A549 cells infected with SARS-CoV-2 Analysis Results (GEO series: GSE147507)
Gene Symbol | Gene ID | Gene Info |
---|---|---|
SP4
|
ENSG00000105866.9 | SP4 |
PML
|
ENSG00000140464.15 | PML |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
SP4 | hg19_v2_chr7_+_21467642_21467671 | -0.36 | 4.8e-01 | Click! |
PML | hg19_v2_chr15_+_74287035_74287117 | -0.36 | 4.8e-01 | Click! |
Promoter | Score | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr2_+_74212073 | 8.80 |
ENST00000441217.1 |
AC073046.25 |
AC073046.25 |
chr18_+_20715416 | 5.09 |
ENST00000580153.1 |
CABLES1 |
Cdk5 and Abl enzyme substrate 1 |
chr8_-_141645645 | 4.46 |
ENST00000519980.1 ENST00000220592.5 |
AGO2 |
argonaute RISC catalytic component 2 |
chr16_+_84002234 | 4.11 |
ENST00000305202.4 |
NECAB2 |
N-terminal EF-hand calcium binding protein 2 |
chr12_+_104235229 | 3.64 |
ENST00000551650.1 |
RP11-650K20.3 |
Uncharacterized protein |
chr8_+_61592073 | 3.57 |
ENST00000526846.1 |
CHD7 |
chromodomain helicase DNA binding protein 7 |
chr2_-_240322685 | 3.54 |
ENST00000544989.1 |
HDAC4 |
histone deacetylase 4 |
chr8_-_42752418 | 3.38 |
ENST00000524954.1 |
RNF170 |
ring finger protein 170 |
chr7_+_97910962 | 3.37 |
ENST00000539286.1 |
BRI3 |
brain protein I3 |
chr8_-_1922789 | 3.30 |
ENST00000521498.1 |
RP11-439C15.4 |
RP11-439C15.4 |
chr7_+_26438187 | 3.24 |
ENST00000439120.1 ENST00000430548.1 ENST00000421862.1 ENST00000449537.1 ENST00000420774.1 ENST00000418758.2 |
AC004540.5 |
AC004540.5 |
chr10_+_134210672 | 2.84 |
ENST00000305233.5 ENST00000368609.4 |
PWWP2B |
PWWP domain containing 2B |
chr9_-_140513231 | 2.83 |
ENST00000371417.3 |
C9orf37 |
chromosome 9 open reading frame 37 |
chr4_+_159690218 | 2.81 |
ENST00000264433.6 |
FNIP2 |
folliculin interacting protein 2 |
chr22_+_50609150 | 2.76 |
ENST00000159647.5 ENST00000395842.2 |
PANX2 |
pannexin 2 |
chr19_-_1568057 | 2.75 |
ENST00000402693.4 ENST00000388824.6 |
MEX3D |
mex-3 RNA binding family member D |
chr2_+_105471969 | 2.74 |
ENST00000361360.2 |
POU3F3 |
POU class 3 homeobox 3 |
chr22_-_42322795 | 2.58 |
ENST00000291232.3 |
TNFRSF13C |
tumor necrosis factor receptor superfamily, member 13C |
chr22_+_46972975 | 2.52 |
ENST00000431155.1 |
GRAMD4 |
GRAM domain containing 4 |
chr17_-_67323385 | 2.52 |
ENST00000588665.1 |
ABCA5 |
ATP-binding cassette, sub-family A (ABC1), member 5 |
chr11_-_17410629 | 2.36 |
ENST00000526912.1 |
KCNJ11 |
potassium inwardly-rectifying channel, subfamily J, member 11 |
chr3_-_126076264 | 2.33 |
ENST00000296233.3 |
KLF15 |
Kruppel-like factor 15 |
chr12_-_125052010 | 2.33 |
ENST00000458234.1 |
NCOR2 |
nuclear receptor corepressor 2 |
chr20_+_62369623 | 2.31 |
ENST00000467211.1 |
RP4-583P15.14 |
RP4-583P15.14 |
chr7_-_74867509 | 2.18 |
ENST00000426327.3 |
GATSL2 |
GATS protein-like 2 |
chr2_-_220252603 | 2.16 |
ENST00000322176.7 ENST00000273075.4 |
DNPEP |
aspartyl aminopeptidase |
chr22_-_43583079 | 2.13 |
ENST00000216129.6 |
TTLL12 |
tubulin tyrosine ligase-like family, member 12 |
chr4_+_2794750 | 2.10 |
ENST00000452765.2 ENST00000389838.2 |
SH3BP2 |
SH3-domain binding protein 2 |
chr20_-_19738569 | 2.07 |
ENST00000598007.1 |
AL121761.2 |
Uncharacterized protein |
chr1_+_2477831 | 2.04 |
ENST00000606645.1 |
RP3-395M20.12 |
RP3-395M20.12 |
chr17_+_42836521 | 2.02 |
ENST00000535346.1 |
ADAM11 |
ADAM metallopeptidase domain 11 |
chr14_+_105886150 | 1.99 |
ENST00000331320.7 ENST00000406191.1 |
MTA1 |
metastasis associated 1 |
chr5_+_2752216 | 1.99 |
ENST00000457752.2 |
C5orf38 |
chromosome 5 open reading frame 38 |
chr16_+_765092 | 1.99 |
ENST00000568223.2 |
METRN |
meteorin, glial cell differentiation regulator |
chr4_+_53525573 | 1.98 |
ENST00000503051.1 |
USP46-AS1 |
USP46 antisense RNA 1 |
chr17_+_42836329 | 1.97 |
ENST00000200557.6 |
ADAM11 |
ADAM metallopeptidase domain 11 |
chr19_+_54926621 | 1.95 |
ENST00000376530.3 ENST00000445095.1 ENST00000391739.3 ENST00000376531.3 |
TTYH1 |
tweety family member 1 |
chr16_-_1464688 | 1.94 |
ENST00000389221.4 ENST00000508903.2 ENST00000397462.1 ENST00000301712.5 |
UNKL |
unkempt family zinc finger-like |
chr4_+_183065793 | 1.93 |
ENST00000512480.1 |
TENM3 |
teneurin transmembrane protein 3 |
chr15_+_76352178 | 1.92 |
ENST00000388942.3 |
C15orf27 |
chromosome 15 open reading frame 27 |
chr19_+_56111680 | 1.91 |
ENST00000301073.3 |
ZNF524 |
zinc finger protein 524 |
chr16_-_11350036 | 1.90 |
ENST00000332029.2 |
SOCS1 |
suppressor of cytokine signaling 1 |
chr7_-_131241361 | 1.88 |
ENST00000378555.3 ENST00000322985.9 ENST00000541194.1 ENST00000537928.1 |
PODXL |
podocalyxin-like |
chr14_+_105781048 | 1.87 |
ENST00000458164.2 ENST00000447393.1 |
PACS2 |
phosphofurin acidic cluster sorting protein 2 |
chr19_+_35759824 | 1.87 |
ENST00000343550.5 |
USF2 |
upstream transcription factor 2, c-fos interacting |
chr1_-_21948906 | 1.87 |
ENST00000374761.2 ENST00000599760.1 |
RAP1GAP |
RAP1 GTPase activating protein |
chr16_+_88519669 | 1.87 |
ENST00000319555.3 |
ZFPM1 |
zinc finger protein, FOG family member 1 |
chr11_-_3186551 | 1.86 |
ENST00000533234.1 |
OSBPL5 |
oxysterol binding protein-like 5 |
chr9_-_140335789 | 1.85 |
ENST00000344119.2 ENST00000371506.2 |
ENTPD8 |
ectonucleoside triphosphate diphosphohydrolase 8 |
chr9_+_129089088 | 1.85 |
ENST00000361171.3 ENST00000545391.1 |
MVB12B |
multivesicular body subunit 12B |
chr2_-_220252530 | 1.83 |
ENST00000521459.1 |
DNPEP |
aspartyl aminopeptidase |
chr21_+_44394742 | 1.83 |
ENST00000432907.2 |
PKNOX1 |
PBX/knotted 1 homeobox 1 |
chr18_-_74534232 | 1.82 |
ENST00000585258.1 |
RP11-162A12.2 |
Uncharacterized protein |
chr19_+_35759968 | 1.82 |
ENST00000222305.3 ENST00000595068.1 ENST00000379134.3 ENST00000594064.1 ENST00000598058.1 |
USF2 |
upstream transcription factor 2, c-fos interacting |
chr17_-_79885576 | 1.80 |
ENST00000574686.1 ENST00000357736.4 |
MAFG |
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog G |
chr4_+_183370146 | 1.80 |
ENST00000510504.1 |
TENM3 |
teneurin transmembrane protein 3 |
chr5_+_14143728 | 1.78 |
ENST00000344204.4 ENST00000537187.1 |
TRIO |
trio Rho guanine nucleotide exchange factor |
chr17_+_79008940 | 1.77 |
ENST00000392411.3 ENST00000575989.1 ENST00000321280.7 ENST00000428708.2 ENST00000575712.1 ENST00000575245.1 ENST00000435091.3 ENST00000321300.6 |
BAIAP2 |
BAI1-associated protein 2 |
chr5_+_92228 | 1.76 |
ENST00000512035.1 |
CTD-2231H16.1 |
CTD-2231H16.1 |
chr14_-_105714771 | 1.73 |
ENST00000550375.1 |
BRF1 |
BRF1, RNA polymerase III transcription initiation factor 90 kDa subunit |
chr14_-_21566731 | 1.73 |
ENST00000360947.3 |
ZNF219 |
zinc finger protein 219 |
chr19_+_51815102 | 1.73 |
ENST00000270642.8 |
IGLON5 |
IgLON family member 5 |
chr17_+_16945820 | 1.73 |
ENST00000577514.1 |
MPRIP |
myosin phosphatase Rho interacting protein |
chr1_-_21978312 | 1.72 |
ENST00000359708.4 ENST00000290101.4 |
RAP1GAP |
RAP1 GTPase activating protein |
chr16_+_29817399 | 1.72 |
ENST00000545521.1 |
MAZ |
MYC-associated zinc finger protein (purine-binding transcription factor) |
chr14_+_105781102 | 1.71 |
ENST00000547217.1 |
PACS2 |
phosphofurin acidic cluster sorting protein 2 |
chr1_+_7844312 | 1.71 |
ENST00000377541.1 |
PER3 |
period circadian clock 3 |
chr16_-_89007491 | 1.71 |
ENST00000327483.5 ENST00000564416.1 |
CBFA2T3 |
core-binding factor, runt domain, alpha subunit 2; translocated to, 3 |
chr1_-_1243392 | 1.70 |
ENST00000354700.5 |
ACAP3 |
ArfGAP with coiled-coil, ankyrin repeat and PH domains 3 |
chr6_-_43478239 | 1.70 |
ENST00000372441.1 |
LRRC73 |
leucine rich repeat containing 73 |
chr19_+_3359561 | 1.70 |
ENST00000589123.1 ENST00000346156.5 ENST00000395111.3 ENST00000586919.1 |
NFIC |
nuclear factor I/C (CCAAT-binding transcription factor) |
chr13_-_110438914 | 1.69 |
ENST00000375856.3 |
IRS2 |
insulin receptor substrate 2 |
chr16_-_776846 | 1.69 |
ENST00000423653.1 |
CCDC78 |
coiled-coil domain containing 78 |
chr2_+_181845532 | 1.65 |
ENST00000602475.1 |
UBE2E3 |
ubiquitin-conjugating enzyme E2E 3 |
chr1_-_1243252 | 1.65 |
ENST00000353662.3 |
ACAP3 |
ArfGAP with coiled-coil, ankyrin repeat and PH domains 3 |
chr5_-_14871866 | 1.65 |
ENST00000284268.6 |
ANKH |
ANKH inorganic pyrophosphate transport regulator |
chr14_-_104313824 | 1.65 |
ENST00000553739.1 ENST00000202556.9 |
PPP1R13B |
protein phosphatase 1, regulatory subunit 13B |
chr9_-_134615326 | 1.64 |
ENST00000438647.1 |
RAPGEF1 |
Rap guanine nucleotide exchange factor (GEF) 1 |
chr17_+_64298944 | 1.63 |
ENST00000413366.3 |
PRKCA |
protein kinase C, alpha |
chr9_+_134269439 | 1.62 |
ENST00000405995.1 |
PRRC2B |
proline-rich coiled-coil 2B |
chr9_-_138799070 | 1.62 |
ENST00000389532.4 ENST00000409386.3 |
CAMSAP1 |
calmodulin regulated spectrin-associated protein 1 |
chr16_+_2570340 | 1.61 |
ENST00000568263.1 ENST00000293971.6 ENST00000302956.4 ENST00000413459.3 ENST00000566706.1 ENST00000569879.1 |
AMDHD2 |
amidohydrolase domain containing 2 |
chr20_+_57466629 | 1.60 |
ENST00000371081.1 ENST00000338783.6 |
GNAS |
GNAS complex locus |
chr19_-_1592652 | 1.59 |
ENST00000156825.1 ENST00000434436.3 |
MBD3 |
methyl-CpG binding domain protein 3 |
chr9_+_139780942 | 1.58 |
ENST00000247668.2 ENST00000359662.3 |
TRAF2 |
TNF receptor-associated factor 2 |
chr14_-_100625932 | 1.58 |
ENST00000553834.1 |
DEGS2 |
delta(4)-desaturase, sphingolipid 2 |
chr1_+_200638629 | 1.57 |
ENST00000568695.1 |
RP11-92G12.3 |
RP11-92G12.3 |
chr20_-_61847455 | 1.57 |
ENST00000370334.4 |
YTHDF1 |
YTH domain family, member 1 |
chr19_+_33685490 | 1.57 |
ENST00000253193.7 |
LRP3 |
low density lipoprotein receptor-related protein 3 |
chr10_-_15413035 | 1.57 |
ENST00000378116.4 ENST00000455654.1 |
FAM171A1 |
family with sequence similarity 171, member A1 |
chr4_+_187065978 | 1.55 |
ENST00000227065.4 ENST00000502970.1 ENST00000514153.1 |
FAM149A |
family with sequence similarity 149, member A |
chr2_+_241508039 | 1.55 |
ENST00000270357.4 |
RNPEPL1 |
arginyl aminopeptidase (aminopeptidase B)-like 1 |
chr19_-_14201776 | 1.53 |
ENST00000269724.5 |
SAMD1 |
sterile alpha motif domain containing 1 |
chr19_-_47734448 | 1.53 |
ENST00000439096.2 |
BBC3 |
BCL2 binding component 3 |
chr20_+_1875378 | 1.53 |
ENST00000356025.3 |
SIRPA |
signal-regulatory protein alpha |
chr1_+_33722080 | 1.53 |
ENST00000483388.1 ENST00000539719.1 |
ZNF362 |
zinc finger protein 362 |
chr16_+_58498177 | 1.52 |
ENST00000567454.1 |
NDRG4 |
NDRG family member 4 |
chr12_+_123319973 | 1.51 |
ENST00000253083.4 |
HIP1R |
huntingtin interacting protein 1 related |
chr4_+_141677577 | 1.51 |
ENST00000609937.1 |
RP11-102N12.3 |
RP11-102N12.3 |
chr17_-_79829190 | 1.50 |
ENST00000581876.1 ENST00000584461.1 ENST00000583868.1 ENST00000400721.4 ENST00000269321.7 |
ARHGDIA |
Rho GDP dissociation inhibitor (GDI) alpha |
chr9_+_139377947 | 1.50 |
ENST00000354376.1 |
C9orf163 |
chromosome 9 open reading frame 163 |
chr17_+_7788104 | 1.49 |
ENST00000380358.4 |
CHD3 |
chromodomain helicase DNA binding protein 3 |
chr11_-_777467 | 1.49 |
ENST00000397472.2 ENST00000524550.1 ENST00000319863.8 ENST00000526325.1 ENST00000442059.2 |
PDDC1 |
Parkinson disease 7 domain containing 1 |
chr22_-_19279201 | 1.49 |
ENST00000353891.5 ENST00000263200.10 ENST00000427926.1 ENST00000449918.1 |
CLTCL1 |
clathrin, heavy chain-like 1 |
chr8_-_80680078 | 1.48 |
ENST00000337919.5 ENST00000354724.3 |
HEY1 |
hes-related family bHLH transcription factor with YRPW motif 1 |
chr2_+_239067597 | 1.47 |
ENST00000546354.1 |
FAM132B |
family with sequence similarity 132, member B |
chr3_+_14989076 | 1.47 |
ENST00000413118.1 ENST00000425241.1 |
NR2C2 |
nuclear receptor subfamily 2, group C, member 2 |
chr11_+_118307179 | 1.47 |
ENST00000534358.1 ENST00000531904.2 ENST00000389506.5 ENST00000354520.4 |
KMT2A |
lysine (K)-specific methyltransferase 2A |
chrX_-_2418596 | 1.46 |
ENST00000381218.3 |
ZBED1 |
zinc finger, BED-type containing 1 |
chr13_-_114567034 | 1.46 |
ENST00000327773.6 ENST00000357389.3 |
GAS6 |
growth arrest-specific 6 |
chr2_+_26395939 | 1.45 |
ENST00000401533.2 |
GAREML |
GRB2 associated, regulator of MAPK1-like |
chr10_-_735553 | 1.45 |
ENST00000280886.6 ENST00000423550.1 |
DIP2C |
DIP2 disco-interacting protein 2 homolog C (Drosophila) |
chr9_-_130742792 | 1.45 |
ENST00000373095.1 |
FAM102A |
family with sequence similarity 102, member A |
chr2_+_220306238 | 1.44 |
ENST00000435853.1 |
SPEG |
SPEG complex locus |
chr8_+_97657531 | 1.44 |
ENST00000519900.1 ENST00000517742.1 |
CPQ |
carboxypeptidase Q |
chr17_+_78234625 | 1.44 |
ENST00000508628.2 ENST00000582970.1 ENST00000456466.1 ENST00000319921.4 |
RNF213 |
ring finger protein 213 |
chr11_+_65122216 | 1.43 |
ENST00000309880.5 |
TIGD3 |
tigger transposable element derived 3 |
chr14_-_75079294 | 1.43 |
ENST00000556359.1 |
LTBP2 |
latent transforming growth factor beta binding protein 2 |
chr14_+_105714910 | 1.43 |
ENST00000392554.3 ENST00000463376.2 ENST00000327471.3 |
BTBD6 |
BTB (POZ) domain containing 6 |
chr12_+_133067157 | 1.43 |
ENST00000261673.6 |
FBRSL1 |
fibrosin-like 1 |
chr22_-_20255212 | 1.43 |
ENST00000416372.1 |
RTN4R |
reticulon 4 receptor |
chr11_+_64001962 | 1.43 |
ENST00000309422.2 |
VEGFB |
vascular endothelial growth factor B |
chr5_+_149865838 | 1.42 |
ENST00000519157.1 |
NDST1 |
N-deacetylase/N-sulfotransferase (heparan glucosaminyl) 1 |
chr22_-_22090064 | 1.42 |
ENST00000339468.3 |
YPEL1 |
yippee-like 1 (Drosophila) |
chr3_+_71803201 | 1.41 |
ENST00000304411.2 |
GPR27 |
G protein-coupled receptor 27 |
chr9_-_140484917 | 1.41 |
ENST00000298585.2 |
ZMYND19 |
zinc finger, MYND-type containing 19 |
chr11_+_637246 | 1.41 |
ENST00000176183.5 |
DRD4 |
dopamine receptor D4 |
chr2_+_206950095 | 1.40 |
ENST00000435627.1 |
AC007383.3 |
AC007383.3 |
chr2_-_135476552 | 1.40 |
ENST00000281924.6 |
TMEM163 |
transmembrane protein 163 |
chr11_-_64949305 | 1.40 |
ENST00000526623.1 |
AP003068.23 |
Uncharacterized protein |
chr22_-_22221900 | 1.40 |
ENST00000215832.6 ENST00000398822.3 |
MAPK1 |
mitogen-activated protein kinase 1 |
chr5_-_693500 | 1.39 |
ENST00000360578.5 |
TPPP |
tubulin polymerization promoting protein |
chr10_+_12391685 | 1.39 |
ENST00000378845.1 |
CAMK1D |
calcium/calmodulin-dependent protein kinase ID |
chr2_-_240322643 | 1.39 |
ENST00000345617.3 |
HDAC4 |
histone deacetylase 4 |
chr14_+_59104741 | 1.38 |
ENST00000395153.3 ENST00000335867.4 |
DACT1 |
dishevelled-binding antagonist of beta-catenin 1 |
chr9_+_139971921 | 1.38 |
ENST00000409858.3 |
UAP1L1 |
UDP-N-acteylglucosamine pyrophosphorylase 1-like 1 |
chr4_-_170947485 | 1.37 |
ENST00000504999.1 |
MFAP3L |
microfibrillar-associated protein 3-like |
chr22_-_20792089 | 1.37 |
ENST00000405555.3 ENST00000266214.5 |
SCARF2 |
scavenger receptor class F, member 2 |
chr8_+_145515263 | 1.36 |
ENST00000528838.1 |
HSF1 |
heat shock transcription factor 1 |
chr11_+_64002292 | 1.35 |
ENST00000426086.2 |
VEGFB |
vascular endothelial growth factor B |
chr12_-_118498911 | 1.35 |
ENST00000544233.1 |
WSB2 |
WD repeat and SOCS box containing 2 |
chr14_-_101053739 | 1.35 |
ENST00000554140.1 |
BEGAIN |
brain-enriched guanylate kinase-associated |
chr3_-_183543301 | 1.35 |
ENST00000318631.3 ENST00000431348.1 |
MAP6D1 |
MAP6 domain containing 1 |
chr22_+_46546406 | 1.35 |
ENST00000440343.1 ENST00000415785.1 |
PPARA |
peroxisome proliferator-activated receptor alpha |
chr20_+_33814457 | 1.35 |
ENST00000246186.6 |
MMP24 |
matrix metallopeptidase 24 (membrane-inserted) |
chr14_+_100705322 | 1.34 |
ENST00000262238.4 |
YY1 |
YY1 transcription factor |
chr12_-_122241812 | 1.34 |
ENST00000538335.1 |
AC084018.1 |
AC084018.1 |
chrX_-_152245978 | 1.34 |
ENST00000538162.2 |
PNMA6D |
paraneoplastic Ma antigen family member 6D (pseudogene) |
chr14_-_93582148 | 1.34 |
ENST00000267615.6 ENST00000553452.1 |
ITPK1 |
inositol-tetrakisphosphate 1-kinase |
chr4_+_1873100 | 1.33 |
ENST00000508803.1 |
WHSC1 |
Wolf-Hirschhorn syndrome candidate 1 |
chr3_+_158450143 | 1.33 |
ENST00000491804.1 |
MFSD1 |
major facilitator superfamily domain containing 1 |
chr5_-_179233934 | 1.33 |
ENST00000292591.7 |
MGAT4B |
mannosyl (alpha-1,3-)-glycoprotein beta-1,4-N-acetylglucosaminyltransferase, isozyme B |
chr15_+_96873921 | 1.33 |
ENST00000394166.3 |
NR2F2 |
nuclear receptor subfamily 2, group F, member 2 |
chr20_-_47444420 | 1.32 |
ENST00000371941.3 ENST00000396220.1 |
PREX1 |
phosphatidylinositol-3,4,5-trisphosphate-dependent Rac exchange factor 1 |
chr5_+_42423872 | 1.32 |
ENST00000230882.4 ENST00000357703.3 |
GHR |
growth hormone receptor |
chr17_-_79828850 | 1.32 |
ENST00000541078.2 |
ARHGDIA |
Rho GDP dissociation inhibitor (GDI) alpha |
chr15_-_30261066 | 1.32 |
ENST00000558447.1 |
TJP1 |
tight junction protein 1 |
chr17_-_78450398 | 1.31 |
ENST00000306773.4 |
NPTX1 |
neuronal pentraxin I |
chr4_+_3076388 | 1.31 |
ENST00000355072.5 |
HTT |
huntingtin |
chr1_-_2323140 | 1.31 |
ENST00000378531.3 ENST00000378529.3 |
MORN1 |
MORN repeat containing 1 |
chr1_-_51796226 | 1.31 |
ENST00000451380.1 ENST00000371747.3 ENST00000439482.1 |
TTC39A |
tetratricopeptide repeat domain 39A |
chr7_-_152133059 | 1.31 |
ENST00000262189.6 ENST00000355193.2 |
KMT2C |
lysine (K)-specific methyltransferase 2C |
chr22_+_38302285 | 1.31 |
ENST00000215957.6 |
MICALL1 |
MICAL-like 1 |
chr8_+_1711918 | 1.31 |
ENST00000331222.4 |
CLN8 |
ceroid-lipofuscinosis, neuronal 8 (epilepsy, progressive with mental retardation) |
chr1_+_17866290 | 1.30 |
ENST00000361221.3 ENST00000452522.1 ENST00000434513.1 |
ARHGEF10L |
Rho guanine nucleotide exchange factor (GEF) 10-like |
chr11_+_48002279 | 1.30 |
ENST00000534219.1 ENST00000527952.1 |
PTPRJ |
protein tyrosine phosphatase, receptor type, J |
chr22_+_38142235 | 1.30 |
ENST00000407319.2 ENST00000403663.2 ENST00000428075.1 |
TRIOBP |
TRIO and F-actin binding protein |
chr13_-_33002151 | 1.30 |
ENST00000495479.1 ENST00000343281.4 ENST00000464470.1 ENST00000380139.4 ENST00000380133.2 |
N4BP2L1 |
NEDD4 binding protein 2-like 1 |
chr11_-_65686496 | 1.30 |
ENST00000449692.3 |
C11orf68 |
chromosome 11 open reading frame 68 |
chr12_+_111856144 | 1.30 |
ENST00000550925.2 |
SH2B3 |
SH2B adaptor protein 3 |
chr10_-_79686284 | 1.30 |
ENST00000372391.2 ENST00000372388.2 |
DLG5 |
discs, large homolog 5 (Drosophila) |
chr7_+_4721885 | 1.30 |
ENST00000328914.4 |
FOXK1 |
forkhead box K1 |
chr17_-_80009650 | 1.30 |
ENST00000310496.4 |
RFNG |
RFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
chr19_+_797392 | 1.30 |
ENST00000350092.4 ENST00000349038.4 ENST00000586481.1 ENST00000585535.1 |
PTBP1 |
polypyrimidine tract binding protein 1 |
chr13_+_100634004 | 1.29 |
ENST00000376335.3 |
ZIC2 |
Zic family member 2 |
chr12_-_120806960 | 1.28 |
ENST00000257552.2 |
MSI1 |
musashi RNA-binding protein 1 |
chr12_+_6419877 | 1.28 |
ENST00000536531.1 |
PLEKHG6 |
pleckstrin homology domain containing, family G (with RhoGef domain) member 6 |
chr19_+_35521616 | 1.28 |
ENST00000595652.1 |
SCN1B |
sodium channel, voltage-gated, type I, beta subunit |
chr14_+_105714827 | 1.28 |
ENST00000536364.1 ENST00000537513.2 |
BTBD6 |
BTB (POZ) domain containing 6 |
chr2_+_234263120 | 1.28 |
ENST00000264057.2 ENST00000427930.1 |
DGKD |
diacylglycerol kinase, delta 130kDa |
chr9_-_140115775 | 1.28 |
ENST00000391553.1 ENST00000392827.1 |
RNF208 |
ring finger protein 208 |
chr20_+_1875110 | 1.28 |
ENST00000400068.3 |
SIRPA |
signal-regulatory protein alpha |
chr17_-_882966 | 1.28 |
ENST00000336868.3 |
NXN |
nucleoredoxin |
chr17_-_31404 | 1.28 |
ENST00000343572.7 |
DOC2B |
double C2-like domains, beta |
chr7_-_50861129 | 1.28 |
ENST00000439044.1 ENST00000402497.1 ENST00000335866.3 |
GRB10 |
growth factor receptor-bound protein 10 |
chr1_+_39571026 | 1.27 |
ENST00000524432.1 |
MACF1 |
microtubule-actin crosslinking factor 1 |
chr3_+_53195517 | 1.27 |
ENST00000487897.1 |
PRKCD |
protein kinase C, delta |
chr9_+_116638562 | 1.27 |
ENST00000374126.5 ENST00000288466.7 |
ZNF618 |
zinc finger protein 618 |
chr16_-_1429674 | 1.27 |
ENST00000403703.1 ENST00000397464.1 ENST00000402641.2 |
UNKL |
unkempt family zinc finger-like |
chr11_+_777562 | 1.27 |
ENST00000530083.1 |
AP006621.5 |
Protein LOC100506518 |
chr14_+_105886275 | 1.27 |
ENST00000405646.1 |
MTA1 |
metastasis associated 1 |
chr16_-_2246436 | 1.27 |
ENST00000343516.6 |
CASKIN1 |
CASK interacting protein 1 |
chr2_+_241375069 | 1.27 |
ENST00000264039.2 |
GPC1 |
glypican 1 |
chr20_-_62601218 | 1.27 |
ENST00000369888.1 |
ZNF512B |
zinc finger protein 512B |
chr5_+_154135453 | 1.27 |
ENST00000517616.1 ENST00000518892.1 |
LARP1 |
La ribonucleoprotein domain family, member 1 |
chr4_+_1714548 | 1.26 |
ENST00000605571.1 |
RP11-572O17.1 |
RP11-572O17.1 |
chr15_-_90358048 | 1.26 |
ENST00000300060.6 ENST00000560137.1 |
ANPEP |
alanyl (membrane) aminopeptidase |
chr9_+_140500126 | 1.26 |
ENST00000431925.2 ENST00000419386.1 |
ARRDC1 |
arrestin domain containing 1 |
chr9_-_138987115 | 1.26 |
ENST00000277554.2 |
NACC2 |
NACC family member 2, BEN and BTB (POZ) domain containing |
chr16_-_87525651 | 1.26 |
ENST00000268616.4 |
ZCCHC14 |
zinc finger, CCHC domain containing 14 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 4.8 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
1.3 | 5.3 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
1.2 | 1.2 | GO:0070507 | regulation of microtubule cytoskeleton organization(GO:0070507) |
1.0 | 3.0 | GO:0003192 | mitral valve formation(GO:0003192) |
0.9 | 2.8 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
0.9 | 0.9 | GO:0006109 | regulation of carbohydrate metabolic process(GO:0006109) |
0.9 | 6.3 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
0.9 | 2.6 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.8 | 1.7 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.8 | 0.8 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
0.8 | 0.8 | GO:0051220 | cytoplasmic sequestering of protein(GO:0051220) |
0.8 | 3.9 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.8 | 2.3 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.7 | 3.0 | GO:0019448 | cysteine biosynthetic process from serine(GO:0006535) cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.7 | 2.1 | GO:0019858 | cytosine metabolic process(GO:0019858) |
0.7 | 1.4 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.7 | 2.1 | GO:0086021 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
0.7 | 2.1 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) |
0.7 | 4.1 | GO:0072021 | ascending thin limb development(GO:0072021) metanephric ascending thin limb development(GO:0072218) |
0.7 | 2.0 | GO:1990575 | mitochondrial L-ornithine transmembrane transport(GO:1990575) |
0.7 | 0.7 | GO:0009268 | response to pH(GO:0009268) |
0.6 | 1.9 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.6 | 4.4 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.6 | 3.1 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
0.6 | 1.9 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
0.6 | 4.4 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.6 | 4.2 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.6 | 2.4 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
0.6 | 0.6 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
0.6 | 1.7 | GO:0090263 | positive regulation of canonical Wnt signaling pathway(GO:0090263) |
0.6 | 2.2 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
0.5 | 1.6 | GO:1900736 | regulation of proteinase activated receptor activity(GO:1900276) regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
0.5 | 1.6 | GO:0015743 | thiosulfate transport(GO:0015709) oxaloacetate transport(GO:0015729) malate transport(GO:0015743) malate transmembrane transport(GO:0071423) oxaloacetate(2-) transmembrane transport(GO:1902356) |
0.5 | 4.8 | GO:0010748 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.5 | 2.1 | GO:1901350 | cell-cell signaling involved in cell-cell junction organization(GO:1901350) |
0.5 | 1.0 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
0.5 | 0.5 | GO:0016264 | gap junction assembly(GO:0016264) |
0.5 | 1.5 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.5 | 0.5 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
0.5 | 1.0 | GO:0097187 | dentinogenesis(GO:0097187) |
0.5 | 1.5 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
0.5 | 1.5 | GO:0097018 | renal albumin absorption(GO:0097018) regulation of renal albumin absorption(GO:2000532) |
0.5 | 1.5 | GO:0007493 | endodermal cell fate determination(GO:0007493) |
0.5 | 1.4 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
0.5 | 3.8 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
0.5 | 1.4 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.5 | 1.9 | GO:1905123 | regulation of glucosylceramidase activity(GO:1905123) |
0.5 | 1.9 | GO:0014011 | Schwann cell proliferation involved in axon regeneration(GO:0014011) negative regulation of Schwann cell migration(GO:1900148) regulation of Schwann cell proliferation involved in axon regeneration(GO:1905044) negative regulation of Schwann cell proliferation involved in axon regeneration(GO:1905045) |
0.5 | 0.9 | GO:0061110 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
0.5 | 0.5 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.5 | 1.4 | GO:0044727 | DNA demethylation of male pronucleus(GO:0044727) |
0.5 | 0.9 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.5 | 1.4 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
0.5 | 1.4 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
0.5 | 1.4 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
0.5 | 1.4 | GO:0021503 | neural fold bending(GO:0021503) |
0.5 | 2.7 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
0.5 | 1.8 | GO:0016333 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
0.5 | 3.6 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.4 | 0.9 | GO:0015817 | histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) |
0.4 | 3.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.4 | 1.3 | GO:0045912 | negative regulation of carbohydrate metabolic process(GO:0045912) |
0.4 | 1.3 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.4 | 2.7 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
0.4 | 2.6 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
0.4 | 1.8 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
0.4 | 2.2 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
0.4 | 1.7 | GO:0060823 | canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) |
0.4 | 5.5 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.4 | 0.4 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
0.4 | 0.8 | GO:1903826 | arginine transmembrane transport(GO:1903826) |
0.4 | 1.3 | GO:0034164 | negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
0.4 | 0.4 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
0.4 | 2.8 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
0.4 | 2.4 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.4 | 2.4 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
0.4 | 0.4 | GO:0060313 | negative regulation of blood vessel remodeling(GO:0060313) |
0.4 | 1.2 | GO:0045083 | negative regulation of interleukin-12 biosynthetic process(GO:0045083) |
0.4 | 1.6 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.4 | 0.8 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.4 | 1.6 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.4 | 0.8 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.4 | 1.2 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.4 | 0.8 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
0.4 | 1.6 | GO:0002384 | hepatic immune response(GO:0002384) |
0.4 | 0.8 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
0.4 | 0.4 | GO:0033058 | directional locomotion(GO:0033058) |
0.4 | 0.4 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.4 | 1.2 | GO:0060086 | circadian temperature homeostasis(GO:0060086) |
0.4 | 1.5 | GO:1905205 | positive regulation of connective tissue replacement(GO:1905205) |
0.4 | 0.4 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.4 | 1.2 | GO:0061042 | vascular wound healing(GO:0061042) |
0.4 | 1.9 | GO:1903412 | response to bile acid(GO:1903412) |
0.4 | 2.3 | GO:0046449 | creatinine metabolic process(GO:0046449) |
0.4 | 0.8 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.4 | 3.7 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.4 | 1.1 | GO:0033037 | polysaccharide localization(GO:0033037) |
0.4 | 1.1 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
0.4 | 1.4 | GO:0009956 | radial pattern formation(GO:0009956) |
0.4 | 1.8 | GO:0036115 | fatty-acyl-CoA catabolic process(GO:0036115) |
0.4 | 0.7 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.4 | 2.1 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
0.4 | 1.1 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.4 | 3.2 | GO:0070560 | protein secretion by platelet(GO:0070560) |
0.3 | 2.1 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
0.3 | 1.0 | GO:0060667 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) branch elongation involved in salivary gland morphogenesis(GO:0060667) mesenchymal cell differentiation involved in lung development(GO:0060915) |
0.3 | 2.8 | GO:0070649 | polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
0.3 | 1.0 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.3 | 0.7 | GO:0072194 | kidney smooth muscle tissue development(GO:0072194) |
0.3 | 1.0 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
0.3 | 2.4 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.3 | 2.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.3 | 0.7 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.3 | 1.0 | GO:0051389 | inactivation of MAPKK activity(GO:0051389) |
0.3 | 2.4 | GO:0019075 | virus maturation(GO:0019075) |
0.3 | 0.7 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.3 | 1.7 | GO:0070141 | response to UV-A(GO:0070141) |
0.3 | 4.1 | GO:0034465 | response to carbon monoxide(GO:0034465) |
0.3 | 1.0 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
0.3 | 1.0 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
0.3 | 1.0 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.3 | 2.0 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
0.3 | 1.4 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.3 | 0.7 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.3 | 0.7 | GO:0060489 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
0.3 | 1.0 | GO:0032878 | regulation of establishment or maintenance of cell polarity(GO:0032878) |
0.3 | 1.3 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.3 | 0.3 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.3 | 1.7 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.3 | 1.0 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
0.3 | 2.3 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
0.3 | 1.3 | GO:0072143 | mesangial cell development(GO:0072143) |
0.3 | 3.0 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
0.3 | 0.7 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.3 | 0.7 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.3 | 2.0 | GO:2001151 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
0.3 | 0.3 | GO:0035272 | exocrine system development(GO:0035272) |
0.3 | 1.9 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.3 | 2.2 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.3 | 2.6 | GO:1905232 | cellular response to L-glutamate(GO:1905232) |
0.3 | 1.0 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
0.3 | 0.6 | GO:1900275 | negative regulation of phospholipase C activity(GO:1900275) |
0.3 | 1.0 | GO:0050823 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
0.3 | 1.6 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.3 | 1.6 | GO:0060214 | endocardium formation(GO:0060214) |
0.3 | 0.3 | GO:0060535 | trachea cartilage morphogenesis(GO:0060535) |
0.3 | 0.9 | GO:1901207 | regulation of heart looping(GO:1901207) |
0.3 | 0.9 | GO:0097535 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
0.3 | 0.3 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.3 | 0.9 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
0.3 | 1.9 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.3 | 0.9 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
0.3 | 2.2 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.3 | 2.2 | GO:0051697 | protein delipidation(GO:0051697) |
0.3 | 0.9 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.3 | 3.4 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.3 | 0.3 | GO:0071450 | cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
0.3 | 0.9 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
0.3 | 3.6 | GO:1904628 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
0.3 | 2.4 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.3 | 0.6 | GO:0031056 | regulation of histone modification(GO:0031056) |
0.3 | 0.6 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.3 | 1.2 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
0.3 | 0.6 | GO:0042398 | cellular modified amino acid biosynthetic process(GO:0042398) |
0.3 | 0.9 | GO:0090222 | centrosome-templated microtubule nucleation(GO:0090222) |
0.3 | 0.6 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.3 | 1.2 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
0.3 | 1.2 | GO:0019417 | sulfur oxidation(GO:0019417) |
0.3 | 0.3 | GO:0014718 | positive regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014718) |
0.3 | 1.2 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.3 | 0.3 | GO:0061357 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
0.3 | 0.6 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
0.3 | 0.9 | GO:0097065 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
0.3 | 3.8 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.3 | 0.6 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.3 | 1.1 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
0.3 | 0.9 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.3 | 1.7 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.3 | 2.5 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.3 | 1.7 | GO:0003404 | optic vesicle morphogenesis(GO:0003404) |
0.3 | 0.3 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
0.3 | 0.8 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
0.3 | 0.8 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.3 | 1.1 | GO:0098582 | innate vocalization behavior(GO:0098582) |
0.3 | 0.3 | GO:0021557 | oculomotor nerve development(GO:0021557) |
0.3 | 0.8 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.3 | 0.8 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
0.3 | 0.8 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
0.3 | 0.3 | GO:0060022 | hard palate development(GO:0060022) |
0.3 | 0.3 | GO:1903311 | regulation of mRNA metabolic process(GO:1903311) |
0.3 | 1.7 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.3 | 0.3 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.3 | 0.6 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
0.3 | 0.8 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.3 | 0.8 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.3 | 0.8 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
0.3 | 2.2 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.3 | 0.3 | GO:0010950 | positive regulation of endopeptidase activity(GO:0010950) |
0.3 | 0.8 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
0.3 | 0.8 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
0.3 | 2.2 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
0.3 | 2.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.3 | 3.8 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.3 | 0.8 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.3 | 0.3 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.3 | 2.2 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.3 | 0.8 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
0.3 | 0.8 | GO:0072366 | regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
0.3 | 0.3 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.3 | 0.5 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
0.3 | 1.6 | GO:2001038 | regulation of cellular response to drug(GO:2001038) |
0.3 | 0.8 | GO:0051795 | positive regulation of catagen(GO:0051795) |
0.3 | 0.8 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
0.3 | 1.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.3 | 0.8 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
0.3 | 0.8 | GO:0008052 | sensory organ boundary specification(GO:0008052) formation of organ boundary(GO:0010160) taste bud development(GO:0061193) |
0.3 | 1.3 | GO:0046203 | spermidine catabolic process(GO:0046203) |
0.3 | 1.0 | GO:0061364 | apoptotic process involved in luteolysis(GO:0061364) |
0.3 | 1.3 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.3 | 1.3 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.3 | 1.0 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.3 | 1.0 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.3 | 0.8 | GO:1903452 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
0.3 | 0.8 | GO:0072034 | renal vesicle induction(GO:0072034) |
0.3 | 1.3 | GO:1901090 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
0.3 | 0.3 | GO:0021650 | vestibulocochlear nerve formation(GO:0021650) |
0.3 | 0.3 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
0.3 | 0.8 | GO:0033319 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
0.3 | 1.3 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.3 | 0.3 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) positive regulation of RNA export from nucleus(GO:0046833) |
0.3 | 1.3 | GO:0061015 | snRNA import into nucleus(GO:0061015) |
0.3 | 1.5 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.3 | 0.8 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
0.3 | 1.0 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
0.3 | 3.5 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
0.2 | 1.5 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.2 | 1.7 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.2 | 0.7 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.2 | 3.5 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
0.2 | 2.0 | GO:0015811 | L-cystine transport(GO:0015811) |
0.2 | 0.5 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.2 | 0.5 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.2 | 5.4 | GO:0097264 | self proteolysis(GO:0097264) |
0.2 | 1.2 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
0.2 | 1.7 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.2 | 1.5 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
0.2 | 0.5 | GO:0042177 | negative regulation of protein catabolic process(GO:0042177) |
0.2 | 0.7 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.2 | 0.7 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.2 | 1.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.2 | 1.0 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.2 | 2.2 | GO:0060992 | response to fungicide(GO:0060992) |
0.2 | 0.2 | GO:0090402 | senescence-associated heterochromatin focus assembly(GO:0035986) oncogene-induced cell senescence(GO:0090402) |
0.2 | 1.4 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.2 | 1.0 | GO:0007512 | adult heart development(GO:0007512) |
0.2 | 0.2 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.2 | 1.4 | GO:0001712 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
0.2 | 0.7 | GO:0060574 | intestinal epithelial cell maturation(GO:0060574) |
0.2 | 1.4 | GO:0015887 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
0.2 | 0.5 | GO:0051291 | protein heterooligomerization(GO:0051291) |
0.2 | 1.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.2 | 1.6 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.2 | 4.0 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.2 | 0.7 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
0.2 | 2.1 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.2 | 2.1 | GO:1903758 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
0.2 | 0.7 | GO:0061743 | motor learning(GO:0061743) |
0.2 | 2.1 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
0.2 | 0.9 | GO:1903949 | positive regulation of cardiac conduction(GO:1903781) positive regulation of atrial cardiac muscle cell action potential(GO:1903949) positive regulation of regulation of vascular smooth muscle cell membrane depolarization(GO:1904199) regulation of vascular smooth muscle cell membrane depolarization(GO:1990736) |
0.2 | 0.5 | GO:0031296 | B cell costimulation(GO:0031296) |
0.2 | 1.2 | GO:0060611 | mammary gland fat development(GO:0060611) mammary duct terminal end bud growth(GO:0060763) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) positive regulation of microglial cell migration(GO:1904141) |
0.2 | 0.7 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
0.2 | 0.7 | GO:0052510 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
0.2 | 0.2 | GO:0000187 | activation of MAPK activity(GO:0000187) |
0.2 | 1.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.2 | 1.4 | GO:0019470 | 4-hydroxyproline catabolic process(GO:0019470) |
0.2 | 0.5 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.2 | 0.7 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
0.2 | 0.7 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.2 | 0.2 | GO:2000137 | negative regulation of cell proliferation involved in heart morphogenesis(GO:2000137) |
0.2 | 0.2 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
0.2 | 0.9 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
0.2 | 1.1 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.2 | 1.6 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
0.2 | 1.8 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.2 | 0.7 | GO:0043095 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
0.2 | 0.4 | GO:0042176 | regulation of protein catabolic process(GO:0042176) |
0.2 | 2.7 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.2 | 2.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.2 | 0.9 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
0.2 | 2.6 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 1.8 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.2 | 0.4 | GO:0009608 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
0.2 | 0.9 | GO:0006218 | uridine catabolic process(GO:0006218) |
0.2 | 0.4 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.2 | 0.7 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.2 | 0.7 | GO:0036333 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
0.2 | 0.2 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
0.2 | 0.4 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.2 | 0.9 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.2 | 1.3 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
0.2 | 1.3 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.2 | 0.2 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.2 | 0.4 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.2 | 0.6 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.2 | 1.3 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.2 | 0.6 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.2 | 1.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.2 | 0.6 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
0.2 | 2.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.2 | 4.9 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
0.2 | 1.7 | GO:0044211 | CTP salvage(GO:0044211) |
0.2 | 1.7 | GO:2000795 | negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
0.2 | 0.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.2 | 4.6 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.2 | 0.4 | GO:0005997 | xylulose metabolic process(GO:0005997) |
0.2 | 0.6 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
0.2 | 4.2 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
0.2 | 0.8 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.2 | 1.2 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.2 | 1.0 | GO:2001273 | regulation of glucose import in response to insulin stimulus(GO:2001273) |
0.2 | 5.1 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.2 | 2.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.2 | 2.7 | GO:0034214 | protein hexamerization(GO:0034214) |
0.2 | 1.0 | GO:1900673 | olefin metabolic process(GO:1900673) |
0.2 | 1.0 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.2 | 2.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.2 | 2.6 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
0.2 | 0.6 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
0.2 | 1.8 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
0.2 | 0.8 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.2 | 1.0 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.2 | 0.4 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
0.2 | 0.2 | GO:0043628 | ncRNA 3'-end processing(GO:0043628) |
0.2 | 0.4 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.2 | 1.8 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
0.2 | 0.4 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.2 | 1.4 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.2 | 0.8 | GO:0003335 | corneocyte development(GO:0003335) |
0.2 | 0.6 | GO:1990637 | response to prolactin(GO:1990637) |
0.2 | 0.4 | GO:0002774 | Fc receptor mediated inhibitory signaling pathway(GO:0002774) |
0.2 | 3.6 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.2 | 0.6 | GO:0044029 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
0.2 | 0.8 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
0.2 | 0.6 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.2 | 0.6 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
0.2 | 0.6 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.2 | 2.8 | GO:0034199 | activation of protein kinase A activity(GO:0034199) |
0.2 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.2 | 1.4 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.2 | 0.2 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.2 | 0.8 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
0.2 | 2.5 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
0.2 | 0.6 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.2 | 1.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.2 | 1.2 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
0.2 | 0.6 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
0.2 | 0.6 | GO:0018194 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
0.2 | 2.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.2 | 1.9 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.2 | 0.6 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
0.2 | 0.6 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.2 | 1.1 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.2 | 0.4 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
0.2 | 0.8 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.2 | 2.6 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
0.2 | 0.6 | GO:1902725 | negative regulation of satellite cell differentiation(GO:1902725) |
0.2 | 0.6 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.2 | 0.6 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
0.2 | 0.6 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.2 | 0.6 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.2 | 3.9 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.2 | 1.1 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.2 | 1.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.2 | 0.4 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
0.2 | 0.4 | GO:0048627 | myoblast development(GO:0048627) |
0.2 | 2.2 | GO:0061734 | parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
0.2 | 4.6 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.2 | 0.6 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
0.2 | 1.3 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
0.2 | 0.5 | GO:0001172 | transcription, RNA-templated(GO:0001172) |
0.2 | 1.3 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.2 | 0.2 | GO:0018904 | ether metabolic process(GO:0018904) |
0.2 | 0.7 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.2 | 2.0 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.2 | 0.5 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.2 | 0.2 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
0.2 | 0.7 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.2 | 2.0 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.2 | 1.1 | GO:0070541 | response to platinum ion(GO:0070541) |
0.2 | 0.7 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
0.2 | 1.6 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
0.2 | 0.7 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.2 | 1.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.2 | 0.7 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.2 | 0.7 | GO:1904387 | cellular response to thyroxine stimulus(GO:0097069) cellular response to L-phenylalanine derivative(GO:1904387) |
0.2 | 0.7 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
0.2 | 0.7 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.2 | 0.5 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
0.2 | 0.5 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
0.2 | 0.4 | GO:0090427 | activation of meiosis(GO:0090427) |
0.2 | 0.2 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.2 | 1.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.2 | 0.2 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.2 | 0.7 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.2 | 0.4 | GO:0010842 | retina layer formation(GO:0010842) |
0.2 | 1.4 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.2 | 1.6 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.2 | 0.3 | GO:0090034 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
0.2 | 1.4 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
0.2 | 0.7 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
0.2 | 0.5 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
0.2 | 0.9 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.2 | 0.3 | GO:2001186 | negative regulation of CD8-positive, alpha-beta T cell activation(GO:2001186) |
0.2 | 0.3 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.2 | 0.5 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
0.2 | 0.3 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
0.2 | 0.5 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
0.2 | 0.3 | GO:0060796 | regulation of transcription involved in primary germ layer cell fate commitment(GO:0060796) |
0.2 | 5.9 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.2 | 0.2 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
0.2 | 1.5 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
0.2 | 1.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.2 | 1.7 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
0.2 | 1.3 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.2 | 0.5 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.2 | 1.3 | GO:0071233 | cellular response to leucine(GO:0071233) |
0.2 | 0.7 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.2 | 0.3 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.2 | 0.7 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
0.2 | 0.2 | GO:0032707 | negative regulation of interleukin-23 production(GO:0032707) |
0.2 | 0.3 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
0.2 | 0.3 | GO:0036166 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
0.2 | 0.2 | GO:0035617 | stress granule disassembly(GO:0035617) |
0.2 | 0.3 | GO:0008355 | olfactory learning(GO:0008355) |
0.2 | 0.8 | GO:0032218 | riboflavin transport(GO:0032218) |
0.2 | 0.5 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
0.2 | 0.6 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
0.2 | 0.2 | GO:0045168 | cell-cell signaling involved in cell fate commitment(GO:0045168) |
0.2 | 1.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.2 | 1.6 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.2 | 1.4 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.2 | 0.8 | GO:0036512 | trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
0.2 | 0.6 | GO:0019640 | glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
0.2 | 0.3 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
0.2 | 0.2 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.2 | 0.6 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.2 | 0.6 | GO:0072185 | metanephric cap development(GO:0072185) metanephric cap morphogenesis(GO:0072186) metanephric cap mesenchymal cell proliferation involved in metanephros development(GO:0090094) |
0.2 | 0.5 | GO:0019230 | proprioception(GO:0019230) |
0.2 | 1.7 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.2 | 1.4 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.2 | 1.9 | GO:0032782 | bile acid secretion(GO:0032782) |
0.2 | 0.5 | GO:1903960 | negative regulation of anion transmembrane transport(GO:1903960) |
0.2 | 0.5 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.2 | 0.6 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.2 | 0.8 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
0.2 | 0.5 | GO:0043406 | positive regulation of MAP kinase activity(GO:0043406) |
0.2 | 0.6 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
0.2 | 0.5 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.2 | 2.2 | GO:0044351 | macropinocytosis(GO:0044351) |
0.2 | 0.3 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.2 | 0.5 | GO:0021502 | neural fold elevation formation(GO:0021502) allantois development(GO:1905069) |
0.2 | 0.6 | GO:0006498 | N-terminal protein lipidation(GO:0006498) |
0.2 | 0.9 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.2 | 0.8 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.2 | 1.2 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
0.2 | 0.8 | GO:0097152 | mesenchymal cell apoptotic process(GO:0097152) |
0.2 | 0.3 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.2 | 0.9 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.2 | 2.0 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.2 | 4.1 | GO:0036150 | phosphatidylserine acyl-chain remodeling(GO:0036150) |
0.2 | 0.8 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 2.0 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
0.2 | 0.8 | GO:0090107 | regulation of high-density lipoprotein particle assembly(GO:0090107) |
0.2 | 1.2 | GO:0046618 | drug export(GO:0046618) |
0.2 | 0.5 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.2 | 0.3 | GO:0019521 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
0.2 | 0.5 | GO:0035981 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
0.2 | 0.3 | GO:0033590 | response to cobalamin(GO:0033590) |
0.2 | 1.2 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) |
0.1 | 0.9 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
0.1 | 1.5 | GO:0014832 | urinary bladder smooth muscle contraction(GO:0014832) urinary tract smooth muscle contraction(GO:0014848) |
0.1 | 0.7 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.1 | 0.4 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
0.1 | 0.3 | GO:0070434 | positive regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070426) positive regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070434) |
0.1 | 1.5 | GO:0034201 | response to oleic acid(GO:0034201) |
0.1 | 2.4 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.1 | 2.5 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.1 | 0.1 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
0.1 | 0.9 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
0.1 | 0.9 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
0.1 | 0.4 | GO:0060722 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
0.1 | 0.1 | GO:0034553 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
0.1 | 0.3 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.1 | 0.6 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.1 | 0.3 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
0.1 | 0.3 | GO:0033029 | neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) positive regulation of myeloid cell apoptotic process(GO:0033034) |
0.1 | 0.4 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
0.1 | 0.9 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.4 | GO:0016240 | autophagosome docking(GO:0016240) |
0.1 | 0.4 | GO:0021722 | pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
0.1 | 0.9 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 0.3 | GO:0021543 | pallium development(GO:0021543) |
0.1 | 1.4 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) positive regulation of triglyceride lipase activity(GO:0061365) |
0.1 | 2.6 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.1 | 0.4 | GO:0021554 | optic nerve development(GO:0021554) |
0.1 | 1.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.1 | 0.6 | GO:0048687 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
0.1 | 1.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.1 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
0.1 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 0.7 | GO:0060157 | urinary bladder development(GO:0060157) |
0.1 | 1.1 | GO:0002447 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
0.1 | 0.4 | GO:0015993 | molecular hydrogen transport(GO:0015993) |
0.1 | 1.0 | GO:0090292 | nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.4 | GO:0014876 | response to injury involved in regulation of muscle adaptation(GO:0014876) |
0.1 | 0.4 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.1 | 0.4 | GO:0044691 | tooth eruption(GO:0044691) |
0.1 | 1.6 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
0.1 | 2.4 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.1 | 0.7 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.1 | 0.8 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 2.5 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.1 | 0.4 | GO:0048075 | positive regulation of eye pigmentation(GO:0048075) |
0.1 | 0.6 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
0.1 | 0.1 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.1 | 1.3 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.1 | 0.6 | GO:0019285 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
0.1 | 0.1 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
0.1 | 2.4 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.1 | 1.8 | GO:0060242 | contact inhibition(GO:0060242) |
0.1 | 0.4 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 1.2 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.1 | 0.8 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.1 | 0.8 | GO:0032625 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
0.1 | 0.4 | GO:0061580 | colon epithelial cell migration(GO:0061580) |
0.1 | 0.6 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
0.1 | 0.7 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
0.1 | 0.6 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
0.1 | 0.3 | GO:0012502 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
0.1 | 0.4 | GO:0061534 | gamma-aminobutyric acid secretion, neurotransmission(GO:0061534) |
0.1 | 1.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.1 | 1.6 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 1.2 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
0.1 | 1.1 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.1 | 0.3 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.1 | 0.9 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.4 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.7 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.1 | 1.1 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
0.1 | 2.5 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.1 | 0.4 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 0.5 | GO:0090299 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.1 | 0.4 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.1 | 0.4 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.1 | 0.1 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.1 | 0.1 | GO:0042350 | GDP-L-fucose biosynthetic process(GO:0042350) |
0.1 | 1.4 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
0.1 | 2.6 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.1 | 0.4 | GO:0050760 | thymidylate synthase biosynthetic process(GO:0050757) regulation of thymidylate synthase biosynthetic process(GO:0050758) negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
0.1 | 0.7 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.4 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.1 | 0.8 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.1 | 0.4 | GO:0061485 | memory T cell proliferation(GO:0061485) |
0.1 | 0.1 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
0.1 | 2.9 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
0.1 | 1.4 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
0.1 | 0.6 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
0.1 | 0.5 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
0.1 | 0.3 | GO:0009644 | response to high light intensity(GO:0009644) |
0.1 | 0.4 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
0.1 | 0.4 | GO:0035634 | response to stilbenoid(GO:0035634) |
0.1 | 0.5 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.5 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 1.2 | GO:0035897 | proteolysis in other organism(GO:0035897) |
0.1 | 0.6 | GO:0030307 | positive regulation of cell growth(GO:0030307) |
0.1 | 0.8 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 1.2 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
0.1 | 0.9 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.1 | 0.6 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.1 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.1 | 0.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.6 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.1 | 0.8 | GO:1903147 | regulation of macromitophagy(GO:1901524) negative regulation of mitophagy(GO:1903147) |
0.1 | 0.1 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.1 | 0.1 | GO:0051784 | negative regulation of nuclear division(GO:0051784) |
0.1 | 0.1 | GO:0038179 | neurotrophin signaling pathway(GO:0038179) |
0.1 | 0.5 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.1 | 0.5 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.1 | 0.5 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
0.1 | 0.5 | GO:0002432 | granuloma formation(GO:0002432) |
0.1 | 0.5 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.1 | 0.6 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.1 | 1.7 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.1 | 1.6 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
0.1 | 0.1 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.1 | 0.1 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.1 | 0.2 | GO:0032661 | regulation of interleukin-18 production(GO:0032661) |
0.1 | 0.9 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.7 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.1 | GO:0006294 | nucleotide-excision repair, preincision complex assembly(GO:0006294) |
0.1 | 0.6 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.6 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.1 | 1.0 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.1 | 0.4 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
0.1 | 0.1 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
0.1 | 0.4 | GO:1901490 | regulation of lymphangiogenesis(GO:1901490) negative regulation of lymphangiogenesis(GO:1901491) |
0.1 | 1.0 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 1.8 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.1 | 1.3 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 0.2 | GO:2000569 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
0.1 | 0.4 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 1.7 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.1 | 0.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.1 | 1.3 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.1 | 0.2 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.1 | 4.2 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
0.1 | 0.2 | GO:1901656 | glycoside transport(GO:1901656) |
0.1 | 0.4 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
0.1 | 0.4 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
0.1 | 0.1 | GO:0021984 | adenohypophysis development(GO:0021984) |
0.1 | 0.8 | GO:1990403 | embryonic brain development(GO:1990403) |
0.1 | 0.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.1 | 0.4 | GO:0070875 | positive regulation of glycogen catabolic process(GO:0045819) positive regulation of glycogen metabolic process(GO:0070875) |
0.1 | 0.8 | GO:2001205 | negative regulation of osteoclast development(GO:2001205) |
0.1 | 0.9 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.1 | 1.8 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 0.6 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.1 | 0.5 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.1 | 0.4 | GO:0098884 | postsynaptic neurotransmitter receptor internalization(GO:0098884) |
0.1 | 0.3 | GO:0000472 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
0.1 | 0.3 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 0.6 | GO:0033080 | immature T cell proliferation in thymus(GO:0033080) regulation of immature T cell proliferation in thymus(GO:0033084) negative regulation of immature T cell proliferation(GO:0033087) negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.1 | 0.3 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) |
0.1 | 0.1 | GO:0009247 | glycolipid biosynthetic process(GO:0009247) |
0.1 | 1.7 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.1 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.1 | 1.0 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 6.0 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
0.1 | 1.9 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.1 | 0.7 | GO:0009099 | branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
0.1 | 0.1 | GO:0007442 | hindgut morphogenesis(GO:0007442) |
0.1 | 0.9 | GO:0051451 | myoblast migration(GO:0051451) |
0.1 | 0.8 | GO:0060356 | leucine import(GO:0060356) |
0.1 | 1.1 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 0.2 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.1 | 0.5 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.1 | 1.7 | GO:0030220 | platelet formation(GO:0030220) |
0.1 | 0.3 | GO:0044146 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
0.1 | 0.4 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 0.6 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.1 | 0.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 1.2 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.1 | 0.1 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
0.1 | 0.2 | GO:0034285 | response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
0.1 | 1.8 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 1.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.4 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.1 | 0.1 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.1 | 0.8 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.1 | 0.9 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 1.1 | GO:1901314 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
0.1 | 0.9 | GO:0046078 | dUMP metabolic process(GO:0046078) |
0.1 | 0.3 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
0.1 | 0.7 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.1 | 1.4 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.1 | 0.4 | GO:0009176 | pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) |
0.1 | 0.8 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.1 | 0.8 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.1 | 0.3 | GO:0033967 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
0.1 | 0.3 | GO:0051414 | response to cortisol(GO:0051414) |
0.1 | 0.3 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.1 | 2.0 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.1 | 1.7 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.1 | 0.4 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.1 | 3.4 | GO:0032011 | ARF protein signal transduction(GO:0032011) |
0.1 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.1 | 0.4 | GO:0036035 | osteoclast development(GO:0036035) |
0.1 | 1.4 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.4 | GO:0036034 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
0.1 | 0.2 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
0.1 | 1.3 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.5 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.5 | GO:2000468 | negative regulation of dopamine uptake involved in synaptic transmission(GO:0051585) norepinephrine uptake(GO:0051620) regulation of norepinephrine uptake(GO:0051621) negative regulation of norepinephrine uptake(GO:0051622) negative regulation of catecholamine uptake involved in synaptic transmission(GO:0051945) regulation of glutathione peroxidase activity(GO:1903282) positive regulation of glutathione peroxidase activity(GO:1903284) positive regulation of hydrogen peroxide catabolic process(GO:1903285) regulation of peroxidase activity(GO:2000468) positive regulation of peroxidase activity(GO:2000470) |
0.1 | 2.1 | GO:0014870 | response to muscle inactivity(GO:0014870) |
0.1 | 0.9 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 1.0 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.1 | 0.8 | GO:1904753 | positive regulation of heart rate by epinephrine(GO:0003065) negative regulation of vascular associated smooth muscle cell migration(GO:1904753) |
0.1 | 0.5 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 2.2 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.1 | 0.5 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
0.1 | 1.9 | GO:0050832 | defense response to fungus(GO:0050832) |
0.1 | 0.2 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
0.1 | 0.9 | GO:0075071 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.1 | 0.7 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.2 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.1 | 2.1 | GO:0035729 | cellular response to hepatocyte growth factor stimulus(GO:0035729) |
0.1 | 0.4 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.1 | 0.3 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) |
0.1 | 0.3 | GO:1904579 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) response to hypobaric hypoxia(GO:1990910) |
0.1 | 0.1 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
0.1 | 0.7 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.1 | 0.3 | GO:0048302 | isotype switching to IgG isotypes(GO:0048291) regulation of isotype switching to IgG isotypes(GO:0048302) |
0.1 | 0.2 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.4 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.1 | 0.4 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.1 | 3.3 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.1 | 0.2 | GO:0006740 | NADPH regeneration(GO:0006740) |
0.1 | 0.4 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.1 | 0.4 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 1.6 | GO:0001765 | membrane raft assembly(GO:0001765) |
0.1 | 0.1 | GO:1904976 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
0.1 | 0.4 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.1 | 0.2 | GO:0097267 | omega-hydroxylase P450 pathway(GO:0097267) |
0.1 | 3.9 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.1 | 0.4 | GO:0046931 | pore complex assembly(GO:0046931) |
0.1 | 2.0 | GO:0009650 | UV protection(GO:0009650) |
0.1 | 0.9 | GO:0006489 | dolichyl diphosphate biosynthetic process(GO:0006489) dolichyl diphosphate metabolic process(GO:0046465) |
0.1 | 1.4 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.1 | 0.2 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.1 | 0.2 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.1 | 0.8 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
0.1 | 0.4 | GO:0007052 | mitotic spindle organization(GO:0007052) |
0.1 | 0.3 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.6 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.1 | 0.1 | GO:0071878 | negative regulation of adrenergic receptor signaling pathway(GO:0071878) |
0.1 | 0.8 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.1 | 0.2 | GO:0060285 | cilium-dependent cell motility(GO:0060285) |
0.1 | 0.2 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.1 | 0.2 | GO:0051445 | regulation of meiotic cell cycle(GO:0051445) |
0.1 | 1.7 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 0.9 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.1 | 0.3 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
0.1 | 0.6 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 1.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.1 | 2.7 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
0.1 | 0.2 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
0.1 | 0.7 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.6 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
0.1 | 0.6 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
0.1 | 0.1 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
0.1 | 2.2 | GO:0031167 | rRNA methylation(GO:0031167) |
0.1 | 0.6 | GO:1902045 | negative regulation of Fas signaling pathway(GO:1902045) positive regulation of blood vessel remodeling(GO:2000504) |
0.1 | 1.5 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
0.1 | 0.4 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 0.4 | GO:0042407 | cristae formation(GO:0042407) |
0.1 | 4.4 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
0.1 | 0.2 | GO:0015783 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
0.1 | 0.5 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.1 | 1.5 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
0.1 | 0.5 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
0.1 | 0.9 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.2 | GO:0070542 | response to fatty acid(GO:0070542) |
0.1 | 0.2 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.1 | 1.2 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 0.4 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.6 | GO:1901906 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
0.1 | 0.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.1 | 0.1 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
0.1 | 1.0 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
0.1 | 0.9 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.1 | 0.1 | GO:0061004 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.1 | 0.8 | GO:0071371 | cellular response to gonadotropin stimulus(GO:0071371) |
0.1 | 0.3 | GO:0010159 | specification of organ position(GO:0010159) |
0.1 | 0.2 | GO:0023035 | CD40 signaling pathway(GO:0023035) regulation of CD40 signaling pathway(GO:2000348) |
0.1 | 1.2 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.1 | 0.5 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.1 | 1.0 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.1 | 1.8 | GO:0051154 | negative regulation of striated muscle cell differentiation(GO:0051154) |
0.1 | 0.7 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.1 | 1.6 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.1 | 0.8 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.1 | 0.5 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.1 | 0.3 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.1 | 0.4 | GO:0052250 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
0.1 | 0.4 | GO:0046778 | modification by virus of host mRNA processing(GO:0046778) |
0.1 | 2.3 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
0.1 | 0.1 | GO:0030573 | bile acid catabolic process(GO:0030573) |
0.1 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 3.1 | GO:0030201 | heparan sulfate proteoglycan metabolic process(GO:0030201) |
0.1 | 0.3 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.1 | 1.1 | GO:0061430 | bone trabecula morphogenesis(GO:0061430) |
0.1 | 0.2 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.1 | 1.6 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.1 | 0.1 | GO:0034378 | chylomicron assembly(GO:0034378) |
0.1 | 0.1 | GO:0061056 | sclerotome development(GO:0061056) |
0.1 | 0.1 | GO:0060920 | atrioventricular node development(GO:0003162) cardiac septum cell differentiation(GO:0003292) cardiac pacemaker cell differentiation(GO:0060920) atrioventricular node cell differentiation(GO:0060922) cardiac pacemaker cell development(GO:0060926) atrioventricular node cell development(GO:0060928) |
0.1 | 0.2 | GO:0098881 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
0.1 | 0.3 | GO:1902304 | activation of blood coagulation via clotting cascade(GO:0002543) phosphatidylserine exposure on blood platelet(GO:0097045) positive regulation of potassium ion export(GO:1902304) |
0.1 | 0.1 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.1 | 0.9 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.1 | 0.3 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
0.1 | 1.6 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.1 | 0.3 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.1 | 1.4 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.1 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.1 | 0.3 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.1 | 0.3 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
0.1 | 1.0 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.2 | GO:0044804 | nucleophagy(GO:0044804) |
0.1 | 1.7 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.1 | 0.2 | GO:2001302 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
0.1 | 0.6 | GO:0071461 | cellular response to redox state(GO:0071461) |
0.1 | 0.8 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.1 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
0.1 | 0.3 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.6 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.1 | 0.3 | GO:0098939 | dendritic transport of mitochondrion(GO:0098939) anterograde dendritic transport of mitochondrion(GO:0098972) |
0.1 | 0.3 | GO:0002887 | negative regulation of myeloid leukocyte mediated immunity(GO:0002887) |
0.1 | 0.8 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
0.1 | 0.5 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.1 | 1.4 | GO:0048741 | skeletal muscle fiber development(GO:0048741) |
0.1 | 0.2 | GO:0046222 | mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
0.1 | 0.4 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 0.2 | GO:0051866 | general adaptation syndrome(GO:0051866) |
0.1 | 0.8 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 0.5 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
0.1 | 0.4 | GO:0055014 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
0.1 | 0.3 | GO:0016598 | protein arginylation(GO:0016598) |
0.1 | 0.6 | GO:0071028 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.1 | 0.2 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 1.0 | GO:0045974 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.1 | 0.3 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
0.1 | 0.3 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
0.1 | 0.6 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.1 | 0.4 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) |
0.1 | 0.7 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.2 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.1 | 0.2 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
0.1 | 0.4 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.1 | 0.1 | GO:0003197 | endocardial cushion development(GO:0003197) |
0.1 | 0.2 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.1 | 0.1 | GO:0001890 | placenta development(GO:0001890) |
0.1 | 0.8 | GO:0006551 | leucine metabolic process(GO:0006551) leucine catabolic process(GO:0006552) |
0.1 | 0.4 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.1 | 0.9 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
0.1 | 0.5 | GO:0072575 | hepatocyte proliferation(GO:0072574) epithelial cell proliferation involved in liver morphogenesis(GO:0072575) |
0.1 | 0.9 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.2 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
0.1 | 1.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.1 | 0.8 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
0.1 | 0.5 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.1 | 0.7 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.1 | 0.2 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
0.1 | 0.4 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
0.1 | 0.8 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.5 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.1 | 0.4 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
0.1 | 0.2 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
0.1 | 2.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.4 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.1 | 0.6 | GO:0070269 | pyroptosis(GO:0070269) |
0.1 | 0.2 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
0.1 | 0.6 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.1 | 1.4 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 0.2 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
0.1 | 0.8 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
0.1 | 0.2 | GO:1901890 | positive regulation of cell junction assembly(GO:1901890) |
0.1 | 0.2 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.1 | 3.8 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.1 | 0.1 | GO:0015801 | aromatic amino acid transport(GO:0015801) |
0.1 | 0.5 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.1 | 0.3 | GO:0061162 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
0.1 | 0.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.3 | GO:0099640 | axo-dendritic protein transport(GO:0099640) |
0.1 | 0.2 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.2 | GO:0046398 | UDP-glucuronate biosynthetic process(GO:0006065) UDP-glucuronate metabolic process(GO:0046398) |
0.1 | 0.2 | GO:0046707 | IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
0.1 | 0.2 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.1 | 0.2 | GO:1900407 | regulation of cellular response to oxidative stress(GO:1900407) |
0.1 | 1.1 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.1 | 0.2 | GO:0061386 | closure of optic fissure(GO:0061386) |
0.1 | 0.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.1 | 0.2 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.3 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
0.1 | 0.3 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
0.1 | 0.5 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 1.0 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.1 | 0.9 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 2.2 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
0.1 | 0.3 | GO:1904106 | protein localization to microvillus(GO:1904106) |
0.1 | 1.9 | GO:1990090 | cellular response to nerve growth factor stimulus(GO:1990090) |
0.1 | 0.1 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.1 | 0.5 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.1 | 0.3 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.1 | 0.3 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.5 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.1 | 0.8 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 0.7 | GO:0043032 | positive regulation of macrophage activation(GO:0043032) |
0.1 | 0.2 | GO:1901628 | excitatory chemical synaptic transmission(GO:0098976) positive regulation of postsynaptic membrane organization(GO:1901628) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.1 | 0.1 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 0.4 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.5 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 1.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.1 | 0.4 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.1 | 0.9 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.1 | 0.2 | GO:0060730 | regulation of intestinal epithelial structure maintenance(GO:0060730) |
0.1 | 0.8 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.1 | GO:0009405 | pathogenesis(GO:0009405) |
0.1 | 0.2 | GO:0060380 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
0.1 | 0.1 | GO:0097501 | detoxification of inorganic compound(GO:0061687) stress response to metal ion(GO:0097501) |
0.1 | 0.1 | GO:0048311 | mitochondrion distribution(GO:0048311) |
0.1 | 0.6 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.1 | 1.4 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.1 | 0.1 | GO:1902946 | protein localization to early endosome(GO:1902946) regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.1 | 0.1 | GO:1904117 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
0.1 | 0.2 | GO:0035623 | regulation of pronephros size(GO:0035565) renal glucose absorption(GO:0035623) |
0.1 | 0.1 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
0.1 | 4.7 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.1 | 0.9 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.1 | 0.2 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
0.1 | 0.1 | GO:0051029 | rRNA transport(GO:0051029) |
0.1 | 1.6 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.2 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.1 | 0.1 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
0.1 | 0.3 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.1 | 0.2 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
0.1 | 0.8 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.1 | 1.3 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 1.8 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.1 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.1 | 0.2 | GO:0006338 | chromatin remodeling(GO:0006338) |
0.1 | 0.3 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.1 | 1.5 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.1 | 0.1 | GO:0030282 | bone mineralization(GO:0030282) |
0.1 | 0.1 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.1 | 0.6 | GO:0016075 | rRNA catabolic process(GO:0016075) |
0.1 | 0.8 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.1 | 0.5 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.1 | 0.7 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.1 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.8 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.1 | 0.3 | GO:0051124 | synaptic growth at neuromuscular junction(GO:0051124) |
0.1 | 0.1 | GO:0070142 | synaptic vesicle budding(GO:0070142) |
0.1 | 0.3 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.1 | 3.7 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.1 | 0.2 | GO:0035136 | forelimb morphogenesis(GO:0035136) |
0.1 | 1.0 | GO:0090129 | regulation of synapse maturation(GO:0090128) positive regulation of synapse maturation(GO:0090129) |
0.1 | 0.1 | GO:0010224 | response to UV-B(GO:0010224) |
0.1 | 0.3 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
0.1 | 0.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.1 | 0.6 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.1 | 0.5 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.1 | 0.2 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 1.9 | GO:0048635 | negative regulation of muscle organ development(GO:0048635) |
0.1 | 0.3 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.1 | 0.3 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
0.1 | 1.3 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.3 | GO:0070370 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
0.1 | 0.1 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
0.1 | 0.1 | GO:1904715 | negative regulation of chaperone-mediated autophagy(GO:1904715) |
0.1 | 0.1 | GO:1904429 | regulation of t-circle formation(GO:1904429) |
0.1 | 0.1 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 0.3 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
0.1 | 0.3 | GO:1901863 | positive regulation of striated muscle tissue development(GO:0045844) positive regulation of muscle organ development(GO:0048636) positive regulation of muscle tissue development(GO:1901863) |
0.1 | 0.8 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.1 | 0.5 | GO:1900120 | regulation of receptor binding(GO:1900120) |
0.1 | 0.5 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.5 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
0.1 | 0.6 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.6 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.1 | 0.2 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
0.1 | 0.8 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 0.2 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
0.1 | 0.2 | GO:0010833 | telomere maintenance via telomere lengthening(GO:0010833) |
0.1 | 0.8 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.1 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.1 | 0.8 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.4 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
0.1 | 0.4 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.1 | 1.1 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.5 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.1 | 0.2 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
0.1 | 0.2 | GO:0072423 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
0.1 | 0.1 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.1 | 0.1 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.1 | 0.5 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
0.1 | 0.7 | GO:0032506 | cytokinetic process(GO:0032506) |
0.1 | 0.6 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.1 | 0.1 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
0.1 | 1.0 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.1 | 0.5 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.1 | 0.1 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
0.1 | 0.2 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.1 | 0.5 | GO:0003264 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) |
0.1 | 0.8 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.1 | 1.2 | GO:0097435 | fibril organization(GO:0097435) |
0.1 | 0.5 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.1 | 0.8 | GO:0038203 | TORC2 signaling(GO:0038203) |
0.1 | 0.1 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
0.1 | 0.2 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
0.1 | 0.8 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.1 | 0.2 | GO:2000535 | regulation of entry of bacterium into host cell(GO:2000535) |
0.1 | 0.4 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.1 | GO:0033076 | isoquinoline alkaloid metabolic process(GO:0033076) |
0.1 | 0.1 | GO:1903233 | regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
0.1 | 0.2 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
0.1 | 1.9 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.1 | 0.2 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.2 | GO:0060023 | soft palate development(GO:0060023) |
0.1 | 0.4 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
0.1 | 0.2 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.1 | 0.2 | GO:1990834 | response to odorant(GO:1990834) |
0.1 | 0.5 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.5 | GO:0007405 | neuroblast proliferation(GO:0007405) |
0.1 | 0.4 | GO:0016128 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
0.1 | 0.3 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.2 | GO:0009078 | alanine metabolic process(GO:0006522) alanine catabolic process(GO:0006524) pyruvate family amino acid metabolic process(GO:0009078) pyruvate family amino acid catabolic process(GO:0009080) |
0.1 | 1.0 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.1 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
0.1 | 0.4 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
0.1 | 0.1 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
0.1 | 0.3 | GO:2001056 | positive regulation of cysteine-type endopeptidase activity(GO:2001056) |
0.1 | 0.3 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.1 | 0.2 | GO:1902598 | creatine transport(GO:0015881) creatine transmembrane transport(GO:1902598) |
0.1 | 0.6 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 1.3 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.1 | 1.0 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.1 | 0.3 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
0.1 | 0.3 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
0.1 | 0.2 | GO:0042335 | cuticle development(GO:0042335) |
0.1 | 0.1 | GO:0022616 | DNA strand elongation involved in DNA replication(GO:0006271) DNA strand elongation(GO:0022616) |
0.1 | 0.8 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.1 | 0.6 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
0.1 | 0.3 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) negative regulation of translational initiation in response to stress(GO:0032057) |
0.1 | 0.3 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
0.1 | 0.1 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.1 | 0.1 | GO:2000866 | positive regulation of estrogen secretion(GO:2000863) positive regulation of estradiol secretion(GO:2000866) |
0.1 | 0.1 | GO:0034402 | mRNA export from nucleus in response to heat stress(GO:0031990) recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
0.1 | 0.2 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.1 | 0.1 | GO:1903802 | L-glutamate import(GO:0051938) L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.1 | 0.9 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.1 | 0.1 | GO:1904796 | regulation of core promoter binding(GO:1904796) positive regulation of core promoter binding(GO:1904798) |
0.1 | 0.3 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
0.1 | 1.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.2 | GO:0070105 | positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
0.1 | 0.2 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
0.1 | 0.3 | GO:0032455 | nerve growth factor processing(GO:0032455) |
0.1 | 0.1 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.1 | 0.1 | GO:0061525 | hindgut development(GO:0061525) |
0.1 | 0.2 | GO:0072684 | mitochondrial tRNA 3'-trailer cleavage, endonucleolytic(GO:0072684) |
0.1 | 0.5 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
0.1 | 0.3 | GO:0097647 | dimeric G-protein coupled receptor signaling pathway(GO:0038042) calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
0.1 | 0.1 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.1 | 0.2 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
0.1 | 0.6 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.1 | 0.2 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.1 | 0.1 | GO:0002832 | negative regulation of response to biotic stimulus(GO:0002832) |
0.1 | 1.6 | GO:0046710 | GDP metabolic process(GO:0046710) |
0.1 | 0.6 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.1 | 0.2 | GO:0060413 | atrial septum morphogenesis(GO:0060413) |
0.1 | 1.4 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.1 | 0.3 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.1 | 0.2 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
0.1 | 0.2 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.1 | 1.0 | GO:1904030 | negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.1 | 1.3 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.1 | 0.7 | GO:0042167 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.1 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.1 | 0.2 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.5 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.1 | 1.0 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.1 | 0.5 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.1 | 0.3 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
0.1 | 1.2 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.1 | 0.3 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.1 | 0.1 | GO:0009648 | photoperiodism(GO:0009648) |
0.1 | 0.1 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.1 | 3.3 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.1 | 0.1 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.1 | 0.6 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
0.1 | 0.3 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.1 | 1.9 | GO:0006007 | glucose catabolic process(GO:0006007) |
0.1 | 0.3 | GO:0060431 | primary lung bud formation(GO:0060431) |
0.1 | 0.4 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.1 | 0.2 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) positive regulation of viral release from host cell(GO:1902188) |
0.1 | 0.5 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 0.8 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.1 | GO:0006429 | leucyl-tRNA aminoacylation(GO:0006429) |
0.1 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.2 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
0.1 | 0.2 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.0 | 0.0 | GO:0018119 | protein nitrosylation(GO:0017014) peptidyl-cysteine S-nitrosylation(GO:0018119) negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.5 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.1 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.0 | 0.0 | GO:1990089 | response to nerve growth factor(GO:1990089) |
0.0 | 0.3 | GO:0014904 | myotube cell development(GO:0014904) |
0.0 | 0.5 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.4 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.0 | 0.3 | GO:0046689 | response to mercury ion(GO:0046689) |
0.0 | 0.3 | GO:0040014 | regulation of multicellular organism growth(GO:0040014) |
0.0 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 1.0 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.0 | 0.2 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
0.0 | 0.0 | GO:0034445 | negative regulation of lipoprotein oxidation(GO:0034443) regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
0.0 | 0.8 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.4 | GO:0006591 | ornithine metabolic process(GO:0006591) |
0.0 | 0.0 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
0.0 | 0.5 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.2 | GO:0021532 | neural tube patterning(GO:0021532) |
0.0 | 0.3 | GO:0030261 | chromosome condensation(GO:0030261) |
0.0 | 0.1 | GO:0071529 | cementum mineralization(GO:0071529) |
0.0 | 0.2 | GO:0072757 | cellular response to camptothecin(GO:0072757) |
0.0 | 0.4 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.1 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
0.0 | 1.1 | GO:0031112 | positive regulation of microtubule polymerization or depolymerization(GO:0031112) |
0.0 | 0.1 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
0.0 | 0.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.4 | GO:0019226 | transmission of nerve impulse(GO:0019226) |
0.0 | 0.1 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
0.0 | 0.2 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
0.0 | 0.2 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.0 | 0.1 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 0.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.0 | 0.3 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.1 | GO:0043132 | NAD transport(GO:0043132) |
0.0 | 0.3 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) |
0.0 | 0.3 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.0 | 0.1 | GO:1902430 | negative regulation of beta-amyloid formation(GO:1902430) |
0.0 | 0.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.3 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.0 | 0.4 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.0 | 0.3 | GO:0030207 | chondroitin sulfate catabolic process(GO:0030207) |
0.0 | 0.3 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.7 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 1.2 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.0 | 1.4 | GO:1902855 | nonmotile primary cilium assembly(GO:0035058) regulation of nonmotile primary cilium assembly(GO:1902855) |
0.0 | 0.1 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
0.0 | 1.0 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.0 | 0.1 | GO:0031938 | regulation of chromatin silencing at telomere(GO:0031938) |
0.0 | 0.1 | GO:1900111 | positive regulation of histone H3-K9 dimethylation(GO:1900111) |
0.0 | 0.2 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.6 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.0 | 0.4 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
0.0 | 0.2 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
0.0 | 0.1 | GO:0051715 | cytolysis in other organism(GO:0051715) |
0.0 | 0.0 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.1 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.7 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.0 | 0.3 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.5 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.0 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.6 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.3 | GO:0030517 | negative regulation of axon extension(GO:0030517) |
0.0 | 0.2 | GO:0032526 | response to retinoic acid(GO:0032526) |
0.0 | 0.1 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
0.0 | 0.3 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.3 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.0 | 0.1 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.0 | 0.3 | GO:0035437 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.0 | 0.6 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.2 | GO:0052551 | response to defense-related nitric oxide production by other organism involved in symbiotic interaction(GO:0052551) response to defense-related host nitric oxide production(GO:0052565) |
0.0 | 0.5 | GO:0021904 | dorsal/ventral neural tube patterning(GO:0021904) |
0.0 | 0.7 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 0.9 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
0.0 | 0.2 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
0.0 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.2 | GO:0060534 | trachea cartilage development(GO:0060534) |
0.0 | 0.1 | GO:2000398 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
0.0 | 0.0 | GO:0044126 | growth involved in symbiotic interaction(GO:0044110) growth of symbiont involved in interaction with host(GO:0044116) growth of symbiont in host(GO:0044117) regulation of growth of symbiont in host(GO:0044126) modulation of growth of symbiont involved in interaction with host(GO:0044144) |
0.0 | 0.2 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.0 | 0.4 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.2 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.0 | 0.3 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.0 | 0.2 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.0 | 0.3 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.2 | GO:0090410 | malonate catabolic process(GO:0090410) |
0.0 | 0.2 | GO:0006929 | substrate-dependent cell migration(GO:0006929) |
0.0 | 1.2 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
0.0 | 0.8 | GO:0030149 | sphingolipid catabolic process(GO:0030149) |
0.0 | 3.3 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.1 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.5 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.2 | GO:0016137 | glycoside metabolic process(GO:0016137) |
0.0 | 0.4 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.5 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.0 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
0.0 | 0.1 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
0.0 | 0.1 | GO:1903975 | regulation of glial cell migration(GO:1903975) negative regulation of glial cell migration(GO:1903976) |
0.0 | 0.1 | GO:0042670 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
0.0 | 0.4 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 0.2 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.3 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.0 | 0.7 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.6 | GO:0051299 | centrosome separation(GO:0051299) |
0.0 | 0.6 | GO:0015816 | glycine transport(GO:0015816) |
0.0 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.0 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.0 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.0 | 0.1 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.0 | 0.2 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.1 | GO:0071351 | interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
0.0 | 0.1 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.0 | 0.8 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.0 | 0.1 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.0 | 0.1 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.0 | 0.2 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.0 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
0.0 | 0.4 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 1.4 | GO:0042475 | odontogenesis of dentin-containing tooth(GO:0042475) |
0.0 | 0.0 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.0 | 0.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.0 | 0.2 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
0.0 | 0.6 | GO:0034122 | negative regulation of toll-like receptor signaling pathway(GO:0034122) |
0.0 | 0.2 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.0 | GO:1990592 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.1 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.0 | 0.2 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.0 | 0.6 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
0.0 | 0.0 | GO:0061371 | determination of heart left/right asymmetry(GO:0061371) |
0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.4 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.2 | GO:0070266 | necroptotic process(GO:0070266) |
0.0 | 0.1 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
0.0 | 0.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 1.0 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.3 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.0 | 0.1 | GO:0046825 | regulation of protein export from nucleus(GO:0046825) |
0.0 | 1.0 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.0 | 0.3 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.0 | 0.2 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
0.0 | 0.2 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 1.2 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.0 | 0.5 | GO:1903393 | positive regulation of adherens junction organization(GO:1903393) |
0.0 | 0.4 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.0 | 0.0 | GO:0030070 | insulin processing(GO:0030070) |
0.0 | 0.8 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.0 | 0.8 | GO:0070373 | negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
0.0 | 0.1 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.1 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.0 | 0.4 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
0.0 | 1.3 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.2 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
0.0 | 0.3 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.0 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
0.0 | 0.2 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
0.0 | 0.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.3 | GO:0032353 | regulation of glucocorticoid biosynthetic process(GO:0031946) negative regulation of hormone metabolic process(GO:0032351) negative regulation of hormone biosynthetic process(GO:0032353) |
0.0 | 0.2 | GO:1903543 | positive regulation of exosomal secretion(GO:1903543) |
0.0 | 0.2 | GO:0007044 | cell-substrate junction assembly(GO:0007044) |
0.0 | 0.3 | GO:0050770 | regulation of axonogenesis(GO:0050770) |
0.0 | 0.4 | GO:0051931 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
0.0 | 0.2 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.0 | 0.2 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
0.0 | 0.3 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.3 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
0.0 | 0.1 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.0 | 0.1 | GO:0048484 | enteric nervous system development(GO:0048484) |
0.0 | 0.3 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
0.0 | 0.1 | GO:1902612 | regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
0.0 | 0.9 | GO:0048286 | lung alveolus development(GO:0048286) |
0.0 | 0.9 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.0 | 0.6 | GO:0048536 | spleen development(GO:0048536) |
0.0 | 0.3 | GO:0015866 | ADP transport(GO:0015866) |
0.0 | 0.1 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
0.0 | 0.1 | GO:0006734 | NADH metabolic process(GO:0006734) |
0.0 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.0 | 0.1 | GO:0035803 | egg coat formation(GO:0035803) |
0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.8 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 2.1 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) |
0.0 | 0.0 | GO:0042320 | regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) |
0.0 | 0.1 | GO:0007051 | spindle organization(GO:0007051) |
0.0 | 0.5 | GO:0097503 | sialylation(GO:0097503) |
0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.1 | GO:0014059 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.0 | 0.2 | GO:0002327 | immature B cell differentiation(GO:0002327) |
0.0 | 0.2 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.6 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.0 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.2 | GO:0046580 | negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
0.0 | 0.3 | GO:1903307 | positive regulation of regulated secretory pathway(GO:1903307) |
0.0 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.0 | 0.0 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.0 | 0.0 | GO:0060674 | placenta blood vessel development(GO:0060674) |
0.0 | 0.4 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) |
0.0 | 0.4 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.0 | 0.1 | GO:0001971 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) negative regulation of activation of membrane attack complex(GO:0001971) |
0.0 | 0.7 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
0.0 | 0.3 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
0.0 | 0.2 | GO:0035640 | exploration behavior(GO:0035640) |
0.0 | 0.1 | GO:0046898 | response to cycloheximide(GO:0046898) |
0.0 | 0.2 | GO:0038060 | nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
0.0 | 0.2 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.0 | 0.3 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 1.7 | GO:0032418 | lysosome localization(GO:0032418) |
0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.4 | GO:0008347 | glial cell migration(GO:0008347) |
0.0 | 0.2 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.0 | 0.1 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
0.0 | 0.1 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
0.0 | 0.1 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.0 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.1 | GO:0002042 | cell migration involved in sprouting angiogenesis(GO:0002042) |
0.0 | 0.1 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
0.0 | 0.3 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.0 | GO:0048146 | positive regulation of fibroblast proliferation(GO:0048146) |
0.0 | 0.1 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.0 | 0.1 | GO:0036451 | cap mRNA methylation(GO:0036451) |
0.0 | 0.4 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
0.0 | 0.1 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
0.0 | 0.1 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.1 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.0 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.1 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
0.0 | 0.0 | GO:1990168 | protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.1 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.0 | 1.2 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 0.0 | GO:0006286 | base-excision repair, base-free sugar-phosphate removal(GO:0006286) DNA dephosphorylation(GO:0098502) |
0.0 | 0.1 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.0 | 0.0 | GO:0045922 | negative regulation of fatty acid metabolic process(GO:0045922) |
0.0 | 0.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.1 | GO:1990502 | dense core granule maturation(GO:1990502) |
0.0 | 2.3 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 0.1 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.0 | 0.1 | GO:0036309 | protein localization to M-band(GO:0036309) |
0.0 | 0.2 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.0 | 0.1 | GO:0071347 | cellular response to interleukin-1(GO:0071347) |
0.0 | 0.5 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.0 | 1.1 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.0 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.0 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.0 | GO:1990180 | mitochondrial tRNA 3'-end processing(GO:1990180) |
0.0 | 0.0 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.0 | 0.2 | GO:0018107 | peptidyl-threonine phosphorylation(GO:0018107) peptidyl-threonine modification(GO:0018210) |
0.0 | 0.1 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
0.0 | 0.0 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.0 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.1 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
0.0 | 0.7 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.3 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.1 | GO:0006907 | pinocytosis(GO:0006907) |
0.0 | 0.3 | GO:0071901 | negative regulation of protein serine/threonine kinase activity(GO:0071901) |
0.0 | 0.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.0 | 0.0 | GO:0061450 | trophoblast cell migration(GO:0061450) regulation of trophoblast cell migration(GO:1901163) |
0.0 | 0.1 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.0 | 3.0 | GO:0035303 | regulation of dephosphorylation(GO:0035303) |
0.0 | 0.5 | GO:0031648 | protein destabilization(GO:0031648) |
0.0 | 0.4 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.1 | GO:0045007 | depurination(GO:0045007) |
0.0 | 0.0 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
0.0 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.3 | GO:0001709 | cell fate determination(GO:0001709) |
0.0 | 2.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 1.5 | GO:0043647 | inositol phosphate metabolic process(GO:0043647) |
0.0 | 0.3 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.0 | GO:0016559 | peroxisome fission(GO:0016559) |
0.0 | 0.2 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
0.0 | 0.0 | GO:0070242 | thymocyte apoptotic process(GO:0070242) |
0.0 | 0.1 | GO:0015864 | uridine transport(GO:0015862) pyrimidine nucleoside transport(GO:0015864) |
0.0 | 0.1 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
0.0 | 0.3 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.0 | GO:0003094 | glomerular filtration(GO:0003094) |
0.0 | 0.1 | GO:0002224 | toll-like receptor signaling pathway(GO:0002224) |
0.0 | 0.5 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.0 | 0.7 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.0 | 0.0 | GO:0070316 | regulation of G0 to G1 transition(GO:0070316) |
0.0 | 0.1 | GO:0061217 | positive regulation of mesonephros development(GO:0061213) regulation of mesonephros development(GO:0061217) |
0.0 | 0.3 | GO:0009311 | oligosaccharide metabolic process(GO:0009311) |
0.0 | 0.1 | GO:0015785 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
0.0 | 0.3 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.0 | 0.0 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
0.0 | 0.0 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
0.0 | 0.1 | GO:0045445 | myoblast differentiation(GO:0045445) |
0.0 | 0.3 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.0 | 0.1 | GO:0080111 | DNA demethylation(GO:0080111) |
0.0 | 0.2 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.1 | GO:0001840 | neural plate development(GO:0001840) |
0.0 | 0.0 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.0 | 0.1 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.0 | 0.1 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.1 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.0 | 0.0 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.0 | 0.1 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.1 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
0.0 | 0.2 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
0.0 | 0.4 | GO:0070987 | error-free translesion synthesis(GO:0070987) |
0.0 | 0.3 | GO:0006026 | aminoglycan catabolic process(GO:0006026) |
0.0 | 0.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.1 | GO:0042262 | DNA protection(GO:0042262) |
0.0 | 0.2 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
0.0 | 0.2 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
0.0 | 0.0 | GO:1900181 | negative regulation of protein localization to nucleus(GO:1900181) |
0.0 | 0.5 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.3 | GO:0043297 | apical junction assembly(GO:0043297) |
0.0 | 0.1 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
0.0 | 0.2 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.0 | GO:0048663 | neuron fate commitment(GO:0048663) |
0.0 | 0.2 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.0 | 0.4 | GO:0050912 | detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) negative regulation of membrane tubulation(GO:1903526) |
0.0 | 0.0 | GO:0001826 | inner cell mass cell differentiation(GO:0001826) |
0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 1.6 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
0.0 | 0.0 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.0 | 1.0 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.0 | 0.0 | GO:0072425 | signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) |
0.0 | 0.0 | GO:0021781 | glial cell fate commitment(GO:0021781) |
0.0 | 0.5 | GO:0006509 | membrane protein ectodomain proteolysis(GO:0006509) |
0.0 | 0.0 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.0 | 0.0 | GO:0015846 | polyamine transport(GO:0015846) |
0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.0 | 0.4 | GO:0071774 | response to fibroblast growth factor(GO:0071774) |
0.0 | 0.4 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.1 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
0.0 | 0.1 | GO:0070831 | basement membrane assembly(GO:0070831) regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.0 | 0.0 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.0 | 0.1 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
0.0 | 0.5 | GO:0070527 | platelet aggregation(GO:0070527) |
0.0 | 0.1 | GO:0044728 | DNA methylation or demethylation(GO:0044728) |
0.0 | 0.2 | GO:0007398 | ectoderm development(GO:0007398) |
0.0 | 0.0 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.0 | 0.1 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
0.0 | 0.3 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.0 | 0.0 | GO:0035456 | response to interferon-beta(GO:0035456) |
0.0 | 0.0 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.1 | GO:0002159 | desmosome assembly(GO:0002159) |
0.0 | 0.0 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.1 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine diphosphate metabolic process(GO:0042357) |
0.0 | 0.1 | GO:0001510 | RNA methylation(GO:0001510) |
0.0 | 0.1 | GO:1904029 | regulation of cyclin-dependent protein kinase activity(GO:1904029) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.1 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
0.0 | 0.0 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.0 | 0.0 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.0 | 0.0 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.1 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
0.0 | 0.2 | GO:2000401 | regulation of lymphocyte migration(GO:2000401) |
0.0 | 0.1 | GO:0008037 | cell recognition(GO:0008037) |
0.0 | 0.0 | GO:0006147 | guanine catabolic process(GO:0006147) |
0.0 | 0.0 | GO:0002545 | chronic inflammatory response to non-antigenic stimulus(GO:0002545) regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002880) |
0.0 | 0.0 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.0 | 0.0 | GO:0002548 | monocyte chemotaxis(GO:0002548) |
0.0 | 0.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.0 | 0.0 | GO:1905053 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 3.9 | GO:0071797 | LUBAC complex(GO:0071797) |
0.6 | 1.7 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.6 | 0.6 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
0.5 | 1.6 | GO:0039713 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
0.5 | 7.6 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.5 | 1.5 | GO:0030689 | Noc complex(GO:0030689) |
0.5 | 1.9 | GO:0097635 | extrinsic component of autophagosome membrane(GO:0097635) |
0.4 | 1.8 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
0.4 | 0.9 | GO:0019034 | viral replication complex(GO:0019034) |
0.4 | 2.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.4 | 1.3 | GO:0034657 | GID complex(GO:0034657) |
0.4 | 1.3 | GO:0097489 | multivesicular body, internal vesicle lumen(GO:0097489) |
0.4 | 0.8 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.4 | 1.2 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
0.4 | 1.5 | GO:0045160 | myosin I complex(GO:0045160) |
0.4 | 2.3 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
0.4 | 1.8 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
0.4 | 1.1 | GO:0098855 | HCN channel complex(GO:0098855) |
0.4 | 1.4 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
0.3 | 1.0 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.3 | 2.0 | GO:0032021 | NELF complex(GO:0032021) |
0.3 | 3.7 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
0.3 | 1.0 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
0.3 | 0.3 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
0.3 | 0.3 | GO:0031226 | intrinsic component of plasma membrane(GO:0031226) |
0.3 | 1.9 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
0.3 | 1.8 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.3 | 1.7 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
0.3 | 1.7 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.3 | 1.9 | GO:0098536 | deuterosome(GO:0098536) |
0.3 | 1.3 | GO:0002133 | polycystin complex(GO:0002133) |
0.3 | 0.8 | GO:0035101 | FACT complex(GO:0035101) |
0.3 | 3.7 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.3 | 1.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.3 | 0.5 | GO:0045180 | basal cortex(GO:0045180) |
0.3 | 0.8 | GO:0000806 | Y chromosome(GO:0000806) |
0.3 | 2.6 | GO:0005638 | lamin filament(GO:0005638) |
0.3 | 2.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.3 | 1.0 | GO:0036284 | tubulobulbar complex(GO:0036284) |
0.3 | 4.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.3 | 1.3 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.3 | 0.5 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.2 | 1.0 | GO:0031523 | Myb complex(GO:0031523) |
0.2 | 1.0 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
0.2 | 7.5 | GO:0071565 | nBAF complex(GO:0071565) |
0.2 | 1.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.2 | 1.4 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.2 | 1.8 | GO:0097361 | CIA complex(GO:0097361) |
0.2 | 1.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.2 | 0.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.2 | 0.2 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.2 | 0.9 | GO:0043293 | apoptosome(GO:0043293) |
0.2 | 4.5 | GO:0032433 | filopodium tip(GO:0032433) |
0.2 | 2.3 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.2 | 0.8 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.2 | 0.4 | GO:0032449 | CBM complex(GO:0032449) |
0.2 | 0.2 | GO:0044393 | microspike(GO:0044393) |
0.2 | 0.6 | GO:0005745 | m-AAA complex(GO:0005745) |
0.2 | 1.0 | GO:0034753 | nuclear aryl hydrocarbon receptor complex(GO:0034753) |
0.2 | 1.6 | GO:0043196 | varicosity(GO:0043196) |
0.2 | 1.4 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.2 | 0.6 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
0.2 | 3.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.2 | 1.1 | GO:0000799 | nuclear condensin complex(GO:0000799) |
0.2 | 1.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.2 | 1.3 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.2 | 0.7 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
0.2 | 2.3 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.2 | 1.9 | GO:0098651 | basement membrane collagen trimer(GO:0098651) |
0.2 | 0.9 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.2 | 4.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 0.9 | GO:0031166 | integral component of vacuolar membrane(GO:0031166) |
0.2 | 0.5 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
0.2 | 0.5 | GO:0009346 | citrate lyase complex(GO:0009346) |
0.2 | 1.2 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.2 | 0.8 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
0.2 | 4.4 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.2 | 0.8 | GO:0031515 | tRNA (m1A) methyltransferase complex(GO:0031515) |
0.2 | 1.2 | GO:0042825 | TAP complex(GO:0042825) |
0.2 | 0.5 | GO:0032173 | septin ring(GO:0005940) septin collar(GO:0032173) |
0.2 | 0.5 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.2 | 1.8 | GO:0097443 | sorting endosome(GO:0097443) |
0.2 | 0.6 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.2 | 0.6 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.2 | 1.9 | GO:0005916 | fascia adherens(GO:0005916) |
0.2 | 1.3 | GO:1990393 | 3M complex(GO:1990393) |
0.2 | 1.7 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.2 | 0.6 | GO:0044753 | amphisome(GO:0044753) |
0.2 | 0.8 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.2 | 0.6 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
0.2 | 0.2 | GO:1990769 | proximal neuron projection(GO:1990769) |
0.2 | 1.4 | GO:0044194 | cytolytic granule(GO:0044194) |
0.2 | 5.7 | GO:0005921 | gap junction(GO:0005921) |
0.1 | 0.6 | GO:0031085 | BLOC-3 complex(GO:0031085) |
0.1 | 2.4 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.6 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.1 | 0.4 | GO:0031256 | leading edge membrane(GO:0031256) |
0.1 | 0.9 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 0.6 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
0.1 | 0.7 | GO:0016938 | kinesin I complex(GO:0016938) |
0.1 | 4.4 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 0.8 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.1 | 1.2 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.4 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 1.0 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.1 | 0.3 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.1 | 3.8 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 1.9 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
0.1 | 0.3 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.1 | 1.9 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 1.8 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 1.0 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 1.4 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 0.4 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
0.1 | 1.0 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 1.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 0.4 | GO:0036398 | TCR signalosome(GO:0036398) |
0.1 | 0.5 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 3.3 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 0.5 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
0.1 | 1.2 | GO:0097413 | Lewy body(GO:0097413) |
0.1 | 1.1 | GO:0051233 | spindle midzone(GO:0051233) |
0.1 | 2.9 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 0.8 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 0.6 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 0.4 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
0.1 | 0.7 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 1.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.1 | 0.1 | GO:0044301 | climbing fiber(GO:0044301) |
0.1 | 0.6 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.4 | GO:0098844 | postsynaptic endocytic zone membrane(GO:0098844) |
0.1 | 1.3 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 0.5 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 1.6 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.4 | GO:0045257 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
0.1 | 2.8 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
0.1 | 1.0 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.1 | 3.7 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 0.1 | GO:1990666 | PCSK9-LDLR complex(GO:1990666) |
0.1 | 0.7 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.1 | 2.8 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 1.9 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.8 | GO:0036021 | endolysosome lumen(GO:0036021) |
0.1 | 0.8 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 2.1 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 0.5 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.4 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.5 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 0.8 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.4 | GO:1903349 | omegasome membrane(GO:1903349) |
0.1 | 1.3 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.4 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 0.9 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 2.9 | GO:0002102 | podosome(GO:0002102) |
0.1 | 1.2 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 1.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 0.4 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
0.1 | 0.7 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 0.6 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.1 | 1.0 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 1.4 | GO:0005902 | microvillus(GO:0005902) |
0.1 | 15.0 | GO:0042641 | actomyosin(GO:0042641) |
0.1 | 2.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 1.1 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 1.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 1.7 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.4 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.5 | GO:1990031 | pinceau fiber(GO:1990031) |
0.1 | 0.6 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 1.2 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.1 | 1.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.8 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.3 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 1.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.2 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 0.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 0.6 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.1 | 0.6 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 2.4 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 3.3 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.6 | GO:0001652 | granular component(GO:0001652) |
0.1 | 0.9 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.1 | 1.6 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.1 | 0.6 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.1 | 0.3 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.1 | 0.5 | GO:0019012 | virion(GO:0019012) virion part(GO:0044423) |
0.1 | 1.9 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.3 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.1 | 0.4 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.1 | 0.5 | GO:0033503 | HULC complex(GO:0033503) |
0.1 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 2.2 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 1.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 1.1 | GO:0032797 | SMN complex(GO:0032797) |
0.1 | 0.2 | GO:0072563 | endothelial microparticle(GO:0072563) |
0.1 | 2.3 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 1.6 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 1.7 | GO:0045120 | pronucleus(GO:0045120) |
0.1 | 7.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 9.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.1 | 0.5 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 0.7 | GO:0034706 | sodium channel complex(GO:0034706) |
0.1 | 1.7 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.1 | 0.5 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.8 | GO:0046930 | pore complex(GO:0046930) |
0.1 | 0.9 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.2 | GO:0044609 | DBIRD complex(GO:0044609) |
0.1 | 0.3 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
0.1 | 1.6 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.1 | 0.6 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 0.4 | GO:0044304 | main axon(GO:0044304) |
0.1 | 0.1 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
0.1 | 0.5 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.1 | GO:0042627 | chylomicron(GO:0042627) |
0.1 | 1.9 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.1 | 3.0 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 0.3 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.1 | 0.4 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 0.3 | GO:0070931 | Golgi-associated vesicle lumen(GO:0070931) |
0.1 | 0.1 | GO:0034515 | proteasome storage granule(GO:0034515) |
0.1 | 2.1 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 0.1 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
0.1 | 0.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.1 | 0.1 | GO:0036117 | hyaluranon cable(GO:0036117) |
0.1 | 0.7 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.5 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 0.4 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.8 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.2 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
0.1 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.2 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.3 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
0.1 | 0.6 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.1 | 0.3 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.1 | 1.7 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 2.0 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.1 | 0.6 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.5 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
0.1 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.3 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.1 | 0.2 | GO:1990742 | microvesicle(GO:1990742) |
0.1 | 1.0 | GO:0005795 | Golgi stack(GO:0005795) |
0.1 | 0.6 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 7.6 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 4.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.1 | 0.3 | GO:0014704 | intercalated disc(GO:0014704) |
0.1 | 0.4 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.1 | 0.4 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) |
0.1 | 0.1 | GO:0030897 | HOPS complex(GO:0030897) |
0.1 | 1.2 | GO:0043218 | compact myelin(GO:0043218) |
0.1 | 0.2 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
0.1 | 1.4 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 1.4 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 0.4 | GO:0031310 | intrinsic component of vacuolar membrane(GO:0031310) |
0.1 | 0.9 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 0.5 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 1.7 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 0.2 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.1 | 0.4 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
0.1 | 0.6 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.5 | GO:0043198 | dendritic shaft(GO:0043198) |
0.1 | 3.3 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 1.4 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.1 | 0.4 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.1 | 0.2 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
0.1 | 0.4 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.1 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
0.1 | 2.9 | GO:0031519 | PcG protein complex(GO:0031519) |
0.1 | 0.6 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.1 | 0.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 2.3 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 0.9 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.7 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.3 | GO:0097362 | MCM8-MCM9 complex(GO:0097362) |
0.1 | 0.4 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.3 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
0.1 | 0.4 | GO:0061617 | MICOS complex(GO:0061617) |
0.1 | 0.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.6 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 0.8 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.1 | 0.2 | GO:0060187 | cell pole(GO:0060187) |
0.1 | 0.6 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.1 | 1.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 0.6 | GO:0061202 | clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
0.1 | 0.4 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.1 | 0.7 | GO:0042555 | MCM complex(GO:0042555) |
0.1 | 1.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.1 | 0.4 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
0.1 | 0.7 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.0 | GO:0016013 | syntrophin complex(GO:0016013) |
0.0 | 0.4 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.8 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.6 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.2 | GO:0031251 | PAN complex(GO:0031251) |
0.0 | 0.6 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.1 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
0.0 | 0.8 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 3.5 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.4 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 1.7 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 5.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.3 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.6 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.2 | GO:0005687 | U4 snRNP(GO:0005687) |
0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 1.4 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.7 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.5 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.2 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.0 | 0.0 | GO:0034665 | integrin alpha1-beta1 complex(GO:0034665) |
0.0 | 0.7 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 3.2 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.3 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.9 | GO:0036020 | endolysosome membrane(GO:0036020) |
0.0 | 1.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.3 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 0.6 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
0.0 | 0.6 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 3.3 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.0 | GO:0034678 | integrin alpha8-beta1 complex(GO:0034678) |
0.0 | 0.4 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.0 | 0.4 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.0 | 0.3 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.8 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.6 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 2.7 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.0 | 0.1 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 0.4 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.4 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.5 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 6.1 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.0 | 2.8 | GO:0005884 | actin filament(GO:0005884) |
0.0 | 1.9 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.4 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 1.7 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.2 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
0.0 | 0.2 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.5 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 1.6 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.4 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 1.8 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.2 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
0.0 | 0.2 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 1.1 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.2 | GO:0031672 | A band(GO:0031672) |
0.0 | 0.8 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 6.0 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.1 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.3 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 7.9 | GO:0001726 | ruffle(GO:0001726) |
0.0 | 0.3 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.3 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 15.9 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 3.7 | GO:0043296 | apical junction complex(GO:0043296) |
0.0 | 5.9 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 1.0 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.4 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.4 | GO:0005657 | replication fork(GO:0005657) |
0.0 | 2.2 | GO:0044853 | plasma membrane raft(GO:0044853) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.2 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
0.0 | 0.2 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.0 | 0.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 2.1 | GO:0031253 | cell projection membrane(GO:0031253) |
0.0 | 0.3 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.9 | GO:0031430 | M band(GO:0031430) |
0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.5 | GO:0005685 | U1 snRNP(GO:0005685) |
0.0 | 0.4 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
0.0 | 1.3 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 14.1 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 0.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 0.9 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.5 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 1.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 9.4 | GO:0005925 | focal adhesion(GO:0005925) |
0.0 | 0.0 | GO:0014802 | terminal cisterna(GO:0014802) |
0.0 | 0.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.9 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 2.1 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.3 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 0.6 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.1 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
0.0 | 0.6 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.6 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 1.0 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.0 | 1.0 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.3 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.0 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.0 | 0.5 | GO:0005882 | intermediate filament(GO:0005882) |
0.0 | 0.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.2 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 1.0 | GO:0030496 | midbody(GO:0030496) |
0.0 | 0.2 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.2 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.1 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 4.5 | GO:0098808 | mRNA cap binding(GO:0098808) |
1.0 | 4.2 | GO:0031685 | adenosine receptor binding(GO:0031685) |
1.0 | 3.1 | GO:0052831 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
0.9 | 2.8 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
0.9 | 2.7 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
0.8 | 0.8 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
0.7 | 3.0 | GO:0050421 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
0.7 | 2.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.7 | 3.5 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.7 | 2.1 | GO:0086020 | gap junction channel activity involved in SA node cell-atrial cardiac muscle cell electrical coupling(GO:0086020) |
0.7 | 0.7 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.7 | 2.7 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
0.7 | 2.0 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
0.7 | 5.9 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.6 | 1.9 | GO:0016826 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
0.6 | 3.0 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
0.6 | 2.4 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.6 | 1.8 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.6 | 3.3 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.5 | 1.6 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
0.5 | 2.7 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
0.5 | 4.8 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.5 | 1.6 | GO:0005174 | CD40 receptor binding(GO:0005174) |
0.5 | 1.6 | GO:0070119 | ciliary neurotrophic factor binding(GO:0070119) |
0.5 | 2.0 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
0.5 | 3.0 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.5 | 1.0 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.5 | 3.9 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
0.5 | 2.7 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
0.5 | 1.4 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
0.4 | 1.3 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
0.4 | 1.3 | GO:0070984 | SET domain binding(GO:0070984) |
0.4 | 0.9 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
0.4 | 1.7 | GO:0035939 | microsatellite binding(GO:0035939) |
0.4 | 1.7 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.4 | 1.3 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.4 | 4.0 | GO:0019826 | oxygen sensor activity(GO:0019826) |
0.4 | 0.4 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.4 | 1.9 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
0.4 | 1.1 | GO:0008431 | vitamin E binding(GO:0008431) |
0.4 | 0.7 | GO:0046332 | SMAD binding(GO:0046332) |
0.4 | 1.5 | GO:0004803 | transposase activity(GO:0004803) |
0.4 | 1.8 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.4 | 1.1 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
0.4 | 2.8 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.4 | 1.8 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
0.3 | 0.3 | GO:0043559 | insulin binding(GO:0043559) |
0.3 | 1.7 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
0.3 | 0.7 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.3 | 1.3 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.3 | 1.0 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
0.3 | 0.3 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.3 | 2.0 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
0.3 | 1.0 | GO:0016705 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen(GO:0016705) |
0.3 | 1.3 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.3 | 2.3 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.3 | 2.2 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
0.3 | 0.9 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
0.3 | 3.5 | GO:0008142 | oxysterol binding(GO:0008142) |
0.3 | 0.9 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
0.3 | 1.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.3 | 1.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.3 | 1.2 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.3 | 1.7 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
0.3 | 1.2 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.3 | 0.9 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.3 | 1.1 | GO:0004325 | ferrochelatase activity(GO:0004325) |
0.3 | 2.8 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.3 | 0.8 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.3 | 0.8 | GO:0008841 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
0.3 | 0.8 | GO:0004756 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
0.3 | 0.8 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
0.3 | 1.6 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
0.3 | 0.3 | GO:0031208 | POZ domain binding(GO:0031208) |
0.3 | 2.2 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
0.3 | 1.3 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
0.3 | 2.7 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.3 | 1.1 | GO:0003978 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
0.3 | 0.8 | GO:0042356 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
0.3 | 1.6 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.3 | 1.3 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.3 | 0.8 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.3 | 1.8 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.3 | 3.7 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.3 | 1.3 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
0.3 | 1.0 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
0.3 | 6.9 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.3 | 0.8 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
0.3 | 3.5 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.3 | 1.0 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
0.3 | 1.3 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.3 | 0.8 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
0.2 | 0.5 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.2 | 3.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.2 | 0.7 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
0.2 | 1.0 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.2 | 0.5 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
0.2 | 1.2 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
0.2 | 2.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.2 | 0.5 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.2 | 0.7 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.2 | 0.7 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
0.2 | 2.9 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.2 | 2.7 | GO:0016015 | morphogen activity(GO:0016015) |
0.2 | 5.5 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.2 | 1.0 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.2 | 0.7 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.2 | 2.3 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.2 | 3.7 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
0.2 | 0.9 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.2 | 0.2 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
0.2 | 0.7 | GO:0070361 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
0.2 | 0.7 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
0.2 | 2.2 | GO:0048495 | Roundabout binding(GO:0048495) |
0.2 | 0.7 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
0.2 | 0.7 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
0.2 | 0.7 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
0.2 | 1.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.2 | 0.4 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.2 | 2.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.2 | 1.3 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.2 | 0.2 | GO:0036033 | mediator complex binding(GO:0036033) |
0.2 | 0.9 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
0.2 | 0.7 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
0.2 | 1.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.2 | 2.6 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.2 | 6.2 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.2 | 0.9 | GO:0034602 | oxoglutarate dehydrogenase (NAD+) activity(GO:0034602) |
0.2 | 2.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.2 | 0.6 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
0.2 | 1.9 | GO:0043426 | MRF binding(GO:0043426) |
0.2 | 0.2 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.2 | 1.0 | GO:0038025 | reelin receptor activity(GO:0038025) |
0.2 | 1.0 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) |
0.2 | 5.8 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.2 | 0.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.2 | 0.8 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.2 | 0.8 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.2 | 0.8 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.2 | 1.2 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
0.2 | 5.8 | GO:0005112 | Notch binding(GO:0005112) |
0.2 | 0.6 | GO:0016730 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
0.2 | 1.0 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.2 | 4.6 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.2 | 1.2 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.2 | 1.2 | GO:0045569 | TRAIL binding(GO:0045569) |
0.2 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.2 | 5.4 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.2 | 0.8 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.2 | 1.4 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
0.2 | 1.2 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
0.2 | 2.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.2 | 0.4 | GO:0002060 | nucleobase binding(GO:0002054) purine nucleobase binding(GO:0002060) |
0.2 | 1.0 | GO:0046935 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.2 | 1.7 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.2 | 0.6 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
0.2 | 0.6 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
0.2 | 2.1 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
0.2 | 2.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.2 | 2.3 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.2 | 1.3 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.2 | 0.6 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
0.2 | 2.0 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.2 | 3.3 | GO:0030957 | Tat protein binding(GO:0030957) |
0.2 | 1.5 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
0.2 | 7.0 | GO:0017166 | vinculin binding(GO:0017166) |
0.2 | 0.5 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
0.2 | 0.2 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.2 | 0.5 | GO:0031762 | alpha-1A adrenergic receptor binding(GO:0031691) follicle-stimulating hormone receptor binding(GO:0031762) |
0.2 | 0.9 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.2 | 0.2 | GO:0004882 | androgen receptor activity(GO:0004882) |
0.2 | 0.7 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
0.2 | 0.7 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
0.2 | 0.7 | GO:0004913 | interleukin-4 receptor activity(GO:0004913) |
0.2 | 0.2 | GO:0005536 | glucose binding(GO:0005536) |
0.2 | 0.7 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
0.2 | 1.4 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
0.2 | 0.5 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
0.2 | 0.7 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.2 | 0.7 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.2 | 0.7 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.2 | 1.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.2 | 0.7 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
0.2 | 2.1 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
0.2 | 1.6 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.2 | 0.5 | GO:0050700 | CARD domain binding(GO:0050700) |
0.2 | 1.2 | GO:0034046 | poly(G) binding(GO:0034046) |
0.2 | 0.5 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.2 | 0.5 | GO:0086075 | gap junction channel activity involved in cardiac conduction electrical coupling(GO:0086075) |
0.2 | 3.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.2 | 0.5 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
0.2 | 1.2 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
0.2 | 1.0 | GO:1903135 | cupric ion binding(GO:1903135) |
0.2 | 3.9 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.2 | 1.0 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.2 | 0.7 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
0.2 | 0.3 | GO:0008061 | chitin binding(GO:0008061) |
0.2 | 0.8 | GO:0070905 | serine binding(GO:0070905) |
0.2 | 1.5 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.2 | 0.7 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.2 | 0.8 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.2 | 0.8 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
0.2 | 6.8 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.2 | 1.2 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.2 | 4.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.2 | 3.6 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.2 | 1.0 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.2 | 0.8 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.2 | 1.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.2 | 5.3 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.2 | 1.6 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.2 | 1.0 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.2 | 1.3 | GO:0003700 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
0.2 | 0.6 | GO:0031996 | thioesterase binding(GO:0031996) |
0.2 | 0.6 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.2 | 0.5 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
0.2 | 1.4 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.2 | 0.5 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.2 | 0.5 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.2 | 1.2 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.2 | 0.5 | GO:0032093 | SAM domain binding(GO:0032093) |
0.2 | 0.5 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
0.2 | 0.5 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
0.2 | 0.6 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
0.2 | 0.2 | GO:0001031 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) 5S rDNA binding(GO:0080084) |
0.2 | 0.9 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
0.2 | 1.4 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.2 | 0.5 | GO:0033149 | FFAT motif binding(GO:0033149) |
0.2 | 0.5 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
0.2 | 0.5 | GO:0000773 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
0.1 | 1.5 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.1 | 1.8 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 2.8 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 1.9 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 1.8 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.4 | GO:0003842 | 1-pyrroline-5-carboxylate dehydrogenase activity(GO:0003842) |
0.1 | 0.7 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.1 | 0.4 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.1 | 0.7 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.1 | 0.4 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
0.1 | 0.9 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 1.9 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.7 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
0.1 | 0.8 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.3 | GO:0043398 | HLH domain binding(GO:0043398) |
0.1 | 0.3 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
0.1 | 2.5 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 0.6 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
0.1 | 1.3 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
0.1 | 0.4 | GO:0004766 | spermidine synthase activity(GO:0004766) |
0.1 | 1.4 | GO:0051766 | inositol trisphosphate kinase activity(GO:0051766) |
0.1 | 0.3 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.1 | 0.6 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
0.1 | 0.4 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 2.1 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.7 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.1 | 1.1 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.8 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 1.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.8 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
0.1 | 0.7 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 5.0 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 2.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.1 | 2.0 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.1 | 1.6 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.7 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.1 | 0.5 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 3.3 | GO:0010857 | calcium-dependent protein kinase activity(GO:0010857) |
0.1 | 0.9 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
0.1 | 1.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.1 | 3.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 0.8 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.1 | 0.5 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
0.1 | 3.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.1 | 0.4 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
0.1 | 2.7 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
0.1 | 1.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 1.0 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.1 | 0.9 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 1.7 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.1 | 1.4 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 0.6 | GO:0042806 | fucose binding(GO:0042806) |
0.1 | 0.4 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.5 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
0.1 | 0.9 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
0.1 | 0.5 | GO:0070012 | oligopeptidase activity(GO:0070012) |
0.1 | 0.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 4.5 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.1 | 0.6 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 1.9 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.1 | 0.6 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.1 | 0.4 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
0.1 | 0.5 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
0.1 | 1.3 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 1.1 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.1 | 2.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 0.6 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
0.1 | 1.6 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.4 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.1 | 0.5 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.1 | 0.4 | GO:0051139 | metal ion:proton antiporter activity(GO:0051139) |
0.1 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
0.1 | 0.4 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.1 | 0.4 | GO:0000384 | first spliceosomal transesterification activity(GO:0000384) |
0.1 | 1.1 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.1 | 0.6 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.5 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.8 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 2.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.4 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
0.1 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 0.6 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.8 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 0.6 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
0.1 | 0.3 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
0.1 | 0.7 | GO:0052656 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
0.1 | 0.7 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 0.8 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 0.3 | GO:0004968 | gonadotropin-releasing hormone receptor activity(GO:0004968) |
0.1 | 0.2 | GO:0019239 | deaminase activity(GO:0019239) |
0.1 | 0.6 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
0.1 | 0.6 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
0.1 | 1.8 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.8 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.1 | 0.3 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.3 | GO:0047017 | prostaglandin-F synthase activity(GO:0047017) |
0.1 | 1.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.7 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.1 | 3.7 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.3 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
0.1 | 0.4 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 6.6 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.1 | 0.4 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 1.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.1 | 1.0 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.9 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.3 | GO:1990259 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
0.1 | 0.3 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.1 | 0.6 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.6 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 0.6 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 4.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.1 | 2.4 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.5 | GO:0060961 | phospholipase D inhibitor activity(GO:0060961) |
0.1 | 3.9 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 0.4 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
0.1 | 0.6 | GO:0004797 | thymidine kinase activity(GO:0004797) |
0.1 | 0.5 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 0.9 | GO:0032810 | sterol response element binding(GO:0032810) |
0.1 | 0.7 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.6 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
0.1 | 0.8 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.1 | 0.8 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.6 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.6 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 0.6 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 0.5 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 0.5 | GO:0031852 | opioid receptor binding(GO:0031628) mu-type opioid receptor binding(GO:0031852) |
0.1 | 1.5 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.9 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.6 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.3 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.1 | 1.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 0.9 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
0.1 | 0.1 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 0.5 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.1 | 0.4 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
0.1 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 1.0 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.7 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 4.0 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.1 | 0.5 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
0.1 | 1.0 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.1 | 1.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 5.1 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 4.0 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.1 | 0.3 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 0.3 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.4 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.5 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.1 | 0.6 | GO:0052841 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
0.1 | 2.1 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 2.0 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 1.0 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.5 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
0.1 | 1.4 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 1.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 2.1 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.3 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
0.1 | 0.7 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 4.2 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
0.1 | 3.6 | GO:0005123 | death receptor binding(GO:0005123) |
0.1 | 0.3 | GO:0004108 | citrate (Si)-synthase activity(GO:0004108) citrate synthase activity(GO:0036440) |
0.1 | 0.2 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.1 | 3.1 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 0.2 | GO:0089720 | caspase binding(GO:0089720) |
0.1 | 0.4 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
0.1 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.1 | 0.3 | GO:0004423 | iduronate-2-sulfatase activity(GO:0004423) |
0.1 | 0.5 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.1 | 1.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 0.5 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.1 | 0.3 | GO:0010309 | acireductone dioxygenase [iron(II)-requiring] activity(GO:0010309) |
0.1 | 4.7 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.1 | 0.4 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
0.1 | 0.2 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.1 | 0.5 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.8 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 3.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.1 | 4.8 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.1 | 0.5 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.2 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.1 | 0.8 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.1 | 0.6 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 0.3 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
0.1 | 1.7 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
0.1 | 0.7 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.9 | GO:0032183 | SUMO binding(GO:0032183) |
0.1 | 0.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 1.0 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
0.1 | 0.4 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
0.1 | 1.5 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 0.2 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.1 | 0.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.1 | 0.4 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 1.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 0.2 | GO:0032129 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
0.1 | 1.6 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.1 | GO:0004818 | glutamate-tRNA ligase activity(GO:0004818) |
0.1 | 4.5 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.5 | GO:0008732 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 1.3 | GO:0048185 | activin binding(GO:0048185) |
0.1 | 0.8 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
0.1 | 0.3 | GO:0004057 | arginyltransferase activity(GO:0004057) |
0.1 | 0.9 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 0.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.1 | 0.2 | GO:0003870 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
0.1 | 1.9 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 2.2 | GO:0034979 | NAD-dependent protein deacetylase activity(GO:0034979) |
0.1 | 1.1 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
0.1 | 0.8 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.8 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.2 | GO:0004794 | L-threonine ammonia-lyase activity(GO:0004794) |
0.1 | 1.0 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.8 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.1 | 0.4 | GO:0010736 | serum response element binding(GO:0010736) |
0.1 | 0.6 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.1 | 0.8 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.1 | 0.9 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.7 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.5 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
0.1 | 1.2 | GO:0005537 | mannose binding(GO:0005537) |
0.1 | 0.2 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
0.1 | 0.5 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 1.8 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 0.2 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.1 | 0.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.7 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
0.1 | 0.2 | GO:0032090 | Pyrin domain binding(GO:0032090) |
0.1 | 0.9 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.1 | 0.3 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
0.1 | 1.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.8 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 3.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 0.3 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.1 | 0.6 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.1 | 0.7 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 6.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 2.6 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 0.4 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 0.4 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.4 | GO:0019863 | IgE binding(GO:0019863) |
0.1 | 2.6 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 0.6 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.4 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.1 | 0.8 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.4 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.1 | 0.6 | GO:0051400 | BH domain binding(GO:0051400) |
0.1 | 0.4 | GO:0003909 | DNA ligase activity(GO:0003909) |
0.1 | 0.6 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
0.1 | 0.2 | GO:0043849 | Ras palmitoyltransferase activity(GO:0043849) |
0.1 | 0.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 0.4 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.1 | 0.4 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.1 | 0.1 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
0.1 | 0.1 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.1 | 0.2 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
0.1 | 1.5 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.4 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.1 | 0.4 | GO:0050780 | dopamine receptor binding(GO:0050780) |
0.1 | 2.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 3.9 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.1 | 0.3 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
0.1 | 0.3 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.2 | GO:0042805 | actinin binding(GO:0042805) |
0.1 | 1.4 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.1 | 0.4 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.8 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.1 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 0.2 | GO:0019783 | ubiquitin-like protein-specific protease activity(GO:0019783) |
0.1 | 0.3 | GO:0004866 | endopeptidase inhibitor activity(GO:0004866) |
0.1 | 1.5 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.1 | 0.3 | GO:0052642 | lysophosphatidic acid phosphatase activity(GO:0052642) |
0.1 | 0.3 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.1 | 1.8 | GO:0071949 | FAD binding(GO:0071949) |
0.1 | 0.2 | GO:0015067 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
0.1 | 2.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 3.9 | GO:0050699 | WW domain binding(GO:0050699) |
0.1 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.2 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
0.1 | 0.3 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
0.1 | 0.7 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.1 | 0.3 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.1 | 0.5 | GO:1990763 | arrestin family protein binding(GO:1990763) |
0.1 | 6.3 | GO:0002039 | p53 binding(GO:0002039) |
0.1 | 0.6 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.9 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.1 | 0.2 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.1 | 0.2 | GO:0004641 | phosphoribosylamine-glycine ligase activity(GO:0004637) phosphoribosylformylglycinamidine cyclo-ligase activity(GO:0004641) phosphoribosylglycinamide formyltransferase activity(GO:0004644) |
0.1 | 1.5 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 8.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.1 | 1.2 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.1 | 0.6 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
0.1 | 0.1 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.1 | 1.9 | GO:0004527 | exonuclease activity(GO:0004527) |
0.1 | 1.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.4 | GO:0008047 | enzyme activator activity(GO:0008047) |
0.1 | 0.4 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 0.2 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
0.1 | 0.2 | GO:0008940 | nitrate reductase activity(GO:0008940) |
0.1 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 1.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.6 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 1.6 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.1 | 0.2 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
0.1 | 31.4 | GO:0001159 | core promoter proximal region DNA binding(GO:0001159) |
0.1 | 0.5 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.2 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
0.1 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.1 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.1 | 0.2 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
0.1 | 0.5 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.1 | 0.5 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.1 | 0.5 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 14.6 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.1 | 0.1 | GO:0043532 | angiostatin binding(GO:0043532) |
0.1 | 0.5 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.3 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.1 | 0.1 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.1 | 0.5 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.1 | 0.5 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.1 | 0.2 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
0.1 | 2.0 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.1 | 0.2 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
0.1 | 2.2 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 0.2 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.1 | 0.8 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.1 | 1.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.1 | 0.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 0.4 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.9 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.1 | 1.3 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.5 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.1 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
0.1 | 0.1 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
0.1 | 0.1 | GO:0070026 | nitric oxide binding(GO:0070026) |
0.1 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 0.1 | GO:0004823 | leucine-tRNA ligase activity(GO:0004823) |
0.1 | 1.0 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.2 | GO:0004441 | inositol-1,4-bisphosphate 1-phosphatase activity(GO:0004441) inositol-1,3,4-trisphosphate 1-phosphatase activity(GO:0052829) |
0.0 | 0.1 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
0.0 | 0.9 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.6 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.5 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
0.0 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.4 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
0.0 | 0.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.4 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
0.0 | 0.6 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.8 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.4 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.4 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.1 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 1.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.3 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.0 | 1.7 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 1.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.1 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.0 | 0.6 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.4 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.6 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 2.1 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.4 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 1.4 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.5 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 1.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.5 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.0 | 0.6 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 1.4 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.0 | 0.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.7 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
0.0 | 1.3 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.3 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
0.0 | 0.0 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 1.9 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.1 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.0 | 0.1 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.2 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
0.0 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.1 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
0.0 | 0.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.2 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.8 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 2.6 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.2 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 1.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 2.3 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.3 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.5 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.3 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
0.0 | 0.3 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.0 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.5 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.3 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.0 | 0.1 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
0.0 | 1.5 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.1 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
0.0 | 0.2 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
0.0 | 0.2 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.0 | 0.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 0.2 | GO:0090409 | malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.0 | 0.1 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 5.7 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.5 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.0 | 0.1 | GO:0070259 | tyrosyl-DNA phosphodiesterase activity(GO:0070259) |
0.0 | 0.4 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.3 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.0 | 0.9 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 1.4 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.2 | GO:0051996 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
0.0 | 0.5 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.2 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
0.0 | 0.1 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 1.3 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.9 | GO:0030371 | translation repressor activity(GO:0030371) |
0.0 | 1.3 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.3 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.0 | 0.1 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) G-protein coupled glutamate receptor activity(GO:0098988) |
0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) fatty acid peroxidase activity(GO:0047888) |
0.0 | 0.4 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.2 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.0 | 0.5 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.6 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.0 | 2.1 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.4 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 1.5 | GO:0051219 | phosphoprotein binding(GO:0051219) |
0.0 | 0.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.3 | GO:0052795 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.1 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.1 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
0.0 | 0.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.0 | 0.1 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
0.0 | 0.9 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.9 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.0 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.0 | 0.3 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.1 | GO:0052857 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
0.0 | 0.3 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.6 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 4.4 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.1 | GO:0019205 | nucleobase-containing compound kinase activity(GO:0019205) |
0.0 | 0.5 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.0 | 0.2 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
0.0 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.2 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
0.0 | 0.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
0.0 | 0.1 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
0.0 | 0.1 | GO:0015432 | bile acid-exporting ATPase activity(GO:0015432) |
0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.4 | GO:0019887 | protein kinase regulator activity(GO:0019887) |
0.0 | 0.1 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.3 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.0 | 0.3 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.1 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 1.2 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 1.9 | GO:0050660 | flavin adenine dinucleotide binding(GO:0050660) |
0.0 | 0.1 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
0.0 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.6 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) lipoprotein particle receptor binding(GO:0070325) |
0.0 | 0.1 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.1 | GO:0008746 | NAD(P)+ transhydrogenase activity(GO:0008746) oxidoreductase activity, acting on NAD(P)H, NAD(P) as acceptor(GO:0016652) |
0.0 | 0.9 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 1.2 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.4 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
0.0 | 0.6 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.2 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.9 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.0 | 0.2 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.0 | 1.1 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.6 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
0.0 | 0.2 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
0.0 | 0.2 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.0 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.5 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.1 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
0.0 | 0.3 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.1 | GO:0008124 | phenylalanine 4-monooxygenase activity(GO:0004505) 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
0.0 | 0.1 | GO:0071633 | dihydroceramidase activity(GO:0071633) |
0.0 | 0.1 | GO:0019144 | ADP-sugar diphosphatase activity(GO:0019144) |
0.0 | 0.5 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.0 | 0.2 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.0 | 0.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 1.2 | GO:0051213 | dioxygenase activity(GO:0051213) |
0.0 | 0.7 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.0 | 0.1 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
0.0 | 5.4 | GO:0060090 | binding, bridging(GO:0060090) |
0.0 | 0.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.0 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
0.0 | 0.1 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
0.0 | 0.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.4 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.4 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.0 | 0.1 | GO:0051861 | glycolipid binding(GO:0051861) |
0.0 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0052871 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
0.0 | 0.1 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
0.0 | 0.2 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.0 | 0.0 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.1 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
0.0 | 0.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.4 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.4 | GO:0015929 | hexosaminidase activity(GO:0015929) |
0.0 | 0.1 | GO:0045159 | myosin II binding(GO:0045159) |
0.0 | 0.4 | GO:0043394 | proteoglycan binding(GO:0043394) |
0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.2 | GO:0008373 | sialyltransferase activity(GO:0008373) |
0.0 | 0.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.0 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
0.0 | 0.0 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.1 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.0 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.1 | GO:0004335 | galactokinase activity(GO:0004335) |
0.0 | 0.9 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 4.5 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
0.0 | 0.3 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.1 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.8 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.2 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.0 | 0.1 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
0.0 | 0.1 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.1 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
0.0 | 0.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.1 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
0.0 | 0.1 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
0.0 | 6.3 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.2 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 1.7 | GO:0016798 | hydrolase activity, acting on glycosyl bonds(GO:0016798) |
0.0 | 0.0 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 3.6 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.0 | 0.9 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 1.0 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.0 | 0.0 | GO:0001855 | complement component C4b binding(GO:0001855) |
0.0 | 0.2 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.2 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.1 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.1 | GO:0031013 | troponin I binding(GO:0031013) |
0.0 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 2.9 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.0 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
0.0 | 0.1 | GO:0004465 | lipoprotein lipase activity(GO:0004465) |
0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.0 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.0 | 0.1 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.1 | GO:0016213 | linoleoyl-CoA desaturase activity(GO:0016213) |
0.0 | 0.0 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.2 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.2 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 2.2 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.4 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.5 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.0 | 0.2 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.0 | 0.1 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.0 | GO:0098639 | protein binding involved in cell-matrix adhesion(GO:0098634) collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.4 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.0 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.5 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
0.0 | 1.0 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.1 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.2 | GO:0070330 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) aromatase activity(GO:0070330) |
0.0 | 0.1 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.2 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.0 | 0.0 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.6 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.0 | GO:0008892 | guanine deaminase activity(GO:0008892) |
0.0 | 0.0 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
0.0 | 0.0 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.2 | GO:0008527 | taste receptor activity(GO:0008527) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 1.2 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.6 | 1.1 | PID MYC PATHWAY | C-MYC pathway |
0.3 | 12.8 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.2 | 0.4 | ST GAQ PATHWAY | G alpha q Pathway |
0.2 | 1.0 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.2 | 0.8 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.2 | 2.3 | ST STAT3 PATHWAY | STAT3 Pathway |
0.2 | 8.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.2 | 0.4 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.2 | 4.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.2 | 1.2 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.2 | 2.5 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.2 | 1.3 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.2 | 0.5 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.2 | 10.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.1 | 3.9 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 1.0 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 11.1 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 2.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 0.9 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.1 | 4.6 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 1.3 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 6.1 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 11.7 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.1 | 6.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 2.4 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 2.6 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 0.8 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.1 | 0.5 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 1.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 3.2 | PID ARF 3PATHWAY | Arf1 pathway |
0.1 | 6.4 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.1 | 0.8 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 1.9 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 0.3 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.1 | 4.8 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.1 | 6.7 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 5.9 | NABA COLLAGENS | Genes encoding collagen proteins |
0.1 | 10.8 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.1 | 2.0 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 5.0 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.1 | 2.0 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 9.7 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.1 | 1.9 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.1 | 1.8 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 4.5 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.1 | 0.4 | PID ENDOTHELIN PATHWAY | Endothelins |
0.1 | 1.8 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 3.4 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.1 | 3.4 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 1.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.1 | 1.9 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.1 | 2.5 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 3.6 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.1 | 0.8 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 1.9 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 6.4 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 4.1 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.1 | 5.4 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.1 | 2.9 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.1 | 0.5 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.1 | 0.4 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 1.6 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.1 | 0.9 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.1 | 2.4 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.1 | 2.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 0.5 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.1 | 15.3 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.1 | 1.3 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.1 | 1.3 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 2.8 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 1.1 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.7 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 4.5 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 2.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.9 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 2.9 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 1.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 1.8 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 2.9 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 1.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 3.2 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.9 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.3 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.2 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 2.5 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 1.0 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 2.0 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.0 | 1.1 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 1.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.7 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 1.3 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.8 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.2 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.3 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.7 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 1.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.9 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 1.4 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 4.8 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.5 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 1.0 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.5 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.5 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.3 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 2.5 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.0 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.8 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.2 | 4.5 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.2 | 3.9 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.2 | 6.9 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.2 | 4.0 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.2 | 1.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.2 | 0.2 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.2 | 0.7 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.2 | 9.6 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.2 | 1.4 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.2 | 5.0 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.2 | 7.0 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.2 | 1.4 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 0.4 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 6.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 0.1 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
0.1 | 4.2 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.1 | 3.0 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 2.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 1.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 2.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.1 | 0.5 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
0.1 | 1.4 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 3.5 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 4.8 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 2.4 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 0.7 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 1.1 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.1 | 3.0 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.1 | 0.3 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 1.7 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 0.8 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
0.1 | 2.7 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.1 | 2.9 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 2.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 2.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.1 | 1.9 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.1 | 0.6 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 6.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 1.8 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 4.3 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 1.1 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.1 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 3.0 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 5.6 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.1 | 3.5 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 3.5 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.1 | 3.4 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.1 | 2.7 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.1 | 1.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 0.9 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.1 | 2.0 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 2.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.1 | 10.3 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.1 | 3.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.1 | 1.6 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 2.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 2.2 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.1 | 1.7 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.1 | 1.8 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 6.5 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.1 | 3.8 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.1 | 0.1 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.1 | 0.1 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.1 | 1.6 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 1.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 0.3 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.1 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 6.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 6.5 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.1 | 0.6 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
0.1 | 2.8 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 1.5 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 0.6 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.1 | 1.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 4.8 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 2.0 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.1 | 0.9 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 3.0 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 0.9 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.1 | 0.7 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.1 | 0.3 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 3.7 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.1 | 0.6 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.1 | 0.5 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 9.9 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.1 | 1.1 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 1.2 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.1 | 2.0 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.1 | 1.3 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 1.4 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 8.9 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 1.6 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.8 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 1.2 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 1.6 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.5 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 1.3 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 1.1 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 1.0 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 1.1 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.4 | REACTOME RNA POL III TRANSCRIPTION | Genes involved in RNA Polymerase III Transcription |
0.0 | 0.4 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.7 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.7 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.9 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 1.1 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 1.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.7 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.3 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 1.0 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 1.2 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 3.4 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.3 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 3.0 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.3 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.0 | 0.6 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.2 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 1.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.8 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.0 | 0.7 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 1.1 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 0.2 | REACTOME UNFOLDED PROTEIN RESPONSE | Genes involved in Unfolded Protein Response |
0.0 | 0.7 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 1.8 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 1.5 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.8 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 1.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.9 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 3.3 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.5 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.0 | 0.5 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.6 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 1.0 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 0.9 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.1 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 1.1 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 1.9 | REACTOME METABOLISM OF CARBOHYDRATES | Genes involved in Metabolism of carbohydrates |
0.0 | 0.5 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.9 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |