A549 cells infected with RSV Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
GATA3
|
ENSG00000107485.11 | GATA binding protein 3 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| GATA3 | hg19_v2_chr10_+_8096631_8096660 | 0.77 | 2.3e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr20_-_62203808 | 3.47 |
ENST00000467148.1
|
HELZ2
|
helicase with zinc finger 2, transcriptional coactivator |
| chr11_+_57310114 | 3.07 |
ENST00000527972.1
ENST00000399154.2 |
SMTNL1
|
smoothelin-like 1 |
| chr1_+_153330322 | 2.40 |
ENST00000368738.3
|
S100A9
|
S100 calcium binding protein A9 |
| chr1_-_27998689 | 2.34 |
ENST00000339145.4
ENST00000362020.4 ENST00000361157.6 |
IFI6
|
interferon, alpha-inducible protein 6 |
| chr9_-_21077939 | 1.98 |
ENST00000380232.2
|
IFNB1
|
interferon, beta 1, fibroblast |
| chr17_-_34417479 | 1.98 |
ENST00000225245.5
|
CCL3
|
chemokine (C-C motif) ligand 3 |
| chr7_-_139756791 | 1.95 |
ENST00000489809.1
|
PARP12
|
poly (ADP-ribose) polymerase family, member 12 |
| chr19_-_49362621 | 1.82 |
ENST00000594195.1
ENST00000595867.1 |
PLEKHA4
|
pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 4 |
| chr12_-_121476959 | 1.80 |
ENST00000339275.5
|
OASL
|
2'-5'-oligoadenylate synthetase-like |
| chr19_+_10197463 | 1.78 |
ENST00000590378.1
ENST00000397881.3 |
C19orf66
|
chromosome 19 open reading frame 66 |
| chr17_+_38171681 | 1.69 |
ENST00000225474.2
ENST00000331769.2 ENST00000394148.3 ENST00000577675.1 |
CSF3
|
colony stimulating factor 3 (granulocyte) |
| chr11_+_12108410 | 1.69 |
ENST00000527997.1
|
RP13-631K18.5
|
RP13-631K18.5 |
| chr12_-_121477039 | 1.63 |
ENST00000257570.5
|
OASL
|
2'-5'-oligoadenylate synthetase-like |
| chr19_+_39786962 | 1.62 |
ENST00000333625.2
|
IFNL1
|
interferon, lambda 1 |
| chr6_+_32812568 | 1.52 |
ENST00000414474.1
|
PSMB9
|
proteasome (prosome, macropain) subunit, beta type, 9 |
| chr2_-_113999260 | 1.52 |
ENST00000468980.2
|
PAX8
|
paired box 8 |
| chr19_+_5681153 | 1.46 |
ENST00000579559.1
ENST00000577222.1 |
HSD11B1L
RPL36
|
hydroxysteroid (11-beta) dehydrogenase 1-like ribosomal protein L36 |
| chr11_-_64764435 | 1.46 |
ENST00000534177.1
ENST00000301887.4 |
BATF2
|
basic leucine zipper transcription factor, ATF-like 2 |
| chr11_+_4510109 | 1.36 |
ENST00000307632.3
|
OR52K1
|
olfactory receptor, family 52, subfamily K, member 1 |
| chr10_+_91152303 | 1.36 |
ENST00000371804.3
|
IFIT1
|
interferon-induced protein with tetratricopeptide repeats 1 |
| chr11_+_57308979 | 1.29 |
ENST00000457912.1
|
SMTNL1
|
smoothelin-like 1 |
| chr16_+_57023406 | 1.28 |
ENST00000262510.6
ENST00000308149.7 ENST00000436936.1 |
NLRC5
|
NLR family, CARD domain containing 5 |
| chr11_+_5710919 | 1.25 |
ENST00000379965.3
ENST00000425490.1 |
TRIM22
|
tripartite motif containing 22 |
| chr3_-_49851313 | 1.24 |
ENST00000333486.3
|
UBA7
|
ubiquitin-like modifier activating enzyme 7 |
| chr6_+_32006159 | 1.20 |
ENST00000478281.1
ENST00000471671.1 ENST00000435122.2 |
CYP21A2
|
cytochrome P450, family 21, subfamily A, polypeptide 2 |
| chr1_+_948803 | 1.19 |
ENST00000379389.4
|
ISG15
|
ISG15 ubiquitin-like modifier |
| chr14_+_91709279 | 1.17 |
ENST00000554096.1
|
CTD-2547L24.3
|
HCG1816139; Uncharacterized protein |
| chr12_+_42624050 | 1.17 |
ENST00000601185.1
|
AC020629.1
|
Uncharacterized protein |
| chr10_+_91092241 | 1.17 |
ENST00000371811.4
|
IFIT3
|
interferon-induced protein with tetratricopeptide repeats 3 |
| chr1_+_28206150 | 1.15 |
ENST00000456990.1
|
THEMIS2
|
thymocyte selection associated family member 2 |
| chr12_-_121476750 | 1.13 |
ENST00000543677.1
|
OASL
|
2'-5'-oligoadenylate synthetase-like |
| chr19_-_36019123 | 1.12 |
ENST00000588674.1
ENST00000452271.2 ENST00000518157.1 |
SBSN
|
suprabasin |
| chr2_+_131769256 | 1.11 |
ENST00000355771.3
|
ARHGEF4
|
Rho guanine nucleotide exchange factor (GEF) 4 |
| chr10_-_79397547 | 1.09 |
ENST00000481070.1
|
KCNMA1
|
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr22_-_50970506 | 1.09 |
ENST00000428989.2
ENST00000403326.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr17_+_38171614 | 1.09 |
ENST00000583218.1
ENST00000394149.3 |
CSF3
|
colony stimulating factor 3 (granulocyte) |
| chr17_+_4843352 | 1.09 |
ENST00000573404.1
ENST00000576452.1 |
RNF167
|
ring finger protein 167 |
| chr12_+_113344582 | 1.08 |
ENST00000202917.5
ENST00000445409.2 ENST00000452357.2 |
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr1_+_44401479 | 1.08 |
ENST00000438616.3
|
ARTN
|
artemin |
| chr14_+_94577074 | 1.08 |
ENST00000444961.1
ENST00000448882.1 ENST00000557098.1 ENST00000554800.1 ENST00000556544.1 ENST00000298902.5 ENST00000555819.1 ENST00000557634.1 ENST00000555744.1 |
IFI27
|
interferon, alpha-inducible protein 27 |
| chr2_+_121493717 | 1.06 |
ENST00000418323.1
|
GLI2
|
GLI family zinc finger 2 |
| chr9_-_21368075 | 1.04 |
ENST00000449498.1
|
IFNA13
|
interferon, alpha 13 |
| chr17_-_42988004 | 1.04 |
ENST00000586125.1
ENST00000591880.1 |
GFAP
|
glial fibrillary acidic protein |
| chr15_-_44969086 | 1.03 |
ENST00000434130.1
ENST00000560780.1 |
PATL2
|
protein associated with topoisomerase II homolog 2 (yeast) |
| chr15_+_45722727 | 1.01 |
ENST00000396650.2
ENST00000558435.1 ENST00000344300.3 |
C15orf48
|
chromosome 15 open reading frame 48 |
| chr9_+_125486269 | 0.99 |
ENST00000259466.1
|
OR1L4
|
olfactory receptor, family 1, subfamily L, member 4 |
| chr10_+_90562705 | 0.99 |
ENST00000539337.1
|
LIPM
|
lipase, family member M |
| chr3_-_120122144 | 0.98 |
ENST00000480823.1
|
FSTL1
|
follistatin-like 1 |
| chr11_-_102668879 | 0.98 |
ENST00000315274.6
|
MMP1
|
matrix metallopeptidase 1 (interstitial collagenase) |
| chr3_+_15469058 | 0.98 |
ENST00000432764.2
|
EAF1
|
ELL associated factor 1 |
| chr9_-_100881466 | 0.96 |
ENST00000341469.2
ENST00000342043.3 ENST00000375098.3 |
TRIM14
|
tripartite motif containing 14 |
| chr17_+_41158742 | 0.95 |
ENST00000415816.2
ENST00000438323.2 |
IFI35
|
interferon-induced protein 35 |
| chr11_-_33913708 | 0.95 |
ENST00000257818.2
|
LMO2
|
LIM domain only 2 (rhombotin-like 1) |
| chr10_-_79397391 | 0.94 |
ENST00000286628.8
ENST00000406533.3 ENST00000354353.5 ENST00000404857.1 |
KCNMA1
|
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr11_-_2950642 | 0.93 |
ENST00000314222.4
|
PHLDA2
|
pleckstrin homology-like domain, family A, member 2 |
| chr12_+_52643077 | 0.92 |
ENST00000553310.2
ENST00000544024.1 |
KRT86
|
keratin 86 |
| chr7_-_92777606 | 0.91 |
ENST00000437805.1
ENST00000446959.1 ENST00000439952.1 ENST00000414791.1 ENST00000446033.1 ENST00000411955.1 ENST00000318238.4 |
SAMD9L
|
sterile alpha motif domain containing 9-like |
| chr22_-_24641027 | 0.90 |
ENST00000398292.3
ENST00000263112.7 ENST00000418439.2 ENST00000424217.1 ENST00000327365.4 |
GGT5
|
gamma-glutamyltransferase 5 |
| chr7_-_139727118 | 0.89 |
ENST00000484111.1
|
PARP12
|
poly (ADP-ribose) polymerase family, member 12 |
| chr19_+_18723660 | 0.89 |
ENST00000262817.3
|
TMEM59L
|
transmembrane protein 59-like |
| chr17_-_76870222 | 0.88 |
ENST00000585421.1
|
TIMP2
|
TIMP metallopeptidase inhibitor 2 |
| chr19_-_10426663 | 0.88 |
ENST00000541276.1
ENST00000393708.3 ENST00000494368.1 |
FDX1L
|
ferredoxin 1-like |
| chr6_-_31107127 | 0.88 |
ENST00000259845.4
|
PSORS1C2
|
psoriasis susceptibility 1 candidate 2 |
| chrX_+_55101495 | 0.87 |
ENST00000374974.3
ENST00000374971.1 |
PAGE2B
|
P antigen family, member 2B |
| chr9_+_125512019 | 0.87 |
ENST00000373684.1
ENST00000304720.2 |
OR1L6
|
olfactory receptor, family 1, subfamily L, member 6 |
| chr19_-_47128294 | 0.85 |
ENST00000596260.1
ENST00000597185.1 ENST00000598865.1 ENST00000594275.1 ENST00000291294.2 |
PTGIR
|
prostaglandin I2 (prostacyclin) receptor (IP) |
| chr12_+_113344811 | 0.84 |
ENST00000551241.1
ENST00000553185.1 ENST00000550689.1 |
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr21_-_47352477 | 0.84 |
ENST00000593412.1
|
PRED62
|
Uncharacterized protein |
| chr22_-_36635684 | 0.83 |
ENST00000358502.5
|
APOL2
|
apolipoprotein L, 2 |
| chr16_+_55512742 | 0.83 |
ENST00000568715.1
ENST00000219070.4 |
MMP2
|
matrix metallopeptidase 2 (gelatinase A, 72kDa gelatinase, 72kDa type IV collagenase) |
| chr8_-_23563922 | 0.82 |
ENST00000418222.1
ENST00000325017.3 |
NKX2-6
|
NK2 homeobox 6 |
| chr6_+_29691056 | 0.82 |
ENST00000414333.1
ENST00000334668.4 ENST00000259951.7 |
HLA-F
|
major histocompatibility complex, class I, F |
| chr12_+_113354341 | 0.82 |
ENST00000553152.1
|
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr1_+_150480576 | 0.81 |
ENST00000346569.6
|
ECM1
|
extracellular matrix protein 1 |
| chr19_+_41117770 | 0.81 |
ENST00000601032.1
|
LTBP4
|
latent transforming growth factor beta binding protein 4 |
| chr19_+_35810164 | 0.80 |
ENST00000598537.1
|
CD22
|
CD22 molecule |
| chr1_-_100643765 | 0.80 |
ENST00000370137.1
ENST00000370138.1 ENST00000342895.3 |
LRRC39
|
leucine rich repeat containing 39 |
| chr1_-_154600421 | 0.79 |
ENST00000368471.3
ENST00000292205.5 |
ADAR
|
adenosine deaminase, RNA-specific |
| chr11_+_69455855 | 0.79 |
ENST00000227507.2
ENST00000536559.1 |
CCND1
|
cyclin D1 |
| chr15_+_67430339 | 0.79 |
ENST00000439724.3
|
SMAD3
|
SMAD family member 3 |
| chr20_+_388056 | 0.78 |
ENST00000411647.1
|
RBCK1
|
RanBP-type and C3HC4-type zinc finger containing 1 |
| chr19_-_51289374 | 0.78 |
ENST00000563228.1
|
CTD-2568A17.1
|
CTD-2568A17.1 |
| chrX_+_48367338 | 0.78 |
ENST00000359882.4
ENST00000537758.1 ENST00000367574.4 ENST00000355961.4 ENST00000489940.1 ENST00000361988.3 |
PORCN
|
porcupine homolog (Drosophila) |
| chr11_-_18270182 | 0.78 |
ENST00000528349.1
ENST00000526900.1 ENST00000529528.1 ENST00000414546.2 ENST00000256733.4 |
SAA2
|
serum amyloid A2 |
| chr19_-_17010360 | 0.78 |
ENST00000599287.2
|
CPAMD8
|
C3 and PZP-like, alpha-2-macroglobulin domain containing 8 |
| chr19_-_40732594 | 0.78 |
ENST00000430325.2
ENST00000433940.1 |
CNTD2
|
cyclin N-terminal domain containing 2 |
| chr14_+_55221541 | 0.77 |
ENST00000555192.1
|
SAMD4A
|
sterile alpha motif domain containing 4A |
| chr17_+_4843413 | 0.76 |
ENST00000572430.1
ENST00000262482.6 |
RNF167
|
ring finger protein 167 |
| chr1_-_109399682 | 0.76 |
ENST00000369995.3
ENST00000370001.3 |
AKNAD1
|
AKNA domain containing 1 |
| chr6_+_13182751 | 0.76 |
ENST00000415087.1
|
PHACTR1
|
phosphatase and actin regulator 1 |
| chr22_-_50970919 | 0.76 |
ENST00000329363.4
ENST00000437588.1 |
ODF3B
|
outer dense fiber of sperm tails 3B |
| chr17_+_7758374 | 0.76 |
ENST00000301599.6
ENST00000574668.1 |
TMEM88
|
transmembrane protein 88 |
| chr19_-_46272462 | 0.75 |
ENST00000317578.6
|
SIX5
|
SIX homeobox 5 |
| chr2_-_191885686 | 0.75 |
ENST00000432058.1
|
STAT1
|
signal transducer and activator of transcription 1, 91kDa |
| chr2_-_191878162 | 0.75 |
ENST00000540176.1
|
STAT1
|
signal transducer and activator of transcription 1, 91kDa |
| chr12_-_56753858 | 0.74 |
ENST00000314128.4
ENST00000557235.1 ENST00000418572.2 |
STAT2
|
signal transducer and activator of transcription 2, 113kDa |
| chr1_-_246357029 | 0.74 |
ENST00000391836.2
|
SMYD3
|
SET and MYND domain containing 3 |
| chr22_+_36649056 | 0.74 |
ENST00000397278.3
ENST00000422706.1 ENST00000426053.1 ENST00000319136.4 |
APOL1
|
apolipoprotein L, 1 |
| chr1_-_228613026 | 0.74 |
ENST00000366696.1
|
HIST3H3
|
histone cluster 3, H3 |
| chr11_-_33891362 | 0.73 |
ENST00000395833.3
|
LMO2
|
LIM domain only 2 (rhombotin-like 1) |
| chr6_-_41254403 | 0.73 |
ENST00000589614.1
ENST00000334475.6 ENST00000591620.1 ENST00000244709.4 |
TREM1
|
triggering receptor expressed on myeloid cells 1 |
| chr5_-_90610200 | 0.72 |
ENST00000511918.1
ENST00000513626.1 ENST00000607854.1 |
LUCAT1
RP11-213H15.4
|
lung cancer associated transcript 1 (non-protein coding) RP11-213H15.4 |
| chr11_+_73675873 | 0.72 |
ENST00000537753.1
ENST00000542350.1 |
DNAJB13
|
DnaJ (Hsp40) homolog, subfamily B, member 13 |
| chr1_+_209878182 | 0.71 |
ENST00000367027.3
|
HSD11B1
|
hydroxysteroid (11-beta) dehydrogenase 1 |
| chr3_+_38179969 | 0.71 |
ENST00000396334.3
ENST00000417037.2 ENST00000424893.1 ENST00000495303.1 ENST00000443433.2 ENST00000421516.1 |
MYD88
|
myeloid differentiation primary response 88 |
| chr17_-_76870126 | 0.71 |
ENST00000586057.1
|
TIMP2
|
TIMP metallopeptidase inhibitor 2 |
| chr7_-_75452673 | 0.71 |
ENST00000416943.1
|
CCL24
|
chemokine (C-C motif) ligand 24 |
| chr19_+_44331555 | 0.70 |
ENST00000590950.1
|
ZNF283
|
zinc finger protein 283 |
| chr8_-_23712312 | 0.70 |
ENST00000290271.2
|
STC1
|
stanniocalcin 1 |
| chr11_-_57335750 | 0.70 |
ENST00000340573.4
|
UBE2L6
|
ubiquitin-conjugating enzyme E2L 6 |
| chr20_-_36794938 | 0.70 |
ENST00000453095.1
|
TGM2
|
transglutaminase 2 |
| chr10_-_79397316 | 0.70 |
ENST00000372421.5
ENST00000457953.1 |
KCNMA1
|
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr12_-_52685312 | 0.69 |
ENST00000327741.5
|
KRT81
|
keratin 81 |
| chr15_-_74284558 | 0.69 |
ENST00000359750.4
ENST00000541638.1 ENST00000562453.1 |
STOML1
|
stomatin (EPB72)-like 1 |
| chr7_+_142498725 | 0.68 |
ENST00000466254.1
|
TRBC2
|
T cell receptor beta constant 2 |
| chr10_-_101380121 | 0.68 |
ENST00000370495.4
|
SLC25A28
|
solute carrier family 25 (mitochondrial iron transporter), member 28 |
| chr6_-_169563013 | 0.68 |
ENST00000439703.1
|
RP11-417E7.1
|
RP11-417E7.1 |
| chr6_-_26250835 | 0.68 |
ENST00000446824.2
|
HIST1H3F
|
histone cluster 1, H3f |
| chr11_-_61647935 | 0.68 |
ENST00000531956.1
|
FADS3
|
fatty acid desaturase 3 |
| chr19_+_51226648 | 0.67 |
ENST00000599973.1
|
CLEC11A
|
C-type lectin domain family 11, member A |
| chrX_-_70326455 | 0.67 |
ENST00000374251.5
|
CXorf65
|
chromosome X open reading frame 65 |
| chr19_-_39735646 | 0.67 |
ENST00000413851.2
|
IFNL3
|
interferon, lambda 3 |
| chr10_-_112255945 | 0.67 |
ENST00000609514.1
ENST00000607952.1 |
RP11-525A16.4
|
RP11-525A16.4 |
| chr17_-_42452063 | 0.67 |
ENST00000588098.1
|
ITGA2B
|
integrin, alpha 2b (platelet glycoprotein IIb of IIb/IIIa complex, antigen CD41) |
| chr1_+_46972668 | 0.66 |
ENST00000371956.4
ENST00000360032.3 |
DMBX1
|
diencephalon/mesencephalon homeobox 1 |
| chr3_+_11196206 | 0.66 |
ENST00000431010.2
|
HRH1
|
histamine receptor H1 |
| chr19_+_41092680 | 0.66 |
ENST00000594298.1
ENST00000597396.1 |
SHKBP1
|
SH3KBP1 binding protein 1 |
| chr2_-_158345341 | 0.66 |
ENST00000435117.1
|
CYTIP
|
cytohesin 1 interacting protein |
| chr9_-_132586378 | 0.66 |
ENST00000351698.4
|
TOR1A
|
torsin family 1, member A (torsin A) |
| chr19_+_4229495 | 0.66 |
ENST00000221847.5
|
EBI3
|
Epstein-Barr virus induced 3 |
| chr4_-_69083720 | 0.65 |
ENST00000432593.3
|
TMPRSS11BNL
|
TMPRSS11B N-terminal like |
| chr11_-_74800799 | 0.65 |
ENST00000305159.3
|
OR2AT4
|
olfactory receptor, family 2, subfamily AT, member 4 |
| chr3_+_11178779 | 0.65 |
ENST00000438284.2
|
HRH1
|
histamine receptor H1 |
| chrX_-_1331527 | 0.65 |
ENST00000381567.3
ENST00000381566.1 ENST00000400841.2 |
CRLF2
|
cytokine receptor-like factor 2 |
| chr1_-_6420737 | 0.65 |
ENST00000541130.1
ENST00000377845.3 |
ACOT7
|
acyl-CoA thioesterase 7 |
| chr10_-_90967063 | 0.65 |
ENST00000371852.2
|
CH25H
|
cholesterol 25-hydroxylase |
| chr8_-_6914251 | 0.65 |
ENST00000330590.2
|
DEFA5
|
defensin, alpha 5, Paneth cell-specific |
| chr2_+_8822113 | 0.65 |
ENST00000396290.1
ENST00000331129.3 |
ID2
|
inhibitor of DNA binding 2, dominant negative helix-loop-helix protein |
| chr2_-_99917639 | 0.64 |
ENST00000308528.4
|
LYG1
|
lysozyme G-like 1 |
| chr9_+_126777676 | 0.64 |
ENST00000488674.2
|
LHX2
|
LIM homeobox 2 |
| chr1_-_155880672 | 0.64 |
ENST00000609492.1
ENST00000368322.3 |
RIT1
|
Ras-like without CAAX 1 |
| chr22_-_36635225 | 0.64 |
ENST00000529194.1
|
APOL2
|
apolipoprotein L, 2 |
| chr19_-_38743878 | 0.64 |
ENST00000587515.1
|
PPP1R14A
|
protein phosphatase 1, regulatory (inhibitor) subunit 14A |
| chr5_+_52285144 | 0.64 |
ENST00000296585.5
|
ITGA2
|
integrin, alpha 2 (CD49B, alpha 2 subunit of VLA-2 receptor) |
| chr22_-_24622080 | 0.64 |
ENST00000425408.1
|
GGT5
|
gamma-glutamyltransferase 5 |
| chr6_+_26020672 | 0.63 |
ENST00000357647.3
|
HIST1H3A
|
histone cluster 1, H3a |
| chr17_+_4843303 | 0.63 |
ENST00000571816.1
|
RNF167
|
ring finger protein 167 |
| chr17_+_7482785 | 0.62 |
ENST00000250092.6
ENST00000380498.6 ENST00000584502.1 |
CD68
|
CD68 molecule |
| chr17_-_39677971 | 0.62 |
ENST00000393976.2
|
KRT15
|
keratin 15 |
| chr11_+_74811578 | 0.61 |
ENST00000531713.1
|
SLCO2B1
|
solute carrier organic anion transporter family, member 2B1 |
| chr3_-_157824292 | 0.61 |
ENST00000483851.2
|
SHOX2
|
short stature homeobox 2 |
| chr20_-_45530365 | 0.61 |
ENST00000414085.1
|
RP11-323C15.2
|
RP11-323C15.2 |
| chr5_-_150467221 | 0.61 |
ENST00000522226.1
|
TNIP1
|
TNFAIP3 interacting protein 1 |
| chr7_+_101928380 | 0.61 |
ENST00000536178.1
|
SH2B2
|
SH2B adaptor protein 2 |
| chr7_+_100770328 | 0.61 |
ENST00000223095.4
ENST00000445463.2 |
SERPINE1
|
serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1 |
| chr17_+_73663470 | 0.60 |
ENST00000583536.1
|
SAP30BP
|
SAP30 binding protein |
| chr12_+_113344755 | 0.60 |
ENST00000550883.1
|
OAS1
|
2'-5'-oligoadenylate synthetase 1, 40/46kDa |
| chr1_+_19970202 | 0.60 |
ENST00000439664.1
|
NBL1
|
neuroblastoma 1, DAN family BMP antagonist |
| chr7_-_1498962 | 0.60 |
ENST00000405088.4
|
MICALL2
|
MICAL-like 2 |
| chr5_+_135385202 | 0.60 |
ENST00000514554.1
|
TGFBI
|
transforming growth factor, beta-induced, 68kDa |
| chr6_+_17393888 | 0.60 |
ENST00000493172.1
ENST00000465994.1 |
CAP2
|
CAP, adenylate cyclase-associated protein, 2 (yeast) |
| chr11_-_615942 | 0.60 |
ENST00000397562.3
ENST00000330243.5 ENST00000397570.1 ENST00000397574.2 |
IRF7
|
interferon regulatory factor 7 |
| chr1_-_153585539 | 0.60 |
ENST00000368706.4
|
S100A16
|
S100 calcium binding protein A16 |
| chr14_-_61124977 | 0.60 |
ENST00000554986.1
|
SIX1
|
SIX homeobox 1 |
| chr16_+_57438679 | 0.60 |
ENST00000219244.4
|
CCL17
|
chemokine (C-C motif) ligand 17 |
| chr10_+_6821545 | 0.59 |
ENST00000436383.1
|
LINC00707
|
long intergenic non-protein coding RNA 707 |
| chr18_+_21464737 | 0.59 |
ENST00000586751.1
|
LAMA3
|
laminin, alpha 3 |
| chr22_-_37215523 | 0.59 |
ENST00000216200.5
|
PVALB
|
parvalbumin |
| chr10_-_79397202 | 0.59 |
ENST00000372437.1
ENST00000372408.2 ENST00000372403.4 |
KCNMA1
|
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
| chr15_-_60695071 | 0.59 |
ENST00000557904.1
|
ANXA2
|
annexin A2 |
| chr5_-_38845812 | 0.58 |
ENST00000513480.1
ENST00000512519.1 |
CTD-2127H9.1
|
CTD-2127H9.1 |
| chr19_-_49944806 | 0.58 |
ENST00000221485.3
|
SLC17A7
|
solute carrier family 17 (vesicular glutamate transporter), member 7 |
| chr8_-_23282820 | 0.58 |
ENST00000520871.1
|
LOXL2
|
lysyl oxidase-like 2 |
| chr20_+_42544782 | 0.58 |
ENST00000423191.2
ENST00000372999.1 |
TOX2
|
TOX high mobility group box family member 2 |
| chrX_+_151903253 | 0.57 |
ENST00000452779.2
ENST00000370291.2 |
CSAG1
|
chondrosarcoma associated gene 1 |
| chr6_-_44233361 | 0.57 |
ENST00000275015.5
|
NFKBIE
|
nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, epsilon |
| chr5_+_53686658 | 0.57 |
ENST00000512618.1
|
LINC01033
|
long intergenic non-protein coding RNA 1033 |
| chrX_+_135279179 | 0.57 |
ENST00000370676.3
|
FHL1
|
four and a half LIM domains 1 |
| chr6_+_126102292 | 0.57 |
ENST00000368357.3
|
NCOA7
|
nuclear receptor coactivator 7 |
| chr19_-_55881741 | 0.57 |
ENST00000264563.2
ENST00000590625.1 ENST00000585513.1 |
IL11
|
interleukin 11 |
| chr5_+_175976324 | 0.57 |
ENST00000261944.5
|
CDHR2
|
cadherin-related family member 2 |
| chr15_+_90735145 | 0.57 |
ENST00000559792.1
|
SEMA4B
|
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4B |
| chr3_-_139195350 | 0.57 |
ENST00000232217.2
|
RBP2
|
retinol binding protein 2, cellular |
| chr16_+_56691838 | 0.57 |
ENST00000394501.2
|
MT1F
|
metallothionein 1F |
| chr5_-_139726181 | 0.56 |
ENST00000507104.1
ENST00000230990.6 |
HBEGF
|
heparin-binding EGF-like growth factor |
| chr2_+_149402989 | 0.56 |
ENST00000397424.2
|
EPC2
|
enhancer of polycomb homolog 2 (Drosophila) |
| chrX_+_135278908 | 0.56 |
ENST00000539015.1
ENST00000370683.1 |
FHL1
|
four and a half LIM domains 1 |
| chr22_-_20745048 | 0.56 |
ENST00000454608.2
|
USP41
|
ubiquitin specific peptidase 41 |
| chr12_+_2912363 | 0.56 |
ENST00000544366.1
|
FKBP4
|
FK506 binding protein 4, 59kDa |
| chr1_+_47137445 | 0.56 |
ENST00000569393.1
ENST00000334122.4 ENST00000415500.1 |
TEX38
|
testis expressed 38 |
| chr12_-_69080590 | 0.56 |
ENST00000433116.2
ENST00000500695.2 |
RP11-637A17.2
|
RP11-637A17.2 |
| chr19_-_44172396 | 0.55 |
ENST00000602141.1
ENST00000593939.1 ENST00000599546.1 |
PLAUR
|
plasminogen activator, urokinase receptor |
| chr5_-_150466692 | 0.55 |
ENST00000315050.7
ENST00000523338.1 ENST00000522100.1 |
TNIP1
|
TNFAIP3 interacting protein 1 |
| chr11_-_104972158 | 0.55 |
ENST00000598974.1
ENST00000593315.1 ENST00000594519.1 ENST00000415981.2 ENST00000525374.1 ENST00000375707.1 |
CASP1
CARD16
CARD17
|
caspase 1, apoptosis-related cysteine peptidase caspase recruitment domain family, member 16 caspase recruitment domain family, member 17 |
| chr11_-_61646054 | 0.55 |
ENST00000527379.1
|
FADS3
|
fatty acid desaturase 3 |
| chr19_-_11456722 | 0.54 |
ENST00000354882.5
|
TMEM205
|
transmembrane protein 205 |
| chr6_-_26043885 | 0.54 |
ENST00000357905.2
|
HIST1H2BB
|
histone cluster 1, H2bb |
| chr14_+_78227105 | 0.54 |
ENST00000439131.2
ENST00000355883.3 ENST00000557011.1 ENST00000556047.1 |
C14orf178
|
chromosome 14 open reading frame 178 |
| chr4_+_75230853 | 0.54 |
ENST00000244869.2
|
EREG
|
epiregulin |
| chr1_+_79086088 | 0.54 |
ENST00000370751.5
ENST00000342282.3 |
IFI44L
|
interferon-induced protein 44-like |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.4 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.5 | 1.5 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 0.4 | 4.9 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) |
| 0.4 | 1.5 | GO:0046725 | negative regulation by virus of viral protein levels in host cell(GO:0046725) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) |
| 0.4 | 1.1 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.3 | 1.4 | GO:0018277 | protein deamination(GO:0018277) |
| 0.3 | 0.3 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
| 0.3 | 1.0 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.3 | 2.5 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.3 | 3.7 | GO:0034465 | response to carbon monoxide(GO:0034465) |
| 0.3 | 2.2 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.3 | 0.9 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.3 | 1.7 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.3 | 3.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.3 | 1.7 | GO:0019060 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.3 | 0.8 | GO:0072616 | interleukin-18 secretion(GO:0072616) |
| 0.3 | 1.3 | GO:0052027 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.3 | 1.1 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.3 | 0.8 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.3 | 1.3 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.3 | 1.8 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
| 0.3 | 0.5 | GO:0051389 | inactivation of MAPKK activity(GO:0051389) |
| 0.3 | 1.0 | GO:0018153 | isopeptide cross-linking via N6-(L-isoglutamyl)-L-lysine(GO:0018153) isopeptide cross-linking(GO:0018262) |
| 0.2 | 0.2 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.2 | 1.0 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.2 | 1.4 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.2 | 0.2 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
| 0.2 | 0.7 | GO:0036058 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) |
| 0.2 | 2.5 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.2 | 1.8 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.2 | 0.7 | GO:2000501 | regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.2 | 0.6 | GO:0033341 | regulation of collagen binding(GO:0033341) |
| 0.2 | 0.8 | GO:1900535 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.2 | 0.6 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.2 | 0.6 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
| 0.2 | 1.0 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
| 0.2 | 0.8 | GO:0019046 | release from viral latency(GO:0019046) |
| 0.2 | 0.6 | GO:0001300 | chronological cell aging(GO:0001300) |
| 0.2 | 1.0 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.2 | 0.6 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.2 | 2.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.2 | 0.6 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.2 | 0.6 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.2 | 0.6 | GO:0090675 | intermicrovillar adhesion(GO:0090675) |
| 0.2 | 0.9 | GO:1904744 | positive regulation of telomeric DNA binding(GO:1904744) |
| 0.2 | 0.9 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.2 | 0.6 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) suppression by virus of host autophagy(GO:0039521) |
| 0.2 | 0.9 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.2 | 0.7 | GO:0090301 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.2 | 0.7 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.2 | 0.7 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.2 | 0.5 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.2 | 1.0 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.2 | 0.5 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.2 | 0.2 | GO:0045210 | FasL biosynthetic process(GO:0045210) |
| 0.2 | 0.2 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.2 | 0.5 | GO:2000224 | sesquiterpenoid metabolic process(GO:0006714) sesquiterpenoid catabolic process(GO:0016107) farnesol metabolic process(GO:0016487) farnesol catabolic process(GO:0016488) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.2 | 0.2 | GO:1901258 | positive regulation of granulocyte colony-stimulating factor production(GO:0071657) positive regulation of macrophage colony-stimulating factor production(GO:1901258) |
| 0.2 | 1.1 | GO:2000317 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
| 0.2 | 0.9 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 0.2 | 0.6 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.2 | 0.6 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
| 0.2 | 0.5 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.1 | 0.3 | GO:0010039 | response to iron ion(GO:0010039) |
| 0.1 | 0.4 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.1 | 0.4 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.1 | 0.6 | GO:0052418 | multi-organism catabolic process(GO:0044035) development of symbiont involved in interaction with host(GO:0044115) modulation of development of symbiont involved in interaction with host(GO:0044145) negative regulation of development of symbiont involved in interaction with host(GO:0044147) metabolism of substance in other organism involved in symbiotic interaction(GO:0052214) catabolism of substance in other organism involved in symbiotic interaction(GO:0052227) metabolism of macromolecule in other organism involved in symbiotic interaction(GO:0052229) catabolism by host of symbiont macromolecule(GO:0052360) catabolism by organism of macromolecule in other organism involved in symbiotic interaction(GO:0052361) catabolism by host of symbiont protein(GO:0052362) catabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052363) catabolism by host of substance in symbiont(GO:0052364) metabolism by host of symbiont macromolecule(GO:0052416) metabolism by host of symbiont protein(GO:0052417) metabolism by organism of protein in other organism involved in symbiotic interaction(GO:0052418) metabolism by host of substance in symbiont(GO:0052419) |
| 0.1 | 0.4 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 0.1 | 2.6 | GO:1901748 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.1 | 0.6 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.1 | 0.9 | GO:0002860 | positive regulation of natural killer cell mediated immune response to tumor cell(GO:0002857) positive regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002860) |
| 0.1 | 0.4 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.1 | 0.4 | GO:0033319 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.1 | 0.8 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.1 | 0.7 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.1 | 1.2 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.1 | 0.6 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 | 1.1 | GO:0051852 | disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
| 0.1 | 0.5 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.1 | 0.4 | GO:0045360 | interleukin-1 biosynthetic process(GO:0042222) regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) |
| 0.1 | 1.2 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 | 0.5 | GO:1904199 | positive regulation of regulation of vascular smooth muscle cell membrane depolarization(GO:1904199) regulation of vascular smooth muscle cell membrane depolarization(GO:1990736) |
| 0.1 | 0.8 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
| 0.1 | 0.5 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.1 | 0.7 | GO:1900244 | positive regulation of synaptic vesicle endocytosis(GO:1900244) positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.1 | 0.3 | GO:0031498 | chromatin disassembly(GO:0031498) |
| 0.1 | 0.4 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.1 | 0.4 | GO:2000824 | negative regulation of androgen receptor activity(GO:2000824) |
| 0.1 | 0.3 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.1 | 0.1 | GO:0051930 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.1 | 0.4 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.1 | 1.0 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.1 | 1.0 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 | 0.4 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.1 | 0.4 | GO:0006738 | nicotinamide riboside catabolic process(GO:0006738) nicotinamide riboside metabolic process(GO:0046495) pyridine nucleoside metabolic process(GO:0070637) pyridine nucleoside catabolic process(GO:0070638) |
| 0.1 | 0.9 | GO:0043606 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.1 | 0.2 | GO:1903949 | positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.1 | 0.7 | GO:0000270 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.1 | 1.2 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.1 | 0.6 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.1 | 1.2 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.1 | 0.4 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 0.1 | 0.7 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.1 | 0.5 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.1 | 0.2 | GO:0010511 | regulation of phosphatidylinositol biosynthetic process(GO:0010511) negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.1 | 0.4 | GO:0002731 | negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.1 | 0.7 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 | 0.5 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.1 | 1.4 | GO:1903943 | negative regulation of myoblast fusion(GO:1901740) regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.1 | 2.2 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.1 | 0.6 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.1 | 0.3 | GO:0086092 | regulation of the force of heart contraction by cardiac conduction(GO:0086092) |
| 0.1 | 12.3 | GO:0071357 | type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.1 | 0.2 | GO:0002232 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 0.1 | 2.6 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.1 | 0.2 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.1 | 0.3 | GO:0035038 | female pronucleus assembly(GO:0035038) |
| 0.1 | 0.2 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 | 0.4 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.1 | 0.5 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 1.1 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.1 | 0.9 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.1 | 0.5 | GO:0006696 | ergosterol biosynthetic process(GO:0006696) ergosterol metabolic process(GO:0008204) |
| 0.1 | 0.4 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.1 | 0.4 | GO:0001970 | positive regulation of activation of membrane attack complex(GO:0001970) |
| 0.1 | 0.1 | GO:0071046 | nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.1 | 0.1 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.7 | GO:0046985 | negative regulation of megakaryocyte differentiation(GO:0045653) positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.1 | 2.6 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 1.0 | GO:0070141 | response to UV-A(GO:0070141) |
| 0.1 | 0.3 | GO:0060474 | positive regulation of sperm motility involved in capacitation(GO:0060474) |
| 0.1 | 0.8 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.5 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.1 | 0.8 | GO:1902571 | regulation of serine-type endopeptidase activity(GO:1900003) regulation of serine-type peptidase activity(GO:1902571) |
| 0.1 | 0.5 | GO:2000470 | negative regulation of dopamine uptake involved in synaptic transmission(GO:0051585) norepinephrine uptake(GO:0051620) regulation of norepinephrine uptake(GO:0051621) negative regulation of norepinephrine uptake(GO:0051622) negative regulation of catecholamine uptake involved in synaptic transmission(GO:0051945) regulation of glutathione peroxidase activity(GO:1903282) positive regulation of glutathione peroxidase activity(GO:1903284) positive regulation of hydrogen peroxide catabolic process(GO:1903285) positive regulation of peroxidase activity(GO:2000470) |
| 0.1 | 0.1 | GO:0055073 | cadmium ion homeostasis(GO:0055073) |
| 0.1 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 0.2 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.1 | 1.0 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 | 1.0 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 0.1 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.1 | 0.3 | GO:0006711 | estrogen catabolic process(GO:0006711) |
| 0.1 | 0.2 | GO:0030101 | natural killer cell activation(GO:0030101) |
| 0.1 | 2.4 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.1 | 0.7 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.1 | 0.1 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 | 0.7 | GO:0038172 | interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.1 | 0.2 | GO:0060031 | mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
| 0.1 | 0.3 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.1 | 0.1 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.1 | 0.2 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.1 | 0.5 | GO:0036511 | trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
| 0.1 | 1.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.1 | 0.3 | GO:0061536 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.1 | 0.3 | GO:2000657 | regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
| 0.1 | 0.5 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.1 | 0.9 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.1 | 0.4 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.1 | 0.3 | GO:0002728 | negative regulation of natural killer cell cytokine production(GO:0002728) |
| 0.1 | 0.6 | GO:0015887 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 0.1 | 0.6 | GO:0001575 | globoside metabolic process(GO:0001575) |
| 0.1 | 0.3 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.1 | 1.1 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.1 | 0.2 | GO:0097018 | renal albumin absorption(GO:0097018) regulation of renal albumin absorption(GO:2000532) |
| 0.1 | 0.2 | GO:1990834 | response to odorant(GO:1990834) |
| 0.1 | 0.2 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 0.1 | 0.2 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.1 | 0.9 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.1 | 0.4 | GO:0003070 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.1 | 0.3 | GO:0036451 | cap mRNA methylation(GO:0036451) |
| 0.1 | 0.3 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA transport(GO:0051031) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 0.4 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.1 | 0.3 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
| 0.1 | 0.2 | GO:0018208 | protein peptidyl-prolyl isomerization(GO:0000413) peptidyl-proline modification(GO:0018208) |
| 0.1 | 0.8 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.1 | 0.4 | GO:0045337 | geranyl diphosphate metabolic process(GO:0033383) geranyl diphosphate biosynthetic process(GO:0033384) farnesyl diphosphate biosynthetic process(GO:0045337) farnesyl diphosphate metabolic process(GO:0045338) |
| 0.1 | 0.4 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
| 0.1 | 0.3 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 0.1 | 0.9 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.1 | 0.8 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.1 | 0.1 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
| 0.1 | 1.1 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 | 0.1 | GO:0050732 | negative regulation of peptidyl-tyrosine phosphorylation(GO:0050732) |
| 0.1 | 1.0 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.1 | 0.3 | GO:0051086 | chaperone mediated protein folding independent of cofactor(GO:0051086) |
| 0.1 | 3.8 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.1 | 0.1 | GO:1902358 | sulfate transmembrane transport(GO:1902358) |
| 0.1 | 0.3 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.1 | 0.3 | GO:0021816 | lamellipodium assembly involved in ameboidal cell migration(GO:0003363) extension of a leading process involved in cell motility in cerebral cortex radial glia guided migration(GO:0021816) |
| 0.1 | 0.3 | GO:0071825 | protein-lipid complex subunit organization(GO:0071825) |
| 0.1 | 1.0 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.2 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.1 | 0.4 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.1 | 0.3 | GO:0036309 | protein localization to M-band(GO:0036309) |
| 0.1 | 0.7 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
| 0.1 | 0.7 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.1 | 0.5 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.1 | 0.5 | GO:0032625 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.1 | 0.4 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.1 | 0.2 | GO:0098976 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.1 | 0.4 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
| 0.1 | 0.3 | GO:0048691 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.1 | 0.8 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.1 | 0.4 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.1 | 0.4 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
| 0.1 | 1.1 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
| 0.1 | 0.2 | GO:0046110 | xanthine metabolic process(GO:0046110) |
| 0.1 | 0.7 | GO:0055014 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.1 | 0.2 | GO:0001172 | transcription, RNA-templated(GO:0001172) |
| 0.1 | 0.9 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 | 0.2 | GO:2000724 | regulation of cardiac vascular smooth muscle cell differentiation(GO:2000722) positive regulation of cardiac vascular smooth muscle cell differentiation(GO:2000724) |
| 0.1 | 0.4 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.1 | 0.4 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.1 | 0.2 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.1 | 0.4 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.1 | 0.2 | GO:0021502 | neural fold elevation formation(GO:0021502) allantois development(GO:1905069) |
| 0.1 | 0.1 | GO:0050766 | positive regulation of phagocytosis(GO:0050766) |
| 0.1 | 0.1 | GO:1990051 | activation of protein kinase C activity(GO:1990051) |
| 0.1 | 1.0 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.1 | 2.1 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.4 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) |
| 0.1 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.1 | 0.3 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.1 | 1.2 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.1 | 0.6 | GO:0018212 | peptidyl-tyrosine phosphorylation(GO:0018108) peptidyl-tyrosine modification(GO:0018212) |
| 0.1 | 0.4 | GO:0030421 | defecation(GO:0030421) |
| 0.1 | 0.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.1 | 0.4 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.1 | 0.1 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.1 | 0.9 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 0.1 | GO:0034402 | recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
| 0.1 | 0.4 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.1 | 0.3 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.1 | 0.5 | GO:1902164 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.1 | 0.5 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.1 | 0.6 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.1 | 0.7 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.1 | 0.3 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 0.2 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.1 | 1.8 | GO:0044364 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.1 | 0.7 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 | 0.5 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.1 | 0.1 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
| 0.1 | 2.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.3 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.5 | GO:1901297 | positive regulation of ephrin receptor signaling pathway(GO:1901189) positive regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901297) positive regulation of canonical Wnt signaling pathway involved in heart development(GO:1905068) |
| 0.1 | 0.1 | GO:0072720 | response to dithiothreitol(GO:0072720) |
| 0.1 | 0.2 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 | 0.4 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.1 | 0.2 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 0.1 | 0.2 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.1 | 1.3 | GO:0046697 | decidualization(GO:0046697) |
| 0.1 | 1.1 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.1 | 0.4 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.1 | 0.7 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.1 | 0.3 | GO:0016102 | retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
| 0.1 | 0.3 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.1 | 1.0 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.1 | 0.3 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.1 | 0.3 | GO:1905167 | positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.1 | 0.1 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.1 | 0.1 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.1 | 0.1 | GO:0034285 | response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.1 | 0.8 | GO:1904867 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.1 | 0.3 | GO:1904995 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.1 | 0.1 | GO:0097325 | melanocyte proliferation(GO:0097325) |
| 0.1 | 0.4 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.1 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) branch elongation involved in mammary gland duct branching(GO:0060751) |
| 0.1 | 0.2 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
| 0.1 | 0.2 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.1 | 0.3 | GO:0006127 | glycerophosphate shuttle(GO:0006127) |
| 0.1 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.1 | 0.1 | GO:0007320 | insemination(GO:0007320) |
| 0.1 | 0.8 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
| 0.1 | 1.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.1 | 0.7 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 1.0 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
| 0.1 | 0.1 | GO:0060838 | lymphatic endothelial cell fate commitment(GO:0060838) |
| 0.1 | 0.2 | GO:0030187 | melatonin metabolic process(GO:0030186) melatonin biosynthetic process(GO:0030187) |
| 0.1 | 0.3 | GO:0048241 | epinephrine transport(GO:0048241) |
| 0.1 | 0.2 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 | 0.7 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 | 0.7 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.1 | 0.2 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.1 | 0.2 | GO:0035668 | TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.1 | 0.2 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.1 | 0.4 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.1 | 0.7 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.1 | 0.5 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.1 | 0.6 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 1.5 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.1 | 0.2 | GO:0010899 | regulation of phosphatidylcholine catabolic process(GO:0010899) negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.1 | 0.5 | GO:0070305 | response to cGMP(GO:0070305) |
| 0.1 | 0.1 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.1 | 0.3 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
| 0.1 | 0.3 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
| 0.1 | 0.1 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.1 | 0.2 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.1 | 0.4 | GO:0014003 | oligodendrocyte development(GO:0014003) |
| 0.1 | 0.8 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 0.1 | GO:2000157 | negative regulation of protein deubiquitination(GO:0090086) regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.1 | 0.2 | GO:0035907 | dorsal aorta development(GO:0035907) |
| 0.1 | 0.1 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.1 | 0.2 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.1 | 0.2 | GO:0015855 | pyrimidine nucleobase transport(GO:0015855) purine nucleobase transmembrane transport(GO:1904823) |
| 0.1 | 0.2 | GO:0036367 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.1 | 0.6 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 0.1 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 | 0.7 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.1 | 0.1 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.1 | 0.4 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.3 | GO:0016098 | monoterpenoid metabolic process(GO:0016098) |
| 0.1 | 0.2 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 | 0.1 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) positive regulation of mononuclear cell migration(GO:0071677) |
| 0.1 | 0.4 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.1 | 0.2 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.1 | 0.5 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
| 0.1 | 0.3 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
| 0.1 | 0.3 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.1 | 0.2 | GO:0038178 | complement component C5a signaling pathway(GO:0038178) negative regulation of granulocyte chemotaxis(GO:0071623) negative regulation of neutrophil chemotaxis(GO:0090024) negative regulation of neutrophil migration(GO:1902623) |
| 0.1 | 0.1 | GO:0015867 | ADP transport(GO:0015866) ATP transport(GO:0015867) adenine nucleotide transport(GO:0051503) |
| 0.1 | 0.2 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.1 | 0.2 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.1 | 0.1 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.1 | 0.2 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.1 | 0.1 | GO:0061145 | bronchus cartilage development(GO:0060532) lung smooth muscle development(GO:0061145) |
| 0.1 | 0.1 | GO:0021965 | spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.1 | 0.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) regulation of skeletal muscle hypertrophy(GO:1904204) |
| 0.1 | 0.4 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.1 | 0.2 | GO:0035989 | tendon development(GO:0035989) |
| 0.0 | 0.0 | GO:0051029 | rRNA transport(GO:0051029) |
| 0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 | 0.3 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.0 | 0.7 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.0 | 0.2 | GO:0001971 | negative regulation of activation of membrane attack complex(GO:0001971) |
| 0.0 | 0.5 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.0 | 0.2 | GO:2000969 | positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.0 | 0.0 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.0 | 0.4 | GO:0035864 | response to potassium ion(GO:0035864) |
| 0.0 | 0.4 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.2 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.0 | 0.2 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.0 | 0.4 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 | 0.1 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
| 0.0 | 0.3 | GO:0010595 | positive regulation of endothelial cell migration(GO:0010595) |
| 0.0 | 0.0 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
| 0.0 | 0.2 | GO:0003184 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 0.0 | 0.2 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.0 | 0.2 | GO:0090402 | senescence-associated heterochromatin focus assembly(GO:0035986) oncogene-induced cell senescence(GO:0090402) |
| 0.0 | 0.1 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.0 | 0.3 | GO:0036166 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.0 | 0.1 | GO:0010877 | lipid transport involved in lipid storage(GO:0010877) |
| 0.0 | 0.1 | GO:0007530 | sex determination(GO:0007530) |
| 0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.0 | 0.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.0 | 0.2 | GO:0071874 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.0 | 0.0 | GO:0035933 | glucocorticoid secretion(GO:0035933) regulation of glucocorticoid secretion(GO:2000849) |
| 0.0 | 0.3 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.3 | GO:0099540 | synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.0 | 0.1 | GO:0035967 | cellular response to topologically incorrect protein(GO:0035967) |
| 0.0 | 0.1 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.0 | 0.0 | GO:0001508 | action potential(GO:0001508) |
| 0.0 | 0.2 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.2 | GO:0019374 | galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.0 | 0.4 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.0 | 0.2 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 | 0.0 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.1 | GO:0007493 | endodermal cell fate determination(GO:0007493) |
| 0.0 | 0.1 | GO:1904925 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.0 | 1.2 | GO:0048247 | lymphocyte chemotaxis(GO:0048247) |
| 0.0 | 0.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.0 | 0.3 | GO:0002675 | positive regulation of acute inflammatory response(GO:0002675) |
| 0.0 | 0.3 | GO:0032418 | lysosome localization(GO:0032418) |
| 0.0 | 0.3 | GO:0060068 | vagina development(GO:0060068) |
| 0.0 | 0.1 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.0 | 0.2 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.0 | 0.2 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.0 | 1.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.5 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.0 | 0.2 | GO:0046449 | allantoin metabolic process(GO:0000255) creatinine metabolic process(GO:0046449) |
| 0.0 | 0.1 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.0 | 1.6 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.8 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.0 | 0.9 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
| 0.0 | 0.2 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.0 | 0.3 | GO:0018149 | peptide cross-linking(GO:0018149) |
| 0.0 | 0.3 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 0.3 | GO:1904550 | chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.0 | 0.2 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.0 | 0.1 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.0 | 0.2 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.0 | 0.1 | GO:0021718 | pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.0 | 0.1 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
| 0.0 | 0.2 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
| 0.0 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.0 | 0.1 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.1 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 | 0.1 | GO:0032930 | positive regulation of superoxide anion generation(GO:0032930) |
| 0.0 | 1.1 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.0 | GO:1901860 | positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.0 | 1.1 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.4 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.3 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 | 0.1 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.0 | 0.1 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) positive regulation of fibrinolysis(GO:0051919) |
| 0.0 | 0.7 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.1 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.0 | 0.1 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) |
| 0.0 | 0.3 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.1 | GO:0060796 | regulation of transcription involved in primary germ layer cell fate commitment(GO:0060796) |
| 0.0 | 0.2 | GO:0017157 | regulation of exocytosis(GO:0017157) |
| 0.0 | 0.0 | GO:0014839 | myoblast migration involved in skeletal muscle regeneration(GO:0014839) |
| 0.0 | 0.5 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
| 0.0 | 0.2 | GO:0019303 | D-ribose catabolic process(GO:0019303) |
| 0.0 | 0.4 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.0 | 0.4 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 | 0.7 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
| 0.0 | 0.2 | GO:0072425 | signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) |
| 0.0 | 0.0 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.0 | 0.4 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
| 0.0 | 0.4 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) |
| 0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.2 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.0 | 0.7 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.0 | 0.2 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 | 0.1 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.0 | 5.5 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 0.5 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.6 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.0 | 0.3 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) |
| 0.0 | 0.1 | GO:0007614 | short-term memory(GO:0007614) |
| 0.0 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.0 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.3 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.2 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.0 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.2 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.0 | 0.4 | GO:0035524 | L-alanine transport(GO:0015808) proline transmembrane transport(GO:0035524) |
| 0.0 | 0.2 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.0 | 0.1 | GO:0031650 | regulation of heat generation(GO:0031650) |
| 0.0 | 0.2 | GO:0051145 | smooth muscle cell differentiation(GO:0051145) |
| 0.0 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.4 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
| 0.0 | 0.0 | GO:0090298 | negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.0 | 0.1 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.0 | 0.1 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.0 | 0.3 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 | 0.1 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.0 | 0.0 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
| 0.0 | 0.3 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
| 0.0 | 0.1 | GO:0072249 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.0 | 0.9 | GO:0045907 | positive regulation of vasoconstriction(GO:0045907) |
| 0.0 | 0.4 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.0 | 0.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.0 | 0.1 | GO:1903979 | negative regulation of microglial cell activation(GO:1903979) |
| 0.0 | 0.5 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:0048665 | neuron fate specification(GO:0048665) |
| 0.0 | 0.3 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.0 | 1.6 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.0 | 0.3 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.0 | 0.1 | GO:0071284 | cellular response to lead ion(GO:0071284) |
| 0.0 | 0.1 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 0.1 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.0 | 0.1 | GO:1903722 | regulation of centriole elongation(GO:1903722) |
| 0.0 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.0 | 0.4 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
| 0.0 | 0.1 | GO:0097647 | dimeric G-protein coupled receptor signaling pathway(GO:0038042) calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.0 | 0.4 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.6 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.0 | GO:0072025 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric DCT cell differentiation(GO:0072240) |
| 0.0 | 0.4 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.0 | 1.5 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.0 | GO:0042461 | photoreceptor cell development(GO:0042461) |
| 0.0 | 0.2 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.0 | 0.1 | GO:0033037 | polysaccharide localization(GO:0033037) |
| 0.0 | 0.3 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.0 | 0.1 | GO:0048705 | skeletal system morphogenesis(GO:0048705) |
| 0.0 | 0.1 | GO:0098596 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
| 0.0 | 0.1 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.0 | 0.2 | GO:0036503 | ERAD pathway(GO:0036503) |
| 0.0 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.1 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.0 | 0.1 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.0 | 0.2 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.0 | 0.7 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.0 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.0 | 0.7 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.1 | GO:0050894 | determination of affect(GO:0050894) |
| 0.0 | 0.5 | GO:0042355 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.3 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.0 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.0 | 0.2 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.0 | 0.1 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.0 | 0.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.0 | 0.2 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) |
| 0.0 | 0.1 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
| 0.0 | 0.2 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.0 | 1.3 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 1.0 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.0 | 0.1 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.0 | 0.2 | GO:1904783 | positive regulation of NMDA glutamate receptor activity(GO:1904783) |
| 0.0 | 0.3 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.0 | 0.1 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 0.0 | 0.1 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.0 | 0.4 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 1.0 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.0 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.1 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.0 | 1.8 | GO:0060135 | maternal process involved in female pregnancy(GO:0060135) |
| 0.0 | 0.0 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 0.1 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.0 | 0.1 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.0 | 0.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.0 | 0.3 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.0 | 0.6 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 1.0 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.0 | 0.1 | GO:0051413 | response to cortisone(GO:0051413) |
| 0.0 | 0.1 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.0 | 0.0 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.0 | 0.1 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.1 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.0 | 0.1 | GO:0060334 | regulation of response to interferon-gamma(GO:0060330) regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.0 | 0.6 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 | 0.1 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.0 | 0.1 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.0 | 0.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.1 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.0 | 1.8 | GO:0070206 | protein trimerization(GO:0070206) |
| 0.0 | 0.1 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.0 | 0.0 | GO:0035378 | carbon dioxide transmembrane transport(GO:0035378) |
| 0.0 | 0.1 | GO:0002881 | negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
| 0.0 | 0.1 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.2 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.0 | 0.1 | GO:0001660 | fever generation(GO:0001660) |
| 0.0 | 0.1 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.0 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 | 0.1 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.0 | 2.0 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.1 | GO:0030952 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) establishment or maintenance of cytoskeleton polarity(GO:0030952) |
| 0.0 | 0.5 | GO:0030220 | platelet formation(GO:0030220) |
| 0.0 | 1.9 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.1 | GO:0030913 | paranodal junction assembly(GO:0030913) |
| 0.0 | 3.0 | GO:0002479 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-dependent(GO:0002479) |
| 0.0 | 0.1 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.0 | 0.1 | GO:0046086 | adenosine biosynthetic process(GO:0046086) |
| 0.0 | 0.2 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.0 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.0 | 0.2 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) |
| 0.0 | 1.1 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.4 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.0 | 0.0 | GO:1903625 | negative regulation of DNA catabolic process(GO:1903625) |
| 0.0 | 0.4 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.2 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) |
| 0.0 | 0.5 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 0.5 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.1 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 | 0.1 | GO:1990874 | regulation of vascular smooth muscle cell proliferation(GO:1904705) vascular smooth muscle cell proliferation(GO:1990874) |
| 0.0 | 0.1 | GO:0035881 | amacrine cell differentiation(GO:0035881) regulation of intestinal epithelial structure maintenance(GO:0060730) |
| 0.0 | 0.1 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) |
| 0.0 | 0.2 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 0.1 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.0 | 0.1 | GO:0048565 | digestive tract development(GO:0048565) |
| 0.0 | 0.4 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.0 | 0.4 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.6 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.5 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.3 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.2 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.0 | 0.4 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.0 | 0.0 | GO:0030397 | mitotic nuclear envelope disassembly(GO:0007077) membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.0 | 0.1 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.0 | 0.1 | GO:0070091 | glucagon secretion(GO:0070091) |
| 0.0 | 0.6 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.0 | 0.4 | GO:0031269 | pseudopodium assembly(GO:0031269) |
| 0.0 | 0.1 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.0 | 0.8 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.0 | 0.2 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.0 | 0.2 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.0 | 0.1 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) negative regulation of store-operated calcium channel activity(GO:1901340) |
| 0.0 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.0 | 0.5 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.1 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.0 | 0.5 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.0 | 0.0 | GO:1900195 | positive regulation of oocyte maturation(GO:1900195) |
| 0.0 | 0.1 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.1 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.4 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.0 | 0.2 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.0 | 0.1 | GO:0071362 | cellular response to ether(GO:0071362) |
| 0.0 | 0.2 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.0 | 0.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.0 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.0 | 0.1 | GO:0060347 | trabecula formation(GO:0060343) heart trabecula formation(GO:0060347) |
| 0.0 | 0.0 | GO:0070301 | cellular response to hydrogen peroxide(GO:0070301) |
| 0.0 | 0.0 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.0 | 0.2 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
| 0.0 | 0.2 | GO:1904379 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.0 | 0.5 | GO:0007567 | parturition(GO:0007567) |
| 0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 | 0.1 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.0 | 0.1 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.0 | 0.1 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.0 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.1 | GO:0006940 | regulation of smooth muscle contraction(GO:0006940) |
| 0.0 | 0.0 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.0 | 0.5 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.0 | 0.1 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.0 | 0.1 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.0 | 0.2 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.0 | 0.1 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
| 0.0 | 1.3 | GO:1901016 | regulation of potassium ion transmembrane transporter activity(GO:1901016) |
| 0.0 | 0.3 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.0 | GO:2000397 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.0 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.3 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.0 | 0.4 | GO:0051775 | response to redox state(GO:0051775) |
| 0.0 | 0.5 | GO:0001702 | gastrulation with mouth forming second(GO:0001702) |
| 0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.0 | 0.2 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.0 | 0.1 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.0 | 0.1 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.0 | 0.0 | GO:0022410 | circadian sleep/wake cycle process(GO:0022410) circadian sleep/wake cycle(GO:0042745) circadian sleep/wake cycle, sleep(GO:0050802) |
| 0.0 | 0.1 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.0 | 0.2 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.0 | 0.5 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.0 | GO:0006809 | nitric oxide biosynthetic process(GO:0006809) nitric oxide metabolic process(GO:0046209) reactive nitrogen species metabolic process(GO:2001057) |
| 0.0 | 0.2 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.0 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
| 0.0 | 0.1 | GO:0046778 | modulation by virus of host gene expression(GO:0039656) modification by virus of host mRNA processing(GO:0046778) |
| 0.0 | 0.3 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.0 | 0.1 | GO:0001928 | regulation of exocyst assembly(GO:0001928) regulation of exocyst localization(GO:0060178) |
| 0.0 | 0.5 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) |
| 0.0 | 0.1 | GO:0045124 | regulation of bone resorption(GO:0045124) |
| 0.0 | 0.4 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
| 0.0 | 0.1 | GO:0098881 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.0 | 0.0 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.0 | 0.1 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.1 | GO:0097032 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.0 | 0.1 | GO:0045013 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.0 | 0.3 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.0 | 0.9 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.0 | 0.1 | GO:1900276 | negative regulation of phospholipase C activity(GO:1900275) regulation of proteinase activated receptor activity(GO:1900276) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
| 0.0 | 0.1 | GO:0051758 | homologous chromosome movement towards spindle pole involved in homologous chromosome segregation(GO:0051758) |
| 0.0 | 0.0 | GO:1905053 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.0 | 0.1 | GO:0019542 | acetate metabolic process(GO:0006083) acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
| 0.0 | 0.1 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.0 | 0.2 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.5 | GO:0060285 | cilium-dependent cell motility(GO:0060285) |
| 0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.3 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.0 | 0.4 | GO:0002021 | response to dietary excess(GO:0002021) |
| 0.0 | 0.3 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.2 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.0 | 0.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 | 0.3 | GO:0051592 | response to calcium ion(GO:0051592) |
| 0.0 | 0.1 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.0 | 0.1 | GO:0051132 | NK T cell proliferation(GO:0001866) NK T cell activation(GO:0051132) |
| 0.0 | 0.3 | GO:0030903 | notochord development(GO:0030903) |
| 0.0 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 0.1 | GO:1904784 | NLRP1 inflammasome complex assembly(GO:1904784) |
| 0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.4 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.0 | 0.1 | GO:1901475 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.2 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 | 0.1 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.0 | 0.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.0 | 0.1 | GO:0031438 | mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) regulation of endoribonuclease activity(GO:0060699) regulation of ribonuclease activity(GO:0060700) negative regulation of ribonuclease activity(GO:0060701) negative regulation of endoribonuclease activity(GO:0060702) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
| 0.0 | 0.1 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
| 0.0 | 0.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.0 | 0.1 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.0 | 0.4 | GO:0052695 | cellular glucuronidation(GO:0052695) |
| 0.0 | 0.2 | GO:0030728 | ovulation(GO:0030728) |
| 0.0 | 0.1 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.0 | 0.1 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.0 | 0.1 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.0 | 0.1 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.0 | 0.2 | GO:0042501 | serine phosphorylation of STAT protein(GO:0042501) |
| 0.0 | 0.3 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.1 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.0 | 0.1 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
| 0.0 | 0.1 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.0 | 0.2 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.0 | 0.2 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.0 | 0.2 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 0.2 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.0 | 0.0 | GO:0042109 | lymphotoxin A production(GO:0032641) interleukin-4 biosynthetic process(GO:0042097) lymphotoxin A biosynthetic process(GO:0042109) regulation of interleukin-4 biosynthetic process(GO:0045402) positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.0 | 0.1 | GO:0036257 | multivesicular body organization(GO:0036257) |
| 0.0 | 0.5 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.2 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 | 0.1 | GO:1903959 | regulation of anion transmembrane transport(GO:1903959) |
| 0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.0 | 0.1 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.2 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) |
| 0.0 | 0.0 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.0 | 0.1 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
| 0.0 | 0.2 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 0.1 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.1 | GO:1900623 | monocyte aggregation(GO:0070487) regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.0 | 0.1 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.1 | GO:0099566 | regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 0.0 | 0.1 | GO:0034128 | negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.0 | 0.3 | GO:0060544 | regulation of necroptotic process(GO:0060544) |
| 0.0 | 0.1 | GO:0061046 | regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.0 | 0.1 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.0 | 0.1 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.0 | 0.0 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.6 | GO:1902855 | nonmotile primary cilium assembly(GO:0035058) regulation of nonmotile primary cilium assembly(GO:1902855) |
| 0.0 | 0.4 | GO:0043507 | positive regulation of JUN kinase activity(GO:0043507) |
| 0.0 | 0.8 | GO:0003341 | cilium movement(GO:0003341) |
| 0.0 | 0.1 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.0 | 0.3 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.0 | 0.4 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.0 | 0.1 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 1.9 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.0 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) fasciculation of motor neuron axon(GO:0097156) |
| 0.0 | 0.1 | GO:0072538 | T-helper 17 type immune response(GO:0072538) |
| 0.0 | 1.0 | GO:0046847 | filopodium assembly(GO:0046847) |
| 0.0 | 0.1 | GO:0072178 | nephric duct morphogenesis(GO:0072178) |
| 0.0 | 0.4 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.0 | 0.2 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.0 | 0.1 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
| 0.0 | 0.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.3 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.0 | 0.3 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.2 | GO:1902913 | positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.0 | 0.1 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.0 | 0.1 | GO:0045047 | protein targeting to ER(GO:0045047) establishment of protein localization to endoplasmic reticulum(GO:0072599) |
| 0.0 | 0.1 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.0 | 0.2 | GO:0045837 | negative regulation of membrane potential(GO:0045837) |
| 0.0 | 0.1 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.0 | 0.9 | GO:0070527 | platelet aggregation(GO:0070527) |
| 0.0 | 0.3 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.0 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
| 0.0 | 0.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.1 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.0 | 0.1 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.0 | 0.1 | GO:1901533 | negative regulation of hematopoietic progenitor cell differentiation(GO:1901533) |
| 0.0 | 0.1 | GO:0001889 | liver development(GO:0001889) hepaticobiliary system development(GO:0061008) |
| 0.0 | 0.2 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 | 0.1 | GO:0035148 | tube formation(GO:0035148) |
| 0.0 | 0.4 | GO:0030819 | positive regulation of cAMP biosynthetic process(GO:0030819) |
| 0.0 | 0.2 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 0.2 | GO:0097369 | sodium ion import(GO:0097369) |
| 0.0 | 0.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.0 | 0.1 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.1 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.0 | 0.1 | GO:0045840 | positive regulation of mitotic nuclear division(GO:0045840) |
| 0.0 | 0.3 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
| 0.0 | 0.3 | GO:0048169 | regulation of long-term neuronal synaptic plasticity(GO:0048169) |
| 0.0 | 0.3 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.1 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.0 | 0.0 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.2 | GO:0008277 | regulation of G-protein coupled receptor protein signaling pathway(GO:0008277) |
| 0.0 | 0.2 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.0 | 0.0 | GO:0043316 | cytotoxic T cell degranulation(GO:0043316) |
| 0.0 | 0.5 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.0 | 0.7 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 0.0 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
| 0.0 | 0.1 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.0 | 0.1 | GO:0071395 | response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
| 0.0 | 0.1 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.0 | 0.1 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.0 | 0.3 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.0 | 0.1 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.0 | 0.4 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.1 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
| 0.0 | 0.0 | GO:0045720 | negative regulation of integrin biosynthetic process(GO:0045720) |
| 0.0 | 0.0 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.0 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.0 | 0.1 | GO:0015827 | tryptophan transport(GO:0015827) |
| 0.0 | 0.3 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.1 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.0 | 0.1 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.0 | 0.0 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.0 | 0.1 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 0.0 | 0.1 | GO:1901166 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
| 0.0 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.2 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.0 | 0.5 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 | 0.1 | GO:0039535 | RIG-I signaling pathway(GO:0039529) regulation of RIG-I signaling pathway(GO:0039535) |
| 0.0 | 0.0 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.2 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.0 | 0.0 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.1 | GO:0019883 | antigen processing and presentation of endogenous antigen(GO:0019883) |
| 0.0 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.2 | GO:0006853 | carnitine shuttle(GO:0006853) |
| 0.0 | 0.0 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.0 | 0.3 | GO:0030325 | adrenal gland development(GO:0030325) |
| 0.0 | 0.2 | GO:0043303 | mast cell activation involved in immune response(GO:0002279) mast cell degranulation(GO:0043303) |
| 0.0 | 0.1 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.0 | 0.2 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
| 0.0 | 0.1 | GO:0003360 | brainstem development(GO:0003360) |
| 0.0 | 0.1 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.0 | 0.1 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
| 0.0 | 0.0 | GO:0010612 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
| 0.0 | 0.0 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.0 | 0.4 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.1 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.0 | 0.1 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.1 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.0 | 0.1 | GO:0051806 | entry into host cell(GO:0030260) entry into host(GO:0044409) entry into cell of other organism involved in symbiotic interaction(GO:0051806) entry into other organism involved in symbiotic interaction(GO:0051828) |
| 0.0 | 0.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 | 0.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 | 0.1 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.0 | 0.1 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.1 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.0 | 0.1 | GO:0035825 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.0 | 0.5 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.1 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) |
| 0.0 | 0.1 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.0 | 0.3 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.1 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.3 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
| 0.0 | 0.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.0 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.0 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.0 | 0.0 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 0.0 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.0 | 0.3 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
| 0.0 | 0.0 | GO:0050712 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.0 | 0.2 | GO:0045199 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.0 | 0.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.1 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.0 | 0.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.3 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) |
| 0.0 | 0.2 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.0 | 0.0 | GO:0090501 | RNA phosphodiester bond hydrolysis(GO:0090501) |
| 0.0 | 0.2 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.2 | GO:0030501 | positive regulation of bone mineralization(GO:0030501) |
| 0.0 | 0.1 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.0 | 0.2 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.0 | GO:0010939 | regulation of necrotic cell death(GO:0010939) |
| 0.0 | 0.1 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 0.0 | 0.4 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.1 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
| 0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
| 0.0 | 0.1 | GO:0060346 | bone trabecula formation(GO:0060346) |
| 0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 1.0 | GO:0031532 | actin cytoskeleton reorganization(GO:0031532) |
| 0.0 | 0.1 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.0 | 0.2 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) |
| 0.0 | 0.0 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 0.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.0 | 0.0 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.0 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
| 0.0 | 0.0 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.2 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.0 | 0.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.0 | GO:0046963 | 3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
| 0.0 | 0.1 | GO:1903543 | positive regulation of exosomal secretion(GO:1903543) |
| 0.0 | 0.2 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.0 | 0.4 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.1 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.0 | 0.2 | GO:0002228 | natural killer cell mediated immunity(GO:0002228) |
| 0.0 | 0.1 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 | 0.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.0 | 0.2 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.6 | GO:0032002 | interleukin-28 receptor complex(GO:0032002) |
| 0.4 | 1.3 | GO:0044216 | host(GO:0018995) host cell(GO:0043657) other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
| 0.3 | 0.8 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 0.3 | 0.5 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.2 | 1.8 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.2 | 0.6 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.2 | 1.3 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.2 | 0.6 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.2 | 1.1 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.2 | 1.9 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.2 | 1.8 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.2 | 0.2 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.1 | 1.0 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 0.4 | GO:0033011 | perinuclear theca(GO:0033011) |
| 0.1 | 0.8 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.1 | 0.4 | GO:0097489 | multivesicular body, internal vesicle lumen(GO:0097489) |
| 0.1 | 0.8 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.1 | 0.6 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.1 | 0.6 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 1.9 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.1 | 1.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 0.7 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 0.1 | GO:0060171 | stereocilium membrane(GO:0060171) |
| 0.1 | 0.4 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.1 | 1.1 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.1 | 0.1 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.1 | 1.4 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.1 | 0.2 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 1.4 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 0.7 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.1 | 1.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.1 | 0.7 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 0.9 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.1 | 0.6 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 1.0 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.6 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.1 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 2.4 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
| 0.1 | 0.3 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 1.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.7 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.1 | 4.9 | GO:0031430 | M band(GO:0031430) |
| 0.1 | 0.3 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.3 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.1 | 1.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.1 | 0.5 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.4 | GO:0030934 | anchoring collagen complex(GO:0030934) |
| 0.1 | 0.3 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.1 | 0.2 | GO:0070702 | inner mucus layer(GO:0070702) outer mucus layer(GO:0070703) |
| 0.1 | 1.9 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 0.4 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.1 | 0.4 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.1 | 0.6 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
| 0.1 | 0.4 | GO:0000801 | central element(GO:0000801) |
| 0.1 | 1.1 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.1 | 0.5 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 1.9 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.1 | 1.1 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 0.4 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.1 | 0.1 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.1 | 0.6 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 0.4 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 0.5 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.1 | 1.0 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 0.4 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.1 | 1.2 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 0.4 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 0.2 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 0.7 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 1.0 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.3 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 0.1 | GO:1990666 | PCSK9-LDLR complex(GO:1990666) |
| 0.1 | 0.5 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.1 | 0.9 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 0.7 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 1.1 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.1 | 0.2 | GO:0001534 | radial spoke(GO:0001534) |
| 0.1 | 0.5 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.4 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.1 | 0.5 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 0.3 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 1.6 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 0.3 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.1 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.4 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.0 | 0.9 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.2 | GO:0036502 | Derlin-1-VIMP complex(GO:0036502) |
| 0.0 | 1.0 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.4 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 3.9 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.0 | 0.2 | GO:0032144 | 4-aminobutyrate transaminase complex(GO:0032144) |
| 0.0 | 0.1 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.0 | 0.5 | GO:0043235 | receptor complex(GO:0043235) |
| 0.0 | 0.7 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.2 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.0 | 0.4 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 0.3 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.3 | GO:0097361 | CIA complex(GO:0097361) |
| 0.0 | 2.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.5 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.3 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.1 | GO:0009346 | citrate lyase complex(GO:0009346) |
| 0.0 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.4 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.2 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.2 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.0 | 0.2 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.0 | 1.4 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.3 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.6 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.2 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 1.3 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 0.8 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.8 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.5 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.5 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.0 | 0.2 | GO:1990876 | cytoplasmic side of nuclear pore(GO:1990876) |
| 0.0 | 0.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.8 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.0 | 0.2 | GO:0017102 | methionyl glutamyl tRNA synthetase complex(GO:0017102) |
| 0.0 | 4.1 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.3 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 0.3 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.2 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.0 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.0 | 4.3 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 1.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.9 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.4 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.0 | 0.2 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 1.0 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.6 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.0 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.1 | GO:0034272 | phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) |
| 0.0 | 2.2 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.2 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.2 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.0 | 0.7 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 0.2 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
| 0.0 | 0.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.8 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.4 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.2 | GO:0000243 | commitment complex(GO:0000243) |
| 0.0 | 0.2 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.0 | 0.3 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.2 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 1.4 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.1 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 0.3 | GO:0000836 | Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 2.2 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.5 | GO:0034358 | plasma lipoprotein particle(GO:0034358) lipoprotein particle(GO:1990777) |
| 0.0 | 0.1 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.0 | 0.1 | GO:0044754 | autolysosome(GO:0044754) |
| 0.0 | 0.1 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.0 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.0 | 0.3 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.5 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.1 | GO:0043257 | laminin-8 complex(GO:0043257) |
| 0.0 | 0.1 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 0.3 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.1 | GO:0031256 | leading edge membrane(GO:0031256) |
| 0.0 | 0.2 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 0.8 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 0.3 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 0.1 | GO:0043260 | laminin-3 complex(GO:0005608) laminin-11 complex(GO:0043260) |
| 0.0 | 0.5 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.1 | GO:0034678 | integrin alpha8-beta1 complex(GO:0034678) |
| 0.0 | 0.5 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.8 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.1 | GO:0045261 | proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.2 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.0 | 0.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.8 | GO:0005911 | cell-cell junction(GO:0005911) |
| 0.0 | 0.2 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.2 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 0.3 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 0.1 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.0 | 0.4 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.1 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.4 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 3.3 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.6 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.0 | 0.3 | GO:0033643 | host cell part(GO:0033643) |
| 0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.0 | 0.1 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.0 | 0.1 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.0 | 0.5 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.3 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.2 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.0 | 0.1 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor heterodimeric complex(GO:0038039) G-protein coupled receptor complex(GO:0097648) |
| 0.0 | 0.1 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.7 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.1 | GO:0070877 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.0 | 0.2 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.3 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.1 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.0 | 0.2 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.3 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.0 | 0.8 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.4 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.3 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.0 | 2.9 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.0 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.0 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.0 | 0.3 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.0 | 0.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.1 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.0 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.0 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.0 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.2 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.2 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
| 0.0 | 0.3 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.3 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.3 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 0.1 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 2.9 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 1.0 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.0 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 0.0 | 0.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.0 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.0 | 0.3 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.4 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 8.0 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.4 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.0 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.0 | 0.1 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.0 | 0.1 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.0 | 0.2 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 0.1 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.1 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.0 | 0.5 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.3 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.2 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.4 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.2 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.1 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.0 | 0.5 | GO:0097546 | ciliary base(GO:0097546) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 7.9 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.4 | 2.2 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.4 | 3.7 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.4 | 2.0 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.3 | 2.4 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.3 | 1.3 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.3 | 1.5 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.3 | 1.4 | GO:0047787 | delta4-3-oxosteroid 5beta-reductase activity(GO:0047787) |
| 0.3 | 1.9 | GO:0030377 | urokinase plasminogen activator receptor activity(GO:0030377) |
| 0.3 | 1.8 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.3 | 0.8 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
| 0.3 | 0.5 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.2 | 0.7 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.2 | 0.9 | GO:0008112 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
| 0.2 | 0.7 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.2 | 2.0 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.2 | 1.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.2 | 0.6 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.2 | 1.8 | GO:0046978 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) |
| 0.2 | 2.0 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.2 | 0.6 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
| 0.2 | 1.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.2 | 1.1 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.2 | 0.5 | GO:0005497 | androgen binding(GO:0005497) |
| 0.2 | 0.5 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.2 | 0.5 | GO:0004397 | histidine ammonia-lyase activity(GO:0004397) |
| 0.2 | 0.8 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.2 | 0.5 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.1 | 2.6 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.1 | 0.4 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.1 | 0.7 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.1 | 0.1 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.1 | 2.6 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.4 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
| 0.1 | 1.4 | GO:0004465 | lipoprotein lipase activity(GO:0004465) |
| 0.1 | 0.4 | GO:0052895 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
| 0.1 | 0.6 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.1 | 0.7 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.1 | 0.4 | GO:0004794 | L-threonine ammonia-lyase activity(GO:0004794) |
| 0.1 | 0.5 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.1 | 0.7 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.1 | 0.4 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.1 | 0.6 | GO:0017060 | 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase activity(GO:0017060) |
| 0.1 | 0.4 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.8 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.1 | 0.6 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.1 | 1.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.1 | 0.4 | GO:0005549 | odorant binding(GO:0005549) |
| 0.1 | 0.8 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 0.1 | 0.4 | GO:1902271 | D3 vitamins binding(GO:1902271) |
| 0.1 | 0.4 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.1 | 0.4 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
| 0.1 | 0.4 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.1 | 0.6 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.1 | 0.6 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.6 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.4 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.1 | 1.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.1 | 0.2 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.1 | 0.4 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.5 | GO:0031782 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.1 | 0.3 | GO:0086040 | sodium:proton antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086040) |
| 0.1 | 0.3 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
| 0.1 | 0.8 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.1 | 0.3 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.1 | 0.3 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.8 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.1 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
| 0.1 | 0.3 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 0.3 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.1 | 0.6 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 0.5 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.1 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.1 | 0.8 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.1 | 0.6 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 0.3 | GO:0005333 | acetylcholine transmembrane transporter activity(GO:0005277) norepinephrine transmembrane transporter activity(GO:0005333) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.1 | 0.5 | GO:0060961 | phospholipase D inhibitor activity(GO:0060961) |
| 0.1 | 0.3 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.1 | 0.1 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 0.6 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 0.7 | GO:0002114 | interleukin-33 receptor activity(GO:0002114) |
| 0.1 | 0.4 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.1 | 0.3 | GO:0030617 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) |
| 0.1 | 0.4 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.3 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.1 | 0.3 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.1 | 1.1 | GO:0036122 | BMP binding(GO:0036122) |
| 0.1 | 0.9 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.5 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.1 | 0.4 | GO:0004310 | farnesyl-diphosphate farnesyltransferase activity(GO:0004310) squalene synthase activity(GO:0051996) |
| 0.1 | 1.2 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.2 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.1 | 0.3 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 0.1 | 0.3 | GO:0032393 | MHC class I receptor activity(GO:0032393) |
| 0.1 | 0.4 | GO:0051120 | hepoxilin A3 synthase activity(GO:0051120) |
| 0.1 | 0.3 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.1 | 0.4 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.1 | 0.1 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.1 | 0.6 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
| 0.1 | 2.0 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.1 | 0.9 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.1 | 0.3 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
| 0.1 | 3.4 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.1 | 2.5 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.7 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 0.9 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.1 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.2 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.1 | 0.7 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.1 | 0.7 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 0.3 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.1 | 1.2 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.1 | 2.4 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.3 | GO:0052590 | sn-glycerol-3-phosphate:ubiquinone oxidoreductase activity(GO:0052590) sn-glycerol-3-phosphate:ubiquinone-8 oxidoreductase activity(GO:0052591) |
| 0.1 | 0.5 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.1 | 0.3 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 0.5 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.1 | 0.6 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.4 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.1 | 0.4 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.1 | 0.5 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.1 | 1.3 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 2.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 0.7 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 0.4 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 0.2 | GO:0031177 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) S-acetyltransferase activity(GO:0016418) phosphopantetheine binding(GO:0031177) |
| 0.1 | 2.4 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.1 | 0.2 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.1 | 0.6 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 0.6 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.1 | 0.9 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 0.6 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.1 | 0.9 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.1 | 0.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.1 | 0.7 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.1 | 0.3 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.1 | 0.3 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.1 | 0.1 | GO:0034736 | sterol O-acyltransferase activity(GO:0004772) cholesterol O-acyltransferase activity(GO:0034736) |
| 0.1 | 0.3 | GO:0016801 | adenosylhomocysteinase activity(GO:0004013) hydrolase activity, acting on ether bonds(GO:0016801) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.3 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.1 | 0.2 | GO:0016964 | alpha-2 macroglobulin receptor activity(GO:0016964) |
| 0.1 | 3.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.1 | 0.6 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 2.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.1 | 0.3 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.1 | 0.5 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.1 | 0.6 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.1 | 0.2 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.1 | 0.2 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.1 | 0.4 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.1 | 0.2 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.1 | 0.2 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.1 | 0.3 | GO:0042806 | fucose binding(GO:0042806) |
| 0.1 | 4.9 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.1 | 0.2 | GO:0004597 | peptide-aspartate beta-dioxygenase activity(GO:0004597) |
| 0.1 | 0.2 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.1 | 1.3 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.2 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.1 | 0.9 | GO:0016918 | retinal binding(GO:0016918) |
| 0.1 | 0.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.1 | 0.5 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.8 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 2.0 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.1 | 0.7 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 0.2 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.1 | 0.6 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.1 | 0.2 | GO:0015265 | pyrimidine nucleobase transmembrane transporter activity(GO:0005350) glycerol channel activity(GO:0015254) urea channel activity(GO:0015265) |
| 0.1 | 0.4 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.1 | 0.2 | GO:0004968 | gonadotropin-releasing hormone receptor activity(GO:0004968) |
| 0.1 | 0.2 | GO:0004421 | hydroxymethylglutaryl-CoA synthase activity(GO:0004421) |
| 0.1 | 0.3 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.1 | 0.3 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.1 | 1.6 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.1 | 2.3 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
| 0.1 | 0.1 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
| 0.1 | 0.3 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.1 | 0.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.1 | 0.2 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.1 | 0.8 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.1 | 0.2 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.1 | 0.3 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.1 | 0.2 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.1 | 0.7 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.1 | 0.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 0.4 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 2.6 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.1 | 1.1 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.7 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.0 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.0 | 1.9 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 1.7 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.2 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.4 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.0 | 0.2 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.2 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.0 | 0.1 | GO:0060589 | nucleoside-triphosphatase regulator activity(GO:0060589) |
| 0.0 | 0.1 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.0 | 0.9 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.2 | GO:0003867 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.0 | 0.7 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.3 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.0 | 0.6 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.3 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.0 | 0.4 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
| 0.0 | 0.2 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.0 | 0.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.3 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.3 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 0.1 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.0 | 0.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.0 | 0.1 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.0 | 1.4 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.5 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.0 | 0.3 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.0 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.0 | 0.7 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.3 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.0 | 0.3 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.0 | 0.7 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.5 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.2 | GO:0033754 | indoleamine 2,3-dioxygenase activity(GO:0033754) |
| 0.0 | 0.1 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
| 0.0 | 0.2 | GO:0008457 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.0 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.0 | 0.7 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.0 | 0.3 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.1 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
| 0.0 | 1.3 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.2 | GO:0099529 | postsynaptic neurotransmitter receptor activity(GO:0098960) neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.0 | 1.1 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.2 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.0 | 0.3 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.0 | 0.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.2 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.0 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.5 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.2 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
| 0.0 | 1.6 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
| 0.0 | 0.3 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.0 | 0.1 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
| 0.0 | 0.3 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.0 | 0.2 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.0 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.4 | GO:0015193 | L-alanine transmembrane transporter activity(GO:0015180) L-proline transmembrane transporter activity(GO:0015193) alanine transmembrane transporter activity(GO:0022858) |
| 0.0 | 0.5 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.1 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.0 | 1.0 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 0.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 6.6 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.0 | 0.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.0 | 0.1 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 0.9 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.1 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.0 | 0.2 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.0 | 0.2 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.0 | 1.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.2 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.0 | 0.5 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.0 | 0.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.1 | GO:0031877 | somatostatin receptor binding(GO:0031877) |
| 0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.4 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 1.0 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.3 | GO:0042835 | BRE binding(GO:0042835) |
| 0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.8 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 0.2 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.0 | 0.0 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.2 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 8.4 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.5 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.0 | 0.2 | GO:0032564 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 0.0 | 0.1 | GO:0047676 | arachidonate-CoA ligase activity(GO:0047676) |
| 0.0 | 0.1 | GO:0001003 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
| 0.0 | 0.7 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.5 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.4 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.3 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 1.1 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.0 | 0.9 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.6 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 0.3 | GO:0031702 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.1 | GO:0004423 | iduronate-2-sulfatase activity(GO:0004423) |
| 0.0 | 0.1 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.0 | 0.1 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.2 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.0 | 0.7 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.2 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.0 | 0.2 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.6 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.0 | GO:0035379 | carbon dioxide transmembrane transporter activity(GO:0035379) |
| 0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.4 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.1 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
| 0.0 | 0.4 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 1.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.2 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.2 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.8 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.1 | GO:0010348 | lithium:proton antiporter activity(GO:0010348) |
| 0.0 | 0.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.0 | 1.7 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 1.5 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.1 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.1 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.0 | 0.1 | GO:0004608 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.0 | 0.3 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
| 0.0 | 0.5 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.4 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.0 | 0.2 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.0 | 0.2 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.2 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 1.6 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 3.6 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.1 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.0 | 0.2 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.7 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.6 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 0.8 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 1.4 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.2 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.1 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.0 | 0.4 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.5 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.7 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.5 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.2 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.7 | GO:0043394 | proteoglycan binding(GO:0043394) |
| 0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.0 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.0 | 0.3 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.1 | GO:1904854 | proteasome core complex binding(GO:1904854) |
| 0.0 | 0.1 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.0 | 0.2 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.1 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 0.0 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.6 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.1 | GO:0043855 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
| 0.0 | 0.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 0.2 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.2 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.0 | 0.2 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.0 | 0.1 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.1 | GO:0016608 | growth hormone-releasing hormone activity(GO:0016608) ghrelin receptor binding(GO:0031768) |
| 0.0 | 0.2 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.4 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.6 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.1 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.0 | 0.5 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.0 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.0 | 0.1 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.0 | 0.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.3 | GO:0044877 | macromolecular complex binding(GO:0044877) |
| 0.0 | 0.4 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.1 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
| 0.0 | 0.7 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.5 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 0.2 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.1 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
| 0.0 | 0.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.1 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.0 | 0.1 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.9 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.9 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.1 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.0 | 0.1 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 0.1 | GO:0003980 | UDP-glucose:glycoprotein glucosyltransferase activity(GO:0003980) |
| 0.0 | 0.1 | GO:0051213 | dioxygenase activity(GO:0051213) |
| 0.0 | 0.2 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.1 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.0 | 0.1 | GO:0008124 | phenylalanine 4-monooxygenase activity(GO:0004505) 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.0 | 0.1 | GO:0019864 | IgG binding(GO:0019864) |
| 0.0 | 0.1 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 0.0 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 0.1 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.3 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.0 | 0.2 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 0.2 | GO:0048185 | activin binding(GO:0048185) |
| 0.0 | 0.1 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.0 | 0.9 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 0.1 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.0 | 0.2 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.1 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.0 | 0.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.1 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.0 | 0.1 | GO:0051500 | D-aminoacyl-tRNA deacylase activity(GO:0051499) D-tyrosyl-tRNA(Tyr) deacylase activity(GO:0051500) |
| 0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.6 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.0 | 0.1 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
| 0.0 | 0.5 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.0 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.6 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.4 | GO:0016917 | GABA receptor activity(GO:0016917) |
| 0.0 | 0.1 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.0 | 0.1 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.0 | 0.6 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.4 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.4 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.1 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.5 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.2 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.0 | 0.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.1 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.4 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.1 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.2 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.0 | GO:0047536 | 2-aminoadipate transaminase activity(GO:0047536) |
| 0.0 | 0.3 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 0.0 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.0 | GO:0036487 | nitric-oxide synthase inhibitor activity(GO:0036487) |
| 0.0 | 0.0 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.0 | 2.8 | GO:0044325 | ion channel binding(GO:0044325) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.1 | GO:0052740 | 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
| 0.0 | 0.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.0 | 0.0 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.0 | 0.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.9 | GO:0005254 | chloride channel activity(GO:0005254) |
| 0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.0 | 0.4 | GO:0004532 | exoribonuclease activity(GO:0004532) |
| 0.0 | 0.1 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.0 | 0.0 | GO:0050146 | nucleoside phosphotransferase activity(GO:0050146) |
| 0.0 | 0.1 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.0 | 0.0 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.0 | 0.1 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.3 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.5 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.1 | GO:0023024 | MHC class I protein complex binding(GO:0023024) |
| 0.0 | 0.0 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
| 0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.1 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.0 | 0.6 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.2 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.0 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
| 0.0 | 0.1 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.3 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.0 | 0.2 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 0.0 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.0 | 0.1 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.0 | 0.2 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.0 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.2 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.2 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.1 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.0 | 0.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.8 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.0 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.0 | 0.1 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.0 | 0.0 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.2 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.0 | 0.0 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.0 | 0.0 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.0 | GO:0032406 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.0 | 0.2 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.1 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 1.0 | GO:0051219 | phosphoprotein binding(GO:0051219) |
| 0.0 | 0.2 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.0 | 0.4 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.0 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
| 0.0 | 0.1 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.1 | GO:0030228 | low-density lipoprotein receptor activity(GO:0005041) lipoprotein particle receptor activity(GO:0030228) |
| 0.0 | 0.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.0 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.0 | 0.0 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.0 | 0.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.0 | 0.0 | GO:0032138 | single base insertion or deletion binding(GO:0032138) |
| 0.0 | 0.3 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.4 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.7 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.0 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.0 | 0.1 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 4.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 0.5 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 0.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.1 | 6.9 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 2.1 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.1 | 3.4 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 0.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 0.5 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 1.5 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.6 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 2.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 16.1 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.7 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 2.7 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 1.6 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 1.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 1.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 2.7 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.3 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.4 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 1.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.9 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.5 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 3.2 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.5 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 1.2 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 0.8 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.5 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 1.7 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.9 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 1.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.5 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.4 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.7 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.5 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 0.4 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.3 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.6 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 2.0 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.5 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 0.4 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.3 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.5 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.4 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.4 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.9 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.6 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.6 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.5 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 1.2 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.2 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.0 | 0.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 0.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.3 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.3 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 22.9 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.1 | 0.5 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.1 | 0.5 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.1 | 1.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.1 | 3.7 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.1 | 1.9 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.1 | 1.0 | REACTOME DEFENSINS | Genes involved in Defensins |
| 0.1 | 1.8 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.1 | 1.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 3.9 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.1 | 4.1 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 2.5 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 1.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 0.1 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 0.5 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.1 | 0.1 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.1 | 2.0 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 1.9 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.1 | 0.4 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 1.7 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 0.9 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.1 | 0.2 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 9.4 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 3.7 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.1 | 0.7 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 0.1 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.1 | 0.2 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.1 | 0.3 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.0 | 0.2 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.0 | 3.8 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 0.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.0 | 0.9 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.6 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.3 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 1.4 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 1.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.8 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.0 | 0.5 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.3 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 1.3 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 1.4 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 1.4 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.0 | 0.4 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 1.5 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 1.1 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 1.4 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.5 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.0 | 0.5 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.6 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.3 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.8 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 1.1 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.2 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.2 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 2.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.9 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.0 | 1.0 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.0 | 0.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.2 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
| 0.0 | 2.0 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.0 | 2.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.5 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 1.5 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 1.8 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.7 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 1.0 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.3 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 0.4 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
| 0.0 | 0.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.4 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.0 | 0.5 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.4 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.6 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
| 0.0 | 0.7 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 0.9 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 0.5 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.0 | 0.4 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.8 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.7 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.6 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 1.1 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.4 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.8 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.0 | 0.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.5 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.0 | 0.9 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.5 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.3 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.0 | 0.2 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.0 | 0.2 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
| 0.0 | 0.7 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.0 | 0.6 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.1 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.0 | 0.5 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 1.3 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.0 | 0.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.0 | 0.4 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.8 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.0 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.0 | 0.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.5 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.3 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.4 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
| 0.0 | 0.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.1 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.0 | 1.2 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 0.1 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |