avrg: A549 cells infected with RSV Analysis Results (GEO series: GSE147507)
Gene Symbol | Gene ID | Gene Info |
---|---|---|
TFAP2C
|
ENSG00000087510.5 | TFAP2C |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
TFAP2C | hg19_v2_chr20_+_55204351_55204377 | -0.97 | 2.9e-02 | Click! |
Promoter | Score | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr15_-_74284558 | 0.95 |
ENST00000359750.4 ENST00000541638.1 ENST00000562453.1 |
STOML1 |
stomatin (EPB72)-like 1 |
chr11_-_47616210 | 0.90 |
ENST00000302514.3 |
C1QTNF4 |
C1q and tumor necrosis factor related protein 4 |
chr4_+_17579110 | 0.89 |
ENST00000606142.1 |
LAP3 |
leucine aminopeptidase 3 |
chr21_+_38338737 | 0.84 |
ENST00000430068.1 |
AP000704.5 |
AP000704.5 |
chr20_-_35580104 | 0.82 |
ENST00000373694.5 |
SAMHD1 |
SAM domain and HD domain 1 |
chr4_+_17578815 | 0.80 |
ENST00000226299.4 |
LAP3 |
leucine aminopeptidase 3 |
chr7_+_111846741 | 0.77 |
ENST00000421043.1 ENST00000425229.1 ENST00000450657.1 |
ZNF277 |
zinc finger protein 277 |
chrX_-_108868390 | 0.76 |
ENST00000372101.2 |
KCNE1L |
KCNE1-like |
chr19_+_35521699 | 0.75 |
ENST00000415950.3 |
SCN1B |
sodium channel, voltage-gated, type I, beta subunit |
chr20_-_35580240 | 0.74 |
ENST00000262878.4 |
SAMHD1 |
SAM domain and HD domain 1 |
chr19_-_51289374 | 0.70 |
ENST00000563228.1 |
CTD-2568A17.1 |
CTD-2568A17.1 |
chr19_+_39279838 | 0.70 |
ENST00000314980.4 |
LGALS7B |
lectin, galactoside-binding, soluble, 7B |
chr6_-_169563013 | 0.69 |
ENST00000439703.1 |
RP11-417E7.1 |
RP11-417E7.1 |
chr6_+_13272904 | 0.69 |
ENST00000379335.3 ENST00000379329.1 |
PHACTR1 |
phosphatase and actin regulator 1 |
chr11_+_130184888 | 0.66 |
ENST00000602376.1 ENST00000532116.3 ENST00000602310.1 |
RP11-121M22.1 |
RP11-121M22.1 |
chr1_-_153521714 | 0.66 |
ENST00000368713.3 |
S100A3 |
S100 calcium binding protein A3 |
chr5_-_168727786 | 0.65 |
ENST00000332966.8 |
SLIT3 |
slit homolog 3 (Drosophila) |
chr14_-_62162541 | 0.60 |
ENST00000557544.1 |
HIF1A-AS1 |
HIF1A antisense RNA 1 |
chr1_-_6321035 | 0.60 |
ENST00000377893.2 |
GPR153 |
G protein-coupled receptor 153 |
chr19_-_55628927 | 0.59 |
ENST00000263433.3 ENST00000376393.2 |
PPP1R12C |
protein phosphatase 1, regulatory subunit 12C |
chr12_+_113495492 | 0.59 |
ENST00000257600.3 |
DTX1 |
deltex homolog 1 (Drosophila) |
chr6_-_160147925 | 0.58 |
ENST00000535561.1 |
SOD2 |
superoxide dismutase 2, mitochondrial |
chr19_-_39832563 | 0.57 |
ENST00000599274.1 |
CTC-246B18.10 |
CTC-246B18.10 |
chr9_-_21368075 | 0.57 |
ENST00000449498.1 |
IFNA13 |
interferon, alpha 13 |
chr6_-_160148356 | 0.57 |
ENST00000401980.3 ENST00000545162.1 |
SOD2 |
superoxide dismutase 2, mitochondrial |
chr1_-_27998689 | 0.57 |
ENST00000339145.4 ENST00000362020.4 ENST00000361157.6 |
IFI6 |
interferon, alpha-inducible protein 6 |
chr1_+_180165672 | 0.56 |
ENST00000443059.1 |
QSOX1 |
quiescin Q6 sulfhydryl oxidase 1 |
chr9_+_130159433 | 0.56 |
ENST00000451404.1 |
SLC2A8 |
solute carrier family 2 (facilitated glucose transporter), member 8 |
chr19_+_35521572 | 0.56 |
ENST00000262631.5 |
SCN1B |
sodium channel, voltage-gated, type I, beta subunit |
chr11_+_60691924 | 0.56 |
ENST00000544065.1 ENST00000453848.2 ENST00000005286.4 |
TMEM132A |
transmembrane protein 132A |
chr6_+_29691198 | 0.56 |
ENST00000440587.2 ENST00000434407.2 |
HLA-F |
major histocompatibility complex, class I, F |
chr22_-_24622080 | 0.55 |
ENST00000425408.1 |
GGT5 |
gamma-glutamyltransferase 5 |
chr11_+_118826999 | 0.54 |
ENST00000264031.2 |
UPK2 |
uroplakin 2 |
chr1_+_44401479 | 0.54 |
ENST00000438616.3 |
ARTN |
artemin |
chr2_-_25100893 | 0.53 |
ENST00000433852.1 |
ADCY3 |
adenylate cyclase 3 |
chr8_-_144512576 | 0.53 |
ENST00000333480.2 |
MAFA |
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog A |
chr19_+_49109990 | 0.53 |
ENST00000321762.1 |
SPACA4 |
sperm acrosome associated 4 |
chr18_+_77439775 | 0.53 |
ENST00000299543.7 ENST00000075430.7 |
CTDP1 |
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) phosphatase, subunit 1 |
chr11_+_61735266 | 0.52 |
ENST00000601917.1 |
AP003733.1 |
Uncharacterized protein; cDNA FLJ36460 fis, clone THYMU2014801 |
chr6_+_29691056 | 0.51 |
ENST00000414333.1 ENST00000334668.4 ENST00000259951.7 |
HLA-F |
major histocompatibility complex, class I, F |
chr8_-_123706338 | 0.51 |
ENST00000521608.1 |
RP11-973F15.1 |
long intergenic non-protein coding RNA 1151 |
chr15_-_74284613 | 0.51 |
ENST00000316911.6 ENST00000564777.1 ENST00000566081.1 ENST00000316900.5 |
STOML1 |
stomatin (EPB72)-like 1 |
chr12_+_111843749 | 0.50 |
ENST00000341259.2 |
SH2B3 |
SH2B adaptor protein 3 |
chr17_+_7758374 | 0.50 |
ENST00000301599.6 ENST00000574668.1 |
TMEM88 |
transmembrane protein 88 |
chr19_-_55881741 | 0.50 |
ENST00000264563.2 ENST00000590625.1 ENST00000585513.1 |
IL11 |
interleukin 11 |
chr17_-_54991395 | 0.50 |
ENST00000316881.4 |
TRIM25 |
tripartite motif containing 25 |
chr4_-_8873531 | 0.49 |
ENST00000400677.3 |
HMX1 |
H6 family homeobox 1 |
chr22_-_37640277 | 0.49 |
ENST00000401529.3 ENST00000249071.6 |
RAC2 |
ras-related C3 botulinum toxin substrate 2 (rho family, small GTP binding protein Rac2) |
chr8_-_145086922 | 0.49 |
ENST00000530478.1 |
PARP10 |
poly (ADP-ribose) polymerase family, member 10 |
chr19_+_8429031 | 0.49 |
ENST00000301455.2 ENST00000541807.1 ENST00000393962.2 |
ANGPTL4 |
angiopoietin-like 4 |
chr22_-_39096981 | 0.49 |
ENST00000427389.1 |
JOSD1 |
Josephin domain containing 1 |
chr3_+_187086120 | 0.48 |
ENST00000259030.2 |
RTP4 |
receptor (chemosensory) transporter protein 4 |
chr4_+_7194247 | 0.48 |
ENST00000507866.2 |
SORCS2 |
sortilin-related VPS10 domain containing receptor 2 |
chr2_-_7005785 | 0.48 |
ENST00000256722.5 ENST00000404168.1 ENST00000458098.1 |
CMPK2 |
cytidine monophosphate (UMP-CMP) kinase 2, mitochondrial |
chr15_-_66679019 | 0.48 |
ENST00000568216.1 ENST00000562124.1 ENST00000570251.1 |
TIPIN |
TIMELESS interacting protein |
chr10_-_135171510 | 0.46 |
ENST00000278025.4 ENST00000368552.3 |
FUOM |
fucose mutarotase |
chr19_-_31840130 | 0.46 |
ENST00000558569.1 |
TSHZ3 |
teashirt zinc finger homeobox 3 |
chr9_+_137533615 | 0.45 |
ENST00000371817.3 |
COL5A1 |
collagen, type V, alpha 1 |
chr16_-_51185149 | 0.45 |
ENST00000566102.1 ENST00000541611.1 |
SALL1 |
spalt-like transcription factor 1 |
chr19_-_38743878 | 0.45 |
ENST00000587515.1 |
PPP1R14A |
protein phosphatase 1, regulatory (inhibitor) subunit 14A |
chr3_-_48632593 | 0.45 |
ENST00000454817.1 ENST00000328333.8 |
COL7A1 |
collagen, type VII, alpha 1 |
chr16_-_4784128 | 0.45 |
ENST00000592711.1 ENST00000590147.1 ENST00000304283.4 ENST00000592190.1 ENST00000589065.1 ENST00000585773.1 ENST00000450067.2 ENST00000592698.1 ENST00000586166.1 ENST00000586605.1 ENST00000592421.1 |
ANKS3 |
ankyrin repeat and sterile alpha motif domain containing 3 |
chr8_+_25042192 | 0.45 |
ENST00000410074.1 |
DOCK5 |
dedicator of cytokinesis 5 |
chr1_+_17634689 | 0.44 |
ENST00000375453.1 ENST00000375448.4 |
PADI4 |
peptidyl arginine deiminase, type IV |
chr19_+_35532612 | 0.44 |
ENST00000600390.1 ENST00000597419.1 |
HPN |
hepsin |
chr15_-_64338521 | 0.43 |
ENST00000457488.1 ENST00000558069.1 |
DAPK2 |
death-associated protein kinase 2 |
chr19_-_49016847 | 0.43 |
ENST00000598924.1 |
CTC-273B12.10 |
CTC-273B12.10 |
chr17_+_7483761 | 0.43 |
ENST00000584180.1 |
CD68 |
CD68 molecule |
chr12_-_125398850 | 0.43 |
ENST00000535859.1 ENST00000546271.1 ENST00000540700.1 ENST00000546120.1 |
UBC |
ubiquitin C |
chr5_-_172756506 | 0.43 |
ENST00000265087.4 |
STC2 |
stanniocalcin 2 |
chr11_+_313503 | 0.43 |
ENST00000528780.1 ENST00000328221.5 |
IFITM1 |
interferon induced transmembrane protein 1 |
chr4_-_56502426 | 0.42 |
ENST00000505262.1 ENST00000507338.1 |
NMU |
neuromedin U |
chr6_-_47445214 | 0.42 |
ENST00000604014.1 |
RP11-385F7.1 |
RP11-385F7.1 |
chr3_-_50540854 | 0.42 |
ENST00000423994.2 ENST00000424201.2 ENST00000479441.1 ENST00000429770.1 |
CACNA2D2 |
calcium channel, voltage-dependent, alpha 2/delta subunit 2 |
chr15_+_63188009 | 0.42 |
ENST00000557900.1 |
RP11-1069G10.2 |
RP11-1069G10.2 |
chr7_+_100770328 | 0.42 |
ENST00000223095.4 ENST00000445463.2 |
SERPINE1 |
serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1 |
chr17_+_7462103 | 0.42 |
ENST00000396545.4 |
TNFSF13 |
tumor necrosis factor (ligand) superfamily, member 13 |
chr12_+_48152774 | 0.41 |
ENST00000549243.1 |
SLC48A1 |
solute carrier family 48 (heme transporter), member 1 |
chr21_+_47063590 | 0.41 |
ENST00000400314.1 |
PCBP3 |
poly(rC) binding protein 3 |
chr7_+_100464760 | 0.41 |
ENST00000200457.4 |
TRIP6 |
thyroid hormone receptor interactor 6 |
chr19_-_38720294 | 0.41 |
ENST00000412732.1 ENST00000456296.1 |
DPF1 |
D4, zinc and double PHD fingers family 1 |
chr4_+_2965307 | 0.41 |
ENST00000398051.4 ENST00000503518.2 ENST00000398052.4 ENST00000345167.6 ENST00000504933.1 ENST00000442472.2 |
GRK4 |
G protein-coupled receptor kinase 4 |
chr6_-_35888858 | 0.41 |
ENST00000507909.1 |
SRPK1 |
SRSF protein kinase 1 |
chrX_+_153237740 | 0.40 |
ENST00000369982.4 |
TMEM187 |
transmembrane protein 187 |
chr18_-_61089611 | 0.40 |
ENST00000591519.1 |
VPS4B |
vacuolar protein sorting 4 homolog B (S. cerevisiae) |
chr11_+_57308979 | 0.40 |
ENST00000457912.1 |
SMTNL1 |
smoothelin-like 1 |
chr13_+_110959598 | 0.40 |
ENST00000360467.5 |
COL4A2 |
collagen, type IV, alpha 2 |
chr4_-_24914576 | 0.40 |
ENST00000502801.1 ENST00000428116.2 |
CCDC149 |
coiled-coil domain containing 149 |
chr10_+_75670862 | 0.40 |
ENST00000446342.1 ENST00000372764.3 ENST00000372762.4 |
PLAU |
plasminogen activator, urokinase |
chr9_+_139839711 | 0.40 |
ENST00000224181.3 |
C8G |
complement component 8, gamma polypeptide |
chr19_-_13213954 | 0.40 |
ENST00000590974.1 |
LYL1 |
lymphoblastic leukemia derived sequence 1 |
chr19_+_51815102 | 0.39 |
ENST00000270642.8 |
IGLON5 |
IgLON family member 5 |
chr11_-_129872672 | 0.39 |
ENST00000531431.1 ENST00000527581.1 |
PRDM10 |
PR domain containing 10 |
chr12_-_53228079 | 0.39 |
ENST00000330553.5 |
KRT79 |
keratin 79 |
chr9_+_131902346 | 0.39 |
ENST00000432124.1 ENST00000435305.1 |
PPP2R4 |
protein phosphatase 2A activator, regulatory subunit 4 |
chr20_+_388056 | 0.39 |
ENST00000411647.1 |
RBCK1 |
RanBP-type and C3HC4-type zinc finger containing 1 |
chr11_+_74951948 | 0.39 |
ENST00000562197.2 |
TPBGL |
trophoblast glycoprotein-like |
chr21_-_36260980 | 0.39 |
ENST00000344691.4 ENST00000358356.5 |
RUNX1 |
runt-related transcription factor 1 |
chr17_+_19030782 | 0.38 |
ENST00000344415.4 ENST00000577213.1 |
GRAPL |
GRB2-related adaptor protein-like |
chr19_-_19739321 | 0.38 |
ENST00000588461.1 |
LPAR2 |
lysophosphatidic acid receptor 2 |
chr16_+_69139467 | 0.38 |
ENST00000569188.1 |
HAS3 |
hyaluronan synthase 3 |
chr8_-_145559943 | 0.38 |
ENST00000332135.4 |
SCRT1 |
scratch family zinc finger 1 |
chr17_+_74381343 | 0.38 |
ENST00000392496.3 |
SPHK1 |
sphingosine kinase 1 |
chr9_+_130159409 | 0.38 |
ENST00000373371.3 |
SLC2A8 |
solute carrier family 2 (facilitated glucose transporter), member 8 |
chr11_-_61348292 | 0.38 |
ENST00000539008.1 ENST00000540677.1 ENST00000542836.1 ENST00000542670.1 ENST00000535826.1 ENST00000545053.1 |
SYT7 |
synaptotagmin VII |
chr5_-_131826457 | 0.38 |
ENST00000437654.1 ENST00000245414.4 |
IRF1 |
interferon regulatory factor 1 |
chr17_+_74380683 | 0.38 |
ENST00000592299.1 ENST00000590959.1 ENST00000323374.4 |
SPHK1 |
sphingosine kinase 1 |
chr22_-_37640456 | 0.38 |
ENST00000405484.1 ENST00000441619.1 ENST00000406508.1 |
RAC2 |
ras-related C3 botulinum toxin substrate 2 (rho family, small GTP binding protein Rac2) |
chr3_+_48507621 | 0.38 |
ENST00000456089.1 |
TREX1 |
three prime repair exonuclease 1 |
chr13_-_99738867 | 0.38 |
ENST00000427887.1 |
DOCK9 |
dedicator of cytokinesis 9 |
chr17_-_54991369 | 0.38 |
ENST00000537230.1 |
TRIM25 |
tripartite motif containing 25 |
chr13_+_98795664 | 0.38 |
ENST00000376581.5 |
FARP1 |
FERM, RhoGEF (ARHGEF) and pleckstrin domain protein 1 (chondrocyte-derived) |
chr13_+_111805980 | 0.37 |
ENST00000491775.1 ENST00000466143.1 ENST00000544132.1 |
ARHGEF7 |
Rho guanine nucleotide exchange factor (GEF) 7 |
chr17_-_4448361 | 0.37 |
ENST00000572759.1 |
MYBBP1A |
MYB binding protein (P160) 1a |
chr11_+_64053311 | 0.37 |
ENST00000540370.1 |
GPR137 |
G protein-coupled receptor 137 |
chr10_+_43572475 | 0.37 |
ENST00000355710.3 ENST00000498820.1 ENST00000340058.5 |
RET |
ret proto-oncogene |
chr19_-_6720686 | 0.37 |
ENST00000245907.6 |
C3 |
complement component 3 |
chr4_+_130014836 | 0.37 |
ENST00000502887.1 |
C4orf33 |
chromosome 4 open reading frame 33 |
chr2_-_74776586 | 0.36 |
ENST00000420535.1 |
LOXL3 |
lysyl oxidase-like 3 |
chr1_+_3689325 | 0.36 |
ENST00000444870.2 ENST00000452264.1 |
SMIM1 |
small integral membrane protein 1 (Vel blood group) |
chr9_+_90341024 | 0.36 |
ENST00000340342.6 ENST00000342020.5 |
CTSL |
cathepsin L |
chr12_-_124457163 | 0.36 |
ENST00000535556.1 |
CCDC92 |
coiled-coil domain containing 92 |
chr1_-_226111929 | 0.36 |
ENST00000343818.6 ENST00000432920.2 |
PYCR2 RP4-559A3.7 |
pyrroline-5-carboxylate reductase family, member 2 Uncharacterized protein |
chr3_+_158450143 | 0.35 |
ENST00000491804.1 |
MFSD1 |
major facilitator superfamily domain containing 1 |
chr19_+_57154508 | 0.35 |
ENST00000598409.1 |
SMIM17 |
small integral membrane protein 17 |
chr16_-_88772670 | 0.35 |
ENST00000562544.1 |
RNF166 |
ring finger protein 166 |
chr16_+_56642489 | 0.35 |
ENST00000561491.1 |
MT2A |
metallothionein 2A |
chr20_+_4129426 | 0.35 |
ENST00000339123.6 ENST00000305958.4 ENST00000278795.3 |
SMOX |
spermine oxidase |
chr1_+_155100342 | 0.34 |
ENST00000368406.2 |
EFNA1 |
ephrin-A1 |
chr14_+_75988768 | 0.34 |
ENST00000286639.6 |
BATF |
basic leucine zipper transcription factor, ATF-like |
chr2_+_219264466 | 0.34 |
ENST00000273062.2 |
CTDSP1 |
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase 1 |
chr11_-_66103932 | 0.34 |
ENST00000311320.4 |
RIN1 |
Ras and Rab interactor 1 |
chr19_+_19431490 | 0.34 |
ENST00000392313.6 ENST00000262815.8 ENST00000609122.1 |
MAU2 |
MAU2 sister chromatid cohesion factor |
chr11_-_66104237 | 0.34 |
ENST00000530056.1 |
RIN1 |
Ras and Rab interactor 1 |
chr19_-_12912601 | 0.34 |
ENST00000334482.5 |
PRDX2 |
peroxiredoxin 2 |
chr16_+_84002234 | 0.34 |
ENST00000305202.4 |
NECAB2 |
N-terminal EF-hand calcium binding protein 2 |
chr4_+_89299994 | 0.34 |
ENST00000264346.7 |
HERC6 |
HECT and RLD domain containing E3 ubiquitin protein ligase family member 6 |
chr12_+_53895052 | 0.34 |
ENST00000552857.1 |
TARBP2 |
TAR (HIV-1) RNA binding protein 2 |
chr1_+_249132512 | 0.33 |
ENST00000505503.1 |
ZNF672 |
zinc finger protein 672 |
chr19_-_10213335 | 0.33 |
ENST00000592641.1 ENST00000253109.4 |
ANGPTL6 |
angiopoietin-like 6 |
chr1_+_92414952 | 0.33 |
ENST00000449584.1 ENST00000427104.1 ENST00000355011.3 ENST00000448194.1 ENST00000426141.1 ENST00000450792.1 ENST00000548992.1 ENST00000552654.1 ENST00000457265.1 |
BRDT |
bromodomain, testis-specific |
chr11_+_66025091 | 0.33 |
ENST00000526758.1 ENST00000440228.2 |
KLC2 |
kinesin light chain 2 |
chr4_+_89299885 | 0.33 |
ENST00000380265.5 ENST00000273960.3 |
HERC6 |
HECT and RLD domain containing E3 ubiquitin protein ligase family member 6 |
chr11_+_65122216 | 0.33 |
ENST00000309880.5 |
TIGD3 |
tigger transposable element derived 3 |
chr11_+_60635035 | 0.33 |
ENST00000278853.5 |
ZP1 |
zona pellucida glycoprotein 1 (sperm receptor) |
chr17_+_26662679 | 0.33 |
ENST00000578158.1 |
TNFAIP1 |
tumor necrosis factor, alpha-induced protein 1 (endothelial) |
chr19_-_2721412 | 0.33 |
ENST00000323469.4 |
DIRAS1 |
DIRAS family, GTP-binding RAS-like 1 |
chr6_+_34204642 | 0.33 |
ENST00000347617.6 ENST00000401473.3 ENST00000311487.5 ENST00000447654.1 ENST00000395004.3 |
HMGA1 |
high mobility group AT-hook 1 |
chr19_-_51017881 | 0.33 |
ENST00000601207.1 ENST00000598657.1 ENST00000376916.3 |
ASPDH |
aspartate dehydrogenase domain containing |
chr1_-_41950342 | 0.33 |
ENST00000372587.4 |
EDN2 |
endothelin 2 |
chr19_+_45204630 | 0.33 |
ENST00000405314.2 |
CEACAM16 |
carcinoembryonic antigen-related cell adhesion molecule 16 |
chr17_+_74372662 | 0.33 |
ENST00000591651.1 ENST00000545180.1 |
SPHK1 |
sphingosine kinase 1 |
chr3_-_50378343 | 0.33 |
ENST00000359365.4 |
RASSF1 |
Ras association (RalGDS/AF-6) domain family member 1 |
chr10_+_124221036 | 0.33 |
ENST00000368984.3 |
HTRA1 |
HtrA serine peptidase 1 |
chr5_-_172755056 | 0.33 |
ENST00000520648.1 |
STC2 |
stanniocalcin 2 |
chr19_+_16254488 | 0.32 |
ENST00000588246.1 ENST00000593031.1 |
HSH2D |
hematopoietic SH2 domain containing |
chrX_+_56259316 | 0.32 |
ENST00000468660.1 |
KLF8 |
Kruppel-like factor 8 |
chr11_-_64570706 | 0.32 |
ENST00000294066.2 ENST00000377350.3 |
MAP4K2 |
mitogen-activated protein kinase kinase kinase kinase 2 |
chr5_-_176827631 | 0.32 |
ENST00000358571.2 |
PFN3 |
profilin 3 |
chr22_-_42310570 | 0.32 |
ENST00000457093.1 |
SHISA8 |
shisa family member 8 |
chr14_-_102026643 | 0.32 |
ENST00000555882.1 ENST00000554441.1 ENST00000553729.1 ENST00000557109.1 ENST00000557532.1 ENST00000554694.1 ENST00000554735.1 ENST00000555174.1 ENST00000557661.1 |
DIO3OS |
DIO3 opposite strand/antisense RNA (head to head) |
chr17_-_39769005 | 0.32 |
ENST00000301653.4 ENST00000593067.1 |
KRT16 |
keratin 16 |
chr2_+_27071292 | 0.32 |
ENST00000431402.1 ENST00000434719.1 |
DPYSL5 |
dihydropyrimidinase-like 5 |
chr6_+_90192974 | 0.32 |
ENST00000520458.1 |
ANKRD6 |
ankyrin repeat domain 6 |
chr15_+_66679155 | 0.32 |
ENST00000307102.5 |
MAP2K1 |
mitogen-activated protein kinase kinase 1 |
chr17_-_81009636 | 0.31 |
ENST00000320865.3 |
B3GNTL1 |
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase-like 1 |
chr17_+_1959369 | 0.31 |
ENST00000576444.1 ENST00000322941.3 |
HIC1 |
hypermethylated in cancer 1 |
chr17_-_79919154 | 0.31 |
ENST00000409678.3 |
NOTUM |
notum pectinacetylesterase homolog (Drosophila) |
chr6_-_97285336 | 0.31 |
ENST00000229955.3 ENST00000417980.1 |
GPR63 |
G protein-coupled receptor 63 |
chr2_+_7005959 | 0.31 |
ENST00000442639.1 |
RSAD2 |
radical S-adenosyl methionine domain containing 2 |
chr3_-_52273098 | 0.31 |
ENST00000499914.2 ENST00000305533.5 ENST00000597542.1 |
TWF2 TLR9 |
twinfilin actin-binding protein 2 toll-like receptor 9 |
chr20_+_4129496 | 0.31 |
ENST00000346595.2 |
SMOX |
spermine oxidase |
chr11_+_46402482 | 0.31 |
ENST00000441869.1 |
MDK |
midkine (neurite growth-promoting factor 2) |
chr22_-_36635225 | 0.31 |
ENST00000529194.1 |
APOL2 |
apolipoprotein L, 2 |
chr19_-_8373173 | 0.31 |
ENST00000537716.2 ENST00000301458.5 |
CD320 |
CD320 molecule |
chr22_+_19744226 | 0.31 |
ENST00000332710.4 ENST00000329705.7 ENST00000359500.3 |
TBX1 |
T-box 1 |
chr2_-_27434635 | 0.31 |
ENST00000401463.1 |
SLC5A6 |
solute carrier family 5 (sodium/multivitamin and iodide cotransporter), member 6 |
chr14_-_67859422 | 0.31 |
ENST00000556532.1 |
PLEK2 |
pleckstrin 2 |
chr7_+_99156393 | 0.31 |
ENST00000422164.1 ENST00000422647.1 ENST00000427931.1 |
ZNF655 |
zinc finger protein 655 |
chr2_-_27498208 | 0.31 |
ENST00000424577.1 ENST00000426569.1 |
SLC30A3 |
solute carrier family 30 (zinc transporter), member 3 |
chr2_-_74781061 | 0.30 |
ENST00000264094.3 ENST00000393937.2 ENST00000409986.1 |
LOXL3 |
lysyl oxidase-like 3 |
chr22_-_20256054 | 0.30 |
ENST00000043402.7 |
RTN4R |
reticulon 4 receptor |
chr11_+_72929319 | 0.30 |
ENST00000393597.2 ENST00000311131.2 |
P2RY2 |
purinergic receptor P2Y, G-protein coupled, 2 |
chr9_-_139258159 | 0.30 |
ENST00000371739.3 |
DNLZ |
DNL-type zinc finger |
chr16_-_30217365 | 0.30 |
ENST00000568353.2 ENST00000549390.1 |
RP11-347C12.3 |
Uncharacterized protein |
chr20_+_62369623 | 0.30 |
ENST00000467211.1 |
RP4-583P15.14 |
RP4-583P15.14 |
chr2_-_237076992 | 0.30 |
ENST00000306318.4 |
GBX2 |
gastrulation brain homeobox 2 |
chr1_+_113392455 | 0.30 |
ENST00000456651.1 ENST00000422022.1 |
RP3-522D1.1 |
RP3-522D1.1 |
chr8_-_139926236 | 0.30 |
ENST00000303045.6 ENST00000435777.1 |
COL22A1 |
collagen, type XXII, alpha 1 |
chr16_-_29478016 | 0.30 |
ENST00000549858.1 ENST00000551411.1 |
RP11-345J4.3 |
Uncharacterized protein |
chr11_-_64512273 | 0.30 |
ENST00000377497.3 ENST00000377487.1 ENST00000430645.1 |
RASGRP2 |
RAS guanyl releasing protein 2 (calcium and DAG-regulated) |
chr6_+_31555045 | 0.30 |
ENST00000396101.3 ENST00000490742.1 |
LST1 |
leukocyte specific transcript 1 |
chr17_+_73717516 | 0.30 |
ENST00000200181.3 ENST00000339591.3 |
ITGB4 |
integrin, beta 4 |
chr3_-_139195350 | 0.30 |
ENST00000232217.2 |
RBP2 |
retinol binding protein 2, cellular |
chr22_+_46067678 | 0.30 |
ENST00000381061.4 ENST00000252934.5 |
ATXN10 |
ataxin 10 |
chr17_+_8339164 | 0.30 |
ENST00000582665.1 ENST00000334527.7 ENST00000299734.7 |
NDEL1 |
nudE neurodevelopment protein 1-like 1 |
chr12_-_124456598 | 0.30 |
ENST00000539761.1 ENST00000539551.1 |
CCDC92 |
coiled-coil domain containing 92 |
chr6_-_117086873 | 0.30 |
ENST00000368557.4 |
FAM162B |
family with sequence similarity 162, member B |
chr12_-_124873357 | 0.29 |
ENST00000448614.1 |
NCOR2 |
nuclear receptor corepressor 2 |
chr1_-_41328018 | 0.29 |
ENST00000372638.2 |
CITED4 |
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.5 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
0.4 | 1.1 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
0.3 | 1.6 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.3 | 0.9 | GO:0061364 | apoptotic process involved in luteolysis(GO:0061364) |
0.2 | 1.1 | GO:0003070 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
0.2 | 0.8 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.2 | 0.3 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.2 | 1.0 | GO:0030421 | defecation(GO:0030421) |
0.2 | 0.5 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
0.2 | 0.6 | GO:0008355 | olfactory learning(GO:0008355) |
0.2 | 0.2 | GO:0071451 | cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
0.2 | 0.9 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
0.1 | 0.6 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
0.1 | 0.6 | GO:0042351 | 'de novo' GDP-L-fucose biosynthetic process(GO:0042351) |
0.1 | 0.6 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.1 | 0.4 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.1 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.4 | GO:0051037 | regulation of transcription involved in meiotic cell cycle(GO:0051037) |
0.1 | 1.0 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
0.1 | 0.4 | GO:0042938 | dipeptide transport(GO:0042938) |
0.1 | 0.7 | GO:2000329 | peptidyl-lysine oxidation(GO:0018057) negative regulation of T-helper 17 cell lineage commitment(GO:2000329) |
0.1 | 0.4 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
0.1 | 0.4 | GO:0002894 | positive regulation of type IIa hypersensitivity(GO:0001798) positive regulation of type II hypersensitivity(GO:0002894) |
0.1 | 0.5 | GO:0003335 | corneocyte development(GO:0003335) |
0.1 | 0.2 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.2 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.1 | 0.6 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 0.3 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
0.1 | 0.7 | GO:0015878 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
0.1 | 0.4 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.1 | 0.3 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
0.1 | 0.3 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.3 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
0.1 | 0.3 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
0.1 | 0.4 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.1 | 0.3 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
0.1 | 0.1 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
0.1 | 0.3 | GO:1901895 | negative regulation of calcium-transporting ATPase activity(GO:1901895) |
0.1 | 0.3 | GO:0021644 | vagus nerve morphogenesis(GO:0021644) |
0.1 | 0.4 | GO:0016334 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
0.1 | 0.1 | GO:0045210 | FasL biosynthetic process(GO:0045210) |
0.1 | 0.7 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.1 | 0.4 | GO:0035900 | response to isolation stress(GO:0035900) |
0.1 | 0.3 | GO:0045081 | negative regulation of interleukin-10 biosynthetic process(GO:0045081) |
0.1 | 0.5 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.1 | 0.3 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
0.1 | 0.4 | GO:1900535 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
0.1 | 0.8 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
0.1 | 0.3 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
0.1 | 0.5 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.1 | 0.3 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
0.1 | 0.4 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.1 | 0.9 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.1 | 0.3 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.1 | 0.1 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
0.1 | 0.3 | GO:0036058 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
0.1 | 0.5 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.1 | 0.3 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
0.1 | 0.3 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.2 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.6 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 0.4 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.1 | 0.2 | GO:0086092 | regulation of the force of heart contraction by cardiac conduction(GO:0086092) |
0.1 | 0.9 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.1 | 0.5 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.1 | 0.6 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.2 | GO:0099545 | trans-synaptic signaling by trans-synaptic complex(GO:0099545) |
0.1 | 0.2 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
0.1 | 0.2 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
0.1 | 0.3 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.1 | 0.4 | GO:0052027 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
0.1 | 0.2 | GO:0060008 | Sertoli cell differentiation(GO:0060008) |
0.1 | 0.2 | GO:1903465 | vacuolar phosphate transport(GO:0007037) positive regulation of mitotic cell cycle DNA replication(GO:1903465) positive regulation of parathyroid hormone secretion(GO:2000830) |
0.1 | 0.2 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
0.1 | 0.5 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
0.1 | 0.5 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.1 | 0.3 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
0.1 | 0.3 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
0.1 | 0.1 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.1 | 0.1 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.1 | 0.4 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
0.1 | 0.3 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.6 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.6 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.1 | 0.6 | GO:0010899 | regulation of phosphatidylcholine catabolic process(GO:0010899) |
0.1 | 0.3 | GO:0018277 | protein deamination(GO:0018277) |
0.1 | 0.4 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
0.1 | 0.3 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
0.1 | 0.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.5 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.3 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
0.1 | 0.9 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.1 | 0.5 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
0.1 | 0.9 | GO:0060180 | female mating behavior(GO:0060180) |
0.1 | 0.2 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.1 | 0.3 | GO:0019046 | release from viral latency(GO:0019046) |
0.1 | 0.1 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
0.1 | 0.3 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.1 | 0.2 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
0.1 | 0.2 | GO:1903762 | regulation of heart looping(GO:1901207) positive regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903762) positive regulation of ventricular cardiac muscle cell action potential(GO:1903947) positive regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905026) positive regulation of membrane repolarization during cardiac muscle cell action potential(GO:1905033) |
0.1 | 0.2 | GO:0034164 | negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
0.1 | 0.5 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.7 | GO:0034465 | response to carbon monoxide(GO:0034465) |
0.1 | 0.1 | GO:0046102 | inosine metabolic process(GO:0046102) |
0.1 | 0.4 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 0.2 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
0.1 | 0.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.1 | 0.4 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.1 | 0.3 | GO:0033384 | geranyl diphosphate metabolic process(GO:0033383) geranyl diphosphate biosynthetic process(GO:0033384) farnesyl diphosphate biosynthetic process(GO:0045337) |
0.1 | 0.4 | GO:2000771 | regulation of unidimensional cell growth(GO:0051510) negative regulation of unidimensional cell growth(GO:0051511) establishment of cell polarity regulating cell shape(GO:0071964) regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000769) positive regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000771) regulation of establishment of cell polarity regulating cell shape(GO:2000782) positive regulation of establishment of cell polarity regulating cell shape(GO:2000784) positive regulation of barbed-end actin filament capping(GO:2000814) |
0.1 | 0.3 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.1 | 0.2 | GO:0072387 | flavin adenine dinucleotide metabolic process(GO:0072387) |
0.1 | 0.2 | GO:0000472 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
0.1 | 0.2 | GO:0019417 | sulfur oxidation(GO:0019417) |
0.1 | 0.4 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.1 | 0.5 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
0.1 | 0.2 | GO:0043095 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
0.1 | 0.2 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.1 | 0.8 | GO:0032119 | sequestering of zinc ion(GO:0032119) |
0.1 | 0.8 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.1 | 0.1 | GO:0010916 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.1 | 0.2 | GO:1990922 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
0.1 | 0.2 | GO:0033341 | regulation of collagen binding(GO:0033341) |
0.1 | 0.5 | GO:0046836 | glycolipid transport(GO:0046836) |
0.1 | 0.3 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.1 | 0.2 | GO:0036090 | cleavage furrow ingression(GO:0036090) lysosomal membrane organization(GO:0097212) |
0.1 | 0.3 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
0.1 | 0.1 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.1 | 0.2 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.1 | 0.2 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
0.1 | 0.2 | GO:0060928 | cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
0.1 | 0.2 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.1 | GO:1904098 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
0.1 | 0.3 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.1 | 0.2 | GO:0048627 | myoblast development(GO:0048627) |
0.1 | 0.2 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 0.3 | GO:0016036 | cellular response to phosphate starvation(GO:0016036) regulation of sulfur amino acid metabolic process(GO:0031335) positive regulation of sulfur amino acid metabolic process(GO:0031337) regulation of homocysteine metabolic process(GO:0050666) positive regulation of homocysteine metabolic process(GO:0050668) |
0.1 | 0.3 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
0.1 | 0.4 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
0.1 | 0.4 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.3 | GO:0044571 | [2Fe-2S] cluster assembly(GO:0044571) |
0.1 | 0.6 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
0.1 | 0.2 | GO:0060823 | canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060823) regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
0.1 | 0.6 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
0.1 | 0.4 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
0.1 | 0.2 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.1 | 0.3 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.1 | 0.4 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 0.2 | GO:0002276 | basophil activation involved in immune response(GO:0002276) basophil activation(GO:0045575) |
0.1 | 0.2 | GO:0070374 | positive regulation of ERK1 and ERK2 cascade(GO:0070374) |
0.0 | 0.3 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
0.0 | 0.6 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.0 | 0.5 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.5 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.2 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.0 | 0.0 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.1 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.0 | 0.3 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.0 | 0.2 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
0.0 | 0.1 | GO:0045083 | negative regulation of interleukin-12 biosynthetic process(GO:0045083) |
0.0 | 0.0 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.1 | GO:0002731 | negative regulation of dendritic cell cytokine production(GO:0002731) |
0.0 | 1.4 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.2 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.2 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
0.0 | 0.4 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.1 | GO:0032773 | regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) positive regulation of melanosome transport(GO:1902910) |
0.0 | 0.2 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.0 | 0.2 | GO:0050976 | detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) |
0.0 | 0.3 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
0.0 | 1.4 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.0 | 0.4 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
0.0 | 0.3 | GO:0021546 | rhombomere development(GO:0021546) |
0.0 | 0.4 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
0.0 | 0.2 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
0.0 | 0.1 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
0.0 | 0.3 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
0.0 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.0 | 0.4 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.2 | GO:0044771 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) |
0.0 | 0.3 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.0 | 0.0 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
0.0 | 0.1 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.2 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.3 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.0 | 0.1 | GO:2000317 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
0.0 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.5 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.5 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.1 | GO:0034553 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
0.0 | 0.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
0.0 | 0.1 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
0.0 | 0.0 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.3 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.4 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
0.0 | 0.4 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
0.0 | 0.2 | GO:0032218 | riboflavin transport(GO:0032218) |
0.0 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.1 | GO:0098935 | dendritic transport(GO:0098935) anterograde dendritic transport(GO:0098937) |
0.0 | 0.2 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.0 | 0.2 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.1 | GO:1990869 | response to chemokine(GO:1990868) cellular response to chemokine(GO:1990869) |
0.0 | 0.4 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.2 | GO:0061143 | alveolar primary septum development(GO:0061143) |
0.0 | 0.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) regulation of skeletal muscle hypertrophy(GO:1904204) |
0.0 | 0.6 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.1 | GO:2000182 | regulation of progesterone biosynthetic process(GO:2000182) |
0.0 | 0.3 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.0 | 0.1 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
0.0 | 0.1 | GO:2000616 | negative regulation of histone H3-K9 acetylation(GO:2000616) |
0.0 | 0.2 | GO:0044145 | multi-organism catabolic process(GO:0044035) development of symbiont involved in interaction with host(GO:0044115) modulation of development of symbiont involved in interaction with host(GO:0044145) negative regulation of development of symbiont involved in interaction with host(GO:0044147) metabolism of substance in other organism involved in symbiotic interaction(GO:0052214) catabolism of substance in other organism involved in symbiotic interaction(GO:0052227) metabolism of macromolecule in other organism involved in symbiotic interaction(GO:0052229) catabolism by host of symbiont macromolecule(GO:0052360) catabolism by organism of macromolecule in other organism involved in symbiotic interaction(GO:0052361) catabolism by host of symbiont protein(GO:0052362) catabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052363) catabolism by host of substance in symbiont(GO:0052364) metabolism by host of symbiont macromolecule(GO:0052416) metabolism by host of symbiont protein(GO:0052417) metabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052418) metabolism by host of substance in symbiont(GO:0052419) |
0.0 | 0.1 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
0.0 | 0.1 | GO:0060796 | regulation of transcription involved in primary germ layer cell fate commitment(GO:0060796) |
0.0 | 0.2 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.4 | GO:0038129 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) ERBB3 signaling pathway(GO:0038129) |
0.0 | 0.1 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
0.0 | 0.3 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
0.0 | 0.4 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.5 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.3 | GO:0070383 | DNA cytosine deamination(GO:0070383) |
0.0 | 0.1 | GO:0090035 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
0.0 | 0.2 | GO:1902904 | negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
0.0 | 0.6 | GO:0060026 | convergent extension(GO:0060026) |
0.0 | 0.3 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.4 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.4 | GO:0071888 | macrophage apoptotic process(GO:0071888) |
0.0 | 0.1 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
0.0 | 0.4 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
0.0 | 0.1 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
0.0 | 0.1 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
0.0 | 0.8 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.2 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.0 | 0.2 | GO:1902462 | transforming growth factor beta activation(GO:0036363) mesenchymal stem cell proliferation(GO:0097168) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.0 | 0.1 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.0 | 0.1 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
0.0 | 0.1 | GO:0070662 | mast cell proliferation(GO:0070662) |
0.0 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.3 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
0.0 | 0.3 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.3 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.1 | GO:1900737 | regulation of proteinase activated receptor activity(GO:1900276) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
0.0 | 0.1 | GO:1904347 | regulation of small intestine smooth muscle contraction(GO:1904347) positive regulation of small intestine smooth muscle contraction(GO:1904349) small intestine smooth muscle contraction(GO:1990770) |
0.0 | 0.1 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.2 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.1 | GO:0002730 | regulation of dendritic cell cytokine production(GO:0002730) |
0.0 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.0 | 1.2 | GO:0035635 | entry of bacterium into host cell(GO:0035635) |
0.0 | 0.1 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.0 | 0.4 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.0 | 0.1 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.0 | 0.1 | GO:0045082 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
0.0 | 0.6 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
0.0 | 0.4 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.1 | GO:0021919 | BMP signaling pathway involved in spinal cord dorsal/ventral patterning(GO:0021919) |
0.0 | 0.1 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
0.0 | 0.2 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.0 | 0.4 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.4 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
0.0 | 0.3 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.4 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
0.0 | 0.1 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.0 | 0.1 | GO:0033123 | positive regulation of cyclic nucleotide catabolic process(GO:0030807) positive regulation of cAMP catabolic process(GO:0030822) positive regulation of purine nucleotide catabolic process(GO:0033123) |
0.0 | 0.2 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
0.0 | 0.2 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
0.0 | 0.1 | GO:0071048 | nuclear ncRNA surveillance(GO:0071029) nuclear mRNA surveillance of spliceosomal pre-mRNA splicing(GO:0071030) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) nuclear retention of unspliced pre-mRNA at the site of transcription(GO:0071048) |
0.0 | 0.2 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.0 | GO:0030311 | poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.8 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.1 | GO:1902568 | regulation of eosinophil degranulation(GO:0043309) positive regulation of eosinophil degranulation(GO:0043311) mature conventional dendritic cell differentiation(GO:0097029) positive regulation of eosinophil activation(GO:1902568) |
0.0 | 0.2 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
0.0 | 0.2 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.0 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.0 | 0.1 | GO:0044209 | AMP salvage(GO:0044209) |
0.0 | 0.2 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.0 | 0.2 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.4 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.0 | 0.0 | GO:0036476 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.0 | 0.5 | GO:0051198 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.0 | 0.1 | GO:0019303 | D-ribose catabolic process(GO:0019303) |
0.0 | 0.1 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine diphosphate metabolic process(GO:0042357) |
0.0 | 0.1 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
0.0 | 0.1 | GO:0045338 | farnesyl diphosphate metabolic process(GO:0045338) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
0.0 | 0.1 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0099640 | axo-dendritic protein transport(GO:0099640) |
0.0 | 0.1 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.0 | 0.3 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 0.4 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.2 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.1 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.0 | 0.2 | GO:2000035 | positive regulation of somatic stem cell population maintenance(GO:1904674) regulation of stem cell division(GO:2000035) |
0.0 | 0.1 | GO:0051685 | maintenance of ER location(GO:0051685) |
0.0 | 0.5 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.0 | 0.0 | GO:0032425 | positive regulation of mismatch repair(GO:0032425) |
0.0 | 0.2 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
0.0 | 0.1 | GO:0006429 | leucyl-tRNA aminoacylation(GO:0006429) |
0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.2 | GO:0036510 | trimming of terminal mannose on C branch(GO:0036510) |
0.0 | 0.2 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
0.0 | 0.1 | GO:0098976 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.0 | 0.2 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
0.0 | 0.1 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.0 | 0.2 | GO:0000050 | urea cycle(GO:0000050) |
0.0 | 0.2 | GO:0015811 | L-cystine transport(GO:0015811) |
0.0 | 0.1 | GO:1904316 | positive regulation of neutrophil degranulation(GO:0043315) cellular response to gravity(GO:0071258) positive regulation of neutrophil activation(GO:1902565) regulation of transcytosis(GO:1904298) positive regulation of transcytosis(GO:1904300) regulation of maternal process involved in parturition(GO:1904301) positive regulation of maternal process involved in parturition(GO:1904303) response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904316) cellular response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904317) |
0.0 | 0.5 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
0.0 | 0.2 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.0 | 0.1 | GO:0032912 | negative regulation of transforming growth factor beta2 production(GO:0032912) |
0.0 | 0.2 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.0 | 0.2 | GO:1903575 | cornified envelope assembly(GO:1903575) |
0.0 | 0.4 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.1 | GO:0090131 | mesenchyme migration(GO:0090131) |
0.0 | 0.1 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.0 | 0.1 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
0.0 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
0.0 | 0.3 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.0 | 0.3 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.0 | 0.1 | GO:0007416 | synapse assembly(GO:0007416) |
0.0 | 0.1 | GO:0071287 | cellular response to manganese ion(GO:0071287) |
0.0 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.0 | GO:1990164 | histone H2A phosphorylation(GO:1990164) |
0.0 | 0.1 | GO:0060032 | notochord regression(GO:0060032) |
0.0 | 0.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.0 | 0.1 | GO:0060319 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil differentiation(GO:0030222) eosinophil fate commitment(GO:0035854) primitive erythrocyte differentiation(GO:0060319) |
0.0 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.0 | 0.3 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.2 | GO:0071569 | protein ufmylation(GO:0071569) |
0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.1 | GO:0018199 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) peptidyl-glutamine modification(GO:0018199) isopeptide cross-linking(GO:0018262) |
0.0 | 0.2 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.0 | 0.2 | GO:0044211 | CTP salvage(GO:0044211) |
0.0 | 0.5 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.0 | 0.3 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.0 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.0 | 0.1 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
0.0 | 0.0 | GO:0060066 | oviduct development(GO:0060066) |
0.0 | 0.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.0 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.2 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.0 | 0.2 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
0.0 | 0.1 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
0.0 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.1 | GO:0009149 | pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
0.0 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) aspartate catabolic process(GO:0006533) L-kynurenine metabolic process(GO:0097052) |
0.0 | 0.1 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
0.0 | 0.2 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.4 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.0 | GO:0071657 | positive regulation of granulocyte colony-stimulating factor production(GO:0071657) positive regulation of macrophage colony-stimulating factor production(GO:1901258) |
0.0 | 0.0 | GO:1902680 | positive regulation of RNA biosynthetic process(GO:1902680) |
0.0 | 0.0 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.0 | 0.4 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
0.0 | 0.2 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.1 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
0.0 | 0.1 | GO:0046502 | uroporphyrinogen III biosynthetic process(GO:0006780) uroporphyrinogen III metabolic process(GO:0046502) |
0.0 | 0.1 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 0.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.1 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.0 | 0.2 | GO:0042048 | olfactory behavior(GO:0042048) |
0.0 | 0.3 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.0 | 0.1 | GO:1990637 | response to prolactin(GO:1990637) |
0.0 | 0.4 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
0.0 | 0.3 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.2 | GO:0071926 | endocannabinoid signaling pathway(GO:0071926) regulation of endocannabinoid signaling pathway(GO:2000124) |
0.0 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.0 | 0.1 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
0.0 | 0.3 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.0 | 0.1 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) |
0.0 | 0.1 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) negative regulation of caveolin-mediated endocytosis(GO:2001287) |
0.0 | 0.1 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
0.0 | 0.0 | GO:1904798 | positive regulation of core promoter binding(GO:1904798) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.1 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
0.0 | 0.9 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
0.0 | 0.7 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.2 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.0 | 0.1 | GO:2000861 | histone H3-K4 demethylation, trimethyl-H3-K4-specific(GO:0034721) estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
0.0 | 0.3 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.2 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 0.9 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.1 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
0.0 | 0.2 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.1 | GO:1904806 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.0 | 0.0 | GO:0006788 | heme oxidation(GO:0006788) |
0.0 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.0 | 0.1 | GO:0009712 | catecholamine metabolic process(GO:0006584) catechol-containing compound metabolic process(GO:0009712) |
0.0 | 0.5 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.0 | 0.0 | GO:0021759 | globus pallidus development(GO:0021759) |
0.0 | 0.6 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.2 | GO:1902363 | regulation of spindle elongation(GO:0032887) regulation of mitotic spindle elongation(GO:0032888) anastral spindle assembly(GO:0055048) protein localization to spindle pole body(GO:0071988) regulation of protein localization to spindle pole body(GO:1902363) positive regulation of protein localization to spindle pole body(GO:1902365) positive regulation of mitotic spindle elongation(GO:1902846) |
0.0 | 0.3 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.0 | 0.3 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.0 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.0 | 0.7 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.1 | GO:0036309 | protein localization to M-band(GO:0036309) |
0.0 | 0.8 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.0 | 0.3 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.1 | GO:0044146 | negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
0.0 | 0.4 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.3 | GO:0098780 | macromitophagy(GO:0000423) response to mitochondrial depolarisation(GO:0098780) |
0.0 | 0.1 | GO:0036093 | male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
0.0 | 0.0 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.0 | 0.6 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.1 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
0.0 | 0.2 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
0.0 | 0.2 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.0 | 0.2 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.0 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.1 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
0.0 | 0.0 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.2 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
0.0 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.1 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.0 | 0.1 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.0 | 0.3 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.0 | 0.2 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.5 | GO:0061621 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
0.0 | 0.3 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.0 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
0.0 | 0.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.1 | GO:1904504 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.0 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.0 | 0.1 | GO:0051135 | positive regulation of NK T cell activation(GO:0051135) |
0.0 | 0.6 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.0 | 0.2 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.0 | 0.2 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
0.0 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.2 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.1 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.0 | 0.6 | GO:0002479 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-dependent(GO:0002479) |
0.0 | 0.2 | GO:0003360 | brainstem development(GO:0003360) |
0.0 | 0.5 | GO:0071800 | podosome assembly(GO:0071800) |
0.0 | 0.1 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
0.0 | 0.0 | GO:0002352 | B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.0 | 0.2 | GO:0001503 | ossification(GO:0001503) |
0.0 | 0.2 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.0 | 0.0 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.0 | 0.2 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
0.0 | 0.0 | GO:0061386 | closure of optic fissure(GO:0061386) |
0.0 | 0.4 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.1 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.8 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
0.0 | 0.1 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
0.0 | 0.1 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
0.0 | 0.1 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
0.0 | 0.1 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
0.0 | 0.3 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
0.0 | 0.1 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.2 | GO:0097435 | fibril organization(GO:0097435) |
0.0 | 0.1 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
0.0 | 0.1 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.0 | 0.1 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.0 | 0.1 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.0 | 2.2 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:2000504 | negative regulation of Fas signaling pathway(GO:1902045) positive regulation of blood vessel remodeling(GO:2000504) |
0.0 | 0.1 | GO:0000271 | polysaccharide biosynthetic process(GO:0000271) |
0.0 | 0.3 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.0 | 0.0 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.1 | GO:1900154 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
0.0 | 0.0 | GO:0051957 | positive regulation of amino acid transport(GO:0051957) |
0.0 | 0.1 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.0 | 0.0 | GO:0016240 | autophagosome docking(GO:0016240) |
0.0 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.1 | GO:0030047 | actin modification(GO:0030047) |
0.0 | 0.1 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
0.0 | 1.6 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.2 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
0.0 | 0.4 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.0 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.1 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.0 | 0.2 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.0 | 0.1 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.0 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.0 | 0.2 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.1 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.0 | 0.1 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
0.0 | 0.1 | GO:0071362 | cellular response to ether(GO:0071362) |
0.0 | 0.2 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.0 | 0.0 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.0 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
0.0 | 0.2 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.0 | 0.4 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
0.0 | 0.1 | GO:0032264 | IMP salvage(GO:0032264) |
0.0 | 0.1 | GO:0006096 | glycolytic process(GO:0006096) ATP generation from ADP(GO:0006757) |
0.0 | 0.1 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.2 | GO:2000680 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.1 | GO:0003322 | pancreatic A cell development(GO:0003322) |
0.0 | 0.1 | GO:1904209 | regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
0.0 | 0.1 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
0.0 | 0.2 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.0 | 0.4 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.0 | 0.1 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.0 | 0.1 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
0.0 | 0.1 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.0 | 0.1 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.0 | 0.1 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:0046189 | melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) secondary metabolite biosynthetic process(GO:0044550) phenol-containing compound biosynthetic process(GO:0046189) |
0.0 | 0.0 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
0.0 | 0.2 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.0 | 0.0 | GO:0006007 | glucose catabolic process(GO:0006007) |
0.0 | 0.1 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
0.0 | 0.3 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.0 | 0.2 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
0.0 | 0.0 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) negative regulation of axon guidance(GO:1902668) |
0.0 | 0.3 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.0 | 0.0 | GO:0045686 | negative regulation of glial cell differentiation(GO:0045686) negative regulation of astrocyte differentiation(GO:0048712) |
0.0 | 0.0 | GO:1902019 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.0 | 0.1 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
0.0 | 0.2 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.0 | 0.0 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.0 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.0 | 0.2 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
0.0 | 0.1 | GO:0050909 | sensory perception of taste(GO:0050909) |
0.0 | 0.2 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.1 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) carbon catabolite activation of transcription(GO:0045991) positive regulation of transcription by glucose(GO:0046016) |
0.0 | 0.1 | GO:0022405 | molting cycle process(GO:0022404) hair cycle process(GO:0022405) |
0.0 | 0.0 | GO:0060022 | hard palate development(GO:0060022) |
0.0 | 0.1 | GO:0009414 | response to water deprivation(GO:0009414) |
0.0 | 0.3 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
0.0 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.0 | 0.0 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.1 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.0 | 0.0 | GO:0060809 | mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
0.0 | 0.6 | GO:0070527 | platelet aggregation(GO:0070527) |
0.0 | 0.0 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
0.0 | 0.1 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
0.0 | 0.1 | GO:0014047 | glutamate secretion(GO:0014047) |
0.0 | 0.3 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.2 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.0 | 0.1 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.0 | 0.0 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.4 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.1 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
0.0 | 0.2 | GO:0015825 | L-serine transport(GO:0015825) |
0.0 | 0.1 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
0.0 | 0.0 | GO:0003263 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) |
0.0 | 0.1 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.0 | 0.1 | GO:0097491 | sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.0 | 0.0 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0032776 | DNA methylation on cytosine(GO:0032776) C-5 methylation of cytosine(GO:0090116) |
0.0 | 0.1 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.0 | 0.8 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.0 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
0.0 | 0.0 | GO:0048820 | hair follicle maturation(GO:0048820) |
0.0 | 0.1 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.0 | 0.1 | GO:0009299 | mRNA transcription(GO:0009299) |
0.0 | 0.1 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.0 | 0.2 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
0.0 | 0.0 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
0.0 | 0.2 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.0 | 0.1 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.1 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.0 | 0.2 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
0.0 | 0.3 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.1 | GO:0009071 | glycine catabolic process(GO:0006546) serine family amino acid catabolic process(GO:0009071) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.0 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.0 | 0.0 | GO:0002728 | negative regulation of natural killer cell cytokine production(GO:0002728) |
0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.2 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.0 | GO:0048265 | response to pain(GO:0048265) |
0.0 | 0.2 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.0 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.0 | 0.2 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.0 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.0 | 0.2 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.1 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.1 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.8 | GO:0016938 | kinesin I complex(GO:0016938) |
0.2 | 0.5 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.1 | 0.4 | GO:0036117 | hyaluranon cable(GO:0036117) |
0.1 | 0.7 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.1 | 0.3 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.1 | 0.6 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
0.1 | 0.6 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.1 | 1.5 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 1.0 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.4 | GO:0030934 | anchoring collagen complex(GO:0030934) |
0.1 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.4 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
0.1 | 0.4 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.5 | GO:0032044 | DSIF complex(GO:0032044) |
0.1 | 0.5 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.4 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 0.3 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
0.1 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 0.5 | GO:0036021 | endolysosome lumen(GO:0036021) |
0.1 | 0.2 | GO:0001534 | radial spoke(GO:0001534) |
0.1 | 0.4 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.1 | GO:0005921 | gap junction(GO:0005921) |
0.1 | 0.3 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 0.2 | GO:0045160 | myosin I complex(GO:0045160) |
0.1 | 0.2 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
0.1 | 0.2 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 0.8 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.2 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 0.3 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
0.1 | 0.2 | GO:0030689 | Noc complex(GO:0030689) |
0.1 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.1 | 0.6 | GO:0098651 | basement membrane collagen trimer(GO:0098651) |
0.1 | 0.2 | GO:0097444 | spine apparatus(GO:0097444) |
0.1 | 0.3 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 0.3 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
0.1 | 0.2 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
0.1 | 0.6 | GO:0032009 | early phagosome(GO:0032009) |
0.1 | 0.3 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.0 | 0.1 | GO:1990666 | PCSK9-LDLR complex(GO:1990666) |
0.0 | 0.3 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.0 | 0.2 | GO:0043260 | laminin-11 complex(GO:0043260) |
0.0 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.2 | GO:0032449 | CBM complex(GO:0032449) |
0.0 | 0.2 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
0.0 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.3 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.0 | 0.5 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.4 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.4 | GO:0032010 | phagolysosome(GO:0032010) |
0.0 | 0.0 | GO:0071159 | NF-kappaB complex(GO:0071159) |
0.0 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.0 | 0.4 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.6 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.1 | GO:0072517 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
0.0 | 0.3 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.3 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.1 | GO:0031905 | early endosome lumen(GO:0031905) |
0.0 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.0 | 0.4 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.3 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
0.0 | 0.3 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.0 | 0.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.3 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.1 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
0.0 | 0.1 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.7 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.2 | GO:0005903 | brush border(GO:0005903) |
0.0 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.2 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
0.0 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 1.0 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.1 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
0.0 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.3 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.0 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.4 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.4 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.1 | GO:0019034 | viral replication complex(GO:0019034) |
0.0 | 0.1 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
0.0 | 0.4 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.5 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.2 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
0.0 | 0.1 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
0.0 | 0.1 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 2.0 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.0 | 0.4 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0036284 | tubulobulbar complex(GO:0036284) |
0.0 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.1 | GO:0044305 | calyx of Held(GO:0044305) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.3 | GO:0033643 | host cell part(GO:0033643) |
0.0 | 0.1 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.1 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
0.0 | 0.9 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.2 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 1.0 | GO:0031430 | M band(GO:0031430) |
0.0 | 0.1 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
0.0 | 0.5 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.0 | 0.1 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.0 | 0.2 | GO:0055028 | cortical microtubule(GO:0055028) |
0.0 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.1 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.3 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.0 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
0.0 | 0.4 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.3 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 2.1 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.2 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
0.0 | 0.3 | GO:0032153 | cell division site(GO:0032153) cell division site part(GO:0032155) |
0.0 | 0.1 | GO:0005960 | glycine cleavage complex(GO:0005960) |
0.0 | 0.1 | GO:0030175 | filopodium(GO:0030175) |
0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.1 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 0.6 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 0.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.2 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.2 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.4 | GO:0036019 | endolysosome(GO:0036019) |
0.0 | 0.0 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.2 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.4 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.6 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.1 | GO:0000799 | nuclear condensin complex(GO:0000799) |
0.0 | 0.0 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.2 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.3 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.5 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.2 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.0 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 1.1 | GO:1904724 | tertiary granule lumen(GO:1904724) |
0.0 | 0.2 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.2 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.0 | 0.3 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.5 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.1 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.2 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.1 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.0 | 0.1 | GO:1990031 | pinceau fiber(GO:1990031) |
0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.3 | GO:0097526 | spliceosomal tri-snRNP complex(GO:0097526) |
0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 0.3 | GO:0032059 | bleb(GO:0032059) |
0.0 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.1 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
0.0 | 0.6 | GO:0043195 | terminal bouton(GO:0043195) |
0.0 | 0.0 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
0.0 | 0.9 | GO:0000139 | Golgi membrane(GO:0000139) |
0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.3 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.5 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.2 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.1 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.0 | 0.1 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.2 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.0 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) cytoplasmic side of late endosome membrane(GO:0098560) cytoplasmic side of lysosomal membrane(GO:0098574) |
0.0 | 0.1 | GO:0030659 | cytoplasmic vesicle membrane(GO:0030659) |
0.0 | 0.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.1 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.2 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.7 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.1 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.5 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
0.2 | 0.7 | GO:0052894 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
0.2 | 1.6 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.2 | 0.9 | GO:0042806 | fucose binding(GO:0042806) |
0.2 | 0.5 | GO:0042356 | GDP-4-dehydro-D-rhamnose reductase activity(GO:0042356) GDP-L-fucose synthase activity(GO:0050577) |
0.2 | 1.1 | GO:0008481 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
0.2 | 1.1 | GO:0046979 | TAP2 binding(GO:0046979) |
0.1 | 0.4 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
0.1 | 1.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.7 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.1 | 0.4 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.1 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.1 | 0.5 | GO:0004362 | glutathione-disulfide reductase activity(GO:0004362) |
0.1 | 0.5 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.7 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 0.2 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.1 | 0.3 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
0.1 | 0.4 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.1 | 0.5 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.1 | 0.3 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
0.1 | 0.3 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
0.1 | 0.4 | GO:0070012 | oligopeptidase activity(GO:0070012) |
0.1 | 0.9 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.3 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
0.1 | 0.3 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
0.1 | 0.3 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
0.1 | 0.4 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.1 | 0.3 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.1 | 0.3 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
0.1 | 0.9 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 0.4 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.1 | 0.7 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 0.3 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 0.3 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.1 | 0.7 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
0.1 | 0.3 | GO:0030395 | lactose binding(GO:0030395) |
0.1 | 0.3 | GO:0016652 | NAD(P)+ transhydrogenase activity(GO:0008746) oxidoreductase activity, acting on NAD(P)H, NAD(P) as acceptor(GO:0016652) |
0.1 | 0.4 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.4 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 0.2 | GO:0086040 | sodium:proton antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086040) |
0.1 | 0.1 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
0.1 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 1.0 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.3 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.1 | 0.2 | GO:0004103 | choline kinase activity(GO:0004103) |
0.1 | 0.3 | GO:0030172 | troponin C binding(GO:0030172) |
0.1 | 0.3 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.3 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.1 | 0.2 | GO:0004447 | iodide peroxidase activity(GO:0004447) |
0.1 | 0.3 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
0.1 | 1.8 | GO:0005536 | glucose binding(GO:0005536) |
0.1 | 0.3 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
0.1 | 0.3 | GO:0004104 | acetylcholinesterase activity(GO:0003990) cholinesterase activity(GO:0004104) |
0.1 | 0.6 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
0.1 | 0.3 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 0.3 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.1 | 0.3 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.1 | 0.2 | GO:0003896 | DNA primase activity(GO:0003896) |
0.1 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.2 | GO:0098782 | mechanically-gated potassium channel activity(GO:0098782) |
0.1 | 0.5 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.1 | 0.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.1 | 0.1 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.1 | 0.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.1 | 0.2 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
0.1 | 0.2 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.1 | 0.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.5 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.1 | 0.3 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
0.1 | 0.5 | GO:0003796 | lysozyme activity(GO:0003796) |
0.1 | 0.2 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
0.1 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.1 | 0.3 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
0.1 | 0.2 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
0.1 | 0.1 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.2 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
0.1 | 0.2 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.1 | 0.2 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
0.1 | 0.1 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.2 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 0.4 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.2 | GO:0098808 | mRNA cap binding(GO:0098808) |
0.1 | 0.5 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
0.1 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 0.4 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.1 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.1 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.1 | 0.7 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
0.0 | 0.1 | GO:0050333 | thiamin-triphosphatase activity(GO:0050333) |
0.0 | 0.2 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
0.0 | 0.4 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
0.0 | 0.1 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
0.0 | 0.5 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.3 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
0.0 | 0.3 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
0.0 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 1.4 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.5 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.3 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.0 | 0.1 | GO:0070364 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
0.0 | 0.3 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.4 | GO:0004793 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.0 | 0.2 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.0 | 0.3 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 1.3 | GO:0043394 | proteoglycan binding(GO:0043394) |
0.0 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.2 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
0.0 | 0.2 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.8 | GO:0019841 | retinol binding(GO:0019841) |
0.0 | 0.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.2 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.3 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.0 | 0.3 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.1 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
0.0 | 0.2 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
0.0 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 1.5 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 0.1 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.0 | 0.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.1 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.1 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
0.0 | 0.1 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.2 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.7 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.2 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.4 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.5 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.3 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.0 | 0.1 | GO:0016608 | growth hormone-releasing hormone activity(GO:0016608) ghrelin receptor binding(GO:0031768) |
0.0 | 0.5 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.3 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.4 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.3 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
0.0 | 0.4 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.2 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.2 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.0 | 0.4 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.0 | 0.1 | GO:0004807 | triose-phosphate isomerase activity(GO:0004807) |
0.0 | 0.3 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.2 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.2 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.1 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
0.0 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.1 | GO:0051996 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
0.0 | 0.1 | GO:0005046 | KDEL sequence binding(GO:0005046) |
0.0 | 0.2 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.0 | 0.3 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
0.0 | 0.1 | GO:0030617 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) |
0.0 | 0.2 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.6 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 0.4 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.1 | GO:0052825 | inositol tetrakisphosphate 1-kinase activity(GO:0047325) inositol-1,3,4-trisphosphate 6-kinase activity(GO:0052725) inositol-1,3,4-trisphosphate 5-kinase activity(GO:0052726) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) |
0.0 | 0.1 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.0 | 0.4 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.6 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.1 | GO:0004823 | leucine-tRNA ligase activity(GO:0004823) |
0.0 | 2.1 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.0 | 0.2 | GO:0015193 | L-alanine transmembrane transporter activity(GO:0015180) L-cystine transmembrane transporter activity(GO:0015184) L-proline transmembrane transporter activity(GO:0015193) alanine transmembrane transporter activity(GO:0022858) |
0.0 | 0.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.5 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
0.0 | 0.3 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.7 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 0.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 0.3 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.2 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.5 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.1 | GO:0098625 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
0.0 | 0.3 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.2 | GO:0004519 | endonuclease activity(GO:0004519) |
0.0 | 0.2 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.0 | 0.3 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.1 | GO:0003867 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.7 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.3 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.1 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
0.0 | 0.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.1 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.0 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.1 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
0.0 | 0.1 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
0.0 | 0.4 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.1 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
0.0 | 0.1 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.0 | 0.1 | GO:0047291 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.6 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0004477 | formate-tetrahydrofolate ligase activity(GO:0004329) methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.0 | 0.3 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.3 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 0.2 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.1 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.0 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 0.1 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
0.0 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.1 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
0.0 | 0.3 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 0.1 | GO:0050682 | AF-2 domain binding(GO:0050682) |
0.0 | 0.2 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.3 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.1 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
0.0 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.1 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.2 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.1 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
0.0 | 0.3 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.4 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.1 | GO:0086057 | voltage-gated calcium channel activity involved in bundle of His cell action potential(GO:0086057) |
0.0 | 0.5 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.4 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.2 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.0 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
0.0 | 0.1 | GO:0004945 | angiotensin receptor activity(GO:0001595) angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.7 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.2 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.4 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.4 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.0 | 0.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.2 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.0 | 1.2 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.1 | GO:0004775 | succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.1 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.4 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.1 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
0.0 | 0.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.0 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.4 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.6 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
0.0 | 0.3 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.5 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.1 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.0 | 0.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.4 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.4 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.6 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.0 | GO:0061599 | molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
0.0 | 0.1 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) |
0.0 | 0.0 | GO:0047025 | 3-oxoacyl-[acyl-carrier-protein] reductase (NADH) activity(GO:0047025) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.8 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.0 | GO:0090541 | MIT domain binding(GO:0090541) |
0.0 | 0.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.2 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.5 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.1 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
0.0 | 1.3 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.0 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
0.0 | 0.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.2 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.7 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 0.0 | GO:0001160 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.5 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
0.0 | 0.2 | GO:0005057 | receptor signaling protein activity(GO:0005057) |
0.0 | 0.2 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.1 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.1 | GO:0047977 | hepoxilin-epoxide hydrolase activity(GO:0047977) |
0.0 | 0.5 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.2 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.0 | 0.5 | GO:0019905 | syntaxin binding(GO:0019905) |
0.0 | 0.8 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.1 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.1 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
0.0 | 0.2 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.1 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 2.4 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.0 | GO:0004139 | deoxyribose-phosphate aldolase activity(GO:0004139) |
0.0 | 0.2 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.1 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.1 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
0.0 | 0.4 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.1 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.5 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.1 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.4 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.5 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.0 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0048039 | ubiquinone binding(GO:0048039) |
0.0 | 0.1 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.0 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
0.0 | 0.1 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.1 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.2 | GO:0019239 | deaminase activity(GO:0019239) |
0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.3 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
0.0 | 0.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.2 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.6 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.4 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.1 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.2 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.1 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.0 | 0.1 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.3 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.0 | GO:0032093 | SAM domain binding(GO:0032093) |
0.0 | 0.1 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
0.0 | 0.1 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.0 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.0 | 0.6 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.1 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.0 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.3 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.7 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 1.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.6 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 2.3 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.7 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.2 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.7 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 1.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 1.7 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.4 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 1.4 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.8 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.2 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 1.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.7 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.3 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.7 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.5 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.4 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 1.1 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.0 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 0.0 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.5 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.2 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 1.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.4 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.3 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.2 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 1.0 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.6 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.8 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 4.5 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.8 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.3 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.6 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.3 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.8 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 1.1 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.4 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.2 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.5 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.8 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 0.3 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 0.4 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.3 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 1.4 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.2 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 1.0 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 1.0 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.6 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.2 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 1.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.4 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.9 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.5 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
0.0 | 0.6 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
0.0 | 1.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 1.0 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 1.6 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.3 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 1.6 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.5 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.0 | 0.2 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.0 | 0.4 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.4 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.0 | 0.8 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 1.1 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.0 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 1.2 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.1 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
0.0 | 0.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.5 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.4 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.0 | 0.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.5 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.6 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.4 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.9 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.6 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.3 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 0.4 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.0 | 2.6 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.4 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.5 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.9 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.0 | 0.2 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 1.3 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.1 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.7 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.2 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.6 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 0.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.6 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 1.4 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.0 | 0.4 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.9 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 1.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.3 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.9 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.4 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.5 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 0.5 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.4 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 1.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.4 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.1 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.3 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.6 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.0 | 0.1 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.0 | 0.4 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.5 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.9 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 0.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |