A549 cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Gene Symbol | Gene ID | Gene Info |
---|---|---|
HIC1
|
ENSG00000177374.8 | HIC1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
HIC1 | hg19_v2_chr17_+_1959369_1959604 | 0.53 | 2.8e-01 | Click! |
Promoter | Score | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr2_+_74212073 | 1.81 |
ENST00000441217.1 |
AC073046.25 |
AC073046.25 |
chr16_+_84002234 | 1.64 |
ENST00000305202.4 |
NECAB2 |
N-terminal EF-hand calcium binding protein 2 |
chr14_-_94254821 | 0.86 |
ENST00000393140.1 |
PRIMA1 |
proline rich membrane anchor 1 |
chr5_+_23951673 | 0.80 |
ENST00000507936.1 |
C5orf17 |
chromosome 5 open reading frame 17 |
chr9_-_130742792 | 0.70 |
ENST00000373095.1 |
FAM102A |
family with sequence similarity 102, member A |
chr11_+_777562 | 0.63 |
ENST00000530083.1 |
AP006621.5 |
Protein LOC100506518 |
chr3_-_137834436 | 0.62 |
ENST00000327532.2 ENST00000467030.1 |
DZIP1L |
DAZ interacting zinc finger protein 1-like |
chr16_+_765092 | 0.61 |
ENST00000568223.2 |
METRN |
meteorin, glial cell differentiation regulator |
chr19_-_18717627 | 0.61 |
ENST00000392386.3 |
CRLF1 |
cytokine receptor-like factor 1 |
chr16_+_1662326 | 0.59 |
ENST00000397412.3 |
CRAMP1L |
Crm, cramped-like (Drosophila) |
chrX_-_45710920 | 0.58 |
ENST00000456532.1 |
RP5-1158E12.3 |
RP5-1158E12.3 |
chr4_+_3768075 | 0.58 |
ENST00000509482.1 ENST00000330055.5 |
ADRA2C |
adrenoceptor alpha 2C |
chrX_-_102565858 | 0.57 |
ENST00000449185.1 ENST00000536889.1 |
BEX2 |
brain expressed X-linked 2 |
chr14_+_64319669 | 0.57 |
ENST00000358025.3 ENST00000357395.3 ENST00000344113.4 ENST00000341472.5 ENST00000356081.3 |
SYNE2 |
spectrin repeat containing, nuclear envelope 2 |
chr12_+_133067157 | 0.57 |
ENST00000261673.6 |
FBRSL1 |
fibrosin-like 1 |
chr1_-_33815486 | 0.57 |
ENST00000373418.3 |
PHC2 |
polyhomeotic homolog 2 (Drosophila) |
chr17_-_67323385 | 0.56 |
ENST00000588665.1 |
ABCA5 |
ATP-binding cassette, sub-family A (ABC1), member 5 |
chr16_+_89696692 | 0.55 |
ENST00000261615.4 |
DPEP1 |
dipeptidase 1 (renal) |
chr7_+_2598628 | 0.55 |
ENST00000402050.2 ENST00000404984.1 ENST00000415271.2 ENST00000438376.2 |
IQCE |
IQ motif containing E |
chr1_-_21948906 | 0.53 |
ENST00000374761.2 ENST00000599760.1 |
RAP1GAP |
RAP1 GTPase activating protein |
chr18_+_77439775 | 0.53 |
ENST00000299543.7 ENST00000075430.7 |
CTDP1 |
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) phosphatase, subunit 1 |
chr4_+_183370146 | 0.52 |
ENST00000510504.1 |
TENM3 |
teneurin transmembrane protein 3 |
chr2_-_85828867 | 0.52 |
ENST00000425160.1 |
TMEM150A |
transmembrane protein 150A |
chr19_-_2236246 | 0.52 |
ENST00000587394.2 |
PLEKHJ1 |
pleckstrin homology domain containing, family J member 1 |
chr11_+_64808675 | 0.51 |
ENST00000529996.1 |
SAC3D1 |
SAC3 domain containing 1 |
chr16_+_67563250 | 0.51 |
ENST00000566907.1 |
FAM65A |
family with sequence similarity 65, member A |
chrX_-_102565932 | 0.49 |
ENST00000372674.1 ENST00000372677.3 |
BEX2 |
brain expressed X-linked 2 |
chr9_-_38424443 | 0.49 |
ENST00000377694.1 |
IGFBPL1 |
insulin-like growth factor binding protein-like 1 |
chr7_+_4721885 | 0.49 |
ENST00000328914.4 |
FOXK1 |
forkhead box K1 |
chr17_-_4167142 | 0.49 |
ENST00000570535.1 ENST00000574367.1 ENST00000341657.4 ENST00000433651.1 |
ANKFY1 |
ankyrin repeat and FYVE domain containing 1 |
chr9_+_131580734 | 0.48 |
ENST00000372642.4 |
ENDOG |
endonuclease G |
chr1_-_32827682 | 0.48 |
ENST00000432622.1 |
FAM229A |
family with sequence similarity 229, member A |
chr19_-_2236290 | 0.48 |
ENST00000591099.2 ENST00000586608.2 ENST00000326631.2 ENST00000587962.2 |
PLEKHJ1 |
pleckstrin homology domain containing, family J member 1 |
chr9_-_138987115 | 0.47 |
ENST00000277554.2 |
NACC2 |
NACC family member 2, BEN and BTB (POZ) domain containing |
chr8_+_143808605 | 0.46 |
ENST00000336138.3 |
THEM6 |
thioesterase superfamily member 6 |
chr13_+_110959598 | 0.46 |
ENST00000360467.5 |
COL4A2 |
collagen, type IV, alpha 2 |
chr11_-_9482010 | 0.46 |
ENST00000596206.1 |
AC132192.1 |
LOC644656 protein; Uncharacterized protein |
chr2_-_113993020 | 0.46 |
ENST00000465084.1 |
PAX8 |
paired box 8 |
chr19_-_15543368 | 0.46 |
ENST00000599686.3 |
WIZ |
widely interspaced zinc finger motifs |
chr14_-_95236551 | 0.45 |
ENST00000238558.3 |
GSC |
goosecoid homeobox |
chr1_-_21059029 | 0.45 |
ENST00000444387.2 ENST00000375031.1 ENST00000518294.1 |
SH2D5 |
SH2 domain containing 5 |
chr16_-_30569584 | 0.45 |
ENST00000252797.2 ENST00000568114.1 |
ZNF764 AC002310.13 |
zinc finger protein 764 Uncharacterized protein |
chr16_-_838329 | 0.45 |
ENST00000563560.1 ENST00000569601.1 ENST00000565809.1 ENST00000565377.1 ENST00000007264.2 ENST00000567114.1 |
RPUSD1 |
RNA pseudouridylate synthase domain containing 1 |
chr9_-_131534188 | 0.45 |
ENST00000414921.1 |
ZER1 |
zyg-11 related, cell cycle regulator |
chr2_+_206950095 | 0.44 |
ENST00000435627.1 |
AC007383.3 |
AC007383.3 |
chr2_+_7005959 | 0.44 |
ENST00000442639.1 |
RSAD2 |
radical S-adenosyl methionine domain containing 2 |
chr14_-_101053739 | 0.44 |
ENST00000554140.1 |
BEGAIN |
brain-enriched guanylate kinase-associated |
chr16_+_770975 | 0.44 |
ENST00000569529.1 ENST00000564000.1 ENST00000219535.3 |
FAM173A |
family with sequence similarity 173, member A |
chr13_+_98795505 | 0.44 |
ENST00000319562.6 |
FARP1 |
FERM, RhoGEF (ARHGEF) and pleckstrin domain protein 1 (chondrocyte-derived) |
chr5_+_149865838 | 0.44 |
ENST00000519157.1 |
NDST1 |
N-deacetylase/N-sulfotransferase (heparan glucosaminyl) 1 |
chr3_+_52279902 | 0.44 |
ENST00000457454.1 |
PPM1M |
protein phosphatase, Mg2+/Mn2+ dependent, 1M |
chr3_+_160473343 | 0.44 |
ENST00000497343.1 |
PPM1L |
protein phosphatase, Mg2+/Mn2+ dependent, 1L |
chr10_-_126432619 | 0.44 |
ENST00000337318.3 |
FAM53B |
family with sequence similarity 53, member B |
chr16_+_619931 | 0.44 |
ENST00000321878.5 ENST00000439574.1 ENST00000026218.5 ENST00000470411.2 |
PIGQ |
phosphatidylinositol glycan anchor biosynthesis, class Q |
chr19_-_19774473 | 0.44 |
ENST00000357324.6 |
ATP13A1 |
ATPase type 13A1 |
chr14_+_59104741 | 0.43 |
ENST00000395153.3 ENST00000335867.4 |
DACT1 |
dishevelled-binding antagonist of beta-catenin 1 |
chr8_+_23386557 | 0.43 |
ENST00000523930.1 |
SLC25A37 |
solute carrier family 25 (mitochondrial iron transporter), member 37 |
chr1_-_21995794 | 0.43 |
ENST00000542643.2 ENST00000374765.4 ENST00000317967.7 |
RAP1GAP |
RAP1 GTPase activating protein |
chr8_+_145597713 | 0.42 |
ENST00000308860.6 ENST00000532190.1 |
ADCK5 |
aarF domain containing kinase 5 |
chr5_-_132166303 | 0.42 |
ENST00000440118.1 |
SHROOM1 |
shroom family member 1 |
chr11_-_777467 | 0.41 |
ENST00000397472.2 ENST00000524550.1 ENST00000319863.8 ENST00000526325.1 ENST00000442059.2 |
PDDC1 |
Parkinson disease 7 domain containing 1 |
chr5_-_175843569 | 0.41 |
ENST00000310418.4 ENST00000345807.2 |
CLTB |
clathrin, light chain B |
chr8_+_144349606 | 0.40 |
ENST00000521682.1 ENST00000340042.1 |
GLI4 |
GLI family zinc finger 4 |
chr19_+_2236509 | 0.40 |
ENST00000221494.5 |
SF3A2 |
splicing factor 3a, subunit 2, 66kDa |
chr13_-_44361025 | 0.40 |
ENST00000261488.6 |
ENOX1 |
ecto-NOX disulfide-thiol exchanger 1 |
chr4_+_1714548 | 0.40 |
ENST00000605571.1 |
RP11-572O17.1 |
RP11-572O17.1 |
chr5_+_6714718 | 0.40 |
ENST00000230859.6 ENST00000515721.1 |
PAPD7 |
PAP associated domain containing 7 |
chr1_-_8763278 | 0.39 |
ENST00000468247.1 |
RERE |
arginine-glutamic acid dipeptide (RE) repeats |
chr8_-_145013711 | 0.39 |
ENST00000345136.3 |
PLEC |
plectin |
chr5_-_172662303 | 0.39 |
ENST00000517440.1 ENST00000329198.4 |
NKX2-5 |
NK2 homeobox 5 |
chr5_-_175843524 | 0.39 |
ENST00000502877.1 |
CLTB |
clathrin, light chain B |
chr9_-_91793675 | 0.39 |
ENST00000375835.4 ENST00000375830.1 |
SHC3 |
SHC (Src homology 2 domain containing) transforming protein 3 |
chr14_+_105714827 | 0.38 |
ENST00000536364.1 ENST00000537513.2 |
BTBD6 |
BTB (POZ) domain containing 6 |
chr15_+_68871308 | 0.38 |
ENST00000261861.5 |
CORO2B |
coronin, actin binding protein, 2B |
chr1_+_2121228 | 0.38 |
ENST00000597060.1 |
AL590822.2 |
Uncharacterized protein; cDNA FLJ36608 fis, clone TRACH2015824 |
chr5_+_179233376 | 0.37 |
ENST00000376929.3 ENST00000514093.1 |
SQSTM1 |
sequestosome 1 |
chr8_+_98881268 | 0.37 |
ENST00000254898.5 ENST00000524308.1 ENST00000522025.2 |
MATN2 |
matrilin 2 |
chr22_-_19929321 | 0.37 |
ENST00000400519.1 ENST00000535882.1 ENST00000334363.9 ENST00000400521.1 |
TXNRD2 |
thioredoxin reductase 2 |
chr1_+_23037323 | 0.37 |
ENST00000544305.1 ENST00000374630.3 ENST00000400191.3 ENST00000374632.3 |
EPHB2 |
EPH receptor B2 |
chr17_-_79519403 | 0.37 |
ENST00000327787.8 ENST00000537152.1 |
C17orf70 |
chromosome 17 open reading frame 70 |
chr10_+_72238517 | 0.37 |
ENST00000263563.6 |
PALD1 |
phosphatase domain containing, paladin 1 |
chr12_+_122242597 | 0.36 |
ENST00000267197.5 |
SETD1B |
SET domain containing 1B |
chr5_+_14143728 | 0.36 |
ENST00000344204.4 ENST00000537187.1 |
TRIO |
trio Rho guanine nucleotide exchange factor |
chr11_+_64808368 | 0.36 |
ENST00000531072.1 ENST00000398846.1 |
SAC3D1 |
SAC3 domain containing 1 |
chr11_+_70244510 | 0.36 |
ENST00000346329.3 ENST00000301843.8 ENST00000376561.3 |
CTTN |
cortactin |
chrX_-_153363188 | 0.36 |
ENST00000303391.6 |
MECP2 |
methyl CpG binding protein 2 (Rett syndrome) |
chr7_+_73082152 | 0.35 |
ENST00000324941.4 ENST00000451519.1 |
VPS37D |
vacuolar protein sorting 37 homolog D (S. cerevisiae) |
chr7_+_2559399 | 0.35 |
ENST00000222725.5 ENST00000359574.3 |
LFNG |
LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
chr13_-_110959478 | 0.35 |
ENST00000543140.1 ENST00000375820.4 |
COL4A1 |
collagen, type IV, alpha 1 |
chr8_+_97657531 | 0.35 |
ENST00000519900.1 ENST00000517742.1 |
CPQ |
carboxypeptidase Q |
chr5_-_524445 | 0.35 |
ENST00000514375.1 ENST00000264938.3 |
SLC9A3 |
solute carrier family 9, subfamily A (NHE3, cation proton antiporter 3), member 3 |
chr2_-_132249955 | 0.35 |
ENST00000309451.6 |
MZT2A |
mitotic spindle organizing protein 2A |
chr18_-_74207146 | 0.34 |
ENST00000443185.2 |
ZNF516 |
zinc finger protein 516 |
chr5_-_146889619 | 0.34 |
ENST00000343218.5 |
DPYSL3 |
dihydropyrimidinase-like 3 |
chr14_-_105714771 | 0.34 |
ENST00000550375.1 |
BRF1 |
BRF1, RNA polymerase III transcription initiation factor 90 kDa subunit |
chr20_+_57464200 | 0.34 |
ENST00000604005.1 |
GNAS |
GNAS complex locus |
chr16_-_1661988 | 0.34 |
ENST00000426508.2 |
IFT140 |
intraflagellar transport 140 homolog (Chlamydomonas) |
chr16_+_58497567 | 0.34 |
ENST00000258187.5 |
NDRG4 |
NDRG family member 4 |
chr9_-_140353748 | 0.34 |
ENST00000371472.2 ENST00000371475.3 ENST00000265663.7 ENST00000437259.1 ENST00000392812.4 ENST00000371474.3 ENST00000371473.3 |
NSMF |
NMDA receptor synaptonuclear signaling and neuronal migration factor |
chr19_-_58874112 | 0.34 |
ENST00000311044.3 ENST00000595763.1 ENST00000425453.3 |
ZNF497 |
zinc finger protein 497 |
chr6_+_43543864 | 0.33 |
ENST00000372236.4 ENST00000535400.1 |
POLH |
polymerase (DNA directed), eta |
chr7_+_2599056 | 0.33 |
ENST00000325979.7 ENST00000423395.1 |
IQCE |
IQ motif containing E |
chr10_-_99531709 | 0.33 |
ENST00000266066.3 |
SFRP5 |
secreted frizzled-related protein 5 |
chr6_+_43543942 | 0.33 |
ENST00000372226.1 ENST00000443535.1 |
POLH |
polymerase (DNA directed), eta |
chr16_+_3096638 | 0.33 |
ENST00000336577.4 |
MMP25 |
matrix metallopeptidase 25 |
chr19_+_42580274 | 0.33 |
ENST00000359044.4 |
ZNF574 |
zinc finger protein 574 |
chr8_-_144699628 | 0.33 |
ENST00000529048.1 ENST00000529064.1 |
TSTA3 |
tissue specific transplantation antigen P35B |
chr8_-_42396185 | 0.33 |
ENST00000518717.1 |
SLC20A2 |
solute carrier family 20 (phosphate transporter), member 2 |
chr17_+_7211656 | 0.33 |
ENST00000416016.2 |
EIF5A |
eukaryotic translation initiation factor 5A |
chr17_+_79373540 | 0.32 |
ENST00000307745.7 |
RP11-1055B8.7 |
BAH and coiled-coil domain-containing protein 1 |
chr12_+_65672702 | 0.32 |
ENST00000538045.1 ENST00000535239.1 |
MSRB3 |
methionine sulfoxide reductase B3 |
chr17_+_74261413 | 0.32 |
ENST00000587913.1 |
UBALD2 |
UBA-like domain containing 2 |
chr5_+_12574944 | 0.32 |
ENST00000505877.1 ENST00000513051.1 ENST00000505196.1 |
CT49 |
cancer/testis antigen 49 (non-protein coding) |
chr17_+_1627834 | 0.32 |
ENST00000419248.1 ENST00000418841.1 |
WDR81 |
WD repeat domain 81 |
chr1_+_1551220 | 0.32 |
ENST00000378712.1 |
MIB2 |
mindbomb E3 ubiquitin protein ligase 2 |
chr11_-_17035943 | 0.32 |
ENST00000355661.3 ENST00000532079.1 ENST00000448080.2 ENST00000531066.1 |
PLEKHA7 |
pleckstrin homology domain containing, family A member 7 |
chr22_-_21213029 | 0.32 |
ENST00000572273.1 ENST00000255882.6 |
PI4KA |
phosphatidylinositol 4-kinase, catalytic, alpha |
chr11_-_130786333 | 0.32 |
ENST00000533214.1 ENST00000528555.1 ENST00000530356.1 ENST00000539184.1 |
SNX19 |
sorting nexin 19 |
chr22_+_45705987 | 0.32 |
ENST00000405673.1 |
FAM118A |
family with sequence similarity 118, member A |
chr12_-_125052010 | 0.32 |
ENST00000458234.1 |
NCOR2 |
nuclear receptor corepressor 2 |
chr5_+_6633534 | 0.32 |
ENST00000537411.1 ENST00000538824.1 |
SRD5A1 |
steroid-5-alpha-reductase, alpha polypeptide 1 (3-oxo-5 alpha-steroid delta 4-dehydrogenase alpha 1) |
chr11_+_63974135 | 0.32 |
ENST00000544997.1 ENST00000345728.5 ENST00000279227.5 |
FERMT3 |
fermitin family member 3 |
chr8_-_145018905 | 0.32 |
ENST00000398774.2 |
PLEC |
plectin |
chr16_-_87799505 | 0.31 |
ENST00000353170.5 ENST00000561825.1 ENST00000270583.5 ENST00000562261.1 ENST00000347925.5 |
KLHDC4 |
kelch domain containing 4 |
chr12_+_132379160 | 0.31 |
ENST00000321867.4 |
ULK1 |
unc-51 like autophagy activating kinase 1 |
chr6_+_1389989 | 0.31 |
ENST00000259806.1 |
FOXF2 |
forkhead box F2 |
chr16_+_838614 | 0.31 |
ENST00000262315.9 ENST00000455171.2 |
CHTF18 |
CTF18, chromosome transmission fidelity factor 18 homolog (S. cerevisiae) |
chr2_+_23608064 | 0.31 |
ENST00000486442.1 |
KLHL29 |
kelch-like family member 29 |
chr4_-_24914508 | 0.31 |
ENST00000504487.1 |
CCDC149 |
coiled-coil domain containing 149 |
chr4_+_8271471 | 0.31 |
ENST00000307358.2 ENST00000382512.3 |
HTRA3 |
HtrA serine peptidase 3 |
chr11_+_827553 | 0.31 |
ENST00000528542.2 ENST00000450448.1 |
EFCAB4A |
EF-hand calcium binding domain 4A |
chr16_+_577697 | 0.31 |
ENST00000562370.1 ENST00000568988.1 ENST00000219611.2 |
CAPN15 |
calpain 15 |
chr20_-_50384864 | 0.30 |
ENST00000311637.5 ENST00000402822.1 |
ATP9A |
ATPase, class II, type 9A |
chr17_+_36886478 | 0.30 |
ENST00000439660.2 |
CISD3 |
CDGSH iron sulfur domain 3 |
chr11_+_827248 | 0.30 |
ENST00000527089.1 ENST00000530183.1 |
EFCAB4A |
EF-hand calcium binding domain 4A |
chr5_+_149109825 | 0.30 |
ENST00000360453.4 ENST00000394320.3 ENST00000309241.5 |
PPARGC1B |
peroxisome proliferator-activated receptor gamma, coactivator 1 beta |
chr20_-_25038804 | 0.30 |
ENST00000323482.4 |
ACSS1 |
acyl-CoA synthetase short-chain family member 1 |
chr22_-_26986045 | 0.30 |
ENST00000442495.1 ENST00000440953.1 ENST00000450022.1 ENST00000338754.4 |
TPST2 |
tyrosylprotein sulfotransferase 2 |
chr8_+_99956662 | 0.30 |
ENST00000523368.1 ENST00000297565.4 ENST00000435298.2 |
OSR2 |
odd-skipped related transciption factor 2 |
chr13_+_98795434 | 0.30 |
ENST00000376586.2 |
FARP1 |
FERM, RhoGEF (ARHGEF) and pleckstrin domain protein 1 (chondrocyte-derived) |
chr5_-_179233314 | 0.30 |
ENST00000523108.1 |
MGAT4B |
mannosyl (alpha-1,3-)-glycoprotein beta-1,4-N-acetylglucosaminyltransferase, isozyme B |
chr22_-_20792089 | 0.30 |
ENST00000405555.3 ENST00000266214.5 |
SCARF2 |
scavenger receptor class F, member 2 |
chr12_-_62997214 | 0.30 |
ENST00000408887.2 |
C12orf61 |
chromosome 12 open reading frame 61 |
chr17_-_7218631 | 0.29 |
ENST00000577040.2 ENST00000389167.5 ENST00000391950.3 |
GPS2 |
G protein pathway suppressor 2 |
chr10_-_128077024 | 0.29 |
ENST00000368679.4 ENST00000368676.4 ENST00000448723.1 |
ADAM12 |
ADAM metallopeptidase domain 12 |
chr19_+_7584088 | 0.29 |
ENST00000394341.2 |
ZNF358 |
zinc finger protein 358 |
chr15_-_102285913 | 0.29 |
ENST00000558592.1 |
RP11-89K11.1 |
Uncharacterized protein |
chr8_-_145050890 | 0.29 |
ENST00000436759.2 |
PLEC |
plectin |
chr2_-_86564696 | 0.29 |
ENST00000437769.1 |
REEP1 |
receptor accessory protein 1 |
chr16_+_88519669 | 0.29 |
ENST00000319555.3 |
ZFPM1 |
zinc finger protein, FOG family member 1 |
chr3_+_49027308 | 0.29 |
ENST00000383729.4 ENST00000343546.4 |
P4HTM |
prolyl 4-hydroxylase, transmembrane (endoplasmic reticulum) |
chr12_+_93965609 | 0.29 |
ENST00000549887.1 ENST00000551556.1 |
SOCS2 |
suppressor of cytokine signaling 2 |
chr16_+_1756162 | 0.29 |
ENST00000250894.4 ENST00000356010.5 |
MAPK8IP3 |
mitogen-activated protein kinase 8 interacting protein 3 |
chr16_+_29802036 | 0.29 |
ENST00000561482.1 ENST00000160827.4 ENST00000569636.2 ENST00000400750.2 |
KIF22 |
kinesin family member 22 |
chr1_+_228674762 | 0.29 |
ENST00000305943.7 |
RNF187 |
ring finger protein 187 |
chr14_+_70078303 | 0.29 |
ENST00000342745.4 |
KIAA0247 |
KIAA0247 |
chr11_+_65082289 | 0.29 |
ENST00000279249.2 |
CDC42EP2 |
CDC42 effector protein (Rho GTPase binding) 2 |
chr17_-_26220366 | 0.29 |
ENST00000460380.2 ENST00000508862.1 ENST00000379102.3 ENST00000582441.1 |
LYRM9 RP1-66C13.4 |
LYR motif containing 9 Uncharacterized protein |
chr17_+_36584662 | 0.29 |
ENST00000431231.2 ENST00000437668.3 |
ARHGAP23 |
Rho GTPase activating protein 23 |
chr17_+_27920486 | 0.28 |
ENST00000394859.3 |
ANKRD13B |
ankyrin repeat domain 13B |
chr12_+_132628963 | 0.28 |
ENST00000330579.1 |
NOC4L |
nucleolar complex associated 4 homolog (S. cerevisiae) |
chr1_-_1243392 | 0.28 |
ENST00000354700.5 |
ACAP3 |
ArfGAP with coiled-coil, ankyrin repeat and PH domains 3 |
chr16_+_88493879 | 0.28 |
ENST00000565624.1 ENST00000437464.1 |
ZNF469 |
zinc finger protein 469 |
chr17_-_31404 | 0.28 |
ENST00000343572.7 |
DOC2B |
double C2-like domains, beta |
chr2_+_217498105 | 0.28 |
ENST00000233809.4 |
IGFBP2 |
insulin-like growth factor binding protein 2, 36kDa |
chr5_+_131705597 | 0.28 |
ENST00000435065.2 |
SLC22A5 |
solute carrier family 22 (organic cation/carnitine transporter), member 5 |
chr22_+_21311367 | 0.28 |
ENST00000444039.1 |
XXbac-B135H6.15 |
XXbac-B135H6.15 |
chr17_+_74261277 | 0.28 |
ENST00000327490.6 |
UBALD2 |
UBA-like domain containing 2 |
chrX_-_39956656 | 0.28 |
ENST00000397354.3 ENST00000378444.4 |
BCOR |
BCL6 corepressor |
chr2_-_69870835 | 0.28 |
ENST00000409085.4 ENST00000406297.3 |
AAK1 |
AP2 associated kinase 1 |
chr8_-_145688231 | 0.28 |
ENST00000530374.1 |
CYHR1 |
cysteine/histidine-rich 1 |
chr1_-_11120057 | 0.28 |
ENST00000376957.2 |
SRM |
spermidine synthase |
chr17_+_74864476 | 0.28 |
ENST00000301618.4 ENST00000569840.2 |
MGAT5B |
mannosyl (alpha-1,6-)-glycoprotein beta-1,6-N-acetyl-glucosaminyltransferase, isozyme B |
chr9_+_131799213 | 0.28 |
ENST00000358369.4 ENST00000406926.2 ENST00000277475.5 ENST00000450073.1 |
FAM73B |
family with sequence similarity 73, member B |
chr8_+_99956759 | 0.28 |
ENST00000522510.1 ENST00000457907.2 |
OSR2 |
odd-skipped related transciption factor 2 |
chr13_-_111358504 | 0.28 |
ENST00000257347.4 |
CARS2 |
cysteinyl-tRNA synthetase 2, mitochondrial (putative) |
chr4_+_2965307 | 0.28 |
ENST00000398051.4 ENST00000503518.2 ENST00000398052.4 ENST00000345167.6 ENST00000504933.1 ENST00000442472.2 |
GRK4 |
G protein-coupled receptor kinase 4 |
chr16_-_79633799 | 0.28 |
ENST00000569649.1 |
MAF |
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog |
chr5_-_172662230 | 0.28 |
ENST00000424406.2 |
NKX2-5 |
NK2 homeobox 5 |
chr19_+_33685490 | 0.28 |
ENST00000253193.7 |
LRP3 |
low density lipoprotein receptor-related protein 3 |
chr15_+_76352178 | 0.28 |
ENST00000388942.3 |
C15orf27 |
chromosome 15 open reading frame 27 |
chr16_-_87525651 | 0.28 |
ENST00000268616.4 |
ZCCHC14 |
zinc finger, CCHC domain containing 14 |
chr7_-_5463175 | 0.27 |
ENST00000399537.4 ENST00000430969.1 |
TNRC18 |
trinucleotide repeat containing 18 |
chr11_+_46354455 | 0.27 |
ENST00000343674.6 |
DGKZ |
diacylglycerol kinase, zeta |
chr9_-_138799070 | 0.27 |
ENST00000389532.4 ENST00000409386.3 |
CAMSAP1 |
calmodulin regulated spectrin-associated protein 1 |
chr17_-_80170689 | 0.27 |
ENST00000389641.4 ENST00000392347.1 ENST00000392343.3 |
CCDC57 |
coiled-coil domain containing 57 |
chr8_-_145582118 | 0.27 |
ENST00000455319.2 ENST00000331890.5 |
FBXL6 |
F-box and leucine-rich repeat protein 6 |
chr19_-_15090488 | 0.27 |
ENST00000594383.1 ENST00000598504.1 ENST00000597262.1 |
SLC1A6 |
solute carrier family 1 (high affinity aspartate/glutamate transporter), member 6 |
chrX_-_2418596 | 0.27 |
ENST00000381218.3 |
ZBED1 |
zinc finger, BED-type containing 1 |
chr16_-_3030407 | 0.27 |
ENST00000431515.2 ENST00000574385.1 ENST00000576268.1 ENST00000574730.1 ENST00000575632.1 ENST00000573944.1 ENST00000262300.8 |
PKMYT1 |
protein kinase, membrane associated tyrosine/threonine 1 |
chr15_-_90645679 | 0.27 |
ENST00000539790.1 ENST00000559482.1 ENST00000330062.3 |
IDH2 |
isocitrate dehydrogenase 2 (NADP+), mitochondrial |
chr16_-_11350036 | 0.27 |
ENST00000332029.2 |
SOCS1 |
suppressor of cytokine signaling 1 |
chr2_+_238395803 | 0.27 |
ENST00000264605.3 |
MLPH |
melanophilin |
chr5_+_172068232 | 0.27 |
ENST00000520919.1 ENST00000522853.1 ENST00000369800.5 |
NEURL1B |
neuralized E3 ubiquitin protein ligase 1B |
chr19_+_9945962 | 0.27 |
ENST00000587625.1 ENST00000247970.4 ENST00000588695.1 |
PIN1 |
peptidylprolyl cis/trans isomerase, NIMA-interacting 1 |
chr1_-_1243252 | 0.27 |
ENST00000353662.3 |
ACAP3 |
ArfGAP with coiled-coil, ankyrin repeat and PH domains 3 |
chr2_+_97481974 | 0.27 |
ENST00000377060.3 ENST00000305510.3 |
CNNM3 |
cyclin M3 |
chr15_-_32162833 | 0.27 |
ENST00000560598.1 |
OTUD7A |
OTU domain containing 7A |
chr1_+_18807424 | 0.27 |
ENST00000400664.1 |
KLHDC7A |
kelch domain containing 7A |
chr22_+_50609150 | 0.26 |
ENST00000159647.5 ENST00000395842.2 |
PANX2 |
pannexin 2 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.9 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
0.3 | 1.0 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
0.3 | 0.8 | GO:0060929 | Purkinje myocyte differentiation(GO:0003168) cardiac pacemaker cell fate commitment(GO:0060927) atrioventricular node cell fate commitment(GO:0060929) |
0.2 | 0.6 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
0.2 | 0.5 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
0.2 | 0.5 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) |
0.2 | 0.5 | GO:0060730 | regulation of intestinal epithelial structure maintenance(GO:0060730) |
0.2 | 0.6 | GO:0042247 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
0.1 | 0.9 | GO:2001151 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
0.1 | 0.4 | GO:0009405 | pathogenesis(GO:0009405) |
0.1 | 0.6 | GO:0032811 | regulation of epinephrine secretion(GO:0014060) negative regulation of epinephrine secretion(GO:0032811) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) epinephrine secretion(GO:0048242) |
0.1 | 0.4 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
0.1 | 0.4 | GO:0015743 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
0.1 | 0.4 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.1 | 0.5 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
0.1 | 0.4 | GO:0051389 | inactivation of MAPKK activity(GO:0051389) |
0.1 | 0.4 | GO:2000612 | thyroid-stimulating hormone secretion(GO:0070460) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
0.1 | 0.5 | GO:0002384 | hepatic immune response(GO:0002384) |
0.1 | 0.4 | GO:0003192 | mitral valve formation(GO:0003192) |
0.1 | 0.5 | GO:1990502 | dense core granule maturation(GO:1990502) |
0.1 | 0.4 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
0.1 | 0.3 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
0.1 | 0.5 | GO:0007070 | negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
0.1 | 0.4 | GO:0061364 | apoptotic process involved in luteolysis(GO:0061364) |
0.1 | 0.6 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
0.1 | 0.3 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
0.1 | 0.3 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
0.1 | 0.3 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
0.1 | 0.3 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
0.1 | 0.3 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
0.1 | 0.3 | GO:0006097 | glyoxylate cycle(GO:0006097) |
0.1 | 0.5 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.1 | 0.3 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.1 | 0.3 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.6 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.1 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.2 | GO:1903450 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
0.1 | 0.2 | GO:0035281 | pre-miRNA export from nucleus(GO:0035281) |
0.1 | 0.2 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
0.1 | 0.7 | GO:0006477 | protein sulfation(GO:0006477) |
0.1 | 0.3 | GO:1905123 | regulation of glucosylceramidase activity(GO:1905123) |
0.1 | 0.2 | GO:0060129 | thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
0.1 | 0.2 | GO:0060086 | circadian temperature homeostasis(GO:0060086) |
0.1 | 0.5 | GO:0072338 | allantoin metabolic process(GO:0000255) creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 0.7 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.2 | GO:1990575 | mitochondrial L-ornithine transmembrane transport(GO:1990575) |
0.1 | 0.2 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.1 | 0.4 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.1 | 0.5 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.1 | 0.3 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
0.1 | 0.1 | GO:2000466 | negative regulation of glycogen (starch) synthase activity(GO:2000466) |
0.1 | 0.5 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.1 | 0.2 | GO:1902256 | apoptotic process involved in outflow tract morphogenesis(GO:0003275) glomerular endothelium development(GO:0072011) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) |
0.1 | 0.5 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.1 | 0.4 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.1 | 0.4 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
0.1 | 0.1 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
0.1 | 0.6 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
0.1 | 0.3 | GO:1904139 | mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) positive regulation of microglial cell migration(GO:1904141) |
0.1 | 0.5 | GO:0048549 | endosome localization(GO:0032439) positive regulation of pinocytosis(GO:0048549) |
0.1 | 0.2 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.1 | 0.5 | GO:0060992 | response to fungicide(GO:0060992) |
0.1 | 0.2 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
0.1 | 0.5 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.1 | 0.2 | GO:0060615 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) branch elongation involved in salivary gland morphogenesis(GO:0060667) mesenchymal cell differentiation involved in lung development(GO:0060915) |
0.1 | 0.2 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.1 | 0.2 | GO:1904897 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
0.1 | 0.2 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.2 | GO:0034164 | negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
0.1 | 0.2 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
0.1 | 0.3 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
0.1 | 0.1 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
0.1 | 0.2 | GO:0035623 | renal glucose absorption(GO:0035623) |
0.1 | 0.1 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.1 | 0.3 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.1 | 0.5 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
0.1 | 0.4 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.2 | GO:1902948 | regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
0.1 | 0.1 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
0.1 | 0.3 | GO:0032625 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
0.1 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 0.5 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.3 | GO:0019541 | acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
0.0 | 0.1 | GO:0045360 | interleukin-1 biosynthetic process(GO:0042222) regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
0.0 | 0.2 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.0 | 0.2 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.3 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
0.0 | 0.1 | GO:0052509 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
0.0 | 0.1 | GO:0021722 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
0.0 | 0.1 | GO:0071315 | cellular response to morphine(GO:0071315) cellular response to isoquinoline alkaloid(GO:0071317) |
0.0 | 0.1 | GO:2001037 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
0.0 | 0.4 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.3 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
0.0 | 0.3 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.0 | 0.5 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.1 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
0.0 | 0.2 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
0.0 | 0.2 | GO:0036116 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
0.0 | 0.2 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.0 | 0.1 | GO:0051866 | general adaptation syndrome(GO:0051866) |
0.0 | 0.1 | GO:0090222 | centrosome-templated microtubule nucleation(GO:0090222) |
0.0 | 0.5 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.0 | 0.3 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.3 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
0.0 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.2 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.2 | GO:0035549 | positive regulation of interferon-beta secretion(GO:0035549) |
0.0 | 0.6 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.3 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.2 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.0 | 0.2 | GO:0032218 | riboflavin transport(GO:0032218) |
0.0 | 0.3 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.1 | GO:1900276 | regulation of proteinase activated receptor activity(GO:1900276) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
0.0 | 0.1 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
0.0 | 0.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.0 | 0.1 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
0.0 | 0.2 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.0 | 0.0 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
0.0 | 0.2 | GO:0009608 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
0.0 | 0.4 | GO:0070141 | response to UV-A(GO:0070141) |
0.0 | 0.2 | GO:1904808 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
0.0 | 0.2 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.3 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.0 | 0.0 | GO:0090102 | cochlea development(GO:0090102) |
0.0 | 0.2 | GO:1903803 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
0.0 | 0.1 | GO:0007493 | endodermal cell fate determination(GO:0007493) |
0.0 | 0.2 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.0 | 0.2 | GO:0072287 | metanephric distal tubule morphogenesis(GO:0072287) |
0.0 | 0.3 | GO:0098712 | L-aspartate transport(GO:0070778) L-aspartate transmembrane transport(GO:0089712) L-glutamate import across plasma membrane(GO:0098712) |
0.0 | 0.3 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.0 | 0.1 | GO:1901859 | negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
0.0 | 0.2 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
0.0 | 0.6 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) aspartate catabolic process(GO:0006533) |
0.0 | 0.3 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
0.0 | 0.3 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.0 | 0.1 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.1 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
0.0 | 1.3 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.4 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
0.0 | 0.1 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
0.0 | 0.3 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.4 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
0.0 | 0.2 | GO:0030323 | respiratory tube development(GO:0030323) |
0.0 | 0.1 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
0.0 | 0.1 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
0.0 | 0.2 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.2 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.3 | GO:0097049 | motor neuron apoptotic process(GO:0097049) |
0.0 | 0.9 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
0.0 | 0.1 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.2 | GO:0019075 | virus maturation(GO:0019075) |
0.0 | 0.1 | GO:1900369 | transcription, RNA-templated(GO:0001172) negative regulation of RNA interference(GO:1900369) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.2 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
0.0 | 0.3 | GO:0060180 | female mating behavior(GO:0060180) |
0.0 | 0.4 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.4 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.0 | 0.4 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.1 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
0.0 | 0.2 | GO:0032970 | regulation of actin filament-based process(GO:0032970) |
0.0 | 0.4 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.3 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.0 | 0.2 | GO:0060214 | endocardium formation(GO:0060214) |
0.0 | 0.2 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.1 | GO:1903921 | protein processing in phagocytic vesicle(GO:1900756) regulation of protein processing in phagocytic vesicle(GO:1903921) positive regulation of protein processing in phagocytic vesicle(GO:1903923) |
0.0 | 0.1 | GO:0098976 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.0 | 0.4 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.1 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
0.0 | 0.6 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.0 | 0.1 | GO:0006424 | glutamyl-tRNA aminoacylation(GO:0006424) |
0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.1 | GO:1904617 | regulation of actin filament binding(GO:1904529) negative regulation of actin filament binding(GO:1904530) regulation of actin binding(GO:1904616) negative regulation of actin binding(GO:1904617) |
0.0 | 0.2 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.2 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.3 | GO:0009304 | transcription initiation from RNA polymerase III promoter(GO:0006384) tRNA transcription(GO:0009304) |
0.0 | 0.3 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
0.0 | 0.2 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
0.0 | 0.1 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.0 | 0.6 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.0 | 0.1 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.0 | 0.2 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
0.0 | 0.2 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
0.0 | 0.6 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) otolith development(GO:0048840) |
0.0 | 0.1 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.1 | GO:0051029 | rRNA transport(GO:0051029) |
0.0 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.0 | 0.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.4 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.0 | 0.3 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.3 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.0 | 0.2 | GO:0030047 | actin modification(GO:0030047) |
0.0 | 0.6 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.2 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.0 | 0.1 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) |
0.0 | 0.2 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.0 | 0.1 | GO:0046833 | positive regulation of RNA export from nucleus(GO:0046833) |
0.0 | 0.6 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.1 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
0.0 | 0.2 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.3 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.0 | 0.3 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.0 | 0.4 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.1 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.3 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.1 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
0.0 | 0.1 | GO:0018277 | protein deamination(GO:0018277) |
0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.0 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.0 | 0.2 | GO:1901376 | mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
0.0 | 0.2 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.0 | 0.1 | GO:0071529 | cementum mineralization(GO:0071529) |
0.0 | 0.3 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.0 | 0.2 | GO:1903758 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
0.0 | 0.4 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.0 | 0.1 | GO:0039019 | pronephric nephron development(GO:0039019) |
0.0 | 0.4 | GO:0044146 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
0.0 | 0.2 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.0 | 0.4 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.1 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) |
0.0 | 0.2 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.6 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.0 | 0.1 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.0 | 0.1 | GO:2000690 | regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
0.0 | 0.1 | GO:1905026 | positive regulation of actin filament-based movement(GO:1903116) positive regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903762) positive regulation of ventricular cardiac muscle cell action potential(GO:1903947) positive regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905026) positive regulation of membrane repolarization during cardiac muscle cell action potential(GO:1905033) |
0.0 | 0.1 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
0.0 | 0.1 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
0.0 | 0.3 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 0.1 | GO:0033489 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
0.0 | 0.0 | GO:0030225 | macrophage differentiation(GO:0030225) |
0.0 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.4 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
0.0 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 0.1 | GO:0050771 | negative regulation of axonogenesis(GO:0050771) |
0.0 | 0.2 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.0 | 0.3 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.3 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.0 | 0.1 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
0.0 | 0.1 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.0 | 0.2 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.1 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.0 | 0.1 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.0 | 0.1 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
0.0 | 0.1 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
0.0 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.0 | 0.1 | GO:1903860 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.0 | 0.1 | GO:1901907 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
0.0 | 0.1 | GO:0055014 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
0.0 | 0.1 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.0 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.0 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.0 | GO:0097187 | dentinogenesis(GO:0097187) |
0.0 | 0.1 | GO:0008218 | bioluminescence(GO:0008218) |
0.0 | 0.1 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.1 | GO:0097065 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
0.0 | 0.2 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.0 | GO:0010265 | SCF complex assembly(GO:0010265) |
0.0 | 0.1 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
0.0 | 0.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.0 | 0.1 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
0.0 | 0.0 | GO:0072021 | ascending thin limb development(GO:0072021) metanephric ascending thin limb development(GO:0072218) |
0.0 | 0.4 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.2 | GO:0097267 | omega-hydroxylase P450 pathway(GO:0097267) |
0.0 | 0.2 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.0 | 0.6 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
0.0 | 0.4 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.3 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.0 | 0.1 | GO:0009439 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
0.0 | 0.0 | GO:0003245 | growth involved in heart morphogenesis(GO:0003241) cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
0.0 | 0.4 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
0.0 | 0.1 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.0 | 0.2 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.0 | 0.0 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
0.0 | 0.1 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
0.0 | 0.1 | GO:0030100 | regulation of endocytosis(GO:0030100) |
0.0 | 0.2 | GO:0034214 | protein hexamerization(GO:0034214) |
0.0 | 0.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.2 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.2 | GO:0016574 | histone ubiquitination(GO:0016574) |
0.0 | 0.4 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.0 | 0.2 | GO:0001766 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.0 | 0.3 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.0 | GO:0070344 | fat cell proliferation(GO:0070341) regulation of fat cell proliferation(GO:0070344) negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.2 | GO:0034201 | response to oleic acid(GO:0034201) |
0.0 | 0.4 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.0 | 0.5 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.5 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
0.0 | 0.4 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
0.0 | 0.2 | GO:0000272 | polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.0 | 0.0 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
0.0 | 1.5 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.0 | 0.2 | GO:1990440 | regulation of interleukin-6 biosynthetic process(GO:0045408) positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.0 | 0.3 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.1 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
0.0 | 0.5 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
0.0 | 0.1 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
0.0 | 0.2 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.1 | GO:1904106 | protein localization to microvillus(GO:1904106) |
0.0 | 0.0 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
0.0 | 0.2 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.0 | 0.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.2 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.1 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
0.0 | 0.2 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.0 | 0.1 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
0.0 | 0.3 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.4 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.5 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.1 | GO:0070236 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.1 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) growth plate cartilage chondrocyte development(GO:0003431) |
0.0 | 0.1 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine salvage(GO:0071267) |
0.0 | 0.5 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.2 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.0 | 0.0 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.0 | 1.3 | GO:0030032 | lamellipodium assembly(GO:0030032) |
0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.2 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.0 | 0.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.1 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.7 | GO:0051726 | regulation of cell cycle(GO:0051726) |
0.0 | 0.1 | GO:0019216 | regulation of lipid metabolic process(GO:0019216) |
0.0 | 0.4 | GO:0030166 | proteoglycan biosynthetic process(GO:0030166) |
0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.2 | GO:0002433 | immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.0 | 0.3 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.0 | 0.2 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.0 | 0.1 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
0.0 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.0 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
0.0 | 0.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.1 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.0 | 0.2 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.2 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.1 | GO:0016240 | autophagosome docking(GO:0016240) |
0.0 | 0.2 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.1 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.1 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.2 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.0 | 1.1 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.1 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
0.0 | 0.1 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.0 | 0.2 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
0.0 | 0.2 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.0 | 0.1 | GO:1903874 | ferrous iron transport(GO:0015684) ferrous iron transmembrane transport(GO:1903874) |
0.0 | 0.1 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.0 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.0 | 0.2 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.0 | 0.1 | GO:0030201 | heparan sulfate proteoglycan metabolic process(GO:0030201) |
0.0 | 0.2 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.0 | 0.1 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.0 | 0.2 | GO:0014832 | urinary bladder smooth muscle contraction(GO:0014832) urinary tract smooth muscle contraction(GO:0014848) |
0.0 | 0.2 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.2 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.7 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
0.1 | 0.6 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
0.1 | 0.6 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.1 | 0.3 | GO:0030689 | Noc complex(GO:0030689) |
0.1 | 0.5 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.1 | 0.4 | GO:0044753 | amphisome(GO:0044753) |
0.1 | 0.5 | GO:1903349 | omegasome membrane(GO:1903349) |
0.1 | 0.8 | GO:0005587 | collagen type IV trimer(GO:0005587) |
0.1 | 0.3 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
0.1 | 0.2 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
0.1 | 0.3 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.1 | 0.2 | GO:0036117 | hyaluranon cable(GO:0036117) |
0.1 | 0.7 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.1 | 0.3 | GO:0045160 | myosin I complex(GO:0045160) |
0.1 | 0.3 | GO:0019034 | viral replication complex(GO:0019034) |
0.1 | 0.2 | GO:0098855 | HCN channel complex(GO:0098855) |
0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.2 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
0.1 | 0.2 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 0.3 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.1 | 0.5 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.3 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.0 | 0.0 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0039714 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
0.0 | 0.5 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.0 | 0.5 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.6 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.1 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) |
0.0 | 0.2 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 1.1 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.2 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.4 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.1 | GO:0031251 | PAN complex(GO:0031251) |
0.0 | 0.4 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.2 | GO:0002133 | polycystin complex(GO:0002133) |
0.0 | 0.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.2 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.5 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.0 | 0.2 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.9 | GO:0071565 | nBAF complex(GO:0071565) |
0.0 | 0.1 | GO:0035101 | FACT complex(GO:0035101) |
0.0 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.3 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.1 | GO:1990032 | parallel fiber(GO:1990032) |
0.0 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.7 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.5 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.2 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.1 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.1 | GO:0097444 | spine apparatus(GO:0097444) |
0.0 | 0.6 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.0 | 0.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.1 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.0 | 0.2 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.7 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.3 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
0.0 | 0.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.3 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.9 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.1 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
0.0 | 0.0 | GO:0008623 | CHRAC(GO:0008623) |
0.0 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.4 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.4 | GO:0098552 | side of membrane(GO:0098552) |
0.0 | 0.5 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.4 | GO:0043194 | axon initial segment(GO:0043194) |
0.0 | 0.1 | GO:0000799 | nuclear condensin complex(GO:0000799) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.2 | GO:0031301 | integral component of organelle membrane(GO:0031301) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.4 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.2 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.1 | GO:0035976 | AP1 complex(GO:0035976) |
0.0 | 0.2 | GO:0045180 | basal cortex(GO:0045180) |
0.0 | 2.0 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.4 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.2 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.1 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
0.0 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.3 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.1 | GO:0032449 | CBM complex(GO:0032449) |
0.0 | 0.3 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 1.7 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.2 | GO:0005858 | axonemal dynein complex(GO:0005858) |
0.0 | 0.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.2 | GO:0097342 | ripoptosome(GO:0097342) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.6 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.2 | 0.6 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.2 | 0.8 | GO:0010736 | serum response element binding(GO:0010736) |
0.2 | 0.5 | GO:0042356 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
0.2 | 0.5 | GO:0070361 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
0.2 | 0.5 | GO:0070119 | ciliary neurotrophic factor binding(GO:0070119) |
0.2 | 0.5 | GO:0070984 | SET domain binding(GO:0070984) |
0.2 | 0.6 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.1 | 0.4 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
0.1 | 0.6 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
0.1 | 0.4 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.1 | 0.3 | GO:0033149 | FFAT motif binding(GO:0033149) |
0.1 | 0.5 | GO:0033765 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.1 | 0.3 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
0.1 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.9 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 0.2 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
0.1 | 0.5 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
0.1 | 0.9 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.7 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
0.1 | 0.3 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
0.1 | 0.3 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
0.1 | 0.8 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.3 | GO:0004766 | spermidine synthase activity(GO:0004766) |
0.1 | 0.3 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
0.1 | 0.3 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
0.1 | 0.4 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
0.1 | 0.4 | GO:0004803 | transposase activity(GO:0004803) |
0.1 | 0.3 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.1 | 0.3 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
0.1 | 0.3 | GO:0052831 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
0.1 | 0.3 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
0.1 | 0.8 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.2 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
0.1 | 0.4 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
0.1 | 0.4 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 0.5 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 0.2 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
0.1 | 0.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.6 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.1 | 0.3 | GO:0042806 | fucose binding(GO:0042806) |
0.1 | 0.3 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.8 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.2 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.4 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
0.1 | 0.2 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.1 | 0.2 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 0.4 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.1 | 0.2 | GO:0016418 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) S-acetyltransferase activity(GO:0016418) |
0.1 | 0.8 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.3 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.3 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.2 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
0.1 | 0.2 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
0.1 | 0.6 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.0 | 0.1 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
0.0 | 0.3 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.0 | 0.6 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.3 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.6 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.0 | 0.3 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.2 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.0 | 0.3 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.2 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
0.0 | 0.3 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 0.3 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.3 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
0.0 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.0 | 0.2 | GO:0004122 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
0.0 | 0.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.0 | 0.2 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.0 | 0.3 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
0.0 | 0.3 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.0 | 0.1 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.0 | 0.3 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
0.0 | 0.4 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.4 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.3 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.4 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.1 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
0.0 | 0.1 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
0.0 | 0.5 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.0 | 0.1 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
0.0 | 0.1 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.2 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
0.0 | 0.1 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
0.0 | 0.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.2 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.0 | 0.2 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.0 | 0.1 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
0.0 | 0.6 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.1 | GO:0030375 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.3 | GO:0016705 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen(GO:0016705) |
0.0 | 0.9 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.1 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
0.0 | 0.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.0 | 1.3 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.2 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.9 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.4 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.1 | GO:0004818 | glutamate-tRNA ligase activity(GO:0004818) |
0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.0 | 0.3 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.3 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.0 | 0.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.0 | 0.3 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.5 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.1 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.3 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.1 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0008124 | phenylalanine 4-monooxygenase activity(GO:0004505) 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
0.0 | 0.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
0.0 | 0.1 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.0 | 0.6 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.0 | 0.4 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.1 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
0.0 | 0.4 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.0 | 0.1 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
0.0 | 0.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.0 | 0.1 | GO:0047273 | galactosylgalactosylglucosylceramide beta-D-acetylgalactosaminyltransferase activity(GO:0047273) |
0.0 | 0.3 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.1 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.0 | 0.1 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.2 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.1 | GO:0035501 | MH1 domain binding(GO:0035501) |
0.0 | 0.2 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.4 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.1 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
0.0 | 0.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.1 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 0.1 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
0.0 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.3 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.0 | 0.6 | GO:0017136 | NAD-dependent histone deacetylase activity(GO:0017136) |
0.0 | 0.1 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.2 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.0 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
0.0 | 0.1 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.0 | 0.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.2 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.3 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.0 | 0.1 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.9 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.2 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.4 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.0 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.1 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.0 | 0.2 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.3 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.0 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.5 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.0 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.1 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.5 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.1 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.0 | 0.4 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.1 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.4 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.2 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.0 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
0.0 | 0.1 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
0.0 | 1.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.0 | 0.9 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 1.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.8 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.5 | ST STAT3 PATHWAY | STAT3 Pathway |
0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 1.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.5 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 1.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.3 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.4 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.0 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.2 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 1.0 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.3 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.4 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.6 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.1 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
0.0 | 0.8 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.0 | 0.5 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 1.6 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.6 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.8 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.6 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 1.3 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 1.0 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.5 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.2 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.7 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.5 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 1.1 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.4 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.2 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 1.1 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.3 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 0.6 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 0.3 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.0 | 0.7 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.4 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.5 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.5 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.8 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.7 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.4 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.3 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.3 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.4 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.5 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.4 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.1 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
0.0 | 0.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 1.0 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.1 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
0.0 | 0.4 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.1 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.0 | 0.2 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.5 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 1.1 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |