5 |
| chr4_-_185395672 | 0.40 |
ENST00000393593.3
|
IRF2
|
interferon regulatory factor 2 |
| chr17_-_982198 | 0.40 |
ENST00000571945.1
ENST00000536794.2 |
ABR
|
active BCR-related |
| chr7_+_5465382 | 0.40 |
ENST00000609130.1
|
RP11-1275H24.2
|
RP11-1275H24.2 |
| chr19_+_45445524 | 0.40 |
ENST00000591600.1
|
APOC4
|
apolipoprotein C-IV |
| chr6_-_42418999 | 0.39 |
ENST00000340840.2
ENST00000354325.2 |
TRERF1
|
transcriptional regulating factor 1 |
| chr1_-_156470515 | 0.39 |
ENST00000340875.5
ENST00000368240.2 ENST00000353795.3 |
MEF2D
|
myocyte enhancer factor 2D |
| chr1_+_36024107 | 0.39 |
ENST00000437806.1
|
NCDN
|
neurochondrin |
| chr19_-_10679697 | 0.37 |
ENST00000335766.2
|
CDKN2D
|
cyclin-dependent kinase inhibitor 2D (p19, inhibits CDK4) |
| chr7_-_5465045 | 0.37 |
ENST00000399434.2
|
TNRC18
|
trinucleotide repeat containing 18 |
| chr17_+_73472575 | 0.37 |
ENST00000375248.5
|
KIAA0195
|
KIAA0195 |
| chr16_-_31021921 | 0.37 |
ENST00000215095.5
|
STX1B
|
syntaxin 1B |
| chr6_+_41514305 | 0.37 |
ENST00000409208.1
ENST00000373057.3 |
FOXP4
|
forkhead box P4 |
| chr1_-_151254362 | 0.37 |
ENST00000447795.2
|
RP11-126K1.2
|
Uncharacterized protein |
| chr19_-_14201776 | 0.36 |
ENST00000269724.5
|
SAMD1
|
sterile alpha motif domain containing 1 |
| chr19_+_56813305 | 0.36 |
ENST00000593151.1
|
AC006116.20
|
Uncharacterized protein |
| chr1_+_203444887 | 0.36 |
ENST00000343110.2
|
PRELP
|
proline/arginine-rich end leucine-rich repeat protein |
| chr1_+_167190066 | 0.35 |
ENST00000367866.2
ENST00000429375.2 ENST00000452019.1 ENST00000420254.3 ENST00000541643.3 |
POU2F1
|
POU class 2 homeobox 1 |
| chr17_-_7155274 | 0.34 |
ENST00000318988.6
ENST00000575783.1 ENST00000573600.1 |
CTDNEP1
|
CTD nuclear envelope phosphatase 1 |
| chr12_-_6798616 | 0.34 |
ENST00000355772.4
ENST00000417772.3 ENST00000396801.3 ENST00000396799.2 |
ZNF384
|
zinc finger protein 384 |
| chr17_+_75316336 | 0.34 |
ENST00000591934.1
|
SEPT9
|
septin 9 |
| chr15_+_40733387 | 0.33 |
ENST00000416165.1
|
BAHD1
|
bromo adjacent homology domain containing 1 |
| chr6_-_10413112 | 0.33 |
ENST00000465858.1
|
TFAP2A
|
transcription factor AP-2 alpha (activating enhancer binding protein 2 alpha) |
| chr9_+_139971921 | 0.33 |
ENST00000409858.3
|
UAP1L1
|
UDP-N-acteylglucosamine pyrophosphorylase 1-like 1 |
| chr6_-_16761678 | 0.33 |
ENST00000244769.4
ENST00000436367.1 |
ATXN1
|
ataxin 1 |
| chr19_+_13988061 | 0.33 |
ENST00000339133.5
ENST00000397555.2 |
NANOS3
|
nanos homolog 3 (Drosophila) |
| chr12_-_6798523 | 0.33 |
ENST00000319770.3
|
ZNF384
|
zinc finger protein 384 |
| chr10_-_103874692 | 0.33 |
ENST00000361198.5
|
LDB1
|
LIM domain binding 1 |
| chr19_-_10679644 | 0.33 |
ENST00000393599.2
|
CDKN2D
|
cyclin-dependent kinase inhibitor 2D (p19, inhibits CDK4) |
| chr15_-_68724490 | 0.33 |
ENST00000315757.7
ENST00000423218.2 |
ITGA11
|
integrin, alpha 11 |
| chr3_+_150126101 | 0.33 |
ENST00000361875.3
ENST00000361136.2 |
TSC22D2
|
TSC22 domain family, member 2 |
| chr19_-_14201507 | 0.32 |
ENST00000533683.2
|
SAMD1
|
sterile alpha motif domain containing 1 |
| chr17_+_7341586 | 0.32 |
ENST00000575235.1
|
FGF11
|
fibroblast growth factor 11 |
| chr2_-_227664474 | 0.32 |
ENST00000305123.5
|
IRS1
|
insulin receptor substrate 1 |
| chr1_+_110754094 | 0.32 |
ENST00000369787.3
ENST00000413138.3 ENST00000438661.2 |
KCNC4
|
potassium voltage-gated channel, Shaw-related subfamily, member 4 |
| chr15_-_61521495 | 0.32 |
ENST00000335670.6
|
RORA
|
RAR-related orphan receptor A |
| chr17_-_7154984 | 0.32 |
ENST00000574322.1
|
CTDNEP1
|
CTD nuclear envelope phosphatase 1 |
| chr17_+_37617721 | 0.32 |
ENST00000584632.1
|
CDK12
|
cyclin-dependent kinase 12 |
| chr7_-_150864635 | 0.32 |
ENST00000297537.4
|
GBX1
|
gastrulation brain homeobox 1 |
| chr6_-_31865452 | 0.32 |
ENST00000375530.4
ENST00000375537.4 |
EHMT2
|
euchromatic histone-lysine N-methyltransferase 2 |
| chr4_+_185395947 | 0.31 |
ENST00000605834.1
|
RP11-326I11.3
|
RP11-326I11.3 |
| chr12_-_71003568 | 0.31 |
ENST00000547715.1
ENST00000451516.2 ENST00000538708.1 ENST00000550857.1 ENST00000261266.5 |
PTPRB
|
protein tyrosine phosphatase, receptor type, B |
| chr12_-_120554622 | 0.31 |
ENST00000229340.5
|
RAB35
|
RAB35, member RAS oncogene family |
| chr19_+_42788172 | 0.31 |
ENST00000160740.3
|
CIC
|
capicua transcriptional repressor |
| chr12_-_53625958 | 0.31 |
ENST00000327550.3
ENST00000546717.1 ENST00000425354.2 ENST00000394426.1 |
RARG
|
retinoic acid receptor, gamma |
| chr16_+_2820912 | 0.31 |
ENST00000570539.1
|
SRRM2
|
serine/arginine repetitive matrix 2 |
| chr19_-_46272462 | 0.31 |
ENST00000317578.6
|
SIX5
|
SIX homeobox 5 |
| chr2_+_27301435 | 0.31 |
ENST00000380320.4
|
EMILIN1
|
elastin microfibril interfacer 1 |
| chr10_+_114710211 | 0.31 |
ENST00000349937.2
ENST00000369397.4 |
TCF7L2
|
transcription factor 7-like 2 (T-cell specific, HMG-box) |
| chr12_-_51611477 | 0.30 |
ENST00000389243.4
|
POU6F1
|
POU class 6 homeobox 1 |
| chr7_+_69064566 | 0.30 |
ENST00000403018.2
|
AUTS2
|
autism susceptibility candidate 2 |
| chr1_-_39407467 | 0.30 |
ENST00000540558.1
|
RHBDL2
|
rhomboid, veinlet-like 2 (Drosophila) |
| chr5_+_92919043 | 0.30 |
ENST00000327111.3
|
NR2F1
|
nuclear receptor subfamily 2, group F, member 1 |
| chr17_-_7142725 | 0.30 |
ENST00000571362.1
ENST00000576955.1 ENST00000320316.3 |
PHF23
|
PHD finger protein 23 |
| chr19_+_34287751 | 0.30 |
ENST00000590771.1
ENST00000589786.1 ENST00000284006.6 ENST00000588881.1 |
KCTD15
|
potassium channel tetramerization domain containing 15 |
| chr2_-_135476552 | 0.30 |
ENST00000281924.6
|
TMEM163
|
transmembrane protein 163 |
| chr1_-_211307315 | 0.30 |
ENST00000271751.4
|
KCNH1
|
potassium voltage-gated channel, subfamily H (eag-related), member 1 |
| chr19_+_38879061 | 0.30 |
ENST00000587013.1
|
SPRED3
|
sprouty-related, EVH1 domain containing 3 |
| chr16_+_29817841 | 0.30 |
ENST00000322945.6
ENST00000562337.1 ENST00000566906.2 ENST00000563402.1 ENST00000219782.6 |
MAZ
|
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr11_-_3186551 | 0.30 |
ENST00000533234.1
|
OSBPL5
|
oxysterol binding protein-like 5 |
| chr12_+_49209348 | 0.29 |
ENST00000536187.2
|
CACNB3
|
calcium channel, voltage-dependent, beta 3 subunit |
| chr7_+_134551583 | 0.29 |
ENST00000435928.1
|
CALD1
|
caldesmon 1 |
| chr6_-_152958521 | 0.29 |
ENST00000367255.5
ENST00000265368.4 ENST00000448038.1 ENST00000341594.5 |
SYNE1
|
spectrin repeat containing, nuclear envelope 1 |
| chr11_-_126870655 | 0.29 |
ENST00000525144.2
|
KIRREL3
|
kin of IRRE like 3 (Drosophila) |
| chr1_-_151299842 | 0.29 |
ENST00000438243.2
ENST00000489223.2 ENST00000368873.1 ENST00000430800.1 ENST00000368872.1 |
PI4KB
|
phosphatidylinositol 4-kinase, catalytic, beta |
| chr2_-_45165994 | 0.29 |
ENST00000444871.2
|
RP11-89K21.1
|
RP11-89K21.1 |
| chr8_-_145018080 | 0.29 |
ENST00000354589.3
|
PLEC
|
plectin |
| chr19_-_50990785 | 0.29 |
ENST00000595005.1
|
CTD-2545M3.8
|
CTD-2545M3.8 |
| chr16_-_31021717 | 0.28 |
ENST00000565419.1
|
STX1B
|
syntaxin 1B |
| chr2_-_240322685 | 0.28 |
ENST00000544989.1
|
HDAC4
|
histone deacetylase 4 |
| chr15_+_76352178 | 0.28 |
ENST00000388942.3
|
C15orf27
|
chromosome 15 open reading frame 27 |
| chr12_-_53893399 | 0.28 |
ENST00000267079.2
|
MAP3K12
|
mitogen-activated protein kinase kinase kinase 12 |
| chr12_-_53614155 | 0.28 |
ENST00000543726.1
|
RARG
|
retinoic acid receptor, gamma |
| chr9_+_35538616 | 0.28 |
ENST00000455600.1
|
RUSC2
|
RUN and SH3 domain containing 2 |
| chr2_-_217236750 | 0.28 |
ENST00000273067.4
|
MARCH4
|
membrane-associated ring finger (C3HC4) 4, E3 ubiquitin protein ligase |
| chr17_+_46131843 | 0.28 |
ENST00000577411.1
|
NFE2L1
|
nuclear factor, erythroid 2-like 1 |
| chr12_-_6798410 | 0.28 |
ENST00000361959.3
ENST00000436774.2 ENST00000544482.1 |
ZNF384
|
zinc finger protein 384 |
| chr14_+_21538517 | 0.28 |
ENST00000298693.3
|
ARHGEF40
|
Rho guanine nucleotide exchange factor (GEF) 40 |
| chr5_+_159343688 | 0.28 |
ENST00000306675.3
|
ADRA1B
|
adrenoceptor alpha 1B |
| chr12_+_85673868 | 0.28 |
ENST00000316824.3
|
ALX1
|
ALX homeobox 1 |
| chr19_+_50433476 | 0.28 |
ENST00000596658.1
|
ATF5
|
activating transcription factor 5 |
| chr12_+_6930964 | 0.28 |
ENST00000382315.3
|
GPR162
|
G protein-coupled receptor 162 |
| chrX_-_1511617 | 0.28 |
ENST00000381401.5
|
SLC25A6
|
solute carrier family 25 (mitochondrial carrier; adenine nucleotide translocator), member 6 |
| chr8_+_21912328 | 0.27 |
ENST00000432128.1
ENST00000443491.2 ENST00000517600.1 ENST00000523782.2 |
DMTN
|
dematin actin binding protein |
| chr11_+_118307179 | 0.27 |
ENST00000534358.1
ENST00000531904.2 ENST00000389506.5 ENST00000354520.4 |
KMT2A
|
lysine (K)-specific methyltransferase 2A |
| chr3_-_195619579 | 0.27 |
ENST00000428187.1
|
TNK2
|
tyrosine kinase, non-receptor, 2 |
| chr20_-_49639631 | 0.27 |
ENST00000424171.1
ENST00000439216.1 ENST00000371571.4 |
KCNG1
|
potassium voltage-gated channel, subfamily G, member 1 |
| chr2_-_45166338 | 0.27 |
ENST00000437916.2
|
RP11-89K21.1
|
RP11-89K21.1 |
| chr10_+_72238517 | 0.27 |
ENST00000263563.6
|
PALD1
|
phosphatase domain containing, paladin 1 |
| chr19_+_46498704 | 0.27 |
ENST00000595358.1
ENST00000594672.1 ENST00000536603.1 |
CCDC61
|
coiled-coil domain containing 61 |
| chr6_+_114178512 | 0.27 |
ENST00000368635.4
|
MARCKS
|
myristoylated alanine-rich protein kinase C substrate |
| chr6_+_31588478 | 0.27 |
ENST00000376007.4
ENST00000376033.2 |
PRRC2A
|
proline-rich coiled-coil 2A |
| chr14_+_23776024 | 0.27 |
ENST00000553781.1
ENST00000556100.1 ENST00000557236.1 ENST00000557579.1 |
BCL2L2-PABPN1
BCL2L2
|
BCL2L2-PABPN1 readthrough BCL2-like 2 |
| chr9_-_14314066 | 0.27 |
ENST00000397575.3
|
NFIB
|
nuclear factor I/B |
| chr11_+_62475130 | 0.27 |
ENST00000294117.5
|
GNG3
|
guanine nucleotide binding protein (G protein), gamma 3 |
| chr6_+_75994755 | 0.27 |
ENST00000607799.1
|
RP1-234P15.4
|
RP1-234P15.4 |
| chr5_+_179233376 | 0.26 |
ENST00000376929.3
ENST00000514093.1 |
SQSTM1
|
sequestosome 1 |
| chr1_-_211307404 | 0.26 |
ENST00000367007.4
|
KCNH1
|
potassium voltage-gated channel, subfamily H (eag-related), member 1 |
| chr1_+_173837488 | 0.26 |
ENST00000427304.1
ENST00000432989.1 ENST00000367702.1 |
ZBTB37
|
zinc finger and BTB domain containing 37 |
| chr17_-_42296855 | 0.26 |
ENST00000436088.1
|
UBTF
|
upstream binding transcription factor, RNA polymerase I |
| chr6_+_44095347 | 0.26 |
ENST00000323267.6
|
TMEM63B
|
transmembrane protein 63B |
| chr6_+_36164487 | 0.26 |
ENST00000357641.6
|
BRPF3
|
bromodomain and PHD finger containing, 3 |
| chr2_+_54342533 | 0.26 |
ENST00000406041.1
|
ACYP2
|
acylphosphatase 2, muscle type |
| chr17_+_36584662 | 0.26 |
ENST00000431231.2
ENST00000437668.3 |
ARHGAP23
|
Rho GTPase activating protein 23 |
| chr16_-_73082274 | 0.26 |
ENST00000268489.5
|
ZFHX3
|
zinc finger homeobox 3 |
| chr1_+_201592013 | 0.26 |
ENST00000593583.1
|
AC096677.1
|
Uncharacterized protein ENSP00000471857 |
| chr12_-_1703331 | 0.25 |
ENST00000339235.3
|
FBXL14
|
F-box and leucine-rich repeat protein 14 |
| chr12_-_53893227 | 0.25 |
ENST00000547488.1
|
MAP3K12
|
mitogen-activated protein kinase kinase kinase 12 |
| chr6_-_37665751 | 0.25 |
ENST00000297153.7
ENST00000434837.3 |
MDGA1
|
MAM domain containing glycosylphosphatidylinositol anchor 1 |
| chr17_+_7452442 | 0.25 |
ENST00000557233.1
|
TNFSF12
|
tumor necrosis factor (ligand) superfamily, member 12 |
| chr3_-_57113281 | 0.25 |
ENST00000468466.1
|
ARHGEF3
|
Rho guanine nucleotide exchange factor (GEF) 3 |
| chr12_+_54332535 | 0.25 |
ENST00000243056.3
|
HOXC13
|
homeobox C13 |
| chr10_-_75351088 | 0.25 |
ENST00000451492.1
ENST00000413442.1 |
USP54
|
ubiquitin specific peptidase 54 |
| chr16_-_29874211 | 0.25 |
ENST00000563415.1
|
CDIPT
|
CDP-diacylglycerol--inositol 3-phosphatidyltransferase |
| chr17_+_7452336 | 0.25 |
ENST00000293826.4
|
TNFSF12-TNFSF13
|
TNFSF12-TNFSF13 readthrough |
| chr8_+_97506033 | 0.25 |
ENST00000518385.1
|
SDC2
|
syndecan 2 |
| chr10_-_75532373 | 0.25 |
ENST00000595757.1
|
AC022400.2
|
Uncharacterized protein; cDNA FLJ44715 fis, clone BRACE3021430 |
| chr17_-_36904437 | 0.25 |
ENST00000585100.1
ENST00000360797.2 ENST00000578109.1 ENST00000579882.1 |
PCGF2
|
polycomb group ring finger 2 |
| chr14_+_21538429 | 0.25 |
ENST00000298694.4
ENST00000555038.1 |
ARHGEF40
|
Rho guanine nucleotide exchange factor (GEF) 40 |
| chr12_-_57030115 | 0.24 |
ENST00000379441.3
ENST00000179765.5 ENST00000551812.1 |
BAZ2A
|
bromodomain adjacent to zinc finger domain, 2A |
| chr11_-_126870683 | 0.24 |
ENST00000525704.2
|
KIRREL3
|
kin of IRRE like 3 (Drosophila) |
| chr12_-_118406028 | 0.24 |
ENST00000425217.1
|
KSR2
|
kinase suppressor of ras 2 |
| chr5_-_146833222 | 0.24 |
ENST00000534907.1
|
DPYSL3
|
dihydropyrimidinase-like 3 |
| chr4_-_168155577 | 0.24 |
ENST00000541354.1
ENST00000509854.1 ENST00000512681.1 ENST00000421836.2 ENST00000510741.1 ENST00000510403.1 |
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chr8_-_141467818 | 0.24 |
ENST00000389327.3
ENST00000438773.2 |
TRAPPC9
|
trafficking protein particle complex 9 |
| chr12_+_53845879 | 0.24 |
ENST00000359282.5
ENST00000603815.1 ENST00000447282.1 ENST00000437231.1 ENST00000549863.1 ENST00000359462.5 ENST00000550520.2 ENST00000546463.1 ENST00000552296.2 |
PCBP2
|
poly(rC) binding protein 2 |
| chr19_+_36208877 | 0.24 |
ENST00000420124.1
ENST00000222270.7 ENST00000341701.1 |
KMT2B
|
Histone-lysine N-methyltransferase 2B |
| chrX_-_129244655 | 0.24 |
ENST00000335997.7
|
ELF4
|
E74-like factor 4 (ets domain transcription factor) |
| chr1_+_160175166 | 0.24 |
ENST00000368077.1
|
PEA15
|
phosphoprotein enriched in astrocytes 15 |
| chr17_+_4736627 | 0.24 |
ENST00000355280.6
ENST00000347992.7 |
MINK1
|
misshapen-like kinase 1 |
| chr20_+_62666902 | 0.24 |
ENST00000431158.1
|
LINC00176
|
long intergenic non-protein coding RNA 176 |
| chr9_-_35754253 | 0.23 |
ENST00000436428.2
|
MSMP
|
microseminoprotein, prostate associated |
| chr21_-_47738112 | 0.23 |
ENST00000417060.1
|
C21orf58
|
chromosome 21 open reading frame 58 |
| chr12_+_57998595 | 0.23 |
ENST00000337737.3
ENST00000548198.1 ENST00000551632.1 |
DTX3
|
deltex homolog 3 (Drosophila) |
| chr14_-_21562648 | 0.23 |
ENST00000555270.1
|
ZNF219
|
zinc finger protein 219 |
| chr17_-_7137857 | 0.23 |
ENST00000005340.5
|
DVL2
|
dishevelled segment polarity protein 2 |
| chr2_-_74601758 | 0.23 |
ENST00000407639.2
ENST00000409438.1 |
DCTN1
|
dynactin 1 |
| chr9_-_123639600 | 0.23 |
ENST00000373896.3
|
PHF19
|
PHD finger protein 19 |
| chr6_+_31515337 | 0.23 |
ENST00000376148.4
ENST00000376145.4 |
NFKBIL1
|
nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor-like 1 |
| chr20_+_32150140 | 0.23 |
ENST00000344201.3
ENST00000346541.3 ENST00000397800.1 ENST00000397798.2 ENST00000492345.1 |
CBFA2T2
|
core-binding factor, runt domain, alpha subunit 2; translocated to, 2 |
| chr1_+_151043070 | 0.23 |
ENST00000368918.3
ENST00000368917.1 |
GABPB2
|
GA binding protein transcription factor, beta subunit 2 |
| chrX_-_153363188 | 0.23 |
ENST00000303391.6
|
MECP2
|
methyl CpG binding protein 2 (Rett syndrome) |
| chr17_-_48133054 | 0.23 |
ENST00000499842.1
|
RP11-1094H24.4
|
RP11-1094H24.4 |
| chr12_+_94542459 | 0.23 |
ENST00000258526.4
|
PLXNC1
|
plexin C1 |
| chr19_-_2015699 | 0.23 |
ENST00000255608.4
|
BTBD2
|
BTB (POZ) domain containing 2 |
| chr11_-_8832182 | 0.23 |
ENST00000527510.1
ENST00000528527.1 ENST00000528523.1 ENST00000313726.6 |
ST5
|
suppression of tumorigenicity 5 |
| chr6_+_35744367 | 0.23 |
ENST00000360454.2
ENST00000403376.3 |
CLPSL2
|
colipase-like 2 |
| chr2_-_220110111 | 0.23 |
ENST00000428427.1
ENST00000356283.3 ENST00000432839.1 ENST00000424620.1 |
GLB1L
|
galactosidase, beta 1-like |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.4 | GO:1902725 | negative regulation of satellite cell differentiation(GO:1902725) |
| 0.4 | 0.7 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.3 | 1.6 | GO:0003404 | optic vesicle morphogenesis(GO:0003404) |
| 0.2 | 0.7 | GO:0001300 | chronological cell aging(GO:0001300) |
| 0.2 | 0.8 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.2 | 0.6 | GO:0007037 | vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
| 0.2 | 0.9 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.2 | 0.7 | GO:0098582 | innate vocalization behavior(GO:0098582) |
| 0.2 | 1.3 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.2 | 0.7 | GO:0048691 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.2 | 0.5 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.2 | 0.5 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.2 | 0.5 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.2 | 0.8 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.2 | 0.5 | GO:0050823 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.2 | 1.2 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
| 0.1 | 0.4 | GO:0052553 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.1 | 0.7 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.1 | 0.6 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.9 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.1 | 0.1 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 | 0.6 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
| 0.1 | 0.4 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.1 | 0.1 | GO:0051885 | positive regulation of anagen(GO:0051885) |
| 0.1 | 0.8 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.1 | 0.3 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.1 | 0.5 | GO:0061015 | snRNA import into nucleus(GO:0061015) |
| 0.1 | 0.2 | GO:1901656 | glycoside transport(GO:1901656) |
| 0.1 | 0.4 | GO:1903412 | response to bile acid(GO:1903412) |
| 0.1 | 0.3 | GO:1905044 | Schwann cell proliferation involved in axon regeneration(GO:0014011) negative regulation of Schwann cell migration(GO:1900148) regulation of Schwann cell proliferation involved in axon regeneration(GO:1905044) negative regulation of Schwann cell proliferation involved in axon regeneration(GO:1905045) |
| 0.1 | 0.1 | GO:0003166 | bundle of His development(GO:0003166) His-Purkinje system cell differentiation(GO:0060932) |
| 0.1 | 0.2 | GO:0044727 | DNA demethylation of male pronucleus(GO:0044727) |
| 0.1 | 0.3 | GO:1900155 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.1 | 0.2 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 0.2 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) |
| 0.1 | 0.4 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.1 | 0.2 | GO:1990575 | mitochondrial L-ornithine transmembrane transport(GO:1990575) |
| 0.1 | 0.6 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.1 | 0.2 | GO:0035981 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.1 | 0.3 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 | 0.3 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.1 | 0.5 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.1 | 0.2 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.1 | 0.5 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.1 | 0.3 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.1 | 0.4 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.1 | 0.6 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.1 | 0.8 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 | 0.2 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.1 | 0.6 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.2 | GO:1900241 | metanephric glomerular mesangial cell development(GO:0072255) reversible differentiation(GO:0090677) cell dedifferentiation involved in phenotypic switching(GO:0090678) positive regulation of phenotypic switching(GO:1900241) regulation of vascular smooth muscle cell dedifferentiation(GO:1905174) positive regulation of vascular smooth muscle cell dedifferentiation(GO:1905176) vascular smooth muscle cell dedifferentiation(GO:1990936) |
| 0.1 | 0.2 | GO:0048075 | positive regulation of eye pigmentation(GO:0048075) |
| 0.1 | 0.1 | GO:0098712 | L-glutamate import across plasma membrane(GO:0098712) |
| 0.1 | 0.5 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.1 | 0.5 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
| 0.1 | 0.1 | GO:0060067 | cervix development(GO:0060067) |
| 0.1 | 0.1 | GO:0060928 | cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
| 0.1 | 0.2 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.1 | 0.8 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 | 0.2 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 0.2 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.1 | 0.2 | GO:0072299 | negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 0.1 | 0.8 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 0.1 | 0.2 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.1 | 0.2 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.3 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.1 | 0.3 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.8 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.3 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.2 | GO:0060023 | soft palate development(GO:0060023) |
| 0.0 | 0.4 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.0 | 0.7 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.0 | 0.4 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.4 | GO:2000795 | negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.0 | 0.3 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.0 | 0.3 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.0 | 0.2 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
| 0.0 | 0.1 | GO:0001946 | lymphangiogenesis(GO:0001946) |
| 0.0 | 0.2 | GO:2000594 | pronephric field specification(GO:0039003) pattern specification involved in pronephros development(GO:0039017) kidney field specification(GO:0072004) regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072304) negative regulation of mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:0072305) mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) apoptotic process involved in metanephric collecting duct development(GO:1900204) apoptotic process involved in metanephric nephron tubule development(GO:1900205) regulation of apoptotic process involved in metanephric collecting duct development(GO:1900214) negative regulation of apoptotic process involved in metanephric collecting duct development(GO:1900215) regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900217) negative regulation of apoptotic process involved in metanephric nephron tubule development(GO:1900218) mesenchymal cell apoptotic process involved in metanephric nephron morphogenesis(GO:1901147) regulation of metanephric DCT cell differentiation(GO:2000592) positive regulation of metanephric DCT cell differentiation(GO:2000594) |
| 0.0 | 0.5 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 0.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 | 0.2 | GO:0060032 | notochord regression(GO:0060032) |
| 0.0 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 | 0.4 | GO:0070236 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.3 | GO:0071350 | interleukin-15-mediated signaling pathway(GO:0035723) cellular response to interleukin-15(GO:0071350) |
| 0.0 | 0.1 | GO:1902559 | 3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
| 0.0 | 0.2 | GO:0010513 | positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
| 0.0 | 0.2 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.0 | 0.3 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.0 | 0.3 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 0.0 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.0 | 0.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.0 | 0.9 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.0 | 0.4 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.0 | 0.2 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.0 | 0.1 | GO:0032765 | positive regulation of mast cell cytokine production(GO:0032765) |
| 0.0 | 0.2 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.0 | 0.4 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.1 | GO:1901207 | regulation of heart looping(GO:1901207) positive regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903762) positive regulation of ventricular cardiac muscle cell action potential(GO:1903947) positive regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905026) positive regulation of membrane repolarization during cardiac muscle cell action potential(GO:1905033) |
| 0.0 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.0 | 0.2 | GO:1905205 | positive regulation of connective tissue replacement(GO:1905205) |
| 0.0 | 0.1 | GO:0060374 | mast cell differentiation(GO:0060374) |
| 0.0 | 0.6 | GO:0021924 | cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.0 | 0.2 | GO:1904578 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.0 | 0.0 | GO:0021539 | subthalamus development(GO:0021539) |
| 0.0 | 0.4 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.0 | 0.4 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.0 | 0.1 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.0 | 0.3 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.0 | 0.3 | GO:1902748 | mammillary body development(GO:0021767) mammillary axonal complex development(GO:0061373) positive regulation of lens fiber cell differentiation(GO:1902748) |
| 0.0 | 0.1 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.0 | 0.1 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.0 | 0.4 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.0 | 0.5 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.1 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.0 | 1.0 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 0.8 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.0 | 0.1 | GO:0032904 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.1 | GO:0002384 | hepatic immune response(GO:0002384) |
| 0.0 | 0.2 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.0 | 0.2 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.0 | 0.2 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.5 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.0 | 0.2 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.0 | 0.1 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.0 | 1.4 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.3 | GO:1904637 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.0 | 0.4 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 0.3 | GO:0075071 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.0 | 0.2 | GO:0060459 | left lung development(GO:0060459) left lung morphogenesis(GO:0060460) |
| 0.0 | 0.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.0 | 0.2 | GO:0003342 | proepicardium development(GO:0003342) septum transversum development(GO:0003343) cellular response to raffinose(GO:0097403) response to raffinose(GO:1901545) |
| 0.0 | 0.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 | 0.8 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.1 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.0 | 0.1 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.0 | 0.8 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.0 | 0.1 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.0 | 0.1 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.0 | 0.1 | GO:0015783 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.0 | 0.2 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.0 | 0.1 | GO:1900020 | activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.1 | GO:1903450 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
| 0.0 | 0.1 | GO:1904849 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.0 | 0.4 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.0 | GO:0072166 | posterior mesonephric tubule development(GO:0072166) |
| 0.0 | 0.1 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.2 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.0 | 0.1 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.0 | 0.5 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.1 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.3 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.0 | 0.7 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.0 | 0.2 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.0 | 0.3 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.1 | GO:1903382 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.0 | 0.1 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
| 0.0 | 0.1 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.3 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
| 0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 | 0.2 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.0 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.1 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.0 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.0 | 0.0 | GO:2000742 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.0 | 0.2 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 | 0.1 | GO:0048627 | myoblast development(GO:0048627) |
| 0.0 | 0.4 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.1 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.0 | 0.1 | GO:0048859 | sensory organ boundary specification(GO:0008052) formation of organ boundary(GO:0010160) formation of anatomical boundary(GO:0048859) taste bud development(GO:0061193) |
| 0.0 | 0.1 | GO:0003245 | growth involved in heart morphogenesis(GO:0003241) cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.0 | 0.0 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.0 | 0.2 | GO:1904327 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.0 | 0.1 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.0 | 0.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.0 | 0.5 | GO:0002192 | IRES-dependent translational initiation(GO:0002192) |
| 0.0 | 0.2 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
| 0.0 | 0.3 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.0 | 0.4 | GO:0003016 | respiratory system process(GO:0003016) |
| 0.0 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 | 0.1 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 | 0.3 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.3 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.1 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.0 | 0.0 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.3 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.0 | 0.2 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 2.7 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.2 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.2 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.0 | 0.2 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.0 | 0.2 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 0.0 | 0.1 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.0 | 0.2 | GO:0010593 | negative regulation of lamellipodium assembly(GO:0010593) |
| 0.0 | 0.1 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.0 | 0.1 | GO:0060356 | leucine import(GO:0060356) |
| 0.0 | 0.2 | GO:2000680 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.0 | 0.9 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 | 0.2 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 | 0.2 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.0 | 0.3 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 | 0.2 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 | 0.1 | GO:0015881 | creatine transport(GO:0015881) creatine transmembrane transport(GO:1902598) |
| 0.0 | 0.1 | GO:1904845 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.0 | 0.1 | GO:0008204 | ergosterol biosynthetic process(GO:0006696) ergosterol metabolic process(GO:0008204) |
| 0.0 | 0.1 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 0.2 | GO:0035898 | parathyroid hormone secretion(GO:0035898) post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.0 | 0.1 | GO:0060981 | cell migration involved in coronary angiogenesis(GO:0060981) |
| 0.0 | 0.1 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.0 | 0.1 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.0 | 0.1 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.7 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.0 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.0 | 0.2 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.1 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.0 | 0.6 | GO:0036109 | alpha-linolenic acid metabolic process(GO:0036109) linoleic acid metabolic process(GO:0043651) |
| 0.0 | 0.0 | GO:0090306 | spindle assembly involved in female meiosis(GO:0007056) spindle assembly involved in meiosis(GO:0090306) |
| 0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.3 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 | 0.5 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.0 | 0.2 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.1 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.0 | 0.0 | GO:0051935 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.0 | 0.1 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.0 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 | 0.3 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.0 | 0.1 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.0 | 0.3 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 | 0.3 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 | 0.2 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.1 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.1 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
| 0.0 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) L-cystine transport(GO:0015811) |
| 0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.1 | GO:0010732 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.0 | 0.0 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.0 | 0.1 | GO:2000669 | negative regulation of dendritic cell apoptotic process(GO:2000669) |
| 0.0 | 0.1 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
| 0.0 | 0.1 | GO:0036371 | protein localization to T-tubule(GO:0036371) |
| 0.0 | 0.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.0 | 0.3 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.0 | 0.2 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 | 0.1 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) |
| 0.0 | 0.1 | GO:0036166 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.0 | GO:1904530 | regulation of actin filament binding(GO:1904529) negative regulation of actin filament binding(GO:1904530) regulation of actin binding(GO:1904616) negative regulation of actin binding(GO:1904617) |
| 0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.0 | 0.1 | GO:0048749 | compound eye development(GO:0048749) |
| 0.0 | 0.2 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
| 0.0 | 0.0 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.1 | GO:0061187 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.0 | 0.1 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.0 | 0.2 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
| 0.0 | 0.2 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.1 | GO:1901907 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.0 | 0.3 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.0 | 0.1 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.3 | GO:0045974 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.0 | 0.0 | GO:1901340 | negative regulation of store-operated calcium channel activity(GO:1901340) |
| 0.0 | 0.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.4 | GO:0036150 | phosphatidylserine acyl-chain remodeling(GO:0036150) |
| 0.0 | 0.5 | GO:0033280 | response to vitamin D(GO:0033280) |
| 0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.0 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.0 | 0.3 | GO:0061162 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.0 | 0.1 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.0 | 0.5 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.0 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 0.0 | 0.0 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.0 | 0.0 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
| 0.0 | 0.1 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.0 | 0.0 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 | 0.1 | GO:1904808 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.0 | 0.1 | GO:0006662 | glycerol ether metabolic process(GO:0006662) |
| 0.0 | 1.2 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.0 | 0.1 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.3 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 | 0.2 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
| 0.0 | 0.1 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.0 | 0.1 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.0 | 0.1 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 | 0.1 | GO:0002329 | immature B cell differentiation(GO:0002327) pre-B cell differentiation(GO:0002329) |
| 0.0 | 0.2 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.2 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.0 | 0.2 | GO:0014877 | response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.0 | 0.2 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.6 | GO:0007019 | microtubule depolymerization(GO:0007019) |
| 0.0 | 0.1 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.0 | 0.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 0.1 | GO:0090285 | negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.0 | 0.0 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.0 | 0.2 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 0.0 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.0 | 0.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.0 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.0 | 0.2 | GO:0097205 | renal filtration(GO:0097205) |
| 0.0 | 0.1 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.0 | 0.1 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.0 | GO:0050928 | negative regulation of positive chemotaxis(GO:0050928) |
| 0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 0.3 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.0 | 0.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 | 0.8 | GO:0070301 | cellular response to hydrogen peroxide(GO:0070301) |
| 0.0 | 0.0 | GO:1900368 | pre-miRNA export from nucleus(GO:0035281) regulation of RNA interference(GO:1900368) |
| 0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.0 | GO:1903595 | positive regulation of histamine secretion by mast cell(GO:1903595) |
| 0.0 | 0.0 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.0 | 0.1 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 | 0.1 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.0 | 0.1 | GO:0032625 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.0 | 0.5 | GO:0030335 | positive regulation of cell migration(GO:0030335) |
| 0.0 | 0.2 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.3 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.2 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.5 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.2 | 0.3 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
| 0.1 | 0.9 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 0.4 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.1 | 0.7 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.1 | 0.7 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.1 | 0.4 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 0.7 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.1 | 0.3 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.1 | 0.4 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.1 | 0.3 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.1 | 0.9 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 0.3 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.1 | 0.5 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 0.3 | GO:0044753 | amphisome(GO:0044753) |
| 0.1 | 0.1 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.1 | 0.3 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.1 | 0.7 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.4 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.0 | 1.4 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 0.2 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 0.0 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.3 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.0 | 0.3 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.0 | 0.7 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.1 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.2 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.0 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 0.1 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.0 | 0.3 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.0 | 0.1 | GO:1990666 | PCSK9-LDLR complex(GO:1990666) |
| 0.0 | 0.2 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.4 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.1 | GO:0097489 | multivesicular body, internal vesicle lumen(GO:0097489) |
| 0.0 | 0.1 | GO:0072563 | endothelial microparticle(GO:0072563) |
| 0.0 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.2 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.0 | 0.2 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.0 | 0.2 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.1 | GO:0043512 | inhibin complex(GO:0043511) inhibin A complex(GO:0043512) |
| 0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.7 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.1 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.0 | 0.3 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.2 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.0 | 0.1 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 0.5 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.0 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.2 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.0 | 0.2 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.0 | 0.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.6 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.3 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.2 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.4 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.3 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.9 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.6 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.2 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.2 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.1 | GO:1990742 | microvesicle(GO:1990742) |
| 0.0 | 0.2 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.1 | GO:0001740 | Barr body(GO:0001740) |
| 0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.5 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.8 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.3 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.3 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 0.3 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 1.3 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
| 0.0 | 0.1 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 0.4 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.0 | 0.0 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.2 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.1 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.0 | 0.1 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.0 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.4 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 1.1 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 1.5 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.5 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.8 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.0 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.0 | 0.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.0 | 0.8 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.0 | 0.0 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.3 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.2 | 0.6 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
| 0.1 | 0.4 | GO:0015207 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.1 | 0.8 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.1 | 0.3 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.1 | 1.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 0.3 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.1 | 0.3 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.1 | 0.9 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.6 | GO:0016213 | linoleoyl-CoA desaturase activity(GO:0016213) |
| 0.1 | 0.5 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
| 0.1 | 1.0 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.4 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.1 | 0.8 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.5 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.1 | 0.2 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
| 0.1 | 0.2 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.1 | 0.5 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 0.1 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 0.1 | 0.3 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 0.5 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.1 | 0.5 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.1 | 0.3 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.9 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 0.3 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.1 | 0.1 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.1 | 0.7 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.1 | 0.8 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.1 | 0.5 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 0.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.3 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.1 | 2.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.1 | 0.2 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 0.1 | 0.2 | GO:0015039 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.1 | 0.2 | GO:0004608 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.1 | 0.4 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 0.3 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.0 | 0.2 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 0.5 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.0 | 0.1 | GO:0070119 | ciliary neurotrophic factor binding(GO:0070119) |
| 0.0 | 0.4 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.2 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.0 | 0.9 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.1 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.0 | 0.3 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.0 | 0.4 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.0 | 0.6 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.3 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
| 0.0 | 0.3 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.8 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.2 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.0 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.4 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.0 | 0.1 | GO:0004108 | citrate (Si)-synthase activity(GO:0004108) citrate synthase activity(GO:0036440) |
| 0.0 | 0.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.8 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 2.1 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.3 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.0 | 0.1 | GO:0030395 | lactose binding(GO:0030395) |
| 0.0 | 0.3 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.2 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.0 | 0.6 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.6 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.2 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.0 | 0.2 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.0 | 0.1 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.0 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.2 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.0 | 0.1 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.0 | 0.2 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.0 | 0.1 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.0 | 0.1 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.0 | 0.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.2 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.0 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.6 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.2 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.1 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.0 | 3.0 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.0 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.2 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.0 | 0.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 0.1 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.0 | 0.6 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.1 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.0 | 0.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.2 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.1 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
| 0.0 | 0.1 | GO:0071633 | dihydroceramidase activity(GO:0071633) |
| 0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.0 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.1 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.0 | 0.8 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.2 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) |
| 0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.2 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.4 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.0 | 0.1 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.9 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.6 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.5 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.4 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.1 | GO:0015186 | L-cystine transmembrane transporter activity(GO:0015184) L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.1 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.0 | 0.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.1 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.0 | 0.1 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.0 | 0.1 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.0 | 0.4 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.3 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.1 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.2 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.0 | 0.1 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.0 | 0.1 | GO:0034431 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.0 | 0.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.3 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.0 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.5 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 1.2 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.0 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.0 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.0 | 0.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.0 | 0.1 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.0 | GO:0004960 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 0.0 | 0.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.0 | 0.8 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.2 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.2 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.0 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.3 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.0 | 0.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.2 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.0 | 0.3 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.3 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.0 | 0.1 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 0.5 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.0 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.0 | 0.5 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.0 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.0 | 0.1 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.0 | 1.2 | GO:0017022 | myosin binding(GO:0017022) |
| 0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.0 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.2 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 1.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.1 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.2 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.0 | 0.0 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.0 | 0.4 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.1 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.2 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.6 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.2 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 1.0 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.9 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 1.0 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.9 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.6 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.4 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 1.0 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.6 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.4 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.3 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.7 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.9 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 1.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.2 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.0 | 1.0 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 0.6 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.7 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.4 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.3 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 0.9 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.0 | 0.0 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 1.2 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
| 0.0 | 0.9 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 0.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.3 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 1.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.7 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.5 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.9 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 0.2 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.2 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.6 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.7 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 1.9 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.4 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.7 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.2 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.3 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.8 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 1.7 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.2 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.4 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.0 | 0.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 0.4 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.6 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.3 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.5 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.4 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 1.2 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.5 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 0.4 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.6 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.3 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.3 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.4 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |