A549 cells infected with IAV Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
ZNF711
|
ENSG00000147180.12 | zinc finger protein 711 |
|
TFAP2A
|
ENSG00000137203.6 | transcription factor AP-2 alpha |
|
TFAP2D
|
ENSG00000008197.4 | transcription factor AP-2 delta |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TFAP2A | hg19_v2_chr6_-_10413112_10413132 | 0.95 | 5.2e-02 | Click! |
| ZNF711 | hg19_v2_chrX_+_84499081_84499115 | -0.41 | 5.9e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr2_+_121493717 | 3.76 |
ENST00000418323.1
|
GLI2
|
GLI family zinc finger 2 |
| chr11_-_568369 | 3.42 |
ENST00000534540.1
ENST00000528245.1 ENST00000500447.1 ENST00000533920.1 |
MIR210HG
|
MIR210 host gene (non-protein coding) |
| chr14_-_50999190 | 2.53 |
ENST00000557390.1
|
MAP4K5
|
mitogen-activated protein kinase kinase kinase kinase 5 |
| chr9_-_139981121 | 2.53 |
ENST00000596585.1
|
AL807752.1
|
Uncharacterized protein |
| chr4_+_76649753 | 2.41 |
ENST00000603759.1
|
USO1
|
USO1 vesicle transport factor |
| chr16_-_28223229 | 2.39 |
ENST00000566073.1
|
XPO6
|
exportin 6 |
| chr11_+_43702322 | 2.30 |
ENST00000395700.4
|
HSD17B12
|
hydroxysteroid (17-beta) dehydrogenase 12 |
| chr11_+_71934962 | 2.20 |
ENST00000543234.1
|
INPPL1
|
inositol polyphosphate phosphatase-like 1 |
| chr4_+_6784358 | 2.20 |
ENST00000508423.1
|
KIAA0232
|
KIAA0232 |
| chr5_+_149865377 | 2.11 |
ENST00000522491.1
|
NDST1
|
N-deacetylase/N-sulfotransferase (heparan glucosaminyl) 1 |
| chr11_-_69490135 | 2.04 |
ENST00000542341.1
|
ORAOV1
|
oral cancer overexpressed 1 |
| chr16_+_87425914 | 2.03 |
ENST00000565788.1
|
MAP1LC3B
|
microtubule-associated protein 1 light chain 3 beta |
| chr8_+_142402089 | 2.02 |
ENST00000521578.1
ENST00000520105.1 ENST00000523147.1 |
PTP4A3
|
protein tyrosine phosphatase type IVA, member 3 |
| chr3_-_5229982 | 1.94 |
ENST00000600805.1
|
AC026202.1
|
Uncharacterized protein |
| chr2_+_240323439 | 1.92 |
ENST00000428471.1
ENST00000413029.1 |
AC062017.1
|
Uncharacterized protein |
| chr16_-_54963026 | 1.89 |
ENST00000560208.1
ENST00000557792.1 |
CRNDE
|
colorectal neoplasia differentially expressed (non-protein coding) |
| chr1_+_63788730 | 1.86 |
ENST00000371116.2
|
FOXD3
|
forkhead box D3 |
| chr6_-_85473073 | 1.86 |
ENST00000606621.1
|
TBX18
|
T-box 18 |
| chr22_+_29664241 | 1.76 |
ENST00000436425.1
ENST00000447973.1 |
EWSR1
|
EWS RNA-binding protein 1 |
| chr19_-_33793430 | 1.75 |
ENST00000498907.2
|
CEBPA
|
CCAAT/enhancer binding protein (C/EBP), alpha |
| chr11_-_47788985 | 1.70 |
ENST00000540172.2
|
FNBP4
|
formin binding protein 4 |
| chr15_+_23810903 | 1.69 |
ENST00000564592.1
|
MKRN3
|
makorin ring finger protein 3 |
| chr11_+_45168182 | 1.69 |
ENST00000526442.1
|
PRDM11
|
PR domain containing 11 |
| chr12_+_112451222 | 1.65 |
ENST00000552052.1
|
ERP29
|
endoplasmic reticulum protein 29 |
| chr17_+_80186908 | 1.63 |
ENST00000582743.1
ENST00000578684.1 ENST00000577650.1 ENST00000582715.1 |
SLC16A3
|
solute carrier family 16 (monocarboxylate transporter), member 3 |
| chr19_+_1261106 | 1.61 |
ENST00000588411.1
|
CIRBP
|
cold inducible RNA binding protein |
| chr5_+_56205878 | 1.61 |
ENST00000423328.1
|
SETD9
|
SET domain containing 9 |
| chr19_+_2249308 | 1.60 |
ENST00000592877.1
ENST00000221496.4 |
AMH
|
anti-Mullerian hormone |
| chr12_-_80084333 | 1.59 |
ENST00000552637.1
|
PAWR
|
PRKC, apoptosis, WT1, regulator |
| chr8_-_101322132 | 1.57 |
ENST00000523481.1
|
RNF19A
|
ring finger protein 19A, RBR E3 ubiquitin protein ligase |
| chr12_-_80084594 | 1.55 |
ENST00000548426.1
|
PAWR
|
PRKC, apoptosis, WT1, regulator |
| chr2_-_178129551 | 1.54 |
ENST00000430047.1
|
NFE2L2
|
nuclear factor, erythroid 2-like 2 |
| chr6_-_72129806 | 1.53 |
ENST00000413945.1
ENST00000602878.1 ENST00000436803.1 ENST00000421704.1 ENST00000441570.1 |
LINC00472
|
long intergenic non-protein coding RNA 472 |
| chr14_-_50999373 | 1.51 |
ENST00000554273.1
|
MAP4K5
|
mitogen-activated protein kinase kinase kinase kinase 5 |
| chr19_+_1000418 | 1.50 |
ENST00000234389.3
|
GRIN3B
|
glutamate receptor, ionotropic, N-methyl-D-aspartate 3B |
| chr4_-_1723040 | 1.49 |
ENST00000382936.3
ENST00000536901.1 ENST00000303277.2 |
TMEM129
|
transmembrane protein 129 |
| chr14_-_23791484 | 1.47 |
ENST00000594872.1
|
AL049829.1
|
Uncharacterized protein |
| chr22_-_42310570 | 1.46 |
ENST00000457093.1
|
SHISA8
|
shisa family member 8 |
| chr20_+_4667094 | 1.45 |
ENST00000424424.1
ENST00000457586.1 |
PRNP
|
prion protein |
| chr12_+_77158021 | 1.44 |
ENST00000550876.1
|
ZDHHC17
|
zinc finger, DHHC-type containing 17 |
| chr11_+_64053311 | 1.43 |
ENST00000540370.1
|
GPR137
|
G protein-coupled receptor 137 |
| chr1_-_8939265 | 1.42 |
ENST00000489867.1
|
ENO1
|
enolase 1, (alpha) |
| chr2_+_177502438 | 1.41 |
ENST00000443670.1
|
AC017048.4
|
long intergenic non-protein coding RNA 1117 |
| chr4_-_75024085 | 1.37 |
ENST00000600169.1
|
AC093677.1
|
Uncharacterized protein |
| chr22_+_45705987 | 1.37 |
ENST00000405673.1
|
FAM118A
|
family with sequence similarity 118, member A |
| chr11_+_695787 | 1.36 |
ENST00000526170.1
ENST00000488769.1 |
TMEM80
|
transmembrane protein 80 |
| chr7_+_97910962 | 1.32 |
ENST00000539286.1
|
BRI3
|
brain protein I3 |
| chr16_-_325910 | 1.32 |
ENST00000359740.5
ENST00000316163.5 ENST00000431291.2 ENST00000397770.3 ENST00000397768.3 |
RGS11
|
regulator of G-protein signaling 11 |
| chr3_-_138553779 | 1.31 |
ENST00000461451.1
|
PIK3CB
|
phosphatidylinositol-4,5-bisphosphate 3-kinase, catalytic subunit beta |
| chr19_+_5681153 | 1.30 |
ENST00000579559.1
ENST00000577222.1 |
HSD11B1L
RPL36
|
hydroxysteroid (11-beta) dehydrogenase 1-like ribosomal protein L36 |
| chr19_-_58514129 | 1.29 |
ENST00000552184.1
ENST00000546715.1 ENST00000536132.1 ENST00000547828.1 ENST00000547121.1 ENST00000551380.1 |
ZNF606
|
zinc finger protein 606 |
| chr5_-_132166303 | 1.28 |
ENST00000440118.1
|
SHROOM1
|
shroom family member 1 |
| chr17_-_79791118 | 1.28 |
ENST00000576431.1
ENST00000575061.1 ENST00000455127.2 ENST00000572645.1 ENST00000538396.1 ENST00000573478.1 |
FAM195B
|
family with sequence similarity 195, member B |
| chr19_+_16435625 | 1.28 |
ENST00000248071.5
ENST00000592003.1 |
KLF2
|
Kruppel-like factor 2 |
| chr16_-_89768035 | 1.26 |
ENST00000569918.1
|
SPATA2L
|
spermatogenesis associated 2-like |
| chr9_-_139010696 | 1.24 |
ENST00000418388.1
ENST00000561457.1 |
C9orf69
|
chromosome 9 open reading frame 69 |
| chr2_+_232575168 | 1.24 |
ENST00000440384.1
|
PTMA
|
prothymosin, alpha |
| chr16_+_50280020 | 1.22 |
ENST00000564965.1
|
ADCY7
|
adenylate cyclase 7 |
| chr9_+_140317802 | 1.20 |
ENST00000341349.2
ENST00000392815.2 |
NOXA1
|
NADPH oxidase activator 1 |
| chr17_-_18266818 | 1.20 |
ENST00000583780.1
|
SHMT1
|
serine hydroxymethyltransferase 1 (soluble) |
| chr13_+_111805980 | 1.20 |
ENST00000491775.1
ENST00000466143.1 ENST00000544132.1 |
ARHGEF7
|
Rho guanine nucleotide exchange factor (GEF) 7 |
| chr19_+_34287174 | 1.17 |
ENST00000587559.1
ENST00000588637.1 |
KCTD15
|
potassium channel tetramerization domain containing 15 |
| chr16_-_1020954 | 1.16 |
ENST00000543238.1
ENST00000539379.1 ENST00000399843.2 ENST00000262301.11 |
LMF1
|
lipase maturation factor 1 |
| chr17_-_74380565 | 1.15 |
ENST00000442767.1
ENST00000423915.1 |
PRPSAP1
|
phosphoribosyl pyrophosphate synthetase-associated protein 1 |
| chr19_-_55895966 | 1.15 |
ENST00000444469.3
|
TMEM238
|
transmembrane protein 238 |
| chr2_+_136499287 | 1.15 |
ENST00000415164.1
|
UBXN4
|
UBX domain protein 4 |
| chr5_-_76382989 | 1.15 |
ENST00000511587.1
|
ZBED3
|
zinc finger, BED-type containing 3 |
| chr11_-_61196858 | 1.15 |
ENST00000413184.2
|
CPSF7
|
cleavage and polyadenylation specific factor 7, 59kDa |
| chr19_+_14184370 | 1.14 |
ENST00000590772.1
|
hsa-mir-1199
|
hsa-mir-1199 |
| chr8_+_145734433 | 1.14 |
ENST00000301327.4
|
MFSD3
|
major facilitator superfamily domain containing 3 |
| chr10_+_88728189 | 1.13 |
ENST00000416348.1
|
ADIRF
|
adipogenesis regulatory factor |
| chr17_-_46724186 | 1.12 |
ENST00000433510.2
|
RP11-357H14.17
|
RP11-357H14.17 |
| chr1_-_762885 | 1.12 |
ENST00000536430.1
ENST00000473798.1 |
LINC00115
|
long intergenic non-protein coding RNA 115 |
| chr3_+_49044765 | 1.12 |
ENST00000429900.2
|
WDR6
|
WD repeat domain 6 |
| chr2_-_24346218 | 1.12 |
ENST00000436622.1
ENST00000313213.4 |
PFN4
|
profilin family, member 4 |
| chr9_-_14322319 | 1.12 |
ENST00000606230.1
|
NFIB
|
nuclear factor I/B |
| chr3_-_9834463 | 1.12 |
ENST00000439043.1
|
TADA3
|
transcriptional adaptor 3 |
| chr15_+_100347228 | 1.11 |
ENST00000559714.1
ENST00000560059.1 |
CTD-2054N24.2
|
Uncharacterized protein |
| chr1_+_109642799 | 1.10 |
ENST00000602755.1
|
SCARNA2
|
small Cajal body-specific RNA 2 |
| chr5_+_149340339 | 1.10 |
ENST00000433184.1
|
SLC26A2
|
solute carrier family 26 (anion exchanger), member 2 |
| chr14_-_69263043 | 1.10 |
ENST00000408913.2
|
ZFP36L1
|
ZFP36 ring finger protein-like 1 |
| chr14_+_105559784 | 1.09 |
ENST00000548104.1
|
RP11-44N21.1
|
RP11-44N21.1 |
| chr15_-_52971544 | 1.09 |
ENST00000566768.1
ENST00000561543.1 |
FAM214A
|
family with sequence similarity 214, member A |
| chr11_+_842928 | 1.09 |
ENST00000397408.1
|
TSPAN4
|
tetraspanin 4 |
| chr19_-_46272462 | 1.08 |
ENST00000317578.6
|
SIX5
|
SIX homeobox 5 |
| chr20_+_34679725 | 1.08 |
ENST00000432589.1
|
EPB41L1
|
erythrocyte membrane protein band 4.1-like 1 |
| chr6_-_85473156 | 1.07 |
ENST00000606784.1
ENST00000606325.1 |
TBX18
|
T-box 18 |
| chr8_-_145115584 | 1.05 |
ENST00000426825.1
|
OPLAH
|
5-oxoprolinase (ATP-hydrolysing) |
| chr7_+_7222157 | 1.05 |
ENST00000419721.1
|
C1GALT1
|
core 1 synthase, glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase, 1 |
| chr4_-_87813566 | 1.05 |
ENST00000504008.1
ENST00000506308.1 |
C4orf36
|
chromosome 4 open reading frame 36 |
| chr17_+_43209967 | 1.05 |
ENST00000431281.1
ENST00000591859.1 |
ACBD4
|
acyl-CoA binding domain containing 4 |
| chr14_+_21566980 | 1.05 |
ENST00000418511.2
ENST00000554329.2 |
TMEM253
|
transmembrane protein 253 |
| chr5_-_177659539 | 1.04 |
ENST00000476170.2
|
PHYKPL
|
5-phosphohydroxy-L-lysine phospho-lyase |
| chr11_+_842808 | 1.04 |
ENST00000397397.2
ENST00000397411.2 ENST00000397396.1 |
TSPAN4
|
tetraspanin 4 |
| chr1_-_3528034 | 1.04 |
ENST00000356575.4
|
MEGF6
|
multiple EGF-like-domains 6 |
| chr3_-_53080047 | 1.04 |
ENST00000482396.1
ENST00000358080.2 ENST00000296295.6 ENST00000394752.3 |
SFMBT1
|
Scm-like with four mbt domains 1 |
| chr12_-_42631529 | 1.03 |
ENST00000548917.1
|
YAF2
|
YY1 associated factor 2 |
| chr2_-_39664206 | 1.03 |
ENST00000484274.1
|
MAP4K3
|
mitogen-activated protein kinase kinase kinase kinase 3 |
| chr15_-_102285913 | 1.03 |
ENST00000558592.1
|
RP11-89K11.1
|
Uncharacterized protein |
| chr19_-_44123734 | 1.03 |
ENST00000598676.1
|
ZNF428
|
zinc finger protein 428 |
| chr16_-_4664382 | 1.03 |
ENST00000591113.1
|
UBALD1
|
UBA-like domain containing 1 |
| chr16_-_1020849 | 1.02 |
ENST00000568897.1
|
LMF1
|
lipase maturation factor 1 |
| chr10_-_75532373 | 1.02 |
ENST00000595757.1
|
AC022400.2
|
Uncharacterized protein; cDNA FLJ44715 fis, clone BRACE3021430 |
| chr1_-_146644036 | 1.02 |
ENST00000425272.2
|
PRKAB2
|
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
| chr16_+_67563250 | 1.01 |
ENST00000566907.1
|
FAM65A
|
family with sequence similarity 65, member A |
| chr7_-_55640141 | 1.01 |
ENST00000452832.1
|
VOPP1
|
vesicular, overexpressed in cancer, prosurvival protein 1 |
| chr3_+_49941420 | 1.00 |
ENST00000419183.1
|
CTD-2330K9.3
|
Uncharacterized protein |
| chr10_+_43932553 | 1.00 |
ENST00000456416.1
ENST00000437590.2 ENST00000451167.1 |
ZNF487
|
zinc finger protein 487 |
| chr5_+_76012009 | 1.00 |
ENST00000505600.1
|
F2R
|
coagulation factor II (thrombin) receptor |
| chr4_-_83295296 | 1.00 |
ENST00000507010.1
ENST00000503822.1 |
HNRNPD
|
heterogeneous nuclear ribonucleoprotein D (AU-rich element RNA binding protein 1, 37kDa) |
| chr11_+_64052294 | 1.00 |
ENST00000536667.1
|
GPR137
|
G protein-coupled receptor 137 |
| chr9_+_127539425 | 0.98 |
ENST00000331715.9
|
OLFML2A
|
olfactomedin-like 2A |
| chr11_+_64052454 | 0.98 |
ENST00000539833.1
|
GPR137
|
G protein-coupled receptor 137 |
| chr7_+_150076406 | 0.98 |
ENST00000329630.5
|
ZNF775
|
zinc finger protein 775 |
| chr6_-_163834852 | 0.97 |
ENST00000604200.1
|
CAHM
|
colon adenocarcinoma hypermethylated (non-protein coding) |
| chr2_-_128145498 | 0.97 |
ENST00000409179.2
|
MAP3K2
|
mitogen-activated protein kinase kinase kinase 2 |
| chr5_-_180229791 | 0.97 |
ENST00000504671.1
ENST00000507384.1 |
MGAT1
|
mannosyl (alpha-1,3-)-glycoprotein beta-1,2-N-acetylglucosaminyltransferase |
| chr16_+_87636474 | 0.96 |
ENST00000284262.2
|
JPH3
|
junctophilin 3 |
| chr11_-_65686586 | 0.96 |
ENST00000438576.2
|
C11orf68
|
chromosome 11 open reading frame 68 |
| chr5_+_154135453 | 0.96 |
ENST00000517616.1
ENST00000518892.1 |
LARP1
|
La ribonucleoprotein domain family, member 1 |
| chr3_-_158450475 | 0.96 |
ENST00000237696.5
|
RARRES1
|
retinoic acid receptor responder (tazarotene induced) 1 |
| chr15_-_90294523 | 0.96 |
ENST00000300057.4
|
MESP1
|
mesoderm posterior 1 homolog (mouse) |
| chr5_-_137090028 | 0.96 |
ENST00000314940.4
|
HNRNPA0
|
heterogeneous nuclear ribonucleoprotein A0 |
| chr17_-_4710288 | 0.95 |
ENST00000571067.1
|
RP11-81A22.5
|
RP11-81A22.5 |
| chr16_+_3070356 | 0.95 |
ENST00000341627.5
ENST00000575124.1 ENST00000575836.1 |
TNFRSF12A
|
tumor necrosis factor receptor superfamily, member 12A |
| chr16_+_2034183 | 0.95 |
ENST00000569451.1
ENST00000248114.6 ENST00000561710.1 |
GFER
|
growth factor, augmenter of liver regeneration |
| chr3_+_32280159 | 0.94 |
ENST00000458535.2
ENST00000307526.3 |
CMTM8
|
CKLF-like MARVEL transmembrane domain containing 8 |
| chr22_-_29663690 | 0.94 |
ENST00000406335.1
|
RHBDD3
|
rhomboid domain containing 3 |
| chr15_+_41056218 | 0.94 |
ENST00000260447.4
|
GCHFR
|
GTP cyclohydrolase I feedback regulator |
| chr19_+_1954632 | 0.94 |
ENST00000589350.1
|
CSNK1G2
|
casein kinase 1, gamma 2 |
| chr15_-_75199213 | 0.94 |
ENST00000562698.1
|
FAM219B
|
family with sequence similarity 219, member B |
| chr2_+_74881432 | 0.93 |
ENST00000453930.1
|
SEMA4F
|
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4F |
| chr19_+_4343524 | 0.93 |
ENST00000262966.8
ENST00000359935.4 ENST00000599840.1 |
MPND
|
MPN domain containing |
| chr15_+_23810853 | 0.93 |
ENST00000568252.1
|
MKRN3
|
makorin ring finger protein 3 |
| chr14_-_105714771 | 0.92 |
ENST00000550375.1
|
BRF1
|
BRF1, RNA polymerase III transcription initiation factor 90 kDa subunit |
| chr12_-_108154705 | 0.92 |
ENST00000547188.1
|
PRDM4
|
PR domain containing 4 |
| chr16_+_90086002 | 0.92 |
ENST00000563936.1
ENST00000536122.1 ENST00000561675.1 |
GAS8
|
growth arrest-specific 8 |
| chr11_-_842509 | 0.91 |
ENST00000322028.4
|
POLR2L
|
polymerase (RNA) II (DNA directed) polypeptide L, 7.6kDa |
| chr16_+_2880254 | 0.91 |
ENST00000570670.1
|
ZG16B
|
zymogen granule protein 16B |
| chr15_+_44829334 | 0.91 |
ENST00000535391.1
|
EIF3J
|
eukaryotic translation initiation factor 3, subunit J |
| chr11_-_65686496 | 0.91 |
ENST00000449692.3
|
C11orf68
|
chromosome 11 open reading frame 68 |
| chr1_+_210502238 | 0.91 |
ENST00000545154.1
ENST00000537898.1 ENST00000391905.3 ENST00000545781.1 ENST00000261458.3 ENST00000308852.6 |
HHAT
|
hedgehog acyltransferase |
| chr1_-_204183071 | 0.90 |
ENST00000308302.3
|
GOLT1A
|
golgi transport 1A |
| chr14_-_94595993 | 0.90 |
ENST00000238609.3
|
IFI27L2
|
interferon, alpha-inducible protein 27-like 2 |
| chr9_+_130159471 | 0.90 |
ENST00000419917.1
|
SLC2A8
|
solute carrier family 2 (facilitated glucose transporter), member 8 |
| chr16_-_85833160 | 0.90 |
ENST00000435200.2
|
EMC8
|
ER membrane protein complex subunit 8 |
| chr9_-_138987115 | 0.90 |
ENST00000277554.2
|
NACC2
|
NACC family member 2, BEN and BTB (POZ) domain containing |
| chr12_-_64062583 | 0.90 |
ENST00000542209.1
|
DPY19L2
|
dpy-19-like 2 (C. elegans) |
| chr8_+_144373550 | 0.90 |
ENST00000330143.3
ENST00000521537.1 ENST00000518432.1 ENST00000520333.1 |
ZNF696
|
zinc finger protein 696 |
| chr4_+_141677577 | 0.90 |
ENST00000609937.1
|
RP11-102N12.3
|
RP11-102N12.3 |
| chr21_-_46359760 | 0.89 |
ENST00000330551.3
ENST00000397841.1 ENST00000380070.4 |
C21orf67
|
chromosome 21 open reading frame 67 |
| chr11_-_12030681 | 0.89 |
ENST00000529338.1
|
DKK3
|
dickkopf WNT signaling pathway inhibitor 3 |
| chr3_+_44903361 | 0.89 |
ENST00000302392.4
|
TMEM42
|
transmembrane protein 42 |
| chr4_+_2061119 | 0.89 |
ENST00000423729.2
|
NAT8L
|
N-acetyltransferase 8-like (GCN5-related, putative) |
| chr17_+_1944790 | 0.89 |
ENST00000575162.1
|
DPH1
|
diphthamide biosynthesis 1 |
| chr12_+_111856144 | 0.89 |
ENST00000550925.2
|
SH2B3
|
SH2B adaptor protein 3 |
| chr17_+_18163848 | 0.89 |
ENST00000323019.4
ENST00000578174.1 ENST00000395704.4 ENST00000395703.4 ENST00000578621.1 ENST00000579341.1 |
MIEF2
|
mitochondrial elongation factor 2 |
| chr11_-_110167331 | 0.89 |
ENST00000534683.1
|
RDX
|
radixin |
| chr9_+_137000484 | 0.89 |
ENST00000608937.1
ENST00000608739.1 |
WDR5
|
WD repeat domain 5 |
| chr12_-_122241812 | 0.88 |
ENST00000538335.1
|
AC084018.1
|
AC084018.1 |
| chr12_-_12419905 | 0.88 |
ENST00000535731.1
|
LRP6
|
low density lipoprotein receptor-related protein 6 |
| chr16_+_88636875 | 0.88 |
ENST00000569435.1
|
ZC3H18
|
zinc finger CCCH-type containing 18 |
| chr9_-_140064496 | 0.87 |
ENST00000371542.3
|
LRRC26
|
leucine rich repeat containing 26 |
| chr12_+_54378849 | 0.87 |
ENST00000515593.1
|
HOXC10
|
homeobox C10 |
| chr14_-_100625932 | 0.86 |
ENST00000553834.1
|
DEGS2
|
delta(4)-desaturase, sphingolipid 2 |
| chr11_+_695380 | 0.86 |
ENST00000397510.3
|
TMEM80
|
transmembrane protein 80 |
| chr18_+_44497455 | 0.86 |
ENST00000592005.1
|
KATNAL2
|
katanin p60 subunit A-like 2 |
| chr11_+_313503 | 0.86 |
ENST00000528780.1
ENST00000328221.5 |
IFITM1
|
interferon induced transmembrane protein 1 |
| chr19_-_1168936 | 0.86 |
ENST00000587655.1
|
SBNO2
|
strawberry notch homolog 2 (Drosophila) |
| chr19_+_13229126 | 0.86 |
ENST00000292431.4
|
NACC1
|
nucleus accumbens associated 1, BEN and BTB (POZ) domain containing |
| chr10_-_14920599 | 0.86 |
ENST00000609399.1
|
RP11-398C13.6
|
RP11-398C13.6 |
| chr5_-_99870932 | 0.86 |
ENST00000504833.1
|
CTD-2001C12.1
|
CTD-2001C12.1 |
| chr19_-_5624057 | 0.86 |
ENST00000590262.1
|
SAFB2
|
scaffold attachment factor B2 |
| chr9_+_130159433 | 0.86 |
ENST00000451404.1
|
SLC2A8
|
solute carrier family 2 (facilitated glucose transporter), member 8 |
| chr12_-_7281469 | 0.86 |
ENST00000542370.1
ENST00000266560.3 |
RBP5
|
retinol binding protein 5, cellular |
| chr3_-_42845922 | 0.85 |
ENST00000452906.2
|
HIGD1A
|
HIG1 hypoxia inducible domain family, member 1A |
| chr16_+_577697 | 0.85 |
ENST00000562370.1
ENST00000568988.1 ENST00000219611.2 |
CAPN15
|
calpain 15 |
| chr1_-_54872059 | 0.85 |
ENST00000371320.3
|
SSBP3
|
single stranded DNA binding protein 3 |
| chr21_-_44898015 | 0.85 |
ENST00000332440.3
|
LINC00313
|
long intergenic non-protein coding RNA 313 |
| chr9_+_130159593 | 0.84 |
ENST00000419132.1
|
SLC2A8
|
solute carrier family 2 (facilitated glucose transporter), member 8 |
| chr17_-_73178599 | 0.84 |
ENST00000578238.1
|
SUMO2
|
small ubiquitin-like modifier 2 |
| chr9_-_136344237 | 0.84 |
ENST00000432868.1
ENST00000371899.4 |
SLC2A6
|
solute carrier family 2 (facilitated glucose transporter), member 6 |
| chr12_+_49740700 | 0.84 |
ENST00000549441.2
ENST00000395069.3 |
DNAJC22
|
DnaJ (Hsp40) homolog, subfamily C, member 22 |
| chr8_+_42396936 | 0.84 |
ENST00000416469.2
|
SMIM19
|
small integral membrane protein 19 |
| chr11_+_65686728 | 0.84 |
ENST00000312515.2
ENST00000525501.1 |
DRAP1
|
DR1-associated protein 1 (negative cofactor 2 alpha) |
| chr19_+_18530184 | 0.84 |
ENST00000601357.2
|
SSBP4
|
single stranded DNA binding protein 4 |
| chr5_+_175298674 | 0.84 |
ENST00000514150.1
|
CPLX2
|
complexin 2 |
| chr16_-_850723 | 0.83 |
ENST00000248150.4
|
GNG13
|
guanine nucleotide binding protein (G protein), gamma 13 |
| chr1_-_21948906 | 0.83 |
ENST00000374761.2
ENST00000599760.1 |
RAP1GAP
|
RAP1 GTPase activating protein |
| chr7_+_73082152 | 0.83 |
ENST00000324941.4
ENST00000451519.1 |
VPS37D
|
vacuolar protein sorting 37 homolog D (S. cerevisiae) |
| chr22_-_39151995 | 0.83 |
ENST00000405018.1
ENST00000438058.1 |
SUN2
|
Sad1 and UNC84 domain containing 2 |
| chr16_+_3070313 | 0.83 |
ENST00000326577.4
|
TNFRSF12A
|
tumor necrosis factor receptor superfamily, member 12A |
| chr5_+_10564432 | 0.83 |
ENST00000296657.5
|
ANKRD33B
|
ankyrin repeat domain 33B |
| chr16_+_3019309 | 0.83 |
ENST00000576565.1
|
PAQR4
|
progestin and adipoQ receptor family member IV |
| chr17_+_78075324 | 0.82 |
ENST00000570803.1
|
GAA
|
glucosidase, alpha; acid |
| chr11_-_69490073 | 0.82 |
ENST00000535657.1
ENST00000539414.1 ENST00000536870.1 ENST00000538554.2 ENST00000279147.4 |
ORAOV1
|
oral cancer overexpressed 1 |
| chr9_-_34665983 | 0.82 |
ENST00000416454.1
ENST00000544078.2 ENST00000421828.2 ENST00000423809.1 |
RP11-195F19.5
|
HCG2040265, isoform CRA_a; Uncharacterized protein; cDNA FLJ50015 |
| chr7_+_26438187 | 0.82 |
ENST00000439120.1
ENST00000430548.1 ENST00000421862.1 ENST00000449537.1 ENST00000420774.1 ENST00000418758.2 |
AC004540.5
|
AC004540.5 |
| chr17_-_61777459 | 0.81 |
ENST00000578993.1
ENST00000583211.1 ENST00000259006.3 |
LIMD2
|
LIM domain containing 2 |
| chr8_+_120885949 | 0.81 |
ENST00000523492.1
ENST00000286234.5 |
DEPTOR
|
DEP domain containing MTOR-interacting protein |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 3.8 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 1.0 | 2.9 | GO:0060829 | regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
| 0.7 | 2.9 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.7 | 2.1 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 0.6 | 3.6 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.6 | 1.7 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.5 | 1.6 | GO:0043105 | regulation of GTP cyclohydrolase I activity(GO:0043095) negative regulation of GTP cyclohydrolase I activity(GO:0043105) |
| 0.5 | 1.6 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.5 | 1.5 | GO:1990575 | mitochondrial L-ornithine transmembrane transport(GO:1990575) |
| 0.4 | 1.3 | GO:1904586 | response to putrescine(GO:1904585) cellular response to putrescine(GO:1904586) hepatocyte dedifferentiation(GO:1990828) |
| 0.4 | 1.3 | GO:1903697 | negative regulation of microvillus assembly(GO:1903697) |
| 0.4 | 2.2 | GO:0097403 | cellular response to raffinose(GO:0097403) response to raffinose(GO:1901545) |
| 0.4 | 1.2 | GO:1900737 | regulation of proteinase activated receptor activity(GO:1900276) negative regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900737) |
| 0.4 | 1.2 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.4 | 1.5 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 0.4 | 1.9 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
| 0.4 | 2.3 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.4 | 0.4 | GO:0032648 | regulation of interferon-beta production(GO:0032648) |
| 0.4 | 1.9 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.4 | 1.1 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 0.4 | 1.1 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 0.4 | 1.1 | GO:0035261 | external genitalia morphogenesis(GO:0035261) |
| 0.3 | 2.4 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.3 | 1.4 | GO:1904482 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 0.3 | 1.0 | GO:0052151 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.3 | 1.3 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.3 | 0.3 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.3 | 1.0 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.3 | 0.9 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
| 0.3 | 1.2 | GO:0072287 | metanephric distal tubule morphogenesis(GO:0072287) |
| 0.3 | 1.8 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.3 | 5.5 | GO:0030210 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.3 | 1.8 | GO:0015878 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 0.3 | 2.7 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 0.3 | 0.3 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.3 | 0.6 | GO:1904582 | regulation of intracellular mRNA localization(GO:1904580) positive regulation of intracellular mRNA localization(GO:1904582) |
| 0.3 | 0.3 | GO:0031060 | regulation of histone methylation(GO:0031060) |
| 0.3 | 0.9 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.3 | 0.3 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.3 | 0.9 | GO:2000744 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.3 | 0.9 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.3 | 0.9 | GO:0002352 | B cell negative selection(GO:0002352) post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.3 | 0.9 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.3 | 1.1 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.3 | 2.5 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.3 | 1.4 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
| 0.3 | 1.1 | GO:1990535 | neuron projection maintenance(GO:1990535) |
| 0.3 | 0.5 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
| 0.3 | 1.3 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.3 | 1.0 | GO:0006565 | cysteine biosynthetic process from serine(GO:0006535) L-serine catabolic process(GO:0006565) |
| 0.3 | 0.5 | GO:0090322 | regulation of superoxide metabolic process(GO:0090322) |
| 0.3 | 2.8 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.2 | 1.0 | GO:0045013 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.2 | 0.2 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.2 | 1.5 | GO:0010133 | proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) |
| 0.2 | 0.7 | GO:0019732 | antifungal humoral response(GO:0019732) antifungal innate immune response(GO:0061760) |
| 0.2 | 0.2 | GO:0038179 | neurotrophin signaling pathway(GO:0038179) |
| 0.2 | 1.0 | GO:0032764 | negative regulation of mast cell cytokine production(GO:0032764) |
| 0.2 | 0.2 | GO:0009624 | response to nematode(GO:0009624) |
| 0.2 | 0.9 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.2 | 1.2 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.2 | 0.7 | GO:0046081 | dUTP metabolic process(GO:0046080) dUTP catabolic process(GO:0046081) |
| 0.2 | 0.5 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.2 | 2.3 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.2 | 1.4 | GO:1901355 | cellular response to rapamycin(GO:0072752) response to rapamycin(GO:1901355) |
| 0.2 | 0.7 | GO:0019082 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.2 | 0.7 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
| 0.2 | 0.2 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.2 | 1.3 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.2 | 3.2 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.2 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.2 | 0.2 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.2 | 0.9 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.2 | 0.8 | GO:0042361 | menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 0.2 | 0.2 | GO:0017014 | protein nitrosylation(GO:0017014) peptidyl-cysteine S-nitrosylation(GO:0018119) negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.2 | 1.0 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.2 | 0.8 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.2 | 2.1 | GO:0034036 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.2 | 0.8 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.2 | 0.2 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.2 | 0.2 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.2 | 0.6 | GO:0061536 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.2 | 0.6 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.2 | 0.2 | GO:0021722 | pons maturation(GO:0021586) superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.2 | 0.8 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.2 | 0.8 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.2 | 1.2 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.2 | 0.6 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.2 | 0.8 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.2 | 0.4 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.2 | 0.8 | GO:0006050 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.2 | 1.2 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.2 | 0.8 | GO:1904199 | positive regulation of regulation of vascular smooth muscle cell membrane depolarization(GO:1904199) regulation of vascular smooth muscle cell membrane depolarization(GO:1990736) |
| 0.2 | 0.2 | GO:2000399 | negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.2 | 0.6 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.2 | 1.2 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.2 | 0.8 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.2 | 1.9 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.2 | 0.8 | GO:1900133 | regulation of renin secretion into blood stream(GO:1900133) |
| 0.2 | 1.1 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.2 | 1.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.2 | 0.6 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.2 | 0.4 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
| 0.2 | 0.7 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.2 | 0.2 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.2 | 0.2 | GO:0010644 | cell communication by electrical coupling(GO:0010644) |
| 0.2 | 0.5 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.2 | 0.2 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.2 | 0.2 | GO:0010634 | positive regulation of epithelial cell migration(GO:0010634) |
| 0.2 | 1.2 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.2 | 0.5 | GO:0002731 | negative regulation of dendritic cell cytokine production(GO:0002731) |
| 0.2 | 1.2 | GO:1901377 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.2 | 1.0 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.2 | 1.0 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.2 | 0.5 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.2 | 2.4 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.2 | 1.2 | GO:0046618 | drug export(GO:0046618) |
| 0.2 | 2.7 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.2 | 0.7 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.2 | 0.3 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 | 0.5 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
| 0.2 | 1.5 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.2 | 0.5 | GO:0060738 | epithelial-mesenchymal signaling involved in prostate gland development(GO:0060738) |
| 0.2 | 0.5 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.2 | 0.3 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.2 | 1.3 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.2 | 0.5 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.2 | 0.2 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.2 | 0.5 | GO:0046022 | positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 0.2 | 1.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.2 | 0.3 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.2 | 0.3 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.2 | 1.5 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
| 0.2 | 1.0 | GO:0002424 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.2 | 1.0 | GO:0070982 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.2 | 1.3 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.2 | 0.5 | GO:0019516 | lactate oxidation(GO:0019516) |
| 0.2 | 0.8 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.2 | 1.5 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.2 | 0.6 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.2 | 0.6 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.2 | 0.6 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.2 | 0.5 | GO:1901291 | negative regulation of double-strand break repair via single-strand annealing(GO:1901291) |
| 0.2 | 0.6 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.2 | 0.3 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.2 | 0.6 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.1 | 4.6 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.1 | 0.6 | GO:0036229 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.1 | 0.4 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.1 | 0.7 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.1 | 0.3 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.1 | 0.7 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.1 | 1.0 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 0.1 | 1.3 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 1.9 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.1 | 0.7 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 1.2 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.1 | 0.6 | GO:0075071 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.1 | 0.6 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.6 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.4 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.1 | 0.8 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.1 | 0.6 | GO:0009447 | putrescine catabolic process(GO:0009447) |
| 0.1 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.1 | 0.4 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 | 0.8 | GO:0036100 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 0.1 | 0.3 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.1 | 0.4 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.1 | 0.5 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.1 | 0.5 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.1 | 0.3 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 | 0.1 | GO:0060149 | negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by RNA(GO:0060967) |
| 0.1 | 0.8 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 0.5 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.1 | 1.1 | GO:2000795 | negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.1 | 0.1 | GO:0032918 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.1 | 0.3 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.1 | 0.4 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.1 | 0.7 | GO:0006311 | meiotic gene conversion(GO:0006311) |
| 0.1 | 1.8 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.1 | 2.9 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 | 2.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.1 | 0.1 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.1 | 0.4 | GO:0072047 | proximal/distal pattern formation involved in nephron development(GO:0072047) specification of nephron tubule identity(GO:0072081) |
| 0.1 | 0.5 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.1 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
| 0.1 | 0.1 | GO:0060577 | pulmonary vein morphogenesis(GO:0060577) |
| 0.1 | 0.4 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.1 | 0.5 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.1 | 0.5 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
| 0.1 | 0.1 | GO:0030432 | peristalsis(GO:0030432) |
| 0.1 | 1.0 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.1 | 0.1 | GO:0072319 | vesicle uncoating(GO:0072319) |
| 0.1 | 0.9 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.4 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.1 | 0.6 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 0.1 | 0.4 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.1 | 0.1 | GO:0034127 | regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034127) negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.1 | 0.5 | GO:0006226 | dUMP biosynthetic process(GO:0006226) |
| 0.1 | 0.2 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 0.1 | 0.4 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.1 | 0.4 | GO:1904761 | negative regulation of myofibroblast differentiation(GO:1904761) |
| 0.1 | 0.4 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.1 | 0.5 | GO:0002384 | hepatic immune response(GO:0002384) |
| 0.1 | 1.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.4 | GO:0035623 | renal glucose absorption(GO:0035623) |
| 0.1 | 0.1 | GO:0039519 | modulation by virus of host autophagy(GO:0039519) |
| 0.1 | 0.4 | GO:0043602 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) |
| 0.1 | 0.5 | GO:0031456 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.1 | 0.5 | GO:0032094 | response to food(GO:0032094) |
| 0.1 | 0.6 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.1 | 0.5 | GO:0006235 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
| 0.1 | 0.4 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 0.4 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 0.1 | 0.6 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.1 | 0.5 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.1 | 0.6 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.1 | 0.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.1 | 0.2 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.1 | 0.6 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 | 0.8 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.6 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.1 | 0.6 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 0.4 | GO:0046041 | ITP metabolic process(GO:0046041) |
| 0.1 | 1.2 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.6 | GO:0021623 | optic cup structural organization(GO:0003409) oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.1 | 0.4 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.1 | 2.9 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 | 0.1 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.1 | 0.1 | GO:0071874 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.1 | 0.3 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
| 0.1 | 0.8 | GO:2000582 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.1 | 0.3 | GO:0070376 | regulation of ERK5 cascade(GO:0070376) negative regulation of ERK5 cascade(GO:0070377) |
| 0.1 | 0.3 | GO:0098884 | postsynaptic neurotransmitter receptor internalization(GO:0098884) |
| 0.1 | 0.3 | GO:0009176 | pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) dUMP metabolic process(GO:0046078) |
| 0.1 | 0.5 | GO:1904353 | regulation of telomere capping(GO:1904353) |
| 0.1 | 1.0 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 | 0.5 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.1 | 0.1 | GO:0071926 | endocannabinoid signaling pathway(GO:0071926) regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.1 | 0.4 | GO:0032915 | positive regulation of transforming growth factor beta2 production(GO:0032915) |
| 0.1 | 0.3 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.1 | 0.4 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 | 0.4 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
| 0.1 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 0.2 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.1 | 1.2 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) |
| 0.1 | 0.3 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.1 | 0.9 | GO:1990262 | regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
| 0.1 | 0.4 | GO:0014744 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of muscle adaptation(GO:0014744) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) positive regulation of connective tissue replacement(GO:1905205) |
| 0.1 | 0.4 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.1 | 0.7 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.1 | 0.3 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 | 1.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 0.3 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.1 | 2.2 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.1 | 0.2 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.1 | 0.8 | GO:0032776 | DNA methylation on cytosine(GO:0032776) C-5 methylation of cytosine(GO:0090116) |
| 0.1 | 0.6 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.1 | 0.4 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.6 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.1 | 0.8 | GO:0097068 | response to thyroxine(GO:0097068) response to L-phenylalanine derivative(GO:1904386) |
| 0.1 | 0.2 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.1 | 0.3 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.1 | 0.4 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.1 | 0.9 | GO:0030279 | negative regulation of ossification(GO:0030279) |
| 0.1 | 0.3 | GO:0046356 | acetyl-CoA catabolic process(GO:0046356) |
| 0.1 | 0.4 | GO:1901091 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.1 | 1.0 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.1 | 0.1 | GO:0060699 | regulation of endoribonuclease activity(GO:0060699) |
| 0.1 | 0.3 | GO:0060490 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 0.1 | 0.4 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.1 | 0.1 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.1 | 0.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.1 | 0.7 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.1 | 0.1 | GO:0009635 | response to herbicide(GO:0009635) |
| 0.1 | 0.5 | GO:0030307 | positive regulation of cell growth(GO:0030307) |
| 0.1 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.1 | 0.1 | GO:0002663 | B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) |
| 0.1 | 0.4 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.1 | 0.4 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 1.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.7 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.1 | 1.0 | GO:0045046 | protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 0.3 | GO:0072684 | mitochondrial tRNA 3'-trailer cleavage, endonucleolytic(GO:0072684) |
| 0.1 | 0.3 | GO:1990637 | response to prolactin(GO:1990637) |
| 0.1 | 1.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.3 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.1 | 0.3 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.1 | 0.1 | GO:0015919 | peroxisomal membrane transport(GO:0015919) |
| 0.1 | 0.9 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.1 | 0.1 | GO:0022605 | oogenesis stage(GO:0022605) |
| 0.1 | 0.9 | GO:1904886 | beta-catenin destruction complex disassembly(GO:1904886) |
| 0.1 | 0.3 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.1 | 0.3 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.1 | 0.3 | GO:1903450 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
| 0.1 | 0.3 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.1 | 0.3 | GO:0018282 | metal incorporation into metallo-sulfur cluster(GO:0018282) iron incorporation into metallo-sulfur cluster(GO:0018283) |
| 0.1 | 0.6 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.1 | 0.3 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.1 | 0.2 | GO:0072019 | nitric oxide transport(GO:0030185) proximal convoluted tubule development(GO:0072019) metanephric proximal convoluted tubule development(GO:0072229) metanephric proximal tubule development(GO:0072237) |
| 0.1 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 | 0.3 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.1 | 0.2 | GO:0001575 | globoside metabolic process(GO:0001575) |
| 0.1 | 0.4 | GO:0021644 | vagus nerve morphogenesis(GO:0021644) |
| 0.1 | 0.3 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.1 | 0.7 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.1 | 0.4 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.1 | 1.0 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 | 0.8 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.8 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.1 | 0.4 | GO:1900063 | regulation of peroxisome organization(GO:1900063) |
| 0.1 | 0.2 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.1 | 0.1 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.1 | 0.6 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.1 | 0.6 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.1 | 1.3 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.5 | GO:1902679 | negative regulation of RNA biosynthetic process(GO:1902679) |
| 0.1 | 0.1 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 0.1 | 0.5 | GO:0043126 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.1 | 0.7 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.4 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.1 | 0.4 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
| 0.1 | 0.9 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.1 | 1.5 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.1 | 0.3 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.1 | 1.8 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 | 0.6 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.1 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.1 | 0.8 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 0.7 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.1 | 0.4 | GO:1904844 | response to L-glutamine(GO:1904844) cellular response to L-glutamine(GO:1904845) |
| 0.1 | 0.5 | GO:0002353 | kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
| 0.1 | 0.3 | GO:0015993 | molecular hydrogen transport(GO:0015993) |
| 0.1 | 0.4 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.1 | 0.6 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.1 | 0.2 | GO:0046732 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.1 | 0.4 | GO:1901858 | regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.1 | 0.4 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 | 0.3 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.1 | 0.3 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
| 0.1 | 0.1 | GO:0060761 | negative regulation of response to cytokine stimulus(GO:0060761) |
| 0.1 | 0.4 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.1 | 0.3 | GO:2000342 | negative regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000342) |
| 0.1 | 0.5 | GO:0010868 | negative regulation of triglyceride biosynthetic process(GO:0010868) |
| 0.1 | 0.3 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.1 | 0.4 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.1 | 0.2 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
| 0.1 | 0.9 | GO:1903430 | negative regulation of cell maturation(GO:1903430) |
| 0.1 | 0.4 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 | 0.9 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.1 | 0.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.1 | 0.3 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 | 0.6 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 2.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 | 0.2 | GO:0072737 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) |
| 0.1 | 0.4 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.1 | 0.1 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
| 0.1 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.1 | 0.7 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) |
| 0.1 | 0.2 | GO:0043385 | mycotoxin metabolic process(GO:0043385) aflatoxin metabolic process(GO:0046222) organic heteropentacyclic compound metabolic process(GO:1901376) |
| 0.1 | 1.0 | GO:1903944 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.1 | 0.1 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
| 0.1 | 0.3 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.1 | 0.2 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.1 | 0.3 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 0.3 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.1 | 0.3 | GO:0022614 | membrane to membrane docking(GO:0022614) |
| 0.1 | 0.8 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.1 | 0.4 | GO:0061015 | snRNA import into nucleus(GO:0061015) |
| 0.1 | 0.1 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.1 | 1.6 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.1 | 0.2 | GO:0035508 | positive regulation of myosin-light-chain-phosphatase activity(GO:0035508) |
| 0.1 | 0.3 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.3 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.1 | 0.4 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.1 | 0.1 | GO:0046514 | ceramide catabolic process(GO:0046514) |
| 0.1 | 0.2 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) |
| 0.1 | 1.1 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.1 | 0.2 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.1 | 0.3 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 | 0.5 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.1 | 0.3 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.1 | 0.2 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
| 0.1 | 0.1 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
| 0.1 | 0.4 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.1 | 0.2 | GO:0061582 | colon epithelial cell migration(GO:0061580) intestinal epithelial cell migration(GO:0061582) |
| 0.1 | 0.6 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.1 | 0.8 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.1 | 0.6 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.1 | 1.4 | GO:1901678 | iron coordination entity transport(GO:1901678) |
| 0.1 | 0.8 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.1 | 0.2 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.1 | 0.2 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.1 | 0.6 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.1 | 3.0 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.1 | 0.1 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.1 | 0.2 | GO:0071139 | resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.1 | 0.6 | GO:1901295 | positive regulation of ephrin receptor signaling pathway(GO:1901189) regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901295) positive regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901297) regulation of canonical Wnt signaling pathway involved in heart development(GO:1905066) positive regulation of canonical Wnt signaling pathway involved in heart development(GO:1905068) |
| 0.1 | 0.3 | GO:0048691 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.1 | 0.2 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.1 | 0.7 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.1 | 0.2 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.1 | 3.0 | GO:1904659 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.1 | 0.1 | GO:2000157 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.1 | 0.4 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
| 0.1 | 0.5 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.1 | 0.1 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.2 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 | 0.3 | GO:0090299 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.1 | 0.5 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.1 | 0.3 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.1 | 0.2 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.1 | 0.2 | GO:0046931 | pore complex assembly(GO:0046931) |
| 0.1 | 0.2 | GO:1904798 | positive regulation of core promoter binding(GO:1904798) |
| 0.1 | 0.1 | GO:0010869 | regulation of receptor biosynthetic process(GO:0010869) |
| 0.1 | 0.2 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
| 0.1 | 0.2 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.1 | 0.8 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.1 | 0.5 | GO:0090034 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.1 | 0.2 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.1 | 0.3 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.1 | 0.5 | GO:0044146 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.1 | 0.4 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 | 0.2 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.1 | 0.7 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 | 1.1 | GO:0046051 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
| 0.1 | 0.5 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 0.2 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.1 | 0.3 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.1 | 0.3 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.1 | 1.7 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.1 | 0.7 | GO:0070560 | calcium-mediated signaling using extracellular calcium source(GO:0035585) protein secretion by platelet(GO:0070560) |
| 0.1 | 0.1 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
| 0.1 | 0.1 | GO:1903526 | negative regulation of membrane tubulation(GO:1903526) |
| 0.1 | 0.4 | GO:0015862 | uridine transport(GO:0015862) |
| 0.1 | 0.1 | GO:0015817 | histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) |
| 0.1 | 0.1 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 0.4 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.1 | 0.8 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.5 | GO:1903435 | positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.1 | 0.4 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
| 0.1 | 0.6 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.1 | 0.1 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
| 0.1 | 0.1 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.1 | 0.1 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.1 | 0.1 | GO:0072054 | renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.1 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.1 | 0.9 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 | 0.1 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.1 | 0.1 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.1 | 0.6 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.1 | 0.1 | GO:0046495 | nicotinamide riboside catabolic process(GO:0006738) nicotinamide riboside metabolic process(GO:0046495) pyridine nucleoside metabolic process(GO:0070637) pyridine nucleoside catabolic process(GO:0070638) |
| 0.1 | 0.4 | GO:0032431 | activation of phospholipase A2 activity(GO:0032431) |
| 0.1 | 0.4 | GO:2000568 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.1 | 0.1 | GO:0014040 | positive regulation of Schwann cell differentiation(GO:0014040) |
| 0.1 | 0.1 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.1 | 0.5 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.1 | 0.8 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.1 | 0.6 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.1 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.1 | 0.2 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.1 | 1.0 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.1 | 0.6 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.1 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.1 | 0.1 | GO:1905206 | positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.1 | 0.8 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 | 0.4 | GO:1902412 | regulation of mitotic cytokinesis(GO:1902412) |
| 0.1 | 0.1 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.1 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.1 | 1.4 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.1 | GO:0019563 | glycerol catabolic process(GO:0019563) |
| 0.1 | 0.4 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 | 1.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.1 | 0.1 | GO:1902617 | response to fluoride(GO:1902617) |
| 0.1 | 0.2 | GO:0001172 | transcription, RNA-templated(GO:0001172) |
| 0.1 | 0.7 | GO:0042148 | strand invasion(GO:0042148) |
| 0.1 | 0.2 | GO:2001302 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 0.1 | 0.2 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.1 | 1.0 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.1 | 2.5 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.1 | 0.1 | GO:0060374 | mast cell differentiation(GO:0060374) |
| 0.1 | 0.7 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.3 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 0.2 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.1 | 0.3 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.1 | 0.7 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.3 | GO:0042635 | positive regulation of hair cycle(GO:0042635) |
| 0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 0.3 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.1 | 0.6 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.1 | 0.6 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
| 0.1 | 0.6 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.1 | 0.1 | GO:0031670 | cellular response to nutrient(GO:0031670) |
| 0.1 | 0.1 | GO:0010595 | positive regulation of endothelial cell migration(GO:0010595) |
| 0.1 | 0.6 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.1 | 0.3 | GO:1904715 | negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 0.1 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 | 0.4 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.1 | 0.3 | GO:0003341 | cilium movement(GO:0003341) |
| 0.1 | 0.3 | GO:0003184 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 0.1 | 0.8 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.1 | 0.4 | GO:0019075 | virus maturation(GO:0019075) |
| 0.1 | 0.3 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.1 | 0.1 | GO:1905051 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.1 | 0.1 | GO:0038202 | TORC1 signaling(GO:0038202) |
| 0.1 | 0.2 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.1 | 0.4 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.1 | 0.5 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.1 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
| 0.1 | 0.7 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 0.2 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 0.3 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.1 | 0.6 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.1 | 0.2 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.1 | GO:0016572 | histone phosphorylation(GO:0016572) |
| 0.1 | 0.2 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.1 | 0.6 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.1 | 0.1 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
| 0.1 | 0.3 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.1 | 0.3 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.1 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 | 0.2 | GO:0036414 | protein citrullination(GO:0018101) citrulline biosynthetic process(GO:0019240) histone citrullination(GO:0036414) |
| 0.1 | 0.2 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.1 | 0.1 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.1 | 0.5 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 0.3 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 | 0.2 | GO:0032480 | negative regulation of type I interferon production(GO:0032480) |
| 0.1 | 0.4 | GO:0036302 | atrioventricular canal development(GO:0036302) |
| 0.1 | 0.2 | GO:1903020 | positive regulation of glycoprotein metabolic process(GO:1903020) |
| 0.1 | 0.3 | GO:0070943 | neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) neutrophil mediated killing of bacterium(GO:0070944) |
| 0.1 | 0.4 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.1 | 0.5 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 | 0.1 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 | 0.4 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.1 | 0.2 | GO:0000354 | cis assembly of pre-catalytic spliceosome(GO:0000354) |
| 0.1 | 0.8 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.1 | 0.4 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 0.2 | GO:0086092 | regulation of the force of heart contraction by cardiac conduction(GO:0086092) |
| 0.1 | 0.1 | GO:0090311 | protein deacylation(GO:0035601) regulation of protein deacetylation(GO:0090311) macromolecule deacylation(GO:0098732) |
| 0.1 | 0.2 | GO:0042058 | regulation of epidermal growth factor receptor signaling pathway(GO:0042058) |
| 0.1 | 0.6 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.9 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.1 | 0.2 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.1 | 0.6 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.1 | 0.1 | GO:0031630 | regulation of synaptic vesicle fusion to presynaptic membrane(GO:0031630) |
| 0.1 | 0.9 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.1 | 0.2 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.1 | 0.1 | GO:0043400 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
| 0.1 | 0.2 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.1 | 0.2 | GO:0071477 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.1 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
| 0.1 | 0.3 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.1 | 0.1 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.1 | 0.1 | GO:0046778 | modification by virus of host mRNA processing(GO:0046778) |
| 0.1 | 0.1 | GO:0015801 | aromatic amino acid transport(GO:0015801) |
| 0.1 | 1.3 | GO:0015893 | drug transport(GO:0015893) |
| 0.1 | 0.1 | GO:0090329 | regulation of DNA-dependent DNA replication(GO:0090329) |
| 0.1 | 0.2 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
| 0.1 | 0.6 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 | 0.3 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 0.1 | 1.2 | GO:0070828 | heterochromatin organization(GO:0070828) |
| 0.1 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.1 | 0.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.1 | 0.2 | GO:0019046 | release from viral latency(GO:0019046) |
| 0.1 | 0.3 | GO:0060611 | mammary gland fat development(GO:0060611) regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) regulation of response to macrophage colony-stimulating factor(GO:1903969) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) positive regulation of microglial cell migration(GO:1904141) |
| 0.1 | 0.1 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 | 0.6 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.1 | 0.2 | GO:0033037 | polysaccharide localization(GO:0033037) |
| 0.1 | 1.0 | GO:0014894 | response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.1 | 0.1 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) |
| 0.1 | 0.3 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 | 0.1 | GO:0002741 | cytokine secretion involved in immune response(GO:0002374) regulation of cytokine secretion involved in immune response(GO:0002739) positive regulation of cytokine secretion involved in immune response(GO:0002741) regulation of alpha-beta T cell proliferation(GO:0046640) negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.1 | 0.4 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.1 | 0.2 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.1 | 0.9 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.1 | 0.3 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.1 | 0.6 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 | 0.8 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.3 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.1 | 0.2 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.1 | 0.4 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.1 | 0.2 | GO:0016559 | peroxisome fission(GO:0016559) |
| 0.1 | 0.3 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.1 | 0.1 | GO:0003197 | endocardial cushion development(GO:0003197) |
| 0.1 | 0.7 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.1 | 0.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.1 | 0.4 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 0.3 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.1 | 1.0 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 0.1 | GO:0034138 | toll-like receptor 3 signaling pathway(GO:0034138) |
| 0.1 | 0.1 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 0.1 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.1 | 0.2 | GO:0051836 | translocation of peptides or proteins into host(GO:0042000) translocation of peptides or proteins into host cell cytoplasm(GO:0044053) translocation of molecules into host(GO:0044417) translocation of peptides or proteins into other organism involved in symbiotic interaction(GO:0051808) translocation of molecules into other organism involved in symbiotic interaction(GO:0051836) |
| 0.1 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.1 | 0.3 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 1.2 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.1 | 0.2 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 | 0.4 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 0.9 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.1 | 0.3 | GO:0010734 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.1 | 0.2 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.1 | 0.1 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.1 | 0.2 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.1 | 0.2 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.1 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 0.2 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.1 | 0.7 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.1 | GO:0009397 | folic acid-containing compound catabolic process(GO:0009397) pteridine-containing compound catabolic process(GO:0042560) |
| 0.1 | 0.5 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 | 0.9 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.1 | 0.1 | GO:0003160 | endocardium morphogenesis(GO:0003160) |
| 0.1 | 0.2 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.1 | 0.3 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.1 | 0.1 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 0.1 | 0.7 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.1 | 0.7 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 0.6 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.3 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 | 0.3 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.1 | 0.1 | GO:0090218 | positive regulation of lipid kinase activity(GO:0090218) |
| 0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.2 | GO:0070874 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.1 | 0.2 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.1 | 0.2 | GO:1903567 | negative regulation of protein localization to cilium(GO:1903565) regulation of protein localization to ciliary membrane(GO:1903567) negative regulation of protein localization to ciliary membrane(GO:1903568) |
| 0.1 | 0.2 | GO:0051758 | homologous chromosome movement towards spindle pole involved in homologous chromosome segregation(GO:0051758) |
| 0.1 | 1.0 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.1 | 0.2 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.1 | 0.3 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 0.2 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.1 | 0.2 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.1 | 0.1 | GO:0014839 | myoblast migration involved in skeletal muscle regeneration(GO:0014839) |
| 0.1 | 0.2 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.1 | 1.2 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.1 | 0.1 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.1 | 0.7 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 0.3 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.1 | 0.2 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.1 | 1.2 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.2 | GO:0060746 | maternal behavior(GO:0042711) parental behavior(GO:0060746) |
| 0.1 | 0.4 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
| 0.1 | 0.2 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.0 | 0.2 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.1 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.1 | GO:1902961 | regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902959) positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) regulation of aspartic-type peptidase activity(GO:1905245) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.0 | 0.2 | GO:0000271 | polysaccharide biosynthetic process(GO:0000271) |
| 0.0 | 0.3 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.0 | 1.6 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.0 | 0.1 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.0 | 0.2 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.5 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 1.9 | GO:0097178 | ruffle assembly(GO:0097178) |
| 0.0 | 0.1 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
| 0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.2 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.9 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
| 0.0 | 0.1 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.0 | 0.6 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.3 | GO:0046149 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 | 0.0 | GO:2000417 | negative regulation of eosinophil migration(GO:2000417) |
| 0.0 | 0.6 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.0 | 0.3 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
| 0.0 | 0.4 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.0 | 0.6 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.2 | GO:1901162 | primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 0.1 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.0 | 0.1 | GO:0019085 | early viral transcription(GO:0019085) |
| 0.0 | 0.1 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
| 0.0 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.0 | 0.0 | GO:0060730 | regulation of intestinal epithelial structure maintenance(GO:0060730) |
| 0.0 | 0.3 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
| 0.0 | 0.1 | GO:0090675 | intermicrovillar adhesion(GO:0090675) |
| 0.0 | 0.1 | GO:0044725 | chromatin reprogramming in the zygote(GO:0044725) DNA demethylation of male pronucleus(GO:0044727) |
| 0.0 | 0.1 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) indolalkylamine biosynthetic process(GO:0046219) |
| 0.0 | 0.4 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.2 | GO:1900673 | olefin metabolic process(GO:1900673) |
| 0.0 | 2.9 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.1 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.1 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
| 0.0 | 0.3 | GO:0097461 | copper ion import(GO:0015677) ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.0 | 0.1 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
| 0.0 | 0.3 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
| 0.0 | 0.0 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.0 | 0.0 | GO:0072554 | blood vessel lumenization(GO:0072554) |
| 0.0 | 0.3 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.0 | 0.1 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.0 | 0.3 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.0 | 0.4 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.0 | 0.2 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.0 | 0.2 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 | 0.2 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.3 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.0 | 0.1 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 1.1 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 0.1 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 0.0 | 0.1 | GO:1904316 | positive regulation of neutrophil degranulation(GO:0043315) cellular response to gravity(GO:0071258) positive regulation of anion channel activity(GO:1901529) positive regulation of neutrophil activation(GO:1902565) regulation of voltage-gated chloride channel activity(GO:1902941) positive regulation of voltage-gated chloride channel activity(GO:1902943) positive regulation of inorganic anion transmembrane transport(GO:1903797) positive regulation of anion transmembrane transport(GO:1903961) regulation of transcytosis(GO:1904298) positive regulation of transcytosis(GO:1904300) regulation of maternal process involved in parturition(GO:1904301) positive regulation of maternal process involved in parturition(GO:1904303) response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904316) cellular response to 2-O-acetyl-1-O-hexadecyl-sn-glycero-3-phosphocholine(GO:1904317) |
| 0.0 | 0.6 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.0 | GO:1903659 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.0 | 0.2 | GO:0043129 | surfactant homeostasis(GO:0043129) |
| 0.0 | 0.4 | GO:1902287 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.0 | 0.4 | GO:0072733 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.0 | 0.9 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.0 | 0.7 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.4 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.0 | 0.1 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.0 | 0.1 | GO:0035349 | coenzyme A transport(GO:0015880) coenzyme A transmembrane transport(GO:0035349) adenosine 3',5'-bisphosphate transmembrane transport(GO:0071106) AMP transport(GO:0080121) |
| 0.0 | 0.5 | GO:0040033 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.0 | 0.3 | GO:0019427 | acetate metabolic process(GO:0006083) acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
| 0.0 | 0.1 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
| 0.0 | 0.3 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.5 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.0 | 0.7 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.0 | 0.4 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.0 | 1.0 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.0 | 0.3 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.0 | 0.3 | GO:0061143 | alveolar primary septum development(GO:0061143) |
| 0.0 | 0.6 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 | 0.1 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.0 | 0.0 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.0 | GO:0048146 | positive regulation of fibroblast proliferation(GO:0048146) |
| 0.0 | 1.1 | GO:0035729 | cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.0 | 0.1 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.0 | 0.2 | GO:0035087 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.0 | 0.0 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.2 | GO:0046847 | filopodium assembly(GO:0046847) |
| 0.0 | 0.2 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.0 | 0.3 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.0 | 0.2 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.0 | 0.2 | GO:0036309 | protein localization to M-band(GO:0036309) |
| 0.0 | 0.5 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.5 | GO:2000553 | regulation of T-helper 2 cell cytokine production(GO:2000551) positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.0 | 0.1 | GO:0035723 | interleukin-15-mediated signaling pathway(GO:0035723) cellular response to interleukin-15(GO:0071350) |
| 0.0 | 0.5 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 0.2 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.0 | 0.3 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.0 | 0.2 | GO:0050925 | negative regulation of negative chemotaxis(GO:0050925) |
| 0.0 | 0.2 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.0 | 0.2 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.1 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.0 | 0.2 | GO:0008207 | C21-steroid hormone metabolic process(GO:0008207) |
| 0.0 | 0.2 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.0 | GO:0010983 | regulation of high-density lipoprotein particle clearance(GO:0010982) positive regulation of high-density lipoprotein particle clearance(GO:0010983) |
| 0.0 | 0.0 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 0.8 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.0 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.0 | 0.2 | GO:1902269 | positive regulation of polyamine transmembrane transport(GO:1902269) |
| 0.0 | 0.1 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.0 | 0.2 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.0 | 0.0 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.0 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
| 0.0 | 0.0 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.0 | 0.1 | GO:0035854 | regulation of primitive erythrocyte differentiation(GO:0010725) eosinophil fate commitment(GO:0035854) |
| 0.0 | 0.1 | GO:0070781 | response to biotin(GO:0070781) |
| 0.0 | 0.3 | GO:0003322 | pancreatic A cell development(GO:0003322) |
| 0.0 | 0.1 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 | 0.5 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.2 | GO:2000691 | regulation of cardiac muscle cell myoblast differentiation(GO:2000690) negative regulation of cardiac muscle cell myoblast differentiation(GO:2000691) |
| 0.0 | 0.3 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.2 | GO:0014832 | urinary bladder smooth muscle contraction(GO:0014832) urinary tract smooth muscle contraction(GO:0014848) |
| 0.0 | 0.7 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.0 | 0.1 | GO:0031056 | regulation of histone modification(GO:0031056) |
| 0.0 | 0.2 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.0 | 0.2 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 | 0.1 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.0 | 0.1 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) negative regulation of cartilage development(GO:0061037) |
| 0.0 | 0.5 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.0 | 0.1 | GO:1990258 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.0 | 0.3 | GO:0097267 | omega-hydroxylase P450 pathway(GO:0097267) |
| 0.0 | 0.4 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.0 | 0.2 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
| 0.0 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.6 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.0 | 0.1 | GO:0070472 | regulation of uterine smooth muscle contraction(GO:0070472) |
| 0.0 | 0.5 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.1 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.3 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.6 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 | 0.1 | GO:0070627 | ferrous iron import(GO:0070627) ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.0 | 0.1 | GO:0050823 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.0 | 0.3 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 | 0.4 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.3 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.0 | 0.5 | GO:0042044 | fluid transport(GO:0042044) |
| 0.0 | 0.5 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 | 0.3 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 | 0.4 | GO:0055048 | regulation of spindle elongation(GO:0032887) regulation of mitotic spindle elongation(GO:0032888) anastral spindle assembly(GO:0055048) protein localization to spindle pole body(GO:0071988) regulation of protein localization to spindle pole body(GO:1902363) positive regulation of protein localization to spindle pole body(GO:1902365) positive regulation of mitotic spindle elongation(GO:1902846) |
| 0.0 | 1.3 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.6 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.3 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.2 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
| 0.0 | 0.2 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.0 | GO:0050779 | RNA destabilization(GO:0050779) |
| 0.0 | 0.5 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.0 | 0.6 | GO:0043401 | steroid hormone mediated signaling pathway(GO:0043401) |
| 0.0 | 0.3 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.0 | 0.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 | 0.1 | GO:1903376 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.0 | 0.1 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.0 | 0.2 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.0 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.0 | 0.6 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.1 | GO:0060940 | epithelial to mesenchymal transition involved in cardiac fibroblast development(GO:0060940) |
| 0.0 | 0.0 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.0 | 0.3 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.1 | GO:0045209 | MAPK phosphatase export from nucleus(GO:0045208) MAPK phosphatase export from nucleus, leptomycin B sensitive(GO:0045209) |
| 0.0 | 0.2 | GO:0072708 | response to sorbitol(GO:0072708) |
| 0.0 | 0.2 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
| 0.0 | 0.4 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.9 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
| 0.0 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.0 | 0.0 | GO:0046833 | positive regulation of RNA export from nucleus(GO:0046833) |
| 0.0 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.0 | 0.4 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.0 | 0.3 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.0 | 0.2 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.0 | 0.0 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.0 | 0.0 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.0 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.0 | 0.0 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.3 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.2 | GO:2000504 | negative regulation of Fas signaling pathway(GO:1902045) positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 | 0.3 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.7 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 | 0.0 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.0 | 0.1 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.0 | 1.1 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.0 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.0 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.0 | 0.4 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
| 0.0 | 0.7 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 | 0.0 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.0 | 0.2 | GO:0031179 | peptide amidation(GO:0001519) protein amidation(GO:0018032) peptide modification(GO:0031179) |
| 0.0 | 0.1 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
| 0.0 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.0 | 0.1 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.0 | 0.6 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.0 | 0.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.2 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.2 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.0 | 0.1 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.0 | 0.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.0 | 0.0 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.0 | 0.2 | GO:0098743 | cell aggregation(GO:0098743) |
| 0.0 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 | 0.0 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
| 0.0 | 0.3 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
| 0.0 | 0.1 | GO:0021784 | postganglionic parasympathetic fiber development(GO:0021784) |
| 0.0 | 0.4 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.0 | 0.5 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.1 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.0 | 0.3 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.1 | GO:0021503 | neural fold bending(GO:0021503) |
| 0.0 | 0.0 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
| 0.0 | 0.1 | GO:0070901 | mitochondrial tRNA methylation(GO:0070901) |
| 0.0 | 0.2 | GO:0045408 | regulation of interleukin-6 biosynthetic process(GO:0045408) |
| 0.0 | 0.4 | GO:0007028 | cytoplasm organization(GO:0007028) |
| 0.0 | 0.0 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 | 0.2 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.0 | 0.3 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 | 0.1 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.0 | GO:0070904 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.0 | 0.1 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.0 | 0.3 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.2 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.0 | 0.1 | GO:0050904 | diapedesis(GO:0050904) |
| 0.0 | 0.1 | GO:0051413 | response to cortisone(GO:0051413) |
| 0.0 | 0.1 | GO:0044782 | cilium organization(GO:0044782) |
| 0.0 | 0.2 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.0 | 0.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.2 | GO:0071104 | response to interleukin-9(GO:0071104) |
| 0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.0 | 0.8 | GO:0010824 | regulation of centrosome duplication(GO:0010824) |
| 0.0 | 0.1 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.0 | 0.0 | GO:0051797 | regulation of hair follicle development(GO:0051797) |
| 0.0 | 0.1 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
| 0.0 | 1.3 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.1 | GO:0050766 | positive regulation of phagocytosis(GO:0050766) |
| 0.0 | 0.5 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.0 | 0.2 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.0 | 0.4 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 | 0.1 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.0 | 0.1 | GO:0035750 | protein localization to myelin sheath abaxonal region(GO:0035750) |
| 0.0 | 0.1 | GO:0072108 | positive regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0072108) |
| 0.0 | 0.3 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.1 | GO:0090306 | spindle assembly involved in female meiosis(GO:0007056) spindle assembly involved in meiosis(GO:0090306) |
| 0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.0 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.0 | 0.1 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.0 | 0.1 | GO:0046603 | negative regulation of mitotic centrosome separation(GO:0046603) |
| 0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.9 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.0 | 0.1 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.2 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 | 0.2 | GO:1901098 | positive regulation of autophagosome maturation(GO:1901098) |
| 0.0 | 0.3 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.3 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 0.4 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.0 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.2 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.0 | 0.0 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.0 | 0.2 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.0 | 0.1 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.0 | 0.1 | GO:0030856 | regulation of epithelial cell differentiation(GO:0030856) |
| 0.0 | 0.0 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
| 0.0 | 0.0 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 | 0.2 | GO:0048864 | stem cell development(GO:0048864) |
| 0.0 | 0.1 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.0 | 0.3 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 | 0.0 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) |
| 0.0 | 0.5 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.0 | 0.1 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
| 0.0 | 0.2 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.0 | 0.0 | GO:0007530 | sex determination(GO:0007530) |
| 0.0 | 0.3 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 1.4 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.1 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.0 | 0.2 | GO:0030238 | male sex determination(GO:0030238) |
| 0.0 | 0.0 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.0 | 0.0 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.0 | 0.4 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.0 | 0.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.0 | 0.1 | GO:0021769 | orbitofrontal cortex development(GO:0021769) |
| 0.0 | 1.0 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.0 | 0.1 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 | 0.2 | GO:0090646 | mitochondrial tRNA processing(GO:0090646) |
| 0.0 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 | 0.1 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) |
| 0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.8 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.6 | GO:0035640 | exploration behavior(GO:0035640) |
| 0.0 | 0.1 | GO:0015800 | acidic amino acid transport(GO:0015800) L-glutamate transport(GO:0015813) |
| 0.0 | 0.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.2 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 0.3 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.0 | GO:1990737 | response to manganese-induced endoplasmic reticulum stress(GO:1990737) |
| 0.0 | 0.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.2 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.0 | 0.0 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
| 0.0 | 0.1 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.0 | 0.0 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.0 | 0.3 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.0 | 0.1 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
| 0.0 | 0.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.2 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.0 | GO:0006579 | amino-acid betaine catabolic process(GO:0006579) |
| 0.0 | 0.3 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.1 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.0 | 0.0 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 0.0 | 0.0 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.0 | 0.2 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 | 1.2 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.1 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.0 | 0.0 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.0 | 0.1 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 0.0 | 0.8 | GO:0010518 | positive regulation of phospholipase activity(GO:0010518) |
| 0.0 | 0.1 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
| 0.0 | 0.3 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 0.5 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.3 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) |
| 0.0 | 0.1 | GO:1903541 | regulation of exosomal secretion(GO:1903541) |
| 0.0 | 0.0 | GO:0002903 | regulation of B cell apoptotic process(GO:0002902) negative regulation of B cell apoptotic process(GO:0002903) |
| 0.0 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.1 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.0 | 2.4 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
| 0.0 | 0.0 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.0 | 0.0 | GO:0061461 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 0.0 | 0.3 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.0 | 0.1 | GO:0071028 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.0 | 0.1 | GO:0038060 | nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
| 0.0 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 | 0.1 | GO:0060838 | radial pattern formation(GO:0009956) lymphatic endothelial cell fate commitment(GO:0060838) regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.0 | 0.1 | GO:0032310 | prostaglandin secretion(GO:0032310) |
| 0.0 | 0.2 | GO:0042417 | dopamine metabolic process(GO:0042417) |
| 0.0 | 0.1 | GO:1904808 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.0 | 0.1 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.0 | 0.0 | GO:0033594 | response to hydroxyisoflavone(GO:0033594) |
| 0.0 | 0.3 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.0 | 0.1 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.0 | 0.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.1 | GO:0045006 | DNA deamination(GO:0045006) |
| 0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.1 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.0 | 0.2 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
| 0.0 | 0.2 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.0 | 0.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.1 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.0 | 0.0 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.1 | GO:0032625 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.0 | 0.0 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.0 | 0.2 | GO:0006563 | L-serine metabolic process(GO:0006563) |
| 0.0 | 0.0 | GO:0006425 | glutaminyl-tRNA aminoacylation(GO:0006425) |
| 0.0 | 0.1 | GO:0071279 | cellular response to cobalt ion(GO:0071279) |
| 0.0 | 0.1 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.0 | 0.2 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.5 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.2 | GO:0036152 | phosphatidylethanolamine acyl-chain remodeling(GO:0036152) |
| 0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.0 | 0.3 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 | 0.2 | GO:0006692 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.0 | 0.3 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.0 | 0.1 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.0 | 0.1 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 0.0 | 0.0 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.0 | 0.6 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) response to sodium arsenite(GO:1903935) cellular response to sodium arsenite(GO:1903936) |
| 0.0 | 0.2 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.0 | 1.3 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.0 | GO:0006312 | mitotic recombination(GO:0006312) |
| 0.0 | 0.2 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.0 | 0.6 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
| 0.0 | 0.1 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.0 | 0.0 | GO:0070167 | regulation of bone mineralization(GO:0030500) regulation of biomineral tissue development(GO:0070167) |
| 0.0 | 0.1 | GO:0014004 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.0 | 0.2 | GO:0035635 | entry of bacterium into host cell(GO:0035635) |
| 0.0 | 0.6 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.0 | 0.0 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.0 | 0.2 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.0 | 0.1 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.0 | 0.1 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 | 0.1 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.0 | 0.4 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
| 0.0 | 0.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.1 | GO:0046958 | nonassociative learning(GO:0046958) |
| 0.0 | 0.1 | GO:0045453 | bone resorption(GO:0045453) |
| 0.0 | 0.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.1 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
| 0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.4 | GO:1901224 | positive regulation of NIK/NF-kappaB signaling(GO:1901224) |
| 0.0 | 0.1 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.0 | 0.1 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.0 | 0.0 | GO:1900155 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.0 | 0.0 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
| 0.0 | 0.3 | GO:0001961 | positive regulation of cytokine-mediated signaling pathway(GO:0001961) |
| 0.0 | 0.2 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.1 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
| 0.0 | 0.2 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.0 | 0.0 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
| 0.0 | 0.3 | GO:0006582 | melanin metabolic process(GO:0006582) |
| 0.0 | 0.1 | GO:0009440 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.0 | GO:0051037 | regulation of transcription involved in meiotic cell cycle(GO:0051037) |
| 0.0 | 0.1 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
| 0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.2 | GO:0032291 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
| 0.0 | 0.0 | GO:0035305 | negative regulation of dephosphorylation(GO:0035305) negative regulation of protein dephosphorylation(GO:0035308) |
| 0.0 | 0.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.0 | GO:1905166 | negative regulation of protein catabolic process in the vacuole(GO:1904351) negative regulation of lysosomal protein catabolic process(GO:1905166) |
| 0.0 | 0.0 | GO:0086067 | AV node cell to bundle of His cell communication(GO:0086067) |
| 0.0 | 0.2 | GO:0032119 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.0 | GO:0042991 | transcription factor import into nucleus(GO:0042991) |
| 0.0 | 0.1 | GO:0032185 | septin cytoskeleton organization(GO:0032185) |
| 0.0 | 0.1 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.0 | 0.4 | GO:0007588 | excretion(GO:0007588) |
| 0.0 | 0.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.2 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.1 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 | 0.0 | GO:0008057 | eye pigment granule organization(GO:0008057) |
| 0.0 | 0.4 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.0 | 0.2 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 0.0 | 0.0 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.0 | 0.2 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.0 | 0.0 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.0 | 0.4 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.2 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.0 | 0.0 | GO:0060168 | thiamine metabolic process(GO:0006772) positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.0 | 0.9 | GO:0034724 | DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 | 0.3 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 | 0.2 | GO:0046135 | pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.0 | 0.2 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.0 | GO:0010989 | regulation of low-density lipoprotein particle clearance(GO:0010988) negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 0.5 | GO:0033198 | response to ATP(GO:0033198) |
| 0.0 | 0.2 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.0 | 0.1 | GO:0010870 | positive regulation of receptor biosynthetic process(GO:0010870) |
| 0.0 | 0.0 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.0 | 0.0 | GO:0099563 | modification of synaptic structure(GO:0099563) |
| 0.0 | 0.0 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.0 | 0.0 | GO:0043317 | negative regulation of dendritic cell antigen processing and presentation(GO:0002605) regulation of cytotoxic T cell degranulation(GO:0043317) negative regulation of cytotoxic T cell degranulation(GO:0043318) |
| 0.0 | 0.1 | GO:0050729 | positive regulation of inflammatory response(GO:0050729) |
| 0.0 | 0.1 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.0 | 0.1 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 | 0.1 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
| 0.0 | 0.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.0 | 0.0 | GO:1904116 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.0 | 0.3 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.0 | 0.0 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.0 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.0 | 0.4 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.0 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.0 | 0.0 | GO:0060995 | cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.0 | 0.0 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.0 | 0.0 | GO:0051712 | positive regulation of killing of cells of other organism(GO:0051712) |
| 0.0 | 0.2 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 | 0.0 | GO:0002879 | positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
| 0.0 | 0.0 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.0 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.0 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.0 | GO:0035810 | regulation of urine volume(GO:0035809) positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.2 | GO:0050718 | positive regulation of interleukin-1 beta secretion(GO:0050718) |
| 0.0 | 0.1 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 0.1 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.0 | 0.0 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.0 | 0.0 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.0 | 0.5 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.1 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.1 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.0 | 0.1 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
| 0.0 | 0.0 | GO:0045907 | positive regulation of vasoconstriction(GO:0045907) |
| 0.0 | 0.1 | GO:1901889 | negative regulation of cell junction assembly(GO:1901889) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.1 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.1 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 | 0.1 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
| 0.0 | 0.1 | GO:0006513 | protein monoubiquitination(GO:0006513) |
| 0.0 | 0.4 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.0 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.0 | 0.1 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
| 0.0 | 0.5 | GO:0007040 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.0 | 0.0 | GO:0032571 | response to vitamin K(GO:0032571) |
| 0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.1 | GO:0050772 | positive regulation of axonogenesis(GO:0050772) |
| 0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.0 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.0 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.0 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) |
| 0.0 | 0.0 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 | 0.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.0 | 0.0 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.0 | 0.2 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.0 | 0.2 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) |
| 0.0 | 0.0 | GO:1905232 | cellular response to L-glutamate(GO:1905232) |
| 0.0 | 0.0 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.0 | 0.0 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
| 0.0 | 0.0 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.0 | 0.0 | GO:1900138 | negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.0 | 0.0 | GO:0045136 | development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 0.0 | 0.1 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.0 | 0.0 | GO:0051414 | response to cortisol(GO:0051414) |
| 0.0 | 0.0 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.0 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.0 | 0.0 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 0.1 | GO:0009409 | response to cold(GO:0009409) |
| 0.0 | 0.1 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.0 | 0.0 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.0 | 0.0 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.1 | GO:0042350 | GDP-L-fucose biosynthetic process(GO:0042350) |
| 0.0 | 0.1 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.0 | 0.2 | GO:0032147 | activation of protein kinase activity(GO:0032147) |
| 0.0 | 0.0 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.0 | 0.0 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.0 | 0.0 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.0 | GO:0002396 | MHC protein complex assembly(GO:0002396) peptide antigen assembly with MHC protein complex(GO:0002501) |
| 0.0 | 0.1 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 | 0.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.0 | 0.0 | GO:0033078 | extrathymic T cell differentiation(GO:0033078) |
| 0.0 | 0.0 | GO:1900248 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.0 | 0.0 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
| 0.0 | 0.2 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.2 | GO:0039714 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
| 0.4 | 3.3 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.3 | 1.3 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.3 | 1.7 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.3 | 1.4 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.3 | 2.6 | GO:0070554 | synaptobrevin 2-SNAP-25-syntaxin-3-complexin complex(GO:0070554) |
| 0.2 | 1.2 | GO:0002133 | polycystin complex(GO:0002133) |
| 0.2 | 0.7 | GO:0035101 | FACT complex(GO:0035101) |
| 0.2 | 0.7 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
| 0.2 | 1.1 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.2 | 0.2 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.2 | 2.3 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.2 | 1.1 | GO:0031417 | NatC complex(GO:0031417) |
| 0.2 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.2 | 0.4 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.2 | 0.9 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.2 | 1.4 | GO:1990393 | 3M complex(GO:1990393) |
| 0.2 | 0.9 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.2 | 0.7 | GO:0097196 | Shu complex(GO:0097196) |
| 0.2 | 0.3 | GO:0030286 | dynein complex(GO:0030286) |
| 0.2 | 0.5 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.2 | 1.0 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.2 | 2.0 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.2 | 1.0 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.2 | 2.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.2 | 1.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.2 | 1.4 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.1 | 0.7 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.1 | 0.7 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.1 | 0.4 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.1 | 1.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.1 | 0.7 | GO:0043260 | laminin-11 complex(GO:0043260) |
| 0.1 | 0.5 | GO:1990745 | EARP complex(GO:1990745) |
| 0.1 | 0.5 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.1 | 0.8 | GO:0044423 | virion(GO:0019012) virion part(GO:0044423) |
| 0.1 | 0.6 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.1 | 0.3 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.1 | 1.0 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.1 | 0.8 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.1 | 0.3 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 0.3 | GO:0030125 | vesicle coat(GO:0030120) clathrin vesicle coat(GO:0030125) |
| 0.1 | 0.4 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 0.8 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.1 | 0.1 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 0.1 | 0.4 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.1 | 2.9 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.7 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.1 | 0.2 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.1 | 0.3 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) postsynaptic endocytic zone membrane(GO:0098844) |
| 0.1 | 0.7 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.1 | 2.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 0.2 | GO:0044393 | microspike(GO:0044393) |
| 0.1 | 0.3 | GO:0001534 | radial spoke(GO:0001534) |
| 0.1 | 0.6 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 0.7 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.1 | 0.4 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.1 | 3.0 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 0.6 | GO:0031673 | H zone(GO:0031673) |
| 0.1 | 0.5 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.1 | 1.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 0.3 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.1 | 0.1 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.1 | 1.5 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.1 | 0.4 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 2.0 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.4 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.1 | 1.7 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.6 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.1 | 0.7 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.1 | 0.5 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 1.5 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.1 | 0.3 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.1 | 0.5 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.1 | 0.5 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 0.4 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.1 | 1.6 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.7 | GO:0097361 | CIA complex(GO:0097361) |
| 0.1 | 0.3 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 0.3 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.1 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.1 | 0.2 | GO:0032797 | SMN complex(GO:0032797) |
| 0.1 | 0.9 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.1 | 1.3 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 1.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 1.3 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.3 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.1 | 0.3 | GO:0071665 | gamma-catenin-TCF7L2 complex(GO:0071665) |
| 0.1 | 0.7 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.1 | 0.8 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 0.2 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
| 0.1 | 1.0 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 0.5 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.1 | 0.1 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.1 | 0.8 | GO:0051286 | cell tip(GO:0051286) |
| 0.1 | 1.6 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.2 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.1 | 1.7 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 0.2 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) |
| 0.1 | 0.8 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 0.3 | GO:0060187 | cell pole(GO:0060187) |
| 0.1 | 1.0 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 0.4 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.1 | 0.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.1 | 0.3 | GO:0031251 | PAN complex(GO:0031251) |
| 0.1 | 0.3 | GO:0071020 | post-spliceosomal complex(GO:0071020) |
| 0.1 | 0.2 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.1 | 0.7 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.1 | 0.3 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.1 | 1.4 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.1 | 0.4 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.1 | 0.4 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.1 | 0.4 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.1 | 0.3 | GO:0044753 | amphisome(GO:0044753) |
| 0.1 | 4.3 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 1.3 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.1 | 0.2 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.1 | 4.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 0.4 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 1.0 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.1 | 4.2 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.1 | 0.5 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 0.1 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.1 | 0.4 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.1 | 0.1 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.1 | 1.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.1 | 0.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 0.3 | GO:0030934 | anchoring collagen complex(GO:0030934) |
| 0.1 | 0.5 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.1 | 1.3 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.3 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.1 | 0.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.1 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 1.5 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.1 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.3 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.2 | GO:0034657 | GID complex(GO:0034657) |
| 0.1 | 0.1 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.1 | 1.9 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.1 | 0.8 | GO:0000235 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.1 | 1.0 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 0.5 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 0.9 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.5 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.1 | 0.7 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 0.4 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.0 | 0.6 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 1.7 | GO:0031305 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.0 | 0.4 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.2 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.0 | 0.1 | GO:0031213 | RSF complex(GO:0031213) |
| 0.0 | 1.9 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.2 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.1 | GO:0034515 | proteasome storage granule(GO:0034515) |
| 0.0 | 1.8 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.0 | 0.4 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.3 | GO:0042825 | TAP complex(GO:0042825) |
| 0.0 | 2.4 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 4.7 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.0 | 0.9 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.1 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.4 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.2 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.0 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.2 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.0 | 1.5 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.6 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.4 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.5 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 1.6 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 0.2 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.3 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.8 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.8 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.0 | 0.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.3 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.0 | 0.2 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.2 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.0 | 0.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.7 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.0 | 0.0 | GO:0098642 | network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) |
| 0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.0 | 0.8 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.3 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.0 | 0.8 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.2 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.6 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 0.3 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.0 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 1.0 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.0 | 1.5 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 1.0 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.2 | GO:0002169 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.0 | 0.2 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.0 | 0.6 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.4 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 1.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 2.9 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.4 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.5 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.4 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.4 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.0 | 1.1 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.6 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.0 | 0.4 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.3 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.1 | GO:0033655 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
| 0.0 | 0.3 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.0 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
| 0.0 | 0.6 | GO:0043203 | axon hillock(GO:0043203) |
| 0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 1.0 | GO:0031105 | septin complex(GO:0031105) |
| 0.0 | 0.4 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.6 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.3 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.0 | 0.4 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 0.3 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.1 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.0 | 0.2 | GO:0072589 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.1 | GO:0070931 | Golgi-associated vesicle lumen(GO:0070931) |
| 0.0 | 0.6 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.0 | 0.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.0 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.5 | GO:0005902 | microvillus(GO:0005902) |
| 0.0 | 0.3 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.4 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 1.3 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 2.8 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.0 | 0.4 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.2 | GO:0030658 | transport vesicle membrane(GO:0030658) |
| 0.0 | 0.2 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.6 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.0 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.0 | 0.4 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.0 | 0.0 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 0.0 | 0.2 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.0 | 0.1 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.0 | 0.2 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 1.2 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 0.3 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.0 | GO:0043614 | multi-eIF complex(GO:0043614) |
| 0.0 | 0.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 1.4 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.1 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.1 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 2.0 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.0 | 0.2 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 4.6 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.1 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.1 | GO:1990876 | cytoplasmic side of nuclear pore(GO:1990876) |
| 0.0 | 0.2 | GO:0044853 | plasma membrane raft(GO:0044853) |
| 0.0 | 0.0 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
| 0.0 | 0.2 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.0 | 0.5 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 0.4 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.1 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.0 | 0.2 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.7 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.7 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
| 0.0 | 0.3 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.0 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
| 0.0 | 0.0 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.1 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.0 | 0.1 | GO:0032449 | CBM complex(GO:0032449) |
| 0.0 | 0.3 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 0.0 | 0.1 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 2.6 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) |
| 0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.0 | 0.5 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.0 | GO:0005873 | plus-end kinesin complex(GO:0005873) |
| 0.0 | 1.8 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.8 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 1.2 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.4 | GO:0042383 | sarcolemma(GO:0042383) |
| 0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.3 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 0.5 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 0.2 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 0.9 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.0 | 0.0 | GO:0034685 | integrin alphav-beta6 complex(GO:0034685) |
| 0.0 | 0.0 | GO:0070877 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.0 | 0.2 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 8.3 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.0 | 0.8 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.3 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.2 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 0.9 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.1 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.5 | 1.6 | GO:0044549 | GTP cyclohydrolase binding(GO:0044549) |
| 0.5 | 3.4 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.5 | 1.9 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.5 | 0.5 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.4 | 1.3 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.4 | 1.1 | GO:0003842 | 1-pyrroline-5-carboxylate dehydrogenase activity(GO:0003842) |
| 0.3 | 1.4 | GO:0015227 | acyl carnitine transmembrane transporter activity(GO:0015227) |
| 0.3 | 1.0 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 0.3 | 1.3 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.3 | 1.6 | GO:0070905 | serine binding(GO:0070905) |
| 0.3 | 1.3 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.3 | 1.3 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.3 | 1.9 | GO:0004797 | thymidine kinase activity(GO:0004797) |
| 0.3 | 0.9 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
| 0.3 | 1.5 | GO:0003947 | (N-acetylneuraminyl)-galactosylglucosylceramide N-acetylgalactosaminyltransferase activity(GO:0003947) |
| 0.3 | 0.9 | GO:0097259 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) 20-hydroxy-leukotriene B4 omega oxidase activity(GO:0097258) 20-aldehyde-leukotriene B4 20-monooxygenase activity(GO:0097259) |
| 0.3 | 1.1 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.3 | 1.7 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.3 | 2.5 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.3 | 1.0 | GO:0050421 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitrite reductase activity(GO:0098809) |
| 0.2 | 1.0 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.2 | 1.7 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.2 | 2.0 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.2 | 0.7 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.2 | 0.7 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.2 | 1.0 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.2 | 0.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
| 0.2 | 1.7 | GO:0008955 | peptidoglycan glycosyltransferase activity(GO:0008955) |
| 0.2 | 0.7 | GO:0004807 | triose-phosphate isomerase activity(GO:0004807) |
| 0.2 | 0.7 | GO:0015633 | zinc transporting ATPase activity(GO:0015633) |
| 0.2 | 0.5 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.2 | 0.7 | GO:0004170 | dUTP diphosphatase activity(GO:0004170) |
| 0.2 | 0.7 | GO:0052857 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 0.2 | 0.7 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 0.2 | 1.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.2 | 0.9 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.2 | 0.7 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.2 | 0.9 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.2 | 0.7 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.2 | 2.6 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.2 | 0.8 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.2 | 1.0 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.2 | 2.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.2 | 0.6 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.2 | 1.2 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.2 | 0.8 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.2 | 0.6 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.2 | 0.6 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
| 0.2 | 0.8 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.2 | 0.6 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
| 0.2 | 1.0 | GO:0005124 | scavenger receptor binding(GO:0005124) |
| 0.2 | 0.6 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.2 | 0.2 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.2 | 0.6 | GO:0070119 | ciliary neurotrophic factor binding(GO:0070119) |
| 0.2 | 1.0 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.2 | 0.8 | GO:0010348 | lithium:proton antiporter activity(GO:0010348) |
| 0.2 | 1.1 | GO:1903135 | cupric ion binding(GO:1903135) |
| 0.2 | 4.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.2 | 1.3 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.2 | 0.6 | GO:0050333 | thiamin-triphosphatase activity(GO:0050333) |
| 0.2 | 0.6 | GO:0016898 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
| 0.2 | 0.7 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.2 | 0.5 | GO:0015068 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
| 0.2 | 0.9 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.2 | 3.8 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.2 | 0.7 | GO:0090556 | apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 0.2 | 1.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.2 | 1.1 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.2 | 1.2 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.2 | 2.4 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.2 | 0.5 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.2 | 1.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.2 | 0.5 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.2 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.2 | 0.5 | GO:0070362 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.2 | 0.5 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.2 | 0.5 | GO:0050613 | delta14-sterol reductase activity(GO:0050613) |
| 0.2 | 0.6 | GO:0004530 | deoxyribonuclease I activity(GO:0004530) |
| 0.2 | 1.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.2 | 0.5 | GO:0031781 | melanocortin receptor binding(GO:0031779) corticotropin hormone receptor binding(GO:0031780) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) type 5 melanocortin receptor binding(GO:0031783) type 1 melanocortin receptor binding(GO:0070996) |
| 0.2 | 0.6 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.2 | 0.5 | GO:0034039 | 8-oxo-7,8-dihydroguanine DNA N-glycosylase activity(GO:0034039) |
| 0.2 | 0.5 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.4 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.1 | 0.7 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.1 | 0.6 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 1.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.1 | 0.7 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.6 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.4 | GO:0008124 | phenylalanine 4-monooxygenase activity(GO:0004505) 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.1 | 0.4 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.1 | 1.5 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 0.4 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.1 | 0.4 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
| 0.1 | 1.0 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.1 | 0.5 | GO:0004974 | leukotriene B4 receptor activity(GO:0001632) leukotriene receptor activity(GO:0004974) |
| 0.1 | 0.4 | GO:0043337 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) CDP-diacylglycerol-phosphatidylglycerol phosphatidyltransferase activity(GO:0043337) |
| 0.1 | 0.7 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.5 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.1 | 0.7 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.4 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 0.6 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.9 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.1 | 0.4 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
| 0.1 | 0.3 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.1 | 0.4 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.1 | 1.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.5 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.1 | 0.5 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.4 | GO:0000384 | first spliceosomal transesterification activity(GO:0000384) |
| 0.1 | 0.4 | GO:0045485 | omega-6 fatty acid desaturase activity(GO:0045485) |
| 0.1 | 0.4 | GO:0001003 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
| 0.1 | 2.0 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 0.1 | 0.4 | GO:0047726 | iron-cytochrome-c reductase activity(GO:0047726) |
| 0.1 | 0.9 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.1 | 0.4 | GO:0016652 | NAD(P)+ transhydrogenase activity(GO:0008746) oxidoreductase activity, acting on NAD(P)H, NAD(P) as acceptor(GO:0016652) |
| 0.1 | 0.4 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.1 | 1.0 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 0.4 | GO:0000404 | heteroduplex DNA loop binding(GO:0000404) |
| 0.1 | 1.2 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.4 | GO:0097158 | pre-mRNA intronic pyrimidine-rich binding(GO:0097158) |
| 0.1 | 0.6 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) |
| 0.1 | 0.4 | GO:0050135 | NAD(P)+ nucleosidase activity(GO:0050135) |
| 0.1 | 0.5 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.1 | 0.5 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.1 | 0.3 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.3 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.1 | 0.3 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
| 0.1 | 0.5 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.1 | 0.3 | GO:0019862 | IgA binding(GO:0019862) |
| 0.1 | 0.8 | GO:0008481 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.1 | 1.0 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.6 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.3 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.1 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.1 | 0.4 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.1 | 0.4 | GO:0050051 | alkane 1-monooxygenase activity(GO:0018685) leukotriene-B4 20-monooxygenase activity(GO:0050051) |
| 0.1 | 0.2 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.1 | 0.3 | GO:0051908 | double-stranded DNA 5'-3' exodeoxyribonuclease activity(GO:0051908) |
| 0.1 | 0.4 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.3 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 0.3 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
| 0.1 | 0.3 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.1 | 1.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.1 | 0.3 | GO:0004657 | proline dehydrogenase activity(GO:0004657) |
| 0.1 | 0.6 | GO:1903763 | gap junction channel activity involved in cell communication by electrical coupling(GO:1903763) |
| 0.1 | 0.5 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.1 | 1.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 1.1 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.1 | 3.0 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 0.5 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.1 | 0.5 | GO:0050115 | myosin-light-chain-phosphatase activity(GO:0050115) |
| 0.1 | 0.8 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 0.2 | GO:0047661 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 4.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 0.9 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.1 | 0.2 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.1 | 0.5 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.1 | 0.5 | GO:0098625 | methylselenol reductase activity(GO:0098625) methylseleninic acid reductase activity(GO:0098626) |
| 0.1 | 0.4 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.1 | 0.1 | GO:1904713 | beta-catenin destruction complex binding(GO:1904713) |
| 0.1 | 0.2 | GO:0060229 | lipase activator activity(GO:0060229) |
| 0.1 | 0.4 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.1 | 0.6 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.1 | 0.3 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.1 | 3.7 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.1 | 0.8 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.1 | 0.8 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.3 | GO:0015432 | bile acid-exporting ATPase activity(GO:0015432) |
| 0.1 | 1.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.2 | GO:0000285 | 1-phosphatidylinositol-3-phosphate 5-kinase activity(GO:0000285) |
| 0.1 | 0.3 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
| 0.1 | 0.3 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
| 0.1 | 0.1 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.1 | 0.8 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 0.4 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.3 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
| 0.1 | 0.7 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.3 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 0.3 | GO:0001133 | RNA polymerase II transcription factor activity, sequence-specific transcription regulatory region DNA binding(GO:0001133) |
| 0.1 | 0.5 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.1 | 2.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 0.6 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.1 | 1.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 1.7 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 0.4 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.1 | 0.3 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.1 | 0.2 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.4 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.1 | 0.7 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.1 | 0.3 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.1 | 0.5 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 0.7 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.1 | 0.4 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.1 | 0.4 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 1.1 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 0.3 | GO:0005055 | laminin receptor activity(GO:0005055) |
| 0.1 | 0.3 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.1 | 1.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.5 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.1 | 0.9 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.1 | 0.9 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.1 | 1.0 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.1 | 1.0 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.1 | 0.9 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 0.4 | GO:0004945 | angiotensin receptor activity(GO:0001595) angiotensin type II receptor activity(GO:0004945) |
| 0.1 | 1.0 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.1 | 1.4 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.1 | 1.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.3 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.1 | 0.3 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.1 | 1.8 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 1.5 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.1 | 1.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 0.4 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.1 | 0.8 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 0.3 | GO:0005199 | structural constituent of cell wall(GO:0005199) |
| 0.1 | 0.3 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.1 | 1.0 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.1 | 0.1 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.1 | 0.3 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) |
| 0.1 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.1 | 0.7 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.1 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.1 | 1.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.5 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.1 | 0.6 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.1 | 0.9 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
| 0.1 | 2.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.2 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.1 | 1.4 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.3 | GO:0004803 | transposase activity(GO:0004803) |
| 0.1 | 0.3 | GO:0002060 | nucleobase binding(GO:0002054) purine nucleobase binding(GO:0002060) |
| 0.1 | 0.1 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.1 | 0.3 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.1 | 0.8 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.5 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.1 | 0.3 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
| 0.1 | 0.5 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.1 | 0.2 | GO:0047017 | prostaglandin-F synthase activity(GO:0047017) |
| 0.1 | 0.2 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 0.1 | 0.4 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.1 | 0.5 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 1.0 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 0.7 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.1 | 0.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.9 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.1 | 0.4 | GO:0052796 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.1 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 0.4 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.1 | 0.9 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.1 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.1 | 0.4 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.1 | 0.8 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 0.6 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.2 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.1 | 0.1 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.1 | 0.2 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.1 | 0.5 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.1 | 0.5 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.9 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.1 | 0.3 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
| 0.1 | 0.5 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.1 | 0.6 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 1.2 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 0.2 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 0.1 | 0.3 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.4 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.1 | 0.2 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) cholesterol O-acyltransferase activity(GO:0034736) |
| 0.1 | 0.2 | GO:0033867 | Fas-activated serine/threonine kinase activity(GO:0033867) |
| 0.1 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 0.3 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.1 | 0.4 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.6 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 0.8 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 0.1 | GO:0090554 | phosphatidylcholine-translocating ATPase activity(GO:0090554) |
| 0.1 | 0.1 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.1 | 0.3 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.1 | 1.9 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
| 0.1 | 0.6 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 1.0 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 0.3 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.1 | 0.4 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.1 | 0.2 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.1 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.2 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.1 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.1 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 2.9 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.1 | 0.8 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 1.8 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 0.7 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.1 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 0.2 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.2 | GO:0086040 | sodium:proton antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086040) |
| 0.1 | 1.3 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.1 | 0.4 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 0.4 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.1 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.1 | 0.2 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
| 0.1 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
| 0.1 | 0.5 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.1 | 0.4 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.1 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.3 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
| 0.1 | 0.3 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 0.5 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.1 | 0.2 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.1 | 0.8 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 1.0 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 0.2 | GO:0019961 | interferon binding(GO:0019961) |
| 0.1 | 0.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 0.2 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.1 | 0.6 | GO:1901476 | carbohydrate transmembrane transporter activity(GO:0015144) carbohydrate transporter activity(GO:1901476) |
| 0.1 | 0.4 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.1 | 0.3 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.1 | 0.4 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.1 | GO:0001098 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
| 0.1 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 1.0 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 0.7 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.1 | 0.6 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.1 | 1.8 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 0.1 | GO:0045142 | triplex DNA binding(GO:0045142) |
| 0.1 | 0.8 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 0.5 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.1 | 0.2 | GO:0004324 | ferredoxin-NADP+ reductase activity(GO:0004324) NADPH-adrenodoxin reductase activity(GO:0015039) oxidoreductase activity, acting on iron-sulfur proteins as donors(GO:0016730) oxidoreductase activity, acting on iron-sulfur proteins as donors, NAD or NADP as acceptor(GO:0016731) |
| 0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 2.0 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 0.4 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.2 | GO:0004335 | galactokinase activity(GO:0004335) |
| 0.1 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.1 | 0.2 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
| 0.1 | 0.2 | GO:0016208 | AMP binding(GO:0016208) |
| 0.1 | 0.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.1 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.1 | 1.5 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 0.1 | GO:0046969 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
| 0.1 | 0.2 | GO:1990175 | EH domain binding(GO:1990175) |
| 0.1 | 0.4 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.4 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.1 | 2.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.1 | GO:0031692 | alpha-1B adrenergic receptor binding(GO:0031692) |
| 0.0 | 0.1 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.0 | 0.1 | GO:0070260 | tyrosyl-RNA phosphodiesterase activity(GO:0036317) 5'-tyrosyl-DNA phosphodiesterase activity(GO:0070260) |
| 0.0 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 1.7 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.1 | GO:0033265 | choline binding(GO:0033265) |
| 0.0 | 0.1 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
| 0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.6 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 1.1 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.2 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.0 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.9 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.1 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 0.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.0 | 0.1 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.0 | 0.4 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.2 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.0 | 0.4 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 1.4 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.4 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.0 | 0.4 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.0 | 0.3 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.3 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.0 | 0.1 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
| 0.0 | 0.0 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 1.7 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.1 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) |
| 0.0 | 0.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.2 | GO:0031812 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.0 | 0.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 1.7 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.9 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.0 | 0.5 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 0.0 | 2.9 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.0 | 0.0 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.1 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.3 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.2 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.0 | 0.1 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.0 | 1.0 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 1.3 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.0 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.0 | 0.3 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.0 | 0.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.2 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.0 | 0.9 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.0 | 0.6 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.0 | 0.6 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 1.1 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.1 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.0 | 1.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.4 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 1.3 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.4 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.0 | 2.6 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 1.7 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.0 | 0.3 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.0 | 0.4 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.0 | 3.5 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.5 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.0 | 0.1 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 0.0 | 0.2 | GO:0004996 | thyroid-stimulating hormone receptor activity(GO:0004996) |
| 0.0 | 0.1 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
| 0.0 | 0.3 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.0 | 0.1 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.0 | 0.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.0 | 2.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.2 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.0 | 0.4 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.7 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.3 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.0 | 0.1 | GO:0032356 | oxidized DNA binding(GO:0032356) |
| 0.0 | 0.4 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
| 0.0 | 0.4 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.6 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
| 0.0 | 0.1 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
| 0.0 | 0.0 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.0 | 0.3 | GO:0003920 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.0 | 1.0 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.0 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:1990259 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.0 | 1.4 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.3 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 0.3 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.0 | 0.1 | GO:0047025 | 3-oxoacyl-[acyl-carrier-protein] reductase (NADH) activity(GO:0047025) |
| 0.0 | 0.5 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.4 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.0 | 0.0 | GO:0030547 | receptor inhibitor activity(GO:0030547) receptor antagonist activity(GO:0048019) |
| 0.0 | 0.1 | GO:0016005 | phospholipase A2 activator activity(GO:0016005) |
| 0.0 | 0.6 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.0 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.0 | 0.1 | GO:0047787 | delta4-3-oxosteroid 5beta-reductase activity(GO:0047787) |
| 0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.2 | GO:0004793 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.0 | 0.6 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.3 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.0 | 0.5 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.6 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 0.1 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.0 | 0.1 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.0 | 0.5 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.0 | 0.2 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.5 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 1.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.9 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
| 0.0 | 0.1 | GO:0008670 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) |
| 0.0 | 0.7 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.1 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
| 0.0 | 0.2 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.0 | 0.0 | GO:0050542 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
| 0.0 | 0.1 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.0 | 0.1 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.0 | 0.2 | GO:0004504 | peptidylglycine monooxygenase activity(GO:0004504) peptidylamidoglycolate lyase activity(GO:0004598) |
| 0.0 | 0.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.1 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
| 0.0 | 0.1 | GO:0004913 | interleukin-4 receptor activity(GO:0004913) |
| 0.0 | 0.1 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
| 0.0 | 0.1 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.4 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.3 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.2 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.1 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.0 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 0.5 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.3 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.0 | 0.6 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.0 | GO:0070890 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.0 | 0.0 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.0 | 0.3 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.4 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.3 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.0 | 0.3 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.0 | 0.8 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 1.4 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
| 0.0 | 0.4 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) |
| 0.0 | 0.4 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.0 | 0.4 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.5 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.4 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.0 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.0 | 0.5 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.7 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.0 | 1.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.3 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.6 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.1 | GO:0005497 | androgen binding(GO:0005497) |
| 0.0 | 0.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.1 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.0 | 0.1 | GO:0015250 | water channel activity(GO:0015250) |
| 0.0 | 0.2 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.0 | 0.2 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.0 | 0.5 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.1 | GO:0008941 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) |
| 0.0 | 0.1 | GO:0052827 | inositol pentakisphosphate phosphatase activity(GO:0052827) |
| 0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 0.1 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
| 0.0 | 0.1 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.0 | 0.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.5 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.2 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.0 | 0.3 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.0 | 0.1 | GO:0042910 | xenobiotic-transporting ATPase activity(GO:0008559) xenobiotic transporter activity(GO:0042910) |
| 0.0 | 0.1 | GO:0005221 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
| 0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.0 | 0.0 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.6 | GO:0017136 | NAD-dependent histone deacetylase activity(GO:0017136) |
| 0.0 | 0.0 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.0 | 1.7 | GO:0003823 | antigen binding(GO:0003823) |
| 0.0 | 0.1 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.0 | 0.1 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.1 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 0.2 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.0 | 0.2 | GO:0016215 | stearoyl-CoA 9-desaturase activity(GO:0004768) acyl-CoA desaturase activity(GO:0016215) |
| 0.0 | 0.5 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.0 | 0.2 | GO:0051183 | vitamin transporter activity(GO:0051183) |
| 0.0 | 0.3 | GO:0005217 | intracellular ligand-gated ion channel activity(GO:0005217) |
| 0.0 | 0.1 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.0 | 0.0 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.4 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.1 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 1.8 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.0 | GO:0015322 | proton-dependent oligopeptide secondary active transmembrane transporter activity(GO:0005427) secondary active oligopeptide transmembrane transporter activity(GO:0015322) |
| 0.0 | 0.2 | GO:0050308 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
| 0.0 | 0.5 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.0 | 0.4 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.1 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.0 | 0.3 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.1 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.0 | 0.1 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.0 | 0.0 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.0 | 0.1 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.0 | 0.2 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 2.2 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.2 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.2 | GO:0030614 | oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) |
| 0.0 | 0.9 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.3 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 1.1 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.0 | GO:0042562 | hormone binding(GO:0042562) |
| 0.0 | 0.6 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.1 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
| 0.0 | 0.0 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.1 | GO:0052839 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.0 | 0.4 | GO:0019825 | oxygen binding(GO:0019825) |
| 0.0 | 0.1 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.0 | 0.1 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.0 | 0.1 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.0 | 0.4 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
| 0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.0 | 0.1 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.0 | 1.2 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 0.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.3 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.1 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
| 0.0 | 0.3 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.0 | 0.0 | GO:0071566 | UFM1 activating enzyme activity(GO:0071566) |
| 0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 1.5 | GO:0003724 | RNA helicase activity(GO:0003724) |
| 0.0 | 0.0 | GO:0017129 | triglyceride binding(GO:0017129) |
| 0.0 | 0.1 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.0 | 1.2 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.0 | 0.1 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.0 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
| 0.0 | 0.1 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.0 | 0.0 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
| 0.0 | 0.1 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.0 | GO:0019778 | Atg12 activating enzyme activity(GO:0019778) Atg8 activating enzyme activity(GO:0019779) |
| 0.0 | 0.0 | GO:0060001 | minus-end directed microfilament motor activity(GO:0060001) |
| 0.0 | 0.4 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.0 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.7 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.6 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.0 | 0.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.0 | 0.7 | GO:0032947 | protein complex scaffold(GO:0032947) |
| 0.0 | 0.0 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
| 0.0 | 0.2 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.0 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.0 | 0.0 | GO:0016826 | N-sulfoglucosamine sulfohydrolase activity(GO:0016250) hydrolase activity, acting on acid sulfur-nitrogen bonds(GO:0016826) |
| 0.0 | 0.0 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.2 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.2 | GO:0048185 | activin binding(GO:0048185) |
| 0.0 | 0.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.0 | 0.1 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.0 | 0.0 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.0 | 0.1 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) |
| 0.0 | 0.5 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.1 | GO:0001076 | transcription factor activity, RNA polymerase II transcription factor binding(GO:0001076) |
| 0.0 | 0.1 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) phosphoribosylformylglycinamidine cyclo-ligase activity(GO:0004641) phosphoribosylglycinamide formyltransferase activity(GO:0004644) |
| 0.0 | 0.5 | GO:0000976 | transcription regulatory region sequence-specific DNA binding(GO:0000976) |
| 0.0 | 0.0 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.1 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.0 | 0.2 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.0 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.0 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.0 | GO:1904854 | proteasome core complex binding(GO:1904854) |
| 0.0 | 0.2 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.0 | 0.1 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.0 | 0.4 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.1 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 0.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.4 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.0 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.0 | 0.0 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.0 | 0.1 | GO:0051766 | inositol trisphosphate kinase activity(GO:0051766) |
| 0.0 | 0.1 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.0 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.0 | 0.0 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.0 | 0.4 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.1 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
| 0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.0 | GO:0061599 | molybdopterin adenylyltransferase activity(GO:0061598) molybdopterin molybdotransferase activity(GO:0061599) |
| 0.0 | 0.6 | GO:0016278 | lysine N-methyltransferase activity(GO:0016278) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.7 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.1 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 0.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 1.1 | PID EPO PATHWAY | EPO signaling pathway |
| 0.1 | 0.6 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 5.1 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.1 | 0.7 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 0.2 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.1 | 3.3 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 2.9 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.1 | 2.5 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.1 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 2.5 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.0 | 0.1 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 1.6 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 2.7 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 3.5 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 4.3 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 1.1 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 0.6 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 1.3 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.4 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.0 | 0.8 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.2 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.0 | 2.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.6 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.6 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.6 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.5 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 1.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 2.0 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.4 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 1.1 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.3 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.6 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 1.5 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.8 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.4 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 0.5 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.4 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.3 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.6 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.3 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.0 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 1.2 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.5 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.6 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.2 | 1.6 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.2 | 4.6 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.2 | 3.5 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.1 | 2.3 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.1 | 1.6 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 4.9 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 1.8 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 0.7 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.1 | 0.6 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 3.4 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.1 | 0.5 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 1.0 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.1 | 1.5 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 0.6 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 0.6 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 0.2 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.1 | 1.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 1.7 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.1 | 2.8 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 1.3 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.1 | 1.5 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 3.0 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 2.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.1 | 1.1 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.1 | 1.1 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.1 | 0.9 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 0.5 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 0.9 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.1 | 0.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.1 | 2.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.1 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.1 | 2.0 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 0.8 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 3.9 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 1.8 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 2.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 1.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.6 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.0 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
| 0.0 | 1.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.5 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.9 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.0 | 0.4 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 2.2 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 1.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.5 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 2.4 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.5 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 1.8 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.9 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.7 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.5 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 1.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.6 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.0 | 0.2 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 3.0 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.3 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 0.7 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 1.8 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.4 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.8 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.1 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
| 0.0 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.0 | 0.9 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.6 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 1.9 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.4 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.7 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.8 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.0 | 0.1 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.0 | 0.1 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.3 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.0 | 0.3 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.5 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 2.3 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.0 | 0.4 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.0 | 2.6 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.7 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.9 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
| 0.0 | 0.6 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.3 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.0 | 0.9 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.0 | 0.4 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.0 | 0.3 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.0 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.0 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 0.0 | 1.4 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.2 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.0 | 0.2 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.8 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 1.2 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.4 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.0 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 0.2 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 0.7 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.5 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |