avrg: A549 cells infected with IAV Analysis Results (GEO series: GSE147507)
Gene Symbol | Gene ID | Gene Info |
---|---|---|
YY1
|
ENSG00000100811.6 | YY1 |
YY2
|
ENSG00000230797.2 | YY2 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
YY2 | hg19_v2_chrX_+_21874105_21874105 | -0.84 | 1.6e-01 | Click! |
YY1 | hg19_v2_chr14_+_100705322_100705360 | -0.81 | 1.9e-01 | Click! |
Promoter | Score | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr16_+_30934376 | 3.55 |
ENST00000562798.1 ENST00000471231.2 |
FBXL19 |
F-box and leucine-rich repeat protein 19 |
chr19_+_507299 | 2.43 |
ENST00000359315.5 |
TPGS1 |
tubulin polyglutamylase complex subunit 1 |
chrX_-_153236819 | 1.73 |
ENST00000354233.3 |
HCFC1 |
host cell factor C1 (VP16-accessory protein) |
chrX_+_153237740 | 1.57 |
ENST00000369982.4 |
TMEM187 |
transmembrane protein 187 |
chr16_+_30662085 | 1.50 |
ENST00000569864.1 |
PRR14 |
proline rich 14 |
chrX_-_153237258 | 1.40 |
ENST00000310441.7 |
HCFC1 |
host cell factor C1 (VP16-accessory protein) |
chr16_+_30662050 | 1.29 |
ENST00000568754.1 |
PRR14 |
proline rich 14 |
chr11_-_62476965 | 1.13 |
ENST00000405837.1 ENST00000531524.1 |
BSCL2 |
Berardinelli-Seip congenital lipodystrophy 2 (seipin) |
chr3_-_48700310 | 1.10 |
ENST00000164024.4 ENST00000544264.1 |
CELSR3 |
cadherin, EGF LAG seven-pass G-type receptor 3 |
chr14_-_23504087 | 1.09 |
ENST00000493471.2 ENST00000460922.2 |
PSMB5 |
proteasome (prosome, macropain) subunit, beta type, 5 |
chr6_-_26027480 | 1.07 |
ENST00000377364.3 |
HIST1H4B |
histone cluster 1, H4b |
chr6_+_26045603 | 1.06 |
ENST00000540144.1 |
HIST1H3C |
histone cluster 1, H3c |
chr17_+_74732889 | 1.06 |
ENST00000591864.1 |
MFSD11 |
major facilitator superfamily domain containing 11 |
chrX_-_153236620 | 1.02 |
ENST00000369984.4 |
HCFC1 |
host cell factor C1 (VP16-accessory protein) |
chr1_-_149785236 | 1.02 |
ENST00000331491.1 |
HIST2H3D |
histone cluster 2, H3d |
chr6_-_33168391 | 0.99 |
ENST00000374685.4 ENST00000413614.2 ENST00000374680.3 |
RXRB |
retinoid X receptor, beta |
chr17_-_43138463 | 0.96 |
ENST00000310604.4 |
DCAKD |
dephospho-CoA kinase domain containing |
chr1_-_149812765 | 0.96 |
ENST00000369158.1 |
HIST2H3C |
histone cluster 2, H3c |
chr14_-_23504337 | 0.94 |
ENST00000361611.6 |
PSMB5 |
proteasome (prosome, macropain) subunit, beta type, 5 |
chr1_+_149824160 | 0.93 |
ENST00000403683.1 |
HIST2H3A |
histone cluster 2, H3a |
chr5_-_139943830 | 0.93 |
ENST00000412920.3 ENST00000511201.2 ENST00000356738.2 ENST00000354402.5 ENST00000358580.5 ENST00000508496.2 |
APBB3 |
amyloid beta (A4) precursor protein-binding, family B, member 3 |
chr17_+_3572087 | 0.92 |
ENST00000248378.5 ENST00000397133.2 |
EMC6 |
ER membrane protein complex subunit 6 |
chr19_-_50316423 | 0.89 |
ENST00000528094.1 ENST00000526575.1 |
FUZ |
fuzzy planar cell polarity protein |
chr11_-_62476694 | 0.89 |
ENST00000524862.1 |
BSCL2 |
Berardinelli-Seip congenital lipodystrophy 2 (seipin) |
chr19_+_39421556 | 0.87 |
ENST00000407800.2 ENST00000402029.3 |
MRPS12 |
mitochondrial ribosomal protein S12 |
chr19_-_55791058 | 0.86 |
ENST00000587959.1 ENST00000585927.1 ENST00000587922.1 ENST00000585698.1 |
HSPBP1 |
HSPA (heat shock 70kDa) binding protein, cytoplasmic cochaperone 1 |
chr9_+_131873591 | 0.83 |
ENST00000393370.2 ENST00000337738.1 ENST00000348141.5 |
PPP2R4 |
protein phosphatase 2A activator, regulatory subunit 4 |
chr19_-_50316517 | 0.83 |
ENST00000313777.4 ENST00000445575.2 |
FUZ |
fuzzy planar cell polarity protein |
chr19_-_56110859 | 0.82 |
ENST00000221665.3 ENST00000592585.1 |
FIZ1 |
FLT3-interacting zinc finger 1 |
chr1_+_11333546 | 0.82 |
ENST00000376804.2 |
UBIAD1 |
UbiA prenyltransferase domain containing 1 |
chr6_+_31588478 | 0.81 |
ENST00000376007.4 ENST00000376033.2 |
PRRC2A |
proline-rich coiled-coil 2A |
chr19_-_55895966 | 0.80 |
ENST00000444469.3 |
TMEM238 |
transmembrane protein 238 |
chr1_-_153950116 | 0.80 |
ENST00000368589.1 |
JTB |
jumping translocation breakpoint |
chr11_-_62477041 | 0.80 |
ENST00000433053.1 |
BSCL2 |
Berardinelli-Seip congenital lipodystrophy 2 (seipin) |
chr11_-_62477103 | 0.79 |
ENST00000532818.1 |
BSCL2 |
Berardinelli-Seip congenital lipodystrophy 2 (seipin) |
chr9_+_131873659 | 0.78 |
ENST00000452489.2 ENST00000347048.4 ENST00000357197.4 ENST00000445241.1 ENST00000355007.3 ENST00000414331.1 |
PPP2R4 |
protein phosphatase 2A activator, regulatory subunit 4 |
chr6_-_27840099 | 0.77 |
ENST00000328488.2 |
HIST1H3I |
histone cluster 1, H3i |
chr17_+_38375528 | 0.77 |
ENST00000583268.1 |
WIPF2 |
WAS/WASL interacting protein family, member 2 |
chr6_-_43484621 | 0.76 |
ENST00000506469.1 ENST00000503972.1 |
YIPF3 |
Yip1 domain family, member 3 |
chr19_-_36545649 | 0.75 |
ENST00000292894.1 |
THAP8 |
THAP domain containing 8 |
chrX_+_153060090 | 0.74 |
ENST00000370086.3 ENST00000370085.3 |
SSR4 |
signal sequence receptor, delta |
chr6_-_26032288 | 0.73 |
ENST00000244661.2 |
HIST1H3B |
histone cluster 1, H3b |
chr16_+_30709530 | 0.73 |
ENST00000411466.2 |
SRCAP |
Snf2-related CREBBP activator protein |
chr17_+_4843352 | 0.73 |
ENST00000573404.1 ENST00000576452.1 |
RNF167 |
ring finger protein 167 |
chr11_+_695380 | 0.72 |
ENST00000397510.3 |
TMEM80 |
transmembrane protein 80 |
chr6_-_33756867 | 0.72 |
ENST00000293760.5 |
LEMD2 |
LEM domain containing 2 |
chr1_-_46769261 | 0.72 |
ENST00000343304.6 |
LRRC41 |
leucine rich repeat containing 41 |
chr19_+_4791722 | 0.71 |
ENST00000269856.3 |
FEM1A |
fem-1 homolog a (C. elegans) |
chr1_-_228594490 | 0.70 |
ENST00000366699.3 ENST00000284551.6 |
TRIM11 |
tripartite motif containing 11 |
chr6_-_27782548 | 0.69 |
ENST00000333151.3 |
HIST1H2AJ |
histone cluster 1, H2aj |
chr19_-_41903161 | 0.68 |
ENST00000602129.1 ENST00000593771.1 ENST00000596905.1 ENST00000221233.4 |
EXOSC5 |
exosome component 5 |
chr14_-_23299009 | 0.68 |
ENST00000488800.1 |
SLC7A7 |
solute carrier family 7 (amino acid transporter light chain, y+L system), member 7 |
chr5_-_148930731 | 0.67 |
ENST00000515748.2 |
CSNK1A1 |
casein kinase 1, alpha 1 |
chrX_+_153059608 | 0.67 |
ENST00000370087.1 |
SSR4 |
signal sequence receptor, delta |
chr10_-_103347883 | 0.67 |
ENST00000339310.3 ENST00000370158.3 ENST00000299206.4 ENST00000456836.2 ENST00000413344.1 ENST00000429502.1 ENST00000430045.1 ENST00000370172.1 ENST00000436284.2 ENST00000370162.3 |
POLL |
polymerase (DNA directed), lambda |
chr1_+_36023370 | 0.67 |
ENST00000356090.4 ENST00000373243.2 |
NCDN |
neurochondrin |
chr6_-_32145861 | 0.66 |
ENST00000336984.6 |
AGPAT1 |
1-acylglycerol-3-phosphate O-acyltransferase 1 |
chr17_-_47865948 | 0.65 |
ENST00000513602.1 |
FAM117A |
family with sequence similarity 117, member A |
chr1_+_1167594 | 0.65 |
ENST00000379198.2 |
B3GALT6 |
UDP-Gal:betaGal beta 1,3-galactosyltransferase polypeptide 6 |
chr11_-_64889649 | 0.64 |
ENST00000434372.2 |
FAU |
Finkel-Biskis-Reilly murine sarcoma virus (FBR-MuSV) ubiquitously expressed |
chr19_-_50316489 | 0.64 |
ENST00000533418.1 |
FUZ |
fuzzy planar cell polarity protein |
chr16_+_30935418 | 0.63 |
ENST00000338343.4 |
FBXL19 |
F-box and leucine-rich repeat protein 19 |
chr12_+_94071129 | 0.63 |
ENST00000552983.1 ENST00000332896.3 ENST00000552033.1 ENST00000548483.1 |
CRADD |
CASP2 and RIPK1 domain containing adaptor with death domain |
chr17_-_45918539 | 0.63 |
ENST00000584123.1 ENST00000578323.1 ENST00000407215.3 ENST00000290216.9 |
SCRN2 |
secernin 2 |
chr6_+_26020672 | 0.62 |
ENST00000357647.3 |
HIST1H3A |
histone cluster 1, H3a |
chr14_-_23504432 | 0.62 |
ENST00000425762.2 |
PSMB5 |
proteasome (prosome, macropain) subunit, beta type, 5 |
chr9_-_35658007 | 0.61 |
ENST00000602361.1 |
RMRP |
RNA component of mitochondrial RNA processing endoribonuclease |
chr1_-_149814478 | 0.61 |
ENST00000369161.3 |
HIST2H2AA3 |
histone cluster 2, H2aa3 |
chr17_-_58603482 | 0.61 |
ENST00000585368.1 |
APPBP2 |
amyloid beta precursor protein (cytoplasmic tail) binding protein 2 |
chr6_-_26033796 | 0.61 |
ENST00000259791.2 |
HIST1H2AB |
histone cluster 1, H2ab |
chr16_+_30935896 | 0.61 |
ENST00000562319.1 ENST00000380310.2 |
FBXL19 |
F-box and leucine-rich repeat protein 19 |
chr19_+_50145328 | 0.60 |
ENST00000360565.3 |
SCAF1 |
SR-related CTD-associated factor 1 |
chr19_+_797392 | 0.60 |
ENST00000350092.4 ENST00000349038.4 ENST00000586481.1 ENST00000585535.1 |
PTBP1 |
polypyrimidine tract binding protein 1 |
chr9_-_131709858 | 0.60 |
ENST00000372586.3 |
DOLK |
dolichol kinase |
chr1_-_153950164 | 0.60 |
ENST00000271843.4 |
JTB |
jumping translocation breakpoint |
chr17_-_4607335 | 0.59 |
ENST00000570571.1 ENST00000575101.1 ENST00000436683.2 ENST00000574876.1 |
PELP1 |
proline, glutamate and leucine rich protein 1 |
chr3_-_183966717 | 0.59 |
ENST00000446569.1 ENST00000418734.2 ENST00000397676.3 |
ALG3 |
ALG3, alpha-1,3- mannosyltransferase |
chr15_-_75199213 | 0.58 |
ENST00000562698.1 |
FAM219B |
family with sequence similarity 219, member B |
chr18_-_47813940 | 0.58 |
ENST00000586837.1 ENST00000412036.2 ENST00000589940.1 |
CXXC1 |
CXXC finger protein 1 |
chr17_+_43238438 | 0.58 |
ENST00000593138.1 ENST00000586681.1 |
HEXIM2 |
hexamethylene bis-acetamide inducible 2 |
chr19_-_19774473 | 0.57 |
ENST00000357324.6 |
ATP13A1 |
ATPase type 13A1 |
chr19_-_3985455 | 0.57 |
ENST00000309311.6 |
EEF2 |
eukaryotic translation elongation factor 2 |
chr18_-_47814032 | 0.57 |
ENST00000589548.1 ENST00000591474.1 |
CXXC1 |
CXXC finger protein 1 |
chr6_-_43484718 | 0.57 |
ENST00000372422.2 |
YIPF3 |
Yip1 domain family, member 3 |
chr16_-_30569801 | 0.56 |
ENST00000395091.2 |
ZNF764 |
zinc finger protein 764 |
chr12_+_6933660 | 0.56 |
ENST00000545321.1 |
GPR162 |
G protein-coupled receptor 162 |
chr16_-_1821496 | 0.55 |
ENST00000564628.1 ENST00000563498.1 |
NME3 |
NME/NM23 nucleoside diphosphate kinase 3 |
chr17_-_37844267 | 0.55 |
ENST00000579146.1 ENST00000378011.4 ENST00000429199.2 ENST00000300658.4 |
PGAP3 |
post-GPI attachment to proteins 3 |
chr11_-_47788985 | 0.55 |
ENST00000540172.2 |
FNBP4 |
formin binding protein 4 |
chr8_-_21988558 | 0.54 |
ENST00000312841.8 |
HR |
hair growth associated |
chrX_+_153657009 | 0.54 |
ENST00000449556.1 |
ATP6AP1 |
ATPase, H+ transporting, lysosomal accessory protein 1 |
chr19_-_44031341 | 0.54 |
ENST00000600651.1 |
ETHE1 |
ethylmalonic encephalopathy 1 |
chr11_-_47270341 | 0.54 |
ENST00000529444.1 ENST00000530453.1 ENST00000537863.1 ENST00000529788.1 ENST00000444355.2 ENST00000527256.1 ENST00000529663.1 ENST00000256997.3 |
ACP2 |
acid phosphatase 2, lysosomal |
chr7_-_5463175 | 0.54 |
ENST00000399537.4 ENST00000430969.1 |
TNRC18 |
trinucleotide repeat containing 18 |
chr1_+_153963227 | 0.54 |
ENST00000368567.4 ENST00000392558.4 |
RPS27 |
ribosomal protein S27 |
chr19_+_56111680 | 0.54 |
ENST00000301073.3 |
ZNF524 |
zinc finger protein 524 |
chr16_-_87903079 | 0.53 |
ENST00000261622.4 |
SLC7A5 |
solute carrier family 7 (amino acid transporter light chain, L system), member 5 |
chr16_+_2034183 | 0.53 |
ENST00000569451.1 ENST00000248114.6 ENST00000561710.1 |
GFER |
growth factor, augmenter of liver regeneration |
chr9_-_100000957 | 0.53 |
ENST00000366109.2 ENST00000607322.1 |
RP11-498P14.5 |
RP11-498P14.5 |
chr6_-_27860956 | 0.53 |
ENST00000359611.2 |
HIST1H2AM |
histone cluster 1, H2am |
chr17_+_4843413 | 0.52 |
ENST00000572430.1 ENST00000262482.6 |
RNF167 |
ring finger protein 167 |
chr19_+_17830051 | 0.52 |
ENST00000594625.1 ENST00000324096.4 ENST00000600186.1 ENST00000597735.1 |
MAP1S |
microtubule-associated protein 1S |
chr19_-_39340563 | 0.52 |
ENST00000601813.1 |
HNRNPL |
heterogeneous nuclear ribonucleoprotein L |
chr1_+_161129240 | 0.51 |
ENST00000492950.1 |
USP21 |
ubiquitin specific peptidase 21 |
chr19_-_19030157 | 0.51 |
ENST00000349893.4 ENST00000351079.4 ENST00000600932.1 ENST00000262812.4 |
COPE |
coatomer protein complex, subunit epsilon |
chr19_-_4670345 | 0.51 |
ENST00000599630.1 ENST00000262947.3 |
C19orf10 |
chromosome 19 open reading frame 10 |
chr17_+_4843654 | 0.51 |
ENST00000575111.1 |
RNF167 |
ring finger protein 167 |
chr7_+_100136811 | 0.50 |
ENST00000300176.4 ENST00000262935.4 |
AGFG2 |
ArfGAP with FG repeats 2 |
chr16_-_1020954 | 0.50 |
ENST00000543238.1 ENST00000539379.1 ENST00000399843.2 ENST00000262301.11 |
LMF1 |
lipase maturation factor 1 |
chr1_+_36023035 | 0.50 |
ENST00000373253.3 |
NCDN |
neurochondrin |
chr16_-_30569584 | 0.50 |
ENST00000252797.2 ENST00000568114.1 |
ZNF764 AC002310.13 |
zinc finger protein 764 Uncharacterized protein |
chr7_-_72971934 | 0.50 |
ENST00000411832.1 |
BCL7B |
B-cell CLL/lymphoma 7B |
chr6_+_33168637 | 0.49 |
ENST00000374677.3 |
SLC39A7 |
solute carrier family 39 (zinc transporter), member 7 |
chr8_-_66474884 | 0.49 |
ENST00000520902.1 |
CTD-3025N20.2 |
CTD-3025N20.2 |
chr19_-_44031375 | 0.49 |
ENST00000292147.2 |
ETHE1 |
ethylmalonic encephalopathy 1 |
chr20_+_44563267 | 0.49 |
ENST00000372409.3 |
PCIF1 |
PDX1 C-terminal inhibiting factor 1 |
chr7_-_73097741 | 0.49 |
ENST00000395176.2 |
DNAJC30 |
DnaJ (Hsp40) homolog, subfamily C, member 30 |
chr6_+_33168597 | 0.49 |
ENST00000374675.3 |
SLC39A7 |
solute carrier family 39 (zinc transporter), member 7 |
chr6_-_27858570 | 0.49 |
ENST00000359303.2 |
HIST1H3J |
histone cluster 1, H3j |
chr5_-_139944196 | 0.49 |
ENST00000357560.4 |
APBB3 |
amyloid beta (A4) precursor protein-binding, family B, member 3 |
chr19_-_39322299 | 0.48 |
ENST00000601094.1 ENST00000595567.1 ENST00000602115.1 ENST00000601778.1 ENST00000597205.1 ENST00000595470.1 |
ECH1 |
enoyl CoA hydratase 1, peroxisomal |
chr6_+_27775899 | 0.48 |
ENST00000358739.3 |
HIST1H2AI |
histone cluster 1, H2ai |
chr12_+_7079944 | 0.48 |
ENST00000261406.6 |
EMG1 |
EMG1 N1-specific pseudouridine methyltransferase |
chr19_+_6372444 | 0.47 |
ENST00000245812.3 |
ALKBH7 |
alkB, alkylation repair homolog 7 (E. coli) |
chr17_-_42092313 | 0.47 |
ENST00000587529.1 ENST00000206380.3 ENST00000542039.1 |
TMEM101 |
transmembrane protein 101 |
chr17_+_28443819 | 0.47 |
ENST00000479218.2 |
NSRP1 |
nuclear speckle splicing regulatory protein 1 |
chr9_+_135037334 | 0.47 |
ENST00000393229.3 ENST00000360670.3 ENST00000393228.4 ENST00000372179.3 |
NTNG2 |
netrin G2 |
chr19_+_984313 | 0.47 |
ENST00000251289.5 ENST00000587001.2 ENST00000607440.1 |
WDR18 |
WD repeat domain 18 |
chr20_-_62203808 | 0.47 |
ENST00000467148.1 |
HELZ2 |
helicase with zinc finger 2, transcriptional coactivator |
chr17_+_4843679 | 0.46 |
ENST00000576229.1 |
RNF167 |
ring finger protein 167 |
chr3_+_160117062 | 0.46 |
ENST00000497311.1 |
SMC4 |
structural maintenance of chromosomes 4 |
chr11_-_62477313 | 0.46 |
ENST00000464544.1 ENST00000530009.1 |
BSCL2 |
Berardinelli-Seip congenital lipodystrophy 2 (seipin) |
chr11_-_9482010 | 0.46 |
ENST00000596206.1 |
AC132192.1 |
LOC644656 protein; Uncharacterized protein |
chr20_-_34542548 | 0.46 |
ENST00000305978.2 |
SCAND1 |
SCAN domain containing 1 |
chr17_-_4843206 | 0.46 |
ENST00000576951.1 |
SLC25A11 |
solute carrier family 25 (mitochondrial carrier; oxoglutarate carrier), member 11 |
chr8_-_103876340 | 0.46 |
ENST00000518353.1 |
AZIN1 |
antizyme inhibitor 1 |
chr16_+_88772866 | 0.46 |
ENST00000453996.2 ENST00000312060.5 ENST00000378384.3 ENST00000567949.1 ENST00000564921.1 |
CTU2 |
cytosolic thiouridylase subunit 2 homolog (S. pombe) |
chr14_+_23235886 | 0.46 |
ENST00000604262.1 ENST00000431881.2 ENST00000412791.1 ENST00000358043.5 |
OXA1L |
oxidase (cytochrome c) assembly 1-like |
chr1_+_155179012 | 0.45 |
ENST00000609421.1 |
MTX1 |
metaxin 1 |
chr8_+_144679984 | 0.45 |
ENST00000504548.2 ENST00000321385.3 |
TIGD5 |
tigger transposable element derived 5 |
chr17_+_685513 | 0.45 |
ENST00000304478.4 |
RNMTL1 |
RNA methyltransferase like 1 |
chr12_+_56862301 | 0.45 |
ENST00000338146.5 |
SPRYD4 |
SPRY domain containing 4 |
chr17_+_4843303 | 0.45 |
ENST00000571816.1 |
RNF167 |
ring finger protein 167 |
chr16_+_67261008 | 0.44 |
ENST00000304800.9 ENST00000563953.1 ENST00000565201.1 |
TMEM208 |
transmembrane protein 208 |
chr2_-_85625857 | 0.44 |
ENST00000453973.1 |
CAPG |
capping protein (actin filament), gelsolin-like |
chr19_+_48949030 | 0.44 |
ENST00000253237.5 |
GRWD1 |
glutamate-rich WD repeat containing 1 |
chr6_-_27806117 | 0.44 |
ENST00000330180.2 |
HIST1H2AK |
histone cluster 1, H2ak |
chr17_-_3571934 | 0.43 |
ENST00000225525.3 |
TAX1BP3 |
Tax1 (human T-cell leukemia virus type I) binding protein 3 |
chr16_-_67190152 | 0.43 |
ENST00000486556.1 |
TRADD |
TNFRSF1A-associated via death domain |
chr17_+_42634844 | 0.43 |
ENST00000315323.3 |
FZD2 |
frizzled family receptor 2 |
chr17_+_4843594 | 0.43 |
ENST00000570328.1 |
RNF167 |
ring finger protein 167 |
chr19_+_1383890 | 0.43 |
ENST00000539480.1 ENST00000313408.7 ENST00000414651.2 |
NDUFS7 |
NADH dehydrogenase (ubiquinone) Fe-S protein 7, 20kDa (NADH-coenzyme Q reductase) |
chr15_-_41836441 | 0.43 |
ENST00000567866.1 ENST00000561603.1 ENST00000304330.4 ENST00000566863.1 |
RPAP1 |
RNA polymerase II associated protein 1 |
chr17_+_7487146 | 0.43 |
ENST00000396501.4 ENST00000584378.1 ENST00000423172.2 ENST00000579445.1 ENST00000585217.1 ENST00000581380.1 |
MPDU1 |
mannose-P-dolichol utilization defect 1 |
chr10_-_79397547 | 0.43 |
ENST00000481070.1 |
KCNMA1 |
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
chr11_+_64950801 | 0.43 |
ENST00000526468.1 |
CAPN1 |
calpain 1, (mu/I) large subunit |
chr7_+_139025875 | 0.43 |
ENST00000297534.6 |
C7orf55 |
chromosome 7 open reading frame 55 |
chr1_-_54518865 | 0.43 |
ENST00000371337.3 |
TMEM59 |
transmembrane protein 59 |
chr17_-_4843316 | 0.43 |
ENST00000544061.2 |
SLC25A11 |
solute carrier family 25 (mitochondrial carrier; oxoglutarate carrier), member 11 |
chr9_+_140100113 | 0.42 |
ENST00000371521.4 ENST00000344894.5 ENST00000427047.2 ENST00000458322.2 |
NDOR1 |
NADPH dependent diflavin oxidoreductase 1 |
chr7_-_72972319 | 0.42 |
ENST00000223368.2 |
BCL7B |
B-cell CLL/lymphoma 7B |
chr1_+_161129254 | 0.42 |
ENST00000368002.3 ENST00000289865.8 ENST00000479344.1 ENST00000368001.1 |
USP21 |
ubiquitin specific peptidase 21 |
chr20_-_32031680 | 0.42 |
ENST00000217381.2 |
SNTA1 |
syntrophin, alpha 1 |
chr14_-_20922960 | 0.42 |
ENST00000553640.1 ENST00000488532.2 |
OSGEP |
O-sialoglycoprotein endopeptidase |
chr19_+_41903709 | 0.41 |
ENST00000542943.1 ENST00000457836.2 |
BCKDHA |
branched chain keto acid dehydrogenase E1, alpha polypeptide |
chr2_+_220306238 | 0.41 |
ENST00000435853.1 |
SPEG |
SPEG complex locus |
chr11_+_63742050 | 0.41 |
ENST00000314133.3 ENST00000535431.1 |
COX8A AP000721.4 |
cytochrome c oxidase subunit VIIIA (ubiquitous) Uncharacterized protein |
chr19_-_10444188 | 0.41 |
ENST00000293677.6 |
RAVER1 |
ribonucleoprotein, PTB-binding 1 |
chr5_-_137090028 | 0.41 |
ENST00000314940.4 |
HNRNPA0 |
heterogeneous nuclear ribonucleoprotein A0 |
chr9_-_130477912 | 0.41 |
ENST00000543175.1 |
PTRH1 |
peptidyl-tRNA hydrolase 1 homolog (S. cerevisiae) |
chr16_-_30773372 | 0.40 |
ENST00000545825.1 ENST00000541260.1 |
C16orf93 |
chromosome 16 open reading frame 93 |
chr11_-_118966167 | 0.40 |
ENST00000530167.1 |
H2AFX |
H2A histone family, member X |
chr6_-_43197189 | 0.40 |
ENST00000509253.1 ENST00000393987.2 ENST00000230431.6 |
DNPH1 |
2'-deoxynucleoside 5'-phosphate N-hydrolase 1 |
chr9_+_131133598 | 0.40 |
ENST00000372853.4 ENST00000452446.1 ENST00000372850.1 ENST00000372847.1 |
URM1 |
ubiquitin related modifier 1 |
chr5_-_139930713 | 0.40 |
ENST00000602657.1 |
SRA1 |
steroid receptor RNA activator 1 |
chr11_+_45907177 | 0.40 |
ENST00000241014.2 |
MAPK8IP1 |
mitogen-activated protein kinase 8 interacting protein 1 |
chr2_+_25015968 | 0.40 |
ENST00000380834.2 ENST00000473706.1 |
CENPO |
centromere protein O |
chr1_+_43232913 | 0.40 |
ENST00000372525.5 ENST00000536543.1 |
C1orf50 |
chromosome 1 open reading frame 50 |
chr11_+_77532233 | 0.39 |
ENST00000525409.1 |
AAMDC |
adipogenesis associated, Mth938 domain containing |
chr17_+_43239191 | 0.39 |
ENST00000589230.1 |
HEXIM2 |
hexamethylene bis-acetamide inducible 2 |
chr3_-_48647470 | 0.39 |
ENST00000203407.5 |
UQCRC1 |
ubiquinol-cytochrome c reductase core protein I |
chr17_+_80014359 | 0.39 |
ENST00000578168.1 |
GPS1 |
G protein pathway suppressor 1 |
chr16_-_70557430 | 0.39 |
ENST00000393612.4 ENST00000564653.1 ENST00000323786.5 |
COG4 |
component of oligomeric golgi complex 4 |
chr1_-_226595648 | 0.38 |
ENST00000366790.3 |
PARP1 |
poly (ADP-ribose) polymerase 1 |
chr1_-_153950098 | 0.38 |
ENST00000356648.1 |
JTB |
jumping translocation breakpoint |
chr4_+_926171 | 0.38 |
ENST00000507319.1 ENST00000264771.4 |
TMEM175 |
transmembrane protein 175 |
chr19_-_45909585 | 0.38 |
ENST00000593226.1 ENST00000418234.2 |
PPP1R13L |
protein phosphatase 1, regulatory subunit 13 like |
chr9_-_130742792 | 0.38 |
ENST00000373095.1 |
FAM102A |
family with sequence similarity 102, member A |
chr19_-_46389359 | 0.38 |
ENST00000302165.3 |
IRF2BP1 |
interferon regulatory factor 2 binding protein 1 |
chr18_-_53257027 | 0.38 |
ENST00000568740.1 ENST00000564403.2 ENST00000537578.1 |
TCF4 |
transcription factor 4 |
chr11_-_10830463 | 0.38 |
ENST00000527419.1 ENST00000530211.1 ENST00000530702.1 ENST00000524932.1 ENST00000532570.1 |
EIF4G2 |
eukaryotic translation initiation factor 4 gamma, 2 |
chr1_-_161015663 | 0.38 |
ENST00000534633.1 |
USF1 |
upstream transcription factor 1 |
chr2_-_190044480 | 0.37 |
ENST00000374866.3 |
COL5A2 |
collagen, type V, alpha 2 |
chrX_+_153656978 | 0.37 |
ENST00000369762.2 ENST00000422890.1 |
ATP6AP1 |
ATPase, H+ transporting, lysosomal accessory protein 1 |
chr17_-_43138357 | 0.37 |
ENST00000342350.5 |
DCAKD |
dephospho-CoA kinase domain containing |
chr16_+_77233294 | 0.37 |
ENST00000378644.4 |
SYCE1L |
synaptonemal complex central element protein 1-like |
chr7_+_138916231 | 0.37 |
ENST00000473989.3 ENST00000288561.8 |
UBN2 |
ubinuclein 2 |
chr12_+_98987369 | 0.37 |
ENST00000401722.3 ENST00000188376.5 ENST00000228318.3 ENST00000551917.1 ENST00000548046.1 ENST00000552981.1 ENST00000551265.1 ENST00000550695.1 ENST00000547534.1 ENST00000549338.1 ENST00000548847.1 |
SLC25A3 |
solute carrier family 25 (mitochondrial carrier; phosphate carrier), member 3 |
chr11_+_842928 | 0.37 |
ENST00000397408.1 |
TSPAN4 |
tetraspanin 4 |
chr19_+_50270219 | 0.37 |
ENST00000354293.5 ENST00000359032.5 |
AP2A1 |
adaptor-related protein complex 2, alpha 1 subunit |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 4.1 | GO:0019046 | release from viral latency(GO:0019046) |
0.6 | 2.4 | GO:0090301 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.2 | 2.2 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.2 | 0.9 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
0.2 | 0.8 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
0.2 | 0.4 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.2 | 1.0 | GO:0070221 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
0.2 | 1.0 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.2 | 1.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.2 | 0.8 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.1 | 0.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.6 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
0.1 | 0.4 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
0.1 | 0.8 | GO:0015878 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
0.1 | 0.4 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.4 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.1 | 0.4 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) |
0.1 | 4.0 | GO:0034389 | lipid particle organization(GO:0034389) |
0.1 | 0.7 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 0.2 | GO:0009896 | positive regulation of catabolic process(GO:0009896) |
0.1 | 0.4 | GO:1902269 | positive regulation of polyamine transmembrane transport(GO:1902269) |
0.1 | 0.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 1.0 | GO:0046465 | dolichyl diphosphate biosynthetic process(GO:0006489) dolichyl diphosphate metabolic process(GO:0046465) |
0.1 | 0.3 | GO:0072720 | response to dithiothreitol(GO:0072720) |
0.1 | 0.9 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 1.7 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.1 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.3 | GO:0080120 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
0.1 | 0.3 | GO:0007493 | endodermal cell fate determination(GO:0007493) |
0.1 | 0.3 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
0.1 | 0.4 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
0.1 | 0.5 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
0.1 | 0.5 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.4 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.1 | 0.5 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 0.7 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.1 | 0.4 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.1 | 0.6 | GO:0051697 | protein delipidation(GO:0051697) |
0.1 | 0.3 | GO:0002432 | granuloma formation(GO:0002432) |
0.1 | 0.3 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
0.1 | 0.3 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
0.1 | 0.3 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
0.1 | 0.2 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.1 | 0.3 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
0.1 | 0.3 | GO:2001178 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
0.1 | 0.2 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.1 | 0.2 | GO:0010621 | negative regulation of transcription by transcription factor localization(GO:0010621) |
0.1 | 0.2 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
0.1 | 0.4 | GO:0036446 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) negative regulation of ATP biosynthetic process(GO:2001170) |
0.1 | 0.5 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.1 | 0.3 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.1 | 0.2 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.1 | 0.2 | GO:1905204 | regulation of connective tissue replacement involved in inflammatory response wound healing(GO:1904596) negative regulation of connective tissue replacement involved in inflammatory response wound healing(GO:1904597) regulation of advanced glycation end-product receptor activity(GO:1904603) negative regulation of advanced glycation end-product receptor activity(GO:1904604) negative regulation of connective tissue replacement(GO:1905204) |
0.1 | 0.3 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.1 | 0.2 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.1 | 0.2 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
0.1 | 0.2 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.1 | 0.2 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
0.1 | 0.4 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.5 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.7 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
0.1 | 0.9 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
0.1 | 0.3 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
0.1 | 0.3 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.1 | 0.1 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
0.1 | 0.7 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.1 | 0.2 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
0.1 | 0.3 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.1 | 0.4 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.1 | 0.2 | GO:1900736 | regulation of proteinase activated receptor activity(GO:1900276) regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
0.1 | 0.2 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.1 | 0.2 | GO:0046041 | ITP metabolic process(GO:0046041) |
0.1 | 1.6 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
0.1 | 0.6 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.3 | GO:0046203 | spermidine catabolic process(GO:0046203) |
0.1 | 0.2 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.1 | 1.1 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.1 | 0.2 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.1 | 0.2 | GO:1904397 | negative regulation of neuromuscular junction development(GO:1904397) |
0.1 | 0.6 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.1 | 0.5 | GO:0046016 | positive regulation of transcription by glucose(GO:0046016) |
0.1 | 0.2 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.1 | 0.4 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.8 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.1 | 0.7 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.1 | 0.2 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
0.1 | 0.2 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
0.1 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.1 | 0.7 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.1 | 0.1 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
0.1 | 0.2 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.1 | 0.2 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
0.1 | 0.7 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.1 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.6 | GO:0009304 | tRNA transcription(GO:0009304) |
0.1 | 0.2 | GO:0001172 | transcription, RNA-templated(GO:0001172) |
0.1 | 0.1 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.4 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.4 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.1 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
0.0 | 0.8 | GO:0090520 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.6 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.0 | 0.2 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.0 | 1.2 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.1 | GO:0072738 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) |
0.0 | 0.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.0 | 0.3 | GO:0003057 | regulation of the force of heart contraction by chemical signal(GO:0003057) |
0.0 | 0.1 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
0.0 | 0.3 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.0 | 0.2 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
0.0 | 0.5 | GO:0034465 | response to carbon monoxide(GO:0034465) |
0.0 | 0.3 | GO:0042335 | cuticle development(GO:0042335) |
0.0 | 0.5 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
0.0 | 0.1 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.2 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
0.0 | 0.2 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
0.0 | 0.3 | GO:0007631 | feeding behavior(GO:0007631) |
0.0 | 0.2 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) |
0.0 | 0.1 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.0 | 0.6 | GO:0046051 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
0.0 | 0.1 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
0.0 | 0.5 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.0 | 0.2 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
0.0 | 0.2 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.0 | 0.1 | GO:0034721 | histone H3-K4 demethylation, trimethyl-H3-K4-specific(GO:0034721) |
0.0 | 0.2 | GO:1903615 | regulation of protein tyrosine phosphatase activity(GO:1903613) positive regulation of protein tyrosine phosphatase activity(GO:1903615) |
0.0 | 0.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 0.8 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.2 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
0.0 | 0.1 | GO:0002879 | positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
0.0 | 0.1 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
0.0 | 0.1 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
0.0 | 1.0 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.4 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.4 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.9 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.3 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.2 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.0 | 0.2 | GO:0018022 | peptidyl-lysine methylation(GO:0018022) |
0.0 | 1.4 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.2 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
0.0 | 1.1 | GO:0031498 | chromatin disassembly(GO:0031498) |
0.0 | 0.1 | GO:0060922 | atrioventricular node development(GO:0003162) cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
0.0 | 0.2 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.1 | GO:0045897 | positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.6 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.1 | GO:1902378 | vestibulocochlear nerve structural organization(GO:0021649) positive regulation of cytokine activity(GO:0060301) ganglion morphogenesis(GO:0061552) VEGF-activated neuropilin signaling pathway involved in axon guidance(GO:1902378) dorsal root ganglion morphogenesis(GO:1904835) otic placode development(GO:1905040) dorsal root ganglion development(GO:1990791) |
0.0 | 0.1 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
0.0 | 0.2 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.1 | GO:0033077 | T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
0.0 | 0.1 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
0.0 | 0.1 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.0 | 0.1 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.0 | 0.7 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0036371 | protein localization to T-tubule(GO:0036371) |
0.0 | 0.4 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
0.0 | 0.4 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.2 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.0 | 0.2 | GO:0060356 | leucine import(GO:0060356) |
0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.4 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.2 | GO:0070236 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.2 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
0.0 | 0.5 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.3 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.2 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.0 | 0.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.2 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.0 | 0.2 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
0.0 | 0.1 | GO:0002586 | regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
0.0 | 0.1 | GO:0001826 | inner cell mass cell differentiation(GO:0001826) |
0.0 | 0.6 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 2.6 | GO:0006521 | regulation of cellular amino acid metabolic process(GO:0006521) |
0.0 | 0.1 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
0.0 | 0.3 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.2 | GO:1900623 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.0 | 0.2 | GO:0002084 | protein depalmitoylation(GO:0002084) |
0.0 | 0.1 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
0.0 | 0.0 | GO:1904640 | response to methionine(GO:1904640) |
0.0 | 0.1 | GO:0012502 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
0.0 | 0.1 | GO:0048205 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
0.0 | 0.1 | GO:2000657 | regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
0.0 | 0.2 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
0.0 | 0.5 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.0 | 0.5 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.7 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.0 | 0.9 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
0.0 | 0.0 | GO:0034971 | histone H3-R17 methylation(GO:0034971) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.4 | GO:0048243 | norepinephrine secretion(GO:0048243) |
0.0 | 0.3 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
0.0 | 0.1 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
0.0 | 0.1 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.1 | GO:0098582 | innate vocalization behavior(GO:0098582) |
0.0 | 0.0 | GO:0048241 | epinephrine transport(GO:0048241) |
0.0 | 0.1 | GO:1904715 | negative regulation of chaperone-mediated autophagy(GO:1904715) |
0.0 | 0.8 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.0 | 0.1 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
0.0 | 0.2 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.0 | 0.4 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
0.0 | 0.2 | GO:0035897 | proteolysis in other organism(GO:0035897) |
0.0 | 0.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.0 | 0.2 | GO:0060068 | vagina development(GO:0060068) |
0.0 | 0.1 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
0.0 | 0.9 | GO:0015991 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) |
0.0 | 1.9 | GO:0006342 | chromatin silencing(GO:0006342) |
0.0 | 0.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.3 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.0 | 0.1 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.1 | GO:0046967 | cytosol to ER transport(GO:0046967) |
0.0 | 0.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.2 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.1 | GO:0033037 | polysaccharide localization(GO:0033037) |
0.0 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.0 | 0.1 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
0.0 | 0.2 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) strand invasion(GO:0042148) |
0.0 | 0.4 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
0.0 | 0.2 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.1 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.3 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.2 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.9 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.0 | 0.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.1 | GO:0019050 | suppression by virus of host apoptotic process(GO:0019050) modulation by virus of host apoptotic process(GO:0039526) cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.1 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.5 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.7 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) |
0.0 | 0.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.0 | 0.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.0 | 0.2 | GO:0032099 | negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
0.0 | 0.1 | GO:0051085 | 'de novo' posttranslational protein folding(GO:0051084) chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.0 | 0.0 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.0 | 0.1 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
0.0 | 0.1 | GO:0003263 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) |
0.0 | 0.1 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
0.0 | 0.2 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) |
0.0 | 0.3 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.4 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.3 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.1 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
0.0 | 0.0 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
0.0 | 0.2 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
0.0 | 0.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.2 | GO:0046958 | nonassociative learning(GO:0046958) |
0.0 | 0.2 | GO:0046323 | glucose import(GO:0046323) |
0.0 | 0.4 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.0 | 0.1 | GO:0060278 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.0 | 0.2 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.0 | 0.0 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.1 | GO:0001878 | response to yeast(GO:0001878) |
0.0 | 0.1 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.0 | 0.1 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.0 | 0.0 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
0.0 | 0.0 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 1.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.3 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
0.0 | 0.3 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.0 | 0.9 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 0.2 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
0.0 | 0.1 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.0 | 0.3 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.1 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
0.0 | 0.0 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.0 | 0.0 | GO:1903936 | response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
0.0 | 0.5 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.0 | 0.0 | GO:0060395 | SMAD protein signal transduction(GO:0060395) |
0.0 | 0.1 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
0.0 | 0.6 | GO:0030262 | apoptotic nuclear changes(GO:0030262) |
0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.5 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 0.2 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.1 | GO:0044211 | CTP salvage(GO:0044211) |
0.0 | 0.1 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.0 | 0.4 | GO:0007130 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
0.0 | 0.1 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.0 | 0.6 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.0 | 0.1 | GO:0014047 | glutamate secretion(GO:0014047) |
0.0 | 0.2 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.0 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
0.0 | 0.3 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
0.0 | 0.3 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.0 | 0.2 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.1 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.0 | 0.1 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.0 | 0.1 | GO:1904116 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
0.0 | 0.0 | GO:1904237 | regulation of substrate-dependent cell migration, cell attachment to substrate(GO:1904235) positive regulation of substrate-dependent cell migration, cell attachment to substrate(GO:1904237) |
0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.1 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
0.0 | 0.3 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.0 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.1 | GO:0051344 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.0 | 0.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
0.0 | 0.1 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.1 | GO:0001825 | blastocyst formation(GO:0001825) |
0.0 | 0.4 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.1 | GO:0009895 | negative regulation of catabolic process(GO:0009895) |
0.0 | 0.3 | GO:0016559 | peroxisome fission(GO:0016559) |
0.0 | 0.1 | GO:0010286 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
0.0 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.0 | 0.2 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
0.0 | 0.0 | GO:0033700 | phospholipid efflux(GO:0033700) |
0.0 | 0.0 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
0.0 | 0.0 | GO:0046677 | response to antibiotic(GO:0046677) |
0.0 | 0.1 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.0 | GO:0070433 | negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
0.0 | 0.0 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.3 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.0 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.2 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.0 | 0.5 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.1 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.0 | 0.0 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
0.0 | 0.1 | GO:0035898 | parathyroid hormone secretion(GO:0035898) post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
0.0 | 0.5 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
0.0 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.0 | 0.1 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.0 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.0 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
0.0 | 0.5 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.1 | GO:0048867 | ganglion mother cell fate determination(GO:0007402) stem cell fate determination(GO:0048867) |
0.0 | 0.1 | GO:0033197 | response to vitamin E(GO:0033197) |
0.0 | 0.0 | GO:0051659 | maintenance of mitochondrion location(GO:0051659) |
0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.0 | 0.3 | GO:0016246 | RNA interference(GO:0016246) |
0.0 | 0.2 | GO:0006554 | lysine catabolic process(GO:0006554) |
0.0 | 0.6 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
0.0 | 0.0 | GO:1990164 | histone H2A phosphorylation(GO:1990164) |
0.0 | 0.1 | GO:0008050 | courtship behavior(GO:0007619) female courtship behavior(GO:0008050) |
0.0 | 0.1 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.3 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.0 | GO:1903094 | negative regulation of protein deubiquitination(GO:0090086) regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 5.9 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.2 | 1.6 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.2 | 3.0 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
0.2 | 0.9 | GO:1903349 | omegasome membrane(GO:1903349) |
0.2 | 0.5 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.4 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.1 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.8 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 1.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.7 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.4 | GO:0043260 | laminin-11 complex(GO:0043260) |
0.1 | 0.1 | GO:0030662 | coated vesicle membrane(GO:0030662) clathrin-coated vesicle membrane(GO:0030665) |
0.1 | 0.7 | GO:0005638 | lamin filament(GO:0005638) |
0.1 | 0.4 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
0.1 | 4.1 | GO:0000786 | nucleosome(GO:0000786) |
0.1 | 0.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.2 | GO:0072517 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 0.9 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 1.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 0.2 | GO:1990037 | Lewy body core(GO:1990037) |
0.1 | 0.4 | GO:0016013 | syntrophin complex(GO:0016013) |
0.0 | 4.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.7 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.6 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.3 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.2 | GO:0070931 | Golgi-associated vesicle lumen(GO:0070931) |
0.0 | 0.4 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.2 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.0 | 0.0 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
0.0 | 0.4 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.4 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.7 | GO:0005687 | U4 snRNP(GO:0005687) |
0.0 | 0.1 | GO:0045273 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
0.0 | 0.2 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.1 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.2 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.0 | 0.5 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.8 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.2 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.2 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
0.0 | 0.1 | GO:0090576 | transcription factor TFIIIB complex(GO:0000126) RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.1 | GO:0035101 | FACT complex(GO:0035101) |
0.0 | 0.3 | GO:0045261 | proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.6 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.3 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.6 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 1.9 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 4.7 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.2 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 0.7 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.5 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.6 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.3 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.4 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.0 | 0.2 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 1.2 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 1.5 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.0 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.4 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.2 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.1 | GO:0000806 | Y chromosome(GO:0000806) |
0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.3 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.9 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.1 | GO:0036398 | TCR signalosome(GO:0036398) |
0.0 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.1 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.8 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.3 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.0 | 1.2 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.4 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 0.1 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.1 | GO:0032044 | DSIF complex(GO:0032044) |
0.0 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.3 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.2 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.1 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.0 | 0.4 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
0.0 | 0.0 | GO:0019034 | viral replication complex(GO:0019034) |
0.0 | 0.0 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.1 | GO:0031905 | early endosome lumen(GO:0031905) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.0 | GO:0044301 | climbing fiber(GO:0044301) |
0.0 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.1 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
0.0 | 0.1 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
0.0 | 0.0 | GO:0044609 | DBIRD complex(GO:0044609) |
0.0 | 0.9 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.0 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.1 | GO:0035976 | AP1 complex(GO:0035976) |
0.0 | 0.2 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.3 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.3 | 1.0 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.3 | 1.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.3 | 4.4 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.3 | 2.4 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
0.2 | 0.7 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
0.2 | 0.2 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.2 | 0.9 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
0.1 | 0.6 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.1 | 0.4 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.1 | 0.4 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.8 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 1.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 0.6 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.1 | 0.3 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
0.1 | 0.3 | GO:0034038 | deoxyhypusine synthase activity(GO:0034038) |
0.1 | 0.3 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
0.1 | 2.8 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.1 | 0.8 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
0.1 | 0.5 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.1 | 0.2 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.1 | 0.3 | GO:0004853 | uroporphyrinogen decarboxylase activity(GO:0004853) |
0.1 | 0.4 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 0.6 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
0.1 | 0.3 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.1 | 0.3 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
0.1 | 1.6 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.6 | GO:0008481 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
0.1 | 0.2 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
0.1 | 0.2 | GO:1904599 | advanced glycation end-product binding(GO:1904599) |
0.1 | 0.4 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
0.1 | 0.3 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
0.1 | 0.1 | GO:0004818 | glutamate-tRNA ligase activity(GO:0004818) |
0.1 | 2.0 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.3 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.1 | 0.2 | GO:0070984 | SET domain binding(GO:0070984) |
0.1 | 1.5 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 1.0 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.3 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
0.1 | 1.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 0.5 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
0.1 | 0.8 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.7 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 0.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.2 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.1 | 0.6 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.5 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.1 | 0.2 | GO:0052839 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.1 | 0.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.2 | GO:0045155 | electron transporter, transferring electrons from CoQH2-cytochrome c reductase complex and cytochrome c oxidase complex activity(GO:0045155) |
0.1 | 0.2 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.2 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.1 | 1.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.1 | 0.3 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
0.1 | 0.4 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.2 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
0.1 | 0.2 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
0.1 | 0.4 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.3 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
0.0 | 0.2 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.0 | 0.3 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.5 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.0 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.2 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.0 | 0.1 | GO:0004807 | triose-phosphate isomerase activity(GO:0004807) |
0.0 | 0.2 | GO:0046873 | metal ion transmembrane transporter activity(GO:0046873) |
0.0 | 0.2 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.0 | GO:0016885 | CoA carboxylase activity(GO:0016421) ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.0 | 0.5 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.3 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.0 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.0 | 0.1 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
0.0 | 0.1 | GO:0004960 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
0.0 | 0.4 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.2 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.2 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
0.0 | 0.2 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.0 | 0.2 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
0.0 | 0.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.1 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
0.0 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.2 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.0 | 0.5 | GO:0015266 | protein channel activity(GO:0015266) |
0.0 | 0.7 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.1 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.0 | 0.3 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.0 | 0.2 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
0.0 | 0.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.0 | 0.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.6 | GO:0001087 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
0.0 | 0.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.4 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 1.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:0004766 | spermidine synthase activity(GO:0004766) |
0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.0 | 0.2 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) aspartic-type endopeptidase inhibitor activity(GO:0019828) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.6 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.0 | 0.2 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.0 | 0.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.0 | 0.5 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.1 | GO:0004756 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
0.0 | 0.1 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
0.0 | 1.0 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.2 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.8 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.0 | 0.7 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.4 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) |
0.0 | 0.1 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
0.0 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.1 | GO:0010736 | serum response element binding(GO:0010736) |
0.0 | 0.2 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 0.2 | GO:0032810 | sterol response element binding(GO:0032810) |
0.0 | 0.6 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.3 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.1 | GO:0032090 | Pyrin domain binding(GO:0032090) |
0.0 | 0.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.8 | GO:0016675 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.3 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.0 | 0.1 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
0.0 | 0.1 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
0.0 | 0.1 | GO:0016855 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.4 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.1 | GO:0015234 | thiamine transmembrane transporter activity(GO:0015234) azole transmembrane transporter activity(GO:1901474) |
0.0 | 0.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.0 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
0.0 | 0.3 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.2 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.1 | GO:0008841 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
0.0 | 0.4 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.7 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.6 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.9 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.0 | 0.1 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
0.0 | 0.4 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.7 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.2 | GO:0019826 | oxygen sensor activity(GO:0019826) |
0.0 | 0.2 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
0.0 | 0.1 | GO:0034431 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
0.0 | 0.5 | GO:0015929 | hexosaminidase activity(GO:0015929) |
0.0 | 0.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.0 | 0.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.0 | 0.6 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.0 | 0.4 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.8 | GO:0003682 | chromatin binding(GO:0003682) |
0.0 | 0.5 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.1 | GO:0004974 | leukotriene B4 receptor activity(GO:0001632) leukotriene receptor activity(GO:0004974) |
0.0 | 0.2 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.3 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.4 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.0 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
0.0 | 0.1 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.0 | 0.3 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.0 | 0.3 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.0 | 1.3 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.0 | 1.3 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.1 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 0.4 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.1 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
0.0 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.3 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.1 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 0.3 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0015333 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
0.0 | 0.3 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
0.0 | 0.1 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.8 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.2 | GO:0016620 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, NAD or NADP as acceptor(GO:0016620) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.0 | 0.4 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.0 | 0.0 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.1 | GO:0004883 | glucocorticoid receptor activity(GO:0004883) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
0.0 | 0.4 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
0.0 | 0.3 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.0 | 0.1 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.3 | GO:0004559 | alpha-mannosidase activity(GO:0004559) mannosidase activity(GO:0015923) |
0.0 | 0.0 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.0 | GO:0097643 | amylin receptor activity(GO:0097643) |
0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.0 | 0.1 | GO:0042835 | BRE binding(GO:0042835) |
0.0 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.0 | 0.1 | GO:0050659 | chondroitin 4-sulfotransferase activity(GO:0047756) N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
0.0 | 0.1 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
0.0 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.1 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
0.0 | 0.1 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.1 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.0 | 0.0 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.0 | 0.2 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.3 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.5 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.0 | 0.3 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.0 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.0 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.7 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 3.3 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 1.0 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.6 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 2.0 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 1.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 2.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.0 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.7 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.1 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.7 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 3.8 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 10.6 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 0.6 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 0.7 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 1.5 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 1.2 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 1.0 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 3.0 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 1.1 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.1 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.0 | 0.6 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 1.1 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.5 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.8 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 2.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 1.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 1.4 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 1.5 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.4 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.3 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 1.5 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.0 | 0.5 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 1.3 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.5 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.5 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 0.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.9 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.3 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.1 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.4 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |