avrg: A549 cells infected with IAV Analysis Results (GEO series: GSE147507)
Gene Symbol | Gene ID | Gene Info |
---|---|---|
ID4
|
ENSG00000172201.6 | ID4 |
TCF4
|
ENSG00000196628.9 | TCF4 |
SNAI2
|
ENSG00000019549.4 | SNAI2 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
TCF4 | hg19_v2_chr18_-_52969844_52969895 | 0.99 | 7.7e-03 | Click! |
ID4 | hg19_v2_chr6_+_19837592_19837621 | 0.86 | 1.4e-01 | Click! |
SNAI2 | hg19_v2_chr8_-_49834299_49834446 | -0.21 | 7.9e-01 | Click! |
Promoter | Score | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr16_+_771663 | 1.15 |
ENST00000568916.1 |
FAM173A |
family with sequence similarity 173, member A |
chrX_-_153279697 | 0.93 |
ENST00000444254.1 |
IRAK1 |
interleukin-1 receptor-associated kinase 1 |
chr19_+_6464243 | 0.93 |
ENST00000600229.1 ENST00000356762.3 |
CRB3 |
crumbs homolog 3 (Drosophila) |
chr19_-_47735918 | 0.84 |
ENST00000449228.1 ENST00000300880.7 ENST00000341983.4 |
BBC3 |
BCL2 binding component 3 |
chr8_+_21906433 | 0.77 |
ENST00000522148.1 |
DMTN |
dematin actin binding protein |
chr9_-_139940608 | 0.74 |
ENST00000371601.4 |
NPDC1 |
neural proliferation, differentiation and control, 1 |
chr11_+_64879317 | 0.71 |
ENST00000526809.1 ENST00000279263.7 ENST00000524986.1 ENST00000534371.1 ENST00000540748.1 ENST00000525385.1 ENST00000345348.5 ENST00000531321.1 ENST00000529414.1 ENST00000526085.1 ENST00000530750.1 |
TM7SF2 |
transmembrane 7 superfamily member 2 |
chr17_+_39411636 | 0.70 |
ENST00000394008.1 |
KRTAP9-9 |
keratin associated protein 9-9 |
chr9_-_131486367 | 0.69 |
ENST00000372663.4 ENST00000406904.2 ENST00000452105.1 ENST00000372672.2 ENST00000372667.5 |
ZDHHC12 |
zinc finger, DHHC-type containing 12 |
chr14_-_50999373 | 0.68 |
ENST00000554273.1 |
MAP4K5 |
mitogen-activated protein kinase kinase kinase kinase 5 |
chr7_-_73184588 | 0.67 |
ENST00000395145.2 |
CLDN3 |
claudin 3 |
chr10_-_103347883 | 0.61 |
ENST00000339310.3 ENST00000370158.3 ENST00000299206.4 ENST00000456836.2 ENST00000413344.1 ENST00000429502.1 ENST00000430045.1 ENST00000370172.1 ENST00000436284.2 ENST00000370162.3 |
POLL |
polymerase (DNA directed), lambda |
chr19_-_56048456 | 0.61 |
ENST00000413299.1 |
SBK2 |
SH3 domain binding kinase family, member 2 |
chr16_+_532503 | 0.60 |
ENST00000412256.1 |
RAB11FIP3 |
RAB11 family interacting protein 3 (class II) |
chr14_-_69263043 | 0.59 |
ENST00000408913.2 |
ZFP36L1 |
ZFP36 ring finger protein-like 1 |
chr16_+_691792 | 0.59 |
ENST00000307650.4 |
FAM195A |
family with sequence similarity 195, member A |
chr14_-_37051798 | 0.59 |
ENST00000258829.5 |
NKX2-8 |
NK2 homeobox 8 |
chr8_-_144815966 | 0.59 |
ENST00000388913.3 |
FAM83H |
family with sequence similarity 83, member H |
chr7_+_2687173 | 0.57 |
ENST00000403167.1 |
TTYH3 |
tweety family member 3 |
chr11_-_560703 | 0.56 |
ENST00000441853.1 ENST00000329451.3 |
C11orf35 |
chromosome 11 open reading frame 35 |
chr1_-_167906020 | 0.52 |
ENST00000458574.1 |
MPC2 |
mitochondrial pyruvate carrier 2 |
chr12_-_80084594 | 0.51 |
ENST00000548426.1 |
PAWR |
PRKC, apoptosis, WT1, regulator |
chr12_-_53473136 | 0.51 |
ENST00000547837.1 ENST00000301463.4 |
SPRYD3 |
SPRY domain containing 3 |
chr7_-_97881429 | 0.50 |
ENST00000420697.1 ENST00000379795.3 ENST00000415086.1 ENST00000542604.1 ENST00000447648.2 |
TECPR1 |
tectonin beta-propeller repeat containing 1 |
chr19_-_47734448 | 0.49 |
ENST00000439096.2 |
BBC3 |
BCL2 binding component 3 |
chr11_-_64885111 | 0.48 |
ENST00000528598.1 ENST00000310597.4 |
ZNHIT2 |
zinc finger, HIT-type containing 2 |
chr16_+_616995 | 0.48 |
ENST00000293874.2 ENST00000409527.2 ENST00000424439.2 ENST00000540585.1 |
PIGQ NHLRC4 |
phosphatidylinositol glycan anchor biosynthesis, class Q NHL repeat containing 4 |
chr22_-_37415475 | 0.47 |
ENST00000403892.3 ENST00000249042.3 ENST00000438203.1 |
TST |
thiosulfate sulfurtransferase (rhodanese) |
chr9_-_131940526 | 0.47 |
ENST00000372491.2 |
IER5L |
immediate early response 5-like |
chr20_+_44035200 | 0.47 |
ENST00000372717.1 ENST00000360981.4 |
DBNDD2 |
dysbindin (dystrobrevin binding protein 1) domain containing 2 |
chr1_+_16083098 | 0.47 |
ENST00000496928.2 ENST00000508310.1 |
FBLIM1 |
filamin binding LIM protein 1 |
chr22_-_36018569 | 0.47 |
ENST00000419229.1 ENST00000406324.1 |
MB |
myoglobin |
chr5_-_133747551 | 0.46 |
ENST00000395009.3 |
CDKN2AIPNL |
CDKN2A interacting protein N-terminal like |
chr19_+_35739631 | 0.45 |
ENST00000602003.1 ENST00000360798.3 ENST00000354900.3 |
LSR |
lipolysis stimulated lipoprotein receptor |
chr19_-_37178284 | 0.45 |
ENST00000425254.2 ENST00000590952.1 ENST00000433232.1 |
AC074138.3 |
AC074138.3 |
chr12_-_80084333 | 0.44 |
ENST00000552637.1 |
PAWR |
PRKC, apoptosis, WT1, regulator |
chr19_+_3708338 | 0.44 |
ENST00000590545.1 |
TJP3 |
tight junction protein 3 |
chr19_+_35739280 | 0.44 |
ENST00000602122.1 |
LSR |
lipolysis stimulated lipoprotein receptor |
chr6_-_31697255 | 0.43 |
ENST00000436437.1 |
DDAH2 |
dimethylarginine dimethylaminohydrolase 2 |
chr9_+_140172200 | 0.43 |
ENST00000357503.2 |
TOR4A |
torsin family 4, member A |
chr20_-_60942361 | 0.43 |
ENST00000252999.3 |
LAMA5 |
laminin, alpha 5 |
chr15_-_32162833 | 0.42 |
ENST00000560598.1 |
OTUD7A |
OTU domain containing 7A |
chr7_+_150065278 | 0.42 |
ENST00000519397.1 ENST00000479668.1 ENST00000540729.1 |
REPIN1 |
replication initiator 1 |
chr9_+_140317802 | 0.42 |
ENST00000341349.2 ENST00000392815.2 |
NOXA1 |
NADPH oxidase activator 1 |
chr3_+_32280159 | 0.41 |
ENST00000458535.2 ENST00000307526.3 |
CMTM8 |
CKLF-like MARVEL transmembrane domain containing 8 |
chr19_-_56047661 | 0.41 |
ENST00000344158.3 |
SBK2 |
SH3 domain binding kinase family, member 2 |
chr4_+_76649753 | 0.41 |
ENST00000603759.1 |
USO1 |
USO1 vesicle transport factor |
chr19_-_42721819 | 0.41 |
ENST00000336034.4 ENST00000598200.1 ENST00000598727.1 ENST00000596251.1 |
DEDD2 |
death effector domain containing 2 |
chr17_-_40346477 | 0.41 |
ENST00000593209.1 ENST00000587427.1 ENST00000588352.1 ENST00000414034.3 ENST00000590249.1 |
GHDC |
GH3 domain containing |
chr19_+_18530184 | 0.41 |
ENST00000601357.2 |
SSBP4 |
single stranded DNA binding protein 4 |
chr19_-_40324767 | 0.41 |
ENST00000601972.1 ENST00000430012.2 ENST00000323039.5 ENST00000348817.3 |
DYRK1B |
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1B |
chr16_+_2820912 | 0.41 |
ENST00000570539.1 |
SRRM2 |
serine/arginine repetitive matrix 2 |
chr22_+_35776354 | 0.41 |
ENST00000412893.1 |
HMOX1 |
heme oxygenase (decycling) 1 |
chr17_+_18163848 | 0.40 |
ENST00000323019.4 ENST00000578174.1 ENST00000395704.4 ENST00000395703.4 ENST00000578621.1 ENST00000579341.1 |
MIEF2 |
mitochondrial elongation factor 2 |
chr19_+_56111680 | 0.40 |
ENST00000301073.3 |
ZNF524 |
zinc finger protein 524 |
chr17_+_73521763 | 0.40 |
ENST00000167462.5 ENST00000375227.4 ENST00000392550.3 ENST00000578363.1 ENST00000579392.1 |
LLGL2 |
lethal giant larvae homolog 2 (Drosophila) |
chr19_-_55791058 | 0.39 |
ENST00000587959.1 ENST00000585927.1 ENST00000587922.1 ENST00000585698.1 |
HSPBP1 |
HSPA (heat shock 70kDa) binding protein, cytoplasmic cochaperone 1 |
chr14_-_69262789 | 0.39 |
ENST00000557022.1 |
ZFP36L1 |
ZFP36 ring finger protein-like 1 |
chr19_-_46272106 | 0.39 |
ENST00000560168.1 |
SIX5 |
SIX homeobox 5 |
chr19_+_51152702 | 0.39 |
ENST00000425202.1 |
C19orf81 |
chromosome 19 open reading frame 81 |
chr14_-_69262947 | 0.39 |
ENST00000557086.1 |
ZFP36L1 |
ZFP36 ring finger protein-like 1 |
chr17_-_79519403 | 0.39 |
ENST00000327787.8 ENST00000537152.1 |
C17orf70 |
chromosome 17 open reading frame 70 |
chr7_-_44122063 | 0.38 |
ENST00000335195.6 ENST00000395831.3 ENST00000414235.1 ENST00000452049.1 ENST00000242248.5 |
POLM |
polymerase (DNA directed), mu |
chr16_+_30953696 | 0.38 |
ENST00000566320.2 ENST00000565939.1 |
FBXL19 |
F-box and leucine-rich repeat protein 19 |
chr14_-_51135005 | 0.38 |
ENST00000556735.1 |
SAV1 |
salvador homolog 1 (Drosophila) |
chrX_-_153775426 | 0.38 |
ENST00000393562.2 |
G6PD |
glucose-6-phosphate dehydrogenase |
chr17_-_39942322 | 0.38 |
ENST00000449889.1 ENST00000465293.1 |
JUP |
junction plakoglobin |
chr1_-_3566627 | 0.38 |
ENST00000419924.2 ENST00000270708.7 |
WRAP73 |
WD repeat containing, antisense to TP73 |
chr11_+_67776012 | 0.38 |
ENST00000539229.1 |
ALDH3B1 |
aldehyde dehydrogenase 3 family, member B1 |
chr1_-_3566590 | 0.38 |
ENST00000424367.1 ENST00000378322.3 |
WRAP73 |
WD repeat containing, antisense to TP73 |
chr16_-_57880439 | 0.38 |
ENST00000565684.1 |
KIFC3 |
kinesin family member C3 |
chr11_-_1785139 | 0.38 |
ENST00000236671.2 |
CTSD |
cathepsin D |
chr8_-_144897549 | 0.37 |
ENST00000356994.2 ENST00000320476.3 |
SCRIB |
scribbled planar cell polarity protein |
chr19_+_55996565 | 0.37 |
ENST00000587400.1 |
NAT14 |
N-acetyltransferase 14 (GCN5-related, putative) |
chr2_+_71295766 | 0.36 |
ENST00000533981.1 |
NAGK |
N-acetylglucosamine kinase |
chr2_-_239148599 | 0.36 |
ENST00000409182.1 ENST00000409002.3 ENST00000450098.1 ENST00000409356.1 ENST00000409160.3 ENST00000409574.1 ENST00000272937.5 |
HES6 |
hes family bHLH transcription factor 6 |
chr19_+_6464502 | 0.36 |
ENST00000308243.7 |
CRB3 |
crumbs homolog 3 (Drosophila) |
chr4_+_129732419 | 0.36 |
ENST00000510308.1 |
PHF17 |
jade family PHD finger 1 |
chr19_-_10697895 | 0.36 |
ENST00000591240.1 ENST00000589684.1 ENST00000591676.1 ENST00000250244.6 ENST00000590923.1 |
AP1M2 |
adaptor-related protein complex 1, mu 2 subunit |
chr10_+_104180580 | 0.36 |
ENST00000425536.1 |
FBXL15 |
F-box and leucine-rich repeat protein 15 |
chr22_-_50970506 | 0.36 |
ENST00000428989.2 ENST00000403326.1 |
ODF3B |
outer dense fiber of sperm tails 3B |
chr12_+_54694979 | 0.36 |
ENST00000552848.1 |
COPZ1 |
coatomer protein complex, subunit zeta 1 |
chr2_-_27486951 | 0.36 |
ENST00000432351.1 |
SLC30A3 |
solute carrier family 30 (zinc transporter), member 3 |
chr19_-_7990991 | 0.36 |
ENST00000318978.4 |
CTXN1 |
cortexin 1 |
chr14_-_20929624 | 0.36 |
ENST00000398020.4 ENST00000250489.4 |
TMEM55B |
transmembrane protein 55B |
chr12_-_25150373 | 0.36 |
ENST00000549828.1 |
C12orf77 |
chromosome 12 open reading frame 77 |
chr11_-_117698765 | 0.35 |
ENST00000532119.1 |
FXYD2 |
FXYD domain containing ion transport regulator 2 |
chr19_-_50979981 | 0.35 |
ENST00000595790.1 ENST00000600100.1 |
FAM71E1 |
family with sequence similarity 71, member E1 |
chr7_+_100450328 | 0.35 |
ENST00000540482.1 ENST00000418037.1 ENST00000428758.1 ENST00000275729.3 ENST00000415287.1 ENST00000354161.3 ENST00000416675.1 |
SLC12A9 |
solute carrier family 12, member 9 |
chr11_-_17410869 | 0.35 |
ENST00000528731.1 |
KCNJ11 |
potassium inwardly-rectifying channel, subfamily J, member 11 |
chr19_+_50433476 | 0.34 |
ENST00000596658.1 |
ATF5 |
activating transcription factor 5 |
chr14_+_55590646 | 0.34 |
ENST00000553493.1 |
LGALS3 |
lectin, galactoside-binding, soluble, 3 |
chr19_+_2249308 | 0.34 |
ENST00000592877.1 ENST00000221496.4 |
AMH |
anti-Mullerian hormone |
chr16_+_28875268 | 0.34 |
ENST00000395532.4 |
SH2B1 |
SH2B adaptor protein 1 |
chr4_-_2420357 | 0.34 |
ENST00000511071.1 ENST00000509171.1 ENST00000290974.2 |
ZFYVE28 |
zinc finger, FYVE domain containing 28 |
chr7_+_29603394 | 0.34 |
ENST00000319694.2 |
PRR15 |
proline rich 15 |
chr7_-_994302 | 0.34 |
ENST00000265846.5 |
ADAP1 |
ArfGAP with dual PH domains 1 |
chr10_+_104404644 | 0.34 |
ENST00000462202.2 |
TRIM8 |
tripartite motif containing 8 |
chr16_-_776431 | 0.34 |
ENST00000293889.6 |
CCDC78 |
coiled-coil domain containing 78 |
chr11_+_64073699 | 0.34 |
ENST00000405666.1 ENST00000468670.1 |
ESRRA |
estrogen-related receptor alpha |
chr19_-_40324255 | 0.34 |
ENST00000593685.1 ENST00000600611.1 |
DYRK1B |
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1B |
chr12_-_118406777 | 0.33 |
ENST00000339824.5 |
KSR2 |
kinase suppressor of ras 2 |
chr9_+_137000484 | 0.33 |
ENST00000608937.1 ENST00000608739.1 |
WDR5 |
WD repeat domain 5 |
chr8_-_144897138 | 0.33 |
ENST00000377533.3 |
SCRIB |
scribbled planar cell polarity protein |
chr19_+_18451391 | 0.33 |
ENST00000269919.6 ENST00000604499.2 ENST00000595066.1 ENST00000252813.5 |
PGPEP1 |
pyroglutamyl-peptidase I |
chr17_-_46035187 | 0.33 |
ENST00000300557.2 |
PRR15L |
proline rich 15-like |
chr19_+_18283959 | 0.33 |
ENST00000597802.2 |
IFI30 |
interferon, gamma-inducible protein 30 |
chr3_+_111393501 | 0.33 |
ENST00000393934.3 |
PLCXD2 |
phosphatidylinositol-specific phospholipase C, X domain containing 2 |
chr2_-_74692473 | 0.32 |
ENST00000535045.1 ENST00000409065.1 ENST00000414701.1 ENST00000448666.1 ENST00000233616.4 ENST00000452063.2 |
MOGS |
mannosyl-oligosaccharide glucosidase |
chr19_-_56056888 | 0.32 |
ENST00000592464.1 ENST00000420723.3 |
SBK3 |
SH3 domain binding kinase family, member 3 |
chr10_+_94608218 | 0.32 |
ENST00000371543.1 |
EXOC6 |
exocyst complex component 6 |
chr2_+_71295733 | 0.32 |
ENST00000443938.2 ENST00000244204.6 |
NAGK |
N-acetylglucosamine kinase |
chr7_-_156803329 | 0.32 |
ENST00000252971.6 |
MNX1 |
motor neuron and pancreas homeobox 1 |
chr8_+_22429205 | 0.32 |
ENST00000520207.1 |
SORBS3 |
sorbin and SH3 domain containing 3 |
chr5_-_74162153 | 0.32 |
ENST00000514200.1 |
FAM169A |
family with sequence similarity 169, member A |
chr22_-_30783075 | 0.31 |
ENST00000215798.6 |
RNF215 |
ring finger protein 215 |
chr16_+_770975 | 0.31 |
ENST00000569529.1 ENST00000564000.1 ENST00000219535.3 |
FAM173A |
family with sequence similarity 173, member A |
chr19_-_51611623 | 0.31 |
ENST00000421832.2 |
CTU1 |
cytosolic thiouridylase subunit 1 |
chr14_-_69262916 | 0.31 |
ENST00000553375.1 |
ZFP36L1 |
ZFP36 ring finger protein-like 1 |
chr16_-_67190152 | 0.31 |
ENST00000486556.1 |
TRADD |
TNFRSF1A-associated via death domain |
chr8_-_144886321 | 0.31 |
ENST00000526832.1 |
SCRIB |
scribbled planar cell polarity protein |
chr19_-_36822595 | 0.31 |
ENST00000585356.1 ENST00000438368.2 ENST00000590622.1 |
LINC00665 |
long intergenic non-protein coding RNA 665 |
chr11_+_842808 | 0.31 |
ENST00000397397.2 ENST00000397411.2 ENST00000397396.1 |
TSPAN4 |
tetraspanin 4 |
chr15_+_76030311 | 0.30 |
ENST00000543887.1 |
AC019294.1 |
AC019294.1 |
chr16_+_14396121 | 0.30 |
ENST00000570945.1 |
RP11-65J21.3 |
RP11-65J21.3 |
chr16_-_28223229 | 0.30 |
ENST00000566073.1 |
XPO6 |
exportin 6 |
chr9_+_139249228 | 0.30 |
ENST00000392944.1 |
GPSM1 |
G-protein signaling modulator 1 |
chr17_+_75276643 | 0.30 |
ENST00000589070.1 |
SEPT9 |
septin 9 |
chr12_+_113860160 | 0.30 |
ENST00000553248.1 ENST00000345635.4 ENST00000547802.1 |
SDSL |
serine dehydratase-like |
chr20_-_36152914 | 0.29 |
ENST00000397131.1 |
BLCAP |
bladder cancer associated protein |
chr14_+_105331596 | 0.29 |
ENST00000556508.1 ENST00000414716.3 ENST00000453495.1 ENST00000418279.1 |
CEP170B |
centrosomal protein 170B |
chr19_+_38755042 | 0.29 |
ENST00000301244.7 |
SPINT2 |
serine peptidase inhibitor, Kunitz type, 2 |
chr7_+_99699179 | 0.29 |
ENST00000438383.1 ENST00000429084.1 ENST00000359593.4 ENST00000439416.1 |
AP4M1 |
adaptor-related protein complex 4, mu 1 subunit |
chr1_+_8378140 | 0.29 |
ENST00000377479.2 |
SLC45A1 |
solute carrier family 45, member 1 |
chr19_+_49838653 | 0.29 |
ENST00000598095.1 ENST00000426897.2 ENST00000323906.4 ENST00000535669.2 ENST00000597602.1 ENST00000595660.1 |
CD37 |
CD37 molecule |
chr2_-_175202151 | 0.29 |
ENST00000595354.1 |
AC018470.1 |
Uncharacterized protein FLJ46347 |
chr16_+_28875126 | 0.29 |
ENST00000359285.5 ENST00000538342.1 |
SH2B1 |
SH2B adaptor protein 1 |
chr22_+_41697520 | 0.28 |
ENST00000352645.4 |
ZC3H7B |
zinc finger CCCH-type containing 7B |
chr19_+_18794470 | 0.28 |
ENST00000321949.8 ENST00000338797.6 |
CRTC1 |
CREB regulated transcription coactivator 1 |
chr19_+_38755203 | 0.28 |
ENST00000587090.1 ENST00000454580.3 |
SPINT2 |
serine peptidase inhibitor, Kunitz type, 2 |
chr22_-_24322660 | 0.28 |
ENST00000404092.1 |
DDT |
D-dopachrome tautomerase |
chr8_+_144373550 | 0.28 |
ENST00000330143.3 ENST00000521537.1 ENST00000518432.1 ENST00000520333.1 |
ZNF696 |
zinc finger protein 696 |
chr3_-_52719912 | 0.28 |
ENST00000420148.1 |
PBRM1 |
polybromo 1 |
chr19_+_41103063 | 0.28 |
ENST00000308370.7 |
LTBP4 |
latent transforming growth factor beta binding protein 4 |
chr9_+_139247484 | 0.28 |
ENST00000429455.1 |
GPSM1 |
G-protein signaling modulator 1 |
chr19_+_8478154 | 0.28 |
ENST00000381035.4 ENST00000595142.1 ENST00000601724.1 ENST00000393944.1 ENST00000215555.2 ENST00000601283.1 ENST00000595213.1 |
MARCH2 |
membrane-associated ring finger (C3HC4) 2, E3 ubiquitin protein ligase |
chr1_-_159893507 | 0.28 |
ENST00000368096.1 |
TAGLN2 |
transgelin 2 |
chr11_+_61447845 | 0.28 |
ENST00000257215.5 |
DAGLA |
diacylglycerol lipase, alpha |
chr12_+_110011571 | 0.27 |
ENST00000539696.1 ENST00000228510.3 ENST00000392727.3 |
MVK |
mevalonate kinase |
chr15_+_91416092 | 0.27 |
ENST00000559353.1 |
FURIN |
furin (paired basic amino acid cleaving enzyme) |
chr17_-_16395328 | 0.27 |
ENST00000470794.1 |
FAM211A |
family with sequence similarity 211, member A |
chr13_+_111837279 | 0.27 |
ENST00000467053.1 |
ARHGEF7 |
Rho guanine nucleotide exchange factor (GEF) 7 |
chr22_+_37415700 | 0.27 |
ENST00000397129.1 |
MPST |
mercaptopyruvate sulfurtransferase |
chr3_+_49507674 | 0.27 |
ENST00000431960.1 ENST00000452317.1 ENST00000435508.2 ENST00000452060.1 ENST00000428779.1 ENST00000419218.1 ENST00000430636.1 |
DAG1 |
dystroglycan 1 (dystrophin-associated glycoprotein 1) |
chr5_-_172662303 | 0.27 |
ENST00000517440.1 ENST00000329198.4 |
NKX2-5 |
NK2 homeobox 5 |
chr19_+_35739597 | 0.27 |
ENST00000361790.3 |
LSR |
lipolysis stimulated lipoprotein receptor |
chr1_-_41328018 | 0.27 |
ENST00000372638.2 |
CITED4 |
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
chr4_-_2420335 | 0.27 |
ENST00000503000.1 |
ZFYVE28 |
zinc finger, FYVE domain containing 28 |
chr9_+_139847347 | 0.27 |
ENST00000371632.3 |
LCN12 |
lipocalin 12 |
chr8_-_144674284 | 0.27 |
ENST00000528519.1 |
EEF1D |
eukaryotic translation elongation factor 1 delta (guanine nucleotide exchange protein) |
chr17_+_80193644 | 0.27 |
ENST00000582946.1 |
SLC16A3 |
solute carrier family 16 (monocarboxylate transporter), member 3 |
chr19_-_3551043 | 0.27 |
ENST00000589995.1 |
MFSD12 |
major facilitator superfamily domain containing 12 |
chr19_+_40873617 | 0.26 |
ENST00000599353.1 |
PLD3 |
phospholipase D family, member 3 |
chr8_-_103876340 | 0.26 |
ENST00000518353.1 |
AZIN1 |
antizyme inhibitor 1 |
chr19_+_38779778 | 0.26 |
ENST00000590738.1 ENST00000587519.2 ENST00000591889.1 |
SPINT2 CTB-102L5.4 |
serine peptidase inhibitor, Kunitz type, 2 CTB-102L5.4 |
chr19_+_18747775 | 0.26 |
ENST00000300976.4 ENST00000595182.1 ENST00000599006.1 |
KLHL26 |
kelch-like family member 26 |
chr2_-_228028829 | 0.26 |
ENST00000396625.3 ENST00000329662.7 |
COL4A4 |
collagen, type IV, alpha 4 |
chr19_+_41094612 | 0.26 |
ENST00000595726.1 |
SHKBP1 |
SH3KBP1 binding protein 1 |
chr16_-_3073933 | 0.26 |
ENST00000574151.1 |
HCFC1R1 |
host cell factor C1 regulator 1 (XPO1 dependent) |
chr17_-_33415837 | 0.26 |
ENST00000414419.2 |
RFFL |
ring finger and FYVE-like domain containing E3 ubiquitin protein ligase |
chr16_+_3019309 | 0.26 |
ENST00000576565.1 |
PAQR4 |
progestin and adipoQ receptor family member IV |
chr19_-_49222956 | 0.26 |
ENST00000599703.1 ENST00000318083.6 ENST00000419611.1 ENST00000377367.3 |
MAMSTR |
MEF2 activating motif and SAP domain containing transcriptional regulator |
chr17_-_72968837 | 0.26 |
ENST00000581676.1 |
HID1 |
HID1 domain containing |
chr1_-_52520828 | 0.26 |
ENST00000610127.1 |
TXNDC12 |
thioredoxin domain containing 12 (endoplasmic reticulum) |
chr19_+_35739782 | 0.26 |
ENST00000347609.4 |
LSR |
lipolysis stimulated lipoprotein receptor |
chr17_-_78450398 | 0.26 |
ENST00000306773.4 |
NPTX1 |
neuronal pentraxin I |
chr7_+_192969 | 0.26 |
ENST00000313766.5 |
FAM20C |
family with sequence similarity 20, member C |
chr22_-_30960876 | 0.26 |
ENST00000401975.1 ENST00000428682.1 ENST00000423299.1 |
GAL3ST1 |
galactose-3-O-sulfotransferase 1 |
chr1_+_154975110 | 0.26 |
ENST00000535420.1 ENST00000368426.3 |
ZBTB7B |
zinc finger and BTB domain containing 7B |
chr16_+_58059470 | 0.25 |
ENST00000219271.3 |
MMP15 |
matrix metallopeptidase 15 (membrane-inserted) |
chr7_+_12726623 | 0.25 |
ENST00000439721.1 |
ARL4A |
ADP-ribosylation factor-like 4A |
chr16_+_77225071 | 0.25 |
ENST00000439557.2 ENST00000545553.1 |
MON1B |
MON1 secretory trafficking family member B |
chr20_+_306177 | 0.25 |
ENST00000544632.1 |
SOX12 |
SRY (sex determining region Y)-box 12 |
chr5_+_443280 | 0.25 |
ENST00000508022.1 |
EXOC3 |
exocyst complex component 3 |
chr16_+_4421841 | 0.25 |
ENST00000304735.3 |
VASN |
vasorin |
chr19_+_14544099 | 0.25 |
ENST00000242783.6 ENST00000586557.1 ENST00000590097.1 |
PKN1 |
protein kinase N1 |
chr19_-_50316517 | 0.25 |
ENST00000313777.4 ENST00000445575.2 |
FUZ |
fuzzy planar cell polarity protein |
chr14_-_91294472 | 0.25 |
ENST00000555975.1 |
CTD-3035D6.2 |
CTD-3035D6.2 |
chr20_-_3767324 | 0.25 |
ENST00000379751.4 |
CENPB |
centromere protein B, 80kDa |
chr7_-_150780609 | 0.25 |
ENST00000297533.4 |
TMUB1 |
transmembrane and ubiquitin-like domain containing 1 |
chr7_-_44105158 | 0.25 |
ENST00000297283.3 |
PGAM2 |
phosphoglycerate mutase 2 (muscle) |
chr14_-_100625932 | 0.25 |
ENST00000553834.1 |
DEGS2 |
delta(4)-desaturase, sphingolipid 2 |
chr1_-_108743471 | 0.25 |
ENST00000569674.1 |
SLC25A24 |
solute carrier family 25 (mitochondrial carrier; phosphate carrier), member 24 |
chr19_-_6415695 | 0.25 |
ENST00000594496.1 ENST00000594745.1 ENST00000600480.1 |
KHSRP |
KH-type splicing regulatory protein |
chr12_-_7281469 | 0.25 |
ENST00000542370.1 ENST00000266560.3 |
RBP5 |
retinol binding protein 5, cellular |
chr1_+_16083154 | 0.25 |
ENST00000375771.1 |
FBLIM1 |
filamin binding LIM protein 1 |
chr16_-_88752889 | 0.25 |
ENST00000332281.5 |
SNAI3 |
snail family zinc finger 3 |
chr16_+_3068393 | 0.25 |
ENST00000573001.1 |
TNFRSF12A |
tumor necrosis factor receptor superfamily, member 12A |
chr3_-_137851220 | 0.25 |
ENST00000236709.3 |
A4GNT |
alpha-1,4-N-acetylglucosaminyltransferase |
chr3_-_156534754 | 0.25 |
ENST00000472943.1 ENST00000473352.1 |
LINC00886 |
long intergenic non-protein coding RNA 886 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.7 | GO:0097403 | cellular response to raffinose(GO:0097403) response to raffinose(GO:1901545) |
0.3 | 1.5 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
0.3 | 1.3 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
0.3 | 1.0 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
0.2 | 0.9 | GO:0006050 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
0.2 | 1.0 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.2 | 1.0 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
0.2 | 0.7 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
0.2 | 0.7 | GO:0090301 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.2 | 0.5 | GO:0090472 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
0.2 | 0.5 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
0.1 | 0.4 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.1 | 0.4 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.1 | 0.5 | GO:0045013 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
0.1 | 0.4 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
0.1 | 0.5 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.1 | 0.3 | GO:0060927 | Purkinje myocyte differentiation(GO:0003168) cardiac pacemaker cell fate commitment(GO:0060927) atrioventricular node cell fate commitment(GO:0060929) |
0.1 | 0.6 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 0.3 | GO:0019085 | early viral transcription(GO:0019085) |
0.1 | 0.4 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
0.1 | 0.6 | GO:0043126 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
0.1 | 0.3 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
0.1 | 1.7 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.1 | 0.3 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.4 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.1 | 0.4 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
0.1 | 0.4 | GO:0060535 | trachea cartilage morphogenesis(GO:0060535) |
0.1 | 0.5 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 0.9 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.3 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
0.1 | 0.3 | GO:1905166 | negative regulation of protein catabolic process in the vacuole(GO:1904351) negative regulation of lysosomal protein catabolic process(GO:1905166) |
0.1 | 0.3 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.1 | 0.3 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.2 | GO:0097187 | dentinogenesis(GO:0097187) |
0.1 | 0.3 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.1 | 0.7 | GO:0070560 | calcium-mediated signaling using extracellular calcium source(GO:0035585) protein secretion by platelet(GO:0070560) |
0.1 | 0.4 | GO:0015783 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
0.1 | 0.6 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.3 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.1 | 0.2 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
0.1 | 0.2 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.1 | 0.3 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
0.1 | 0.3 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.1 | 0.7 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.4 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.1 | 0.7 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 0.1 | GO:0035986 | senescence-associated heterochromatin focus assembly(GO:0035986) oncogene-induced cell senescence(GO:0090402) |
0.1 | 0.3 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.1 | 0.4 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 0.3 | GO:0072287 | metanephric distal tubule morphogenesis(GO:0072287) |
0.1 | 0.3 | GO:1904482 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
0.1 | 0.2 | GO:0002590 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) positive regulation of iron ion transport(GO:0034758) positive regulation of iron ion transmembrane transport(GO:0034761) regulation of iron ion import(GO:1900390) regulation of ferrous iron import into cell(GO:1903989) positive regulation of ferrous iron import into cell(GO:1903991) regulation of ferrous iron binding(GO:1904432) positive regulation of ferrous iron binding(GO:1904434) regulation of transferrin receptor binding(GO:1904435) positive regulation of transferrin receptor binding(GO:1904437) regulation of ferrous iron import across plasma membrane(GO:1904438) positive regulation of ferrous iron import across plasma membrane(GO:1904440) |
0.1 | 0.4 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
0.1 | 0.3 | GO:1902269 | positive regulation of polyamine transmembrane transport(GO:1902269) |
0.1 | 0.2 | GO:0060574 | intestinal epithelial cell maturation(GO:0060574) |
0.1 | 0.2 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.1 | 0.5 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.4 | GO:0001575 | globoside metabolic process(GO:0001575) |
0.1 | 0.5 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.1 | 0.5 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.1 | 0.2 | GO:0048597 | B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) positive regulation of apoptotic DNA fragmentation(GO:1902512) |
0.1 | 1.4 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.1 | 0.4 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.1 | 0.2 | GO:0003335 | corneocyte development(GO:0003335) |
0.1 | 0.2 | GO:0052151 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
0.1 | 0.2 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
0.1 | 0.3 | GO:0036309 | protein localization to M-band(GO:0036309) |
0.1 | 0.1 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.1 | 0.3 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
0.1 | 0.2 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.1 | 0.2 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.1 | 0.2 | GO:0061760 | antifungal humoral response(GO:0019732) antifungal innate immune response(GO:0061760) |
0.1 | 0.4 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
0.1 | 0.3 | GO:0006562 | proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) |
0.1 | 0.3 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.3 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.4 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.4 | GO:0071603 | endothelial cell-cell adhesion(GO:0071603) |
0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
0.1 | 0.3 | GO:2001151 | regulation of renal water transport(GO:2001151) positive regulation of renal water transport(GO:2001153) |
0.1 | 0.4 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
0.1 | 0.2 | GO:0002879 | positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
0.1 | 0.2 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
0.1 | 0.1 | GO:0071586 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
0.1 | 0.3 | GO:2000669 | negative regulation of dendritic cell apoptotic process(GO:2000669) |
0.1 | 0.2 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.1 | 1.0 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 0.1 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.0 | 0.4 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
0.0 | 0.5 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.0 | 0.3 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.0 | 0.5 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.0 | 0.1 | GO:1900369 | transcription, RNA-templated(GO:0001172) negative regulation of RNA interference(GO:1900369) |
0.0 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.2 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.0 | 0.1 | GO:0050822 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
0.0 | 0.1 | GO:0060380 | regulation of single-stranded telomeric DNA binding(GO:0060380) positive regulation of single-stranded telomeric DNA binding(GO:0060381) |
0.0 | 1.0 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.0 | 0.2 | GO:1904845 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
0.0 | 0.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.0 | 0.3 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
0.0 | 0.2 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.0 | 0.2 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.3 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
0.0 | 0.1 | GO:0070904 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
0.0 | 0.2 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.0 | 0.1 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.0 | 0.3 | GO:0006388 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.0 | 0.1 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
0.0 | 0.1 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 0.1 | GO:0001941 | postsynaptic membrane organization(GO:0001941) |
0.0 | 0.2 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.2 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
0.0 | 0.1 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.0 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
0.0 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.0 | 0.1 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.0 | 0.1 | GO:1901076 | positive regulation of engulfment of apoptotic cell(GO:1901076) |
0.0 | 0.2 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.0 | 0.3 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
0.0 | 0.2 | GO:2000538 | regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
0.0 | 0.1 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
0.0 | 0.2 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.0 | 0.1 | GO:1904582 | regulation of intracellular mRNA localization(GO:1904580) positive regulation of intracellular mRNA localization(GO:1904582) |
0.0 | 0.4 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
0.0 | 0.2 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.5 | GO:0030473 | nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) |
0.0 | 0.1 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.3 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
0.0 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.0 | 0.0 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.0 | 0.2 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
0.0 | 0.1 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
0.0 | 0.1 | GO:0072249 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
0.0 | 0.1 | GO:0001923 | B-1 B cell differentiation(GO:0001923) B-1a B cell differentiation(GO:0002337) |
0.0 | 0.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.0 | GO:0045622 | regulation of T-helper cell differentiation(GO:0045622) |
0.0 | 0.7 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
0.0 | 0.2 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.2 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.1 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
0.0 | 0.5 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.1 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
0.0 | 0.1 | GO:0002384 | hepatic immune response(GO:0002384) |
0.0 | 0.2 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.1 | GO:0070837 | disaccharide biosynthetic process(GO:0046351) dehydroascorbic acid transport(GO:0070837) |
0.0 | 0.3 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.2 | GO:0071461 | cellular response to redox state(GO:0071461) |
0.0 | 0.0 | GO:0060738 | epithelial-mesenchymal signaling involved in prostate gland development(GO:0060738) |
0.0 | 0.1 | GO:0072387 | flavin adenine dinucleotide metabolic process(GO:0072387) |
0.0 | 0.1 | GO:0006565 | cysteine biosynthetic process from serine(GO:0006535) L-serine catabolic process(GO:0006565) |
0.0 | 0.1 | GO:0072738 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) |
0.0 | 0.1 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
0.0 | 0.0 | GO:0036482 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
0.0 | 0.1 | GO:0090187 | positive regulation of high-density lipoprotein particle assembly(GO:0090108) positive regulation of pancreatic juice secretion(GO:0090187) positive regulation of secretion of lysosomal enzymes(GO:0090340) |
0.0 | 0.3 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.3 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.0 | 0.2 | GO:0015862 | uridine transport(GO:0015862) |
0.0 | 0.4 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.0 | 0.4 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.3 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.1 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) pathway-restricted SMAD protein phosphorylation(GO:0060389) positive regulation of transmembrane receptor protein serine/threonine kinase signaling pathway(GO:0090100) |
0.0 | 0.1 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
0.0 | 0.4 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
0.0 | 0.1 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.0 | 0.2 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.0 | 0.1 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.0 | 0.1 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
0.0 | 0.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 1.0 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.4 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.5 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.0 | 0.0 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.1 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
0.0 | 0.3 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.0 | 0.0 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
0.0 | 0.0 | GO:0046356 | acetyl-CoA catabolic process(GO:0046356) |
0.0 | 0.1 | GO:0070266 | necroptotic process(GO:0070266) |
0.0 | 0.1 | GO:0043602 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
0.0 | 0.4 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
0.0 | 0.0 | GO:2000822 | regulation of fear response(GO:1903365) regulation of behavioral fear response(GO:2000822) |
0.0 | 0.1 | GO:2001176 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
0.0 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.0 | 0.1 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
0.0 | 0.2 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.0 | 0.0 | GO:0008637 | apoptotic mitochondrial changes(GO:0008637) |
0.0 | 0.2 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.0 | 0.2 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.1 | GO:2000334 | blood microparticle formation(GO:0072564) regulation of blood microparticle formation(GO:2000332) positive regulation of blood microparticle formation(GO:2000334) |
0.0 | 0.1 | GO:0002065 | columnar/cuboidal epithelial cell differentiation(GO:0002065) |
0.0 | 0.1 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.0 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.2 | GO:0006591 | ornithine metabolic process(GO:0006591) |
0.0 | 0.2 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 0.1 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
0.0 | 0.1 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
0.0 | 0.2 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.0 | 0.1 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
0.0 | 0.1 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.0 | 0.2 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.2 | GO:0051958 | methotrexate transport(GO:0051958) |
0.0 | 0.2 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) |
0.0 | 0.8 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
0.0 | 0.1 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.1 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
0.0 | 0.3 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.1 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.2 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.0 | 0.3 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
0.0 | 0.2 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
0.0 | 0.1 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
0.0 | 0.1 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
0.0 | 0.1 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
0.0 | 0.1 | GO:0072008 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.1 | GO:0019056 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
0.0 | 0.1 | GO:0038155 | interleukin-23-mediated signaling pathway(GO:0038155) |
0.0 | 0.1 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.0 | 0.1 | GO:0030264 | nuclear fragmentation involved in apoptotic nuclear change(GO:0030264) |
0.0 | 0.1 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.0 | 0.1 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
0.0 | 0.1 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
0.0 | 0.1 | GO:0042350 | GDP-L-fucose biosynthetic process(GO:0042350) |
0.0 | 0.1 | GO:1904719 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.0 | 0.0 | GO:0044691 | tooth eruption(GO:0044691) |
0.0 | 0.2 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
0.0 | 0.3 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
0.0 | 0.4 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.1 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.1 | GO:1990523 | bone regeneration(GO:1990523) |
0.0 | 0.1 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
0.0 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.0 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.0 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.1 | GO:2000851 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) positive regulation of cortisol secretion(GO:0051464) positive regulation of glucocorticoid secretion(GO:2000851) |
0.0 | 0.0 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.0 | 0.1 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.0 | 0.1 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
0.0 | 0.0 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.1 | GO:0046618 | drug export(GO:0046618) |
0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
0.0 | 0.0 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.1 | GO:0061143 | alveolar primary septum development(GO:0061143) |
0.0 | 0.2 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.1 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
0.0 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.8 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.3 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.3 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
0.0 | 0.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.0 | 0.7 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.1 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.0 | 0.4 | GO:0000052 | citrulline metabolic process(GO:0000052) |
0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
0.0 | 0.3 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.0 | 0.2 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
0.0 | 0.1 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.0 | 0.1 | GO:0043542 | endothelial cell migration(GO:0043542) |
0.0 | 0.1 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
0.0 | 0.1 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.1 | GO:0032392 | DNA geometric change(GO:0032392) |
0.0 | 0.1 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.0 | 0.0 | GO:0035634 | response to stilbenoid(GO:0035634) |
0.0 | 0.1 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.1 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.0 | 0.2 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
0.0 | 0.1 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
0.0 | 0.1 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
0.0 | 0.1 | GO:0045041 | B cell cytokine production(GO:0002368) protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.2 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.2 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.2 | GO:0032782 | bile acid secretion(GO:0032782) |
0.0 | 0.5 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.1 | GO:0044727 | chromatin reprogramming in the zygote(GO:0044725) DNA demethylation of male pronucleus(GO:0044727) |
0.0 | 0.4 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.0 | GO:0060796 | regulation of transcription involved in primary germ layer cell fate commitment(GO:0060796) |
0.0 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.0 | 0.7 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.0 | 0.1 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.0 | GO:1902159 | regulation of cyclic nucleotide-gated ion channel activity(GO:1902159) |
0.0 | 0.1 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.0 | 0.0 | GO:0072014 | proximal tubule development(GO:0072014) |
0.0 | 0.3 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.0 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
0.0 | 0.1 | GO:0031179 | peptide amidation(GO:0001519) protein amidation(GO:0018032) peptide modification(GO:0031179) |
0.0 | 0.1 | GO:0044211 | CTP salvage(GO:0044211) |
0.0 | 0.1 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
0.0 | 0.1 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
0.0 | 0.0 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
0.0 | 0.2 | GO:0034465 | response to carbon monoxide(GO:0034465) |
0.0 | 0.2 | GO:0002084 | protein depalmitoylation(GO:0002084) |
0.0 | 0.1 | GO:0033076 | isoquinoline alkaloid metabolic process(GO:0033076) |
0.0 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.0 | GO:0018149 | peptide cross-linking(GO:0018149) |
0.0 | 0.3 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.0 | 0.4 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.0 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.0 | 0.5 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.0 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.0 | 0.1 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
0.0 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.3 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.0 | 0.2 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.0 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.0 | 0.0 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.0 | 0.2 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.1 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.1 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.0 | 0.1 | GO:0016559 | peroxisome fission(GO:0016559) |
0.0 | 0.1 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
0.0 | 0.0 | GO:1905053 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
0.0 | 0.3 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.0 | 0.1 | GO:0000023 | maltose metabolic process(GO:0000023) |
0.0 | 0.1 | GO:0032218 | riboflavin transport(GO:0032218) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.3 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.1 | GO:0032918 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
0.0 | 0.1 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
0.0 | 0.0 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
0.0 | 0.1 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
0.0 | 0.0 | GO:1903094 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
0.0 | 0.0 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.0 | 0.1 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
0.0 | 0.0 | GO:0036451 | cap mRNA methylation(GO:0036451) |
0.0 | 0.0 | GO:0002731 | negative regulation of dendritic cell cytokine production(GO:0002731) |
0.0 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.0 | 0.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.3 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
0.0 | 0.1 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
0.0 | 0.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.0 | 0.2 | GO:0060965 | negative regulation of gene silencing by miRNA(GO:0060965) |
0.0 | 0.1 | GO:0071104 | response to interleukin-9(GO:0071104) |
0.0 | 0.5 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.1 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
0.0 | 0.0 | GO:0030573 | bile acid catabolic process(GO:0030573) |
0.0 | 0.1 | GO:0046056 | dADP metabolic process(GO:0046056) |
0.0 | 0.0 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
0.0 | 0.1 | GO:0090116 | DNA methylation on cytosine(GO:0032776) C-5 methylation of cytosine(GO:0090116) |
0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.0 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
0.0 | 0.2 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.0 | 0.1 | GO:0015798 | myo-inositol transport(GO:0015798) |
0.0 | 0.0 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.0 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
0.0 | 0.1 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
0.0 | 0.1 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.0 | 0.0 | GO:0044028 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.1 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.0 | 0.1 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
0.0 | 0.1 | GO:0000720 | meiotic mismatch repair(GO:0000710) pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.0 | 0.2 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.0 | 0.0 | GO:1901538 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
0.0 | 0.1 | GO:0060143 | positive regulation of syncytium formation by plasma membrane fusion(GO:0060143) |
0.0 | 0.1 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.1 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
0.0 | 0.0 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
0.0 | 0.2 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.0 | 0.3 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.1 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
0.0 | 0.2 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.1 | GO:1990569 | UDP-N-acetylglucosamine transport(GO:0015788) UDP-N-acetylglucosamine transmembrane transport(GO:1990569) |
0.0 | 0.8 | GO:0007520 | myoblast fusion(GO:0007520) |
0.0 | 0.2 | GO:0015866 | ADP transport(GO:0015866) |
0.0 | 0.1 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
0.0 | 0.1 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
0.0 | 0.1 | GO:1902731 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) negative regulation of chondrocyte proliferation(GO:1902731) |
0.0 | 0.3 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.1 | GO:0002353 | kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
0.0 | 0.1 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
0.0 | 0.3 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.0 | 0.5 | GO:0001755 | neural crest cell migration(GO:0001755) |
0.0 | 0.0 | GO:0042816 | vitamin B6 metabolic process(GO:0042816) |
0.0 | 0.0 | GO:0048665 | neuron fate specification(GO:0048665) |
0.0 | 0.0 | GO:2000744 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
0.0 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.8 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.0 | 0.0 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.0 | GO:0034443 | negative regulation of lipoprotein oxidation(GO:0034443) regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
0.0 | 0.1 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.0 | 0.1 | GO:2001169 | regulation of ATP biosynthetic process(GO:2001169) positive regulation of ATP biosynthetic process(GO:2001171) |
0.0 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.1 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
0.0 | 0.3 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.2 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.0 | 0.2 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.0 | 0.0 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.0 | 0.1 | GO:0021816 | lamellipodium assembly involved in ameboidal cell migration(GO:0003363) extension of a leading process involved in cell motility in cerebral cortex radial glia guided migration(GO:0021816) |
0.0 | 0.1 | GO:0018377 | protein myristoylation(GO:0018377) |
0.0 | 0.1 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.0 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.0 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.0 | 0.1 | GO:0098582 | innate vocalization behavior(GO:0098582) |
0.0 | 0.1 | GO:0050957 | equilibrioception(GO:0050957) |
0.0 | 0.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.1 | GO:0015793 | glycerol transport(GO:0015793) |
0.0 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.0 | 0.1 | GO:0035900 | response to isolation stress(GO:0035900) |
0.0 | 0.1 | GO:0009644 | response to high light intensity(GO:0009644) |
0.0 | 0.0 | GO:0052330 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
0.0 | 0.0 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) negative regulation of bicellular tight junction assembly(GO:1903347) |
0.0 | 0.1 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.0 | 0.0 | GO:0033320 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
0.0 | 0.0 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.0 | 0.2 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
0.0 | 0.0 | GO:1903413 | response to bile acid(GO:1903412) cellular response to bile acid(GO:1903413) |
0.0 | 0.3 | GO:0006884 | cell volume homeostasis(GO:0006884) |
0.0 | 0.1 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.0 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
0.0 | 0.1 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.1 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.0 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.0 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.1 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.0 | 0.1 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
0.0 | 0.0 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
0.0 | 0.0 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.0 | 0.0 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.0 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.0 | 0.1 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
0.0 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.0 | GO:0032203 | telomere formation via telomerase(GO:0032203) |
0.0 | 0.4 | GO:0034199 | activation of protein kinase A activity(GO:0034199) |
0.0 | 0.1 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
0.0 | 0.0 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.0 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
0.0 | 0.0 | GO:2000342 | negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.1 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.1 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.0 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
0.0 | 0.1 | GO:0051167 | glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
0.0 | 0.0 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
0.0 | 0.2 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.0 | 0.0 | GO:1901143 | insulin catabolic process(GO:1901143) |
0.0 | 0.0 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.0 | 0.1 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.0 | 0.2 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.0 | 0.1 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.0 | 0.3 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.3 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.0 | 0.0 | GO:0060489 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
0.0 | 0.1 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.0 | GO:1901162 | primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.1 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.0 | 0.0 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:0036509 | trimming of terminal mannose on B branch(GO:0036509) trimming of first mannose on A branch(GO:0036511) trimming of second mannose on A branch(GO:0036512) |
0.0 | 0.0 | GO:0100009 | regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
0.0 | 0.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.0 | 0.4 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.0 | GO:0007440 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
0.0 | 0.8 | GO:0030032 | lamellipodium assembly(GO:0030032) |
0.0 | 0.3 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.0 | 0.0 | GO:0032796 | uropod organization(GO:0032796) |
0.0 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.2 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
0.0 | 0.0 | GO:0046603 | negative regulation of mitotic centrosome separation(GO:0046603) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.0 | GO:0051941 | regulation of amino acid import(GO:0010958) regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
0.0 | 0.0 | GO:0006657 | CDP-choline pathway(GO:0006657) |
0.0 | 0.1 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
0.0 | 0.0 | GO:0090208 | positive regulation of triglyceride metabolic process(GO:0090208) |
0.0 | 0.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.1 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.0 | 0.0 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:0043335 | protein unfolding(GO:0043335) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.2 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
0.1 | 0.7 | GO:0043260 | laminin-11 complex(GO:0043260) |
0.1 | 0.5 | GO:0071665 | gamma-catenin-TCF7L2 complex(GO:0071665) |
0.1 | 1.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.1 | 1.5 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.8 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.3 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.1 | 0.2 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
0.1 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 0.2 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 0.4 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 0.1 | GO:0098576 | lumenal side of membrane(GO:0098576) |
0.1 | 0.2 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
0.1 | 0.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 0.6 | GO:0070554 | synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
0.1 | 0.3 | GO:0002133 | polycystin complex(GO:0002133) |
0.0 | 0.1 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) |
0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.3 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.5 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
0.0 | 0.3 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.2 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
0.0 | 0.4 | GO:0005587 | collagen type IV trimer(GO:0005587) |
0.0 | 0.0 | GO:1990769 | proximal neuron projection(GO:1990769) |
0.0 | 0.2 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.2 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.0 | 0.5 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.5 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.2 | GO:0032449 | CBM complex(GO:0032449) |
0.0 | 0.5 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.5 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.2 | GO:0031166 | integral component of vacuolar membrane(GO:0031166) |
0.0 | 0.8 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
0.0 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 0.2 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
0.0 | 0.1 | GO:0036117 | hyaluranon cable(GO:0036117) |
0.0 | 0.5 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.6 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
0.0 | 0.5 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.7 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.1 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 0.1 | GO:0044301 | climbing fiber(GO:0044301) |
0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.5 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.1 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.1 | GO:0072536 | interleukin-23 receptor complex(GO:0072536) |
0.0 | 0.3 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.5 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.1 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
0.0 | 0.2 | GO:0042825 | TAP complex(GO:0042825) |
0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 0.3 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:1990031 | pinceau fiber(GO:1990031) |
0.0 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
0.0 | 0.2 | GO:0097361 | CIA complex(GO:0097361) |
0.0 | 0.6 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.0 | 0.0 | GO:0036398 | TCR signalosome(GO:0036398) |
0.0 | 0.1 | GO:0019034 | viral replication complex(GO:0019034) |
0.0 | 0.6 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.1 | GO:0032044 | DSIF complex(GO:0032044) |
0.0 | 0.0 | GO:0016234 | inclusion body(GO:0016234) |
0.0 | 0.7 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
0.0 | 0.1 | GO:0009346 | citrate lyase complex(GO:0009346) |
0.0 | 0.5 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.0 | 0.1 | GO:0034657 | GID complex(GO:0034657) |
0.0 | 0.1 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.0 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.0 | 1.0 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.3 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 1.1 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.2 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 0.3 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.1 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.0 | 0.1 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.3 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.0 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
0.0 | 0.2 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
0.0 | 0.0 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.1 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.0 | 0.8 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.1 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.0 | 0.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.0 | GO:0097444 | spine apparatus(GO:0097444) |
0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.0 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
0.0 | 0.0 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.0 | 0.0 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.1 | GO:0032806 | carboxy-terminal domain protein kinase complex(GO:0032806) |
0.0 | 1.2 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 1.0 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.1 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
0.0 | 0.6 | GO:0090544 | BAF-type complex(GO:0090544) |
0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.0 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
0.0 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.0 | GO:0070931 | Golgi-associated vesicle lumen(GO:0070931) |
0.0 | 0.0 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.4 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
0.0 | 0.0 | GO:0044609 | DBIRD complex(GO:0044609) |
0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.0 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
0.0 | 0.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.1 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
0.0 | 0.0 | GO:0032010 | phagolysosome(GO:0032010) |
0.0 | 0.8 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.3 | GO:0031105 | septin complex(GO:0031105) |
0.0 | 0.0 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.1 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
0.0 | 1.6 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.1 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.7 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
0.2 | 0.9 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.2 | 1.3 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.2 | 0.5 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.2 | 1.2 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.4 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.1 | 0.4 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
0.1 | 0.5 | GO:0005199 | structural constituent of cell wall(GO:0005199) |
0.1 | 0.7 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.3 | GO:0016705 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen(GO:0016705) |
0.1 | 0.4 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
0.1 | 0.4 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) leukotriene receptor activity(GO:0004974) |
0.1 | 0.7 | GO:0016403 | dimethylargininase activity(GO:0016403) |
0.1 | 0.4 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.1 | 0.3 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
0.1 | 0.5 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.4 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
0.1 | 0.4 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
0.1 | 0.7 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.2 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
0.1 | 0.4 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
0.1 | 0.3 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 0.2 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
0.1 | 0.2 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
0.1 | 0.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.2 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
0.1 | 0.2 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.1 | 0.2 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
0.1 | 1.0 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.1 | 0.3 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.1 | 0.3 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.3 | GO:0010736 | serum response element binding(GO:0010736) |
0.1 | 2.0 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.1 | 0.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.2 | GO:0016898 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
0.1 | 0.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
0.1 | 0.2 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.3 | GO:0019863 | IgE binding(GO:0019863) |
0.1 | 0.4 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
0.1 | 0.2 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
0.1 | 0.3 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 0.3 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.1 | 0.4 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
0.1 | 0.3 | GO:0070905 | serine binding(GO:0070905) |
0.1 | 0.3 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.1 | 0.2 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
0.1 | 0.7 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.1 | 0.7 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.1 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.1 | 0.2 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
0.1 | 0.2 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 0.3 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
0.1 | 0.2 | GO:0015131 | thiosulfate transmembrane transporter activity(GO:0015117) oxaloacetate transmembrane transporter activity(GO:0015131) |
0.1 | 0.6 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 0.2 | GO:0047225 | acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0047225) |
0.1 | 1.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.4 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.0 | 0.5 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
0.0 | 0.3 | GO:0004797 | deoxycytidine kinase activity(GO:0004137) thymidine kinase activity(GO:0004797) |
0.0 | 0.3 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.0 | 0.1 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
0.0 | 0.0 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.5 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 1.2 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.7 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.0 | 0.1 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
0.0 | 0.3 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.0 | 0.1 | GO:0070890 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
0.0 | 0.1 | GO:0070984 | SET domain binding(GO:0070984) |
0.0 | 0.3 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
0.0 | 0.5 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.3 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.0 | 0.1 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
0.0 | 0.8 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.2 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
0.0 | 0.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.0 | 0.1 | GO:0051213 | dioxygenase activity(GO:0051213) |
0.0 | 0.1 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
0.0 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
0.0 | 0.1 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
0.0 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.2 | GO:0000982 | transcription factor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0000982) |
0.0 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.3 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.2 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.0 | 0.2 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.0 | GO:0019826 | oxygen sensor activity(GO:0019826) |
0.0 | 0.1 | GO:0045142 | triplex DNA binding(GO:0045142) |
0.0 | 0.1 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
0.0 | 0.1 | GO:0016250 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.1 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
0.0 | 0.2 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
0.0 | 0.7 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.0 | 0.1 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
0.0 | 0.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.2 | GO:1903135 | cupric ion binding(GO:1903135) |
0.0 | 0.1 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
0.0 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.1 | GO:0070119 | ciliary neurotrophic factor binding(GO:0070119) |
0.0 | 0.1 | GO:0033612 | receptor serine/threonine kinase binding(GO:0033612) |
0.0 | 0.1 | GO:0015432 | bile acid-exporting ATPase activity(GO:0015432) |
0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.0 | 0.3 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
0.0 | 0.2 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
0.0 | 0.1 | GO:0070025 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
0.0 | 0.1 | GO:0003842 | 1-pyrroline-5-carboxylate dehydrogenase activity(GO:0003842) |
0.0 | 0.7 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.4 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.1 | GO:0001133 | RNA polymerase II transcription factor activity, sequence-specific transcription regulatory region DNA binding(GO:0001133) |
0.0 | 0.1 | GO:0090556 | apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.1 | GO:0005055 | laminin receptor activity(GO:0005055) |
0.0 | 0.2 | GO:0046979 | TAP2 binding(GO:0046979) |
0.0 | 0.1 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
0.0 | 0.2 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
0.0 | 0.3 | GO:0032810 | sterol response element binding(GO:0032810) |
0.0 | 0.1 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.0 | 0.1 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
0.0 | 0.3 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.3 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.3 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.0 | 0.1 | GO:0016708 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.0 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.1 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
0.0 | 0.0 | GO:0016769 | transaminase activity(GO:0008483) transferase activity, transferring nitrogenous groups(GO:0016769) |
0.0 | 0.2 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.1 | GO:0000400 | DNA secondary structure binding(GO:0000217) four-way junction DNA binding(GO:0000400) |
0.0 | 0.6 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.0 | 0.4 | GO:0015926 | glucosidase activity(GO:0015926) |
0.0 | 0.1 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
0.0 | 0.1 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
0.0 | 0.2 | GO:0050294 | steroid sulfotransferase activity(GO:0050294) |
0.0 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.0 | 0.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0042019 | interleukin-23 binding(GO:0042019) interleukin-23 receptor activity(GO:0042020) |
0.0 | 0.1 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
0.0 | 0.1 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
0.0 | 0.9 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.3 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.0 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.0 | GO:0047787 | delta4-3-oxosteroid 5beta-reductase activity(GO:0047787) |
0.0 | 0.7 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.0 | 0.1 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.0 | 0.4 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.2 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.1 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
0.0 | 0.9 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.1 | GO:0008112 | nicotinamide N-methyltransferase activity(GO:0008112) pyridine N-methyltransferase activity(GO:0030760) |
0.0 | 0.2 | GO:0008955 | peptidoglycan glycosyltransferase activity(GO:0008955) |
0.0 | 0.4 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.1 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
0.0 | 0.1 | GO:0045569 | TRAIL binding(GO:0045569) |
0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.1 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
0.0 | 0.1 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 1.2 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.0 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.0 | 0.1 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
0.0 | 0.1 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
0.0 | 0.1 | GO:0047025 | 3-oxoacyl-[acyl-carrier-protein] reductase (NADH) activity(GO:0047025) |
0.0 | 0.4 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.0 | 0.3 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.0 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
0.0 | 0.1 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
0.0 | 0.1 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
0.0 | 0.1 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
0.0 | 0.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.2 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
0.0 | 0.1 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
0.0 | 0.6 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.0 | 0.0 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.1 | GO:0008431 | vitamin E binding(GO:0008431) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.2 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
0.0 | 0.1 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.2 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.1 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.0 | 0.1 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.1 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
0.0 | 0.5 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.2 | GO:0000977 | RNA polymerase II regulatory region sequence-specific DNA binding(GO:0000977) |
0.0 | 0.4 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.1 | GO:0004598 | peptidylglycine monooxygenase activity(GO:0004504) peptidylamidoglycolate lyase activity(GO:0004598) |
0.0 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
0.0 | 0.4 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.0 | 0.1 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
0.0 | 0.4 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.1 | GO:0050115 | myosin-light-chain-phosphatase activity(GO:0050115) |
0.0 | 0.2 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.1 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.2 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 0.1 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.0 | 0.1 | GO:0005174 | CD40 receptor binding(GO:0005174) |
0.0 | 0.1 | GO:0016652 | NAD(P)+ transhydrogenase activity(GO:0008746) oxidoreductase activity, acting on NAD(P)H, NAD(P) as acceptor(GO:0016652) |
0.0 | 0.1 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
0.0 | 0.1 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.0 | 0.1 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
0.0 | 0.0 | GO:0030249 | calcium sensitive guanylate cyclase activator activity(GO:0008048) cyclase regulator activity(GO:0010851) cyclase activator activity(GO:0010853) guanylate cyclase regulator activity(GO:0030249) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.0 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
0.0 | 0.2 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
0.0 | 0.0 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
0.0 | 0.1 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.0 | 0.3 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.0 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.3 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.1 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
0.0 | 0.0 | GO:0015068 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
0.0 | 0.2 | GO:0015266 | protein channel activity(GO:0015266) |
0.0 | 0.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.0 | 0.1 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
0.0 | 0.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
0.0 | 0.1 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
0.0 | 0.2 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.0 | 0.1 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.2 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.0 | GO:0031626 | beta-endorphin binding(GO:0031626) |
0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
0.0 | 0.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.0 | 0.1 | GO:0005462 | UDP-N-acetylglucosamine transmembrane transporter activity(GO:0005462) |
0.0 | 0.2 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
0.0 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.0 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.2 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.2 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.0 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
0.0 | 0.1 | GO:0043532 | angiostatin binding(GO:0043532) |
0.0 | 0.1 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.0 | 0.3 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.0 | 0.0 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.1 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.2 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.2 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 0.1 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
0.0 | 0.0 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
0.0 | 0.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.0 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
0.0 | 0.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.1 | GO:0045159 | myosin II binding(GO:0045159) |
0.0 | 0.1 | GO:1901474 | thiamine transmembrane transporter activity(GO:0015234) azole transmembrane transporter activity(GO:1901474) |
0.0 | 0.3 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.0 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
0.0 | 0.0 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.0 | GO:1990763 | arrestin family protein binding(GO:1990763) |
0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.0 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.0 | 0.2 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
0.0 | 0.0 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
0.0 | 0.0 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.0 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.0 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.1 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
0.0 | 0.1 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.0 | 0.3 | GO:0004871 | signal transducer activity(GO:0004871) |
0.0 | 0.4 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.0 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.0 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 0.2 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.4 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
0.0 | 0.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.6 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.6 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.1 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.0 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 0.0 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.0 | 0.4 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 1.3 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.0 | 0.7 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.6 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.5 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 1.6 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.3 | ST STAT3 PATHWAY | STAT3 Pathway |
0.0 | 0.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 1.4 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.6 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.0 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.9 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.1 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 1.6 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 1.8 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.2 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.6 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.9 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.8 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.6 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 1.0 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.8 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.4 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.0 | 0.7 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.2 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.0 | 0.2 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.4 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.6 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.0 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
0.0 | 0.9 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.4 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.6 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.5 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.3 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.5 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.1 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.7 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.3 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.3 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.3 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.0 | 0.4 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.2 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.0 | 0.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |