A549 cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
GATA3
|
ENSG00000107485.11 | GATA3 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| GATA3 | hg19_v2_chr10_+_8096769_8096787 | 0.98 | 4.2e-04 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr19_-_16008880 | 1.51 |
ENST00000011989.7 ENST00000221700.6 |
CYP4F2 |
cytochrome P450, family 4, subfamily F, polypeptide 2 |
| chr21_-_46492927 | 1.28 |
ENST00000599569.1 |
AP001579.1 |
Uncharacterized protein |
| chr12_-_13105081 | 1.20 |
ENST00000541128.1 |
GPRC5D |
G protein-coupled receptor, family C, group 5, member D |
| chr17_-_33448468 | 1.17 |
ENST00000591723.1 ENST00000593039.1 ENST00000587405.1 |
RAD51L3-RFFL RAD51D |
Uncharacterized protein RAD51 paralog D |
| chr9_-_34662651 | 1.04 |
ENST00000259631.4 |
CCL27 |
chemokine (C-C motif) ligand 27 |
| chr1_+_236557569 | 0.96 |
ENST00000334232.4 |
EDARADD |
EDAR-associated death domain |
| chr6_+_31515337 | 0.95 |
ENST00000376148.4 ENST00000376145.4 |
NFKBIL1 |
nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor-like 1 |
| chr3_+_127317945 | 0.90 |
ENST00000472731.1 |
MCM2 |
minichromosome maintenance complex component 2 |
| chr17_+_33448593 | 0.86 |
ENST00000158009.5 |
FNDC8 |
fibronectin type III domain containing 8 |
| chr13_+_111837279 | 0.80 |
ENST00000467053.1 |
ARHGEF7 |
Rho guanine nucleotide exchange factor (GEF) 7 |
| chr9_+_2029019 | 0.77 |
ENST00000382194.1 |
SMARCA2 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily a, member 2 |
| chr6_-_31651817 | 0.77 |
ENST00000375863.3 ENST00000375860.2 |
LY6G5C |
lymphocyte antigen 6 complex, locus G5C |
| chr19_+_56813305 | 0.75 |
ENST00000593151.1 |
AC006116.20 |
Uncharacterized protein |
| chr3_-_52869205 | 0.75 |
ENST00000446157.2 |
MUSTN1 |
musculoskeletal, embryonic nuclear protein 1 |
| chr11_-_62609281 | 0.73 |
ENST00000525239.1 ENST00000538098.2 |
WDR74 |
WD repeat domain 74 |
| chr3_-_20053741 | 0.71 |
ENST00000389050.4 |
PP2D1 |
protein phosphatase 2C-like domain containing 1 |
| chr2_-_99917639 | 0.71 |
ENST00000308528.4 |
LYG1 |
lysozyme G-like 1 |
| chrX_+_47083037 | 0.71 |
ENST00000523034.1 |
CDK16 |
cyclin-dependent kinase 16 |
| chrX_-_1331527 | 0.68 |
ENST00000381567.3 ENST00000381566.1 ENST00000400841.2 |
CRLF2 |
cytokine receptor-like factor 2 |
| chr1_+_228645796 | 0.67 |
ENST00000369160.2 |
HIST3H2BB |
histone cluster 3, H2bb |
| chr9_-_130712995 | 0.65 |
ENST00000373084.4 |
FAM102A |
family with sequence similarity 102, member A |
| chr3_-_50383096 | 0.65 |
ENST00000442887.1 ENST00000360165.3 |
ZMYND10 |
zinc finger, MYND-type containing 10 |
| chr17_+_68047418 | 0.64 |
ENST00000586373.1 ENST00000588782.1 |
LINC01028 |
long intergenic non-protein coding RNA 1028 |
| chr11_-_1776176 | 0.64 |
ENST00000429746.1 |
CTSD |
cathepsin D |
| chr22_+_41968007 | 0.64 |
ENST00000460790.1 |
CSDC2 |
cold shock domain containing C2, RNA binding |
| chr17_+_74075263 | 0.64 |
ENST00000334586.5 ENST00000392503.2 |
ZACN |
zinc activated ligand-gated ion channel |
| chr1_+_19970202 | 0.63 |
ENST00000439664.1 |
NBL1 |
neuroblastoma 1, DAN family BMP antagonist |
| chr5_-_146781153 | 0.62 |
ENST00000520473.1 |
DPYSL3 |
dihydropyrimidinase-like 3 |
| chr18_+_46065570 | 0.61 |
ENST00000591412.1 |
CTIF |
CBP80/20-dependent translation initiation factor |
| chr2_-_27486951 | 0.61 |
ENST00000432351.1 |
SLC30A3 |
solute carrier family 30 (zinc transporter), member 3 |
| chr5_-_159766528 | 0.59 |
ENST00000505287.2 |
CCNJL |
cyclin J-like |
| chr7_-_5553369 | 0.59 |
ENST00000453700.3 ENST00000382368.3 |
FBXL18 |
F-box and leucine-rich repeat protein 18 |
| chr19_-_42931567 | 0.59 |
ENST00000244289.4 |
LIPE |
lipase, hormone-sensitive |
| chr6_-_168397757 | 0.58 |
ENST00000456585.1 ENST00000414364.1 |
KIF25-AS1 |
KIF25 antisense RNA 1 |
| chr12_+_58087901 | 0.58 |
ENST00000315970.7 ENST00000547079.1 ENST00000439210.2 ENST00000389146.6 ENST00000413095.2 ENST00000551035.1 ENST00000257966.8 ENST00000435406.2 ENST00000550372.1 ENST00000389142.5 |
OS9 |
osteosarcoma amplified 9, endoplasmic reticulum lectin |
| chr3_-_49933249 | 0.57 |
ENST00000434765.1 |
MST1R |
macrophage stimulating 1 receptor (c-met-related tyrosine kinase) |
| chr17_+_4843413 | 0.57 |
ENST00000572430.1 ENST00000262482.6 |
RNF167 |
ring finger protein 167 |
| chr18_-_75705654 | 0.57 |
ENST00000578833.2 ENST00000582805.1 |
LINC01029 |
long intergenic non-protein coding RNA 1029 |
| chr16_+_524850 | 0.57 |
ENST00000450428.1 ENST00000452814.1 |
RAB11FIP3 |
RAB11 family interacting protein 3 (class II) |
| chr19_+_7710774 | 0.56 |
ENST00000602355.1 |
STXBP2 |
syntaxin binding protein 2 |
| chr17_-_4843316 | 0.56 |
ENST00000544061.2 |
SLC25A11 |
solute carrier family 25 (mitochondrial carrier; oxoglutarate carrier), member 11 |
| chr13_-_24471194 | 0.56 |
ENST00000382137.3 ENST00000382057.3 |
C1QTNF9B |
C1q and tumor necrosis factor related protein 9B |
| chr11_+_2397418 | 0.55 |
ENST00000530648.1 |
CD81 |
CD81 molecule |
| chr5_+_150404904 | 0.55 |
ENST00000521632.1 |
GPX3 |
glutathione peroxidase 3 (plasma) |
| chr12_+_58087738 | 0.55 |
ENST00000552285.1 |
OS9 |
osteosarcoma amplified 9, endoplasmic reticulum lectin |
| chr11_+_64794991 | 0.55 |
ENST00000352068.5 ENST00000525648.1 |
SNX15 |
sorting nexin 15 |
| chr18_-_74839891 | 0.55 |
ENST00000581878.1 |
MBP |
myelin basic protein |
| chr11_+_33563618 | 0.54 |
ENST00000526400.1 |
KIAA1549L |
KIAA1549-like |
| chr11_+_64794875 | 0.54 |
ENST00000377244.3 ENST00000534637.1 ENST00000524831.1 |
SNX15 |
sorting nexin 15 |
| chr2_+_128177458 | 0.54 |
ENST00000409048.1 ENST00000422777.3 |
PROC |
protein C (inactivator of coagulation factors Va and VIIIa) |
| chr12_+_52643077 | 0.54 |
ENST00000553310.2 ENST00000544024.1 |
KRT86 |
keratin 86 |
| chr18_+_63273310 | 0.54 |
ENST00000579862.1 |
RP11-775G23.1 |
RP11-775G23.1 |
| chr5_-_135290705 | 0.54 |
ENST00000274507.1 |
LECT2 |
leukocyte cell-derived chemotaxin 2 |
| chr19_-_41903161 | 0.53 |
ENST00000602129.1 ENST00000593771.1 ENST00000596905.1 ENST00000221233.4 |
EXOSC5 |
exosome component 5 |
| chr15_+_42565393 | 0.53 |
ENST00000561871.1 |
GANC |
glucosidase, alpha; neutral C |
| chr12_-_49581152 | 0.53 |
ENST00000550811.1 |
TUBA1A |
tubulin, alpha 1a |
| chr18_+_46066359 | 0.53 |
ENST00000587752.1 ENST00000588345.1 |
CTIF |
CBP80/20-dependent translation initiation factor |
| chr12_+_78359999 | 0.52 |
ENST00000550503.1 |
NAV3 |
neuron navigator 3 |
| chrX_-_55020511 | 0.52 |
ENST00000375006.3 ENST00000374992.2 |
PFKFB1 |
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 1 |
| chr1_+_95975672 | 0.52 |
ENST00000440116.2 ENST00000456933.1 |
RP11-286B14.1 |
RP11-286B14.1 |
| chr11_+_66115304 | 0.52 |
ENST00000531602.1 |
RP11-867G23.8 |
Uncharacterized protein |
| chr5_+_150406527 | 0.51 |
ENST00000520059.1 |
GPX3 |
glutathione peroxidase 3 (plasma) |
| chr12_-_85430024 | 0.51 |
ENST00000547836.1 ENST00000532498.2 |
TSPAN19 |
tetraspanin 19 |
| chr19_-_10697895 | 0.51 |
ENST00000591240.1 ENST00000589684.1 ENST00000591676.1 ENST00000250244.6 ENST00000590923.1 |
AP1M2 |
adaptor-related protein complex 1, mu 2 subunit |
| chr15_-_44969086 | 0.50 |
ENST00000434130.1 ENST00000560780.1 |
PATL2 |
protein associated with topoisomerase II homolog 2 (yeast) |
| chr6_+_31514622 | 0.50 |
ENST00000376146.4 |
NFKBIL1 |
nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor-like 1 |
| chr1_-_183538319 | 0.50 |
ENST00000420553.1 ENST00000419402.1 |
NCF2 |
neutrophil cytosolic factor 2 |
| chr1_+_212738676 | 0.49 |
ENST00000366981.4 ENST00000366987.2 |
ATF3 |
activating transcription factor 3 |
| chr22_-_30234218 | 0.49 |
ENST00000307790.3 ENST00000542393.1 ENST00000397771.2 |
ASCC2 |
activating signal cointegrator 1 complex subunit 2 |
| chr1_-_16302608 | 0.49 |
ENST00000375743.4 ENST00000375733.2 |
ZBTB17 |
zinc finger and BTB domain containing 17 |
| chr17_+_4843303 | 0.49 |
ENST00000571816.1 |
RNF167 |
ring finger protein 167 |
| chr16_+_29690358 | 0.48 |
ENST00000395384.4 ENST00000562473.1 |
QPRT |
quinolinate phosphoribosyltransferase |
| chr11_+_2397402 | 0.48 |
ENST00000475945.2 |
CD81 |
CD81 molecule |
| chr1_-_16302565 | 0.47 |
ENST00000537142.1 ENST00000448462.2 |
ZBTB17 |
zinc finger and BTB domain containing 17 |
| chr3_-_145940126 | 0.47 |
ENST00000498625.1 |
PLSCR4 |
phospholipid scramblase 4 |
| chr11_+_117073850 | 0.47 |
ENST00000529622.1 |
TAGLN |
transgelin |
| chr17_-_72864739 | 0.47 |
ENST00000579893.1 ENST00000544854.1 |
FDXR |
ferredoxin reductase |
| chr8_-_61880248 | 0.47 |
ENST00000525556.1 |
AC022182.3 |
AC022182.3 |
| chr9_+_125512019 | 0.47 |
ENST00000373684.1 ENST00000304720.2 |
OR1L6 |
olfactory receptor, family 1, subfamily L, member 6 |
| chr14_+_24674926 | 0.47 |
ENST00000339917.5 ENST00000556621.1 ENST00000287913.6 ENST00000428351.2 ENST00000555092.1 |
TSSK4 |
testis-specific serine kinase 4 |
| chr16_-_67881588 | 0.47 |
ENST00000561593.1 ENST00000565114.1 |
CENPT |
centromere protein T |
| chr9_-_88874519 | 0.46 |
ENST00000376001.3 ENST00000339137.3 |
C9orf153 |
chromosome 9 open reading frame 153 |
| chr12_-_122107549 | 0.46 |
ENST00000355329.3 |
MORN3 |
MORN repeat containing 3 |
| chr19_+_10654854 | 0.46 |
ENST00000586477.1 ENST00000586863.1 |
ATG4D |
autophagy related 4D, cysteine peptidase |
| chr1_+_206579736 | 0.46 |
ENST00000439126.1 |
SRGAP2 |
SLIT-ROBO Rho GTPase activating protein 2 |
| chr2_-_152118276 | 0.46 |
ENST00000409092.1 |
RBM43 |
RNA binding motif protein 43 |
| chr3_-_121379739 | 0.46 |
ENST00000428394.2 ENST00000314583.3 |
HCLS1 |
hematopoietic cell-specific Lyn substrate 1 |
| chr10_-_5227096 | 0.46 |
ENST00000488756.1 ENST00000334314.3 |
AKR1CL1 |
aldo-keto reductase family 1, member C-like 1 |
| chr5_+_175976324 | 0.46 |
ENST00000261944.5 |
CDHR2 |
cadherin-related family member 2 |
| chr4_+_169418255 | 0.46 |
ENST00000505667.1 ENST00000511948.1 |
PALLD |
palladin, cytoskeletal associated protein |
| chr12_+_123459127 | 0.46 |
ENST00000397389.2 ENST00000538755.1 ENST00000536150.1 ENST00000545056.1 ENST00000545612.1 ENST00000538628.1 ENST00000545317.1 |
OGFOD2 |
2-oxoglutarate and iron-dependent oxygenase domain containing 2 |
| chr1_+_47901689 | 0.46 |
ENST00000334793.5 |
FOXD2 |
forkhead box D2 |
| chr17_-_46623441 | 0.45 |
ENST00000330070.4 |
HOXB2 |
homeobox B2 |
| chr17_+_18996287 | 0.45 |
ENST00000399091.1 ENST00000443876.1 ENST00000428928.1 |
AC007952.5 |
Uncharacterized protein ENSP00000382042 |
| chr12_-_53207842 | 0.45 |
ENST00000458244.2 |
KRT4 |
keratin 4 |
| chr17_+_28886584 | 0.45 |
ENST00000584297.1 ENST00000579181.1 |
TBC1D29 |
TBC1 domain family, member 29 |
| chr19_-_40732594 | 0.45 |
ENST00000430325.2 ENST00000433940.1 |
CNTD2 |
cyclin N-terminal domain containing 2 |
| chr19_-_10614386 | 0.45 |
ENST00000171111.5 |
KEAP1 |
kelch-like ECH-associated protein 1 |
| chr11_+_6411670 | 0.45 |
ENST00000530395.1 ENST00000527275.1 |
SMPD1 |
sphingomyelin phosphodiesterase 1, acid lysosomal |
| chr3_-_194373831 | 0.44 |
ENST00000437613.1 |
LSG1 |
large 60S subunit nuclear export GTPase 1 |
| chr17_-_4843206 | 0.44 |
ENST00000576951.1 |
SLC25A11 |
solute carrier family 25 (mitochondrial carrier; oxoglutarate carrier), member 11 |
| chr21_-_44751903 | 0.44 |
ENST00000450205.1 |
LINC00322 |
long intergenic non-protein coding RNA 322 |
| chr1_-_55089191 | 0.44 |
ENST00000302250.2 ENST00000371304.2 |
FAM151A |
family with sequence similarity 151, member A |
| chr6_-_32095968 | 0.44 |
ENST00000375203.3 ENST00000375201.4 |
ATF6B |
activating transcription factor 6 beta |
| chr6_-_27880174 | 0.44 |
ENST00000303324.2 |
OR2B2 |
olfactory receptor, family 2, subfamily B, member 2 |
| chr19_-_10464570 | 0.44 |
ENST00000529739.1 |
TYK2 |
tyrosine kinase 2 |
| chr17_-_76870222 | 0.44 |
ENST00000585421.1 |
TIMP2 |
TIMP metallopeptidase inhibitor 2 |
| chr9_+_131133598 | 0.44 |
ENST00000372853.4 ENST00000452446.1 ENST00000372850.1 ENST00000372847.1 |
URM1 |
ubiquitin related modifier 1 |
| chr4_+_139694701 | 0.43 |
ENST00000502606.1 |
RP11-98O2.1 |
RP11-98O2.1 |
| chr7_-_2883928 | 0.43 |
ENST00000275364.3 |
GNA12 |
guanine nucleotide binding protein (G protein) alpha 12 |
| chr3_-_128690173 | 0.43 |
ENST00000508239.1 |
RP11-723O4.6 |
Uncharacterized protein FLJ43738 |
| chr9_+_125486269 | 0.43 |
ENST00000259466.1 |
OR1L4 |
olfactory receptor, family 1, subfamily L, member 4 |
| chr1_+_161129254 | 0.43 |
ENST00000368002.3 ENST00000289865.8 ENST00000479344.1 ENST00000368001.1 |
USP21 |
ubiquitin specific peptidase 21 |
| chr1_-_219615984 | 0.43 |
ENST00000420762.1 |
RP11-95P13.1 |
RP11-95P13.1 |
| chr1_+_12538594 | 0.43 |
ENST00000543710.1 |
VPS13D |
vacuolar protein sorting 13 homolog D (S. cerevisiae) |
| chr17_+_4843352 | 0.43 |
ENST00000573404.1 ENST00000576452.1 |
RNF167 |
ring finger protein 167 |
| chr16_-_67965756 | 0.43 |
ENST00000571044.1 ENST00000571605.1 |
CTRL |
chymotrypsin-like |
| chr2_-_27579842 | 0.42 |
ENST00000423998.1 ENST00000264720.3 |
GTF3C2 |
general transcription factor IIIC, polypeptide 2, beta 110kDa |
| chr18_-_47813940 | 0.42 |
ENST00000586837.1 ENST00000412036.2 ENST00000589940.1 |
CXXC1 |
CXXC finger protein 1 |
| chr2_-_89157161 | 0.42 |
ENST00000390237.2 |
IGKC |
immunoglobulin kappa constant |
| chr6_+_131958436 | 0.42 |
ENST00000357639.3 ENST00000543135.1 ENST00000427148.2 ENST00000358229.5 |
ENPP3 |
ectonucleotide pyrophosphatase/phosphodiesterase 3 |
| chr14_-_50065882 | 0.42 |
ENST00000539688.1 |
AL139099.1 |
Full-length cDNA clone CS0DK012YO09 of HeLa cells of Homo sapiens (human); Uncharacterized protein |
| chr17_-_40086783 | 0.42 |
ENST00000592970.1 |
ACLY |
ATP citrate lyase |
| chr16_+_30934376 | 0.42 |
ENST00000562798.1 ENST00000471231.2 |
FBXL19 |
F-box and leucine-rich repeat protein 19 |
| chr3_-_49893907 | 0.42 |
ENST00000482582.1 |
TRAIP |
TRAF interacting protein |
| chr1_+_154229547 | 0.42 |
ENST00000428595.1 |
UBAP2L |
ubiquitin associated protein 2-like |
| chr11_+_6411636 | 0.42 |
ENST00000299397.3 ENST00000356761.2 ENST00000342245.4 |
SMPD1 |
sphingomyelin phosphodiesterase 1, acid lysosomal |
| chr6_+_90272488 | 0.42 |
ENST00000485637.1 ENST00000522705.1 |
ANKRD6 |
ankyrin repeat domain 6 |
| chr19_+_57999079 | 0.42 |
ENST00000426954.2 ENST00000354197.4 ENST00000523882.1 ENST00000520540.1 ENST00000519310.1 ENST00000442920.2 ENST00000523312.1 ENST00000424930.2 |
ZNF419 |
zinc finger protein 419 |
| chr1_+_156589051 | 0.42 |
ENST00000255039.1 |
HAPLN2 |
hyaluronan and proteoglycan link protein 2 |
| chr19_+_544034 | 0.41 |
ENST00000592501.1 ENST00000264553.3 |
GZMM |
granzyme M (lymphocyte met-ase 1) |
| chr4_+_159727272 | 0.41 |
ENST00000379346.3 |
FNIP2 |
folliculin interacting protein 2 |
| chr12_+_113587558 | 0.41 |
ENST00000335621.6 |
CCDC42B |
coiled-coil domain containing 42B |
| chr15_+_58702742 | 0.41 |
ENST00000356113.6 ENST00000414170.3 |
LIPC |
lipase, hepatic |
| chr19_-_10426663 | 0.41 |
ENST00000541276.1 ENST00000393708.3 ENST00000494368.1 |
FDX1L |
ferredoxin 1-like |
| chr14_-_61124977 | 0.41 |
ENST00000554986.1 |
SIX1 |
SIX homeobox 1 |
| chr22_+_22676808 | 0.41 |
ENST00000390290.2 |
IGLV1-51 |
immunoglobulin lambda variable 1-51 |
| chr7_+_114562909 | 0.41 |
ENST00000423503.1 ENST00000427207.1 |
MDFIC |
MyoD family inhibitor domain containing |
| chr12_+_48178706 | 0.41 |
ENST00000599515.1 |
AC004466.1 |
Uncharacterized protein |
| chr1_+_150480576 | 0.41 |
ENST00000346569.6 |
ECM1 |
extracellular matrix protein 1 |
| chr16_-_86588627 | 0.41 |
ENST00000565482.1 ENST00000564364.1 ENST00000561989.1 ENST00000543303.2 ENST00000381214.5 ENST00000360900.6 ENST00000322911.6 ENST00000546093.1 ENST00000569000.1 ENST00000562994.1 ENST00000561522.1 |
MTHFSD |
methenyltetrahydrofolate synthetase domain containing |
| chr20_-_43133491 | 0.40 |
ENST00000411544.1 |
SERINC3 |
serine incorporator 3 |
| chr3_-_49170522 | 0.40 |
ENST00000418109.1 |
LAMB2 |
laminin, beta 2 (laminin S) |
| chr17_+_73663402 | 0.40 |
ENST00000355423.3 |
SAP30BP |
SAP30 binding protein |
| chr13_+_27844464 | 0.40 |
ENST00000241463.4 |
RASL11A |
RAS-like, family 11, member A |
| chr17_-_42994283 | 0.40 |
ENST00000593179.1 |
GFAP |
glial fibrillary acidic protein |
| chrX_-_48901012 | 0.40 |
ENST00000315869.7 |
TFE3 |
transcription factor binding to IGHM enhancer 3 |
| chr15_+_75491213 | 0.40 |
ENST00000360639.2 |
C15orf39 |
chromosome 15 open reading frame 39 |
| chr18_-_53735601 | 0.40 |
ENST00000589754.1 |
CTD-2008L17.2 |
CTD-2008L17.2 |
| chr19_-_36231437 | 0.40 |
ENST00000591748.1 |
IGFLR1 |
IGF-like family receptor 1 |
| chr12_-_11002063 | 0.40 |
ENST00000544994.1 ENST00000228811.4 ENST00000540107.1 |
PRR4 |
proline rich 4 (lacrimal) |
| chr19_-_46272462 | 0.40 |
ENST00000317578.6 |
SIX5 |
SIX homeobox 5 |
| chr17_-_4448361 | 0.39 |
ENST00000572759.1 |
MYBBP1A |
MYB binding protein (P160) 1a |
| chr9_+_140119618 | 0.39 |
ENST00000359069.2 |
C9orf169 |
chromosome 9 open reading frame 169 |
| chr5_+_121465234 | 0.39 |
ENST00000504912.1 ENST00000505843.1 |
ZNF474 |
zinc finger protein 474 |
| chr19_+_51226573 | 0.39 |
ENST00000250340.4 |
CLEC11A |
C-type lectin domain family 11, member A |
| chrX_+_70364667 | 0.39 |
ENST00000536169.1 ENST00000395855.2 ENST00000374051.3 ENST00000358741.3 |
NLGN3 |
neuroligin 3 |
| chr12_+_122018697 | 0.39 |
ENST00000541574.1 |
RP13-941N14.1 |
RP13-941N14.1 |
| chr16_+_19619083 | 0.39 |
ENST00000538552.1 |
C16orf62 |
chromosome 16 open reading frame 62 |
| chr19_-_51872233 | 0.39 |
ENST00000601435.1 ENST00000291715.1 |
CLDND2 |
claudin domain containing 2 |
| chr19_-_55791058 | 0.39 |
ENST00000587959.1 ENST00000585927.1 ENST00000587922.1 ENST00000585698.1 |
HSPBP1 |
HSPA (heat shock 70kDa) binding protein, cytoplasmic cochaperone 1 |
| chr1_+_27158483 | 0.39 |
ENST00000374141.2 |
ZDHHC18 |
zinc finger, DHHC-type containing 18 |
| chr20_+_1099233 | 0.39 |
ENST00000246015.4 ENST00000335877.6 ENST00000438768.2 |
PSMF1 |
proteasome (prosome, macropain) inhibitor subunit 1 (PI31) |
| chr11_+_19799327 | 0.38 |
ENST00000540292.1 |
NAV2 |
neuron navigator 2 |
| chr12_-_52761262 | 0.38 |
ENST00000257901.3 |
KRT85 |
keratin 85 |
| chr16_-_71610985 | 0.38 |
ENST00000355962.4 |
TAT |
tyrosine aminotransferase |
| chr3_+_127317705 | 0.38 |
ENST00000480910.1 |
MCM2 |
minichromosome maintenance complex component 2 |
| chr10_-_101825151 | 0.38 |
ENST00000441382.1 |
CPN1 |
carboxypeptidase N, polypeptide 1 |
| chr3_+_52454971 | 0.38 |
ENST00000465863.1 |
PHF7 |
PHD finger protein 7 |
| chr20_-_39928705 | 0.38 |
ENST00000436099.2 ENST00000309060.3 ENST00000373261.1 ENST00000436440.2 ENST00000540170.1 ENST00000557816.1 ENST00000560361.1 |
ZHX3 |
zinc fingers and homeoboxes 3 |
| chr19_-_9237626 | 0.38 |
ENST00000305444.2 |
OR7G3 |
olfactory receptor, family 7, subfamily G, member 3 |
| chr4_-_7873981 | 0.38 |
ENST00000360265.4 |
AFAP1 |
actin filament associated protein 1 |
| chr7_+_97736197 | 0.38 |
ENST00000297293.5 |
LMTK2 |
lemur tyrosine kinase 2 |
| chr17_-_56296580 | 0.38 |
ENST00000313863.6 ENST00000546108.1 ENST00000337050.7 ENST00000393119.2 |
MKS1 |
Meckel syndrome, type 1 |
| chr17_-_47286729 | 0.38 |
ENST00000300406.2 ENST00000511277.1 ENST00000511673.1 |
GNGT2 |
guanine nucleotide binding protein (G protein), gamma transducing activity polypeptide 2 |
| chr15_+_67458861 | 0.38 |
ENST00000558428.1 ENST00000558827.1 |
SMAD3 |
SMAD family member 3 |
| chr2_+_90192768 | 0.37 |
ENST00000390275.2 |
IGKV1D-13 |
immunoglobulin kappa variable 1D-13 |
| chrX_+_47082408 | 0.37 |
ENST00000518022.1 ENST00000276052.6 |
CDK16 |
cyclin-dependent kinase 16 |
| chr3_+_150126101 | 0.37 |
ENST00000361875.3 ENST00000361136.2 |
TSC22D2 |
TSC22 domain family, member 2 |
| chr3_+_121289551 | 0.37 |
ENST00000334384.3 |
ARGFX |
arginine-fifty homeobox |
| chr16_+_71660052 | 0.37 |
ENST00000567566.1 |
MARVELD3 |
MARVEL domain containing 3 |
| chr19_+_47105309 | 0.37 |
ENST00000599839.1 ENST00000596362.1 |
CALM3 |
calmodulin 3 (phosphorylase kinase, delta) |
| chr4_-_2935674 | 0.37 |
ENST00000514800.1 |
MFSD10 |
major facilitator superfamily domain containing 10 |
| chr16_+_67694849 | 0.37 |
ENST00000602551.1 ENST00000458121.2 ENST00000219255.3 |
PARD6A |
par-6 family cell polarity regulator alpha |
| chr17_+_75447326 | 0.37 |
ENST00000591088.1 |
SEPT9 |
septin 9 |
| chr3_+_11178779 | 0.37 |
ENST00000438284.2 |
HRH1 |
histamine receptor H1 |
| chr7_+_75024903 | 0.37 |
ENST00000323819.3 ENST00000430211.1 |
TRIM73 |
tripartite motif containing 73 |
| chrX_+_47004639 | 0.37 |
ENST00000345781.6 |
RBM10 |
RNA binding motif protein 10 |
| chr17_-_56591978 | 0.37 |
ENST00000583656.1 |
MTMR4 |
myotubularin related protein 4 |
| chr19_+_12848299 | 0.37 |
ENST00000357332.3 |
ASNA1 |
arsA arsenite transporter, ATP-binding, homolog 1 (bacterial) |
| chr1_+_42619070 | 0.37 |
ENST00000372581.1 |
GUCA2B |
guanylate cyclase activator 2B (uroguanylin) |
| chr15_+_59910132 | 0.37 |
ENST00000559200.1 |
GCNT3 |
glucosaminyl (N-acetyl) transferase 3, mucin type |
| chr22_-_26875345 | 0.37 |
ENST00000398141.1 |
HPS4 |
Hermansky-Pudlak syndrome 4 |
| chr16_+_69333585 | 0.37 |
ENST00000570054.2 |
RP11-343C2.11 |
Uncharacterized protein |
| chr7_+_134551583 | 0.37 |
ENST00000435928.1 |
CALD1 |
caldesmon 1 |
| chr4_-_90758227 | 0.36 |
ENST00000506691.1 ENST00000394986.1 ENST00000506244.1 ENST00000394989.2 ENST00000394991.3 |
SNCA |
synuclein, alpha (non A4 component of amyloid precursor) |
| chr3_-_49131788 | 0.36 |
ENST00000395443.2 ENST00000411682.1 |
QRICH1 |
glutamine-rich 1 |
| chr20_-_62493217 | 0.36 |
ENST00000601296.1 |
C20ORF135 |
C20ORF135 |
| chr1_-_149785236 | 0.36 |
ENST00000331491.1 |
HIST2H3D |
histone cluster 2, H3d |
| chr15_+_67418047 | 0.36 |
ENST00000540846.2 |
SMAD3 |
SMAD family member 3 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.6 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.2 | 1.0 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.2 | 0.7 | GO:0048075 | positive regulation of eye pigmentation(GO:0048075) |
| 0.2 | 0.9 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.2 | 0.7 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.2 | 0.9 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.2 | 0.8 | GO:0090299 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.2 | 1.1 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.2 | 0.8 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.2 | 0.6 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.2 | 0.7 | GO:0019046 | release from viral latency(GO:0019046) |
| 0.2 | 0.9 | GO:0009253 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.2 | 1.3 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
| 0.2 | 1.4 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.2 | 0.9 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
| 0.2 | 0.3 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.2 | 0.8 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.2 | 1.0 | GO:0015878 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 0.2 | 0.5 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.2 | 0.7 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.2 | 0.8 | GO:0044501 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.2 | 0.5 | GO:0090675 | intermicrovillar adhesion(GO:0090675) |
| 0.2 | 0.5 | GO:0021569 | rhombomere 3 development(GO:0021569) |
| 0.1 | 0.1 | GO:1902958 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.1 | 0.7 | GO:0051585 | negative regulation of dopamine uptake involved in synaptic transmission(GO:0051585) norepinephrine uptake(GO:0051620) regulation of norepinephrine uptake(GO:0051621) negative regulation of norepinephrine uptake(GO:0051622) negative regulation of catecholamine uptake involved in synaptic transmission(GO:0051945) regulation of glutathione peroxidase activity(GO:1903282) positive regulation of glutathione peroxidase activity(GO:1903284) positive regulation of hydrogen peroxide catabolic process(GO:1903285) positive regulation of peroxidase activity(GO:2000470) |
| 0.1 | 0.4 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.1 | 0.6 | GO:0003363 | lamellipodium assembly involved in ameboidal cell migration(GO:0003363) extension of a leading process involved in cell motility in cerebral cortex radial glia guided migration(GO:0021816) |
| 0.1 | 0.1 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
| 0.1 | 0.6 | GO:0072312 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.1 | 0.9 | GO:0071486 | cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 0.1 | 0.1 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.1 | 0.4 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.1 | 0.4 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.1 | 0.4 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.1 | 0.4 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.4 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.1 | 0.4 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.1 | 0.5 | GO:0002384 | hepatic immune response(GO:0002384) |
| 0.1 | 0.3 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.1 | 0.1 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.1 | 0.8 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.1 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.1 | 0.5 | GO:0018277 | protein deamination(GO:0018277) |
| 0.1 | 0.7 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
| 0.1 | 0.4 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 | 0.5 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 | 0.5 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.1 | 0.4 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.1 | 0.2 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 | 0.3 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.1 | 0.5 | GO:1901594 | detection of temperature stimulus involved in thermoception(GO:0050960) response to capsazepine(GO:1901594) |
| 0.1 | 0.3 | GO:0060381 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
| 0.1 | 0.6 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.1 | 0.9 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.3 | GO:0046603 | negative regulation of mitotic centrosome separation(GO:0046603) |
| 0.1 | 0.4 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.1 | 0.3 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 1.4 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.7 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 1.0 | GO:0042791 | 5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
| 0.1 | 0.6 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.1 | 0.3 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.1 | 0.3 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.1 | 0.3 | GO:0086092 | regulation of the force of heart contraction by cardiac conduction(GO:0086092) |
| 0.1 | 0.3 | GO:1901291 | negative regulation of double-strand break repair via single-strand annealing(GO:1901291) |
| 0.1 | 0.3 | GO:0098976 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.1 | 0.5 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.1 | 0.4 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.1 | 0.4 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 0.3 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.1 | 0.1 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.1 | 0.3 | GO:0072737 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) |
| 0.1 | 0.3 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.1 | 0.3 | GO:0015881 | creatine transport(GO:0015881) creatine transmembrane transport(GO:1902598) |
| 0.1 | 0.3 | GO:0019082 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.1 | 0.5 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.1 | 1.3 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.1 | 0.3 | GO:0060265 | positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
| 0.1 | 0.1 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.1 | 0.2 | GO:0051340 | regulation of ligase activity(GO:0051340) positive regulation of ligase activity(GO:0051351) |
| 0.1 | 0.3 | GO:0005986 | sucrose biosynthetic process(GO:0005986) |
| 0.1 | 0.4 | GO:2000969 | positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.1 | 0.4 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.1 | 0.3 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.1 | 1.3 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 | 0.3 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.1 | 0.4 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.1 | 0.3 | GO:1990709 | presynaptic active zone organization(GO:1990709) |
| 0.1 | 0.3 | GO:0032618 | interleukin-15 production(GO:0032618) |
| 0.1 | 0.3 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.1 | 0.5 | GO:1904209 | regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 0.1 | 0.6 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.1 | 0.2 | GO:0061145 | bronchus cartilage development(GO:0060532) lung smooth muscle development(GO:0061145) |
| 0.1 | 0.3 | GO:2000570 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.1 | 0.1 | GO:1901617 | organic hydroxy compound biosynthetic process(GO:1901617) |
| 0.1 | 0.3 | GO:1900736 | regulation of proteinase activated receptor activity(GO:1900276) regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
| 0.1 | 0.3 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.1 | 0.9 | GO:0042148 | strand invasion(GO:0042148) |
| 0.1 | 0.3 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.1 | 0.8 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.3 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 0.1 | 0.1 | GO:0032632 | interleukin-3 production(GO:0032632) |
| 0.1 | 0.2 | GO:1900275 | negative regulation of phospholipase C activity(GO:1900275) |
| 0.1 | 0.1 | GO:0048708 | astrocyte differentiation(GO:0048708) |
| 0.1 | 0.2 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.1 | 0.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 0.2 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.1 | 0.4 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.1 | 0.2 | GO:0046041 | ITP metabolic process(GO:0046041) |
| 0.1 | 0.3 | GO:0015855 | pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.1 | 0.4 | GO:0036512 | trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.1 | 0.2 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.1 | 0.2 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
| 0.1 | 0.1 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.1 | 0.2 | GO:0001172 | transcription, RNA-templated(GO:0001172) |
| 0.1 | 0.3 | GO:0021965 | spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.1 | 0.5 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.1 | 0.8 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
| 0.1 | 0.2 | GO:1903464 | negative regulation of mitotic cell cycle DNA replication(GO:1903464) |
| 0.1 | 0.6 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.4 | GO:0061009 | common bile duct development(GO:0061009) |
| 0.1 | 0.5 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.1 | 0.5 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 0.1 | 0.2 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
| 0.1 | 0.2 | GO:1903093 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.1 | 0.3 | GO:0046968 | peptide antigen transport(GO:0046968) |
| 0.1 | 0.1 | GO:0001946 | lymphangiogenesis(GO:0001946) |
| 0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.1 | 0.2 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.1 | 0.3 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.1 | 0.1 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 0.1 | 0.3 | GO:1904845 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.1 | 0.2 | GO:2001247 | positive regulation of phosphatidylcholine biosynthetic process(GO:2001247) |
| 0.1 | 0.4 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 0.1 | 0.1 | GO:0007189 | adenylate cyclase-activating G-protein coupled receptor signaling pathway(GO:0007189) |
| 0.1 | 0.7 | GO:0035524 | L-alanine transport(GO:0015808) proline transmembrane transport(GO:0035524) |
| 0.1 | 0.2 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
| 0.1 | 0.3 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.1 | 0.1 | GO:0045732 | positive regulation of protein catabolic process(GO:0045732) |
| 0.1 | 0.2 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
| 0.1 | 0.2 | GO:0006711 | estrogen catabolic process(GO:0006711) |
| 0.1 | 0.2 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.1 | 0.2 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.1 | 1.5 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 | 0.4 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.1 | 0.2 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.1 | 0.2 | GO:0072720 | response to dithiothreitol(GO:0072720) |
| 0.1 | 0.6 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.1 | 0.6 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.1 | 0.6 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.1 | 0.8 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 | 0.6 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.1 | 0.3 | GO:0048146 | positive regulation of fibroblast proliferation(GO:0048146) |
| 0.1 | 0.8 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.1 | 0.6 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.1 | 0.1 | GO:1901860 | positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.1 | 0.1 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.1 | 0.3 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.1 | 0.3 | GO:0071873 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.1 | 0.2 | GO:0043087 | regulation of GTPase activity(GO:0043087) |
| 0.1 | 0.1 | GO:1904106 | protein localization to microvillus(GO:1904106) |
| 0.1 | 0.2 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 | 0.4 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.1 | 0.3 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.1 | 0.2 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.1 | 0.2 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.1 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.1 | 0.2 | GO:0010160 | sensory organ boundary specification(GO:0008052) formation of organ boundary(GO:0010160) taste bud development(GO:0061193) |
| 0.1 | 0.3 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.1 | 0.4 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.1 | 0.6 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 | 1.1 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.1 | 1.0 | GO:0032329 | serine transport(GO:0032329) |
| 0.1 | 0.4 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.7 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 | 0.1 | GO:0051389 | inactivation of MAPKK activity(GO:0051389) |
| 0.1 | 0.2 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 0.3 | GO:0018057 | peptidyl-lysine oxidation(GO:0018057) negative regulation of T-helper 17 cell lineage commitment(GO:2000329) |
| 0.1 | 0.3 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.1 | 0.2 | GO:0009304 | tRNA transcription(GO:0009304) |
| 0.1 | 0.1 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.1 | 0.4 | GO:0061034 | olfactory bulb mitral cell layer development(GO:0061034) |
| 0.1 | 0.2 | GO:0070141 | response to UV-A(GO:0070141) |
| 0.1 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.1 | 0.1 | GO:1904744 | positive regulation of telomeric DNA binding(GO:1904744) |
| 0.1 | 0.2 | GO:0033320 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.1 | 0.4 | GO:0042695 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 | 0.2 | GO:0014876 | response to injury involved in regulation of muscle adaptation(GO:0014876) |
| 0.1 | 0.6 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.1 | 0.2 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 | 0.4 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.1 | 0.4 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 0.5 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.1 | 0.3 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
| 0.1 | 0.1 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
| 0.1 | 0.2 | GO:0032387 | negative regulation of intracellular transport(GO:0032387) |
| 0.1 | 0.2 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.1 | 0.2 | GO:0035690 | cellular response to drug(GO:0035690) |
| 0.1 | 0.2 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.1 | 0.7 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 | 0.4 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 0.4 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.1 | 0.2 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.1 | 0.5 | GO:1990834 | response to odorant(GO:1990834) |
| 0.1 | 0.2 | GO:0003168 | Purkinje myocyte differentiation(GO:0003168) cardiac pacemaker cell fate commitment(GO:0060927) atrioventricular node cell fate commitment(GO:0060929) |
| 0.1 | 0.2 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.1 | 0.5 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.1 | 0.2 | GO:0036114 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.1 | 0.2 | GO:0050760 | thymidylate synthase biosynthetic process(GO:0050757) regulation of thymidylate synthase biosynthetic process(GO:0050758) negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.1 | 0.3 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.1 | 0.2 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.2 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.1 | 0.3 | GO:0044855 | plasma membrane raft distribution(GO:0044855) plasma membrane raft localization(GO:0044856) plasma membrane raft polarization(GO:0044858) regulation of plasma membrane raft polarization(GO:1903906) |
| 0.1 | 0.4 | GO:0019075 | virus maturation(GO:0019075) |
| 0.1 | 0.3 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.1 | 0.2 | GO:1902948 | regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.1 | 0.2 | GO:0009409 | response to cold(GO:0009409) |
| 0.1 | 0.5 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.1 | 0.2 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.1 | 0.3 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.1 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 | 0.1 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.1 | 0.3 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.1 | 0.5 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 0.2 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.1 | 0.5 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 | 0.2 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.1 | 0.1 | GO:0070256 | negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 0.1 | 0.2 | GO:1905051 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.1 | 0.2 | GO:0046882 | negative regulation of B cell differentiation(GO:0045578) negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.1 | 0.1 | GO:0006429 | leucyl-tRNA aminoacylation(GO:0006429) |
| 0.1 | 0.5 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 | 0.6 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.1 | 1.1 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.1 | 0.2 | GO:1901207 | regulation of heart looping(GO:1901207) positive regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903762) positive regulation of ventricular cardiac muscle cell action potential(GO:1903947) positive regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905026) positive regulation of membrane repolarization during cardiac muscle cell action potential(GO:1905033) |
| 0.1 | 0.2 | GO:0002728 | negative regulation of natural killer cell cytokine production(GO:0002728) |
| 0.1 | 0.3 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.2 | GO:1901895 | negative regulation of calcium-transporting ATPase activity(GO:1901895) |
| 0.1 | 0.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.2 | GO:0046963 | 3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
| 0.1 | 0.2 | GO:1904815 | negative regulation of protein localization to chromosome, telomeric region(GO:1904815) |
| 0.1 | 0.2 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.1 | 0.2 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.1 | 0.1 | GO:0050787 | detoxification of mercury ion(GO:0050787) |
| 0.1 | 0.1 | GO:0055013 | cardiac cell development(GO:0055006) cardiac muscle cell development(GO:0055013) |
| 0.1 | 0.3 | GO:0042335 | cuticle development(GO:0042335) |
| 0.1 | 0.2 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.1 | 0.2 | GO:0050712 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.1 | 0.2 | GO:0002194 | hepatocyte cell migration(GO:0002194) otic placode formation(GO:0043049) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 0.1 | 0.3 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
| 0.1 | 0.1 | GO:0015783 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.1 | 0.1 | GO:0007416 | synapse assembly(GO:0007416) |
| 0.1 | 0.2 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
| 0.1 | 0.4 | GO:0014848 | urinary bladder smooth muscle contraction(GO:0014832) urinary tract smooth muscle contraction(GO:0014848) |
| 0.1 | 0.2 | GO:0036451 | cap mRNA methylation(GO:0036451) |
| 0.1 | 0.8 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.1 | 0.3 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.1 | 0.2 | GO:1903045 | neural crest cell migration involved in sympathetic nervous system development(GO:1903045) |
| 0.1 | 0.1 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.1 | 0.2 | GO:2000224 | sesquiterpenoid metabolic process(GO:0006714) sesquiterpenoid catabolic process(GO:0016107) farnesol metabolic process(GO:0016487) farnesol catabolic process(GO:0016488) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.1 | 0.4 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.1 | 0.2 | GO:0072616 | interleukin-18 secretion(GO:0072616) |
| 0.1 | 0.5 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 | 0.1 | GO:0043368 | positive T cell selection(GO:0043368) |
| 0.1 | 0.1 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.1 | 0.5 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.1 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 0.2 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.1 | 1.1 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.1 | 0.3 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.4 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.1 | 0.4 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.1 | 0.2 | GO:0005997 | xylulose metabolic process(GO:0005997) |
| 0.1 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.1 | 0.2 | GO:0001300 | chronological cell aging(GO:0001300) |
| 0.1 | 0.3 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.1 | 0.4 | GO:0045229 | cell envelope organization(GO:0043163) external encapsulating structure organization(GO:0045229) |
| 0.1 | 0.2 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.0 | 0.2 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
| 0.0 | 0.2 | GO:0072708 | response to sorbitol(GO:0072708) cellular response to sorbitol(GO:0072709) |
| 0.0 | 0.4 | GO:1902996 | regulation of neurofibrillary tangle assembly(GO:1902996) |
| 0.0 | 0.2 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.0 | 0.2 | GO:0090362 | positive regulation of platelet-derived growth factor production(GO:0090362) |
| 0.0 | 0.2 | GO:0051413 | response to cortisone(GO:0051413) |
| 0.0 | 0.3 | GO:0097647 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.0 | 1.0 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.0 | 0.1 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.0 | 0.4 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.0 | 0.2 | GO:0031337 | cellular response to phosphate starvation(GO:0016036) regulation of sulfur amino acid metabolic process(GO:0031335) positive regulation of sulfur amino acid metabolic process(GO:0031337) regulation of homocysteine metabolic process(GO:0050666) positive regulation of homocysteine metabolic process(GO:0050668) |
| 0.0 | 0.2 | GO:0046778 | modification by virus of host mRNA processing(GO:0046778) |
| 0.0 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.4 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.4 | GO:1900623 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.0 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.0 | 0.3 | GO:0072619 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.0 | 0.2 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.4 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 0.0 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.0 | 0.1 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.0 | 0.1 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.0 | 0.2 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.0 | 0.1 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.0 | 0.3 | GO:1903307 | positive regulation of regulated secretory pathway(GO:1903307) |
| 0.0 | 0.6 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.1 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.0 | 0.1 | GO:0014068 | positive regulation of phosphatidylinositol 3-kinase signaling(GO:0014068) |
| 0.0 | 0.6 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.0 | 0.1 | GO:0061713 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
| 0.0 | 0.7 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.0 | 0.2 | GO:0043006 | activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
| 0.0 | 0.4 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.1 | GO:1902949 | positive regulation of tau-protein kinase activity(GO:1902949) |
| 0.0 | 0.6 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 | 0.2 | GO:1902161 | positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.0 | 0.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.0 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.4 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.0 | 0.2 | GO:0030222 | eosinophil differentiation(GO:0030222) |
| 0.0 | 0.4 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.0 | 0.2 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 | 0.2 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.0 | 0.1 | GO:0044727 | DNA demethylation of male pronucleus(GO:0044727) |
| 0.0 | 2.2 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.0 | 0.2 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.0 | 0.1 | GO:2000295 | regulation of hydrogen peroxide catabolic process(GO:2000295) |
| 0.0 | 0.4 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.0 | 0.3 | GO:0070543 | response to linoleic acid(GO:0070543) |
| 0.0 | 0.1 | GO:0009080 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
| 0.0 | 0.2 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
| 0.0 | 0.2 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.0 | 0.4 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) |
| 0.0 | 0.2 | GO:0039656 | modulation by virus of host transcription(GO:0019056) modulation by virus of host gene expression(GO:0039656) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.0 | 0.1 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 | 0.9 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 | 0.1 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.0 | 0.2 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 | 0.2 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.0 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.1 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.0 | 0.3 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.0 | 0.1 | GO:0045799 | positive regulation of chromatin assembly or disassembly(GO:0045799) |
| 0.0 | 0.3 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
| 0.0 | 0.1 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.5 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.0 | 0.3 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.0 | 0.5 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.2 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.7 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.1 | GO:1904528 | positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 0.1 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.0 | 0.1 | GO:0048867 | ganglion mother cell fate determination(GO:0007402) stem cell fate determination(GO:0048867) |
| 0.0 | 0.2 | GO:1903401 | L-lysine transmembrane transport(GO:1903401) |
| 0.0 | 0.2 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.0 | 0.1 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 0.0 | 0.2 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
| 0.0 | 0.9 | GO:0001702 | gastrulation with mouth forming second(GO:0001702) |
| 0.0 | 0.2 | GO:0045007 | depurination(GO:0045007) |
| 0.0 | 1.1 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.5 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.3 | GO:0015827 | tryptophan transport(GO:0015827) leucine import(GO:0060356) |
| 0.0 | 0.5 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 0.1 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.0 | 0.4 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.0 | 0.2 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
| 0.0 | 0.3 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) positive regulation of transforming growth factor beta3 production(GO:0032916) |
| 0.0 | 0.4 | GO:0000023 | maltose metabolic process(GO:0000023) |
| 0.0 | 0.1 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.0 | 0.4 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.0 | 0.4 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.0 | 0.5 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.1 | GO:0060667 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) branch elongation involved in salivary gland morphogenesis(GO:0060667) mesenchymal cell differentiation involved in lung development(GO:0060915) |
| 0.0 | 0.4 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.0 | 0.2 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.0 | 0.2 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.0 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.5 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.0 | 0.3 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.0 | 0.2 | GO:0030047 | actin modification(GO:0030047) |
| 0.0 | 0.2 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.0 | 0.1 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.0 | 0.2 | GO:0035026 | leading edge cell differentiation(GO:0035026) |
| 0.0 | 0.1 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
| 0.0 | 0.4 | GO:0009838 | abscission(GO:0009838) |
| 0.0 | 0.2 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.0 | 0.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.0 | 0.2 | GO:0019640 | glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
| 0.0 | 0.7 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.7 | GO:1901748 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.0 | 0.2 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.4 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.2 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 0.0 | 0.2 | GO:0018153 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
| 0.0 | 0.5 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
| 0.0 | 0.3 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.2 | GO:0070091 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
| 0.0 | 0.2 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.0 | 0.1 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.0 | 0.1 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
| 0.0 | 0.1 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 0.0 | 0.3 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 | 0.0 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.0 | 1.1 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 | 0.3 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.0 | 0.4 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.0 | 0.3 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 | 0.0 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.0 | 0.1 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.0 | 0.1 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.3 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.0 | 0.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.0 | 0.3 | GO:0070560 | protein secretion by platelet(GO:0070560) |
| 0.0 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.0 | 0.2 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 0.0 | GO:0030324 | lung development(GO:0030324) |
| 0.0 | 0.3 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.1 | GO:0060433 | bronchus development(GO:0060433) lung goblet cell differentiation(GO:0060480) lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.0 | 0.5 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.3 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.1 | GO:0002503 | peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 0.0 | 0.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 1.6 | GO:0015991 | ATP hydrolysis coupled proton transport(GO:0015991) |
| 0.0 | 0.2 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.2 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.0 | 0.1 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 | 0.1 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.0 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) glycerol biosynthetic process(GO:0006114) aspartate catabolic process(GO:0006533) |
| 0.0 | 0.1 | GO:0042245 | RNA repair(GO:0042245) |
| 0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.3 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.0 | 1.8 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 | 0.1 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) response to aldosterone(GO:1904044) |
| 0.0 | 0.2 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.0 | 0.2 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.0 | 0.2 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.0 | 0.1 | GO:0018065 | protein lipoylation(GO:0009249) protein-cofactor linkage(GO:0018065) |
| 0.0 | 0.0 | GO:0010716 | negative regulation of extracellular matrix disassembly(GO:0010716) |
| 0.0 | 0.1 | GO:2000501 | regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.0 | 0.2 | GO:0071926 | endocannabinoid signaling pathway(GO:0071926) regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.0 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 0.3 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.0 | 0.1 | GO:1902283 | negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.0 | 0.2 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.0 | 0.3 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 | 0.2 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.2 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 1.0 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.1 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.0 | 0.1 | GO:0021756 | striatum development(GO:0021756) |
| 0.0 | 0.4 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 0.2 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.0 | 0.2 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.0 | 0.5 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.0 | 0.1 | GO:0034059 | response to anoxia(GO:0034059) |
| 0.0 | 0.1 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.0 | 0.1 | GO:0019470 | 4-hydroxyproline catabolic process(GO:0019470) |
| 0.0 | 1.8 | GO:0006007 | glucose catabolic process(GO:0006007) NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.0 | 0.5 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.4 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.3 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 1.1 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.0 | 0.6 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 | 0.2 | GO:0034036 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.0 | 0.3 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.1 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.0 | 0.7 | GO:1902306 | negative regulation of sodium ion transmembrane transport(GO:1902306) |
| 0.0 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 | 0.5 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.0 | 0.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 0.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 1.6 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.0 | 0.0 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) positive regulation of anion transmembrane transport(GO:1903961) |
| 0.0 | 0.1 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
| 0.0 | 0.1 | GO:0007320 | insemination(GO:0007320) |
| 0.0 | 0.4 | GO:0046051 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
| 0.0 | 0.2 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.0 | 0.4 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.0 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.2 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.0 | 0.2 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.0 | 0.2 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.0 | 0.3 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 | 0.4 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.2 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.0 | 0.2 | GO:0010469 | regulation of receptor activity(GO:0010469) |
| 0.0 | 0.2 | GO:1990418 | response to insulin-like growth factor stimulus(GO:1990418) |
| 0.0 | 0.0 | GO:0060458 | right lung development(GO:0060458) |
| 0.0 | 0.2 | GO:0048243 | norepinephrine secretion(GO:0048243) |
| 0.0 | 0.1 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.0 | 0.1 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.0 | 0.1 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.0 | 0.1 | GO:1902824 | cleavage furrow ingression(GO:0036090) regulation of late endosome to lysosome transport(GO:1902822) positive regulation of late endosome to lysosome transport(GO:1902824) |
| 0.0 | 0.3 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.2 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) |
| 0.0 | 0.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.0 | 0.1 | GO:1902938 | regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.1 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) positive regulation of fibrinolysis(GO:0051919) |
| 0.0 | 0.2 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
| 0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.0 | 0.1 | GO:0051801 | cytolysis by symbiont of host cells(GO:0001897) cytolysis in other organism involved in symbiotic interaction(GO:0051801) |
| 0.0 | 0.3 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.2 | GO:1902045 | negative regulation of Fas signaling pathway(GO:1902045) |
| 0.0 | 0.1 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.0 | 0.6 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.0 | 0.9 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.0 | 0.1 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
| 0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.2 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.0 | 0.4 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.1 | GO:0097201 | negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.0 | 0.3 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.2 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.1 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
| 0.0 | 0.0 | GO:1900195 | positive regulation of oocyte maturation(GO:1900195) |
| 0.0 | 0.1 | GO:0036258 | multivesicular body assembly(GO:0036258) |
| 0.0 | 0.4 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.8 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.0 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.1 | GO:1903935 | response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.0 | 0.5 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.7 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.0 | 0.1 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.0 | 0.1 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.0 | 0.4 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.0 | 0.4 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
| 0.0 | 0.2 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.2 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.0 | 0.0 | GO:1903365 | regulation of fear response(GO:1903365) regulation of behavioral fear response(GO:2000822) |
| 0.0 | 0.3 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.0 | 0.4 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.1 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) |
| 0.0 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.0 | 0.2 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.0 | 0.1 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.0 | 0.2 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.1 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.1 | GO:0070301 | cellular response to hydrogen peroxide(GO:0070301) |
| 0.0 | 0.1 | GO:0032796 | uropod organization(GO:0032796) |
| 0.0 | 0.3 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 | 0.1 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.0 | 0.1 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.0 | 0.1 | GO:0060041 | retina development in camera-type eye(GO:0060041) |
| 0.0 | 0.1 | GO:0015824 | proline transport(GO:0015824) |
| 0.0 | 0.2 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.1 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.0 | 0.5 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.6 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.0 | 0.1 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 | 0.1 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.0 | 0.1 | GO:0002192 | IRES-dependent translational initiation(GO:0002192) |
| 0.0 | 0.1 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.0 | 0.1 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.0 | 0.4 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.0 | GO:0051935 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.0 | 0.2 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
| 0.0 | 0.4 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.0 | 0.2 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.0 | 0.1 | GO:0007405 | neuroblast proliferation(GO:0007405) |
| 0.0 | 0.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.5 | GO:0007172 | signal complex assembly(GO:0007172) |
| 0.0 | 0.1 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.2 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.0 | 0.1 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.0 | 0.3 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.0 | 0.2 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.0 | 0.1 | GO:0098907 | protein localization to T-tubule(GO:0036371) regulation of SA node cell action potential(GO:0098907) |
| 0.0 | 0.0 | GO:1900138 | negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.0 | 0.2 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
| 0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.2 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.0 | 0.2 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) positive regulation of T-helper 17 cell differentiation(GO:2000321) |
| 0.0 | 0.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.4 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.1 | GO:0045337 | geranyl diphosphate metabolic process(GO:0033383) geranyl diphosphate biosynthetic process(GO:0033384) farnesyl diphosphate biosynthetic process(GO:0045337) |
| 0.0 | 0.4 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 | 0.1 | GO:0031033 | myosin filament organization(GO:0031033) myosin filament assembly(GO:0031034) striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.6 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.0 | 0.1 | GO:0070221 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.0 | 0.6 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.0 | 0.1 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.0 | 1.3 | GO:0002279 | mast cell activation involved in immune response(GO:0002279) mast cell degranulation(GO:0043303) |
| 0.0 | 0.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.0 | 0.1 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.0 | 0.1 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) |
| 0.0 | 0.0 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.0 | 0.2 | GO:0061339 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.0 | 0.2 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 | 0.3 | GO:0010447 | response to acidic pH(GO:0010447) |
| 0.0 | 0.1 | GO:0070384 | Harderian gland development(GO:0070384) |
| 0.0 | 0.3 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.2 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
| 0.0 | 0.3 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
| 0.0 | 0.6 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.0 | 0.4 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 0.2 | GO:0033700 | phospholipid efflux(GO:0033700) |
| 0.0 | 0.1 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) |
| 0.0 | 0.3 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
| 0.0 | 0.0 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.0 | 0.1 | GO:0009165 | nucleotide biosynthetic process(GO:0009165) |
| 0.0 | 0.8 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.1 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.0 | 0.1 | GO:0015785 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.0 | 0.4 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.0 | 0.0 | GO:0071503 | response to heparin(GO:0071503) |
| 0.0 | 0.2 | GO:0003174 | mitral valve development(GO:0003174) mitral valve morphogenesis(GO:0003183) |
| 0.0 | 0.1 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.1 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.6 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.0 | 0.3 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.0 | 0.1 | GO:0070142 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) synaptic vesicle budding(GO:0070142) |
| 0.0 | 0.2 | GO:0070236 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.1 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
| 0.0 | 0.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.2 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 0.1 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.1 | GO:0015862 | uridine transport(GO:0015862) pyrimidine nucleoside transport(GO:0015864) |
| 0.0 | 0.3 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.0 | 0.2 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.0 | 0.0 | GO:0009441 | glycolate metabolic process(GO:0009441) |
| 0.0 | 0.1 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.0 | 0.5 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.2 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.0 | 0.1 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.0 | 0.3 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.3 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.0 | 0.2 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.0 | 0.1 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.0 | 0.1 | GO:0002887 | negative regulation of myeloid leukocyte mediated immunity(GO:0002887) negative regulation of leukocyte degranulation(GO:0043301) negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) negative regulation of neutrophil activation(GO:1902564) |
| 0.0 | 0.3 | GO:0060412 | ventricular septum morphogenesis(GO:0060412) |
| 0.0 | 0.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.0 | 0.2 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.0 | 1.1 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.1 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
| 0.0 | 0.4 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.2 | GO:0007184 | SMAD protein import into nucleus(GO:0007184) |
| 0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.0 | 0.0 | GO:0001575 | globoside metabolic process(GO:0001575) |
| 0.0 | 0.1 | GO:0033198 | response to ATP(GO:0033198) |
| 0.0 | 0.1 | GO:0030199 | collagen fibril organization(GO:0030199) |
| 0.0 | 0.2 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 | 0.3 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.1 | GO:1901910 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.0 | 0.1 | GO:0051106 | positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.2 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.0 | GO:0015960 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.0 | 0.1 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
| 0.0 | 0.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.0 | 0.1 | GO:0060751 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) branch elongation involved in mammary gland duct branching(GO:0060751) |
| 0.0 | 1.5 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.1 | GO:0090094 | metanephric cap development(GO:0072185) metanephric cap morphogenesis(GO:0072186) metanephric cap mesenchymal cell proliferation involved in metanephros development(GO:0090094) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 0.0 | 0.2 | GO:0097435 | fibril organization(GO:0097435) |
| 0.0 | 0.3 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.2 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.0 | 0.0 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
| 0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.0 | 0.2 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.5 | GO:0015804 | neutral amino acid transport(GO:0015804) |
| 0.0 | 0.3 | GO:0030220 | platelet formation(GO:0030220) |
| 0.0 | 0.2 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
| 0.0 | 0.3 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.1 | GO:0010593 | negative regulation of lamellipodium assembly(GO:0010593) |
| 0.0 | 0.0 | GO:0030101 | natural killer cell activation(GO:0030101) |
| 0.0 | 0.7 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
| 0.0 | 0.4 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.0 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.0 | 0.1 | GO:0000717 | nucleotide-excision repair, DNA duplex unwinding(GO:0000717) |
| 0.0 | 0.0 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 | 0.0 | GO:0021678 | third ventricle development(GO:0021678) |
| 0.0 | 0.1 | GO:0046066 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) dGDP metabolic process(GO:0046066) |
| 0.0 | 0.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 | 0.4 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.4 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.0 | 0.4 | GO:0006853 | carnitine shuttle(GO:0006853) |
| 0.0 | 0.1 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 | 0.3 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 0.1 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 | 0.3 | GO:0010884 | positive regulation of lipid storage(GO:0010884) |
| 0.0 | 0.7 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) fasciculation of motor neuron axon(GO:0097156) |
| 0.0 | 0.2 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
| 0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.0 | 0.2 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.6 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.1 | GO:1900827 | positive regulation of cell communication by electrical coupling(GO:0010650) maintenance of protein location in membrane(GO:0072658) maintenance of protein location in plasma membrane(GO:0072660) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
| 0.0 | 0.3 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.0 | 0.0 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.0 | 0.0 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.0 | 0.1 | GO:1904647 | response to rotenone(GO:1904647) |
| 0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.1 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.1 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.0 | 0.1 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.0 | 0.3 | GO:2000178 | negative regulation of neural precursor cell proliferation(GO:2000178) |
| 0.0 | 0.1 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 0.0 | 0.1 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.0 | 0.1 | GO:0060143 | positive regulation of syncytium formation by plasma membrane fusion(GO:0060143) |
| 0.0 | 0.5 | GO:0048713 | regulation of oligodendrocyte differentiation(GO:0048713) |
| 0.0 | 0.0 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.0 | 0.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.5 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.2 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.0 | 0.1 | GO:0046939 | nucleotide phosphorylation(GO:0046939) |
| 0.0 | 0.1 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
| 0.0 | 0.4 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.0 | 0.1 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
| 0.0 | 0.2 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.0 | 0.1 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.4 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.0 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.0 | 0.3 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.0 | 0.1 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.0 | 0.1 | GO:0061763 | multivesicular body-lysosome fusion(GO:0061763) |
| 0.0 | 0.1 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 | 0.1 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
| 0.0 | 0.3 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
| 0.0 | 0.0 | GO:0048241 | epinephrine transport(GO:0048241) |
| 0.0 | 0.0 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.0 | 0.1 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.2 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 | 0.2 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) |
| 0.0 | 0.4 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
| 0.0 | 0.0 | GO:0071350 | interleukin-15-mediated signaling pathway(GO:0035723) extrathymic T cell selection(GO:0045062) cellular response to interleukin-15(GO:0071350) regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.0 | 0.3 | GO:0007019 | microtubule depolymerization(GO:0007019) |
| 0.0 | 0.1 | GO:0044111 | multi-organism catabolic process(GO:0044035) development involved in symbiotic interaction(GO:0044111) development of symbiont involved in interaction with host(GO:0044115) modulation of development of symbiont involved in interaction with host(GO:0044145) negative regulation of development of symbiont involved in interaction with host(GO:0044147) metabolism of substance in other organism involved in symbiotic interaction(GO:0052214) catabolism of substance in other organism involved in symbiotic interaction(GO:0052227) metabolism of macromolecule in other organism involved in symbiotic interaction(GO:0052229) catabolism by host of symbiont macromolecule(GO:0052360) catabolism by organism of macromolecule in other organism involved in symbiotic interaction(GO:0052361) catabolism by host of symbiont protein(GO:0052362) catabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052363) catabolism by host of substance in symbiont(GO:0052364) metabolism by host of symbiont macromolecule(GO:0052416) metabolism by host of symbiont protein(GO:0052417) metabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052418) metabolism by host of substance in symbiont(GO:0052419) |
| 0.0 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.3 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.1 | GO:0051958 | methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.0 | 0.2 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.2 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 | 0.1 | GO:0032053 | ciliary basal body organization(GO:0032053) positive regulation of protein localization to cilium(GO:1903566) |
| 0.0 | 0.4 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.0 | 0.1 | GO:0030262 | apoptotic nuclear changes(GO:0030262) |
| 0.0 | 0.0 | GO:0007632 | visual behavior(GO:0007632) |
| 0.0 | 0.2 | GO:0035383 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
| 0.0 | 0.0 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.0 | 0.1 | GO:0039019 | pronephric nephron development(GO:0039019) |
| 0.0 | 0.1 | GO:0039526 | suppression by virus of host apoptotic process(GO:0019050) modulation by virus of host apoptotic process(GO:0039526) |
| 0.0 | 0.0 | GO:0031077 | B cell selection(GO:0002339) B cell negative selection(GO:0002352) post-embryonic camera-type eye development(GO:0031077) post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.0 | 0.1 | GO:0046125 | deoxyribonucleoside metabolic process(GO:0009120) thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.0 | 0.2 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.2 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.0 | 0.1 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.0 | 0.3 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.0 | GO:0001507 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.0 | 0.3 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.0 | 0.1 | GO:0002381 | immunoglobulin production involved in immunoglobulin mediated immune response(GO:0002381) |
| 0.0 | 0.1 | GO:0051549 | positive regulation of keratinocyte migration(GO:0051549) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.2 | GO:0051189 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.1 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.0 | 0.1 | GO:0021997 | neural plate axis specification(GO:0021997) |
| 0.0 | 0.0 | GO:0021860 | pyramidal neuron differentiation(GO:0021859) pyramidal neuron development(GO:0021860) |
| 0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.0 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 | 0.9 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.0 | 0.1 | GO:2000194 | regulation of female gonad development(GO:2000194) |
| 0.0 | 0.0 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.2 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 | 0.2 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 | 0.2 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.2 | GO:0031334 | positive regulation of protein complex assembly(GO:0031334) |
| 0.0 | 0.1 | GO:0019835 | cytolysis(GO:0019835) |
| 0.0 | 0.1 | GO:0006734 | NADH metabolic process(GO:0006734) |
| 0.0 | 0.1 | GO:0097194 | execution phase of apoptosis(GO:0097194) |
| 0.0 | 0.0 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.0 | 0.0 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.0 | 0.0 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
| 0.0 | 0.1 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.0 | 0.2 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.5 | GO:0021904 | dorsal/ventral neural tube patterning(GO:0021904) |
| 0.0 | 0.0 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.1 | GO:0072299 | adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) visceral serous pericardium development(GO:0061032) negative regulation of glomerular mesangial cell proliferation(GO:0072125) posterior mesonephric tubule development(GO:0072166) negative regulation of metanephric glomerulus development(GO:0072299) regulation of metanephric glomerular mesangial cell proliferation(GO:0072301) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) negative regulation of glomerulus development(GO:0090194) |
| 0.0 | 0.4 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.3 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.0 | 0.0 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.1 | GO:0098582 | innate vocalization behavior(GO:0098582) |
| 0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.3 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| 0.0 | 0.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.1 | GO:0008204 | ergosterol biosynthetic process(GO:0006696) ergosterol metabolic process(GO:0008204) |
| 0.0 | 0.0 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.7 | GO:0060135 | maternal process involved in female pregnancy(GO:0060135) |
| 0.0 | 0.4 | GO:0008630 | intrinsic apoptotic signaling pathway in response to DNA damage(GO:0008630) |
| 0.0 | 0.2 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.0 | 0.1 | GO:0098743 | cell aggregation(GO:0098743) |
| 0.0 | 0.1 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.0 | 0.1 | GO:0032410 | negative regulation of transporter activity(GO:0032410) |
| 0.0 | 0.1 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
| 0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) regulation of histone H3-K14 acetylation(GO:0071440) |
| 0.0 | 0.1 | GO:0001676 | long-chain fatty acid metabolic process(GO:0001676) |
| 0.0 | 0.1 | GO:0030822 | positive regulation of cyclic nucleotide catabolic process(GO:0030807) positive regulation of cAMP catabolic process(GO:0030822) positive regulation of purine nucleotide catabolic process(GO:0033123) |
| 0.0 | 0.2 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.0 | 0.2 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.0 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.0 | 0.1 | GO:0042476 | odontogenesis(GO:0042476) |
| 0.0 | 0.1 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.0 | 0.0 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.0 | 0.1 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.0 | 0.3 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.1 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.0 | 0.0 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 | 0.3 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.1 | GO:0042501 | serine phosphorylation of STAT protein(GO:0042501) |
| 0.0 | 0.0 | GO:0010644 | cell communication by electrical coupling(GO:0010644) |
| 0.0 | 0.1 | GO:0042354 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.0 | 0.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 1.0 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.0 | 0.1 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.4 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.1 | GO:2001023 | regulation of response to drug(GO:2001023) |
| 0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.0 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.0 | 0.1 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.0 | 0.0 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.0 | 0.3 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.1 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.0 | 0.0 | GO:0002579 | positive regulation of antigen processing and presentation(GO:0002579) |
| 0.0 | 0.7 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.0 | 0.1 | GO:0035745 | CD4-positive, alpha-beta T cell cytokine production(GO:0035743) T-helper 2 cell cytokine production(GO:0035745) |
| 0.0 | 0.0 | GO:0048749 | compound eye development(GO:0048749) |
| 0.0 | 0.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.0 | 0.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
| 0.0 | 0.2 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
| 0.0 | 0.2 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
| 0.0 | 0.1 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.0 | 0.2 | GO:0002828 | regulation of type 2 immune response(GO:0002828) |
| 0.0 | 0.1 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.0 | 0.5 | GO:0032526 | response to retinoic acid(GO:0032526) |
| 0.0 | 0.1 | GO:0099612 | protein localization to axon(GO:0099612) |
| 0.0 | 0.1 | GO:0061430 | bone trabecula morphogenesis(GO:0061430) |
| 0.0 | 0.1 | GO:0090281 | negative regulation of calcium ion import(GO:0090281) |
| 0.0 | 0.1 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.0 | 0.0 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.0 | 0.0 | GO:0019285 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.0 | 0.1 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.2 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.0 | 0.1 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.0 | 0.1 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
| 0.0 | 0.0 | GO:0014909 | smooth muscle cell migration(GO:0014909) |
| 0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 | 0.1 | GO:0001958 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.0 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
| 0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.5 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
| 0.0 | 0.1 | GO:0035994 | response to muscle stretch(GO:0035994) |
| 0.0 | 0.3 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.6 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) |
| 0.0 | 0.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.0 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.0 | 0.0 | GO:0072338 | cellular lactam metabolic process(GO:0072338) |
| 0.0 | 0.1 | GO:0032330 | regulation of chondrocyte differentiation(GO:0032330) |
| 0.0 | 0.4 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
| 0.0 | 0.2 | GO:0043921 | modulation by host of viral transcription(GO:0043921) modulation by host of symbiont transcription(GO:0052472) |
| 0.0 | 0.3 | GO:0030207 | chondroitin sulfate catabolic process(GO:0030207) |
| 0.0 | 0.1 | GO:0051344 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.0 | 0.1 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.0 | 0.1 | GO:0007567 | parturition(GO:0007567) |
| 0.0 | 0.2 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.1 | GO:0072144 | renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
| 0.0 | 0.1 | GO:0006045 | N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
| 0.0 | 0.0 | GO:0048755 | branching morphogenesis of a nerve(GO:0048755) negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) regulation of branching morphogenesis of a nerve(GO:2000172) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.0 | 0.4 | GO:0031498 | chromatin disassembly(GO:0031498) |
| 0.0 | 0.1 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.0 | 0.1 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.0 | 0.0 | GO:0035502 | metanephric part of ureteric bud development(GO:0035502) |
| 0.0 | 0.0 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.0 | 0.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 | 0.1 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.4 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.1 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.0 | 0.2 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.1 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.1 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.2 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 0.0 | 0.1 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 0.1 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.0 | 0.1 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 0.1 | GO:0030903 | notochord development(GO:0030903) |
| 0.0 | 0.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.0 | 0.0 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.0 | 0.1 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 0.0 | 0.3 | GO:0045669 | positive regulation of osteoblast differentiation(GO:0045669) |
| 0.0 | 0.0 | GO:0019516 | lactate oxidation(GO:0019516) |
| 0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
| 0.0 | 0.1 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.0 | 0.1 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 0.2 | GO:0001709 | cell fate determination(GO:0001709) |
| 0.0 | 0.2 | GO:0010613 | positive regulation of cardiac muscle hypertrophy(GO:0010613) positive regulation of muscle hypertrophy(GO:0014742) |
| 0.0 | 0.0 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.0 | 0.1 | GO:0060430 | lung saccule development(GO:0060430) |
| 0.0 | 0.2 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.0 | 0.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.1 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
| 0.0 | 0.2 | GO:0030038 | contractile actin filament bundle assembly(GO:0030038) stress fiber assembly(GO:0043149) |
| 0.0 | 0.2 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.0 | 0.1 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.0 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.0 | 0.9 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.1 | GO:0030238 | male sex determination(GO:0030238) |
| 0.0 | 0.0 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 | 0.0 | GO:0010755 | regulation of plasminogen activation(GO:0010755) |
| 0.0 | 0.2 | GO:1903543 | positive regulation of exosomal secretion(GO:1903543) |
| 0.0 | 0.0 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 | 0.0 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 | 0.1 | GO:0097267 | omega-hydroxylase P450 pathway(GO:0097267) |
| 0.0 | 0.0 | GO:0032439 | endosome localization(GO:0032439) |
| 0.0 | 0.1 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 0.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 | 0.0 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.0 | 0.1 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.8 | GO:0009346 | citrate lyase complex(GO:0009346) |
| 0.2 | 0.8 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.2 | 0.8 | GO:0070931 | Golgi-associated vesicle lumen(GO:0070931) |
| 0.2 | 0.6 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.2 | 0.7 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.2 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.2 | 0.5 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.1 | 0.8 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.1 | 0.7 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.5 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 0.4 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.1 | 0.9 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 0.5 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 1.3 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.1 | 0.2 | GO:0060199 | clathrin-sculpted glutamate transport vesicle(GO:0060199) clathrin-sculpted glutamate transport vesicle membrane(GO:0060203) |
| 0.1 | 1.0 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.1 | 0.5 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.1 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.3 | GO:1990032 | parallel fiber(GO:1990032) |
| 0.1 | 1.8 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.3 | GO:0039714 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
| 0.1 | 0.5 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 1.3 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.7 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.1 | 1.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 0.3 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.1 | 0.2 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.1 | 1.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 1.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.2 | GO:0043511 | inhibin complex(GO:0043511) inhibin A complex(GO:0043512) |
| 0.1 | 0.3 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 1.9 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.6 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 0.3 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.5 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 0.7 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 0.7 | GO:0000836 | Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.1 | 0.7 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 1.0 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.1 | 0.3 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.1 | 0.5 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.1 | 1.0 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.1 | 0.2 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.1 | 0.7 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.4 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 0.5 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.1 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.1 | 0.6 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 0.5 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.1 | 0.4 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.1 | 0.3 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.1 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.1 | 0.4 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 1.0 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 0.3 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.1 | 0.2 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
| 0.1 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.1 | 1.5 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.7 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.1 | 0.4 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.4 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 0.2 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 0.2 | GO:0097196 | Shu complex(GO:0097196) |
| 0.0 | 0.4 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.3 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.2 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.0 | 0.2 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 1.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.3 | GO:0098647 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.0 | 0.2 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.0 | 0.1 | GO:1990666 | PCSK9-LDLR complex(GO:1990666) |
| 0.0 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.5 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.0 | 0.4 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.0 | 0.3 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.4 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.0 | 0.4 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.0 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.0 | 0.7 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.0 | 0.5 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.0 | 0.3 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.0 | 0.6 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.7 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.3 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.1 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
| 0.0 | 0.2 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 0.7 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.0 | 0.2 | GO:0097181 | protein C inhibitor-TMPRSS7 complex(GO:0036024) protein C inhibitor-TMPRSS11E complex(GO:0036025) protein C inhibitor-PLAT complex(GO:0036026) protein C inhibitor-PLAU complex(GO:0036027) protein C inhibitor-thrombin complex(GO:0036028) protein C inhibitor-KLK3 complex(GO:0036029) protein C inhibitor-plasma kallikrein complex(GO:0036030) serine protease inhibitor complex(GO:0097180) protein C inhibitor-coagulation factor V complex(GO:0097181) protein C inhibitor-coagulation factor Xa complex(GO:0097182) protein C inhibitor-coagulation factor XI complex(GO:0097183) |
| 0.0 | 0.5 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.6 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.9 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.2 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.0 | 0.1 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.0 | 0.3 | GO:0097361 | CIA complex(GO:0097361) |
| 0.0 | 0.2 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.0 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 1.0 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.5 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 0.4 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.0 | 0.3 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.3 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.5 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0097179 | protease inhibitor complex(GO:0097179) |
| 0.0 | 0.1 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.0 | 0.3 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.1 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.0 | 0.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.0 | 0.8 | GO:0042599 | lamellar body(GO:0042599) |
| 0.0 | 0.9 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.3 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 0.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.7 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 0.3 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.4 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.5 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.7 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 0.4 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.2 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.0 | 2.7 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.0 | 1.1 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.2 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.0 | 0.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.0 | 1.0 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 2.1 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.4 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.5 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 0.1 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.0 | 0.3 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.1 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.0 | 0.4 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.6 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| 0.0 | 0.1 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.0 | 0.2 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.0 | 0.1 | GO:0036457 | keratohyalin granule(GO:0036457) |
| 0.0 | 0.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.1 | GO:0000791 | euchromatin(GO:0000791) |
| 0.0 | 0.3 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.0 | 1.8 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.1 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.0 | 1.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.1 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.0 | 0.2 | GO:0042825 | TAP complex(GO:0042825) |
| 0.0 | 0.1 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.3 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.0 | 0.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.3 | GO:0098533 | cation-transporting ATPase complex(GO:0090533) ATPase dependent transmembrane transport complex(GO:0098533) ATPase complex(GO:1904949) |
| 0.0 | 0.3 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.5 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 0.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.0 | 0.1 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.0 | 0.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.0 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.0 | 0.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.0 | 0.1 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.0 | 0.2 | GO:0001740 | Barr body(GO:0001740) |
| 0.0 | 0.5 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.0 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.0 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.5 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.1 | GO:0031906 | late endosome lumen(GO:0031906) |
| 0.0 | 0.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.3 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.1 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.1 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.0 | 0.5 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.6 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.2 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.1 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.0 | 0.1 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.0 | 0.5 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.1 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.6 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.9 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 1.8 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.2 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.0 | 0.1 | GO:0000243 | commitment complex(GO:0000243) |
| 0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 1.2 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.3 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 0.7 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 1.2 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 0.1 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.0 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.0 | 0.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.6 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.0 | 0.2 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.0 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.3 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.0 | 0.1 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.0 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.0 | 0.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.0 | 0.1 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
| 0.0 | 0.0 | GO:0070877 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.0 | 0.4 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 0.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.0 | 0.2 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 1.3 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.5 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 0.3 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.6 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.2 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 0.4 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.1 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.0 | 0.0 | GO:0043257 | laminin-8 complex(GO:0043257) |
| 0.0 | 0.9 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.4 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 1.2 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 1.4 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 0.3 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.0 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.0 | 0.1 | GO:0034680 | integrin alpha10-beta1 complex(GO:0034680) |
| 0.0 | 1.2 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.4 | GO:0043679 | axon terminus(GO:0043679) |
| 0.0 | 0.2 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.1 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.1 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.0 | GO:0005713 | recombination nodule(GO:0005713) |
| 0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.0 | 0.2 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.4 | GO:0030658 | transport vesicle membrane(GO:0030658) |
| 0.0 | 0.1 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.0 | 0.5 | GO:0043197 | dendritic spine(GO:0043197) |
| 0.0 | 0.5 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.5 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.1 | GO:0045120 | male pronucleus(GO:0001940) pronucleus(GO:0045120) |
| 0.0 | 0.0 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 0.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.5 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.1 | GO:0033643 | host cell part(GO:0033643) |
| 0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.1 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 1.6 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.3 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.1 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.1 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.0 | 0.0 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.1 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.2 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.0 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 1.2 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.3 | GO:0052870 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.4 | 0.4 | GO:0030249 | calcium sensitive guanylate cyclase activator activity(GO:0008048) cyclase regulator activity(GO:0010851) cyclase activator activity(GO:0010853) guanylate cyclase regulator activity(GO:0030249) guanylate cyclase activator activity(GO:0030250) |
| 0.3 | 0.9 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
| 0.3 | 1.1 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.3 | 0.8 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
| 0.2 | 1.2 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.2 | 1.0 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.2 | 0.8 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
| 0.2 | 1.3 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.2 | 0.5 | GO:0070119 | ciliary neurotrophic factor binding(GO:0070119) |
| 0.2 | 0.7 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.2 | 0.5 | GO:0019862 | IgA binding(GO:0019862) |
| 0.2 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.2 | 0.5 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.2 | 0.8 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.2 | 0.5 | GO:0016730 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.2 | 0.9 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.6 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.7 | GO:0060961 | phospholipase D inhibitor activity(GO:0060961) |
| 0.1 | 0.1 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.1 | 0.4 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.1 | 0.8 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.1 | 0.8 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.1 | 0.4 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.1 | 0.9 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.1 | 0.6 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.4 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.1 | 0.4 | GO:0047225 | acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0047225) |
| 0.1 | 0.4 | GO:0032129 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
| 0.1 | 0.5 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.1 | 0.6 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.1 | 1.0 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.1 | 0.6 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.1 | 0.8 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.1 | 0.5 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.3 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.1 | 0.3 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.1 | 0.6 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.1 | 0.4 | GO:0034602 | oxoglutarate dehydrogenase (NAD+) activity(GO:0034602) |
| 0.1 | 0.4 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.1 | 0.5 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.1 | 0.9 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.3 | GO:0086040 | sodium:proton antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086040) |
| 0.1 | 0.3 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.1 | 0.3 | GO:0004423 | iduronate-2-sulfatase activity(GO:0004423) |
| 0.1 | 0.5 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.1 | 0.9 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.1 | 0.3 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
| 0.1 | 1.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.1 | 0.8 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.1 | 0.3 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.1 | 0.3 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.1 | 0.2 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.3 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.1 | 0.3 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
| 0.1 | 0.8 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.1 | 0.4 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.1 | 0.1 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
| 0.1 | 0.3 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 0.3 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.1 | 0.2 | GO:0004530 | deoxyribonuclease I activity(GO:0004530) |
| 0.1 | 0.9 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.4 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
| 0.1 | 0.5 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.1 | 0.7 | GO:0001007 | transcription factor activity, RNA polymerase III transcription factor binding(GO:0001007) |
| 0.1 | 1.9 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 0.2 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
| 0.1 | 0.3 | GO:0005350 | pyrimidine nucleobase transmembrane transporter activity(GO:0005350) glycerol channel activity(GO:0015254) |
| 0.1 | 0.2 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.1 | 0.5 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.2 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.1 | 0.2 | GO:0030617 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) |
| 0.1 | 1.3 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.2 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.1 | 0.2 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.1 | 1.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.1 | 0.2 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.1 | 0.9 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 0.4 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.1 | 0.2 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.1 | 0.7 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 0.7 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.2 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.1 | 0.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 0.2 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.1 | 0.4 | GO:0010736 | serum response element binding(GO:0010736) |
| 0.1 | 1.6 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.6 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.3 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.1 | 0.3 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 0.2 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.6 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.3 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.1 | 0.2 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.1 | 0.3 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.1 | 0.3 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.1 | 0.6 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
| 0.1 | 0.3 | GO:0051800 | phosphatidylinositol-3,4-bisphosphate 3-phosphatase activity(GO:0051800) |
| 0.1 | 0.2 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
| 0.1 | 0.6 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.1 | 0.1 | GO:0030375 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.1 | 0.2 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.1 | 0.4 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.1 | 0.7 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.1 | 0.1 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.1 | 0.7 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.2 | GO:0047787 | delta4-3-oxosteroid 5beta-reductase activity(GO:0047787) |
| 0.1 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.1 | 0.2 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.1 | 0.4 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.1 | 0.6 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 0.3 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.1 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 1.1 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.1 | GO:0004823 | leucine-tRNA ligase activity(GO:0004823) |
| 0.1 | 0.1 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.2 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.1 | 0.1 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.1 | 0.3 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.1 | 0.2 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.1 | 0.2 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
| 0.1 | 0.3 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 0.2 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.1 | 0.4 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.1 | 0.2 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.1 | 0.2 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 0.1 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.1 | 0.7 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.1 | 0.3 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.1 | 0.5 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.2 | GO:0032406 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.0 | 0.1 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
| 0.0 | 0.1 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.0 | 1.0 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.9 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.5 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.2 | GO:0017060 | 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase activity(GO:0017060) |
| 0.0 | 0.2 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.0 | 0.2 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.0 | 0.4 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.0 | 0.4 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.0 | 0.1 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.0 | 0.3 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.0 | 1.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.6 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.0 | 0.5 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.2 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.0 | 0.5 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.0 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.0 | 0.1 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.0 | 0.5 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 1.1 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.1 | GO:0061714 | folic acid receptor activity(GO:0061714) |
| 0.0 | 0.6 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.0 | 0.1 | GO:0052856 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 0.0 | 0.5 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.0 | 0.3 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.0 | 0.2 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.3 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 0.5 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.1 | GO:0003842 | 1-pyrroline-5-carboxylate dehydrogenase activity(GO:0003842) |
| 0.0 | 0.3 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.6 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.1 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
| 0.0 | 0.0 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.0 | 0.4 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.2 | GO:0019863 | IgE binding(GO:0019863) |
| 0.0 | 0.2 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.1 | GO:0080101 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.0 | 0.9 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.1 | GO:0052894 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.0 | 0.8 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.7 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.0 | 0.3 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.9 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.5 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.3 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.0 | 0.4 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 1.2 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.2 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.0 | 0.1 | GO:0010309 | acireductone dioxygenase [iron(II)-requiring] activity(GO:0010309) |
| 0.0 | 0.5 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.2 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.0 | 0.2 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.0 | 0.6 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 0.1 | GO:0005549 | odorant binding(GO:0005549) |
| 0.0 | 0.4 | GO:0032450 | alpha-1,4-glucosidase activity(GO:0004558) maltose alpha-glucosidase activity(GO:0032450) |
| 0.0 | 0.1 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.0 | 0.1 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
| 0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.2 | GO:0004532 | exoribonuclease activity(GO:0004532) |
| 0.0 | 0.1 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.0 | 0.1 | GO:0036487 | nitric-oxide synthase inhibitor activity(GO:0036487) |
| 0.0 | 0.2 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.0 | 0.1 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
| 0.0 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.3 | GO:0052796 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.7 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.1 | GO:0031780 | corticotropin hormone receptor binding(GO:0031780) type 5 melanocortin receptor binding(GO:0031783) |
| 0.0 | 0.2 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.0 | 0.1 | GO:0015068 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
| 0.0 | 0.1 | GO:0031177 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) S-acetyltransferase activity(GO:0016418) phosphopantetheine binding(GO:0031177) |
| 0.0 | 0.5 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.1 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.0 | 0.2 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.0 | 0.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.5 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.0 | 0.3 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.0 | 0.4 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.5 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.0 | 0.8 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.2 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.0 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.0 | 0.2 | GO:0033906 | protein tyrosine kinase inhibitor activity(GO:0030292) hyaluronoglucuronidase activity(GO:0033906) |
| 0.0 | 0.3 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.0 | 0.6 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.0 | 0.3 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.4 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.0 | 0.1 | GO:0004781 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.0 | 0.3 | GO:1990763 | arrestin family protein binding(GO:1990763) |
| 0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.0 | 1.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.4 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 0.1 | GO:0016992 | lipoate synthase activity(GO:0016992) radical SAM enzyme activity(GO:0070283) |
| 0.0 | 0.2 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
| 0.0 | 0.2 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.0 | 0.1 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
| 0.0 | 1.7 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.0 | 0.1 | GO:0004911 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.0 | 0.1 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.0 | 1.2 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.5 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.1 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.0 | 0.3 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.0 | 0.2 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 0.2 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) |
| 0.0 | 0.1 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.0 | 0.8 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.0 | 0.2 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.1 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.0 | 0.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.2 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
| 0.0 | 0.2 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.0 | 0.3 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.1 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
| 0.0 | 0.3 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.1 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.0 | 0.5 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.0 | 0.5 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.0 | 0.3 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.4 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.1 | GO:0030547 | receptor inhibitor activity(GO:0030547) |
| 0.0 | 0.4 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.0 | 0.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.2 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.0 | 0.3 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.1 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.0 | 0.2 | GO:0045118 | azole transporter activity(GO:0045118) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.0 | 0.1 | GO:0034191 | apolipoprotein receptor binding(GO:0034190) apolipoprotein A-I receptor binding(GO:0034191) |
| 0.0 | 0.2 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.0 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.4 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.1 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.0 | 0.1 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.0 | 0.8 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.7 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.4 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.6 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.7 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.0 | 0.4 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.0 | 1.0 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.3 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.9 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.4 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.2 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.5 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.3 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.0 | 0.8 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.0 | 0.1 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.0 | 0.3 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.0 | 0.2 | GO:0004447 | iodide peroxidase activity(GO:0004447) |
| 0.0 | 0.1 | GO:0004974 | leukotriene B4 receptor activity(GO:0001632) leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.2 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 0.9 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 1.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.7 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.0 | 0.2 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.0 | 1.0 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.4 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.0 | 0.1 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
| 0.0 | 0.3 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.3 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.2 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.0 | 1.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.2 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.1 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.0 | 0.1 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.0 | 0.1 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
| 0.0 | 0.9 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.1 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.0 | 0.2 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.1 | GO:0004968 | gonadotropin-releasing hormone receptor activity(GO:0004968) |
| 0.0 | 0.1 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.0 | 0.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.1 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
| 0.0 | 0.4 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 0.3 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.3 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.2 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 0.2 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.0 | 0.7 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.1 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
| 0.0 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.1 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) tetrahydrobiopterin binding(GO:0034617) |
| 0.0 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.6 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.0 | 0.3 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.0 | 0.1 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.0 | 0.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.2 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
| 0.0 | 0.2 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.0 | 0.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.6 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.1 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.1 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 1.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.0 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.2 | GO:0042835 | BRE binding(GO:0042835) |
| 0.0 | 0.0 | GO:0002054 | nucleobase binding(GO:0002054) purine nucleobase binding(GO:0002060) |
| 0.0 | 0.6 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.1 | GO:0004458 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
| 0.0 | 0.4 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.1 | GO:0032393 | MHC class I receptor activity(GO:0032393) |
| 0.0 | 0.2 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.0 | 0.1 | GO:0072545 | tyrosine binding(GO:0072545) |
| 0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.1 | GO:0052593 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
| 0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.2 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.0 | 0.4 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.2 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.2 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.1 | GO:0016499 | orexin receptor activity(GO:0016499) |
| 0.0 | 0.6 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.2 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.0 | 0.1 | GO:0033754 | indoleamine 2,3-dioxygenase activity(GO:0033754) |
| 0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.2 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.0 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.1 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
| 0.0 | 0.6 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 0.1 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.0 | 0.4 | GO:0015116 | secondary active sulfate transmembrane transporter activity(GO:0008271) sulfate transmembrane transporter activity(GO:0015116) |
| 0.0 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.0 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.0 | 0.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.1 | GO:0004520 | endodeoxyribonuclease activity(GO:0004520) |
| 0.0 | 0.4 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 0.4 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.1 | GO:0052847 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.0 | 0.3 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.6 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.1 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.0 | 1.3 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.0 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.1 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.0 | 0.1 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.0 | 0.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.4 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 0.4 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.6 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.2 | GO:0031701 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.0 | 0.3 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.0 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.1 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.0 | 0.1 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.0 | 0.3 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.0 | 0.2 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.0 | 0.2 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.2 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.3 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.1 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.0 | 0.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.8 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.0 | 0.4 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.5 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.1 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.1 | GO:0098639 | protein binding involved in cell-matrix adhesion(GO:0098634) collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.1 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 0.0 | 0.1 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.0 | 0.1 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 0.7 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.5 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.2 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.0 | 0.6 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.0 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
| 0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.1 | GO:0099583 | neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
| 0.0 | 0.1 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.1 | GO:0015350 | reduced folate carrier activity(GO:0008518) methotrexate transporter activity(GO:0015350) |
| 0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.0 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.0 | 0.0 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
| 0.0 | 0.4 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.1 | GO:0004797 | thymidine kinase activity(GO:0004797) |
| 0.0 | 0.1 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.1 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.0 | 0.3 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.2 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.0 | 0.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.1 | GO:1990175 | EH domain binding(GO:1990175) |
| 0.0 | 0.7 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.0 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.0 | 0.0 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.0 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.0 | 0.3 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.6 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.0 | 0.5 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.0 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.1 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
| 0.0 | 0.1 | GO:0009384 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) N-acylmannosamine kinase activity(GO:0009384) |
| 0.0 | 0.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.3 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.0 | 0.7 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.8 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.2 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.1 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
| 0.0 | 0.1 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
| 0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 0.1 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
| 0.0 | 0.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.1 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 0.0 | 0.2 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.2 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.1 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.0 | 0.0 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.0 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.0 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.0 | 0.0 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.3 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.0 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 0.0 | 0.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.3 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.1 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 0.0 | 0.0 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.0 | 0.0 | GO:0051499 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 0.0 | 0.0 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.0 | 0.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.0 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.0 | 0.1 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.0 | 0.0 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.0 | 0.5 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 2.8 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.0 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.0 | 0.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.0 | GO:0016278 | lysine N-methyltransferase activity(GO:0016278) |
| 0.0 | 0.0 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.4 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.0 | 0.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.0 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.5 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.0 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.2 | GO:0043236 | laminin binding(GO:0043236) |
| 0.0 | 0.0 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.0 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.0 | 0.4 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.0 | 0.2 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.0 | 0.4 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 1.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.7 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.0 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.3 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.0 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.0 | GO:0072591 | citrate-L-glutamate ligase activity(GO:0072591) |
| 0.0 | 0.1 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.7 | GO:0000975 | regulatory region DNA binding(GO:0000975) transcription regulatory region DNA binding(GO:0044212) |
| 0.0 | 0.0 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.0 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.1 | 0.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 0.2 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.1 | 2.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 0.3 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.1 | 1.0 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.1 | 1.9 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.1 | 0.5 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.0 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.5 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.9 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.5 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 1.1 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 2.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 3.9 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.3 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 1.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.2 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 0.5 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 1.6 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 1.4 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.3 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 1.2 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.9 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.3 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.6 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.9 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.9 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.7 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.4 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 1.0 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.2 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 1.0 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 1.1 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 5.9 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.6 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 0.5 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 1.4 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.8 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.5 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 1.1 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 1.5 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.7 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.9 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.7 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.4 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 1.0 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 1.7 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.1 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.4 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 0.6 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.5 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.4 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 1.1 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.0 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.3 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.4 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.1 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 0.5 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.6 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 1.2 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.1 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.6 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.5 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.8 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 1.6 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.1 | 0.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.1 | 0.3 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 1.0 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 0.8 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 2.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.1 | 1.5 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.1 | 0.2 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.1 | 0.3 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.1 | 1.1 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 1.0 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.0 | 1.0 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.0 | 2.3 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 4.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.8 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 1.0 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 1.7 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 2.5 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 1.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.1 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 3.2 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 0.4 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 1.6 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 1.4 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.7 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 1.0 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 0.7 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.0 | 1.5 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 2.1 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 1.0 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.7 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.5 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 1.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 0.5 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 2.7 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.0 | 0.8 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 1.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 1.7 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.0 | 0.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.5 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.7 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 0.5 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.6 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 1.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.4 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.0 | 0.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.5 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.7 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.4 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.7 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 0.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.7 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 1.0 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.7 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.3 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.0 | 0.3 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.5 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.7 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.7 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.0 | 0.8 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 1.2 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.3 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 1.2 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.7 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.7 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.5 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.4 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.6 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.0 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 0.0 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.0 | 0.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.1 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.8 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.2 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.1 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.3 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.3 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |