A549 cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Gene Symbol | Gene ID | Gene Info |
---|---|---|
PAX5
|
ENSG00000196092.8 | PAX5 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
PAX5 | hg19_v2_chr9_-_37034028_37034157 | -0.36 | 4.8e-01 | Click! |
Promoter | Score | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr9_-_34662651 | 0.92 |
ENST00000259631.4 |
CCL27 |
chemokine (C-C motif) ligand 27 |
chr11_+_107650219 | 0.79 |
ENST00000398067.1 |
AP001024.1 |
Uncharacterized protein |
chr6_-_41701898 | 0.57 |
ENST00000433032.1 |
TFEB |
transcription factor EB |
chr1_-_17676070 | 0.54 |
ENST00000602074.1 |
AC004824.2 |
Uncharacterized protein |
chr8_-_1922789 | 0.53 |
ENST00000521498.1 |
RP11-439C15.4 |
RP11-439C15.4 |
chr2_-_27531313 | 0.52 |
ENST00000296099.2 |
UCN |
urocortin |
chr1_-_161059380 | 0.51 |
ENST00000368012.3 |
PVRL4 |
poliovirus receptor-related 4 |
chr5_+_133842243 | 0.48 |
ENST00000515627.2 |
AC005355.2 |
AC005355.2 |
chr17_+_73539232 | 0.47 |
ENST00000580925.1 |
LLGL2 |
lethal giant larvae homolog 2 (Drosophila) |
chr17_+_80317121 | 0.45 |
ENST00000333437.4 |
TEX19 |
testis expressed 19 |
chr3_+_184055240 | 0.44 |
ENST00000383847.2 |
FAM131A |
family with sequence similarity 131, member A |
chr4_+_40337340 | 0.43 |
ENST00000310169.2 |
CHRNA9 |
cholinergic receptor, nicotinic, alpha 9 (neuronal) |
chr8_-_37594944 | 0.43 |
ENST00000330539.1 |
RP11-863K10.7 |
Uncharacterized protein |
chr17_+_38024417 | 0.42 |
ENST00000348931.4 ENST00000583811.1 ENST00000584588.1 ENST00000377940.3 |
ZPBP2 |
zona pellucida binding protein 2 |
chr16_+_67840986 | 0.41 |
ENST00000561639.1 ENST00000567852.1 ENST00000565148.1 ENST00000388833.3 ENST00000561654.1 ENST00000431934.2 |
TSNAXIP1 |
translin-associated factor X interacting protein 1 |
chr11_+_117198801 | 0.41 |
ENST00000527609.1 ENST00000533570.1 |
CEP164 |
centrosomal protein 164kDa |
chr16_-_776846 | 0.39 |
ENST00000423653.1 |
CCDC78 |
coiled-coil domain containing 78 |
chr6_-_31651817 | 0.39 |
ENST00000375863.3 ENST00000375860.2 |
LY6G5C |
lymphocyte antigen 6 complex, locus G5C |
chr17_+_4692230 | 0.37 |
ENST00000331264.7 |
GLTPD2 |
glycolipid transfer protein domain containing 2 |
chr17_+_42977062 | 0.37 |
ENST00000410006.2 ENST00000357776.2 ENST00000410027.1 |
CCDC103 |
coiled-coil domain containing 103 |
chr16_+_2533020 | 0.36 |
ENST00000562105.1 |
TBC1D24 |
TBC1 domain family, member 24 |
chr17_-_27277615 | 0.36 |
ENST00000583747.1 ENST00000584236.1 |
PHF12 |
PHD finger protein 12 |
chr3_-_142720267 | 0.36 |
ENST00000597953.1 |
RP11-91G21.1 |
RP11-91G21.1 |
chr12_-_13105081 | 0.36 |
ENST00000541128.1 |
GPRC5D |
G protein-coupled receptor, family C, group 5, member D |
chr12_+_54384370 | 0.36 |
ENST00000504315.1 |
HOXC6 |
homeobox C6 |
chr17_+_26638667 | 0.36 |
ENST00000600595.1 |
AC061975.10 |
Uncharacterized protein |
chr12_-_71003568 | 0.35 |
ENST00000547715.1 ENST00000451516.2 ENST00000538708.1 ENST00000550857.1 ENST00000261266.5 |
PTPRB |
protein tyrosine phosphatase, receptor type, B |
chr2_+_175199674 | 0.35 |
ENST00000394967.2 |
SP9 |
Sp9 transcription factor |
chr1_+_179051160 | 0.35 |
ENST00000367625.4 ENST00000352445.6 |
TOR3A |
torsin family 3, member A |
chr11_+_62475130 | 0.34 |
ENST00000294117.5 |
GNG3 |
guanine nucleotide binding protein (G protein), gamma 3 |
chrX_+_47083037 | 0.34 |
ENST00000523034.1 |
CDK16 |
cyclin-dependent kinase 16 |
chr19_+_58838369 | 0.34 |
ENST00000329665.4 |
ZSCAN22 |
zinc finger and SCAN domain containing 22 |
chr7_+_26438187 | 0.33 |
ENST00000439120.1 ENST00000430548.1 ENST00000421862.1 ENST00000449537.1 ENST00000420774.1 ENST00000418758.2 |
AC004540.5 |
AC004540.5 |
chr16_+_4845379 | 0.33 |
ENST00000588606.1 ENST00000586005.1 |
SMIM22 |
small integral membrane protein 22 |
chr6_-_43478239 | 0.33 |
ENST00000372441.1 |
LRRC73 |
leucine rich repeat containing 73 |
chr5_+_56205878 | 0.32 |
ENST00000423328.1 |
SETD9 |
SET domain containing 9 |
chr15_-_44069513 | 0.32 |
ENST00000433927.1 |
ELL3 |
elongation factor RNA polymerase II-like 3 |
chr1_-_223853425 | 0.32 |
ENST00000366873.2 ENST00000419193.2 |
CAPN8 |
calpain 8 |
chr3_+_187930429 | 0.32 |
ENST00000420410.1 |
LPP |
LIM domain containing preferred translocation partner in lipoma |
chr16_-_776431 | 0.32 |
ENST00000293889.6 |
CCDC78 |
coiled-coil domain containing 78 |
chr1_-_27226928 | 0.31 |
ENST00000361720.5 |
GPATCH3 |
G patch domain containing 3 |
chr16_-_740354 | 0.31 |
ENST00000293883.4 |
WDR24 |
WD repeat domain 24 |
chr15_-_74045088 | 0.31 |
ENST00000569673.1 |
C15orf59 |
chromosome 15 open reading frame 59 |
chr3_+_169629354 | 0.31 |
ENST00000428432.2 ENST00000335556.3 |
SAMD7 |
sterile alpha motif domain containing 7 |
chr16_-_1429010 | 0.31 |
ENST00000513783.1 |
UNKL |
unkempt family zinc finger-like |
chr11_-_125351481 | 0.30 |
ENST00000577924.1 |
FEZ1 |
fasciculation and elongation protein zeta 1 (zygin I) |
chr1_+_39571026 | 0.30 |
ENST00000524432.1 |
MACF1 |
microtubule-actin crosslinking factor 1 |
chr11_+_2421718 | 0.30 |
ENST00000380996.5 ENST00000333256.6 ENST00000380992.1 ENST00000437110.1 ENST00000435795.1 |
TSSC4 |
tumor suppressing subtransferable candidate 4 |
chr1_+_197871854 | 0.29 |
ENST00000436652.1 |
C1orf53 |
chromosome 1 open reading frame 53 |
chr19_+_10959043 | 0.29 |
ENST00000397820.4 |
C19orf38 |
chromosome 19 open reading frame 38 |
chr2_-_240322685 | 0.29 |
ENST00000544989.1 |
HDAC4 |
histone deacetylase 4 |
chr19_+_19649057 | 0.29 |
ENST00000586018.1 ENST00000291495.5 |
CILP2 |
cartilage intermediate layer protein 2 |
chr22_+_22676808 | 0.29 |
ENST00000390290.2 |
IGLV1-51 |
immunoglobulin lambda variable 1-51 |
chr11_+_73675873 | 0.29 |
ENST00000537753.1 ENST00000542350.1 |
DNAJB13 |
DnaJ (Hsp40) homolog, subfamily B, member 13 |
chr16_+_30953696 | 0.28 |
ENST00000566320.2 ENST00000565939.1 |
FBXL19 |
F-box and leucine-rich repeat protein 19 |
chr19_-_19384055 | 0.28 |
ENST00000389363.4 |
TM6SF2 |
transmembrane 6 superfamily member 2 |
chr19_-_58485895 | 0.28 |
ENST00000314391.3 |
C19orf18 |
chromosome 19 open reading frame 18 |
chr3_+_9691117 | 0.28 |
ENST00000353332.5 ENST00000420925.1 ENST00000296003.4 ENST00000351233.5 |
MTMR14 |
myotubularin related protein 14 |
chr1_+_46668994 | 0.27 |
ENST00000371980.3 |
LURAP1 |
leucine rich adaptor protein 1 |
chr2_-_98950434 | 0.27 |
ENST00000409490.1 |
AC092675.3 |
Uncharacterized protein |
chr12_-_111142729 | 0.27 |
ENST00000546713.1 |
HVCN1 |
hydrogen voltage-gated channel 1 |
chr8_+_97657531 | 0.27 |
ENST00000519900.1 ENST00000517742.1 |
CPQ |
carboxypeptidase Q |
chr12_-_57644952 | 0.27 |
ENST00000554578.1 ENST00000546246.2 ENST00000553489.1 ENST00000332782.2 |
STAC3 |
SH3 and cysteine rich domain 3 |
chr2_+_209131059 | 0.26 |
ENST00000422495.1 ENST00000452564.1 |
PIKFYVE |
phosphoinositide kinase, FYVE finger containing |
chr19_+_49377575 | 0.26 |
ENST00000600406.1 |
PPP1R15A |
protein phosphatase 1, regulatory subunit 15A |
chr2_+_10560147 | 0.26 |
ENST00000422133.1 |
HPCAL1 |
hippocalcin-like 1 |
chr16_+_30662050 | 0.26 |
ENST00000568754.1 |
PRR14 |
proline rich 14 |
chr14_-_75079294 | 0.26 |
ENST00000556359.1 |
LTBP2 |
latent transforming growth factor beta binding protein 2 |
chr17_-_19619917 | 0.26 |
ENST00000325411.5 ENST00000350657.5 ENST00000433844.2 |
SLC47A2 |
solute carrier family 47 (multidrug and toxin extrusion), member 2 |
chrX_+_48620147 | 0.26 |
ENST00000303227.6 |
GLOD5 |
glyoxalase domain containing 5 |
chr15_-_83224682 | 0.25 |
ENST00000562833.1 |
RP11-152F13.10 |
RP11-152F13.10 |
chr1_+_17575584 | 0.25 |
ENST00000375460.3 |
PADI3 |
peptidyl arginine deiminase, type III |
chr12_-_106697974 | 0.25 |
ENST00000553039.1 |
CKAP4 |
cytoskeleton-associated protein 4 |
chr22_-_42322795 | 0.25 |
ENST00000291232.3 |
TNFRSF13C |
tumor necrosis factor receptor superfamily, member 13C |
chr17_+_45286706 | 0.25 |
ENST00000393450.1 ENST00000572303.1 |
MYL4 |
myosin, light chain 4, alkali; atrial, embryonic |
chr16_-_11477562 | 0.25 |
ENST00000595168.1 |
CTD-3088G3.8 |
Protein LOC388210 |
chr16_+_24857309 | 0.24 |
ENST00000565769.1 ENST00000449109.2 ENST00000424767.2 ENST00000545376.1 ENST00000569520.1 |
SLC5A11 |
solute carrier family 5 (sodium/inositol cotransporter), member 11 |
chr17_+_32597232 | 0.24 |
ENST00000378569.2 ENST00000200307.4 ENST00000394627.1 ENST00000394630.3 |
CCL7 |
chemokine (C-C motif) ligand 7 |
chr19_-_2096478 | 0.24 |
ENST00000591236.1 ENST00000589902.1 |
MOB3A |
MOB kinase activator 3A |
chr16_-_30064244 | 0.24 |
ENST00000571269.1 ENST00000561666.1 |
FAM57B |
family with sequence similarity 57, member B |
chr12_-_66317967 | 0.24 |
ENST00000601398.1 |
AC090673.2 |
Uncharacterized protein |
chr11_+_7595136 | 0.23 |
ENST00000529575.1 |
PPFIBP2 |
PTPRF interacting protein, binding protein 2 (liprin beta 2) |
chr16_+_15068831 | 0.23 |
ENST00000535621.2 ENST00000566426.1 |
PDXDC1 |
pyridoxal-dependent decarboxylase domain containing 1 |
chr16_+_24857552 | 0.23 |
ENST00000568579.1 ENST00000567758.1 ENST00000569071.1 ENST00000539472.1 |
SLC5A11 |
solute carrier family 5 (sodium/inositol cotransporter), member 11 |
chr19_-_6379069 | 0.23 |
ENST00000597721.1 |
PSPN |
persephin |
chr6_+_26199737 | 0.23 |
ENST00000359985.1 |
HIST1H2BF |
histone cluster 1, H2bf |
chr7_-_16460863 | 0.23 |
ENST00000407010.2 ENST00000399310.3 |
ISPD |
isoprenoid synthase domain containing |
chr14_+_103394963 | 0.23 |
ENST00000559525.1 ENST00000559789.1 |
AMN |
amnion associated transmembrane protein |
chr12_-_31158902 | 0.23 |
ENST00000544329.1 ENST00000418254.2 ENST00000222396.5 |
RP11-551L14.4 |
RP11-551L14.4 |
chr7_-_102232891 | 0.23 |
ENST00000514917.2 |
RP11-514P8.7 |
RP11-514P8.7 |
chr22_-_36600727 | 0.23 |
ENST00000397275.2 ENST00000328429.4 |
APOL4 |
apolipoprotein L, 4 |
chr17_-_73839792 | 0.22 |
ENST00000590762.1 |
UNC13D |
unc-13 homolog D (C. elegans) |
chr15_+_41057818 | 0.22 |
ENST00000558467.1 |
GCHFR |
GTP cyclohydrolase I feedback regulator |
chr19_-_44008863 | 0.22 |
ENST00000601646.1 |
PHLDB3 |
pleckstrin homology-like domain, family B, member 3 |
chr1_-_78444776 | 0.22 |
ENST00000370767.1 ENST00000421641.1 |
FUBP1 |
far upstream element (FUSE) binding protein 1 |
chr6_+_153019023 | 0.22 |
ENST00000367245.5 ENST00000529453.1 |
MYCT1 |
myc target 1 |
chr17_-_65992544 | 0.22 |
ENST00000580729.1 |
RP11-855A2.5 |
RP11-855A2.5 |
chr9_+_133589333 | 0.22 |
ENST00000372348.2 ENST00000393293.4 |
ABL1 |
c-abl oncogene 1, non-receptor tyrosine kinase |
chr19_-_2090131 | 0.22 |
ENST00000591326.1 |
MOB3A |
MOB kinase activator 3A |
chr18_-_2982869 | 0.22 |
ENST00000584915.1 |
LPIN2 |
lipin 2 |
chr1_-_39407467 | 0.22 |
ENST00000540558.1 |
RHBDL2 |
rhomboid, veinlet-like 2 (Drosophila) |
chr15_+_91418918 | 0.22 |
ENST00000560824.1 |
FURIN |
furin (paired basic amino acid cleaving enzyme) |
chr19_+_14551066 | 0.22 |
ENST00000342216.4 |
PKN1 |
protein kinase N1 |
chr22_-_38480100 | 0.22 |
ENST00000427592.1 |
SLC16A8 |
solute carrier family 16 (monocarboxylate transporter), member 8 |
chr8_+_61592073 | 0.22 |
ENST00000526846.1 |
CHD7 |
chromodomain helicase DNA binding protein 7 |
chr7_-_150777920 | 0.21 |
ENST00000353841.2 ENST00000297532.6 |
FASTK |
Fas-activated serine/threonine kinase |
chr17_+_68047418 | 0.21 |
ENST00000586373.1 ENST00000588782.1 |
LINC01028 |
long intergenic non-protein coding RNA 1028 |
chr11_-_77122928 | 0.21 |
ENST00000528203.1 ENST00000528592.1 ENST00000528633.1 ENST00000529248.1 |
PAK1 |
p21 protein (Cdc42/Rac)-activated kinase 1 |
chr2_-_43019698 | 0.21 |
ENST00000431905.1 ENST00000294973.6 |
HAAO |
3-hydroxyanthranilate 3,4-dioxygenase |
chr17_-_73840415 | 0.21 |
ENST00000592386.1 ENST00000412096.2 ENST00000586147.1 |
UNC13D |
unc-13 homolog D (C. elegans) |
chr16_+_89168993 | 0.21 |
ENST00000538340.1 ENST00000543676.1 |
ACSF3 |
acyl-CoA synthetase family member 3 |
chr17_+_6900201 | 0.21 |
ENST00000480801.1 |
ALOX12 |
arachidonate 12-lipoxygenase |
chr17_-_79623597 | 0.21 |
ENST00000574024.1 ENST00000331056.5 |
PDE6G |
phosphodiesterase 6G, cGMP-specific, rod, gamma |
chr9_-_139891165 | 0.21 |
ENST00000494426.1 |
CLIC3 |
chloride intracellular channel 3 |
chr17_+_4618734 | 0.21 |
ENST00000571206.1 |
ARRB2 |
arrestin, beta 2 |
chr9_+_133539981 | 0.21 |
ENST00000253008.2 |
PRDM12 |
PR domain containing 12 |
chr9_+_129097520 | 0.21 |
ENST00000436593.3 |
MVB12B |
multivesicular body subunit 12B |
chrX_-_151938171 | 0.21 |
ENST00000393902.3 ENST00000417212.1 ENST00000370278.3 |
MAGEA3 |
melanoma antigen family A, 3 |
chr9_+_116207007 | 0.21 |
ENST00000374140.2 |
RGS3 |
regulator of G-protein signaling 3 |
chr8_+_22941868 | 0.21 |
ENST00000397703.2 |
TNFRSF10C |
tumor necrosis factor receptor superfamily, member 10c, decoy without an intracellular domain |
chr19_+_47852538 | 0.21 |
ENST00000328771.4 |
DHX34 |
DEAH (Asp-Glu-Ala-His) box polypeptide 34 |
chr7_-_2883650 | 0.21 |
ENST00000544127.1 |
GNA12 |
guanine nucleotide binding protein (G protein) alpha 12 |
chr7_+_116595028 | 0.21 |
ENST00000397751.1 |
ST7-OT4 |
ST7 overlapping transcript 4 |
chr7_-_150777949 | 0.20 |
ENST00000482571.1 |
FASTK |
Fas-activated serine/threonine kinase |
chr19_-_19626838 | 0.20 |
ENST00000360913.3 |
TSSK6 |
testis-specific serine kinase 6 |
chr19_-_6767431 | 0.20 |
ENST00000437152.3 ENST00000597687.1 |
SH2D3A |
SH2 domain containing 3A |
chr6_-_170151603 | 0.20 |
ENST00000366774.3 |
TCTE3 |
t-complex-associated-testis-expressed 3 |
chr16_-_86588627 | 0.20 |
ENST00000565482.1 ENST00000564364.1 ENST00000561989.1 ENST00000543303.2 ENST00000381214.5 ENST00000360900.6 ENST00000322911.6 ENST00000546093.1 ENST00000569000.1 ENST00000562994.1 ENST00000561522.1 |
MTHFSD |
methenyltetrahydrofolate synthetase domain containing |
chr18_-_8337038 | 0.20 |
ENST00000594251.1 |
AP001094.1 |
Uncharacterized protein |
chr12_+_22852791 | 0.20 |
ENST00000413794.2 |
RP11-114G22.1 |
RP11-114G22.1 |
chr16_-_67597789 | 0.20 |
ENST00000605277.1 |
CTD-2012K14.6 |
CTD-2012K14.6 |
chr4_+_183370146 | 0.20 |
ENST00000510504.1 |
TENM3 |
teneurin transmembrane protein 3 |
chr8_+_55370487 | 0.20 |
ENST00000297316.4 |
SOX17 |
SRY (sex determining region Y)-box 17 |
chr5_+_6766004 | 0.20 |
ENST00000506093.1 |
RP11-332J15.3 |
RP11-332J15.3 |
chr17_+_78518617 | 0.20 |
ENST00000537330.1 ENST00000570891.1 |
RPTOR |
regulatory associated protein of MTOR, complex 1 |
chr22_-_45404819 | 0.20 |
ENST00000447824.3 ENST00000404079.2 ENST00000420689.1 ENST00000403565.1 |
PHF21B |
PHD finger protein 21B |
chr11_-_65359947 | 0.20 |
ENST00000597463.1 |
AP001362.1 |
Uncharacterized protein |
chr6_-_33256664 | 0.20 |
ENST00000444176.1 |
WDR46 |
WD repeat domain 46 |
chr9_-_130952989 | 0.20 |
ENST00000415526.1 ENST00000277465.4 |
CIZ1 |
CDKN1A interacting zinc finger protein 1 |
chr19_-_43690674 | 0.20 |
ENST00000342951.6 ENST00000366175.3 |
PSG5 |
pregnancy specific beta-1-glycoprotein 5 |
chr7_-_37956409 | 0.20 |
ENST00000436072.2 |
SFRP4 |
secreted frizzled-related protein 4 |
chrX_+_103294483 | 0.20 |
ENST00000355016.3 |
H2BFM |
H2B histone family, member M |
chrX_+_46772065 | 0.20 |
ENST00000455411.1 |
PHF16 |
jade family PHD finger 3 |
chr20_-_44718538 | 0.20 |
ENST00000290231.6 ENST00000372291.3 |
NCOA5 |
nuclear receptor coactivator 5 |
chr1_+_161185032 | 0.20 |
ENST00000367992.3 ENST00000289902.1 |
FCER1G |
Fc fragment of IgE, high affinity I, receptor for; gamma polypeptide |
chr22_+_22988816 | 0.20 |
ENST00000480559.1 ENST00000448514.1 |
GGTLC2 |
gamma-glutamyltransferase light chain 2 |
chr16_+_3062457 | 0.20 |
ENST00000445369.2 |
CLDN9 |
claudin 9 |
chr5_+_159656437 | 0.20 |
ENST00000402432.3 |
FABP6 |
fatty acid binding protein 6, ileal |
chr11_-_119293903 | 0.20 |
ENST00000580275.1 |
THY1 |
Thy-1 cell surface antigen |
chr10_-_104211294 | 0.19 |
ENST00000239125.1 |
C10orf95 |
chromosome 10 open reading frame 95 |
chr7_+_99156212 | 0.19 |
ENST00000454654.1 |
ZNF655 |
zinc finger protein 655 |
chr19_+_44037334 | 0.19 |
ENST00000314228.5 |
ZNF575 |
zinc finger protein 575 |
chr16_+_4475806 | 0.19 |
ENST00000262375.6 ENST00000355296.4 ENST00000431375.2 ENST00000574895.1 |
DNAJA3 |
DnaJ (Hsp40) homolog, subfamily A, member 3 |
chr11_-_74204692 | 0.19 |
ENST00000528085.1 |
LIPT2 |
lipoyl(octanoyl) transferase 2 (putative) |
chr17_-_15165825 | 0.19 |
ENST00000426385.3 |
PMP22 |
peripheral myelin protein 22 |
chr19_-_55895966 | 0.19 |
ENST00000444469.3 |
TMEM238 |
transmembrane protein 238 |
chr19_+_36027660 | 0.19 |
ENST00000585510.1 |
GAPDHS |
glyceraldehyde-3-phosphate dehydrogenase, spermatogenic |
chr11_+_118401899 | 0.19 |
ENST00000528373.1 ENST00000544878.1 ENST00000354284.4 ENST00000533137.1 ENST00000532762.1 ENST00000526973.1 ENST00000354064.7 ENST00000533102.1 ENST00000313236.5 ENST00000527267.1 ENST00000524725.1 ENST00000533689.1 |
TMEM25 |
transmembrane protein 25 |
chr1_-_45956868 | 0.19 |
ENST00000451835.2 |
TESK2 |
testis-specific kinase 2 |
chr11_-_130786333 | 0.19 |
ENST00000533214.1 ENST00000528555.1 ENST00000530356.1 ENST00000539184.1 |
SNX19 |
sorting nexin 19 |
chr16_-_740419 | 0.19 |
ENST00000248142.6 |
WDR24 |
WD repeat domain 24 |
chr1_+_174417095 | 0.19 |
ENST00000367685.2 |
GPR52 |
G protein-coupled receptor 52 |
chr19_+_544034 | 0.19 |
ENST00000592501.1 ENST00000264553.3 |
GZMM |
granzyme M (lymphocyte met-ase 1) |
chrX_+_16185836 | 0.19 |
ENST00000400003.1 |
MAGEB17 |
melanoma antigen family B, 17 |
chr1_-_31769595 | 0.19 |
ENST00000263694.4 |
SNRNP40 |
small nuclear ribonucleoprotein 40kDa (U5) |
chr11_+_208773 | 0.19 |
ENST00000528357.1 |
RIC8A |
RIC8 guanine nucleotide exchange factor A |
chr3_-_50383096 | 0.19 |
ENST00000442887.1 ENST00000360165.3 |
ZMYND10 |
zinc finger, MYND-type containing 10 |
chr19_+_11485333 | 0.19 |
ENST00000312423.2 |
SWSAP1 |
SWIM-type zinc finger 7 associated protein 1 |
chr6_-_166309725 | 0.19 |
ENST00000545867.1 |
SDIM1 |
stress responsive DNAJB4 interacting membrane protein 1 |
chr11_+_73661364 | 0.19 |
ENST00000339764.1 |
DNAJB13 |
DnaJ (Hsp40) homolog, subfamily B, member 13 |
chr5_-_72744336 | 0.19 |
ENST00000499003.3 |
FOXD1 |
forkhead box D1 |
chr16_+_2570431 | 0.19 |
ENST00000563556.1 |
AMDHD2 |
amidohydrolase domain containing 2 |
chr17_-_46716647 | 0.19 |
ENST00000608940.1 |
RP11-357H14.17 |
RP11-357H14.17 |
chr7_+_75024337 | 0.19 |
ENST00000450434.1 |
TRIM73 |
tripartite motif containing 73 |
chr8_+_101349823 | 0.19 |
ENST00000519566.1 |
KB-1991G8.1 |
KB-1991G8.1 |
chr16_+_25703274 | 0.19 |
ENST00000331351.5 |
HS3ST4 |
heparan sulfate (glucosamine) 3-O-sulfotransferase 4 |
chr14_+_100705322 | 0.19 |
ENST00000262238.4 |
YY1 |
YY1 transcription factor |
chr16_+_69333585 | 0.19 |
ENST00000570054.2 |
RP11-343C2.11 |
Uncharacterized protein |
chr21_-_37432832 | 0.19 |
ENST00000332131.4 |
SETD4 |
SET domain containing 4 |
chr3_-_195619579 | 0.19 |
ENST00000428187.1 |
TNK2 |
tyrosine kinase, non-receptor, 2 |
chr19_-_21950332 | 0.19 |
ENST00000598026.1 |
ZNF100 |
zinc finger protein 100 |
chr22_+_30752963 | 0.19 |
ENST00000445005.1 ENST00000430839.1 |
CCDC157 |
coiled-coil domain containing 157 |
chr11_+_65339820 | 0.19 |
ENST00000316409.2 ENST00000449319.2 ENST00000530349.1 |
FAM89B |
family with sequence similarity 89, member B |
chr11_+_113930955 | 0.19 |
ENST00000535700.1 |
ZBTB16 |
zinc finger and BTB domain containing 16 |
chr19_-_4455290 | 0.19 |
ENST00000394765.3 ENST00000592515.1 |
UBXN6 |
UBX domain protein 6 |
chr17_-_67323385 | 0.19 |
ENST00000588665.1 |
ABCA5 |
ATP-binding cassette, sub-family A (ABC1), member 5 |
chr19_-_47735918 | 0.18 |
ENST00000449228.1 ENST00000300880.7 ENST00000341983.4 |
BBC3 |
BCL2 binding component 3 |
chr12_+_110011571 | 0.18 |
ENST00000539696.1 ENST00000228510.3 ENST00000392727.3 |
MVK |
mevalonate kinase |
chr17_-_46703826 | 0.18 |
ENST00000550387.1 ENST00000311177.5 |
HOXB9 |
homeobox B9 |
chr11_+_3877412 | 0.18 |
ENST00000527651.1 |
STIM1 |
stromal interaction molecule 1 |
chr17_-_42976736 | 0.18 |
ENST00000591382.1 ENST00000593072.1 ENST00000592576.1 ENST00000402521.3 |
EFTUD2 |
elongation factor Tu GTP binding domain containing 2 |
chr16_-_19725899 | 0.18 |
ENST00000567367.1 |
KNOP1 |
lysine-rich nucleolar protein 1 |
chr20_+_47835884 | 0.18 |
ENST00000371764.4 |
DDX27 |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 27 |
chr7_+_1609765 | 0.18 |
ENST00000437964.1 ENST00000533935.1 ENST00000532358.1 ENST00000524978.1 |
PSMG3-AS1 |
PSMG3 antisense RNA 1 (head to head) |
chr17_+_42977122 | 0.18 |
ENST00000412523.2 ENST00000331733.4 ENST00000417826.2 |
FAM187A CCDC103 |
family with sequence similarity 187, member A coiled-coil domain containing 103 |
chr11_+_118307179 | 0.18 |
ENST00000534358.1 ENST00000531904.2 ENST00000389506.5 ENST00000354520.4 |
KMT2A |
lysine (K)-specific methyltransferase 2A |
chr11_-_45928830 | 0.18 |
ENST00000449465.1 |
C11orf94 |
chromosome 11 open reading frame 94 |
chr6_-_39902185 | 0.18 |
ENST00000373195.3 ENST00000308559.7 ENST00000373188.2 |
MOCS1 |
molybdenum cofactor synthesis 1 |
chr19_-_13900972 | 0.18 |
ENST00000397557.1 |
AC008686.1 |
Uncharacterized protein |
chr3_-_13114587 | 0.18 |
ENST00000429247.1 |
IQSEC1 |
IQ motif and Sec7 domain 1 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.5 | GO:1903367 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.2 | 0.6 | GO:0002432 | granuloma formation(GO:0002432) |
0.1 | 0.4 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
0.1 | 0.4 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
0.1 | 0.6 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
0.1 | 0.1 | GO:0010676 | positive regulation of cellular carbohydrate metabolic process(GO:0010676) |
0.1 | 0.3 | GO:0060734 | regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) |
0.1 | 0.3 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
0.1 | 0.3 | GO:0050823 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
0.1 | 0.3 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
0.1 | 0.3 | GO:1990051 | activation of protein kinase C activity(GO:1990051) |
0.1 | 0.4 | GO:0032915 | positive regulation of transforming growth factor beta2 production(GO:0032915) |
0.1 | 0.3 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
0.1 | 0.1 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
0.1 | 0.3 | GO:0061713 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
0.1 | 0.3 | GO:1901594 | detection of temperature stimulus involved in thermoception(GO:0050960) response to capsazepine(GO:1901594) |
0.1 | 0.3 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.4 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
0.1 | 0.3 | GO:0090410 | malonate catabolic process(GO:0090410) |
0.1 | 0.2 | GO:0061580 | colon epithelial cell migration(GO:0061580) |
0.1 | 0.3 | GO:0070845 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
0.1 | 0.2 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
0.1 | 0.2 | GO:0019082 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
0.1 | 0.3 | GO:1901536 | negative regulation of DNA demethylation(GO:1901536) |
0.1 | 0.2 | GO:0007493 | endodermal cell fate determination(GO:0007493) |
0.1 | 0.2 | GO:0060827 | regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
0.1 | 0.2 | GO:1902203 | negative regulation of hepatocyte growth factor receptor signaling pathway(GO:1902203) regulation of cellular response to hepatocyte growth factor stimulus(GO:2001112) negative regulation of cellular response to hepatocyte growth factor stimulus(GO:2001113) |
0.1 | 0.1 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.1 | 0.1 | GO:0032185 | septin cytoskeleton organization(GO:0032185) |
0.1 | 0.3 | GO:1990502 | dense core granule maturation(GO:1990502) |
0.1 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.1 | 0.5 | GO:0019075 | virus maturation(GO:0019075) |
0.1 | 0.3 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
0.1 | 0.1 | GO:1901656 | glycoside transport(GO:1901656) |
0.1 | 0.2 | GO:0033025 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
0.1 | 0.3 | GO:0032690 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
0.1 | 0.2 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
0.1 | 0.3 | GO:1901091 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
0.1 | 0.3 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.1 | 0.1 | GO:2000669 | negative regulation of dendritic cell apoptotic process(GO:2000669) |
0.1 | 0.2 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
0.1 | 0.3 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.1 | 0.4 | GO:0015878 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
0.1 | 0.2 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
0.1 | 0.2 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
0.1 | 0.2 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.1 | 0.2 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
0.1 | 0.2 | GO:0072185 | metanephric cap development(GO:0072185) metanephric cap morphogenesis(GO:0072186) metanephric cap mesenchymal cell proliferation involved in metanephros development(GO:0090094) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
0.1 | 0.2 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
0.1 | 0.2 | GO:0018307 | enzyme active site formation(GO:0018307) |
0.1 | 0.1 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.3 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.1 | 0.2 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
0.1 | 0.1 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
0.1 | 0.1 | GO:0045347 | regulation of MHC class II biosynthetic process(GO:0045346) negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 0.2 | GO:0086021 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
0.1 | 0.1 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
0.1 | 0.2 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
0.1 | 0.3 | GO:0001575 | globoside metabolic process(GO:0001575) |
0.1 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
0.1 | 0.2 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
0.1 | 0.3 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.2 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.1 | 0.2 | GO:2001302 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
0.1 | 0.2 | GO:1900111 | positive regulation of histone H3-K9 dimethylation(GO:1900111) |
0.1 | 0.2 | GO:0035623 | renal glucose absorption(GO:0035623) |
0.1 | 0.3 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.1 | 0.2 | GO:0098582 | innate vocalization behavior(GO:0098582) |
0.1 | 0.4 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.1 | 0.2 | GO:0021503 | neural fold bending(GO:0021503) |
0.1 | 0.2 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.1 | 0.2 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.1 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.0 | 0.2 | GO:0006238 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
0.0 | 0.1 | GO:1903033 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
0.0 | 0.2 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
0.0 | 0.1 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.0 | 0.2 | GO:0003363 | lamellipodium assembly involved in ameboidal cell migration(GO:0003363) extension of a leading process involved in cell motility in cerebral cortex radial glia guided migration(GO:0021816) |
0.0 | 0.2 | GO:1902024 | histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) |
0.0 | 0.1 | GO:1905051 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
0.0 | 0.2 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.2 | GO:0019417 | sulfur oxidation(GO:0019417) |
0.0 | 0.0 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
0.0 | 0.2 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
0.0 | 0.2 | GO:1903803 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
0.0 | 0.5 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
0.0 | 0.3 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
0.0 | 0.4 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
0.0 | 0.2 | GO:1903971 | mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) positive regulation of microglial cell migration(GO:1904141) |
0.0 | 0.4 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.0 | 0.1 | GO:0061193 | sensory organ boundary specification(GO:0008052) formation of organ boundary(GO:0010160) taste bud development(GO:0061193) |
0.0 | 0.1 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
0.0 | 0.1 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
0.0 | 0.1 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
0.0 | 0.2 | GO:0003166 | bundle of His development(GO:0003166) His-Purkinje system cell differentiation(GO:0060932) |
0.0 | 0.1 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
0.0 | 0.4 | GO:0070560 | protein secretion by platelet(GO:0070560) |
0.0 | 0.1 | GO:1901207 | regulation of heart looping(GO:1901207) |
0.0 | 0.5 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.0 | 0.1 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.0 | 0.2 | GO:0052250 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
0.0 | 0.0 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
0.0 | 0.1 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
0.0 | 0.3 | GO:1902612 | regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
0.0 | 0.2 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.0 | 0.1 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
0.0 | 0.4 | GO:0046618 | drug export(GO:0046618) |
0.0 | 0.1 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
0.0 | 0.1 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.0 | 0.1 | GO:0046041 | ITP metabolic process(GO:0046041) |
0.0 | 0.2 | GO:1903542 | negative regulation of exosomal secretion(GO:1903542) |
0.0 | 0.2 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
0.0 | 0.1 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.0 | 0.0 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.0 | 0.2 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
0.0 | 0.1 | GO:0086092 | regulation of the force of heart contraction by cardiac conduction(GO:0086092) |
0.0 | 0.2 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
0.0 | 0.1 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.0 | 0.1 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.0 | 0.1 | GO:0048627 | myoblast development(GO:0048627) |
0.0 | 0.5 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.5 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.1 | GO:0003341 | cilium movement(GO:0003341) |
0.0 | 0.4 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
0.0 | 0.3 | GO:0015798 | myo-inositol transport(GO:0015798) |
0.0 | 0.1 | GO:0042531 | regulation of tyrosine phosphorylation of STAT protein(GO:0042509) positive regulation of tyrosine phosphorylation of STAT protein(GO:0042531) positive regulation of JAK-STAT cascade(GO:0046427) positive regulation of STAT cascade(GO:1904894) |
0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.1 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
0.0 | 0.7 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.0 | 0.2 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
0.0 | 0.1 | GO:0002519 | natural killer cell tolerance induction(GO:0002519) |
0.0 | 0.0 | GO:0051495 | positive regulation of cytoskeleton organization(GO:0051495) |
0.0 | 0.1 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
0.0 | 0.2 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.0 | GO:0060922 | cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
0.0 | 0.3 | GO:0072143 | mesangial cell development(GO:0072143) |
0.0 | 0.2 | GO:2001153 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
0.0 | 0.1 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.0 | 0.2 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.0 | 0.3 | GO:0061198 | fungiform papilla formation(GO:0061198) |
0.0 | 0.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.2 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
0.0 | 0.0 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.0 | 0.3 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
0.0 | 0.1 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
0.0 | 0.1 | GO:0070446 | cellular response to caloric restriction(GO:0061433) negative regulation of oligodendrocyte progenitor proliferation(GO:0070446) |
0.0 | 0.3 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.0 | 0.5 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 0.4 | GO:0006552 | leucine catabolic process(GO:0006552) |
0.0 | 0.2 | GO:0033590 | response to cobalamin(GO:0033590) |
0.0 | 0.3 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.0 | 0.2 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.0 | 0.2 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.0 | 0.6 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.2 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.0 | 0.2 | GO:0051585 | negative regulation of dopamine uptake involved in synaptic transmission(GO:0051585) norepinephrine uptake(GO:0051620) regulation of norepinephrine uptake(GO:0051621) negative regulation of norepinephrine uptake(GO:0051622) negative regulation of catecholamine uptake involved in synaptic transmission(GO:0051945) regulation of glutathione peroxidase activity(GO:1903282) positive regulation of glutathione peroxidase activity(GO:1903284) positive regulation of hydrogen peroxide catabolic process(GO:1903285) positive regulation of peroxidase activity(GO:2000470) |
0.0 | 0.2 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
0.0 | 0.1 | GO:0033037 | polysaccharide localization(GO:0033037) |
0.0 | 0.2 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.0 | 0.1 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.1 | GO:0002774 | Fc receptor mediated inhibitory signaling pathway(GO:0002774) |
0.0 | 0.2 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
0.0 | 0.3 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.2 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
0.0 | 0.1 | GO:0002881 | negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
0.0 | 0.2 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.0 | 0.2 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
0.0 | 0.2 | GO:0060356 | leucine import(GO:0060356) |
0.0 | 0.2 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.0 | 0.5 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 0.2 | GO:0014735 | regulation of muscle atrophy(GO:0014735) |
0.0 | 0.1 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
0.0 | 0.1 | GO:0046210 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
0.0 | 0.1 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
0.0 | 0.1 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
0.0 | 0.3 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.2 | GO:0035624 | receptor transactivation(GO:0035624) |
0.0 | 0.1 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.0 | 0.1 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) |
0.0 | 0.2 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
0.0 | 0.1 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.0 | 0.2 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.0 | 0.3 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.0 | 0.1 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
0.0 | 0.1 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
0.0 | 0.2 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.1 | GO:0032707 | negative regulation of interleukin-23 production(GO:0032707) |
0.0 | 0.1 | GO:0021592 | fourth ventricle development(GO:0021592) |
0.0 | 0.0 | GO:0097052 | L-kynurenine metabolic process(GO:0097052) |
0.0 | 0.2 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.1 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
0.0 | 0.0 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.3 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.2 | GO:0071440 | regulation of histone H3-K14 acetylation(GO:0071440) |
0.0 | 0.1 | GO:0060214 | endocardium formation(GO:0060214) |
0.0 | 0.1 | GO:0007402 | ganglion mother cell fate determination(GO:0007402) |
0.0 | 0.2 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
0.0 | 0.1 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.0 | 0.1 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.0 | 0.1 | GO:0060730 | regulation of intestinal epithelial structure maintenance(GO:0060730) |
0.0 | 0.2 | GO:0071233 | cellular response to leucine(GO:0071233) |
0.0 | 0.1 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
0.0 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) |
0.0 | 0.0 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.0 | 0.2 | GO:0006710 | androgen catabolic process(GO:0006710) |
0.0 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
0.0 | 0.2 | GO:0019827 | stem cell population maintenance(GO:0019827) maintenance of cell number(GO:0098727) |
0.0 | 0.1 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.7 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
0.0 | 0.4 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
0.0 | 0.1 | GO:0007500 | mesodermal cell fate determination(GO:0007500) |
0.0 | 0.1 | GO:0042704 | uterine wall breakdown(GO:0042704) |
0.0 | 0.1 | GO:2000398 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
0.0 | 0.1 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.0 | 0.2 | GO:0061074 | regulation of neural retina development(GO:0061074) |
0.0 | 0.2 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
0.0 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
0.0 | 0.0 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.0 | 0.1 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 0.1 | GO:0002276 | basophil activation involved in immune response(GO:0002276) |
0.0 | 0.0 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.0 | 0.2 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
0.0 | 0.3 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
0.0 | 0.2 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.0 | 0.2 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
0.0 | 0.1 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
0.0 | 0.1 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
0.0 | 0.1 | GO:1904502 | lipophagy(GO:0061724) regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.0 | 0.0 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
0.0 | 0.1 | GO:0001556 | oocyte maturation(GO:0001556) |
0.0 | 0.1 | GO:0052417 | multi-organism catabolic process(GO:0044035) development of symbiont involved in interaction with host(GO:0044115) modulation of development of symbiont involved in interaction with host(GO:0044145) negative regulation of development of symbiont involved in interaction with host(GO:0044147) metabolism of substance in other organism involved in symbiotic interaction(GO:0052214) catabolism of substance in other organism involved in symbiotic interaction(GO:0052227) metabolism of macromolecule in other organism involved in symbiotic interaction(GO:0052229) catabolism by host of symbiont macromolecule(GO:0052360) catabolism by organism of macromolecule in other organism involved in symbiotic interaction(GO:0052361) catabolism by host of symbiont protein(GO:0052362) catabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052363) catabolism by host of substance in symbiont(GO:0052364) metabolism by host of symbiont macromolecule(GO:0052416) metabolism by host of symbiont protein(GO:0052417) metabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052418) metabolism by host of substance in symbiont(GO:0052419) |
0.0 | 0.1 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.1 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
0.0 | 0.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:0001300 | chronological cell aging(GO:0001300) |
0.0 | 0.1 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) isoquinoline alkaloid metabolic process(GO:0033076) |
0.0 | 0.1 | GO:1903412 | response to bile acid(GO:1903412) |
0.0 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.1 | GO:0036034 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
0.0 | 0.1 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
0.0 | 0.1 | GO:0061357 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
0.0 | 0.1 | GO:1904116 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
0.0 | 0.1 | GO:0015709 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
0.0 | 0.1 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.0 | 0.2 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.1 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
0.0 | 0.3 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.1 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
0.0 | 0.1 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.0 | 0.3 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.0 | 0.2 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.3 | GO:1903943 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
0.0 | 0.1 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.1 | GO:0003169 | coronary vein morphogenesis(GO:0003169) regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
0.0 | 0.1 | GO:0070256 | negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
0.0 | 0.3 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
0.0 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.0 | 0.3 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
0.0 | 0.1 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
0.0 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) gas homeostasis(GO:0033483) |
0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.0 | GO:0009078 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
0.0 | 0.0 | GO:0032752 | regulation of interleukin-3 production(GO:0032672) positive regulation of interleukin-3 production(GO:0032752) interleukin-3 biosynthetic process(GO:0042223) regulation of interleukin-3 biosynthetic process(GO:0045399) positive regulation of interleukin-3 biosynthetic process(GO:0045401) |
0.0 | 0.1 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
0.0 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.0 | 0.0 | GO:1903979 | negative regulation of microglial cell activation(GO:1903979) |
0.0 | 0.1 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
0.0 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.0 | 0.1 | GO:0071400 | cellular response to oleic acid(GO:0071400) |
0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.0 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.0 | 0.1 | GO:1990654 | sebum secreting cell proliferation(GO:1990654) |
0.0 | 0.3 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
0.0 | 0.1 | GO:0090107 | regulation of high-density lipoprotein particle assembly(GO:0090107) |
0.0 | 0.1 | GO:0072684 | mitochondrial tRNA 3'-trailer cleavage, endonucleolytic(GO:0072684) |
0.0 | 0.1 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.2 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.1 | GO:0043060 | meiotic metaphase I plate congression(GO:0043060) meiotic spindle midzone assembly(GO:0051257) meiotic metaphase plate congression(GO:0051311) |
0.0 | 0.2 | GO:0031269 | pseudopodium assembly(GO:0031269) regulation of pseudopodium assembly(GO:0031272) positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.1 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.4 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.1 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
0.0 | 0.1 | GO:0019858 | cytosine metabolic process(GO:0019858) |
0.0 | 0.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0048597 | B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.0 | 0.1 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) |
0.0 | 0.3 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.0 | 0.0 | GO:0034767 | positive regulation of transmembrane transport(GO:0034764) positive regulation of ion transmembrane transport(GO:0034767) |
0.0 | 0.0 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
0.0 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.0 | 0.1 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
0.0 | 0.1 | GO:0072334 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
0.0 | 0.1 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
0.0 | 0.1 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
0.0 | 0.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.1 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
0.0 | 0.1 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
0.0 | 0.1 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.0 | 0.3 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.0 | 0.0 | GO:1900195 | positive regulation of oocyte maturation(GO:1900195) |
0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.0 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.0 | 0.1 | GO:0033594 | response to vitamin K(GO:0032571) response to hydroxyisoflavone(GO:0033594) |
0.0 | 0.1 | GO:2000314 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.0 | 0.2 | GO:0034201 | response to oleic acid(GO:0034201) |
0.0 | 0.1 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
0.0 | 0.1 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
0.0 | 0.1 | GO:0051795 | positive regulation of catagen(GO:0051795) |
0.0 | 0.2 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.0 | 0.2 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.1 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.0 | 0.0 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.0 | GO:0046968 | peptide antigen transport(GO:0046968) |
0.0 | 0.1 | GO:0019046 | release from viral latency(GO:0019046) |
0.0 | 0.1 | GO:0031938 | regulation of chromatin silencing at telomere(GO:0031938) |
0.0 | 0.0 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.2 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.0 | 0.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.2 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
0.0 | 0.0 | GO:0043006 | activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
0.0 | 0.0 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.0 | 0.0 | GO:0046885 | regulation of hormone biosynthetic process(GO:0046885) |
0.0 | 0.1 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
0.0 | 0.1 | GO:0048596 | embryonic camera-type eye morphogenesis(GO:0048596) |
0.0 | 0.0 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.1 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
0.0 | 0.1 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
0.0 | 0.2 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.1 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
0.0 | 0.1 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.0 | 0.1 | GO:1904579 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) response to hypobaric hypoxia(GO:1990910) |
0.0 | 0.1 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
0.0 | 0.1 | GO:0006196 | AMP catabolic process(GO:0006196) |
0.0 | 0.2 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
0.0 | 0.1 | GO:1902462 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
0.0 | 0.1 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.0 | 0.1 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
0.0 | 0.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.0 | 0.2 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.0 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.3 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.1 | GO:1901216 | positive regulation of neuron death(GO:1901216) |
0.0 | 0.2 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.0 | 0.0 | GO:0035566 | regulation of metanephros size(GO:0035566) |
0.0 | 0.2 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.0 | 0.3 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.0 | 0.2 | GO:1901314 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
0.0 | 0.0 | GO:1903526 | negative regulation of membrane tubulation(GO:1903526) |
0.0 | 0.7 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.0 | 0.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.4 | GO:0051014 | actin filament severing(GO:0051014) |
0.0 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.0 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.0 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.0 | 0.0 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
0.0 | 0.0 | GO:0010955 | negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
0.0 | 0.1 | GO:0007439 | ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
0.0 | 0.2 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
0.0 | 0.0 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
0.0 | 0.2 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
0.0 | 0.0 | GO:0051928 | positive regulation of calcium ion transport(GO:0051928) |
0.0 | 0.0 | GO:2000584 | regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
0.0 | 0.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.2 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.0 | 0.1 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
0.0 | 0.2 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.0 | 0.0 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.0 | 0.1 | GO:0032916 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) positive regulation of transforming growth factor beta3 production(GO:0032916) |
0.0 | 0.0 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
0.0 | 0.1 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.0 | 0.3 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.0 | GO:0072300 | positive regulation of metanephric glomerulus development(GO:0072300) |
0.0 | 0.1 | GO:0033127 | regulation of histone phosphorylation(GO:0033127) |
0.0 | 0.1 | GO:1901628 | positive regulation of postsynaptic membrane organization(GO:1901628) |
0.0 | 0.1 | GO:1903926 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
0.0 | 0.1 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.0 | 0.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.1 | GO:0034334 | adherens junction maintenance(GO:0034334) |
0.0 | 0.2 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.3 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.0 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
0.0 | 0.1 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 0.3 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.0 | 0.0 | GO:2000861 | estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
0.0 | 0.3 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.1 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.0 | 0.1 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
0.0 | 0.1 | GO:0003404 | optic vesicle morphogenesis(GO:0003404) optic cup structural organization(GO:0003409) oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
0.0 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.0 | GO:0060374 | mast cell differentiation(GO:0060374) |
0.0 | 0.1 | GO:1904617 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
0.0 | 0.1 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
0.0 | 0.1 | GO:1903660 | negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.1 | GO:0019470 | 4-hydroxyproline catabolic process(GO:0019470) |
0.0 | 0.2 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.0 | 0.0 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
0.0 | 0.2 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.0 | 0.1 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
0.0 | 0.3 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.3 | GO:0045820 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.1 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.0 | 0.1 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
0.0 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.0 | GO:0038084 | vascular endothelial growth factor signaling pathway(GO:0038084) |
0.0 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.0 | 0.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.1 | GO:1903401 | L-lysine transmembrane transport(GO:1903401) |
0.0 | 0.2 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
0.0 | 0.4 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.0 | 0.3 | GO:0015866 | ADP transport(GO:0015866) ATP transport(GO:0015867) |
0.0 | 0.1 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.0 | 0.2 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.1 | GO:0030818 | negative regulation of cAMP biosynthetic process(GO:0030818) |
0.0 | 0.0 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.0 | 0.2 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.0 | 0.1 | GO:1904428 | negative regulation of tubulin deacetylation(GO:1904428) |
0.0 | 0.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.2 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.0 | GO:0019474 | L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine metabolic process(GO:0046440) |
0.0 | 0.2 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
0.0 | 0.1 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.2 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.0 | 0.2 | GO:0071028 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.0 | 0.1 | GO:0006788 | heme oxidation(GO:0006788) |
0.0 | 0.3 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
0.0 | 0.0 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.4 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.0 | 0.2 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
0.0 | 0.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.0 | 0.2 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.1 | GO:0019377 | glycolipid catabolic process(GO:0019377) |
0.0 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.0 | 0.4 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) |
0.0 | 0.1 | GO:0070541 | response to platinum ion(GO:0070541) |
0.0 | 0.3 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.0 | 0.1 | GO:0046898 | response to cycloheximide(GO:0046898) |
0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.3 | GO:0090292 | nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.0 | 0.1 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.0 | 0.1 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
0.0 | 0.1 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
0.0 | 0.1 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.0 | 0.1 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
0.0 | 0.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.0 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.6 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.1 | GO:0034349 | glial cell apoptotic process(GO:0034349) |
0.0 | 0.0 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.0 | 0.1 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) branch elongation involved in mammary gland duct branching(GO:0060751) |
0.0 | 0.2 | GO:0007501 | mesodermal cell fate specification(GO:0007501) |
0.0 | 0.0 | GO:0018364 | box C/D snoRNA 3'-end processing(GO:0000494) peptidyl-glutamine methylation(GO:0018364) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
0.0 | 0.0 | GO:0044028 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
0.0 | 0.1 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
0.0 | 0.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.0 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.3 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.0 | GO:0002476 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
0.0 | 0.0 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
0.0 | 0.2 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
0.0 | 0.0 | GO:0014744 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of muscle adaptation(GO:0014744) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
0.0 | 0.1 | GO:0061518 | macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
0.0 | 0.1 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.0 | 0.0 | GO:1902725 | negative regulation of satellite cell differentiation(GO:1902725) |
0.0 | 0.0 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
0.0 | 0.0 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.1 | GO:0061364 | apoptotic process involved in luteolysis(GO:0061364) |
0.0 | 0.0 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.0 | 0.0 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
0.0 | 0.1 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
0.0 | 0.0 | GO:1904798 | positive regulation of core promoter binding(GO:1904798) |
0.0 | 0.2 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.0 | GO:0050757 | thymidylate synthase biosynthetic process(GO:0050757) regulation of thymidylate synthase biosynthetic process(GO:0050758) negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
0.0 | 0.1 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
0.0 | 0.3 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
0.0 | 0.0 | GO:1902304 | positive regulation of potassium ion export(GO:1902304) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
0.0 | 0.0 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
0.0 | 0.2 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
0.0 | 0.1 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
0.0 | 0.0 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
0.0 | 0.1 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
0.0 | 0.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 0.0 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.1 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 0.2 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.0 | 0.1 | GO:1900623 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.0 | 0.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.0 | GO:2001037 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.2 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.3 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.0 | 0.2 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.1 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.0 | 0.1 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
0.0 | 0.0 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
0.0 | 0.1 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
0.0 | 0.0 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.6 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.0 | 0.1 | GO:0001893 | maternal placenta development(GO:0001893) |
0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.2 | GO:0031167 | rRNA methylation(GO:0031167) |
0.0 | 0.1 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.0 | 0.1 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.0 | GO:0046081 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
0.0 | 0.1 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.0 | 0.0 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
0.0 | 0.0 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.0 | 0.0 | GO:0030324 | lung development(GO:0030324) |
0.0 | 0.1 | GO:0031100 | organ regeneration(GO:0031100) |
0.0 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.0 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.0 | 0.0 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.0 | 0.2 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.1 | GO:0034378 | chylomicron assembly(GO:0034378) |
0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.1 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
0.0 | 0.3 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.0 | 0.1 | GO:0046465 | dolichyl diphosphate biosynthetic process(GO:0006489) dolichyl diphosphate metabolic process(GO:0046465) |
0.0 | 0.1 | GO:1905232 | cellular response to L-glutamate(GO:1905232) |
0.0 | 0.2 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
0.0 | 0.1 | GO:0021678 | third ventricle development(GO:0021678) |
0.0 | 0.1 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
0.0 | 0.1 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
0.0 | 0.0 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.0 | 0.0 | GO:0033077 | T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
0.0 | 0.0 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
0.0 | 0.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.1 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.0 | 0.1 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
0.0 | 0.6 | GO:0048741 | skeletal muscle fiber development(GO:0048741) |
0.0 | 0.2 | GO:0038203 | TORC2 signaling(GO:0038203) |
0.0 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.0 | 0.0 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.0 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.1 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.1 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.0 | 0.0 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
0.0 | 0.8 | GO:0010761 | fibroblast migration(GO:0010761) |
0.0 | 0.1 | GO:2000329 | peptidyl-lysine oxidation(GO:0018057) negative regulation of T-helper 17 cell lineage commitment(GO:2000329) |
0.0 | 0.2 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.0 | 0.0 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.0 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.0 | 0.0 | GO:0021551 | central nervous system morphogenesis(GO:0021551) cardiac muscle tissue regeneration(GO:0061026) |
0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
0.0 | 0.1 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
0.0 | 0.4 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.1 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
0.0 | 0.2 | GO:0000097 | sulfur amino acid biosynthetic process(GO:0000097) |
0.0 | 0.0 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.0 | 0.2 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.0 | 0.0 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.0 | 0.2 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
0.0 | 0.0 | GO:0010813 | neuropeptide catabolic process(GO:0010813) |
0.0 | 0.0 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
0.0 | 0.0 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.2 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.0 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.1 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.2 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.0 | 0.1 | GO:0046203 | spermidine catabolic process(GO:0046203) |
0.0 | 0.1 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.1 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.0 | 0.0 | GO:1990168 | protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.1 | GO:1901098 | positive regulation of autophagosome maturation(GO:1901098) |
0.0 | 0.0 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.1 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.0 | 0.0 | GO:0046709 | IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.0 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
0.0 | 0.3 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.4 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.0 | 0.0 | GO:1900533 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
0.0 | 0.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.0 | 0.3 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.2 | GO:0007567 | parturition(GO:0007567) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.0 | 0.1 | GO:1902221 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.0 | 0.0 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
0.0 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.0 | GO:0033084 | regulation of immature T cell proliferation in thymus(GO:0033084) negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.0 | 0.0 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.0 | 0.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.0 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
0.0 | 0.0 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.0 | 0.1 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.0 | 0.0 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
0.0 | 0.0 | GO:0010454 | negative regulation of cell fate commitment(GO:0010454) |
0.0 | 0.1 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.0 | 0.8 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.0 | GO:0021888 | hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
0.0 | 0.0 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
0.0 | 0.0 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.0 | 0.1 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.0 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
0.0 | 0.0 | GO:0045210 | negative regulation of dendritic cell cytokine production(GO:0002731) FasL biosynthetic process(GO:0045210) |
0.0 | 0.1 | GO:0006696 | ergosterol biosynthetic process(GO:0006696) ergosterol metabolic process(GO:0008204) |
0.0 | 0.1 | GO:0046368 | GDP-L-fucose biosynthetic process(GO:0042350) GDP-L-fucose metabolic process(GO:0046368) |
0.0 | 0.0 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
0.0 | 0.0 | GO:0009213 | pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
0.0 | 0.3 | GO:1902603 | carnitine transmembrane transport(GO:1902603) |
0.0 | 0.0 | GO:0010193 | response to ozone(GO:0010193) |
0.0 | 0.1 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
0.0 | 0.0 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.0 | 0.0 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.0 | 0.1 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.2 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
0.0 | 0.1 | GO:0061042 | vascular wound healing(GO:0061042) |
0.0 | 0.1 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) |
0.0 | 0.1 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.2 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.0 | 0.0 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.0 | 0.0 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.0 | 0.2 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.0 | 0.0 | GO:0048505 | regulation of development, heterochronic(GO:0040034) regulation of timing of cell differentiation(GO:0048505) |
0.0 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.0 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
0.0 | 0.0 | GO:0060032 | notochord regression(GO:0060032) |
0.0 | 0.2 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.2 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.0 | 0.0 | GO:1903519 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.3 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.0 | GO:0014909 | smooth muscle cell migration(GO:0014909) |
0.0 | 0.7 | GO:0032418 | lysosome localization(GO:0032418) |
0.0 | 0.1 | GO:0030220 | platelet formation(GO:0030220) |
0.0 | 0.1 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
0.0 | 0.0 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.0 | 0.0 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.0 | 0.1 | GO:0061015 | snRNA import into nucleus(GO:0061015) |
0.0 | 0.1 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.0 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.1 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
0.0 | 0.1 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
0.0 | 0.0 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.0 | GO:1900138 | negative regulation of phospholipase A2 activity(GO:1900138) |
0.0 | 0.0 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.0 | 0.1 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
0.0 | 0.0 | GO:0001702 | gastrulation with mouth forming second(GO:0001702) |
0.0 | 0.1 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.0 | 0.2 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
0.0 | 0.1 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.1 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.0 | 0.1 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.0 | 0.0 | GO:0007494 | midgut development(GO:0007494) |
0.0 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
0.0 | 0.1 | GO:0006662 | glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
0.0 | 0.2 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.1 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.1 | GO:0006657 | CDP-choline pathway(GO:0006657) |
0.0 | 0.1 | GO:0034629 | cellular protein complex localization(GO:0034629) |
0.0 | 0.2 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.0 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
0.0 | 0.0 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.0 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.0 | 0.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.1 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.0 | 0.0 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) negative regulation of store-operated calcium channel activity(GO:1901340) |
0.0 | 0.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.0 | 0.0 | GO:0014047 | glutamate secretion(GO:0014047) |
0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.0 | GO:0051758 | homologous chromosome movement towards spindle pole involved in homologous chromosome segregation(GO:0051758) |
0.0 | 0.1 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.0 | 0.0 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
0.0 | 0.1 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
0.0 | 0.3 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.0 | 0.0 | GO:1904180 | negative regulation of membrane depolarization(GO:1904180) |
0.0 | 0.0 | GO:0009405 | pathogenesis(GO:0009405) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.1 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.0 | 0.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.0 | 0.1 | GO:0046778 | modification by virus of host mRNA processing(GO:0046778) |
0.0 | 0.4 | GO:0014003 | oligodendrocyte development(GO:0014003) |
0.0 | 0.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.0 | 0.1 | GO:0015732 | prostaglandin transport(GO:0015732) |
0.0 | 0.0 | GO:0061485 | memory T cell proliferation(GO:0061485) |
0.0 | 0.0 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.0 | GO:0015965 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
0.0 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.0 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.0 | 0.0 | GO:0010159 | specification of organ position(GO:0010159) |
0.0 | 0.1 | GO:0035372 | protein localization to microtubule(GO:0035372) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.8 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.5 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.1 | 0.1 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.1 | 0.2 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
0.1 | 0.2 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 0.3 | GO:0016938 | kinesin I complex(GO:0016938) |
0.1 | 0.2 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
0.1 | 0.2 | GO:0097444 | spine apparatus(GO:0097444) |
0.1 | 0.1 | GO:1902911 | protein kinase complex(GO:1902911) |
0.1 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 0.5 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.2 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
0.0 | 0.2 | GO:0097196 | Shu complex(GO:0097196) |
0.0 | 0.3 | GO:0042825 | TAP complex(GO:0042825) |
0.0 | 0.5 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
0.0 | 0.2 | GO:0036284 | tubulobulbar complex(GO:0036284) |
0.0 | 0.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.0 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
0.0 | 0.4 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.1 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.7 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.0 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.1 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.0 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.1 | GO:0034515 | proteasome storage granule(GO:0034515) |
0.0 | 0.2 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
0.0 | 0.4 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.2 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.0 | 0.1 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.0 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.0 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.2 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
0.0 | 0.4 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.2 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.1 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.0 | 0.2 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.0 | 0.1 | GO:0044218 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.1 | GO:0045160 | myosin I complex(GO:0045160) |
0.0 | 0.1 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
0.0 | 0.2 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.0 | 0.1 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 0.6 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.3 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.1 | GO:0034657 | GID complex(GO:0034657) |
0.0 | 0.4 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.0 | 0.1 | GO:0030934 | anchoring collagen complex(GO:0030934) |
0.0 | 0.1 | GO:0001534 | radial spoke(GO:0001534) |
0.0 | 0.0 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.1 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
0.0 | 0.1 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.4 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.3 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 0.2 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.0 | 0.5 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.4 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.4 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.6 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.1 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
0.0 | 0.2 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
0.0 | 0.3 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.2 | GO:0005587 | collagen type IV trimer(GO:0005587) |
0.0 | 0.1 | GO:1990031 | pinceau fiber(GO:1990031) |
0.0 | 0.2 | GO:0035976 | AP1 complex(GO:0035976) |
0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.3 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.1 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
0.0 | 0.7 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.2 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.1 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
0.0 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.1 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.0 | 0.6 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.3 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.1 | GO:0097060 | synaptic membrane(GO:0097060) |
0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.1 | GO:1905202 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
0.0 | 0.0 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.0 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.0 | GO:0071020 | post-spliceosomal complex(GO:0071020) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.1 | GO:0032010 | phagolysosome(GO:0032010) |
0.0 | 0.1 | GO:0000836 | Hrd1p ubiquitin ligase complex(GO:0000836) |
0.0 | 0.4 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.3 | GO:0014704 | intercalated disc(GO:0014704) |
0.0 | 0.1 | GO:0070931 | Golgi-associated vesicle lumen(GO:0070931) |
0.0 | 0.1 | GO:0072563 | endothelial microparticle(GO:0072563) |
0.0 | 0.1 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
0.0 | 0.1 | GO:0061695 | transferase complex, transferring phosphorus-containing groups(GO:0061695) |
0.0 | 0.1 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.3 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.1 | GO:0097361 | CIA complex(GO:0097361) |
0.0 | 1.5 | GO:0097525 | spliceosomal snRNP complex(GO:0097525) |
0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.1 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.0 | 0.0 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
0.0 | 0.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.0 | GO:0044306 | neuron projection terminus(GO:0044306) |
0.0 | 0.0 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.0 | 0.1 | GO:0036338 | viral envelope(GO:0019031) viral membrane(GO:0036338) |
0.0 | 0.0 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.0 | GO:0036117 | hyaluranon cable(GO:0036117) |
0.0 | 0.0 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.0 | 0.6 | GO:0031527 | filopodium membrane(GO:0031527) |
0.0 | 0.5 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.3 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.4 | GO:0036020 | endolysosome membrane(GO:0036020) |
0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.1 | GO:0090661 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.4 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
0.0 | 0.0 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.3 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.1 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.1 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.1 | GO:0031256 | leading edge membrane(GO:0031256) |
0.0 | 0.0 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.8 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.4 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
0.0 | 0.0 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
0.0 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.3 | GO:0043218 | compact myelin(GO:0043218) |
0.0 | 0.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.3 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.0 | 0.3 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.1 | GO:0090568 | nuclear transcriptional repressor complex(GO:0090568) |
0.0 | 1.5 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.3 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.0 | 0.4 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.0 | GO:0018444 | translation release factor complex(GO:0018444) |
0.0 | 0.1 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.0 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
0.0 | 0.3 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.0 | GO:0098844 | postsynaptic endocytic zone membrane(GO:0098844) |
0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.4 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.0 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.0 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
0.0 | 0.2 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.1 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.9 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.3 | GO:0071565 | nBAF complex(GO:0071565) |
0.0 | 0.4 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.0 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.2 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.1 | GO:0033643 | host cell part(GO:0033643) |
0.0 | 0.0 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.1 | GO:0045177 | apical part of cell(GO:0045177) |
0.0 | 0.0 | GO:0043257 | laminin-8 complex(GO:0043257) |
0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 1.2 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.2 | GO:0038201 | TOR complex(GO:0038201) |
0.0 | 0.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.1 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:0000145 | exocyst(GO:0000145) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.8 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
0.1 | 0.4 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 0.4 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
0.1 | 0.4 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
0.1 | 0.4 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.3 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.1 | 0.3 | GO:0061714 | folic acid receptor activity(GO:0061714) |
0.1 | 0.3 | GO:0001156 | TFIIIC-class transcription factor binding(GO:0001156) |
0.1 | 0.7 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.1 | 0.3 | GO:0090409 | malonyl-CoA synthetase activity(GO:0090409) |
0.1 | 0.2 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
0.1 | 0.2 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
0.1 | 0.2 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
0.1 | 0.2 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
0.1 | 0.4 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
0.1 | 0.2 | GO:0052726 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
0.1 | 0.2 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
0.1 | 0.3 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
0.1 | 0.4 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
0.1 | 0.2 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
0.1 | 0.4 | GO:0043813 | phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) |
0.1 | 0.4 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
0.1 | 0.2 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
0.1 | 0.2 | GO:0086020 | gap junction channel activity involved in SA node cell-atrial cardiac muscle cell electrical coupling(GO:0086020) |
0.1 | 0.2 | GO:0045142 | triplex DNA binding(GO:0045142) |
0.1 | 0.2 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
0.1 | 0.3 | GO:0035326 | enhancer binding(GO:0035326) |
0.1 | 0.3 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.2 | GO:0047977 | hepoxilin-epoxide hydrolase activity(GO:0047977) |
0.1 | 0.3 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
0.1 | 0.2 | GO:0070283 | lipoate synthase activity(GO:0016992) radical SAM enzyme activity(GO:0070283) |
0.1 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.2 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.1 | 0.2 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
0.1 | 0.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.1 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.0 | 0.3 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
0.0 | 0.2 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.3 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.0 | 0.8 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.2 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.2 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
0.0 | 0.1 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.2 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.0 | 0.1 | GO:0003870 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
0.0 | 0.2 | GO:0004441 | inositol-1,4-bisphosphate 1-phosphatase activity(GO:0004441) inositol-1,3,4-trisphosphate 1-phosphatase activity(GO:0052829) |
0.0 | 0.1 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
0.0 | 0.3 | GO:0045569 | TRAIL binding(GO:0045569) |
0.0 | 0.1 | GO:0047536 | 2-aminoadipate transaminase activity(GO:0047536) |
0.0 | 0.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.3 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.0 | 0.3 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 0.4 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.4 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.0 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.0 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.3 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.2 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.0 | 0.4 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.0 | 0.2 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.0 | 0.1 | GO:0052870 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
0.0 | 0.1 | GO:0086040 | sodium:proton antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086040) |
0.0 | 0.3 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
0.0 | 0.4 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.0 | 0.2 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
0.0 | 0.2 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
0.0 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.0 | 0.2 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.0 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.1 | GO:0008441 | 3'(2'),5'-bisphosphate nucleotidase activity(GO:0008441) |
0.0 | 0.2 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.0 | 0.4 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
0.0 | 0.6 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.0 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.1 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.2 | GO:0060961 | phospholipase D inhibitor activity(GO:0060961) |
0.0 | 0.4 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.0 | 0.4 | GO:0045159 | myosin II binding(GO:0045159) |
0.0 | 0.3 | GO:0004515 | nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.2 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
0.0 | 0.1 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.3 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
0.0 | 0.1 | GO:0097643 | amylin receptor activity(GO:0097643) |
0.0 | 0.1 | GO:0032090 | Pyrin domain binding(GO:0032090) |
0.0 | 0.1 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
0.0 | 0.1 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
0.0 | 0.5 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.1 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
0.0 | 0.0 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
0.0 | 0.1 | GO:0036487 | nitric-oxide synthase inhibitor activity(GO:0036487) |
0.0 | 0.1 | GO:0016731 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
0.0 | 0.2 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
0.0 | 0.2 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
0.0 | 0.2 | GO:0052794 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.1 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.0 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 0.2 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
0.0 | 0.1 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.0 | 0.1 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.0 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.1 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.0 | 0.1 | GO:0000773 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
0.0 | 0.1 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
0.0 | 0.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.4 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.2 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
0.0 | 0.3 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.1 | GO:0030760 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
0.0 | 0.1 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.0 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.2 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
0.0 | 0.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.0 | 0.1 | GO:0001003 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
0.0 | 0.2 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.1 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
0.0 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 0.1 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.0 | 0.0 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 1.0 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
0.0 | 0.2 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
0.0 | 0.1 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.0 | GO:0000987 | core promoter proximal region sequence-specific DNA binding(GO:0000987) |
0.0 | 0.1 | GO:0015117 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
0.0 | 0.3 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.1 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
0.0 | 0.1 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.0 | 0.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.2 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
0.0 | 0.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.0 | 0.1 | GO:0032393 | MHC class I receptor activity(GO:0032393) |
0.0 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 0.1 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
0.0 | 0.1 | GO:0000384 | first spliceosomal transesterification activity(GO:0000384) |
0.0 | 0.1 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
0.0 | 0.1 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
0.0 | 0.1 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
0.0 | 0.1 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.1 | GO:0098988 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) G-protein coupled glutamate receptor activity(GO:0098988) |
0.0 | 0.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.0 | 0.2 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.0 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
0.0 | 0.6 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
0.0 | 0.2 | GO:0051766 | inositol trisphosphate kinase activity(GO:0051766) |
0.0 | 0.2 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.1 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
0.0 | 0.1 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.1 | GO:0086075 | gap junction channel activity involved in cardiac conduction electrical coupling(GO:0086075) |
0.0 | 0.4 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.1 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
0.0 | 0.1 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
0.0 | 0.1 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.0 | 0.5 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.1 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
0.0 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.0 | 0.1 | GO:0005174 | CD40 receptor binding(GO:0005174) |
0.0 | 0.0 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.0 | 0.2 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
0.0 | 0.3 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.2 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.0 | 0.1 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
0.0 | 0.1 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.4 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.0 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.0 | 0.1 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.1 | GO:0050659 | chondroitin 4-sulfotransferase activity(GO:0047756) N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
0.0 | 0.1 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
0.0 | 0.8 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.1 | GO:0052894 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
0.0 | 0.1 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
0.0 | 0.5 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.1 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 0.1 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
0.0 | 0.2 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.2 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.6 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.2 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.1 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) leukotriene receptor activity(GO:0004974) |
0.0 | 0.4 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
0.0 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
0.0 | 0.2 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.1 | GO:0036440 | citrate (Si)-synthase activity(GO:0004108) citrate synthase activity(GO:0036440) |
0.0 | 0.0 | GO:0005217 | intracellular ligand-gated ion channel activity(GO:0005217) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.6 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.1 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
0.0 | 0.1 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.1 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
0.0 | 0.0 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.1 | GO:0032564 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
0.0 | 0.1 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.0 | 0.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.2 | GO:0089720 | caspase binding(GO:0089720) |
0.0 | 0.0 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.2 | GO:0051427 | hormone receptor binding(GO:0051427) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.1 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.2 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.2 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.0 | 0.1 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) phosphoribosylformylglycinamidine cyclo-ligase activity(GO:0004641) phosphoribosylglycinamide formyltransferase activity(GO:0004644) |
0.0 | 0.2 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.2 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.3 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
0.0 | 0.1 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
0.0 | 0.3 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
0.0 | 0.0 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.0 | 0.1 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.1 | GO:0004522 | ribonuclease A activity(GO:0004522) |
0.0 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.1 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
0.0 | 0.1 | GO:0052857 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:1990763 | arrestin family protein binding(GO:1990763) |
0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.0 | 0.1 | GO:0061598 | molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
0.0 | 0.0 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.1 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
0.0 | 0.1 | GO:0004325 | ferrochelatase activity(GO:0004325) |
0.0 | 0.0 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.1 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.0 | 0.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.1 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.0 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
0.0 | 0.7 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.0 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
0.0 | 0.0 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
0.0 | 0.0 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.0 | 0.2 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.0 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
0.0 | 0.4 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.2 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.0 | 0.2 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.0 | 0.0 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.3 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.1 | GO:0098808 | mRNA cap binding(GO:0098808) |
0.0 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.6 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.0 | GO:0034736 | sterol O-acyltransferase activity(GO:0004772) cholesterol O-acyltransferase activity(GO:0034736) |
0.0 | 0.0 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
0.0 | 0.1 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) |
0.0 | 0.2 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.1 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
0.0 | 0.1 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
0.0 | 0.3 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.0 | 0.6 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.0 | GO:0090541 | MIT domain binding(GO:0090541) |
0.0 | 0.0 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.0 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 0.2 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.1 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.0 | 0.1 | GO:0004530 | deoxyribonuclease I activity(GO:0004530) |
0.0 | 0.1 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.2 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.0 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.0 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
0.0 | 0.0 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
0.0 | 0.3 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
0.0 | 0.1 | GO:0032810 | sterol response element binding(GO:0032810) |
0.0 | 0.0 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
0.0 | 0.1 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.0 | GO:0043849 | Ras palmitoyltransferase activity(GO:0043849) |
0.0 | 0.0 | GO:0046969 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.0 | 0.2 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.1 | GO:0042806 | fucose binding(GO:0042806) |
0.0 | 0.2 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.3 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.2 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.0 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 0.1 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.2 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.0 | 0.2 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.2 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.0 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
0.0 | 0.0 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
0.0 | 0.3 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.0 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.0 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.1 | GO:0048030 | disaccharide binding(GO:0048030) |
0.0 | 0.0 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.1 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.0 | 0.3 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.0 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
0.0 | 0.0 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.0 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0045029 | UDP-activated nucleotide receptor activity(GO:0045029) |
0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.0 | GO:0004423 | iduronate-2-sulfatase activity(GO:0004423) |
0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.0 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.0 | 1.1 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) |
0.0 | 0.2 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.0 | 0.3 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.0 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 0.0 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.0 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.0 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.8 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
0.0 | 0.0 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
0.0 | 0.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.1 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.0 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
0.0 | 0.0 | GO:0008940 | nitrate reductase activity(GO:0008940) |
0.0 | 0.0 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.0 | GO:0030553 | cGMP binding(GO:0030553) |
0.0 | 0.1 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.0 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
0.0 | 0.0 | GO:0098809 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
0.0 | 0.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 0.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.2 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.0 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
0.0 | 0.1 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.0 | 0.0 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.0 | GO:0031177 | S-acetyltransferase activity(GO:0016418) phosphopantetheine binding(GO:0031177) |
0.0 | 0.0 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.0 | GO:0050577 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.1 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.2 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.0 | 0.0 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
0.0 | 0.1 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.0 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.0 | GO:0030984 | kininogen binding(GO:0030984) |
0.0 | 0.0 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.0 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
0.0 | 0.5 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.0 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.0 | 0.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 1.0 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.0 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.0 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
0.0 | 0.1 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.0 | 0.1 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
0.0 | 0.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.1 | GO:0010736 | serum response element binding(GO:0010736) |
0.0 | 0.3 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.0 | 0.2 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.3 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.1 | GO:0008170 | N-methyltransferase activity(GO:0008170) |
0.0 | 0.1 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.1 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.0 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.3 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.6 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.8 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.8 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.4 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.5 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.9 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 1.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.5 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 1.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.9 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 1.0 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.5 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.3 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.2 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 1.0 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.7 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.6 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.2 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.7 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.0 | 0.5 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.0 | 0.1 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.0 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.8 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.1 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.0 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 1.0 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 1.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.6 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.4 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.6 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.4 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.3 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.5 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.3 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.4 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.3 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 1.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.3 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.5 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.4 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.7 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.7 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.0 | 0.3 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.0 | 0.5 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.3 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.0 | 0.4 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.3 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.3 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.0 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.3 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.8 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.3 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.5 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 1.2 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.0 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.4 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.7 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.4 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.1 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |