A549 cells infected with IAV Analysis Results (GEO series: GSE147507)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
TFDP1
|
ENSG00000198176.8 | transcription factor Dp-1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TFDP1 | hg19_v2_chr13_+_114239588_114239752 | 0.55 | 4.5e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr1_+_6845578 | 0.98 |
ENST00000467404.2
ENST00000439411.2 |
CAMTA1
|
calmodulin binding transcription activator 1 |
| chr20_-_62462566 | 0.68 |
ENST00000245663.4
ENST00000302995.2 |
ZBTB46
|
zinc finger and BTB domain containing 46 |
| chr1_+_6845497 | 0.66 |
ENST00000473578.1
ENST00000557126.1 |
CAMTA1
|
calmodulin binding transcription activator 1 |
| chr4_-_18023350 | 0.60 |
ENST00000539056.1
ENST00000382226.5 ENST00000326877.4 |
LCORL
|
ligand dependent nuclear receptor corepressor-like |
| chr17_-_73179046 | 0.52 |
ENST00000314523.7
ENST00000420826.2 |
SUMO2
|
small ubiquitin-like modifier 2 |
| chr1_+_43148059 | 0.52 |
ENST00000321358.7
ENST00000332220.6 |
YBX1
|
Y box binding protein 1 |
| chr4_-_83351005 | 0.49 |
ENST00000295470.5
|
HNRNPDL
|
heterogeneous nuclear ribonucleoprotein D-like |
| chr6_-_86353510 | 0.49 |
ENST00000444272.1
|
SYNCRIP
|
synaptotagmin binding, cytoplasmic RNA interacting protein |
| chr10_+_70587279 | 0.44 |
ENST00000298596.6
ENST00000399169.4 ENST00000399165.4 ENST00000399162.2 |
STOX1
|
storkhead box 1 |
| chr1_+_100818156 | 0.42 |
ENST00000336454.3
|
CDC14A
|
cell division cycle 14A |
| chr2_+_149402009 | 0.42 |
ENST00000457184.1
|
EPC2
|
enhancer of polycomb homolog 2 (Drosophila) |
| chr6_+_20403997 | 0.42 |
ENST00000535432.1
|
E2F3
|
E2F transcription factor 3 |
| chr11_-_46142615 | 0.41 |
ENST00000529734.1
ENST00000323180.6 |
PHF21A
|
PHD finger protein 21A |
| chr17_-_42276574 | 0.41 |
ENST00000589805.1
|
ATXN7L3
|
ataxin 7-like 3 |
| chr9_-_34523027 | 0.40 |
ENST00000399775.2
|
ENHO
|
energy homeostasis associated |
| chr4_-_83350580 | 0.40 |
ENST00000349655.4
ENST00000602300.1 |
HNRNPDL
|
heterogeneous nuclear ribonucleoprotein D-like |
| chr6_-_86352982 | 0.39 |
ENST00000369622.3
|
SYNCRIP
|
synaptotagmin binding, cytoplasmic RNA interacting protein |
| chr11_-_19263145 | 0.39 |
ENST00000532666.1
ENST00000527884.1 |
E2F8
|
E2F transcription factor 8 |
| chr3_-_113464906 | 0.38 |
ENST00000477813.1
|
NAA50
|
N(alpha)-acetyltransferase 50, NatE catalytic subunit |
| chr13_-_52027134 | 0.38 |
ENST00000311234.4
ENST00000425000.1 ENST00000463928.1 ENST00000442263.3 ENST00000398119.2 |
INTS6
|
integrator complex subunit 6 |
| chr18_-_45457478 | 0.36 |
ENST00000402690.2
ENST00000356825.4 |
SMAD2
|
SMAD family member 2 |
| chr1_+_43148625 | 0.36 |
ENST00000436427.1
|
YBX1
|
Y box binding protein 1 |
| chr1_+_100818009 | 0.36 |
ENST00000370125.2
ENST00000361544.6 ENST00000370124.3 |
CDC14A
|
cell division cycle 14A |
| chr8_-_67525473 | 0.36 |
ENST00000522677.3
|
MYBL1
|
v-myb avian myeloblastosis viral oncogene homolog-like 1 |
| chr2_-_17935027 | 0.35 |
ENST00000446852.1
|
SMC6
|
structural maintenance of chromosomes 6 |
| chr16_-_51185172 | 0.35 |
ENST00000251020.4
|
SALL1
|
spalt-like transcription factor 1 |
| chr11_-_64889252 | 0.34 |
ENST00000525297.1
ENST00000529259.1 |
FAU
|
Finkel-Biskis-Reilly murine sarcoma virus (FBR-MuSV) ubiquitously expressed |
| chr5_+_61602236 | 0.34 |
ENST00000514082.1
ENST00000407818.3 |
KIF2A
|
kinesin heavy chain member 2A |
| chr4_-_174255400 | 0.34 |
ENST00000506267.1
|
HMGB2
|
high mobility group box 2 |
| chr3_+_133292759 | 0.34 |
ENST00000431519.2
|
CDV3
|
CDV3 homolog (mouse) |
| chr10_+_76586348 | 0.33 |
ENST00000372724.1
ENST00000287239.4 ENST00000372714.1 |
KAT6B
|
K(lysine) acetyltransferase 6B |
| chr1_-_226496772 | 0.33 |
ENST00000359525.2
ENST00000460719.1 |
LIN9
|
lin-9 homolog (C. elegans) |
| chrX_+_123094369 | 0.33 |
ENST00000455404.1
ENST00000218089.9 |
STAG2
|
stromal antigen 2 |
| chr16_+_67596310 | 0.32 |
ENST00000264010.4
ENST00000401394.1 |
CTCF
|
CCCTC-binding factor (zinc finger protein) |
| chr1_+_154193643 | 0.32 |
ENST00000456325.1
|
UBAP2L
|
ubiquitin associated protein 2-like |
| chr12_-_30907862 | 0.32 |
ENST00000541765.1
ENST00000537108.1 |
CAPRIN2
|
caprin family member 2 |
| chr7_+_128379449 | 0.32 |
ENST00000479257.1
|
CALU
|
calumenin |
| chr1_-_154155595 | 0.32 |
ENST00000328159.4
ENST00000368531.2 ENST00000323144.7 ENST00000368533.3 ENST00000341372.3 |
TPM3
|
tropomyosin 3 |
| chr19_+_47104553 | 0.32 |
ENST00000598871.1
ENST00000594523.1 |
CALM3
|
calmodulin 3 (phosphorylase kinase, delta) |
| chr15_+_44580955 | 0.32 |
ENST00000345795.2
ENST00000360824.3 |
CASC4
|
cancer susceptibility candidate 4 |
| chr1_+_154193325 | 0.31 |
ENST00000428931.1
ENST00000441890.1 ENST00000271877.7 ENST00000412596.1 ENST00000368504.1 ENST00000437652.1 |
UBAP2L
|
ubiquitin associated protein 2-like |
| chr19_-_48673465 | 0.30 |
ENST00000598938.1
|
LIG1
|
ligase I, DNA, ATP-dependent |
| chr11_-_129872672 | 0.30 |
ENST00000531431.1
ENST00000527581.1 |
PRDM10
|
PR domain containing 10 |
| chr19_-_10341948 | 0.30 |
ENST00000590320.1
ENST00000592342.1 ENST00000588952.1 |
S1PR2
DNMT1
|
sphingosine-1-phosphate receptor 2 DNA (cytosine-5-)-methyltransferase 1 |
| chr10_-_75634219 | 0.30 |
ENST00000305762.7
|
CAMK2G
|
calcium/calmodulin-dependent protein kinase II gamma |
| chr2_+_136289030 | 0.29 |
ENST00000409478.1
ENST00000264160.4 ENST00000329971.3 ENST00000438014.1 |
R3HDM1
|
R3H domain containing 1 |
| chr16_-_49315731 | 0.29 |
ENST00000219197.6
|
CBLN1
|
cerebellin 1 precursor |
| chr2_+_149402553 | 0.29 |
ENST00000258484.6
ENST00000409654.1 |
EPC2
|
enhancer of polycomb homolog 2 (Drosophila) |
| chr4_-_57301748 | 0.29 |
ENST00000264220.2
|
PPAT
|
phosphoribosyl pyrophosphate amidotransferase |
| chr4_-_103748696 | 0.29 |
ENST00000321805.7
|
UBE2D3
|
ubiquitin-conjugating enzyme E2D 3 |
| chr4_-_83351294 | 0.28 |
ENST00000502762.1
|
HNRNPDL
|
heterogeneous nuclear ribonucleoprotein D-like |
| chrX_+_69674943 | 0.28 |
ENST00000542398.1
|
DLG3
|
discs, large homolog 3 (Drosophila) |
| chr17_-_48943706 | 0.28 |
ENST00000499247.2
|
TOB1
|
transducer of ERBB2, 1 |
| chr18_-_5296001 | 0.28 |
ENST00000357006.4
|
ZBTB14
|
zinc finger and BTB domain containing 14 |
| chr2_-_17935059 | 0.28 |
ENST00000448223.2
ENST00000381272.4 ENST00000351948.4 |
SMC6
|
structural maintenance of chromosomes 6 |
| chr1_-_91487770 | 0.27 |
ENST00000337393.5
|
ZNF644
|
zinc finger protein 644 |
| chr5_+_61601965 | 0.27 |
ENST00000401507.3
|
KIF2A
|
kinesin heavy chain member 2A |
| chr17_-_57232525 | 0.27 |
ENST00000583380.1
ENST00000580541.1 ENST00000578105.1 ENST00000437036.2 |
SKA2
|
spindle and kinetochore associated complex subunit 2 |
| chr1_+_25757376 | 0.27 |
ENST00000399766.3
ENST00000399763.3 ENST00000374343.4 |
TMEM57
|
transmembrane protein 57 |
| chrX_-_153363125 | 0.27 |
ENST00000407218.1
ENST00000453960.2 |
MECP2
|
methyl CpG binding protein 2 (Rett syndrome) |
| chr11_-_61196858 | 0.27 |
ENST00000413184.2
|
CPSF7
|
cleavage and polyadenylation specific factor 7, 59kDa |
| chr18_-_45457192 | 0.27 |
ENST00000586514.1
ENST00000591214.1 ENST00000589877.1 |
SMAD2
|
SMAD family member 2 |
| chr1_-_23670813 | 0.27 |
ENST00000374612.1
|
HNRNPR
|
heterogeneous nuclear ribonucleoprotein R |
| chr3_-_113415441 | 0.26 |
ENST00000491165.1
ENST00000316407.4 |
KIAA2018
|
KIAA2018 |
| chr7_-_72936608 | 0.26 |
ENST00000404251.1
|
BAZ1B
|
bromodomain adjacent to zinc finger domain, 1B |
| chr14_+_56046990 | 0.26 |
ENST00000438792.2
ENST00000395314.3 ENST00000395308.1 |
KTN1
|
kinectin 1 (kinesin receptor) |
| chr1_-_23670752 | 0.26 |
ENST00000302271.6
ENST00000426846.2 ENST00000427764.2 ENST00000606561.1 ENST00000374616.3 |
HNRNPR
|
heterogeneous nuclear ribonucleoprotein R |
| chr5_-_118324200 | 0.26 |
ENST00000515439.3
ENST00000510708.1 |
DTWD2
|
DTW domain containing 2 |
| chr18_-_51751132 | 0.26 |
ENST00000256429.3
|
MBD2
|
methyl-CpG binding domain protein 2 |
| chr13_-_96329048 | 0.26 |
ENST00000606011.1
ENST00000499499.2 |
DNAJC3-AS1
|
DNAJC3 antisense RNA 1 (head to head) |
| chr6_-_153304697 | 0.26 |
ENST00000367241.3
|
FBXO5
|
F-box protein 5 |
| chr14_+_23790690 | 0.26 |
ENST00000556821.1
|
PABPN1
|
poly(A) binding protein, nuclear 1 |
| chr2_+_48541776 | 0.26 |
ENST00000413569.1
ENST00000340553.3 |
FOXN2
|
forkhead box N2 |
| chr18_-_5296138 | 0.26 |
ENST00000400143.3
|
ZBTB14
|
zinc finger and BTB domain containing 14 |
| chr1_-_63153944 | 0.25 |
ENST00000340370.5
ENST00000404627.2 ENST00000251157.5 |
DOCK7
|
dedicator of cytokinesis 7 |
| chr8_-_17104099 | 0.25 |
ENST00000524358.1
|
CNOT7
|
CCR4-NOT transcription complex, subunit 7 |
| chr8_-_124286735 | 0.25 |
ENST00000395571.3
|
ZHX1
|
zinc fingers and homeoboxes 1 |
| chr20_+_47662805 | 0.25 |
ENST00000262982.2
ENST00000542325.1 |
CSE1L
|
CSE1 chromosome segregation 1-like (yeast) |
| chr10_+_111967345 | 0.25 |
ENST00000332674.5
ENST00000453116.1 |
MXI1
|
MAX interactor 1, dimerization protein |
| chr12_+_69004805 | 0.25 |
ENST00000541216.1
|
RAP1B
|
RAP1B, member of RAS oncogene family |
| chr1_-_91487806 | 0.25 |
ENST00000361321.5
|
ZNF644
|
zinc finger protein 644 |
| chr8_-_80680078 | 0.25 |
ENST00000337919.5
ENST00000354724.3 |
HEY1
|
hes-related family bHLH transcription factor with YRPW motif 1 |
| chr15_+_44719394 | 0.24 |
ENST00000260327.4
ENST00000396780.1 |
CTDSPL2
|
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase like 2 |
| chr1_-_26232522 | 0.24 |
ENST00000399728.1
|
STMN1
|
stathmin 1 |
| chr8_-_67525524 | 0.24 |
ENST00000517885.1
|
MYBL1
|
v-myb avian myeloblastosis viral oncogene homolog-like 1 |
| chr18_+_9913977 | 0.24 |
ENST00000400000.2
ENST00000340541.4 |
VAPA
|
VAMP (vesicle-associated membrane protein)-associated protein A, 33kDa |
| chr15_+_44580899 | 0.24 |
ENST00000559222.1
ENST00000299957.6 |
CASC4
|
cancer susceptibility candidate 4 |
| chr2_-_48132814 | 0.24 |
ENST00000316377.4
ENST00000378314.3 |
FBXO11
|
F-box protein 11 |
| chr1_+_94883931 | 0.24 |
ENST00000394233.2
ENST00000454898.2 ENST00000536817.1 |
ABCD3
|
ATP-binding cassette, sub-family D (ALD), member 3 |
| chr1_+_6845384 | 0.24 |
ENST00000303635.7
|
CAMTA1
|
calmodulin binding transcription activator 1 |
| chr12_-_112037306 | 0.24 |
ENST00000535949.1
ENST00000542287.2 ENST00000377617.3 ENST00000550104.1 |
ATXN2
|
ataxin 2 |
| chr1_-_23670817 | 0.23 |
ENST00000478691.1
|
HNRNPR
|
heterogeneous nuclear ribonucleoprotein R |
| chr1_+_100818484 | 0.23 |
ENST00000544534.1
|
CDC14A
|
cell division cycle 14A |
| chr2_-_232328867 | 0.23 |
ENST00000453992.1
ENST00000417652.1 ENST00000454824.1 |
NCL
|
nucleolin |
| chr17_-_1303462 | 0.23 |
ENST00000573026.1
ENST00000575977.1 ENST00000571732.1 ENST00000264335.8 |
YWHAE
|
tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, epsilon |
| chr1_+_94883991 | 0.23 |
ENST00000370214.4
|
ABCD3
|
ATP-binding cassette, sub-family D (ALD), member 3 |
| chr11_-_19262486 | 0.23 |
ENST00000250024.4
|
E2F8
|
E2F transcription factor 8 |
| chr2_+_42396574 | 0.23 |
ENST00000401738.3
|
EML4
|
echinoderm microtubule associated protein like 4 |
| chr2_+_121493717 | 0.23 |
ENST00000418323.1
|
GLI2
|
GLI family zinc finger 2 |
| chr12_-_112037136 | 0.23 |
ENST00000608853.1
|
ATXN2
|
ataxin 2 |
| chr3_-_49449350 | 0.23 |
ENST00000454011.2
ENST00000445425.1 ENST00000422781.1 |
RHOA
|
ras homolog family member A |
| chr12_-_64784306 | 0.23 |
ENST00000543259.1
|
C12orf56
|
chromosome 12 open reading frame 56 |
| chr12_+_121078355 | 0.22 |
ENST00000316803.3
|
CABP1
|
calcium binding protein 1 |
| chr12_+_98909520 | 0.22 |
ENST00000261210.5
|
TMPO
|
thymopoietin |
| chr10_-_112678904 | 0.22 |
ENST00000423273.1
ENST00000436562.1 ENST00000447005.1 ENST00000454061.1 |
BBIP1
|
BBSome interacting protein 1 |
| chr2_-_48132924 | 0.22 |
ENST00000403359.3
|
FBXO11
|
F-box protein 11 |
| chr13_+_73632897 | 0.22 |
ENST00000377687.4
|
KLF5
|
Kruppel-like factor 5 (intestinal) |
| chr12_+_69004736 | 0.22 |
ENST00000545720.2
|
RAP1B
|
RAP1B, member of RAS oncogene family |
| chr17_-_73178599 | 0.22 |
ENST00000578238.1
|
SUMO2
|
small ubiquitin-like modifier 2 |
| chr4_+_57301896 | 0.22 |
ENST00000514888.1
ENST00000264221.2 ENST00000505164.1 |
PAICS
|
phosphoribosylaminoimidazole carboxylase, phosphoribosylaminoimidazole succinocarboxamide synthetase |
| chr11_+_108093755 | 0.21 |
ENST00000527891.1
ENST00000532931.1 |
ATM
|
ataxia telangiectasia mutated |
| chr2_-_98612379 | 0.21 |
ENST00000425805.2
|
TMEM131
|
transmembrane protein 131 |
| chr6_-_18264706 | 0.21 |
ENST00000244776.7
ENST00000503715.1 |
DEK
|
DEK oncogene |
| chr17_-_79849438 | 0.21 |
ENST00000331204.4
ENST00000505490.2 |
ALYREF
|
Aly/REF export factor |
| chr2_+_173292390 | 0.21 |
ENST00000442250.1
ENST00000458358.1 ENST00000409080.1 |
ITGA6
|
integrin, alpha 6 |
| chrX_-_19905577 | 0.21 |
ENST00000379697.3
|
SH3KBP1
|
SH3-domain kinase binding protein 1 |
| chrX_+_123094672 | 0.21 |
ENST00000354548.5
ENST00000458700.1 |
STAG2
|
stromal antigen 2 |
| chr13_+_98086445 | 0.21 |
ENST00000245304.4
|
RAP2A
|
RAP2A, member of RAS oncogene family |
| chr2_-_136288740 | 0.21 |
ENST00000264159.6
ENST00000536680.1 |
ZRANB3
|
zinc finger, RAN-binding domain containing 3 |
| chr14_+_56046914 | 0.21 |
ENST00000413890.2
ENST00000395309.3 ENST00000554567.1 ENST00000555498.1 |
KTN1
|
kinectin 1 (kinesin receptor) |
| chrX_-_129244336 | 0.21 |
ENST00000434609.1
|
ELF4
|
E74-like factor 4 (ets domain transcription factor) |
| chr14_+_64971292 | 0.21 |
ENST00000358738.3
ENST00000394712.2 |
ZBTB1
|
zinc finger and BTB domain containing 1 |
| chr19_+_16222678 | 0.21 |
ENST00000586682.1
|
RAB8A
|
RAB8A, member RAS oncogene family |
| chr12_+_98909260 | 0.21 |
ENST00000556029.1
|
TMPO
|
thymopoietin |
| chr6_+_135502501 | 0.21 |
ENST00000527615.1
ENST00000420123.2 ENST00000525369.1 ENST00000528774.1 ENST00000534121.1 ENST00000534044.1 ENST00000533624.1 |
MYB
|
v-myb avian myeloblastosis viral oncogene homolog |
| chr19_-_10305302 | 0.21 |
ENST00000592054.1
|
DNMT1
|
DNA (cytosine-5-)-methyltransferase 1 |
| chr5_+_34929677 | 0.20 |
ENST00000342382.4
ENST00000382021.2 ENST00000303525.7 |
DNAJC21
|
DnaJ (Hsp40) homolog, subfamily C, member 21 |
| chrX_+_11776410 | 0.20 |
ENST00000361672.2
|
MSL3
|
male-specific lethal 3 homolog (Drosophila) |
| chr19_+_30433110 | 0.20 |
ENST00000542441.2
ENST00000392271.1 |
URI1
|
URI1, prefoldin-like chaperone |
| chr6_+_47445467 | 0.20 |
ENST00000359314.5
|
CD2AP
|
CD2-associated protein |
| chr2_+_64681219 | 0.20 |
ENST00000238875.5
|
LGALSL
|
lectin, galactoside-binding-like |
| chr2_+_42396472 | 0.20 |
ENST00000318522.5
ENST00000402711.2 |
EML4
|
echinoderm microtubule associated protein like 4 |
| chr10_+_49514698 | 0.20 |
ENST00000432379.1
ENST00000429041.1 ENST00000374189.1 |
MAPK8
|
mitogen-activated protein kinase 8 |
| chr11_+_82868030 | 0.20 |
ENST00000298281.4
ENST00000530660.1 |
PCF11
|
PCF11 cleavage and polyadenylation factor subunit |
| chr2_+_64681641 | 0.20 |
ENST00000409537.2
|
LGALSL
|
lectin, galactoside-binding-like |
| chr5_+_176560595 | 0.20 |
ENST00000508896.1
|
NSD1
|
nuclear receptor binding SET domain protein 1 |
| chr11_+_9595180 | 0.20 |
ENST00000450114.2
|
WEE1
|
WEE1 G2 checkpoint kinase |
| chr9_+_108210279 | 0.20 |
ENST00000374716.4
ENST00000374710.3 ENST00000481272.1 ENST00000484973.1 ENST00000394926.3 ENST00000539376.1 |
FSD1L
|
fibronectin type III and SPRY domain containing 1-like |
| chr3_-_167813132 | 0.20 |
ENST00000309027.4
|
GOLIM4
|
golgi integral membrane protein 4 |
| chr10_+_111985837 | 0.20 |
ENST00000393134.1
|
MXI1
|
MAX interactor 1, dimerization protein |
| chr19_+_16222439 | 0.20 |
ENST00000300935.3
|
RAB8A
|
RAB8A, member RAS oncogene family |
| chr10_+_94833642 | 0.20 |
ENST00000224356.4
ENST00000394139.1 |
CYP26A1
|
cytochrome P450, family 26, subfamily A, polypeptide 1 |
| chr15_-_75743915 | 0.20 |
ENST00000394949.4
|
SIN3A
|
SIN3 transcription regulator family member A |
| chr5_+_179105615 | 0.20 |
ENST00000514383.1
|
CANX
|
calnexin |
| chr3_+_110790590 | 0.19 |
ENST00000485303.1
|
PVRL3
|
poliovirus receptor-related 3 |
| chr1_+_154947126 | 0.19 |
ENST00000368439.1
|
CKS1B
|
CDC28 protein kinase regulatory subunit 1B |
| chr7_-_72936531 | 0.19 |
ENST00000339594.4
|
BAZ1B
|
bromodomain adjacent to zinc finger domain, 1B |
| chr6_-_110500826 | 0.19 |
ENST00000265601.3
ENST00000447287.1 ENST00000444391.1 |
WASF1
|
WAS protein family, member 1 |
| chr4_-_174255536 | 0.19 |
ENST00000446922.2
|
HMGB2
|
high mobility group box 2 |
| chr5_-_159546396 | 0.19 |
ENST00000523662.1
ENST00000456329.3 ENST00000307063.7 |
PWWP2A
|
PWWP domain containing 2A |
| chr1_+_193091080 | 0.19 |
ENST00000367435.3
|
CDC73
|
cell division cycle 73 |
| chr4_+_57774042 | 0.19 |
ENST00000309042.7
|
REST
|
RE1-silencing transcription factor |
| chr5_+_113697983 | 0.19 |
ENST00000264773.3
|
KCNN2
|
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 2 |
| chr2_+_46769798 | 0.19 |
ENST00000238738.4
|
RHOQ
|
ras homolog family member Q |
| chr11_-_59436453 | 0.19 |
ENST00000300146.9
|
PATL1
|
protein associated with topoisomerase II homolog 1 (yeast) |
| chr16_+_84002234 | 0.19 |
ENST00000305202.4
|
NECAB2
|
N-terminal EF-hand calcium binding protein 2 |
| chr1_+_89150245 | 0.19 |
ENST00000370513.5
|
PKN2
|
protein kinase N2 |
| chr13_+_98628886 | 0.19 |
ENST00000490680.1
ENST00000539640.1 ENST00000403772.3 |
IPO5
|
importin 5 |
| chr1_-_109584716 | 0.19 |
ENST00000531337.1
ENST00000529074.1 ENST00000369965.4 |
WDR47
|
WD repeat domain 47 |
| chr11_-_46848393 | 0.19 |
ENST00000526496.1
|
CKAP5
|
cytoskeleton associated protein 5 |
| chr5_+_34656529 | 0.19 |
ENST00000513974.1
ENST00000512629.1 |
RAI14
|
retinoic acid induced 14 |
| chr5_+_34656569 | 0.19 |
ENST00000428746.2
|
RAI14
|
retinoic acid induced 14 |
| chr2_+_208576259 | 0.19 |
ENST00000392209.3
|
CCNYL1
|
cyclin Y-like 1 |
| chr2_+_219081817 | 0.19 |
ENST00000315717.5
ENST00000420104.1 ENST00000295685.10 |
ARPC2
|
actin related protein 2/3 complex, subunit 2, 34kDa |
| chr17_-_7197881 | 0.19 |
ENST00000007699.5
|
YBX2
|
Y box binding protein 2 |
| chr11_-_76155618 | 0.19 |
ENST00000530759.1
|
RP11-111M22.3
|
RP11-111M22.3 |
| chr20_-_49547731 | 0.19 |
ENST00000396029.3
|
ADNP
|
activity-dependent neuroprotector homeobox |
| chr10_-_75255668 | 0.19 |
ENST00000545874.1
|
PPP3CB
|
protein phosphatase 3, catalytic subunit, beta isozyme |
| chr2_+_149402989 | 0.18 |
ENST00000397424.2
|
EPC2
|
enhancer of polycomb homolog 2 (Drosophila) |
| chr2_+_173292280 | 0.18 |
ENST00000264107.7
|
ITGA6
|
integrin, alpha 6 |
| chr2_-_25896380 | 0.18 |
ENST00000545439.1
ENST00000407186.1 ENST00000406818.3 ENST00000404103.3 ENST00000407661.3 ENST00000407038.3 ENST00000405222.1 ENST00000288642.8 |
DTNB
|
dystrobrevin, beta |
| chr6_-_17706618 | 0.18 |
ENST00000262077.2
ENST00000537253.1 |
NUP153
|
nucleoporin 153kDa |
| chr7_-_27239703 | 0.18 |
ENST00000222753.4
|
HOXA13
|
homeobox A13 |
| chr1_-_229478714 | 0.18 |
ENST00000284617.2
|
CCSAP
|
centriole, cilia and spindle-associated protein |
| chrY_+_2803322 | 0.18 |
ENST00000383052.1
ENST00000155093.3 ENST00000449237.1 ENST00000443793.1 |
ZFY
|
zinc finger protein, Y-linked |
| chr11_+_76156045 | 0.18 |
ENST00000533988.1
ENST00000524490.1 ENST00000334736.3 ENST00000343878.3 ENST00000533972.1 |
C11orf30
|
chromosome 11 open reading frame 30 |
| chr17_+_45726803 | 0.18 |
ENST00000535458.2
ENST00000583648.1 |
KPNB1
|
karyopherin (importin) beta 1 |
| chr1_-_45672221 | 0.18 |
ENST00000359600.5
|
ZSWIM5
|
zinc finger, SWIM-type containing 5 |
| chr17_-_57232596 | 0.18 |
ENST00000581068.1
ENST00000330137.7 |
SKA2
|
spindle and kinetochore associated complex subunit 2 |
| chr6_-_86352642 | 0.18 |
ENST00000355238.6
|
SYNCRIP
|
synaptotagmin binding, cytoplasmic RNA interacting protein |
| chr15_-_57210769 | 0.18 |
ENST00000559000.1
|
ZNF280D
|
zinc finger protein 280D |
| chr11_+_13299186 | 0.18 |
ENST00000527998.1
ENST00000396441.3 ENST00000533520.1 ENST00000529825.1 ENST00000389707.4 ENST00000401424.1 ENST00000529388.1 ENST00000530357.1 ENST00000403290.1 ENST00000361003.4 ENST00000389708.3 ENST00000403510.3 ENST00000482049.1 |
ARNTL
|
aryl hydrocarbon receptor nuclear translocator-like |
| chr4_+_94750014 | 0.18 |
ENST00000306011.3
|
ATOH1
|
atonal homolog 1 (Drosophila) |
| chrX_-_139015153 | 0.18 |
ENST00000370557.1
|
ATP11C
|
ATPase, class VI, type 11C |
| chr6_+_27833034 | 0.18 |
ENST00000357320.2
|
HIST1H2AL
|
histone cluster 1, H2al |
| chr12_+_107168342 | 0.18 |
ENST00000392837.4
|
RIC8B
|
RIC8 guanine nucleotide exchange factor B |
| chr9_+_131218698 | 0.18 |
ENST00000434106.3
ENST00000546203.1 ENST00000446274.1 ENST00000421776.2 ENST00000432065.2 |
ODF2
|
outer dense fiber of sperm tails 2 |
| chr5_+_74807581 | 0.18 |
ENST00000241436.4
ENST00000352007.5 |
POLK
|
polymerase (DNA directed) kappa |
| chr11_-_14379997 | 0.17 |
ENST00000526063.1
ENST00000532814.1 |
RRAS2
|
related RAS viral (r-ras) oncogene homolog 2 |
| chr14_-_45603657 | 0.17 |
ENST00000396062.3
|
FKBP3
|
FK506 binding protein 3, 25kDa |
| chr15_-_77712429 | 0.17 |
ENST00000564328.1
ENST00000558305.1 |
PEAK1
|
pseudopodium-enriched atypical kinase 1 |
| chr3_-_71114066 | 0.17 |
ENST00000485326.2
|
FOXP1
|
forkhead box P1 |
| chr12_+_123849462 | 0.17 |
ENST00000543072.1
|
hsa-mir-8072
|
hsa-mir-8072 |
| chr4_+_54243917 | 0.17 |
ENST00000507166.1
|
FIP1L1
|
factor interacting with PAPOLA and CPSF1 |
| chr6_+_24775641 | 0.17 |
ENST00000378054.2
ENST00000476555.1 |
GMNN
|
geminin, DNA replication inhibitor |
| chr11_-_95522907 | 0.17 |
ENST00000358780.5
ENST00000542135.1 |
FAM76B
|
family with sequence similarity 76, member B |
| chr1_-_36235529 | 0.17 |
ENST00000318121.3
ENST00000373220.3 ENST00000520551.1 |
CLSPN
|
claspin |
| chr9_+_131451480 | 0.17 |
ENST00000322030.8
|
SET
|
SET nuclear oncogene |
| chr4_+_184426147 | 0.17 |
ENST00000302327.3
|
ING2
|
inhibitor of growth family, member 2 |
| chr4_-_39367949 | 0.17 |
ENST00000503784.1
ENST00000349703.2 ENST00000381897.1 |
RFC1
|
replication factor C (activator 1) 1, 145kDa |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.7 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 0.2 | 2.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.1 | 0.7 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.1 | 0.4 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.1 | 0.4 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.1 | 0.4 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.1 | 0.5 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.1 | 0.4 | GO:1903515 | calcium ion transport from cytosol to endoplasmic reticulum(GO:1903515) |
| 0.1 | 0.4 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.1 | 0.4 | GO:0021861 | forebrain radial glial cell differentiation(GO:0021861) |
| 0.1 | 0.3 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 | 0.7 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.1 | GO:0061450 | trophoblast cell migration(GO:0061450) regulation of trophoblast cell migration(GO:1901163) positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 | 0.6 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.1 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.1 | 0.4 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 0.1 | 0.5 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.1 | 0.8 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.1 | 0.3 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.1 | 0.3 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.1 | 0.1 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.1 | 0.3 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.1 | 0.8 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.1 | 0.3 | GO:0071789 | spindle pole body duplication(GO:0030474) spindle pole body organization(GO:0051300) spindle pole body localization(GO:0070631) establishment of spindle pole body localization(GO:0070632) spindle pole body localization to nuclear envelope(GO:0071789) establishment of spindle pole body localization to nuclear envelope(GO:0071790) |
| 0.1 | 0.3 | GO:2000174 | regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.1 | 0.2 | GO:1904897 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.1 | 0.2 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.1 | 0.2 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.1 | 0.4 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 | 0.2 | GO:1901254 | modulation by host of viral RNA genome replication(GO:0044830) positive regulation of intracellular transport of viral material(GO:1901254) |
| 0.1 | 0.4 | GO:0033504 | floor plate development(GO:0033504) |
| 0.1 | 0.4 | GO:0061034 | olfactory bulb mitral cell layer development(GO:0061034) |
| 0.1 | 0.2 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.1 | 0.3 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 | 0.2 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.1 | 0.2 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 0.1 | 0.5 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.1 | 0.2 | GO:0034402 | recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
| 0.1 | 0.2 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
| 0.1 | 0.3 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 | 0.5 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.1 | 0.3 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 0.2 | GO:0071140 | resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.1 | 0.2 | GO:0036292 | DNA rewinding(GO:0036292) |
| 0.1 | 0.2 | GO:0097156 | fasciculation of motor neuron axon(GO:0097156) |
| 0.1 | 0.1 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 | 1.1 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.5 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 | 0.3 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.1 | 0.1 | GO:0072194 | kidney smooth muscle tissue development(GO:0072194) |
| 0.1 | 0.2 | GO:0034552 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.1 | 0.2 | GO:0035750 | protein localization to myelin sheath abaxonal region(GO:0035750) |
| 0.1 | 0.2 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
| 0.1 | 0.6 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 | 0.4 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 0.2 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.1 | 0.2 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
| 0.1 | 0.3 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.1 | 0.3 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.1 | 0.3 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.1 | 0.2 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.1 | 0.2 | GO:1903676 | regulation of cap-dependent translational initiation(GO:1903674) positive regulation of cap-dependent translational initiation(GO:1903676) |
| 0.1 | 0.2 | GO:0006272 | leading strand elongation(GO:0006272) |
| 0.1 | 0.4 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.1 | 0.4 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.1 | 0.2 | GO:0021577 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
| 0.0 | 0.1 | GO:0000961 | negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
| 0.0 | 0.1 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.0 | 0.1 | GO:1904530 | negative regulation of actin filament binding(GO:1904530) negative regulation of actin binding(GO:1904617) |
| 0.0 | 0.2 | GO:1903722 | negative regulation of exosomal secretion(GO:1903542) regulation of centriole elongation(GO:1903722) |
| 0.0 | 0.2 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.0 | 0.2 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.0 | 0.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.0 | 0.6 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.1 | GO:0070101 | positive regulation of chemokine-mediated signaling pathway(GO:0070101) |
| 0.0 | 0.1 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.0 | 0.2 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.0 | 0.2 | GO:0044027 | DNA hypermethylation(GO:0044026) hypermethylation of CpG island(GO:0044027) |
| 0.0 | 0.3 | GO:1902962 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.0 | 0.2 | GO:1990927 | vesicle-mediated cholesterol transport(GO:0090119) short-term synaptic potentiation(GO:1990926) calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.0 | 0.3 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.0 | 0.6 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.1 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.0 | 0.5 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.0 | 0.2 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.0 | 0.5 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 | 0.1 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.0 | 0.2 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 | 0.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.3 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 | 0.2 | GO:0002270 | plasmacytoid dendritic cell activation(GO:0002270) regulation of restriction endodeoxyribonuclease activity(GO:0032072) T-helper 1 cell activation(GO:0035711) negative regulation of apoptotic cell clearance(GO:2000426) |
| 0.0 | 0.1 | GO:0032707 | negative regulation of interleukin-23 production(GO:0032707) |
| 0.0 | 0.1 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.0 | 0.2 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.0 | 0.3 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.0 | 0.5 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.0 | 0.6 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
| 0.0 | 0.7 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.4 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.0 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 | 0.3 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.0 | 0.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
| 0.0 | 0.3 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.2 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.0 | 0.0 | GO:0046959 | habituation(GO:0046959) |
| 0.0 | 0.2 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.0 | 0.5 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.0 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.0 | 0.1 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.0 | 0.1 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.0 | 0.1 | GO:1902908 | regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) regulation of melanosome transport(GO:1902908) positive regulation of melanosome transport(GO:1902910) |
| 0.0 | 0.2 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.0 | 0.1 | GO:0042000 | translocation of peptides or proteins into host(GO:0042000) translocation of peptides or proteins into host cell cytoplasm(GO:0044053) translocation of molecules into host(GO:0044417) translocation of peptides or proteins into other organism involved in symbiotic interaction(GO:0051808) translocation of molecules into other organism involved in symbiotic interaction(GO:0051836) |
| 0.0 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.0 | 0.1 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.0 | 0.2 | GO:0001828 | inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
| 0.0 | 0.2 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
| 0.0 | 0.4 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.0 | 0.3 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.0 | 1.7 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.0 | 0.1 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
| 0.0 | 0.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.2 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 | 0.2 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.0 | 0.1 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
| 0.0 | 0.1 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.0 | 0.1 | GO:0003360 | brainstem development(GO:0003360) |
| 0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.1 | GO:0003064 | regulation of heart rate by hormone(GO:0003064) |
| 0.0 | 0.1 | GO:0022614 | membrane to membrane docking(GO:0022614) |
| 0.0 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.1 | GO:0090677 | metanephric glomerular mesangial cell development(GO:0072255) reversible differentiation(GO:0090677) cell dedifferentiation involved in phenotypic switching(GO:0090678) positive regulation of phenotypic switching(GO:1900241) regulation of vascular smooth muscle cell dedifferentiation(GO:1905174) positive regulation of vascular smooth muscle cell dedifferentiation(GO:1905176) vascular smooth muscle cell dedifferentiation(GO:1990936) |
| 0.0 | 1.2 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.0 | 0.1 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.0 | 0.2 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 0.1 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.0 | 0.2 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.2 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.0 | 0.3 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.3 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.0 | 0.2 | GO:0060136 | enucleate erythrocyte differentiation(GO:0043353) embryonic process involved in female pregnancy(GO:0060136) |
| 0.0 | 0.1 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.0 | 0.2 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 0.0 | 0.2 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.0 | 0.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.1 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.0 | 0.3 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.1 | GO:0070781 | response to biotin(GO:0070781) |
| 0.0 | 0.8 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.2 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.0 | 0.4 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.2 | GO:0034670 | chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.0 | 0.1 | GO:1902741 | type I interferon secretion(GO:0072641) interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.0 | 0.5 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.3 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.0 | 0.6 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.1 | GO:1905075 | occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.0 | 0.1 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 | 0.1 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.0 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 | 0.5 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
| 0.0 | 0.1 | GO:0032918 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.0 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.1 | GO:0098884 | postsynaptic neurotransmitter receptor internalization(GO:0098884) |
| 0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.4 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.1 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.0 | 0.1 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.1 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 1.9 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
| 0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.1 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.0 | 0.1 | GO:1903452 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
| 0.0 | 0.3 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.1 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 | 0.1 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) |
| 0.0 | 0.4 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
| 0.0 | 0.0 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
| 0.0 | 0.4 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 | 0.1 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.0 | 0.1 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.1 | GO:0045720 | negative regulation of integrin biosynthetic process(GO:0045720) |
| 0.0 | 0.1 | GO:0098507 | polynucleotide 5' dephosphorylation(GO:0098507) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.0 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.0 | 0.1 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.0 | 0.3 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.1 | GO:1901911 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.0 | 0.0 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.1 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.0 | 0.3 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 | 0.2 | GO:0002176 | male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.0 | 0.1 | GO:0016260 | selenocysteine biosynthetic process(GO:0016260) |
| 0.0 | 0.2 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.0 | 0.1 | GO:0032229 | regulation of synaptic vesicle fusion to presynaptic membrane(GO:0031630) negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.0 | 0.1 | GO:0030505 | inorganic diphosphate transport(GO:0030505) |
| 0.0 | 0.3 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
| 0.0 | 0.1 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.0 | 0.1 | GO:1903031 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.0 | GO:0060516 | primary prostatic bud elongation(GO:0060516) |
| 0.0 | 0.0 | GO:2000687 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.0 | 0.1 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
| 0.0 | 0.1 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.0 | 0.1 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.0 | 0.2 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.0 | 0.0 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.0 | 0.1 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.0 | 0.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.0 | 0.1 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.0 | 0.0 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.0 | 0.1 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.0 | 0.1 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
| 0.0 | 0.1 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.0 | 0.1 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.0 | 0.2 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.1 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.0 | 0.3 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.0 | 0.2 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.1 | GO:0021592 | fourth ventricle development(GO:0021592) initiation of neural tube closure(GO:0021993) |
| 0.0 | 0.1 | GO:1901340 | negative regulation of store-operated calcium channel activity(GO:1901340) |
| 0.0 | 0.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.0 | 0.2 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.0 | 0.2 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.1 | GO:0051029 | rRNA transport(GO:0051029) |
| 0.0 | 0.0 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.0 | 0.1 | GO:0032803 | regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
| 0.0 | 0.1 | GO:0044029 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.0 | 0.1 | GO:0060423 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
| 0.0 | 0.3 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.0 | 0.1 | GO:0097676 | histone H3-K36 dimethylation(GO:0097676) |
| 0.0 | 0.1 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.0 | 0.4 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.0 | 0.2 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.6 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.1 | GO:1901994 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.0 | 0.1 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.0 | 0.1 | GO:0061289 | cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.0 | 0.1 | GO:1904772 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.0 | 0.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.0 | 1.0 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.0 | 0.0 | GO:0033206 | meiotic chromosome movement towards spindle pole(GO:0016344) meiotic cytokinesis(GO:0033206) |
| 0.0 | 0.3 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.1 | GO:0060829 | regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060827) negative regulation of canonical Wnt signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060829) |
| 0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.0 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 0.2 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.0 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.0 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 0.0 | 0.2 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.1 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.0 | 0.0 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.0 | 0.1 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.0 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
| 0.0 | 0.1 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.0 | 0.0 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.0 | 0.0 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.0 | 0.3 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.0 | 0.0 | GO:0018008 | N-terminal peptidyl-glycine N-myristoylation(GO:0018008) |
| 0.0 | 0.1 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.0 | 0.4 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 | 0.1 | GO:0048205 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 0.3 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.2 | GO:0009629 | response to gravity(GO:0009629) |
| 0.0 | 0.3 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.1 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.0 | 0.1 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.0 | 0.0 | GO:0098712 | L-glutamate import across plasma membrane(GO:0098712) |
| 0.0 | 0.4 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 | 0.1 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 | 0.0 | GO:0021893 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) regulation of amacrine cell differentiation(GO:1902869) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.0 | 0.3 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 1.5 | GO:0035722 | interleukin-12-mediated signaling pathway(GO:0035722) cellular response to interleukin-12(GO:0071349) |
| 0.0 | 0.0 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.0 | 0.0 | GO:0051461 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.0 | 0.0 | GO:0042245 | RNA repair(GO:0042245) |
| 0.0 | 0.2 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.0 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.0 | 0.1 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.0 | 0.1 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.0 | 0.1 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.1 | GO:0090291 | negative regulation of osteoclast proliferation(GO:0090291) |
| 0.0 | 0.2 | GO:0001967 | suckling behavior(GO:0001967) |
| 0.0 | 0.1 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.0 | 0.1 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.0 | 0.1 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.2 | GO:0009414 | response to water deprivation(GO:0009414) |
| 0.0 | 0.2 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.0 | GO:0014062 | regulation of serotonin secretion(GO:0014062) |
| 0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 | 0.4 | GO:0098779 | mitophagy in response to mitochondrial depolarization(GO:0098779) |
| 0.0 | 0.0 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) nephrogenic mesenchyme morphogenesis(GO:0072134) kidney mesenchymal cell proliferation(GO:0072135) metanephric mesenchymal cell proliferation involved in metanephros development(GO:0072136) |
| 0.0 | 0.0 | GO:0072428 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) negative regulation of mitotic cell cycle DNA replication(GO:1903464) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.0 | 0.1 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.0 | 0.1 | GO:1904806 | regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.0 | 0.0 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.1 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.0 | 0.1 | GO:0070671 | response to interleukin-12(GO:0070671) |
| 0.0 | 0.1 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.0 | 0.1 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.0 | 0.0 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.1 | GO:2001295 | malonyl-CoA biosynthetic process(GO:2001295) |
| 0.0 | 0.1 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.0 | 0.0 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.0 | 0.0 | GO:0060214 | endocardium morphogenesis(GO:0003160) endocardium formation(GO:0060214) |
| 0.0 | 0.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.0 | 0.3 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.1 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.0 | 0.1 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.0 | 0.2 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.0 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 1.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.5 | GO:0097009 | energy homeostasis(GO:0097009) |
| 0.0 | 0.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.0 | 0.2 | GO:0046785 | microtubule polymerization(GO:0046785) |
| 0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.1 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.0 | 0.7 | GO:0090307 | mitotic spindle assembly(GO:0090307) |
| 0.0 | 0.0 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
| 0.0 | 0.5 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.4 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.0 | 0.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.1 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.0 | 0.0 | GO:0048749 | compound eye development(GO:0048749) |
| 0.0 | 0.1 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.0 | 0.1 | GO:0036486 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
| 0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.4 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.1 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.2 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.0 | 0.0 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.0 | 0.1 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 0.0 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) purine nucleobase salvage(GO:0043096) |
| 0.0 | 0.0 | GO:0000967 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.0 | 0.2 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.0 | 0.7 | GO:0030049 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.0 | 0.1 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.1 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.0 | 0.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.0 | 0.0 | GO:0003289 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
| 0.0 | 0.6 | GO:0035666 | TRIF-dependent toll-like receptor signaling pathway(GO:0035666) |
| 0.0 | 0.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.0 | GO:0045081 | negative regulation of interleukin-10 biosynthetic process(GO:0045081) |
| 0.0 | 0.0 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.1 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.0 | 0.3 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.0 | 0.1 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.2 | GO:0006089 | lactate metabolic process(GO:0006089) |
| 0.0 | 0.0 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.0 | GO:0060738 | epithelial-mesenchymal signaling involved in prostate gland development(GO:0060738) |
| 0.0 | 0.4 | GO:0046710 | GDP metabolic process(GO:0046710) |
| 0.0 | 0.4 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.0 | 0.1 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
| 0.0 | 0.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.0 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.0 | 0.4 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 | 0.4 | GO:2000273 | positive regulation of receptor activity(GO:2000273) |
| 0.0 | 0.0 | GO:0006423 | cysteinyl-tRNA aminoacylation(GO:0006423) |
| 0.0 | 0.2 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.0 | 0.2 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.3 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
| 0.0 | 0.1 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.0 | 0.0 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.0 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.2 | 0.6 | GO:0034676 | integrin alpha6-beta4 complex(GO:0034676) |
| 0.1 | 0.4 | GO:0075341 | host cell PML body(GO:0075341) |
| 0.1 | 0.1 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.1 | 0.7 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.5 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.1 | 1.0 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.3 | GO:0070762 | nuclear pore transmembrane ring(GO:0070762) |
| 0.1 | 1.0 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 0.5 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.1 | 0.2 | GO:1902737 | dendritic filopodium(GO:1902737) |
| 0.1 | 0.4 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.1 | 0.2 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.1 | 0.6 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.1 | 0.2 | GO:0031213 | RSF complex(GO:0031213) |
| 0.1 | 0.7 | GO:0072487 | MSL complex(GO:0072487) |
| 0.1 | 0.7 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 0.2 | GO:0032173 | septin ring(GO:0005940) septin collar(GO:0032173) |
| 0.1 | 0.2 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 0.2 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.1 | 0.2 | GO:0043614 | multi-eIF complex(GO:0043614) |
| 0.0 | 0.2 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 0.0 | 0.7 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.2 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.0 | 0.2 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.0 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.3 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.3 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.3 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.3 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.0 | 0.2 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.0 | 0.3 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.5 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.0 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 0.6 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.0 | 1.0 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 1.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.1 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.0 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.4 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.1 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.0 | 0.2 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 0.6 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.0 | 0.1 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.0 | 0.1 | GO:0032449 | CBM complex(GO:0032449) |
| 0.0 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.2 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.2 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.5 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.0 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:0098844 | postsynaptic endocytic zone(GO:0098843) postsynaptic endocytic zone membrane(GO:0098844) |
| 0.0 | 0.6 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.0 | 0.2 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.2 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.0 | 0.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.4 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.0 | 0.0 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.0 | 0.4 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 0.1 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.0 | 0.3 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.0 | 0.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.0 | 0.3 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 0.2 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.1 | GO:0034753 | nuclear aryl hydrocarbon receptor complex(GO:0034753) |
| 0.0 | 0.4 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.0 | 0.0 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.7 | GO:0070822 | Sin3-type complex(GO:0070822) |
| 0.0 | 0.1 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.0 | 0.1 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.0 | 0.5 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.5 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.1 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.0 | 0.0 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 0.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 0.1 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.0 | 0.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.3 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) Barr body(GO:0001740) |
| 0.0 | 0.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.3 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.1 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.1 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 0.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.5 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.3 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.1 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.5 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.2 | GO:0051286 | cell tip(GO:0051286) |
| 0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.0 | 0.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.1 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
| 0.0 | 0.2 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.5 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
| 0.0 | 0.2 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.0 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.5 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.2 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.1 | GO:0030118 | clathrin coat(GO:0030118) |
| 0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.7 | GO:0097546 | ciliary base(GO:0097546) |
| 0.0 | 0.0 | GO:0030427 | site of polarized growth(GO:0030427) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 0.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 0.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.1 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.0 | 0.5 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.2 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 0.1 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 0.0 | 0.0 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 1.6 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.0 | GO:0031251 | PAN complex(GO:0031251) |
| 0.0 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.0 | 0.0 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.0 | 0.1 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.2 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.1 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.3 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.4 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.6 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.4 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.1 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.4 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.5 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.1 | 0.4 | GO:0031775 | lutropin-choriogonadotropic hormone receptor binding(GO:0031775) calcium-transporting ATPase activity involved in regulation of cardiac muscle cell membrane potential(GO:0086039) |
| 0.1 | 0.5 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.1 | 0.5 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.1 | 0.4 | GO:0051022 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.3 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.1 | 0.3 | GO:0047322 | [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase activity(GO:0047322) [acetyl-CoA carboxylase] kinase activity(GO:0050405) |
| 0.1 | 0.3 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.1 | 0.2 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.1 | 0.2 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.1 | 0.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.3 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.1 | 0.3 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.3 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.1 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 0.9 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.5 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 1.0 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.3 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.1 | 0.2 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
| 0.1 | 0.2 | GO:0047291 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.1 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.1 | 0.2 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 0.6 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.4 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.1 | 0.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.9 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.0 | 0.2 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.0 | 0.2 | GO:0032143 | single thymine insertion binding(GO:0032143) |
| 0.0 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 0.2 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.0 | 0.2 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.0 | 0.6 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.4 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.0 | 0.4 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.0 | 0.1 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
| 0.0 | 0.2 | GO:0004057 | arginyltransferase activity(GO:0004057) |
| 0.0 | 0.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.1 | GO:0016964 | alpha-2 macroglobulin receptor activity(GO:0016964) |
| 0.0 | 0.1 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.0 | 0.8 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.0 | 1.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.0 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.0 | 0.2 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.0 | 0.2 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.0 | 0.3 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.0 | 0.3 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.2 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.0 | 0.3 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.0 | 0.3 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.0 | 0.6 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.1 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.0 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.0 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:0016768 | spermine synthase activity(GO:0016768) |
| 0.0 | 0.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.1 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.0 | 0.3 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.0 | 0.1 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.0 | 0.3 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.0 | 0.3 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 1.2 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.0 | 0.3 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.0 | 0.4 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.0 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.5 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.0 | 0.2 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.0 | 0.1 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
| 0.0 | 0.1 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.0 | 1.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.3 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.0 | 0.1 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.0 | 0.1 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.0 | 0.1 | GO:0001156 | TFIIIC-class transcription factor binding(GO:0001156) |
| 0.0 | 0.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.2 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.0 | 0.2 | GO:1990763 | arrestin family protein binding(GO:1990763) |
| 0.0 | 0.3 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.0 | 0.1 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.0 | 0.2 | GO:1904047 | S-adenosyl-L-methionine binding(GO:1904047) |
| 0.0 | 0.1 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.0 | 0.1 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.0 | 0.3 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.0 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.1 | GO:0004651 | polynucleotide 5'-phosphatase activity(GO:0004651) |
| 0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.3 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.1 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.0 | 0.3 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.0 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.4 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.1 | GO:0008486 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.0 | 0.8 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.1 | GO:0004157 | dihydropyrimidinase activity(GO:0004157) |
| 0.0 | 0.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.1 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.0 | 0.2 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.1 | GO:0004040 | amidase activity(GO:0004040) |
| 0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.9 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.8 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.1 | GO:0047888 | fatty acid peroxidase activity(GO:0047888) |
| 0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.2 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.1 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.0 | 0.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.3 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.3 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.1 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.0 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.2 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.5 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.0 | 0.1 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.0 | GO:0019107 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 0.0 | 1.5 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.7 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.4 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.0 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.2 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 0.1 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.9 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.0 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.0 | 0.9 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.0 | 0.1 | GO:0001163 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 1.0 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 1.1 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.0 | 0.3 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.2 | GO:0015631 | tubulin binding(GO:0015631) |
| 0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
| 0.0 | 0.6 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.0 | 0.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.3 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.0 | 0.1 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.0 | 0.0 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.0 | 0.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.1 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.0 | 0.1 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.4 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.3 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.2 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.0 | 0.1 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.0 | 1.1 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.0 | 0.5 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.1 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.0 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.0 | 0.3 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 0.5 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.2 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.0 | 0.1 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 0.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.1 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.1 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.3 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.1 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.0 | GO:0004817 | cysteine-tRNA ligase activity(GO:0004817) |
| 0.0 | 0.2 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.4 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 2.8 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 1.6 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.8 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.6 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.0 | 1.4 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.6 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.5 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.0 | 0.1 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.7 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 1.0 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.4 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 1.3 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.8 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.5 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.7 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.9 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.8 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.2 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 0.7 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.5 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 1.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.1 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.6 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.0 | 1.1 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.7 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.0 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.0 | 1.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.8 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.0 | 0.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.1 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.0 | 1.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.4 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.6 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.2 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.4 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.0 | 0.6 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 1.0 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.2 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.0 | 0.8 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.0 | 0.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 0.7 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.4 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.0 | 0.2 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.0 | 0.4 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 2.3 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 0.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.3 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.8 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 0.7 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 0.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
| 0.0 | 0.1 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.1 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
| 0.0 | 0.6 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.5 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.3 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.1 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.6 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 1.0 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.4 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.2 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.0 | 0.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |